aboutsummaryrefslogtreecommitdiffstats
path: root/test/mocks
diff options
context:
space:
mode:
Diffstat (limited to 'test/mocks')
-rw-r--r--test/mocks/pnfsimulator/README.md47
-rw-r--r--test/mocks/pnfsimulator/config/config.json29
-rw-r--r--test/mocks/pnfsimulator/deployment/PnP_PNF_sim_heat_template.yml129
-rw-r--r--test/mocks/pnfsimulator/docker-compose.dev.yml24
-rw-r--r--test/mocks/pnfsimulator/docker-compose.yml18
-rw-r--r--test/mocks/pnfsimulator/json_schema/input_validator.json193
-rw-r--r--test/mocks/pnfsimulator/json_schema/output_validator_ves_schema_30.0.1.json2432
-rw-r--r--test/mocks/pnfsimulator/netconf/pnf-simulator.data.xml4
-rw-r--r--test/mocks/pnfsimulator/netconf/pnf-simulator.yang4
-rw-r--r--test/mocks/pnfsimulator/pom.xml508
-rw-r--r--test/mocks/pnfsimulator/sftp/sftp-file.txt2
-rwxr-xr-xtest/mocks/pnfsimulator/simulator.sh20
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/Main.java20
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/logging/MDCVariables.java35
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/message/JSONObjectFactory.java63
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/message/MessageConstants.java58
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/message/MessageProvider.java61
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/NetconfConfigurationCheckingTask.java33
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorService.java30
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorServiceConfiguration.java51
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationCache.java5
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationReader.java6
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationWriter.java18
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConnectionParams.java13
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/rest/SimulatorController.java132
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/rest/util/DateUtil.java4
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/rest/util/ResponseBuilder.java19
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/Simulator.java119
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/SimulatorFactory.java41
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/client/HttpClientAdapter.java58
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/client/HttpClientAdapterImpl.java87
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/validation/JSONValidator.java66
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/validation/ParamsValidator.java121
-rw-r--r--test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/validation/ValidationException.java4
-rw-r--r--test/mocks/pnfsimulator/src/main/resources/log4j2.xml24
-rw-r--r--test/mocks/pnfsimulator/src/main/resources/logback.xml50
-rw-r--r--test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/message/JSONObjectFactoryTest.java69
-rw-r--r--test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/message/MessageProviderTest.java64
-rw-r--r--test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/NetconfConfigurationCheckingTaskTest.java94
-rw-r--r--test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorServiceConfigurationTest.java72
-rw-r--r--test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorServiceTest.java73
-rw-r--r--test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationCacheTest.java (renamed from test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfSessionFactory.java)29
-rw-r--r--test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationReaderTest.java70
-rw-r--r--test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationWriterTest.java67
-rw-r--r--test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/rest/SimulatorControllerTest.java195
-rw-r--r--test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/rest/util/DateUtilTest.java38
-rw-r--r--test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/rest/util/ResponseBuilderTest.java46
-rw-r--r--test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/SimulatorFactoryTest.java80
-rw-r--r--test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/SimulatorTest.java92
-rw-r--r--test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/TestMessages.java111
-rw-r--r--test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/client/HttpClientAdapterImplTest.java71
-rw-r--r--test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/validation/JSONValidatorTest.java123
-rw-r--r--test/mocks/pnfsimulator/src/test/resources/invalid-test-schema.json19
-rw-r--r--test/mocks/pnfsimulator/src/test/resources/logback-test.xml49
-rw-r--r--test/mocks/pnfsimulator/src/test/resources/valid-test-schema.json19
-rw-r--r--test/mocks/pnfsimulator/ssh/ssh_host_rsa_key54
-rw-r--r--test/mocks/pnfsimulator/ssh/ssh_host_rsa_key.pub1
57 files changed, 5183 insertions, 781 deletions
diff --git a/test/mocks/pnfsimulator/README.md b/test/mocks/pnfsimulator/README.md
index 5b9871a18..d53a07521 100644
--- a/test/mocks/pnfsimulator/README.md
+++ b/test/mocks/pnfsimulator/README.md
@@ -1,2 +1,45 @@
-# pnf-simulator
-Generate VES event related to PNF integration.
+# PNF Simulator
+Simulator that generates VES events related to PNF PNP integration.
+
+##Downloading simulator
+Official version of simulator can be downloaded for public ONAP docker registry as image.
+*docker login -u anonymous -p anonymous nexus3.onap.org:10003*
+
+Another option is to checkout PNF Simulator project from ONAP Git repository.
+
+##Usage of simulator
+
+###Configuration
+The configuration for simulator is stored in */config/config.json* file.
+It contains all parameters for simulation such as duration time,interval between messages and values of the configurable fields of VES message.
+If you want to change duration or value of message sending to VES collector you just need to edit this file.
+The message that is being sent to VES is built inside the simulator and it's content can be found in log of the simulator.
+
+###Running simulator
+The recommended way is to checkout PNF Simulator project from ONAP Git repository and use *simulator*.sh script
+If you copy *simulator.sh* script to another location, keep in mind to copy also *docker-compose.yml* and directories: *config,json_schema and netconf*.
+In order to run simulator, invoke ./simulator.sh start
+Script downloads if necessary needed Docker images and runs instances of these images.
+
+###Logging
+It is possible to get access to logs by invocation of *./simulator.sh* logs.
+The content of the logs is related to the last simulator run.
+Every start of simulator will generate new logs.
+
+###SFTP support
+PNF Simulator allows to serve files via SFTP server. SFTP server has predefined user sftp-user.
+Connection to SFTP server is being done with usage of SSH keys. Private key is stored in *ssh* directory.
+In order to download *sftp-file.txt* file simply run *sftp -P 2222 -i ssh/ssh_host_rsa_key sftp-user@localhost:sftp/sftp-file.txt*
+In order to add a new file (e.g. test.zip), put the file into *sftp* directory and run simulator.
+After that again execute sftp command: *sftp -P 2222 -i ssh/ssh_host_rsa_key sftp-user@localhost:sftp/test.zip*
+
+###Developer mode
+For development of PNF Simulator, run *simulator.sh* start-dev in order to run Netopeer.
+After that it is possible to run PNF Simulator from IDE.
+
+
+
+
+
+
+
diff --git a/test/mocks/pnfsimulator/config/config.json b/test/mocks/pnfsimulator/config/config.json
index b7eb1cc12..2a67be511 100644
--- a/test/mocks/pnfsimulator/config/config.json
+++ b/test/mocks/pnfsimulator/config/config.json
@@ -1,23 +1,24 @@
+
{
"simulatorParams": {
- "vesServerUrl": "http://10.154.187.70:8080/eventListener/v5",
+ "vesServerUrl": "http://VES-HOST:VES-PORT/eventListener/v7",
"testDuration": "10",
"messageInterval": "1"
},
"messageParams": {
- "pnfSerialNumber": "val1",
- "pnfVendorName": "val2",
- "pnfOamIpv4Address": "val3",
- "pnfOamIpv6Address": "val4",
- "pnfFamily": "val5",
- "pnfModelNumber": "val6",
- "pnfSoftwareVersion": "val7",
- "pnfType": "val8",
- "eventName": "val9",
- "nfNamingCode": "val10",
- "nfcNamingCode": "val11",
- "sourceName": "val12",
+ "pnf_serialNumber": "6061ZW3",
+ "pnf_vendorName": "Nokia",
+ "pnf_oamV4IpAddress": "val3",
+ "pnf_oamV6IpAddress": "val4",
+ "pnf_unitFamily": "BBU",
+ "pnf_modelNumber": "val6",
+ "pnf_softwareVersion": "val7",
+ "pnf_unitType": "val8",
+ "eventName": "pnfRegistration_Nokia_5gDu",
+ "nfNamingCode": "gNB",
+ "nfcNamingCode": "oam",
+ "sourceName": "NOK6061ZW3",
"sourceId": "val13",
- "reportingEntityName": "val14"
+ "reportingEntityName": "NOK6061ZW3"
}
}
diff --git a/test/mocks/pnfsimulator/deployment/PnP_PNF_sim_heat_template.yml b/test/mocks/pnfsimulator/deployment/PnP_PNF_sim_heat_template.yml
new file mode 100644
index 000000000..d9acc9e37
--- /dev/null
+++ b/test/mocks/pnfsimulator/deployment/PnP_PNF_sim_heat_template.yml
@@ -0,0 +1,129 @@
+description: Heat template that deploys PnP PNF simulator
+heat_template_version: '2013-05-23'
+parameters:
+ flavor_name: {description: Type of instance (flavor) to be used, label: Flavor,
+ type: string}
+ image_name: {description: Image to be used for compute instance, label: Image name
+ or ID, type: string}
+ key_name: {description: Public/Private key pair name, label: Key pair name, type: string}
+ public_net_id: {description: Public network that enables remote connection to VNF,
+ label: Public network name or ID, type: string}
+ private_net_id: {type: string, description: Private network id, label: Private network name or ID}
+ private_subnet_id: {type: string, description: Private subnet id, label: Private subnetwork name or ID}
+ proxy: {type: string, description: Proxy, label: Proxy, default: ""}
+resources:
+ PNF_PnP_simualtor:
+ type: OS::Nova::Server
+ properties:
+ key_name: { get_param: key_name }
+ image: { get_param: image_name }
+ flavor: { get_param: flavor_name }
+ networks:
+ - port: { get_resource: PNF_PnP_simualtor_port0 }
+ user_data_format: RAW
+ user_data:
+ str_replace:
+ template: |
+ #!/bin/bash
+
+ set_versions () {
+ DOCKER_COMPOSE_VERSION=1.22.0
+ }
+
+
+ enable_root_ssh () {
+ sed -i 's/PermitRootLogin.*/PermitRootLogin yes/' /etc/ssh/sshd_config
+ sed -i 's/PasswordAuthentication.*/PasswordAuthentication yes/' /etc/ssh/sshd_config
+ service sshd restart
+ echo -e "arthur\narthur" | passwd root
+ }
+
+ update_os () {
+ dnf -y install fedora-upgrade
+ }
+
+ docker_install_configure () {
+ dnf -y remove docker \
+ docker-client \
+ docker-client-latest \
+ docker-common \
+ docker-latest \
+ docker-latest-logrotate \
+ docker-logrotate \
+ docker-selinux \
+ docker-engine-selinux \
+ docker-engine
+ dnf -y install dnf-plugins-core
+ dnf config-manager \
+ --add-repo \
+ https://download.docker.com/linux/fedora/docker-ce.repo
+ dnf -y install docker-ce
+ systemctl start docker
+ mkdir -p /etc/systemd/system/docker.service.d/
+ cat > /etc/systemd/system/docker.service.d/override.conf<< EOF
+ [Service]
+ Environment="HTTP_PROXY=$proxy"
+ Environment="HTTPS_PROXY=$proxy"
+ EOF
+ systemctl daemon-reload
+ systemctl restart docker
+ docker login -u docker -p docker nexus3.onap.org:10003
+ }
+ docker_compose_install () {
+ curl -L https://github.com/docker/compose/releases/download/$DOCKER_COMPOSE_VERSION/docker-compose-$(uname -s)-$(uname -m) -o /usr/local/bin/docker-compose
+ chmod +x /usr/local/bin/docker-compose
+ }
+ pnf_sim_file_checkout () {
+ mkdir ~/sim/
+ mkdir ~/sim/ssh
+ cd ~/sim/ssh/;wget "https://gerrit.onap.org/r/gitweb?p=integration.git;a=blob_plain;f=test/mocks/pnfsimulator/ssh/ssh_host_rsa_key;hb=HEAD" -O ssh_host_rsa_key
+ cd ~/sim/ssh/;wget "https://gerrit.onap.org/r/gitweb?p=integration.git;a=blob_plain;f=test/mocks/pnfsimulator/ssh/ssh_host_rsa_key.pub;hb=HEAD" -O ssh_host_rsa_key.pub
+ mkdir ~/sim/sftp
+ cd ~/sim/sftp/;wget "https://gerrit.onap.org/r/gitweb?p=integration.git;a=blob_plain;f=test/mocks/pnfsimulator/sftp/sftp-file.txt;hb=HEAD" -O sftp-file.txt
+ mkdir ~/sim/config
+ cd ~/sim/config/;wget "https://gerrit.onap.org/r/gitweb?p=integration.git;a=blob_plain;f=test/mocks/pnfsimulator/config/config.json;hb=HEAD" -O config.json
+ cd ~/sim/config/;wget "https://gerrit.onap.org/r/gitweb?p=integration.git;a=blob_plain;f=test/mocks/pnfsimulator/config/netconf.env;hb=HEAD" -O netconf.env
+ mkdir ~/sim/json_schema
+ cd ~/sim/config/;wget "https://gerrit.onap.org/r/gitweb?p=integration.git;a=blob_plain;f=test/mocks/pnfsimulator/json_schema/input_validator.json;hb=HEAD" -O input_validator.json
+ cd ~/sim/config/;wget "https://gerrit.onap.org/r/gitweb?p=integration.git;a=blob_plain;f=test/mocks/pnfsimulator/json_schema/output_validator_ves_schema_30.0.1.json;hb=HEAD" -O output_validator_ves_schema_30.0.1.json
+ mkdir ~/sim/netconf
+ cd ~/sim/netconf/;wget "https://gerrit.onap.org/r/gitweb?p=integration.git;a=blob_plain;f=test/mocks/pnfsimulator/netconf/pnf-simulator.data.xml;hb=HEAD" -O pnf-simulator.data.xml
+ cd ~/sim/netconf/;wget "https://gerrit.onap.org/r/gitweb?p=integration.git;a=blob_plain;f=test/mocks/pnfsimulator/netconf/pnf-simulator.yang;hb=HEAD" -O pnf-simulator.yang
+ cd ~/sim/;wget "https://gerrit.onap.org/r/gitweb?p=integration.git;a=blob_plain;f=test/mocks/pnfsimulator/docker-compose.yml;hb=HEAD" -O docker-compose.yml
+ cd ~/sim/;wget "https://gerrit.onap.org/r/gitweb?p=integration.git;a=blob_plain;f=test/mocks/pnfsimulator/simulator.sh;hb=HEAD" -O simulator.sh
+ chmod 654 ~/sim/simulator.sh
+ }
+
+ start_simulator (){
+ ~/sim/simulator.sh start
+ }
+
+ set_versions
+ enable_root_ssh
+ update_os
+ docker_install_configure
+ docker_compose_install
+ pnf_sim_file_checkout
+ start_simulator
+ params:
+ $proxy: { get_param: proxy }
+ PNF_PnP_simualtor_port0:
+ type: OS::Neutron::Port
+ properties:
+ network_id: { get_param: private_net_id }
+ security_groups:
+ - default
+ fixed_ips:
+ - subnet_id: { get_param: private_subnet_id }
+ PNF_PnP_simualtor_public:
+ type: OS::Neutron::FloatingIP
+ properties:
+ floating_network_id: { get_param: public_net_id }
+ port_id: { get_resource: PNF_PnP_simualtor_port0 }
+outputs:
+ PNF_PnP_simualtor_private_ip:
+ description: IP address of PNF_PnP_simualtor in private network
+ value: { get_attr: [ PNF_PnP_simualtor, first_address ] }
+ PNF_PnP_simualtor_public_ip:
+ description: Floating IP address of PNF_PnP_simualtor in public network
+ value: { get_attr: [ PNF_PnP_simualtor_public, floating_ip_address ] }
diff --git a/test/mocks/pnfsimulator/docker-compose.dev.yml b/test/mocks/pnfsimulator/docker-compose.dev.yml
deleted file mode 100644
index c389eee65..000000000
--- a/test/mocks/pnfsimulator/docker-compose.dev.yml
+++ /dev/null
@@ -1,24 +0,0 @@
-version: '3'
-
-services:
- pnf-simulator:
- container_name: pnf-simulator
- image: pnf-simulator:latest
- ports:
- - "5000:5000"
- volumes:
- - ./logs:/var/log
- env_file:
- - ./config/netconf.env
- depends_on:
- - netopeer
-
- netopeer:
- container_name: netopeer
- image: sysrepo/sysrepo-netopeer2:latest
- ports:
- - "830:830"
- env_file:
- - ./config/netconf.env
- volumes:
- - ./netconf:/netconf
diff --git a/test/mocks/pnfsimulator/docker-compose.yml b/test/mocks/pnfsimulator/docker-compose.yml
index af9494a2a..5f73cde74 100644
--- a/test/mocks/pnfsimulator/docker-compose.yml
+++ b/test/mocks/pnfsimulator/docker-compose.yml
@@ -8,8 +8,10 @@ services:
- "5000:5000"
volumes:
- ./logs:/var/log
+ - ./json_schema:/json_schema
env_file:
- ./config/netconf.env
+ restart: on-failure
depends_on:
- netopeer
@@ -18,7 +20,21 @@ services:
image: sysrepo/sysrepo-netopeer2:latest
ports:
- "830:830"
+ volumes:
+ - ./netconf:/netconf
env_file:
- ./config/netconf.env
+ restart: on-failure
+ depends_on:
+ - sftp-server
+
+ sftp-server:
+ container_name: sftp-server
+ image: atmoz/sftp:alpine
+ ports:
+ - "2222:22"
volumes:
- - ./netconf:/netconf
+ - ./sftp:/home/sftp-user/sftp
+ - ./ssh/ssh_host_rsa_key.pub:/home/sftp-user/.ssh/keys/ssh_host_rsa_key.pub:ro
+ restart: on-failure
+ command: sftp-user::1001 \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/json_schema/input_validator.json b/test/mocks/pnfsimulator/json_schema/input_validator.json
new file mode 100644
index 000000000..195f4bf35
--- /dev/null
+++ b/test/mocks/pnfsimulator/json_schema/input_validator.json
@@ -0,0 +1,193 @@
+{
+ "$id": "http://example.com/example.json",
+ "type": "object",
+ "definitions": {},
+ "$schema": "http://json-schema.org/draft-07/schema#",
+ "properties": {
+ "simulatorParams": {
+ "$id": "/properties/simulatorParams",
+ "type": "object",
+ "properties": {
+ "vesServerUrl": {
+ "$id": "/properties/simulatorParams/properties/vesServerUrl",
+ "type": "string",
+ "title": "The Vesserverurl Schema ",
+ "default": "",
+ "examples": [
+ "http://10.42.111.53:VES-PORT/eventListener/v7"
+ ]
+ },
+ "testDuration": {
+ "$id": "/properties/simulatorParams/properties/testDuration",
+ "type": "string",
+ "title": "The Testduration Schema ",
+ "default": "",
+ "examples": [
+ "10"
+ ]
+ },
+ "messageInterval": {
+ "$id": "/properties/simulatorParams/properties/messageInterval",
+ "type": "string",
+ "title": "The Messageinterval Schema ",
+ "default": "",
+ "examples": [
+ "1"
+ ]
+ }
+ }
+ },
+ "messageParams": {
+ "$id": "/properties/messageParams",
+ "type": "object",
+ "properties": {
+ "pnf_serialNumber": {
+ "$id": "/properties/messageParams/properties/pnf_serialNumber",
+ "type": "string",
+ "title": "The Pnf_serialnumber Schema ",
+ "default": "",
+ "examples": [
+ "6061ZW3"
+ ]
+ },
+ "pnf_vendorName": {
+ "$id": "/properties/messageParams/properties/pnf_vendorName",
+ "type": "string",
+ "title": "The Pnf_vendorname Schema ",
+ "default": "",
+ "examples": [
+ "Nokia"
+ ]
+ },
+ "pnf_oamV4IpAddress": {
+ "$id": "/properties/messageParams/properties/pnf_oamV4IpAddress",
+ "type": "string",
+ "title": "The Pnf_oamv4ipaddress Schema ",
+ "default": "",
+ "examples": [
+ "val3"
+ ]
+ },
+ "pnf_oamV6IpAddress": {
+ "$id": "/properties/messageParams/properties/pnf_oamV6IpAddress",
+ "type": "string",
+ "title": "The Pnf_oamv6ipaddress Schema ",
+ "default": "",
+ "examples": [
+ "val4"
+ ]
+ },
+ "pnf_unitFamily": {
+ "$id": "/properties/messageParams/properties/pnf_unitFamily",
+ "type": "string",
+ "title": "The Pnf_unitfamily Schema ",
+ "default": "",
+ "examples": [
+ "BBU"
+ ]
+ },
+ "pnf_modelNumber": {
+ "$id": "/properties/messageParams/properties/pnf_modelNumber",
+ "type": "string",
+ "title": "The Pnf_modelnumber Schema ",
+ "default": "",
+ "examples": [
+ "val6"
+ ]
+ },
+ "pnf_softwareVersion": {
+ "$id": "/properties/messageParams/properties/pnf_softwareVersion",
+ "type": "string",
+ "title": "The Pnf_softwareversion Schema ",
+ "default": "",
+ "examples": [
+ "val7"
+ ]
+ },
+ "pnf_unitType": {
+ "$id": "/properties/messageParams/properties/pnf_unitType",
+ "type": "string",
+ "title": "The Pnf_unittype Schema ",
+ "default": "",
+ "examples": [
+ "val8"
+ ]
+ },
+ "eventName": {
+ "$id": "/properties/messageParams/properties/eventName",
+ "type": "string",
+ "title": "The Eventname Schema ",
+ "default": "",
+ "examples": [
+ "pnfRegistration_Nokia_5gDu"
+ ]
+ },
+ "nfNamingCode": {
+ "$id": "/properties/messageParams/properties/nfNamingCode",
+ "type": "string",
+ "title": "The Nfnamingcode Schema ",
+ "default": "",
+ "examples": [
+ "gNB"
+ ]
+ },
+ "nfcNamingCode": {
+ "$id": "/properties/messageParams/properties/nfcNamingCode",
+ "type": "string",
+ "title": "The Nfcnamingcode Schema ",
+ "default": "",
+ "examples": [
+ "oam"
+ ]
+ },
+ "sourceName": {
+ "$id": "/properties/messageParams/properties/sourceName",
+ "type": "string",
+ "title": "The Sourcename Schema ",
+ "default": "",
+ "examples": [
+ "NOK6061ZW3"
+ ]
+ },
+ "sourceId": {
+ "$id": "/properties/messageParams/properties/sourceId",
+ "type": "string",
+ "title": "The Sourceid Schema ",
+ "default": "",
+ "examples": [
+ "val13"
+ ]
+ },
+ "reportingEntityName": {
+ "$id": "/properties/messageParams/properties/reportingEntityName",
+ "type": "string",
+ "title": "The Reportingentityname Schema ",
+ "default": "",
+ "examples": [
+ "NOK6061ZW3"
+ ]
+ }
+ },
+ "required": [
+ "pnf_serialNumber",
+ "pnf_vendorName"
+ ],
+ "anyOf": [
+ {
+ "required": [
+ "pnf_oamV4IpAddress"
+ ]
+ },
+ {
+ "required": [
+ "pnf_oamV6IpAddress"
+ ]
+ }
+ ]
+ }
+ },
+ "required": [
+ "simulatorParams",
+ "messageParams"
+ ]
+} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/json_schema/output_validator_ves_schema_30.0.1.json b/test/mocks/pnfsimulator/json_schema/output_validator_ves_schema_30.0.1.json
new file mode 100644
index 000000000..385ba25e3
--- /dev/null
+++ b/test/mocks/pnfsimulator/json_schema/output_validator_ves_schema_30.0.1.json
@@ -0,0 +1,2432 @@
+{
+ "$schema": "http://json-schema.org/draft-04/schema#",
+ "title": "VES Event Listener Common Event Format",
+ "type": "object",
+ "properties": {
+ "event": {"$ref": "#/definitions/event"},
+ "eventList": {"$ref": "#/definitions/eventList"}
+ },
+
+ "definitions": {
+ "schemaHeaderBlock": {
+ "description": "schema date, version, author and associated API",
+ "type": "object",
+ "properties": {
+ "associatedApi": {
+ "description": "VES Event Listener",
+ "type": "string"
+ },
+ "lastUpdatedBy": {
+ "description": "re2947",
+ "type": "string"
+ },
+ "schemaDate": {
+ "description": "July 31, 2018",
+ "type": "string"
+ },
+ "schemaVersion": {
+ "description": "30.0.1",
+ "type": "number"
+ }
+ }
+ },
+ "schemaLicenseAndCopyrightNotice": {
+ "description": "Copyright (c) 2018, AT&T Intellectual Property. All rights reserved",
+ "type": "object",
+ "properties": {
+ "apacheLicense2.0": {
+ "description": "Licensed under the Apache License, Version 2.0 (the 'License'); you may not use this file except in compliance with the License. You may obtain a copy of the License at:",
+ "type": "string"
+ },
+ "licenseUrl": {
+ "description": "http://www.apache.org/licenses/LICENSE-2.0",
+ "type": "string"
+ },
+ "asIsClause": {
+ "description": "Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an 'AS IS' BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.",
+ "type": "string"
+ },
+ "permissionsAndLimitations": {
+ "description": "See the License for the specific language governing permissions and limitations under the License.",
+ "type": "string"
+ }
+ }
+ },
+ "arrayOfJsonObject": {
+ "description": "array of json objects described by name, schema and other meta-information",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/jsonObject"
+ }
+ },
+ "arrayOfNamedHashMap": {
+ "description": "array of named hashMaps",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/namedHashMap"
+ }
+ },
+ "codecsInUse": {
+ "description": "number of times an identified codec was used over the measurementInterval",
+ "type": "object",
+ "properties": {
+ "codecIdentifier": { "type": "string" },
+ "numberInUse": { "type": "integer" }
+ },
+ "additionalProperties": false,
+ "required": [ "codecIdentifier", "numberInUse" ]
+ },
+ "commonEventHeader": {
+ "description": "fields common to all events",
+ "type": "object",
+ "properties": {
+ "domain": {
+ "description": "the eventing domain associated with the event",
+ "type": "string",
+ "enum": [
+ "fault",
+ "heartbeat",
+ "measurement",
+ "mobileFlow",
+ "notification",
+ "other",
+ "pnfRegistration",
+ "sipSignaling",
+ "stateChange",
+ "syslog",
+ "thresholdCrossingAlert",
+ "voiceQuality"
+ ]
+ },
+ "eventId": {
+ "description": "event key that is unique to the event source",
+ "type": "string"
+ },
+ "eventName": {
+ "description": "unique event name",
+ "type": "string"
+ },
+ "eventType": {
+ "description": "for example - applicationNf, guestOS, hostOS, platform",
+ "type": "string"
+ },
+ "internalHeaderFields": { "$ref": "#/definitions/internalHeaderFields" },
+ "lastEpochMicrosec": {
+ "description": "the latest unix time aka epoch time associated with the event from any component--as microseconds elapsed since 1 Jan 1970 not including leap seconds",
+ "type": "number"
+ },
+ "nfcNamingCode": {
+ "description": "3 character network function component type, aligned with vfc naming standards",
+ "type": "string"
+ },
+ "nfNamingCode": {
+ "description": "4 character network function type, aligned with nf naming standards",
+ "type": "string"
+ },
+ "nfVendorName": {
+ "description": "network function vendor name",
+ "type": "string"
+ },
+ "priority": {
+ "description": "processing priority",
+ "type": "string",
+ "enum": [
+ "High",
+ "Medium",
+ "Normal",
+ "Low"
+ ]
+ },
+ "reportingEntityId": {
+ "description": "UUID identifying the entity reporting the event, for example an OAM VM; must be populated by the ATT enrichment process",
+ "type": "string"
+ },
+ "reportingEntityName": {
+ "description": "name of the entity reporting the event, for example, an EMS name; may be the same as sourceName",
+ "type": "string"
+ },
+ "sequence": {
+ "description": "ordering of events communicated by an event source instance or 0 if not needed",
+ "type": "integer"
+ },
+ "sourceId": {
+ "description": "UUID identifying the entity experiencing the event issue; must be populated by the ATT enrichment process",
+ "type": "string"
+ },
+ "sourceName": {
+ "description": "name of the entity experiencing the event issue",
+ "type": "string"
+ },
+ "startEpochMicrosec": {
+ "description": "the earliest unix time aka epoch time associated with the event from any component--as microseconds elapsed since 1 Jan 1970 not including leap seconds",
+ "type": "number"
+ },
+ "timeZoneOffset": {
+ "description": "UTC offset for the local time zone of the device as UTC+/-hh.mm",
+ "type": "string"
+ },
+ "version": {
+ "description": "version of the event header",
+ "type": "string",
+ "enum": [ "4.0.1" ]
+ },
+ "vesEventListenerVersion": {
+ "description": "version of the VES Event Listener API",
+ "type": "string",
+ "enum": [ "7.0.1" ]
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "domain", "eventId", "eventName", "lastEpochMicrosec",
+ "priority", "reportingEntityName", "sequence", "sourceName",
+ "startEpochMicrosec", "version", "vesEventListenerVersion" ]
+ },
+ "counter": {
+ "description": "performance counter",
+ "type": "object",
+ "properties": {
+ "criticality": { "type": "string", "enum": [ "CRIT", "MAJ" ] },
+ "hashMap": { "$ref": "#/definitions/hashMap" },
+ "thresholdCrossed": { "type": "string" }
+ },
+ "additionalProperties": false,
+ "required": [ "criticality", "hashMap", "thresholdCrossed" ]
+ },
+ "cpuUsage": {
+ "description": "usage of an identified CPU",
+ "type": "object",
+ "properties": {
+ "cpuCapacityContention": {
+ "description": "the amount of time the CPU cannot run due to contention, in milliseconds over the measurementInterval",
+ "type": "number"
+ },
+ "cpuDemandAvg": {
+ "description": "the total CPU time that the NF/NFC/VM could use if there was no contention, in milliseconds over the measurementInterval",
+ "type": "number"
+ },
+ "cpuDemandMhz": {
+ "description": "CPU demand in megahertz",
+ "type": "number"
+ },
+ "cpuDemandPct": {
+ "description": "CPU demand as a percentage of the provisioned capacity",
+ "type": "number"
+ },
+ "cpuIdentifier": {
+ "description": "cpu identifer",
+ "type": "string"
+ },
+ "cpuIdle": {
+ "description": "percentage of CPU time spent in the idle task",
+ "type": "number"
+ },
+ "cpuLatencyAvg": {
+ "description": "percentage of time the VM is unable to run because it is contending for access to the physical CPUs",
+ "type": "number"
+ },
+ "cpuOverheadAvg": {
+ "description": "the overhead demand above available allocations and reservations, in milliseconds over the measurementInterval",
+ "type": "number"
+ },
+ "cpuSwapWaitTime": {
+ "description": "swap wait time. in milliseconds over the measurementInterval",
+ "type": "number"
+ },
+ "cpuUsageInterrupt": {
+ "description": "percentage of time spent servicing interrupts",
+ "type": "number"
+ },
+ "cpuUsageNice": {
+ "description": "percentage of time spent running user space processes that have been niced",
+ "type": "number"
+ },
+ "cpuUsageSoftIrq": {
+ "description": "percentage of time spent handling soft irq interrupts",
+ "type": "number"
+ },
+ "cpuUsageSteal": {
+ "description": "percentage of time spent in involuntary wait which is neither user, system or idle time and is effectively time that went missing",
+ "type": "number"
+ },
+ "cpuUsageSystem": {
+ "description": "percentage of time spent on system tasks running the kernel",
+ "type": "number"
+ },
+ "cpuUsageUser": {
+ "description": "percentage of time spent running un-niced user space processes",
+ "type": "number"
+ },
+ "cpuWait": {
+ "description": "percentage of CPU time spent waiting for I/O operations to complete",
+ "type": "number"
+ },
+ "percentUsage": {
+ "description": "aggregate cpu usage of the virtual machine on which the xNFC reporting the event is running",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "cpuIdentifier", "percentUsage" ]
+ },
+ "diskUsage": {
+ "description": "usage of an identified disk",
+ "type": "object",
+ "properties": {
+ "diskBusResets": {
+ "description": "number of bus resets over the measurementInterval",
+ "type": "number"
+ },
+ "diskCommandsAborted": {
+ "description": "number of disk commands aborted over the measurementInterval",
+ "type": "number"
+ },
+ "diskCommandsAvg": {
+ "description": "average number of commands per second over the measurementInterval",
+ "type": "number"
+ },
+ "diskFlushRequests": {
+ "description": "total flush requests of the disk cache over the measurementInterval",
+ "type": "number"
+ },
+ "diskFlushTime": {
+ "description": "milliseconds spent on disk cache flushing over the measurementInterval",
+ "type": "number"
+ },
+ "diskIdentifier": {
+ "description": "disk identifier",
+ "type": "string"
+ },
+ "diskIoTimeAvg": {
+ "description": "milliseconds spent doing input/output operations over 1 sec; treat this metric as a device load percentage where 1000ms matches 100% load; provide the average over the measurement interval",
+ "type": "number"
+ },
+ "diskIoTimeLast": {
+ "description": "milliseconds spent doing input/output operations over 1 sec; treat this metric as a device load percentage where 1000ms matches 100% load; provide the last value measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskIoTimeMax": {
+ "description": "milliseconds spent doing input/output operations over 1 sec; treat this metric as a device load percentage where 1000ms matches 100% load; provide the maximum value measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskIoTimeMin": {
+ "description": "milliseconds spent doing input/output operations over 1 sec; treat this metric as a device load percentage where 1000ms matches 100% load; provide the minimum value measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskMergedReadAvg": {
+ "description": "number of logical read operations that were merged into physical read operations, e.g., two logical reads were served by one physical disk access; provide the average measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskMergedReadLast": {
+ "description": "number of logical read operations that were merged into physical read operations, e.g., two logical reads were served by one physical disk access; provide the last value measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskMergedReadMax": {
+ "description": "number of logical read operations that were merged into physical read operations, e.g., two logical reads were served by one physical disk access; provide the maximum value measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskMergedReadMin": {
+ "description": "number of logical read operations that were merged into physical read operations, e.g., two logical reads were served by one physical disk access; provide the minimum value measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskMergedWriteAvg": {
+ "description": "number of logical write operations that were merged into physical write operations, e.g., two logical writes were served by one physical disk access; provide the average measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskMergedWriteLast": {
+ "description": "number of logical write operations that were merged into physical write operations, e.g., two logical writes were served by one physical disk access; provide the last value measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskMergedWriteMax": {
+ "description": "number of logical write operations that were merged into physical write operations, e.g., two logical writes were served by one physical disk access; provide the maximum value measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskMergedWriteMin": {
+ "description": "number of logical write operations that were merged into physical write operations, e.g., two logical writes were served by one physical disk access; provide the minimum value measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskOctetsReadAvg": {
+ "description": "number of octets per second read from a disk or partition; provide the average measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskOctetsReadLast": {
+ "description": "number of octets per second read from a disk or partition; provide the last measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskOctetsReadMax": {
+ "description": "number of octets per second read from a disk or partition; provide the maximum measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskOctetsReadMin": {
+ "description": "number of octets per second read from a disk or partition; provide the minimum measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskOctetsWriteAvg": {
+ "description": "number of octets per second written to a disk or partition; provide the average measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskOctetsWriteLast": {
+ "description": "number of octets per second written to a disk or partition; provide the last measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskOctetsWriteMax": {
+ "description": "number of octets per second written to a disk or partition; provide the maximum measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskOctetsWriteMin": {
+ "description": "number of octets per second written to a disk or partition; provide the minimum measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskOpsReadAvg": {
+ "description": "number of read operations per second issued to the disk; provide the average measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskOpsReadLast": {
+ "description": "number of read operations per second issued to the disk; provide the last measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskOpsReadMax": {
+ "description": "number of read operations per second issued to the disk; provide the maximum measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskOpsReadMin": {
+ "description": "number of read operations per second issued to the disk; provide the minimum measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskOpsWriteAvg": {
+ "description": "number of write operations per second issued to the disk; provide the average measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskOpsWriteLast": {
+ "description": "number of write operations per second issued to the disk; provide the last measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskOpsWriteMax": {
+ "description": "number of write operations per second issued to the disk; provide the maximum measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskOpsWriteMin": {
+ "description": "number of write operations per second issued to the disk; provide the minimum measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskPendingOperationsAvg": {
+ "description": "queue size of pending I/O operations per second; provide the average measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskPendingOperationsLast": {
+ "description": "queue size of pending I/O operations per second; provide the last measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskPendingOperationsMax": {
+ "description": "queue size of pending I/O operations per second; provide the maximum measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskPendingOperationsMin": {
+ "description": "queue size of pending I/O operations per second; provide the minimum measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskReadCommandsAvg": {
+ "description": "average number of read commands issued per second to the disk over the measurementInterval",
+ "type": "number"
+ },
+ "diskTime": {
+ "description": "nanoseconds spent on disk cache reads/writes within the measurement interval",
+ "type": "number"
+ },
+ "diskTimeReadAvg": {
+ "description": "milliseconds a read operation took to complete; provide the average measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskTimeReadLast": {
+ "description": "milliseconds a read operation took to complete; provide the last measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskTimeReadMax": {
+ "description": "milliseconds a read operation took to complete; provide the maximum measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskTimeReadMin": {
+ "description": "milliseconds a read operation took to complete; provide the minimum measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskTimeWriteAvg": {
+ "description": "milliseconds a write operation took to complete; provide the average measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskTimeWriteLast": {
+ "description": "milliseconds a write operation took to complete; provide the last measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskTimeWriteMax": {
+ "description": "milliseconds a write operation took to complete; provide the maximum measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskTimeWriteMin": {
+ "description": "milliseconds a write operation took to complete; provide the minimum measurement within the measurement interval",
+ "type": "number"
+ },
+ "diskTotalReadLatencyAvg": {
+ "description": "average read time from the perspective of a Guest OS: sum of the Kernel Read Latency and Physical Device Read Latency in milliseconds over the measurement interval",
+ "type": "number"
+ },
+ "diskTotalWriteLatencyAvg": {
+ "description": "average write time from the perspective of a Guest OS: sum of the Kernel Write Latency and Physical Device Write Latency in milliseconds over the measurement interval",
+ "type": "number"
+ },
+ "diskWeightedIoTimeAvg": {
+ "description": "measure in ms over 1 sec of both I/O completion time and the backlog that may be accumulating; value is the average within the collection interval",
+ "type": "number"
+ },
+ "diskWeightedIoTimeLast": {
+ "description": "measure in ms over 1 sec of both I/O completion time and the backlog that may be accumulating; value is the last within the collection interval",
+ "type": "number"
+ },
+ "diskWeightedIoTimeMax": {
+ "description": "measure in ms over 1 sec of both I/O completion time and the backlog that may be accumulating; value is the maximum within the collection interval",
+ "type": "number"
+ },
+ "diskWeightedIoTimeMin": {
+ "description": "measure in ms over 1 sec of both I/O completion time and the backlog that may be accumulating; value is the minimum within the collection interval",
+ "type": "number"
+ },
+ "diskWriteCommandsAvg": {
+ "description": "average number of write commands issued per second to the disk over the measurementInterval",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "diskIdentifier" ]
+ },
+ "endOfCallVqmSummaries": {
+ "description": "provides end of call voice quality metrics",
+ "type": "object",
+ "properties": {
+ "adjacencyName": {
+ "description": " adjacency name",
+ "type": "string"
+ },
+ "endpointAverageJitter": {
+ "description": "endpoint average jitter",
+ "type": "number"
+ },
+ "endpointDescription": {
+ "description": "either Caller or Callee",
+ "type": "string",
+ "enum": ["Caller", "Callee"]
+ },
+ "endpointMaxJitter": {
+ "description": "endpoint maximum jitter",
+ "type": "number"
+ },
+ "endpointRtpOctetsDiscarded": {
+ "description": "",
+ "type": "number"
+ },
+ "endpointRtpOctetsLost": {
+ "description": "endpoint RTP octets lost",
+ "type": "number"
+ },
+ "endpointRtpOctetsReceived": {
+ "description": "",
+ "type": "number"
+ },
+ "endpointRtpOctetsSent": {
+ "description": "",
+ "type": "number"
+ },
+ "endpointRtpPacketsDiscarded": {
+ "description": "",
+ "type": "number"
+ },
+ "endpointRtpPacketsLost": {
+ "description": "endpoint RTP packets lost",
+ "type": "number"
+ },
+ "endpointRtpPacketsReceived": {
+ "description": "",
+ "type": "number"
+ },
+ "endpointRtpPacketsSent": {
+ "description": "",
+ "type": "number"
+ },
+ "localAverageJitter": {
+ "description": "Local average jitter",
+ "type": "number"
+ },
+ "localAverageJitterBufferDelay": {
+ "description": "Local average jitter delay",
+ "type": "number"
+ },
+ "localMaxJitter": {
+ "description": "Local maximum jitter",
+ "type": "number"
+ },
+ "localMaxJitterBufferDelay": {
+ "description": "Local maximum jitter delay",
+ "type": "number"
+ },
+ "localRtpOctetsDiscarded": {
+ "description": "",
+ "type": "number"
+ },
+ "localRtpOctetsLost": {
+ "description": "Local RTP octets lost",
+ "type": "number"
+ },
+ "localRtpOctetsReceived": {
+ "description": "",
+ "type": "number"
+ },
+ "localRtpOctetsSent": {
+ "description": "",
+ "type": "number"
+ },
+ "localRtpPacketsDiscarded": {
+ "description": "",
+ "type": "number"
+ },
+ "localRtpPacketsLost": {
+ "description": "Local RTP packets lost",
+ "type": "number"
+ },
+ "localRtpPacketsReceived": {
+ "description": "",
+ "type": "number"
+ },
+ "localRtpPacketsSent": {
+ "description": "",
+ "type": "number"
+ },
+ "mosCqe": {
+ "description": "1-5 1dp",
+ "type": "number"
+ },
+ "oneWayDelay": {
+ "description": "one-way path delay in milliseconds",
+ "type": "number"
+ },
+ "packetLossPercent": {
+ "description" : "Calculated percentage packet loss based on Endpoint RTP packets lost (as reported in RTCP) and Local RTP packets sent. Direction is based on Endpoint description (Caller, Callee). Decimal (2 dp)",
+ "type": "number"
+ },
+ "rFactor": {
+ "description": "0-100",
+ "type": "number"
+ },
+ "roundTripDelay": {
+ "description": "millisecs",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "adjacencyName", "endpointDescription" ]
+ },
+ "event": {
+ "description": "the root level of the common event format",
+ "type": "object",
+ "properties": {
+ "commonEventHeader": { "$ref": "#/definitions/commonEventHeader" },
+ "faultFields": { "$ref": "#/definitions/faultFields" },
+ "heartbeatFields": { "$ref": "#/definitions/heartbeatFields" },
+ "measurementFields": { "$ref": "#/definitions/measurementFields" },
+ "mobileFlowFields": { "$ref": "#/definitions/mobileFlowFields" },
+ "notificationFields": { "$ref": "#/definitions/notificationFields" },
+ "otherFields": { "$ref": "#/definitions/otherFields" },
+ "pnfRegistrationFields": { "$ref": "#/definitions/pnfRegistrationFields" },
+ "sipSignalingFields": { "$ref": "#/definitions/sipSignalingFields" },
+ "stateChangeFields": { "$ref": "#/definitions/stateChangeFields" },
+ "syslogFields": { "$ref": "#/definitions/syslogFields" },
+ "thresholdCrossingAlertFields": { "$ref": "#/definitions/thresholdCrossingAlertFields" },
+ "voiceQualityFields": { "$ref": "#/definitions/voiceQualityFields" }
+ },
+ "additionalProperties": false,
+ "required": [ "commonEventHeader" ]
+ },
+ "eventList": {
+ "description": "array of events",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/event"
+ }
+ },
+ "faultFields": {
+ "description": "fields specific to fault events",
+ "type": "object",
+ "properties": {
+ "alarmAdditionalInformation": { "$ref": "#/definitions/hashMap" },
+ "alarmCondition": {
+ "description": "alarm condition reported by the device",
+ "type": "string"
+ },
+ "alarmInterfaceA": {
+ "description": "card, port, channel or interface name of the device generating the alarm",
+ "type": "string"
+ },
+ "eventCategory": {
+ "description": "Event category, for example: license, link, routing, security, signaling",
+ "type": "string"
+ },
+ "eventSeverity": {
+ "description": "event severity",
+ "type": "string",
+ "enum": [
+ "CRITICAL",
+ "MAJOR",
+ "MINOR",
+ "WARNING",
+ "NORMAL"
+ ]
+ },
+ "eventSourceType": {
+ "description": "type of event source; examples: card, host, other, port, portThreshold, router, slotThreshold, switch, virtualMachine, virtualNetworkFunction",
+ "type": "string"
+ },
+ "faultFieldsVersion": {
+ "description": "version of the faultFields block",
+ "type": "string",
+ "enum": [ "4.0" ]
+ },
+ "specificProblem": {
+ "description": "short description of the alarm or problem",
+ "type": "string"
+ },
+ "vfStatus": {
+ "description": "virtual function status enumeration",
+ "type": "string",
+ "enum": [
+ "Active",
+ "Idle",
+ "Preparing to terminate",
+ "Ready to terminate",
+ "Requesting termination"
+ ]
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "alarmCondition", "eventSeverity", "eventSourceType",
+ "faultFieldsVersion", "specificProblem", "vfStatus" ]
+ },
+ "filesystemUsage": {
+ "description": "disk usage of an identified virtual machine in gigabytes and/or gigabytes per second",
+ "type": "object",
+ "properties": {
+ "blockConfigured": { "type": "number" },
+ "blockIops": { "type": "number" },
+ "blockUsed": { "type": "number" },
+ "ephemeralConfigured": { "type": "number" },
+ "ephemeralIops": { "type": "number" },
+ "ephemeralUsed": { "type": "number" },
+ "filesystemName": { "type": "string" }
+ },
+ "additionalProperties": false,
+ "required": [ "blockConfigured", "blockIops", "blockUsed", "ephemeralConfigured",
+ "ephemeralIops", "ephemeralUsed", "filesystemName" ]
+ },
+ "gtpPerFlowMetrics": {
+ "description": "Mobility GTP Protocol per flow metrics",
+ "type": "object",
+ "properties": {
+ "avgBitErrorRate": {
+ "description": "average bit error rate",
+ "type": "number"
+ },
+ "avgPacketDelayVariation": {
+ "description": "Average packet delay variation or jitter in milliseconds for received packets: Average difference between the packet timestamp and time received for all pairs of consecutive packets",
+ "type": "number"
+ },
+ "avgPacketLatency": {
+ "description": "average delivery latency",
+ "type": "number"
+ },
+ "avgReceiveThroughput": {
+ "description": "average receive throughput",
+ "type": "number"
+ },
+ "avgTransmitThroughput": {
+ "description": "average transmit throughput",
+ "type": "number"
+ },
+ "durConnectionFailedStatus": {
+ "description": "duration of failed state in milliseconds, computed as the cumulative time between a failed echo request and the next following successful error request, over this reporting interval",
+ "type": "number"
+ },
+ "durTunnelFailedStatus": {
+ "description": "Duration of errored state, computed as the cumulative time between a tunnel error indicator and the next following non-errored indicator, over this reporting interval",
+ "type": "number"
+ },
+ "flowActivatedBy": {
+ "description": "Endpoint activating the flow",
+ "type": "string"
+ },
+ "flowActivationEpoch": {
+ "description": "Time the connection is activated in the flow (connection) being reported on, or transmission time of the first packet if activation time is not available",
+ "type": "number"
+ },
+ "flowActivationMicrosec": {
+ "description": "Integer microseconds for the start of the flow connection",
+ "type": "number"
+ },
+ "flowActivationTime": {
+ "description": "time the connection is activated in the flow being reported on, or transmission time of the first packet if activation time is not available; with RFC 2822 compliant format: Sat, 13 Mar 2010 11:29:05 -0800",
+ "type": "string"
+ },
+ "flowDeactivatedBy": {
+ "description": "Endpoint deactivating the flow",
+ "type": "string"
+ },
+ "flowDeactivationEpoch": {
+ "description": "Time for the start of the flow connection, in integer UTC epoch time aka UNIX time",
+ "type": "number"
+ },
+ "flowDeactivationMicrosec": {
+ "description": "Integer microseconds for the start of the flow connection",
+ "type": "number"
+ },
+ "flowDeactivationTime": {
+ "description": "Transmission time of the first packet in the flow connection being reported on; with RFC 2822 compliant format: Sat, 13 Mar 2010 11:29:05 -0800",
+ "type": "string"
+ },
+ "flowStatus": {
+ "description": "connection status at reporting time as a working / inactive / failed indicator value",
+ "type": "string"
+ },
+ "gtpConnectionStatus": {
+ "description": "Current connection state at reporting time",
+ "type": "string"
+ },
+ "gtpTunnelStatus": {
+ "description": "Current tunnel state at reporting time",
+ "type": "string"
+ },
+ "ipTosCountList": { "$ref": "#/definitions/hashMap" },
+ "ipTosList": {
+ "description": "Array of unique IP Type-of-Service values observed in the flow where values range from '0' to '255'",
+ "type": "array",
+ "items": {
+ "type": "string"
+ }
+ },
+ "largePacketRtt": {
+ "description": "large packet round trip time",
+ "type": "number"
+ },
+ "largePacketThreshold": {
+ "description": "large packet threshold being applied",
+ "type": "number"
+ },
+ "maxPacketDelayVariation": {
+ "description": "Maximum packet delay variation or jitter in milliseconds for received packets: Maximum of the difference between the packet timestamp and time received for all pairs of consecutive packets",
+ "type": "number"
+ },
+ "maxReceiveBitRate": {
+ "description": "maximum receive bit rate",
+ "type": "number"
+ },
+ "maxTransmitBitRate": {
+ "description": "maximum transmit bit rate",
+ "type": "number"
+ },
+ "mobileQciCosCountList": { "$ref": "#/definitions/hashMap" },
+ "mobileQciCosList": {
+ "description": "Array of unique LTE QCI or UMTS class-of-service values observed in the flow",
+ "type": "array",
+ "items": {
+ "type": "string"
+ }
+ },
+ "numActivationFailures": {
+ "description": "Number of failed activation requests, as observed by the reporting node",
+ "type": "number"
+ },
+ "numBitErrors": {
+ "description": "number of errored bits",
+ "type": "number"
+ },
+ "numBytesReceived": {
+ "description": "number of bytes received, including retransmissions",
+ "type": "number"
+ },
+ "numBytesTransmitted": {
+ "description": "number of bytes transmitted, including retransmissions",
+ "type": "number"
+ },
+ "numDroppedPackets": {
+ "description": "number of received packets dropped due to errors per virtual interface",
+ "type": "number"
+ },
+ "numGtpEchoFailures": {
+ "description": "Number of Echo request path failures where failed paths are defined in 3GPP TS 29.281 sec 7.2.1 and 3GPP TS 29.060 sec. 11.2",
+ "type": "number"
+ },
+ "numGtpTunnelErrors": {
+ "description": "Number of tunnel error indications where errors are defined in 3GPP TS 29.281 sec 7.3.1 and 3GPP TS 29.060 sec. 11.1",
+ "type": "number"
+ },
+ "numHttpErrors": {
+ "description": "Http error count",
+ "type": "number"
+ },
+ "numL7BytesReceived": {
+ "description": "number of tunneled layer 7 bytes received, including retransmissions",
+ "type": "number"
+ },
+ "numL7BytesTransmitted": {
+ "description": "number of tunneled layer 7 bytes transmitted, excluding retransmissions",
+ "type": "number"
+ },
+ "numLostPackets": {
+ "description": "number of lost packets",
+ "type": "number"
+ },
+ "numOutOfOrderPackets": {
+ "description": "number of out-of-order packets",
+ "type": "number"
+ },
+ "numPacketErrors": {
+ "description": "number of errored packets",
+ "type": "number"
+ },
+ "numPacketsReceivedExclRetrans": {
+ "description": "number of packets received, excluding retransmission",
+ "type": "number"
+ },
+ "numPacketsReceivedInclRetrans": {
+ "description": "number of packets received, including retransmission",
+ "type": "number"
+ },
+ "numPacketsTransmittedInclRetrans": {
+ "description": "number of packets transmitted, including retransmissions",
+ "type": "number"
+ },
+ "numRetries": {
+ "description": "number of packet retries",
+ "type": "number"
+ },
+ "numTimeouts": {
+ "description": "number of packet timeouts",
+ "type": "number"
+ },
+ "numTunneledL7BytesReceived": {
+ "description": "number of tunneled layer 7 bytes received, excluding retransmissions",
+ "type": "number"
+ },
+ "roundTripTime": {
+ "description": "round trip time",
+ "type": "number"
+ },
+ "tcpFlagCountList": { "$ref": "#/definitions/hashMap" },
+ "tcpFlagList": {
+ "description": "Array of unique TCP Flags observed in the flow",
+ "type": "array",
+ "items": {
+ "type": "string"
+ }
+ },
+ "timeToFirstByte": {
+ "description": "Time in milliseconds between the connection activation and first byte received",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "avgBitErrorRate", "avgPacketDelayVariation", "avgPacketLatency",
+ "avgReceiveThroughput", "avgTransmitThroughput",
+ "flowActivationEpoch", "flowActivationMicrosec",
+ "flowDeactivationEpoch", "flowDeactivationMicrosec",
+ "flowDeactivationTime", "flowStatus",
+ "maxPacketDelayVariation", "numActivationFailures",
+ "numBitErrors", "numBytesReceived", "numBytesTransmitted",
+ "numDroppedPackets", "numL7BytesReceived",
+ "numL7BytesTransmitted", "numLostPackets",
+ "numOutOfOrderPackets", "numPacketErrors",
+ "numPacketsReceivedExclRetrans",
+ "numPacketsReceivedInclRetrans",
+ "numPacketsTransmittedInclRetrans",
+ "numRetries", "numTimeouts", "numTunneledL7BytesReceived",
+ "roundTripTime", "timeToFirstByte"
+ ]
+ },
+ "hashMap": {
+ "description": "an associative array which is an array of key:value pairs",
+ "type": "object",
+ "additionalProperties": { "type": "string" },
+ "default": {}
+ },
+ "heartbeatFields": {
+ "description": "optional field block for fields specific to heartbeat events",
+ "type": "object",
+ "properties": {
+ "additionalFields": { "$ref": "#/definitions/hashMap" },
+ "heartbeatFieldsVersion": {
+ "description": "version of the heartbeatFields block",
+ "type": "string",
+ "enum": [ "3.0" ]
+ },
+ "heartbeatInterval": {
+ "description": "current heartbeat interval in seconds",
+ "type": "integer"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "heartbeatFieldsVersion", "heartbeatInterval" ]
+ },
+ "hugePages": {
+ "description": "metrics on system hugepages",
+ "type": "object",
+ "properties": {
+ "bytesFree": {
+ "description": "number of free hugepages in bytes",
+ "type": "number"
+ },
+ "bytesUsed": {
+ "description": "number of used hugepages in bytes",
+ "type": "number"
+ },
+ "hugePagesIdentifier": {
+ "description": "hugePages identifier",
+ "type": "number"
+ },
+ "percentFree": {
+ "description": "number of free hugepages in percent",
+ "type": "number"
+ },
+ "percentUsed": {
+ "description": "number of free hugepages in percent",
+ "type": "number"
+ },
+ "vmPageNumberFree": {
+ "description": "number of free vmPages in numbers",
+ "type": "number"
+ },
+ "vmPageNumberUsed": {
+ "description": "number of used vmPages in numbers",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "hugePagesIdentifier" ]
+ },
+ "internalHeaderFields": {
+ "description": "enrichment fields for internal VES Event Listener service use only, not supplied by event sources",
+ "type": "object"
+ },
+ "ipmi": {
+ "description": "intelligent platform management interface metrics",
+ "type": "object",
+ "properties": {
+ "exitAirTemperature": {
+ "description": "system fan exit air flow temperature in celsius",
+ "type": "number"
+ },
+ "frontPanelTemperature": {
+ "description": "front panel temperature in celsius",
+ "type": "number"
+ },
+ "ioModuleTemperature": {
+ "description": "io module temperature in celsius",
+ "type": "number"
+ },
+ "ipmiBaseboardTemperatureArray": {
+ "description": "array of ipmiBaseboardTemperature objects",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/ipmiBaseboardTemperature"
+ }
+ },
+ "ipmiBaseboardVoltageRegulatorArray": {
+ "description": "array of ipmiBaseboardVoltageRegulator objects",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/ipmiBaseboardVoltageRegulator"
+ }
+ },
+ "ipmiBatteryArray": {
+ "description": "array of ipmiBattery objects",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/ipmiBattery"
+ }
+ },
+ "ipmiFanArray": {
+ "description": "array of ipmiFan objects",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/ipmiFan"
+ }
+ },
+ "ipmiHsbpArray": {
+ "description": "array of ipmiHsbp objects",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/ipmiHsbp"
+ }
+ },
+ "ipmiGlobalAggregateTemperatureMarginArray": {
+ "description": "array of ipmiGlobalAggregateTemperatureMargin objects",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/ipmiGlobalAggregateTemperatureMargin"
+ }
+ },
+ "ipmiNicArray": {
+ "description": "array of ipmiNic objects",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/ipmiNic"
+ }
+ },
+ "ipmiPowerSupplyArray": {
+ "description": "array of ipmiPowerSupply objects",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/ipmiPowerSupply"
+ }
+ },
+ "ipmiProcessorArray": {
+ "description": "array of ipmiProcessor objects",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/ipmiProcessor"
+ }
+ },
+ "systemAirflow": {
+ "description": "airfflow in cubic feet per minute (cfm)",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false
+ },
+ "ipmiBaseboardTemperature": {
+ "description": "intelligent platform management interface (ipmi) baseboard temperature metrics",
+ "type": "object",
+ "properties": {
+ "baseboardTemperatureIdentifier": {
+ "description": "identifier for the location where the temperature is taken",
+ "type": "string"
+ },
+ "baseboardTemperature": {
+ "description": "baseboard temperature in celsius",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "baseboardTemperatureIdentifier" ]
+ },
+ "ipmiBaseboardVoltageRegulator": {
+ "description": "intelligent platform management interface (ipmi) baseboard voltage regulator metrics",
+ "type": "object",
+ "properties": {
+ "baseboardVoltageRegulatorIdentifier": {
+ "description": "identifier for the baseboard voltage regulator",
+ "type": "string"
+ },
+ "voltageRegulatorTemperature": {
+ "description": "voltage regulator temperature in celsius",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "baseboardVoltageRegulatorIdentifier" ]
+ },
+ "ipmiBattery": {
+ "description": "intelligent platform management interface (ipmi) battery metrics",
+ "type": "object",
+ "properties": {
+ "batteryIdentifier": {
+ "description": "identifier for the battery",
+ "type": "string"
+ },
+ "batteryType": {
+ "description": "type of battery",
+ "type": "string"
+ },
+ "batteryVoltageLevel": {
+ "description": "battery voltage level",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "batteryIdentifier" ]
+ },
+ "ipmiFan": {
+ "description": "intelligent platform management interface (ipmi) fan metrics",
+ "type": "object",
+ "properties": {
+ "fanIdentifier": {
+ "description": "identifier for the fan",
+ "type": "string"
+ },
+ "fanSpeed": {
+ "description": "fan speed in revolutions per minute (rpm)",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "fanIdentifier" ]
+ },
+ "ipmiGlobalAggregateTemperatureMargin": {
+ "description": "intelligent platform management interface (ipmi) global aggregate temperature margin",
+ "type": "object",
+ "properties": {
+ "ipmiGlobalAggregateTemperatureMarginIdentifier": {
+ "description": "identifier for the ipmi global aggregate temperature margin metrics",
+ "type": "string"
+ },
+ "globalAggregateTemperatureMargin": {
+ "description": "the difference between the current global aggregate temperature, in celsius, and the global aggregate throttling thermal trip point",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "ipmiGlobalAggregateTemperatureMarginIdentifier", "globalAggregateTemperatureMargin" ]
+ },
+ "ipmiHsbp": {
+ "description": "intelligent platform management interface (ipmi) hot swap backplane power metrics",
+ "type": "object",
+ "properties": {
+ "hsbpIdentifier": {
+ "description": "identifier for the hot swap backplane power unit",
+ "type": "string"
+ },
+ "hsbpTemperature": {
+ "description": "hot swap backplane power temperature in celsius",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "hsbpIdentifier" ]
+ },
+ "ipmiNic": {
+ "description": "intelligent platform management interface (ipmi) network interface control card (nic) metrics",
+ "type": "object",
+ "properties": {
+ "nicIdentifier": {
+ "description": "identifier for the network interface control card",
+ "type": "string"
+ },
+ "nicTemperature": {
+ "description": "nic temperature in celsius",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "nicIdentifier" ]
+ },
+ "ipmiPowerSupply": {
+ "description": "intelligent platform management interface (ipmi) power supply metrics",
+ "type": "object",
+ "properties": {
+ "powerSupplyIdentifier": {
+ "description": "identifier for the power supply",
+ "type": "string"
+ },
+ "powerSupplyInputPower": {
+ "description": "input power in watts",
+ "type": "number"
+ },
+ "powerSupplyCurrentOutputPercent": {
+ "description": "current output voltage as a percentage of the design specified level",
+ "type": "number"
+ },
+ "powerSupplyTemperature": {
+ "description": "power supply temperature in celsius",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "powerSupplyIdentifier" ]
+ },
+ "ipmiProcessor": {
+ "description": "intelligent platform management interface processor metrics",
+ "type": "object",
+ "properties": {
+ "processorIdentifier": {
+ "description": "identifier for an ipmi processor",
+ "type": "string"
+ },
+ "processorThermalControlPercent": {
+ "description": "io module temperature in celsius",
+ "type": "number"
+ },
+ "processorDtsThermalMargin": {
+ "description": "front panel temperature in celsius",
+ "type": "number"
+ },
+ "processorDimmAggregateThermalMarginArray": {
+ "description": "array of processorDimmAggregateThermalMargin objects",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/processorDimmAggregateThermalMargin"
+ }
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "processorIdentifier" ]
+ },
+ "jsonObject": {
+ "description": "json object schema, name and other meta-information along with one or more object instances",
+ "type": "object",
+ "properties": {
+ "objectInstances": {
+ "description": "one or more instances of the jsonObject",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/jsonObjectInstance"
+ }
+ },
+ "objectName": {
+ "description": "name of the JSON Object",
+ "type": "string"
+ },
+ "objectSchema": {
+ "description": "json schema for the object",
+ "type": "string"
+ },
+ "objectSchemaUrl": {
+ "description": "Url to the json schema for the object",
+ "type": "string"
+ },
+ "nfSubscribedObjectName": {
+ "description": "name of the object associated with the nfSubscriptonId",
+ "type": "string"
+ },
+ "nfSubscriptionId": {
+ "description": "identifies an openConfig telemetry subscription on a network function, which configures the network function to send complex object data associated with the jsonObject",
+ "type": "string"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "objectInstances", "objectName" ]
+ },
+ "jsonObjectInstance": {
+ "description": "meta-information about an instance of a jsonObject along with the actual object instance",
+ "type": "object",
+ "properties": {
+ "jsonObject": { "$ref": "#/definitions/jsonObject" },
+ "objectInstance": {
+ "description": "an instance conforming to the jsonObject objectSchema",
+ "type": "object"
+ },
+ "objectInstanceEpochMicrosec": {
+ "description": "the unix time aka epoch time associated with this objectInstance--as microseconds elapsed since 1 Jan 1970 not including leap seconds",
+ "type": "number"
+ },
+ "objectKeys": {
+ "description": "an ordered set of keys that identifies this particular instance of jsonObject",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/key"
+ }
+ }
+ },
+ "additionalProperties": false
+ },
+ "key": {
+ "description": "tuple which provides the name of a key along with its value and relative order",
+ "type": "object",
+ "properties": {
+ "keyName": {
+ "description": "name of the key",
+ "type": "string"
+ },
+ "keyOrder": {
+ "description": "relative sequence or order of the key with respect to other keys",
+ "type": "integer"
+ },
+ "keyValue": {
+ "description": "value of the key",
+ "type": "string"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "keyName" ]
+ },
+ "latencyBucketMeasure": {
+ "description": "number of counts falling within a defined latency bucket",
+ "type": "object",
+ "properties": {
+ "countsInTheBucket": { "type": "number" },
+ "highEndOfLatencyBucket": { "type": "number" },
+ "lowEndOfLatencyBucket": { "type": "number" }
+ },
+ "additionalProperties": false,
+ "required": [ "countsInTheBucket" ]
+ },
+ "load": {
+ "description": "/proc/loadavg cpu utilization and io utilization metrics",
+ "type": "object",
+ "properties": {
+ "longTerm": {
+ "description": "number of jobs in the run queue (state R, cpu utilization) or waiting for disk I/O (state D, io utilization) averaged over 15 minutes using /proc/loadavg",
+ "type": "number"
+ },
+ "midTerm": {
+ "description": "number of jobs in the run queue (state R, cpu utilization) or waiting for disk I/O (state D, io utilization) averaged over 5 minutes using /proc/loadavg",
+ "type": "number"
+ },
+ "shortTerm": {
+ "description": "number of jobs in the run queue (state R, cpu utilization) or waiting for disk I/O (state D, io utilization) averaged over 1 minute using /proc/loadavg",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false
+ },
+ "machineCheckException": {
+ "description": "metrics on vm machine check exceptions",
+ "type": "object",
+ "properties": {
+ "correctedMemoryErrors": {
+ "description": "total hardware errors that were corrected by the hardware (e.g. data corruption corrected via  ECC) over the measurementInterval",
+ "type": "number"
+ },
+ "correctedMemoryErrorsIn1Hr": {
+ "description": "total hardware errors that were corrected by the hardware over the last one hour",
+ "type": "number"
+ },
+ "uncorrectedMemoryErrors": {
+ "description": "total uncorrected hardware errors that were detected by the hardware (e.g., causing data corruption) over the measurementInterval",
+ "type": "number"
+ },
+ "uncorrectedMemoryErrorsIn1Hr": {
+ "description": "total uncorrected hardware errors that were detected by the hardware over the last one hour",
+ "type": "number"
+ },
+ "vmIdentifier": {
+ "description": "virtual machine identifier associated with the machine check exception",
+ "type": "string"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "vmIdentifier" ]
+ },
+ "measurementFields": {
+ "description": "measurement fields",
+ "type": "object",
+ "properties": {
+ "additionalFields": { "$ref": "#/definitions/hashMap" },
+ "additionalMeasurements": {"$ref": "#/definitions/arrayOfNamedHashMap"},
+ "additionalObjects": {"$ref": "#/definitions/arrayOfJsonObject"},
+ "codecUsageArray": {
+ "description": "array of codecs in use",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/codecsInUse"
+ }
+ },
+ "concurrentSessions": {
+ "description": "peak concurrent sessions for the VM or xNF over the measurementInterval",
+ "type": "integer"
+ },
+ "configuredEntities": {
+ "description": "over the measurementInterval, peak total number of: users, subscribers, devices, adjacencies, etc., for the VM, or subscribers, devices, etc., for the xNF",
+ "type": "integer"
+ },
+ "cpuUsageArray": {
+ "description": "usage of an array of CPUs",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/cpuUsage"
+ }
+ },
+ "diskUsageArray": {
+ "description": "usage of an array of disks",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/diskUsage"
+ }
+ },
+ "featureUsageArray": { "$ref": "#/definitions/hashMap" },
+ "filesystemUsageArray": {
+ "description": "filesystem usage of the VM on which the xNFC reporting the event is running",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/filesystemUsage"
+ }
+ },
+ "hugePagesArray": {
+ "description": "array of metrics on hugepPages",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/hugePages"
+ }
+ },
+ "ipmi": { "$ref": "#/definitions/ipmi" },
+ "latencyDistribution": {
+ "description": "array of integers representing counts of requests whose latency in milliseconds falls within per-xNF configured ranges",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/latencyBucketMeasure"
+ }
+ },
+ "loadArray": {
+ "description": "array of system load metrics",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/load"
+ }
+ },
+ "machineCheckExceptionArray": {
+ "description": "array of machine check exceptions",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/machineCheckException"
+ }
+ },
+ "meanRequestLatency": {
+ "description": "mean seconds required to respond to each request for the VM on which the xNFC reporting the event is running",
+ "type": "number"
+ },
+ "measurementInterval": {
+ "description": "interval over which measurements are being reported in seconds",
+ "type": "number"
+ },
+ "measurementFieldsVersion": {
+ "description": "version of the measurementFields block",
+ "type": "string",
+ "enum": [ "4.0" ]
+ },
+ "memoryUsageArray": {
+ "description": "memory usage of an array of VMs",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/memoryUsage"
+ }
+ },
+ "numberOfMediaPortsInUse": {
+ "description": "number of media ports in use",
+ "type": "integer"
+ },
+ "requestRate": {
+ "description": "peak rate of service requests per second to the xNF over the measurementInterval",
+ "type": "number"
+ },
+ "nfcScalingMetric": {
+ "description": "represents busy-ness of the network function from 0 to 100 as reported by the xNFC",
+ "type": "integer"
+ },
+ "nicPerformanceArray": {
+ "description": "usage of an array of network interface cards",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/nicPerformance"
+ }
+ },
+ "processStatsArray": {
+ "description": "array of metrics on system processes",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/processStats"
+ }
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "measurementInterval", "measurementFieldsVersion" ]
+ },
+ "memoryUsage": {
+ "description": "memory usage of an identified virtual machine",
+ "type": "object",
+ "properties": {
+ "memoryBuffered": {
+ "description": "kibibytes of temporary storage for raw disk blocks",
+ "type": "number"
+ },
+ "memoryCached": {
+ "description": "kibibytes of memory used for cache",
+ "type": "number"
+ },
+ "memoryConfigured": {
+ "description": "kibibytes of memory configured in the virtual machine on which the xNFC reporting the event is running",
+ "type": "number"
+ },
+ "memoryDemand": {
+ "description": "host demand in kibibytes",
+ "type": "number"
+ },
+ "memoryFree": {
+ "description": "kibibytes of physical RAM left unused by the system",
+ "type": "number"
+ },
+ "memoryLatencyAvg": {
+ "description": "Percentage of time the VM is waiting to access swapped or compressed memory",
+ "type": "number"
+ },
+ "memorySharedAvg": {
+ "description": "shared memory in kilobytes",
+ "type": "number"
+ },
+ "memorySlabRecl": {
+ "description": "the part of the slab that can be reclaimed such as caches measured in kibibytes",
+ "type": "number"
+ },
+ "memorySlabUnrecl": {
+ "description": "the part of the slab that cannot be reclaimed even when lacking memory measured in kibibytes",
+ "type": "number"
+ },
+ "memorySwapInAvg": {
+ "description": "Amount of memory swapped-in from host cache in kibibytes",
+ "type": "number"
+ },
+ "memorySwapInRateAvg": {
+ "description": "rate at which memory is swapped from disk into active memory during the interval in kilobytes per second",
+ "type": "number"
+ },
+ "memorySwapOutAvg": {
+ "description": "Amount of memory swapped-out to host cache in kibibytes",
+ "type": "number"
+ },
+ "memorySwapOutRateAvg": {
+ "description": "rate at which memory is being swapped from active memory to disk during the current interval in kilobytes per second",
+ "type": "number"
+ },
+ "memorySwapUsedAvg": {
+ "description": "space used for caching swapped pages in the host cache in kibibytes",
+ "type": "number"
+ },
+ "memoryUsed": {
+ "description": "total memory minus the sum of free, buffered, cached and slab memory measured in kibibytes",
+ "type": "number"
+ },
+ "percentMemoryUsage": {
+ "description": "Percentage of memory usage; value = (memoryUsed / (memoryUsed + memoryFree) x 100 if denomintor is nonzero, or 0, if otherwise",
+ "type": "number"
+ },
+ "vmIdentifier": {
+ "description": "virtual machine identifier associated with the memory metrics",
+ "type": "string"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "memoryFree", "memoryUsed", "vmIdentifier" ]
+ },
+ "mobileFlowFields": {
+ "description": "mobileFlow fields",
+ "type": "object",
+ "properties": {
+ "additionalFields": { "$ref": "#/definitions/hashMap" },
+ "applicationType": {
+ "description": "Application type inferred",
+ "type": "string"
+ },
+ "appProtocolType": {
+ "description": "application protocol",
+ "type": "string"
+ },
+ "appProtocolVersion": {
+ "description": "application protocol version",
+ "type": "string"
+ },
+ "cid": {
+ "description": "cell id",
+ "type": "string"
+ },
+ "connectionType": {
+ "description": "Abbreviation referencing a 3GPP reference point e.g., S1-U, S11, etc",
+ "type": "string"
+ },
+ "ecgi": {
+ "description": "Evolved Cell Global Id",
+ "type": "string"
+ },
+ "flowDirection": {
+ "description": "Flow direction, indicating if the reporting node is the source of the flow or destination for the flow",
+ "type": "string"
+ },
+ "gtpPerFlowMetrics": { "$ref": "#/definitions/gtpPerFlowMetrics" },
+ "gtpProtocolType": {
+ "description": "GTP protocol",
+ "type": "string"
+ },
+ "gtpVersion": {
+ "description": "GTP protocol version",
+ "type": "string"
+ },
+ "httpHeader": {
+ "description": "HTTP request header, if the flow connects to a node referenced by HTTP",
+ "type": "string"
+ },
+ "imei": {
+ "description": "IMEI for the subscriber UE used in this flow, if the flow connects to a mobile device",
+ "type": "string"
+ },
+ "imsi": {
+ "description": "IMSI for the subscriber UE used in this flow, if the flow connects to a mobile device",
+ "type": "string"
+ },
+ "ipProtocolType": {
+ "description": "IP protocol type e.g., TCP, UDP, RTP...",
+ "type": "string"
+ },
+ "ipVersion": {
+ "description": "IP protocol version e.g., IPv4, IPv6",
+ "type": "string"
+ },
+ "lac": {
+ "description": "location area code",
+ "type": "string"
+ },
+ "mcc": {
+ "description": "mobile country code",
+ "type": "string"
+ },
+ "mnc": {
+ "description": "mobile network code",
+ "type": "string"
+ },
+ "mobileFlowFieldsVersion": {
+ "description": "version of the mobileFlowFields block",
+ "type": "string",
+ "enum": [ "4.0" ]
+ },
+ "msisdn": {
+ "description": "MSISDN for the subscriber UE used in this flow, as an integer, if the flow connects to a mobile device",
+ "type": "string"
+ },
+ "otherEndpointIpAddress": {
+ "description": "IP address for the other endpoint, as used for the flow being reported on",
+ "type": "string"
+ },
+ "otherEndpointPort": {
+ "description": "IP Port for the reporting entity, as used for the flow being reported on",
+ "type": "integer"
+ },
+ "otherFunctionalRole": {
+ "description": "Functional role of the other endpoint for the flow being reported on e.g., MME, S-GW, P-GW, PCRF...",
+ "type": "string"
+ },
+ "rac": {
+ "description": "routing area code",
+ "type": "string"
+ },
+ "radioAccessTechnology": {
+ "description": "Radio Access Technology e.g., 2G, 3G, LTE",
+ "type": "string"
+ },
+ "reportingEndpointIpAddr": {
+ "description": "IP address for the reporting entity, as used for the flow being reported on",
+ "type": "string"
+ },
+ "reportingEndpointPort": {
+ "description": "IP port for the reporting entity, as used for the flow being reported on",
+ "type": "integer"
+ },
+ "sac": {
+ "description": "service area code",
+ "type": "string"
+ },
+ "samplingAlgorithm": {
+ "description": "Integer identifier for the sampling algorithm or rule being applied in calculating the flow metrics if metrics are calculated based on a sample of packets, or 0 if no sampling is applied",
+ "type": "integer"
+ },
+ "tac": {
+ "description": "transport area code",
+ "type": "string"
+ },
+ "tunnelId": {
+ "description": "tunnel identifier",
+ "type": "string"
+ },
+ "vlanId": {
+ "description": "VLAN identifier used by this flow",
+ "type": "string"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "flowDirection", "gtpPerFlowMetrics", "ipProtocolType", "ipVersion",
+ "mobileFlowFieldsVersion", "otherEndpointIpAddress", "otherEndpointPort",
+ "reportingEndpointIpAddr", "reportingEndpointPort" ]
+ },
+ "namedHashMap": {
+ "description": "a hashMap which is associated with and described by a name",
+ "type": "object",
+ "properties": {
+ "name": { "type": "string" },
+ "hashMap": { "$ref": "#/definitions/hashMap" }
+ },
+ "additionalProperties": false,
+ "required": [ "name", "hashMap" ]
+ },
+ "nicPerformance": {
+ "description": "describes the performance and errors of an identified network interface card",
+ "type": "object",
+ "properties": {
+ "administrativeState": {
+ "description": "administrative state",
+ "type": "string",
+ "enum": [ "inService", "outOfService" ]
+ },
+ "nicIdentifier": {
+ "description": "nic identification",
+ "type": "string"
+ },
+ "operationalState": {
+ "description": "operational state",
+ "type": "string",
+ "enum": [ "inService", "outOfService" ]
+ },
+ "receivedBroadcastPacketsAccumulated": {
+ "description": "Cumulative count of broadcast packets received as read at the end of the measurement interval",
+ "type": "number"
+ },
+ "receivedBroadcastPacketsDelta": {
+ "description": "Count of broadcast packets received within the measurement interval",
+ "type": "number"
+ },
+ "receivedDiscardedPacketsAccumulated": {
+ "description": "Cumulative count of discarded packets received as read at the end of the measurement interval",
+ "type": "number"
+ },
+ "receivedDiscardedPacketsDelta": {
+ "description": "Count of discarded packets received within the measurement interval",
+ "type": "number"
+ },
+ "receivedErrorPacketsAccumulated": {
+ "description": "Cumulative count of error packets received as read at the end of the measurement interval",
+ "type": "number"
+ },
+ "receivedErrorPacketsDelta": {
+ "description": "Count of error packets received within the measurement interval",
+ "type": "number"
+ },
+ "receivedMulticastPacketsAccumulated": {
+ "description": "Cumulative count of multicast packets received as read at the end of the measurement interval",
+ "type": "number"
+ },
+ "receivedMulticastPacketsDelta": {
+ "description": "Count of multicast packets received within the measurement interval",
+ "type": "number"
+ },
+ "receivedOctetsAccumulated": {
+ "description": "Cumulative count of octets received as read at the end of the measurement interval",
+ "type": "number"
+ },
+ "receivedOctetsDelta": {
+ "description": "Count of octets received within the measurement interval",
+ "type": "number"
+ },
+ "receivedTotalPacketsAccumulated": {
+ "description": "Cumulative count of all packets received as read at the end of the measurement interval",
+ "type": "number"
+ },
+ "receivedPercentDiscard": {
+ "description": "Percentage of discarded packets received; value = (receivedDiscardedPacketsDelta / receivedTotalPacketsDelta) x 100, if denominator is nonzero, or 0, if otherwise",
+ "type": "number"
+ },
+ "receivedPercentError": {
+ "description": "Percentage of error packets received; value = (receivedErrorPacketsDelta / receivedTotalPacketsDelta) x 100, if denominator is nonzero, or 0, if otherwise.",
+ "type": "number"
+ },
+ "receivedTotalPacketsDelta": {
+ "description": "Count of all packets received within the measurement interval",
+ "type": "number"
+ },
+ "receivedUnicastPacketsAccumulated": {
+ "description": "Cumulative count of unicast packets received as read at the end of the measurement interval",
+ "type": "number"
+ },
+ "receivedUnicastPacketsDelta": {
+ "description": "Count of unicast packets received within the measurement interval",
+ "type": "number"
+ },
+ "receivedUtilization": {
+ "description": "Percentage of utilization received; value = (receivedOctetsDelta / (speed x (lastEpochMicrosec - startEpochMicrosec))) x 100, if denominator is nonzero, or 0, if otherwise",
+ "type": "number"
+ },
+ "speed": {
+ "description": "Speed configured in mbps",
+ "type": "number"
+ },
+ "transmittedBroadcastPacketsAccumulated": {
+ "description": "Cumulative count of broadcast packets transmitted as read at the end of the measurement interval",
+ "type": "number"
+ },
+ "transmittedBroadcastPacketsDelta": {
+ "description": "Count of broadcast packets transmitted within the measurement interval",
+ "type": "number"
+ },
+ "transmittedDiscardedPacketsAccumulated": {
+ "description": "Cumulative count of discarded packets transmitted as read at the end of the measurement interval",
+ "type": "number"
+ },
+ "transmittedDiscardedPacketsDelta": {
+ "description": "Count of discarded packets transmitted within the measurement interval",
+ "type": "number"
+ },
+ "transmittedErrorPacketsAccumulated": {
+ "description": "Cumulative count of error packets transmitted as read at the end of the measurement interval",
+ "type": "number"
+ },
+ "transmittedErrorPacketsDelta": {
+ "description": "Count of error packets transmitted within the measurement interval",
+ "type": "number"
+ },
+ "transmittedMulticastPacketsAccumulated": {
+ "description": "Cumulative count of multicast packets transmitted as read at the end of the measurement interval",
+ "type": "number"
+ },
+ "transmittedMulticastPacketsDelta": {
+ "description": "Count of multicast packets transmitted within the measurement interval",
+ "type": "number"
+ },
+ "transmittedOctetsAccumulated": {
+ "description": "Cumulative count of octets transmitted as read at the end of the measurement interval",
+ "type": "number"
+ },
+ "transmittedOctetsDelta": {
+ "description": "Count of octets transmitted within the measurement interval",
+ "type": "number"
+ },
+ "transmittedTotalPacketsAccumulated": {
+ "description": "Cumulative count of all packets transmitted as read at the end of the measurement interval",
+ "type": "number"
+ },
+ "transmittedTotalPacketsDelta": {
+ "description": "Count of all packets transmitted within the measurement interval",
+ "type": "number"
+ },
+ "transmittedUnicastPacketsAccumulated": {
+ "description": "Cumulative count of unicast packets transmitted as read at the end of the measurement interval",
+ "type": "number"
+ },
+ "transmittedUnicastPacketsDelta": {
+ "description": "Count of unicast packets transmitted within the measurement interval",
+ "type": "number"
+ },
+ "transmittedPercentDiscard": {
+ "description": "Percentage of discarded packets transmitted; value = (transmittedDiscardedPacketsDelta / transmittedTotalPacketsDelta) x 100, if denominator is nonzero, or 0, if otherwise",
+ "type": "number"
+ },
+ "transmittedPercentError": {
+ "description": "Percentage of error packets received; value = (transmittedErrorPacketsDelta / transmittedTotalPacketsDelta) x 100, if denominator is nonzero, or 0, if otherwise",
+ "type": "number"
+ },
+ "transmittedUtilization": {
+ "description": "Percentage of utilization transmitted; value = (transmittedOctetsDelta / (speed x (lastEpochMicrosec - startEpochMicrosec))) x 100, if denominator is nonzero, or 0, if otherwise.",
+ "type": "number"
+ },
+ "valuesAreSuspect": {
+ "description": "Indicates whether vNicPerformance values are likely inaccurate due to counter overflow or other condtions",
+ "type": "string",
+ "enum": [ "true", "false" ]
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "nicIdentifier", "valuesAreSuspect" ]
+ },
+ "notificationFields": {
+ "description": "notification fields",
+ "type": "object",
+ "properties": {
+ "additionalFields": { "$ref": "#/definitions/hashMap" },
+ "arrayOfNamedHashMap": {"$ref": "#/definitions/arrayOfNamedHashMap"},
+ "changeContact": {
+ "description": "identifier for a contact related to the change",
+ "type": "string"
+ },
+ "changeIdentifier": {
+ "description": "system or session identifier associated with the change",
+ "type": "string"
+ },
+ "changeType": {
+ "description": "describes what has changed for the entity",
+ "type": "string"
+ },
+ "newState": {
+ "description": "new state of the entity",
+ "type": "string"
+ },
+ "oldState": {
+ "description": "previous state of the entity",
+ "type": "string"
+ },
+ "notificationFieldsVersion": {
+ "description": "version of the notificationFields block",
+ "type": "string",
+ "enum": [ "2.0" ]
+ },
+ "stateInterface": {
+ "description": "card or port name of the entity that changed state",
+ "type": "string"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "changeIdentifier", "changeType", "notificationFieldsVersion" ]
+ },
+ "otherFields": {
+ "description": "fields for events belonging to the 'other' domain of the commonEventHeader domain enumeration",
+ "type": "object",
+ "properties": {
+ "arrayOfNamedHashMap": {"$ref": "#/definitions/arrayOfNamedHashMap"},
+ "hashMap": {"$ref": "#/definitions/hashMap"},
+ "jsonObjects": {"$ref": "#/definitions/arrayOfJsonObject"},
+ "otherFieldsVersion": {
+ "description": "version of the otherFields block",
+ "type": "string",
+ "enum": [ "3.0" ]
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "otherFieldsVersion" ]
+ },
+ "pnfRegistrationFields": {
+ "description": "hardware device registration fields",
+ "type": "object",
+ "properties": {
+ "additionalFields": { "$ref": "#/definitions/hashMap" },
+ "lastServiceDate": {
+ "description": "TS 32.692 dateOfLastService = date of last service; e.g. 15022017",
+ "type": "string"
+ },
+ "macAddress": {
+ "description": "MAC address of OAM interface of the unit",
+ "type": "string"
+ },
+ "manufactureDate": {
+ "description": "TS 32.692 dateOfManufacture = manufacture date of the unit; 24032016",
+ "type": "string"
+ },
+ "modelNumber": {
+ "description": "TS 32.692 versionNumber = version of the unit from vendor; e.g. AJ02. Maps to AAI equip-model",
+ "type": "string"
+ },
+ "oamV4IpAddress": {
+ "description": "IPv4 m-plane IP address to be used by the manager to contact the PNF",
+ "type": "string"
+ },
+ "oamV6IpAddress": {
+ "description": "IPv6 m-plane IP address to be used by the manager to contact the PNF",
+ "type": "string"
+ },
+ "pnfRegistrationFieldsVersion": {
+ "description": "version of the pnfRegistrationFields block",
+ "type": "string",
+ "enum": [ "2.0" ]
+ },
+ "serialNumber": {
+ "description": "TS 32.692 serialNumber = serial number of the unit; e.g. 6061ZW3",
+ "type": "string"
+ },
+ "softwareVersion": {
+ "description": "TS 32.692 swName = active SW running on the unit; e.g. 5gDUv18.05.201",
+ "type": "string"
+ },
+ "unitFamily": {
+ "description": "TS 32.692 vendorUnitFamilyType = general type of HW unit; e.g. BBU",
+ "type": "string"
+ },
+ "unitType": {
+ "description": "TS 32.692 vendorUnitTypeNumber = vendor name for the unit; e.g. Airscale",
+ "type": "string"
+ },
+ "vendorName": {
+ "description": "TS 32.692 vendorName = name of manufacturer; e.g. Nokia. Maps to AAI equip-vendor",
+ "type": "string"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "pnfRegistrationFieldsVersion" ]
+ },
+ "processorDimmAggregateThermalMargin": {
+ "description": "intelligent platform management interface (ipmi) processor dual inline memory module aggregate thermal margin metrics",
+ "type": "object",
+ "properties": {
+ "processorDimmAggregateThermalMarginIdentifier": {
+ "description": "identifier for the aggregate thermal margin metrics from the processor dual inline memory module",
+ "type": "string"
+ },
+ "thermalMargin": {
+ "description": "the difference between the DIMM's current temperature, in celsius, and the DIMM's throttling thermal trip point",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "processorDimmAggregateThermalMarginIdentifier", "thermalMargin" ]
+ },
+ "processStats": {
+ "description": "metrics on system processes",
+ "type": "object",
+ "properties": {
+ "forkRate": {
+ "description": "the number of threads created since the last reboot",
+ "type": "number"
+ },
+ "processIdentifier": {
+ "description": "processIdentifier",
+ "type": "string"
+ },
+ "psStateBlocked": {
+ "description": "the number of processes in a blocked state",
+ "type": "number"
+ },
+ "psStatePaging": {
+ "description": "the number of processes in a paging state",
+ "type": "number"
+ },
+ "psStateRunning": {
+ "description": "the number of processes in a running state",
+ "type": "number"
+ },
+ "psStateSleeping": {
+ "description": "the number of processes in a sleeping state",
+ "type": "number"
+ },
+ "psStateStopped": {
+ "description": "the number of processes in a stopped state",
+ "type": "number"
+ },
+ "psStateZombie": {
+ "description": "the number of processes in a zombie state",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "processIdentifier" ]
+ },
+ "requestError": {
+ "description": "standard request error data structure",
+ "type": "object",
+ "properties": {
+ "messageId": {
+ "description": "Unique message identifier of the format ABCnnnn where ABC is either SVC for Service Exceptions or POL for Policy Exception",
+ "type": "string"
+ },
+ "text": {
+ "description": "Message text, with replacement variables marked with %n, where n is an index into the list of <variables> elements, starting at 1",
+ "type": "string"
+ },
+ "url": {
+ "description": "Hyperlink to a detailed error resource e.g., an HTML page for browser user agents",
+ "type": "string"
+ },
+ "variables": {
+ "description": "List of zero or more strings that represent the contents of the variables used by the message text",
+ "type": "string"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "messageId", "text" ]
+ },
+ "sipSignalingFields": {
+ "description": "sip signaling fields",
+ "type": "object",
+ "properties": {
+ "additionalInformation": { "$ref": "#/definitions/hashMap"},
+ "compressedSip": {
+ "description": "the full SIP request/response including headers and bodies",
+ "type": "string"
+ },
+ "correlator": {
+ "description": "this is the same for all events on this call",
+ "type": "string"
+ },
+ "localIpAddress": {
+ "description": "IP address on xNF",
+ "type": "string"
+ },
+ "localPort": {
+ "description": "port on xNF",
+ "type": "string"
+ },
+ "remoteIpAddress": {
+ "description": "IP address of peer endpoint",
+ "type": "string"
+ },
+ "remotePort": {
+ "description": "port of peer endpoint",
+ "type": "string"
+ },
+ "sipSignalingFieldsVersion": {
+ "description": "version of the sipSignalingFields block",
+ "type": "string",
+ "enum": [ "3.0" ]
+ },
+ "summarySip": {
+ "description": "the SIP Method or Response ('INVITE', '200 OK', 'BYE', etc)",
+ "type": "string"
+ },
+ "vendorNfNameFields": {
+ "$ref": "#/definitions/vendorNfNameFields"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "correlator", "localIpAddress", "localPort", "remoteIpAddress",
+ "remotePort", "sipSignalingFieldsVersion", "vendorNfNameFields" ]
+ },
+ "stateChangeFields": {
+ "description": "stateChange fields",
+ "type": "object",
+ "properties": {
+ "additionalFields": { "$ref": "#/definitions/hashMap" },
+ "newState": {
+ "description": "new state of the entity",
+ "type": "string",
+ "enum": [
+ "inService",
+ "maintenance",
+ "outOfService"
+ ]
+ },
+ "oldState": {
+ "description": "previous state of the entity",
+ "type": "string",
+ "enum": [
+ "inService",
+ "maintenance",
+ "outOfService"
+ ]
+ },
+ "stateChangeFieldsVersion": {
+ "description": "version of the stateChangeFields block",
+ "type": "string",
+ "enum": [ "4.0" ]
+ },
+ "stateInterface": {
+ "description": "card or port name of the entity that changed state",
+ "type": "string"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "newState", "oldState", "stateChangeFieldsVersion", "stateInterface" ]
+ },
+ "syslogFields": {
+ "description": "sysLog fields",
+ "type": "object",
+ "properties": {
+ "additionalFields": { "$ref": "#/definitions/hashMap" },
+ "eventSourceHost": {
+ "description": "hostname of the device",
+ "type": "string"
+ },
+ "eventSourceType": {
+ "description": "type of event source; examples: other, router, switch, host, card, port, slotThreshold, portThreshold, virtualMachine, virtualNetworkFunction",
+ "type": "string"
+ },
+ "syslogFacility": {
+ "description": "numeric code from 0 to 23 for facility--see table in documentation",
+ "type": "integer"
+ },
+ "syslogFieldsVersion": {
+ "description": "version of the syslogFields block",
+ "type": "string",
+ "enum": [ "4.0" ]
+ },
+ "syslogMsg": {
+ "description": "syslog message",
+ "type": "string"
+ },
+ "syslogMsgHost": {
+ "description": "hostname parsed from non-VES syslog message",
+ "type": "string"
+ },
+ "syslogPri": {
+ "description": "0-192 combined severity and facility",
+ "type": "integer"
+ },
+ "syslogProc": {
+ "description": "identifies the application that originated the message",
+ "type": "string"
+ },
+ "syslogProcId": {
+ "description": "a change in the value of this field indicates a discontinuity in syslog reporting",
+ "type": "number"
+ },
+ "syslogSData": {
+ "description": "syslog structured data consisting of a structured data Id followed by a set of key value pairs",
+ "type": "string"
+ },
+ "syslogSdId": {
+ "description": "0-32 char in format name@number for example ourSDID@32473",
+ "type": "string"
+ },
+ "syslogSev": {
+ "description": "numerical Code for severity derived from syslogPri as remaider of syslogPri / 8",
+ "type": "string",
+ "enum": [
+ "Alert",
+ "Critical",
+ "Debug",
+ "Emergency",
+ "Error",
+ "Info",
+ "Notice",
+ "Warning"
+ ]
+ },
+ "syslogTag": {
+ "description": "msgId indicating the type of message such as TCPOUT or TCPIN; NILVALUE should be used when no other value can be provided",
+ "type": "string"
+ },
+ "syslogTs": {
+ "description": "timestamp parsed from non-VES syslog message",
+ "type": "string"
+ },
+ "syslogVer": {
+ "description": "IANA assigned version of the syslog protocol specification - typically 1",
+ "type": "number"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "eventSourceType", "syslogFieldsVersion", "syslogMsg", "syslogTag" ]
+ },
+ "thresholdCrossingAlertFields": {
+ "description": "fields specific to threshold crossing alert events",
+ "type": "object",
+ "properties": {
+ "additionalFields": { "$ref": "#/definitions/hashMap"},
+ "additionalParameters": {
+ "description": "performance counters",
+ "type": "array",
+ "items": {
+ "$ref": "#/definitions/counter"
+ }
+ },
+ "alertAction": {
+ "description": "Event action",
+ "type": "string",
+ "enum": [
+ "CLEAR",
+ "CONT",
+ "SET"
+ ]
+ },
+ "alertDescription": {
+ "description": "Unique short alert description such as IF-SHUB-ERRDROP",
+ "type": "string"
+ },
+ "alertType": {
+ "description": "Event type",
+ "type": "string",
+ "enum": [
+ "CARD-ANOMALY",
+ "ELEMENT-ANOMALY",
+ "INTERFACE-ANOMALY",
+ "SERVICE-ANOMALY"
+ ]
+ },
+ "alertValue": {
+ "description": "Calculated API value (if applicable)",
+ "type": "string"
+ },
+ "associatedAlertIdList": {
+ "description": "List of eventIds associated with the event being reported",
+ "type": "array",
+ "items": { "type": "string" }
+ },
+ "collectionTimestamp": {
+ "description": "Time when the performance collector picked up the data; with RFC 2822 compliant format: Sat, 13 Mar 2010 11:29:05 -0800",
+ "type": "string"
+ },
+ "dataCollector": {
+ "description": "Specific performance collector instance used",
+ "type": "string"
+ },
+ "elementType": {
+ "description": "type of network element - internal ATT field",
+ "type": "string"
+ },
+ "eventSeverity": {
+ "description": "event severity or priority",
+ "type": "string",
+ "enum": [
+ "CRITICAL",
+ "MAJOR",
+ "MINOR",
+ "WARNING",
+ "NORMAL"
+ ]
+ },
+ "eventStartTimestamp": {
+ "description": "Time closest to when the measurement was made; with RFC 2822 compliant format: Sat, 13 Mar 2010 11:29:05 -0800",
+ "type": "string"
+ },
+ "interfaceName": {
+ "description": "Physical or logical port or card (if applicable)",
+ "type": "string"
+ },
+ "networkService": {
+ "description": "network name - internal ATT field",
+ "type": "string"
+ },
+ "possibleRootCause": {
+ "description": "Reserved for future use",
+ "type": "string"
+ },
+ "thresholdCrossingFieldsVersion": {
+ "description": "version of the thresholdCrossingAlertFields block",
+ "type": "string",
+ "enum": [ "4.0" ]
+ }
+ },
+ "additionalProperties": false,
+ "required": [
+ "additionalParameters",
+ "alertAction",
+ "alertDescription",
+ "alertType",
+ "collectionTimestamp",
+ "eventSeverity",
+ "eventStartTimestamp",
+ "thresholdCrossingFieldsVersion"
+ ]
+ },
+ "vendorNfNameFields": {
+ "description": "provides vendor, nf and nfModule identifying information",
+ "type": "object",
+ "properties": {
+ "vendorName": {
+ "description": "network function vendor name",
+ "type": "string"
+ },
+ "nfModuleName": {
+ "description": "name of the nfModule generating the event",
+ "type": "string"
+ },
+ "nfName": {
+ "description": "name of the network function generating the event",
+ "type": "string"
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "vendorName" ]
+ },
+ "voiceQualityFields": {
+ "description": "provides statistics related to customer facing voice products",
+ "type": "object",
+ "properties": {
+ "additionalInformation": { "$ref": "#/definitions/hashMap"},
+ "calleeSideCodec": {
+ "description": "callee codec for the call",
+ "type": "string"
+ },
+ "callerSideCodec": {
+ "description": "caller codec for the call",
+ "type": "string"
+ },
+ "correlator": {
+ "description": "this is the same for all events on this call",
+ "type": "string"
+ },
+ "endOfCallVqmSummaries": {
+ "$ref": "#/definitions/endOfCallVqmSummaries"
+ },
+ "phoneNumber": {
+ "description": "phone number associated with the correlator",
+ "type": "string"
+ },
+ "midCallRtcp": {
+ "description": "Base64 encoding of the binary RTCP data excluding Eth/IP/UDP headers",
+ "type": "string"
+ },
+ "vendorNfNameFields": {
+ "$ref": "#/definitions/vendorNfNameFields"
+ },
+ "voiceQualityFieldsVersion": {
+ "description": "version of the voiceQualityFields block",
+ "type": "string",
+ "enum": [ "4.0" ]
+ }
+ },
+ "additionalProperties": false,
+ "required": [ "calleeSideCodec", "callerSideCodec", "correlator", "midCallRtcp",
+ "vendorNfNameFields", "voiceQualityFieldsVersion" ]
+ }
+ }
+} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/netconf/pnf-simulator.data.xml b/test/mocks/pnfsimulator/netconf/pnf-simulator.data.xml
index 83f80c451..9d648bba7 100644
--- a/test/mocks/pnfsimulator/netconf/pnf-simulator.data.xml
+++ b/test/mocks/pnfsimulator/netconf/pnf-simulator.data.xml
@@ -1,4 +1,4 @@
<config xmlns="http://nokia.com/pnf-simulator">
- <testDuration>10</testDuration>
- <messageInterval>1</messageInterval>
+ <itemValue1>42</itemValue1>
+ <itemValue2>35</itemValue2>
</config>
diff --git a/test/mocks/pnfsimulator/netconf/pnf-simulator.yang b/test/mocks/pnfsimulator/netconf/pnf-simulator.yang
index dda65545a..d7fc2f26e 100644
--- a/test/mocks/pnfsimulator/netconf/pnf-simulator.yang
+++ b/test/mocks/pnfsimulator/netconf/pnf-simulator.yang
@@ -3,7 +3,7 @@ module pnf-simulator {
prefix config;
container config {
config true;
- leaf testDuration {type uint32;}
- leaf messageInterval {type uint32;}
+ leaf itemValue1 {type uint32;}
+ leaf itemValue2 {type uint32;}
}
}
diff --git a/test/mocks/pnfsimulator/pom.xml b/test/mocks/pnfsimulator/pom.xml
index 0af1f6f6d..563ee271f 100644
--- a/test/mocks/pnfsimulator/pom.xml
+++ b/test/mocks/pnfsimulator/pom.xml
@@ -1,197 +1,323 @@
<?xml version="1.0" encoding="UTF-8"?>
-<project xmlns="http://maven.apache.org/POM/4.0.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
- xsi:schemaLocation="http://maven.apache.org/POM/4.0.0 http://maven.apache.org/xsd/maven-4.0.0.xsd">
- <modelVersion>4.0.0</modelVersion>
+<project xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xmlns="http://maven.apache.org/POM/4.0.0"
+ xsi:schemaLocation="http://maven.apache.org/POM/4.0.0 http://maven.apache.org/xsd/maven-4.0.0.xsd">
+ <modelVersion>4.0.0</modelVersion>
- <groupId>org.onap.pnfsimulator</groupId>
- <artifactId>pnf-simulator</artifactId>
- <version>2.0.0-SNAPSHOT</version>
- <name>pnf-simulator</name>
+ <parent>
+ <groupId>org.onap.oparent</groupId>
+ <artifactId>oparent</artifactId>
+ <version>1.1.0</version>
+ </parent>
- <properties>
- <project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
- <maven.compiler.source>1.8</maven.compiler.source>
- <maven.compiler.target>1.8</maven.compiler.target>
- <simulator.main.class>org.onap.pnfsimulator.Main</simulator.main.class>
- <docker.image.tag>latest</docker.image.tag>
- <dependency.directory.name>libs</dependency.directory.name>
- <dependency.directory.location>
- ${project.build.directory}/${dependency.directory.name}
- </dependency.directory.location>
- <onap.nexus.dockerregistry.daily>nexus3.onap.org:10003</onap.nexus.dockerregistry.daily>
- </properties>
+ <groupId>org.onap.pnfsimulator</groupId>
+ <artifactId>pnf-simulator</artifactId>
+ <version>2.0.0-SNAPSHOT</version>
- <dependencies>
- <dependency>
- <groupId>org.springframework.boot</groupId>
- <artifactId>spring-boot-starter</artifactId>
- <version>2.0.2.RELEASE</version>
- <exclusions>
- <exclusion>
- <groupId>org.springframework.boot</groupId>
- <artifactId>spring-boot-starter-logging</artifactId>
- </exclusion>
- </exclusions>
- </dependency>
- <dependency>
- <groupId>org.springframework.boot</groupId>
- <artifactId>spring-boot-starter-web</artifactId>
- <version>2.0.2.RELEASE</version>
- </dependency>
- <dependency>
- <groupId>org.springframework.boot</groupId>
- <artifactId>spring-boot-starter-log4j2</artifactId>
- <version>2.0.2.RELEASE</version>
- </dependency>
- <dependency>
- <groupId>org.apache.logging.log4j</groupId>
- <artifactId>log4j-api</artifactId>
- <version>2.11.0</version>
- </dependency>
- <dependency>
- <groupId>org.apache.logging.log4j</groupId>
- <artifactId>log4j-core</artifactId>
- <version>2.11.0</version>
- </dependency>
- <dependency>
- <groupId>org.apache.logging.log4j</groupId>
- <artifactId>log4j-slf4j-impl</artifactId>
- <version>2.11.0</version>
- </dependency>
- <dependency>
- <groupId>org.apache.logging.log4j</groupId>
- <artifactId>log4j-jul</artifactId>
- <version>2.11.0</version>
- <scope>runtime</scope>
- </dependency>
- <dependency>
- <groupId>commons-io</groupId>
- <artifactId>commons-io</artifactId>
- <version>2.6</version>
- </dependency>
- <dependency>
- <groupId>org.json</groupId>
- <artifactId>json</artifactId>
- <version>20180130</version>
- </dependency>
- <dependency>
- <groupId>org.apache.httpcomponents</groupId>
- <artifactId>httpclient</artifactId>
- <version>4.5.5</version>
- </dependency>
- <dependency>
- <groupId>com.google.guava</groupId>
- <artifactId>guava</artifactId>
- <version>21.0</version>
- </dependency>
- <dependency>
- <groupId>commons-cli</groupId>
- <artifactId>commons-cli</artifactId>
- <version>1.4</version>
- </dependency>
- <dependency>
- <groupId>org.junit.jupiter</groupId>
- <artifactId>junit-jupiter-engine</artifactId>
- <version>5.1.1</version>
- <scope>test</scope>
- </dependency>
- <dependency>
- <groupId>org.assertj</groupId>
- <artifactId>assertj-core</artifactId>
- <version>3.9.1</version>
- <scope>test</scope>
- </dependency>
- <dependency>
- <groupId>org.apache.commons</groupId>
- <artifactId>commons-lang3</artifactId>
- <version>3.7</version>
- </dependency>
- <dependency>
- <groupId>org.onosproject</groupId>
- <artifactId>jnc</artifactId>
- <version>1.0</version>
- </dependency>
- </dependencies>
+ <name>pnf-simulator</name>
- <build>
- <plugins>
- <plugin>
- <groupId>org.apache.maven.plugins</groupId>
- <artifactId>maven-compiler-plugin</artifactId>
- <configuration>
- <source>${maven.compiler.source}</source>
- <target>${maven.compiler.target}</target>
- <showWarnings>true</showWarnings>
- <showDeprecation>true</showDeprecation>
- </configuration>
- </plugin>
- <plugin>
- <artifactId>maven-surefire-plugin</artifactId>
- <version>2.19</version>
- <dependencies>
- <dependency>
- <groupId>org.junit.platform</groupId>
- <artifactId>junit-platform-surefire-provider</artifactId>
- <version>1.1.1</version>
- </dependency>
- </dependencies>
- <configuration>
- <detail>true</detail>
- <printSummary>true</printSummary>
- </configuration>
- </plugin>
- <plugin>
- <groupId>org.apache.maven.plugins</groupId>
- <artifactId>maven-dependency-plugin</artifactId>
- <configuration>
- <outputDirectory>${dependency.directory.location}</outputDirectory>
- <includeScope>runtime</includeScope>
- <silent>true</silent>
- </configuration>
- <executions>
- <execution>
- <id>copy-external-dependencies</id>
- <phase>package</phase>
- <goals>
- <goal>copy-dependencies</goal>
- </goals>
- </execution>
- </executions>
- </plugin>
- <plugin>
- <groupId>com.spotify</groupId>
- <artifactId>docker-maven-plugin</artifactId>
- <version>1.0.0</version>
- <configuration>
- <imageName>${onap.nexus.dockerregistry.daily}/onap/${project.artifactId}</imageName>
- <imageTags>latest</imageTags>
- <imageTags>${project.version}-latest</imageTags>
- <serverId>${onap.nexus.dockerregistry.daily}</serverId>
- <baseImage>openjdk:8-jdk-alpine</baseImage>
- <cmd>java -cp ${dependency.directory.name}/*:${project.build.finalName}.jar ${simulator.main.class}</cmd>
- <resources>
- <resource>
- <targetPath>${dependency.directory.name}</targetPath>
- <directory>${dependency.directory.location}</directory>
- </resource>
- <resource>
- <targetPath>/</targetPath>
- <directory>${project.build.directory}</directory>
- <include>${project.build.finalName}.jar</include>
- </resource>
- </resources>
- </configuration>
- <executions>
- <execution>
- <id>build-image</id>
- <phase>package</phase>
- <goals>
- <goal>build</goal>
- </goals>
- </execution>
- </executions>
- </plugin>
- </plugins>
- </build>
-</project>
+ <properties>
+ <project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
+ <maven.compiler.source>1.8</maven.compiler.source>
+ <maven.compiler.target>1.8</maven.compiler.target>
+ <maven.build.timestamp.format>yyyyMMdd'T'HHmmss</maven.build.timestamp.format>
+
+ <simulator.main.class>org.onap.pnfsimulator.Main</simulator.main.class>
+ <docker.image.tag>latest</docker.image.tag>
+ <junit.jupiter.version>5.1.0</junit.jupiter.version>
+ <junit.vintage.version>5.1.0</junit.vintage.version>
+ <docker.image.name>onap/${project.artifactId}</docker.image.name>
+
+ <dependency.directory.name>libs</dependency.directory.name>
+ <dependency.directory.location>${project.build.directory}/${dependency.directory.name}
+ </dependency.directory.location>
+
+ <onap.nexus.dockerregistry.daily>nexus3.onap.org:10003</onap.nexus.dockerregistry.daily>
+ </properties>
+
+ <dependencies>
+ <dependency>
+ <groupId>org.springframework.boot</groupId>
+ <artifactId>spring-boot-starter</artifactId>
+ <version>2.0.2.RELEASE</version>
+ <exclusions>
+ <exclusion>
+ <groupId>org.springframework.boot</groupId>
+ <artifactId>spring-boot-starter-logging</artifactId>
+ </exclusion>
+ </exclusions>
+ </dependency>
+ <dependency>
+ <groupId>org.springframework.boot</groupId>
+ <artifactId>spring-boot-starter-web</artifactId>
+ <version>2.0.2.RELEASE</version>
+ </dependency>
+ <dependency>
+ <groupId>ch.qos.logback</groupId>
+ <artifactId>logback-classic</artifactId>
+ <version>1.2.3</version>
+ </dependency>
+ <dependency>
+ <groupId>ch.qos.logback</groupId>
+ <artifactId>logback-core</artifactId>
+ <version>1.2.3</version>
+ </dependency>
+ <dependency>
+ <groupId>org.slf4j</groupId>
+ <artifactId>slf4j-api</artifactId>
+ <version>1.7.25</version>
+ </dependency>
+ <dependency>
+ <groupId>commons-io</groupId>
+ <artifactId>commons-io</artifactId>
+ <version>2.6</version>
+ </dependency>
+ <dependency>
+ <groupId>org.json</groupId>
+ <artifactId>json</artifactId>
+ <version>20180130</version>
+ </dependency>
+ <dependency>
+ <groupId>org.everit.json</groupId>
+ <artifactId>org.everit.json.schema</artifactId>
+ <version>1.3.0</version>
+ </dependency>
+ <dependency>
+ <groupId>com.github.fge</groupId>
+ <artifactId>json-schema-validator</artifactId>
+ <version>2.2.6</version>
+ </dependency>
+ <dependency>
+ <groupId>com.google.code.gson</groupId>
+ <artifactId>gson</artifactId>
+ <version>2.8.2</version>
+ </dependency>
+ <dependency>
+ <groupId>org.apache.httpcomponents</groupId>
+ <artifactId>httpclient</artifactId>
+ <version>4.5.5</version>
+ </dependency>
+ <dependency>
+ <groupId>com.google.guava</groupId>
+ <artifactId>guava</artifactId>
+ <version>21.0</version>
+ </dependency>
+ <dependency>
+ <groupId>commons-cli</groupId>
+ <artifactId>commons-cli</artifactId>
+ <version>1.4</version>
+ </dependency>
+ <dependency>
+ <groupId>org.apache.commons</groupId>
+ <artifactId>commons-lang3</artifactId>
+ <version>3.7</version>
+ </dependency>
+ <dependency>
+ <groupId>org.onosproject</groupId>
+ <artifactId>jnc</artifactId>
+ <version>1.0</version>
+ </dependency>
+
+ <dependency>
+ <groupId>org.junit.jupiter</groupId>
+ <artifactId>junit-jupiter-engine</artifactId>
+ <version>5.1.1</version>
+ <scope>test</scope>
+ </dependency>
+ <dependency>
+ <groupId>org.junit.jupiter</groupId>
+ <artifactId>junit-jupiter-migrationsupport</artifactId>
+ <version>${junit.jupiter.version}</version>
+ <scope>test</scope>
+ </dependency>
+ <dependency>
+ <groupId>org.assertj</groupId>
+ <artifactId>assertj-core</artifactId>
+ <version>3.9.1</version>
+ <scope>test</scope>
+ </dependency>
+ <dependency>
+ <groupId>org.apache.sshd</groupId>
+ <artifactId>sshd-core</artifactId>
+ <version>0.9.0</version>
+ <scope>test</scope>
+ </dependency>
+ <dependency>
+ <groupId>org.mockito</groupId>
+ <artifactId>mockito-core</artifactId>
+ <version>2.18.3</version>
+ <scope>test</scope>
+ </dependency>
+
+ <dependency>
+ <groupId>org.springframework</groupId>
+ <artifactId>spring-test</artifactId>
+ <version>5.0.4.RELEASE</version>
+ <scope>test</scope>
+ </dependency>
+ <dependency>
+ <groupId>org.springframework.boot</groupId>
+ <artifactId>spring-boot-starter-test</artifactId>
+ <version>2.0.1.RELEASE</version>
+ <scope>test</scope>
+ </dependency>
+ </dependencies>
+
+ <build>
+ <plugins>
+ <plugin>
+ <groupId>org.apache.maven.plugins</groupId>
+ <artifactId>maven-compiler-plugin</artifactId>
+ <version>3.7.0</version>
+ <configuration>
+ <source>${maven.compiler.source}</source>
+ <target>${maven.compiler.target}</target>
+ <showWarnings>true</showWarnings>
+ <showDeprecation>true</showDeprecation>
+ </configuration>
+ </plugin>
+ <plugin>
+ <groupId>org.apache.maven.plugins</groupId>
+ <artifactId>maven-jar-plugin</artifactId>
+ <version>3.0.2</version>
+ <configuration>
+ <archive>
+ <manifestEntries>
+ <Main-Class>${simulator.main.class}</Main-Class>
+ <Build-Time>${maven.build.timestamp}</Build-Time>
+ </manifestEntries>
+ </archive>
+ </configuration>
+ </plugin>
+ <plugin>
+ <groupId>pl.project13.maven</groupId>
+ <artifactId>git-commit-id-plugin</artifactId>
+ <version>2.2.4</version>
+ <executions>
+ <execution>
+ <id>get-commit-info</id>
+ <goals>
+ <goal>revision</goal>
+ </goals>
+ </execution>
+ </executions>
+ <configuration>
+ <dotGitDirectory>${project.basedir}/.git</dotGitDirectory>
+ <generateGitPropertiesFile>true</generateGitPropertiesFile>
+ <includeOnlyProperties>git.commit.id.abbrev</includeOnlyProperties>
+ </configuration>
+ </plugin>
+ <plugin>
+ <artifactId>maven-surefire-plugin</artifactId>
+ <version>2.19</version>
+ <dependencies>
+ <dependency>
+ <groupId>org.junit.platform</groupId>
+ <artifactId>junit-platform-surefire-provider</artifactId>
+ <version>1.1.1</version>
+ </dependency>
+ </dependencies>
+ <configuration>
+ <detail>true</detail>
+ <printSummary>true</printSummary>
+ </configuration>
+ </plugin>
+ <plugin>
+ <groupId>org.apache.maven.plugins</groupId>
+ <artifactId>maven-dependency-plugin</artifactId>
+ <configuration>
+ <outputDirectory>${dependency.directory.location}</outputDirectory>
+ <includeScope>runtime</includeScope>
+ <silent>true</silent>
+ </configuration>
+ <executions>
+ <execution>
+ <id>copy-external-dependencies</id>
+ <phase>package</phase>
+ <goals>
+ <goal>copy-dependencies</goal>
+ </goals>
+ </execution>
+ </executions>
+ </plugin>
+ <plugin>
+ <groupId>com.spotify</groupId>
+ <artifactId>docker-maven-plugin</artifactId>
+ <version>1.0.0</version>
+ <configuration>
+ <registryUrl>${onap.nexus.dockerregistry.daily}</registryUrl>
+ <imageName>${onap.nexus.dockerregistry.daily}/${docker.image.name}</imageName>
+ <forceTags>true</forceTags>
+ <imageTags>
+ <tag>latest</tag>
+ <tag>${project.version}</tag>
+ <tag>${project.version}-${maven.build.timestamp}</tag>
+ </imageTags>
+ <baseImage>openjdk:8-jre-alpine</baseImage>
+ <cmd>java -cp ${dependency.directory.name}/*:${project.build.finalName}.jar ${simulator.main.class}</cmd>
+ <resources>
+ <resource>
+ <targetPath>${dependency.directory.name}</targetPath>
+ <directory>${dependency.directory.location}</directory>
+ </resource>
+ <resource>
+ <targetPath>/</targetPath>
+ <directory>${project.build.directory}</directory>
+ <include>${project.build.finalName}.jar</include>
+ </resource>
+ </resources>
+ <forceTags>true</forceTags>
+ </configuration>
+ </plugin>
+ <plugin>
+ <groupId>org.jacoco</groupId>
+ <artifactId>jacoco-maven-plugin</artifactId>
+ <version>0.8.1</version>
+ <configuration>
+ <excludes>
+ <exclude>org/onap/pnfsimulator/Main.class</exclude>
+ </excludes>
+ </configuration>
+ <executions>
+ <execution>
+ <id>default-prepare-agent</id>
+ <goals>
+ <goal>prepare-agent</goal>
+ </goals>
+ </execution>
+ <execution>
+ <id>report</id>
+ <phase>prepare-package</phase>
+ <goals>
+ <goal>report</goal>
+ </goals>
+ </execution>
+ <execution>
+ <id>check</id>
+ <goals>
+ <goal>check</goal>
+ </goals>
+ <configuration>
+ <rules>
+ <rule>
+ <element>CLASS</element>
+ <limits>
+ <limit>
+ <value>COVEREDRATIO</value>
+ <minimum>0.70</minimum>
+ </limit>
+ <limit>
+ <counter>BRANCH</counter>
+ <value>COVEREDRATIO</value>
+ <minimum>0.75</minimum>
+ </limit>
+ </limits>
+ </rule>
+ </rules>
+ </configuration>
+ </execution>
+ </executions>
+ </plugin>
+ </plugins>
+ </build>
+</project> \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/sftp/sftp-file.txt b/test/mocks/pnfsimulator/sftp/sftp-file.txt
new file mode 100644
index 000000000..43f671212
--- /dev/null
+++ b/test/mocks/pnfsimulator/sftp/sftp-file.txt
@@ -0,0 +1,2 @@
+We are SFTP specialists.
+Do you prefer chocolate or vanilia? \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/simulator.sh b/test/mocks/pnfsimulator/simulator.sh
index cf16e2400..23facce6a 100755
--- a/test/mocks/pnfsimulator/simulator.sh
+++ b/test/mocks/pnfsimulator/simulator.sh
@@ -3,7 +3,6 @@
set -euo pipefail
COMPOSE_FILE_NAME=docker-compose.yml
-DEV_COMPOSE_FILE_NAME=docker-compose.dev.yml
NETOPEER_CONTAINER_NAME=netopeer
SIMULATOR_CONTAINER_NAME=pnf-simulator
SIMULATOR_PORT=5000
@@ -22,9 +21,7 @@ function main(){
"start")
start $COMPOSE_FILE_NAME;;
"start-dev")
- start $DEV_COMPOSE_FILE_NAME;;
- "start-debug")
- start_netconf_server $DEV_COMPOSE_FILE_NAME;;
+ start_netconf_server $COMPOSE_FILE_NAME;;
"stop")
stop;;
"run-simulator")
@@ -42,7 +39,7 @@ function main(){
function build_image(){
if [ -f pom.xml ]; then
- mvn clean package
+ mvn clean package docker:build
else
echo "pom.xml file not found"
exit 1
@@ -74,7 +71,7 @@ function start(){
}
function running_containers(){
- docker-compose -f $COMPOSE_FILE_NAME ps -q && docker-compose -f $DEV_COMPOSE_FILE_NAME ps -q
+ docker-compose -f $COMPOSE_FILE_NAME ps -q
}
function stop(){
@@ -89,14 +86,14 @@ function stop(){
function run_simulator(){
cat << EndOfMessage
Simulator response:
-$(curl -s -X POST -H "Content-Type: application/json" -d @config/config.json $SIMULATOR_START_URL | json_pp)
+$(curl -s -X POST -H "Content-Type: application/json" -H "X-ONAP-RequestID: 123" -H "X-InvocationID: 456" -d @config/config.json $SIMULATOR_START_URL)
EndOfMessage
}
function stop_simulator(){
cat << EndOfMessage
Simulator response:
-$(curl -s -X POST $SIMULATOR_STOP_URL | json_pp)
+$(curl -s -X POST $SIMULATOR_STOP_URL)
EndOfMessage
}
@@ -114,7 +111,7 @@ cat << EndOfMessage
$(docker-compose -f $RUNNING_COMPOSE_CONFIG ps)
Simulator response:
-$(curl -s -X GET $SIMULATOR_STATUS_URL | json_pp)
+$(curl -s -X GET $SIMULATOR_STATUS_URL)
EndOfMessage
}
@@ -123,8 +120,7 @@ cat << EndOfMessage
Available options:
build - locally builds simulator image from existing code
start - starts simulator and netopeer2 containers using remote simulator image and specified model name
-start-dev - starts simulator and netopeer2 containers using remote simulator image
-start-debug - starts only netopeer2 container
+start-dev - starts only netopeer2 container
run-simulator - starts sending PNF registration messages with parameters specified in config.json
stop-simulator - stop sending PNF registration messages
stop - stops both containers
@@ -142,7 +138,7 @@ Logs are written to logs/pnf-simulator.log. After each "start/start-dev" old log
FOR DEVELOPERS
1. Build local simulator image using "./simulator.sh build"
-2. Run containers with "./simulator.sh start-dev"
+2. Run containers with "./simulator.sh start-debug"
If you change the source code you have to rebuild image with "./simulator.sh build" and run "./simulator.sh start/start-dev" again
EndOfMessage
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/Main.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/Main.java
index 0e9fe4d3d..244eef6bd 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/Main.java
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/Main.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -20,14 +20,30 @@
package org.onap.pnfsimulator;
+import org.onap.pnfsimulator.message.MessageProvider;
+import org.onap.pnfsimulator.simulator.validation.JSONValidator;
import org.springframework.boot.SpringApplication;
import org.springframework.boot.autoconfigure.SpringBootApplication;
+import org.springframework.context.annotation.Bean;
import org.springframework.scheduling.annotation.EnableAsync;
@SpringBootApplication
@EnableAsync
public class Main {
+
public static void main(String[] args) {
SpringApplication.run(Main.class, args);
}
+
+ @Bean
+ public MessageProvider messageProvider() {
+ return new MessageProvider();
+ }
+
+ @Bean
+ public JSONValidator jsonValidator() {
+ return new JSONValidator();
+ }
}
+
+
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/logging/MDCVariables.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/logging/MDCVariables.java
new file mode 100644
index 000000000..8f6fe3b66
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/logging/MDCVariables.java
@@ -0,0 +1,35 @@
+/*
+ * ============LICENSE_START=======================================================
+ * PNF-REGISTRATION-HANDLER
+ * ================================================================================
+ * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.pnfsimulator.logging;
+
+public final class MDCVariables {
+
+ public static final String X_ONAP_REQUEST_ID = "X-ONAP-RequestID";
+ public static final String X_INVOCATION_ID = "X-InvocationID";
+ public static final String REQUEST_ID = "RequestID";
+ public static final String INVOCATION_ID = "InvocationID";
+ public static final String INSTANCE_UUID = "InstanceUUID";
+ public static final String RESPONSE_CODE = "ResponseCode";
+ public static final String SERVICE_NAME = "ServiceName";
+
+ private MDCVariables() {
+ }
+}
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/message/JSONObjectFactory.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/message/JSONObjectFactory.java
new file mode 100644
index 000000000..fd2b95af1
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/message/JSONObjectFactory.java
@@ -0,0 +1,63 @@
+/*
+ * ============LICENSE_START=======================================================
+ * PNF-REGISTRATION-HANDLER
+ * ================================================================================
+ * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.pnfsimulator.message;
+
+import static org.onap.pnfsimulator.message.MessageConstants.*;
+
+import org.json.JSONObject;
+
+final class JSONObjectFactory {
+
+ static JSONObject generateConstantCommonEventHeader() {
+ JSONObject commonEventHeader = new JSONObject();
+ long timestamp = System.currentTimeMillis();
+ commonEventHeader.put(DOMAIN, PNF_REGISTRATION);
+ commonEventHeader.put(EVENT_ID, generateEventId());
+ commonEventHeader.put(EVENT_TYPE, PNF_REGISTRATION);
+ commonEventHeader.put(LAST_EPOCH_MICROSEC, timestamp);
+ commonEventHeader.put(PRIORITY, PRIORITY_NORMAL);
+ commonEventHeader.put(SEQUENCE, SEQUENCE_NUMBER);
+ commonEventHeader.put(START_EPOCH_MICROSEC, timestamp);
+ commonEventHeader.put(INTERNAL_HEADER_FIELDS, new JSONObject());
+ commonEventHeader.put(VERSION, VERSION_NUMBER);
+ commonEventHeader.put(VES_EVENT_LISTENER_VERSION, VES_EVENT_LISTENER_VERSION_NUMBER);
+ return commonEventHeader;
+ }
+
+ static JSONObject generatePnfRegistrationFields() {
+ JSONObject pnfRegistrationFields = new JSONObject();
+ pnfRegistrationFields.put(PNF_REGISTRATION_FIELDS_VERSION, PNF_REGISTRATION_FIELDS_VERSION_VALUE);
+ pnfRegistrationFields.put(PNF_LAST_SERVICE_DATE, String.valueOf(System.currentTimeMillis()));
+ pnfRegistrationFields.put(PNF_MANUFACTURE_DATE, String.valueOf(System.currentTimeMillis()));
+ return pnfRegistrationFields;
+ }
+
+ static String generateEventId() {
+ String timeAsString = String.valueOf(System.currentTimeMillis());
+ return String.format("registration_%s",
+ timeAsString.substring(timeAsString.length() - 11, timeAsString.length() - 3));
+ }
+
+ private JSONObjectFactory(){
+
+ }
+
+}
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/message/MessageConstants.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/message/MessageConstants.java
index 8e7c6fcfd..7861d5f9c 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/message/MessageConstants.java
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/message/MessageConstants.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -22,34 +22,44 @@ package org.onap.pnfsimulator.message;
public final class MessageConstants {
- public static final String EVENT = "event";
- public static final String DOMAIN = "domain";
- public static final String EVENT_ID = "eventId";
- public static final String EVENT_TYPE = "eventType";
- public static final String LAST_EPOCH_MICROSEC = "lastEpochMicrosec";
- public static final String PRIORITY = "priority";
- public static final String SEQUENCE = "sequence";
- public static final String START_EPOCH_MICROSEC = "startEpochMicrosec";
- public static final String INTERNAL_HEADER_FIELDS = "internalHeaderFields";
- public static final String VERSION = "version";
- public static final String OTHER_FIELDS_VERSION = "otherFieldsVersion";
- public static final String PNF_LAST_SERVICE_DATE = "pnfLastServiceDate";
- public static final String PNF_MANUFACTURE_DATE = "pnfManufactureDate";
-
public static final String SIMULATOR_PARAMS_CONTAINER = "simulatorParams";
public static final String MESSAGE_PARAMS_CONTAINER = "messageParams";
+ static final String EVENT = "event";
+ static final String DOMAIN = "domain";
+ static final String EVENT_ID = "eventId";
+ static final String EVENT_TYPE = "eventType";
+ static final String LAST_EPOCH_MICROSEC = "lastEpochMicrosec";
+ static final String PRIORITY = "priority";
+ static final String SEQUENCE = "sequence";
+ static final String START_EPOCH_MICROSEC = "startEpochMicrosec";
+ static final String INTERNAL_HEADER_FIELDS = "internalHeaderFields";
+ static final String VERSION = "version";
+ static final String PNF_REGISTRATION_FIELDS_VERSION = "pnfRegistrationFieldsVersion";
+ static final String PNF_LAST_SERVICE_DATE = "lastServiceDate";
+ static final String PNF_MANUFACTURE_DATE = "manufactureDate";
+ static final String VES_EVENT_LISTENER_VERSION = "vesEventListenerVersion";
- // mandatory
- public static final String PNF_OAM_IPV4_ADDRESS = "pnfOamIpv4Address";
- public static final String PNF_OAM_IPV6_ADDRESS = "pnfOamIpv6Address";
- public static final String PNF_SERIAL_NUMBER = "pnfSerialNumber";
- public static final String PNF_VENDOR_NAME = "pnfVendorName";
+ // mandatory used in json file, but not in java logic
+ //public static final String PNF_OAM_IPV4_ADDRESS = "pnfOamIpv4Address";
+ //public static final String PNF_OAM_IPV6_ADDRESS = "pnfOamIpv6Address";
+ //public static final String PNF_SERIAL_NUMBER = "pnfSerialNumber";
+ //public static final String PNF_VENDOR_NAME = "pnfVendorName";
public static final String VES_SERVER_URL = "vesServerUrl";
- public static final String PNF_PREFIX = "pnf";
- public static final String COMMON_EVENT_HEADER = "commonEventHeader";
- public static final String OTHER_FIELDS = "otherFields";
public static final String TEST_DURATION = "testDuration";
public static final String MESSAGE_INTERVAL = "messageInterval";
+ static final String PNF_PREFIX = "pnf_";
+ static final String COMMON_EVENT_HEADER = "commonEventHeader";
+ static final String PNF_REGISTRATION_FIELDS = "pnfRegistrationFields";
+
+
+ //===============================================================
+ //constant values
+ static final String PNF_REGISTRATION ="pnfRegistration";
+ static final String PRIORITY_NORMAL = "Normal";
+ static final String VERSION_NUMBER = "4.0.1";
+ static final String VES_EVENT_LISTENER_VERSION_NUMBER = "7.0.1";
+ static final String PNF_REGISTRATION_FIELDS_VERSION_VALUE = "2.0";
+ static final int SEQUENCE_NUMBER = 0;
private MessageConstants() {
}
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/message/MessageProvider.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/message/MessageProvider.java
index 44ca9666c..7c3bf9ef8 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/message/MessageProvider.java
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/message/MessageProvider.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -21,43 +21,30 @@
package org.onap.pnfsimulator.message;
import static org.onap.pnfsimulator.message.MessageConstants.COMMON_EVENT_HEADER;
-import static org.onap.pnfsimulator.message.MessageConstants.DOMAIN;
-import static org.onap.pnfsimulator.message.MessageConstants.EVENT_ID;
-import static org.onap.pnfsimulator.message.MessageConstants.EVENT_TYPE;
-import static org.onap.pnfsimulator.message.MessageConstants.INTERNAL_HEADER_FIELDS;
-import static org.onap.pnfsimulator.message.MessageConstants.LAST_EPOCH_MICROSEC;
-import static org.onap.pnfsimulator.message.MessageConstants.OTHER_FIELDS;
-import static org.onap.pnfsimulator.message.MessageConstants.OTHER_FIELDS_VERSION;
-import static org.onap.pnfsimulator.message.MessageConstants.PNF_LAST_SERVICE_DATE;
-import static org.onap.pnfsimulator.message.MessageConstants.PNF_MANUFACTURE_DATE;
-import static org.onap.pnfsimulator.message.MessageConstants.PNF_PREFIX;
-import static org.onap.pnfsimulator.message.MessageConstants.PRIORITY;
-import static org.onap.pnfsimulator.message.MessageConstants.SEQUENCE;
-import static org.onap.pnfsimulator.message.MessageConstants.START_EPOCH_MICROSEC;
-import static org.onap.pnfsimulator.message.MessageConstants.VERSION;
import static org.onap.pnfsimulator.message.MessageConstants.EVENT;
+import static org.onap.pnfsimulator.message.MessageConstants.PNF_PREFIX;
+import static org.onap.pnfsimulator.message.MessageConstants.PNF_REGISTRATION_FIELDS;
import java.util.Map;
-import java.util.UUID;
import org.json.JSONObject;
public class MessageProvider {
public JSONObject createMessage(JSONObject params) {
- if(params == null){
+ if (params == null) {
throw new IllegalArgumentException("Params object cannot be null");
}
- Map<String, Object> paramsMap = params.toMap();
+ Map<String, Object> paramsMap = params.toMap();
JSONObject root = new JSONObject();
- JSONObject commonEventHeader = generateConstantCommonEventHeader();
- JSONObject otherFields = generateConstantOtherFields();
+ JSONObject commonEventHeader = JSONObjectFactory.generateConstantCommonEventHeader();
+ JSONObject pnfRegistrationFields = JSONObjectFactory.generatePnfRegistrationFields();
paramsMap.forEach((key, value) -> {
if (key.startsWith(PNF_PREFIX)) {
- otherFields.put(key, value);
+ pnfRegistrationFields.put(key.substring(PNF_PREFIX.length()), value);
} else {
commonEventHeader.put(key, value);
}
@@ -65,37 +52,9 @@ public class MessageProvider {
JSONObject event = new JSONObject();
event.put(COMMON_EVENT_HEADER, commonEventHeader);
- event.put(OTHER_FIELDS, otherFields);
+ event.put(PNF_REGISTRATION_FIELDS, pnfRegistrationFields);
root.put(EVENT, event);
return root;
}
- private JSONObject generateConstantCommonEventHeader() {
-
- JSONObject commonEventHeader = new JSONObject();
- long timestamp = System.currentTimeMillis();
-
- commonEventHeader.put(DOMAIN, "other");
- commonEventHeader.put(EVENT_ID, UUID.randomUUID() + "-reg");
- commonEventHeader.put(EVENT_TYPE, "pnfRegistration");
- commonEventHeader.put(LAST_EPOCH_MICROSEC, timestamp);
- commonEventHeader.put(PRIORITY, "Normal");
- commonEventHeader.put(SEQUENCE, 0);
- commonEventHeader.put(START_EPOCH_MICROSEC, timestamp);
- commonEventHeader.put(INTERNAL_HEADER_FIELDS, new JSONObject());
- commonEventHeader.put(VERSION, 3);
-
- return commonEventHeader;
- }
-
- private JSONObject generateConstantOtherFields() {
-
- JSONObject otherFields = new JSONObject();
-
- otherFields.put(OTHER_FIELDS_VERSION, 1);
- otherFields.put(PNF_LAST_SERVICE_DATE, System.currentTimeMillis());
- otherFields.put(PNF_MANUFACTURE_DATE, System.currentTimeMillis());
-
- return otherFields;
- }
}
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/NetconfConfigurationCheckingTask.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/NetconfConfigurationCheckingTask.java
index b4eda0a79..2300d6492 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/NetconfConfigurationCheckingTask.java
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/NetconfConfigurationCheckingTask.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -21,17 +21,17 @@
package org.onap.pnfsimulator.netconfmonitor;
import com.tailf.jnc.JNCException;
-import org.apache.logging.log4j.LogManager;
-import org.apache.logging.log4j.Logger;
+import java.io.IOException;
+import java.util.TimerTask;
import org.onap.pnfsimulator.netconfmonitor.netconf.NetconfConfigurationCache;
import org.onap.pnfsimulator.netconfmonitor.netconf.NetconfConfigurationReader;
import org.onap.pnfsimulator.netconfmonitor.netconf.NetconfConfigurationWriter;
-
-import java.io.IOException;
-import java.util.TimerTask;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
public class NetconfConfigurationCheckingTask extends TimerTask {
- private static final Logger LOGGER = LogManager.getLogger(NetconfConfigurationCheckingTask.class);
+
+ private static final Logger LOGGER = LoggerFactory.getLogger(NetconfConfigurationCheckingTask.class);
private final NetconfConfigurationReader reader;
private final NetconfConfigurationWriter writer;
@@ -47,16 +47,15 @@ public class NetconfConfigurationCheckingTask extends TimerTask {
@Override
public void run() {
- String currentConfiguration = "";
try {
- currentConfiguration = reader.read();
- } catch (IOException|JNCException e) {
- LOGGER.info("Error during configuration reading: {}", e.getMessage());
- }
- if (!currentConfiguration.equals(cache.getConfiguration())) {
- LOGGER.info("Configuration has changed, new configuration:\n\n{}", currentConfiguration);
- writer.writeToFile(currentConfiguration);
- cache.update(currentConfiguration);
+ String currentConfiguration = reader.read();
+ if (!currentConfiguration.equals(cache.getConfiguration())) {
+ LOGGER.info("Configuration has changed, new configuration:\n\n{}", currentConfiguration);
+ writer.writeToFile(currentConfiguration);
+ cache.update(currentConfiguration);
+ }
+ } catch (IOException | JNCException e) {
+ LOGGER.warn("Error during configuration reading: {}", e.getMessage());
}
}
}
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorService.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorService.java
index c4d6198f7..0e7ab257d 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorService.java
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorService.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -21,18 +21,20 @@
package org.onap.pnfsimulator.netconfmonitor;
import com.tailf.jnc.JNCException;
+import java.io.IOException;
+import java.util.Timer;
+import javax.annotation.PostConstruct;
import org.onap.pnfsimulator.netconfmonitor.netconf.NetconfConfigurationCache;
import org.onap.pnfsimulator.netconfmonitor.netconf.NetconfConfigurationReader;
import org.onap.pnfsimulator.netconfmonitor.netconf.NetconfConfigurationWriter;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
import org.springframework.beans.factory.annotation.Autowired;
import org.springframework.stereotype.Service;
-import javax.annotation.PostConstruct;
-import java.io.IOException;
-import java.util.Timer;
-
@Service
public class NetconfMonitorService {
+ private static final Logger LOGGER = LoggerFactory.getLogger(NetconfMonitorService.class);
private static final long timePeriod = 1000L;
private static final long startDelay = 0;
@@ -53,15 +55,19 @@ public class NetconfMonitorService {
}
@PostConstruct
- public void start() throws IOException, JNCException {
+ public void start() {
setStartConfiguration();
- NetconfConfigurationCheckingTask task = new NetconfConfigurationCheckingTask(reader, writer, cache);
+ NetconfConfigurationCheckingTask task = new NetconfConfigurationCheckingTask(reader, writer, cache);
timer.scheduleAtFixedRate(task, startDelay, timePeriod);
}
- private void setStartConfiguration() throws IOException, JNCException {
- String configuration = reader.read();
- writer.writeToFile(configuration);
- cache.update(configuration);
+ private void setStartConfiguration() {
+ try {
+ String configuration = reader.read();
+ writer.writeToFile(configuration);
+ cache.update(configuration);
+ } catch (IOException | JNCException e) {
+ LOGGER.warn("Error during configuration reading: {}", e.getMessage());
+ }
}
}
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorServiceConfiguration.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorServiceConfiguration.java
index 82ea85aee..b0965d42b 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorServiceConfiguration.java
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorServiceConfiguration.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -22,19 +22,24 @@ package org.onap.pnfsimulator.netconfmonitor;
import com.tailf.jnc.JNCException;
import com.tailf.jnc.NetconfSession;
-import org.apache.logging.log4j.LogManager;
-import org.apache.logging.log4j.Logger;
-import org.onap.pnfsimulator.netconfmonitor.netconf.*;
-import org.springframework.context.annotation.Bean;
-import org.springframework.context.annotation.Configuration;
-
+import com.tailf.jnc.SSHConnection;
+import com.tailf.jnc.SSHSession;
import java.io.IOException;
import java.util.Map;
import java.util.Timer;
+import org.onap.pnfsimulator.netconfmonitor.netconf.NetconfConfigurationCache;
+import org.onap.pnfsimulator.netconfmonitor.netconf.NetconfConfigurationReader;
+import org.onap.pnfsimulator.netconfmonitor.netconf.NetconfConfigurationWriter;
+import org.onap.pnfsimulator.netconfmonitor.netconf.NetconfConnectionParams;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+import org.springframework.context.annotation.Bean;
+import org.springframework.context.annotation.Configuration;
@Configuration
public class NetconfMonitorServiceConfiguration {
- private static final Logger LOGGER = LogManager.getLogger(NetconfMonitorServiceConfiguration.class);
+
+ private static final Logger LOGGER = LoggerFactory.getLogger(NetconfMonitorServiceConfiguration.class);
private static final Map<String, String> enviroment = System.getenv();
private static final String LOG_PATH = "/var/log";
@@ -44,7 +49,7 @@ public class NetconfMonitorServiceConfiguration {
private static final String NETCONF_MODEL = "NETCONF_MODEL";
private static final String NETCONF_MAIN_CONTAINER = "NETCONF_MAIN_CONTAINER";
- private static final String DEFAULT_NETCONF_ADDRESS = "netopeer";
+ private static final String DEFAULT_NETCONF_ADDRESS = "localhost";
private static final int DEFAULT_NETCONF_PORT = 830;
private static final String DEFAULT_NETCONF_MODEL = "pnf-simulator";
private static final String DEFAULT_NETCONF_MAIN_CONTAINER = "config";
@@ -64,12 +69,18 @@ public class NetconfMonitorServiceConfiguration {
@Bean
public NetconfConfigurationReader configurationReader() throws IOException, JNCException {
- NetconfConnectionParams params = createConnectionParams();
+ NetconfConnectionParams params = resolveConnectionParams();
LOGGER.info("Configuration params are : {}", params);
- NetconfSession session = NetconfSessionFactory.create(params);
+ NetconfSession session = createNetconfSession(params);
return new NetconfConfigurationReader(session, buildModelPath());
}
+ NetconfSession createNetconfSession(NetconfConnectionParams params) throws IOException, JNCException {
+ SSHConnection sshConnection = new SSHConnection(params.address, params.port);
+ sshConnection.authenticateWithPassword(params.user, params.password);
+ return new NetconfSession( new SSHSession(sshConnection));
+ }
+
@Bean
public NetconfConfigurationWriter netconfConfigurationWriter() {
return new NetconfConfigurationWriter(LOG_PATH);
@@ -77,22 +88,24 @@ public class NetconfMonitorServiceConfiguration {
private String buildModelPath() {
return String.format("/%s:%s",
- enviroment.getOrDefault(NETCONF_MODEL, DEFAULT_NETCONF_MODEL),
- enviroment.getOrDefault(NETCONF_MAIN_CONTAINER, DEFAULT_NETCONF_MAIN_CONTAINER));
+ enviroment.getOrDefault(NETCONF_MODEL, DEFAULT_NETCONF_MODEL),
+ enviroment.getOrDefault(NETCONF_MAIN_CONTAINER, DEFAULT_NETCONF_MAIN_CONTAINER));
}
- private NetconfConnectionParams createConnectionParams() {
+ NetconfConnectionParams resolveConnectionParams() {
return new NetconfConnectionParams(
- enviroment.getOrDefault(NETCONF_ADDRESS, DEFAULT_NETCONF_ADDRESS),
- resolveNetconfPort(),
- DEFAULT_NETCONF_USER,
- DEFAULT_NETCONF_PASSWORD);
+ enviroment.getOrDefault(NETCONF_ADDRESS, DEFAULT_NETCONF_ADDRESS),
+ resolveNetconfPort(),
+ DEFAULT_NETCONF_USER,
+ DEFAULT_NETCONF_PASSWORD);
}
private int resolveNetconfPort() {
try {
return Integer.parseInt(enviroment.get(NETCONF_PORT));
} catch (NumberFormatException e) {
+ LOGGER.warn("Invalid netconf port: {}. Default netconf port {} is set.", e.getMessage(),
+ DEFAULT_NETCONF_PORT);
return DEFAULT_NETCONF_PORT;
}
}
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationCache.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationCache.java
index 820234620..39721841b 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationCache.java
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationCache.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -21,6 +21,7 @@
package org.onap.pnfsimulator.netconfmonitor.netconf;
public class NetconfConfigurationCache {
+
private String configuration = "";
public String getConfiguration() {
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationReader.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationReader.java
index e8979254d..593598e86 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationReader.java
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationReader.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -22,10 +22,10 @@ package org.onap.pnfsimulator.netconfmonitor.netconf;
import com.tailf.jnc.JNCException;
import com.tailf.jnc.NetconfSession;
-
import java.io.IOException;
public class NetconfConfigurationReader {
+
private final NetconfSession session;
private final String netconfModelPath;
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationWriter.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationWriter.java
index 4c3d53e39..40030796f 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationWriter.java
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationWriter.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -20,18 +20,18 @@
package org.onap.pnfsimulator.netconfmonitor.netconf;
-import java.text.DateFormat;
-import java.text.SimpleDateFormat;
-import org.apache.logging.log4j.LogManager;
-import org.apache.logging.log4j.Logger;
-
import java.io.BufferedWriter;
import java.io.FileWriter;
import java.io.IOException;
+import java.text.DateFormat;
+import java.text.SimpleDateFormat;
import org.onap.pnfsimulator.rest.util.DateUtil;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
public class NetconfConfigurationWriter {
- private static final Logger LOGGER = LogManager.getLogger(NetconfConfigurationWriter.class);
+
+ private static final Logger LOGGER = LoggerFactory.getLogger(NetconfConfigurationWriter.class);
private static final DateFormat dateFormat = new SimpleDateFormat("yyyy-MM-dd_HH:mm:ss");
private String pathToLog;
@@ -45,7 +45,7 @@ public class NetconfConfigurationWriter {
writer.write(configuration);
LOGGER.info("Configuration wrote to file {}/{} ", pathToLog, fileName);
} catch (IOException e) {
- LOGGER.info("Failed to write configuration to file: {}", e.getMessage());
+ LOGGER.warn("Failed to write configuration to file: {}", e.getMessage());
}
}
}
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConnectionParams.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConnectionParams.java
index 3130d2b06..1d6eb89bf 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConnectionParams.java
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConnectionParams.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -21,6 +21,7 @@
package org.onap.pnfsimulator.netconfmonitor.netconf;
public class NetconfConnectionParams {
+
public final String address;
public final int port;
public final String user;
@@ -36,9 +37,9 @@ public class NetconfConnectionParams {
@Override
public String toString() {
return String.format("NetconfConnectionParams{address=%s, port=%d, user=%s, password=%s}",
- address,
- port,
- user,
- password);
+ address,
+ port,
+ user,
+ password);
}
} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/rest/SimulatorController.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/rest/SimulatorController.java
index 46a63a21c..3b275a66f 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/rest/SimulatorController.java
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/rest/SimulatorController.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -20,30 +20,48 @@
package org.onap.pnfsimulator.rest;
+import static org.onap.pnfsimulator.logging.MDCVariables.INSTANCE_UUID;
+import static org.onap.pnfsimulator.logging.MDCVariables.INVOCATION_ID;
+import static org.onap.pnfsimulator.logging.MDCVariables.REQUEST_ID;
+import static org.onap.pnfsimulator.logging.MDCVariables.RESPONSE_CODE;
+import static org.onap.pnfsimulator.logging.MDCVariables.SERVICE_NAME;
+import static org.onap.pnfsimulator.logging.MDCVariables.X_INVOCATION_ID;
+import static org.onap.pnfsimulator.logging.MDCVariables.X_ONAP_REQUEST_ID;
import static org.onap.pnfsimulator.message.MessageConstants.SIMULATOR_PARAMS_CONTAINER;
import static org.onap.pnfsimulator.rest.util.ResponseBuilder.MESSAGE;
import static org.onap.pnfsimulator.rest.util.ResponseBuilder.REMAINING_TIME;
import static org.onap.pnfsimulator.rest.util.ResponseBuilder.SIMULATOR_STATUS;
import static org.onap.pnfsimulator.rest.util.ResponseBuilder.TIMESTAMP;
+import static org.springframework.http.HttpStatus.BAD_REQUEST;
+import static org.springframework.http.HttpStatus.INTERNAL_SERVER_ERROR;
+import static org.springframework.http.HttpStatus.OK;
+import java.io.IOException;
import java.text.DateFormat;
import java.text.SimpleDateFormat;
-import org.apache.logging.log4j.LogManager;
-import org.apache.logging.log4j.Logger;
+import com.github.fge.jsonschema.core.exceptions.ProcessingException;
+import java.util.UUID;
import org.json.JSONException;
import org.json.JSONObject;
import org.onap.pnfsimulator.message.MessageConstants;
-import org.onap.pnfsimulator.message.MessageProvider;
import org.onap.pnfsimulator.rest.util.DateUtil;
import org.onap.pnfsimulator.rest.util.ResponseBuilder;
import org.onap.pnfsimulator.simulator.Simulator;
import org.onap.pnfsimulator.simulator.SimulatorFactory;
+import org.onap.pnfsimulator.simulator.validation.JSONValidator;
import org.onap.pnfsimulator.simulator.validation.ValidationException;
-import org.springframework.http.HttpStatus;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+import org.slf4j.MDC;
+import org.slf4j.Marker;
+import org.slf4j.MarkerFactory;
+import org.springframework.beans.factory.annotation.Autowired;
+import org.springframework.http.HttpHeaders;
import org.springframework.http.ResponseEntity;
import org.springframework.web.bind.annotation.GetMapping;
import org.springframework.web.bind.annotation.PostMapping;
import org.springframework.web.bind.annotation.RequestBody;
+import org.springframework.web.bind.annotation.RequestHeader;
import org.springframework.web.bind.annotation.RequestMapping;
import org.springframework.web.bind.annotation.RestController;
@@ -52,87 +70,104 @@ import org.springframework.web.bind.annotation.RestController;
@RequestMapping("/simulator")
public class SimulatorController {
- private static final Logger LOGGER = LogManager.getLogger(Simulator.class);
+ private static final Logger LOGGER = LoggerFactory.getLogger(Simulator.class);
private static final DateFormat RESPONSE_DATE_FORMAT = new SimpleDateFormat("yyyy/MM/dd HH:mm:ss,SSS");
-
+ private final Marker ENTRY = MarkerFactory.getMarker("ENTRY");
private Simulator simulator;
+ private JSONValidator validator;
+ private SimulatorFactory factory;
- @PostMapping("start")
- public ResponseEntity start(@RequestBody String message) {
+ @Autowired
+ public SimulatorController(JSONValidator validator, SimulatorFactory factory) {
+ this.validator = validator;
+ this.factory = factory;
+ }
- if (simulator != null && simulator.isAlive()) {
+ @PostMapping("start")
+ public ResponseEntity start(@RequestHeader HttpHeaders headers, @RequestBody String message) {
+ MDC.put(REQUEST_ID, headers.getFirst(X_ONAP_REQUEST_ID));
+ MDC.put(INVOCATION_ID, headers.getFirst(X_INVOCATION_ID));
+ MDC.put(INSTANCE_UUID, UUID.randomUUID().toString());
+ MDC.put(SERVICE_NAME, "/simulator/start");
+ LOGGER.info(ENTRY,"Simulator starting");
+
+ if (isSimulatorRunning()) {
+ MDC.put(RESPONSE_CODE, BAD_REQUEST.toString());
return ResponseBuilder
- .status(HttpStatus.BAD_REQUEST.value())
+ .status(BAD_REQUEST)
.put(TIMESTAMP, DateUtil.getTimestamp(RESPONSE_DATE_FORMAT))
.put(MESSAGE, "Cannot start simulator since it's already running")
.build();
}
try {
+ validator.validate(message, "json_schema/input_validator.json");
+
JSONObject root = new JSONObject(message);
JSONObject simulatorParams = root.getJSONObject(SIMULATOR_PARAMS_CONTAINER);
JSONObject messageParams = root.getJSONObject(MessageConstants.MESSAGE_PARAMS_CONTAINER);
- simulator = SimulatorFactory
- .usingMessageProvider(new MessageProvider())
- .create(simulatorParams, messageParams);
-
+ simulator = factory.create(simulatorParams, messageParams);
simulator.start();
- } catch (JSONException e) {
+ MDC.put(RESPONSE_CODE, OK.toString());
+ return ResponseBuilder
+ .status(OK)
+ .put(TIMESTAMP, DateUtil.getTimestamp(RESPONSE_DATE_FORMAT))
+ .put(MESSAGE, "Simulator started")
+ .build();
- LOGGER.error("Cannot start simulator, invalid json format: " + e.getMessage());
- LOGGER.debug("Received json has invalid format:\n" + message);
+ } catch (JSONException e) {
+ MDC.put(RESPONSE_CODE, BAD_REQUEST.toString());
+ LOGGER.warn("Cannot start simulator, invalid json format: {}", e.getMessage());
+ LOGGER.debug("Received json has invalid format", e);
return ResponseBuilder
- .status(HttpStatus.BAD_REQUEST.value())
+ .status(BAD_REQUEST)
.put(TIMESTAMP, DateUtil.getTimestamp(RESPONSE_DATE_FORMAT))
.put(MESSAGE, "Cannot start simulator, invalid json format")
.build();
- } catch (ValidationException e) {
-
- LOGGER.error("Cannot start simulator - missing mandatory parameters");
+ } catch (ProcessingException | ValidationException | IOException e) {
+ MDC.put(RESPONSE_CODE, BAD_REQUEST.toString());
+ LOGGER.warn("Json validation failed: {}", e.getMessage());
return ResponseBuilder
- .status(HttpStatus.BAD_REQUEST.value())
+ .status(BAD_REQUEST)
.put(TIMESTAMP, DateUtil.getTimestamp(RESPONSE_DATE_FORMAT))
- .put(MESSAGE, e.getMessage())
+ .put(MESSAGE, "Cannot start simulator - Json format is not compatible with schema definitions")
.build();
- } catch (RuntimeException e) {
-
+ } catch (Exception e) {
+ MDC.put(RESPONSE_CODE, INTERNAL_SERVER_ERROR.toString());
LOGGER.error("Cannot start simulator - unexpected exception", e);
return ResponseBuilder
- .status(HttpStatus.INTERNAL_SERVER_ERROR.value())
+ .status(INTERNAL_SERVER_ERROR)
.put(TIMESTAMP, DateUtil.getTimestamp(RESPONSE_DATE_FORMAT))
.put(MESSAGE, "Unexpected exception: " + e.getMessage())
.build();
}
-
- return ResponseBuilder
- .status(HttpStatus.OK.value())
- .put(TIMESTAMP, DateUtil.getTimestamp(RESPONSE_DATE_FORMAT))
- .put(MESSAGE, "Simulator started")
- .build();
+ finally {
+ MDC.clear();
+ }
}
@GetMapping("status")
public ResponseEntity status() {
-
- if (simulator != null && simulator.isAlive()) {
-
+ if (isSimulatorRunning()) {
ResponseBuilder responseBuilder = ResponseBuilder
- .status(HttpStatus.OK.value())
+ .status(OK)
.put(TIMESTAMP, DateUtil.getTimestamp(RESPONSE_DATE_FORMAT))
.put(SIMULATOR_STATUS, "RUNNING");
- if (!simulator.isEndless()) {
- responseBuilder.put(REMAINING_TIME, simulator.getRemainingTime());
- }
- return responseBuilder.build();
+ return !simulator.isEndless() ?
+ responseBuilder
+ .put(REMAINING_TIME, simulator.getRemainingTime())
+ .build() :
+ responseBuilder
+ .build();
} else {
return ResponseBuilder
- .status(HttpStatus.OK.value())
+ .status(OK)
.put(TIMESTAMP, DateUtil.getTimestamp(RESPONSE_DATE_FORMAT))
.put(SIMULATOR_STATUS, "NOT RUNNING")
.build();
@@ -141,22 +176,25 @@ public class SimulatorController {
@PostMapping("stop")
public ResponseEntity stop() {
-
- if (simulator != null && simulator.isAlive()) {
+ if (isSimulatorRunning()) {
simulator.interrupt();
return ResponseBuilder
- .status(HttpStatus.OK.value())
+ .status(OK)
.put(TIMESTAMP, DateUtil.getTimestamp(RESPONSE_DATE_FORMAT))
.put(MESSAGE, "Simulator successfully stopped")
.build();
} else {
return ResponseBuilder
- .status(HttpStatus.BAD_REQUEST.value())
+ .status(BAD_REQUEST)
.put(TIMESTAMP, DateUtil.getTimestamp(RESPONSE_DATE_FORMAT))
.put(MESSAGE, "Cannot stop simulator, because it's not running")
.build();
}
}
+
+ private boolean isSimulatorRunning() {
+ return simulator != null && simulator.isAlive();
+ }
}
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/rest/util/DateUtil.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/rest/util/DateUtil.java
index 73443d06e..284d58904 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/rest/util/DateUtil.java
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/rest/util/DateUtil.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/rest/util/ResponseBuilder.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/rest/util/ResponseBuilder.java
index 31d22a713..98f4588c1 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/rest/util/ResponseBuilder.java
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/rest/util/ResponseBuilder.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -22,6 +22,7 @@ package org.onap.pnfsimulator.rest.util;
import java.util.LinkedHashMap;
import java.util.Map;
+import org.springframework.http.HttpStatus;
import org.springframework.http.ResponseEntity;
public class ResponseBuilder {
@@ -31,16 +32,16 @@ public class ResponseBuilder {
public static final String SIMULATOR_STATUS = "simulatorStatus";
public static final String REMAINING_TIME = "remainingTime";
- private int statusCode;
+ private HttpStatus httpStatus;
private Map<String, Object> body = new LinkedHashMap<>();
- private ResponseBuilder(int statusCode) {
- this.statusCode = statusCode;
+ private ResponseBuilder(HttpStatus httpStatus) {
+ this.httpStatus = httpStatus;
}
- public static ResponseBuilder status(int statusCode) {
+ public static ResponseBuilder status(HttpStatus httpStatus) {
- return new ResponseBuilder(statusCode);
+ return new ResponseBuilder(httpStatus);
}
public ResponseBuilder put(String key, Object value) {
@@ -52,10 +53,10 @@ public class ResponseBuilder {
public ResponseEntity build() {
if (body.isEmpty()) {
- return ResponseEntity.status(statusCode).build();
+ return ResponseEntity.status(httpStatus).build();
}
- return ResponseEntity.status(statusCode).body(body);
+ return ResponseEntity.status(httpStatus).body(body);
}
}
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/Simulator.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/Simulator.java
index 0c713e127..854311709 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/Simulator.java
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/Simulator.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -22,49 +22,61 @@ package org.onap.pnfsimulator.simulator;
import java.time.Duration;
import java.time.Instant;
-import org.apache.logging.log4j.LogManager;
-import org.apache.logging.log4j.Logger;
+import java.util.Map;
import org.json.JSONObject;
import org.onap.pnfsimulator.simulator.client.HttpClientAdapter;
+import org.onap.pnfsimulator.simulator.client.HttpClientAdapterImpl;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+import org.slf4j.MDC;
+import org.slf4j.Marker;
+import org.slf4j.MarkerFactory;
public class Simulator extends Thread {
- private static final Logger LOGGER = LogManager.getLogger(Simulator.class);
- private HttpClientAdapter clientProvider;
+ private static final Logger LOGGER = LoggerFactory.getLogger(Simulator.class);
+ private final Marker EXIT = MarkerFactory.getMarker("EXIT");
+ private Map<String,String> contextMap = MDC.getCopyOfContextMap();
+ private boolean isEndless;
+ private String vesUrl;
+ private HttpClientAdapter httpClient;
private JSONObject messageBody;
- private Instant endTime;
private Duration duration;
private Duration interval;
- private final boolean isEndless;
-
- public Simulator(String vesServerUrl, JSONObject messageBody, Duration duration, Duration interval) {
- this.messageBody = messageBody;
- this.duration = duration;
- this.interval = interval;
- this.clientProvider = new HttpClientAdapter(vesServerUrl);
- this.isEndless = duration.getSeconds() == 0;
+ private Instant endTime;
+
+ private Simulator() {
}
- public void run() {
- LOGGER.info("Simulation started - duration: " + getDuration() + ", interval: {}s", interval.getSeconds());
+ public static Builder builder() {
+ return new Builder();
+ }
+ public void run() {
+ setMdcContextMap(contextMap);
+ LOGGER.info("Simulation started - duration: {}, interval: {}s", getDuration(), interval.getSeconds());
endTime = Instant.now().plus(duration);
- boolean isEndless = isEndless();
while (isEndless || runningTimeNotExceeded()) {
try {
- LOGGER.debug("Message to be sent:\n" + messageBody.toString(4));
- clientProvider.sendMsg(messageBody.toString());
+ LOGGER.debug("Message to be sent:\n" + getMessage());
+ httpClient.send(messageBody.toString(), vesUrl);
Thread.sleep(interval.toMillis());
} catch (InterruptedException e) {
LOGGER.info("Simulation interrupted");
return;
}
}
- LOGGER.info("Simulation finished");
+ LOGGER.info(EXIT, "Simulation finished");
+ MDC.clear();
}
- public boolean isEndless() {
- return isEndless;
+ private void setMdcContextMap(Map<String,String> mdcContextMap) {
+ if(mdcContextMap != null)
+ MDC.setContextMap(mdcContextMap);
+ }
+
+ private String getMessage() {
+ return messageBody.toString(4);
}
private String getDuration() {
@@ -75,10 +87,65 @@ public class Simulator extends Thread {
return Instant.now().isBefore(endTime);
}
- public long getRemainingTime(){
+ public boolean isEndless() {
+ return isEndless;
+ }
+
+ public long getRemainingTime() {
return Duration.between(Instant.now(), endTime).getSeconds();
}
- public String getMessage(){
- return messageBody.toString(4);
+
+ public static class Builder {
+
+ private String vesUrl;
+ private HttpClientAdapter httpClient;
+ private JSONObject messageBody;
+ private Duration duration;
+ private Duration interval;
+
+ private Builder() {
+ this.vesUrl = "";
+ this.httpClient = new HttpClientAdapterImpl();
+ this.messageBody = new JSONObject();
+ this.duration = Duration.ZERO;
+ this.interval = Duration.ZERO;
+ }
+
+ public Builder withVesUrl(String vesUrl) {
+ this.vesUrl = vesUrl;
+ return this;
+ }
+
+ public Builder withCustomHttpClientAdapter(HttpClientAdapter httpClient) {
+ this.httpClient = httpClient;
+ return this;
+ }
+
+ public Builder withMessageBody(JSONObject messageBody) {
+ this.messageBody = messageBody;
+ return this;
+ }
+
+ public Builder withDuration(Duration duration) {
+ this.duration = duration;
+ return this;
+ }
+
+
+ public Builder withInterval(Duration interval) {
+ this.interval = interval;
+ return this;
+ }
+
+ public Simulator build() {
+ Simulator simulator = new Simulator();
+ simulator.vesUrl = this.vesUrl;
+ simulator.httpClient = this.httpClient;
+ simulator.messageBody = this.messageBody;
+ simulator.duration = this.duration;
+ simulator.interval = this.interval;
+ simulator.isEndless = duration.equals(Duration.ZERO);
+ return simulator;
+ }
}
} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/SimulatorFactory.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/SimulatorFactory.java
index 7f1b0a808..394864431 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/SimulatorFactory.java
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/SimulatorFactory.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -20,38 +20,49 @@
package org.onap.pnfsimulator.simulator;
-import static java.lang.Integer.*;
+import static java.lang.Integer.parseInt;
import static org.onap.pnfsimulator.message.MessageConstants.MESSAGE_INTERVAL;
import static org.onap.pnfsimulator.message.MessageConstants.TEST_DURATION;
import static org.onap.pnfsimulator.message.MessageConstants.VES_SERVER_URL;
+import com.github.fge.jsonschema.core.exceptions.ProcessingException;
+import java.io.IOException;
import java.time.Duration;
import org.json.JSONObject;
import org.onap.pnfsimulator.message.MessageProvider;
-import org.onap.pnfsimulator.simulator.validation.ParamsValidator;
+import org.onap.pnfsimulator.simulator.validation.JSONValidator;
import org.onap.pnfsimulator.simulator.validation.ValidationException;
+import org.springframework.beans.factory.annotation.Autowired;
+import org.springframework.stereotype.Service;
+@Service
public class SimulatorFactory {
- private MessageProvider messageProvider;
+ private static final String DEFAULT_OUTPUT_SCHEMA_PATH = "json_schema/output_validator_ves_schema_30.0.1.json";
- public static SimulatorFactory usingMessageProvider(MessageProvider messageProvider) {
- return new SimulatorFactory(messageProvider);
- }
+ private MessageProvider messageProvider;
+ private JSONValidator validator;
- private SimulatorFactory(MessageProvider messageProvider) {
+ @Autowired
+ public SimulatorFactory(MessageProvider messageProvider, JSONValidator validator) {
this.messageProvider = messageProvider;
+ this.validator = validator;
}
- public Simulator create(JSONObject simulatorParams, JSONObject messageParams) throws ValidationException {
-
- ParamsValidator.forParams(simulatorParams, messageParams).validate();
-
+ public Simulator create(JSONObject simulatorParams, JSONObject messageParams)
+ throws ProcessingException, IOException, ValidationException {
Duration duration = Duration.ofSeconds(parseInt(simulatorParams.getString(TEST_DURATION)));
Duration interval = Duration.ofSeconds(parseInt(simulatorParams.getString(MESSAGE_INTERVAL)));
- String vesServerUrl = simulatorParams.getString(VES_SERVER_URL);
+ String vesUrl = simulatorParams.getString(VES_SERVER_URL);
JSONObject messageBody = messageProvider.createMessage(messageParams);
- return new Simulator(vesServerUrl, messageBody, duration, interval);
+ validator.validate(messageBody.toString(), DEFAULT_OUTPUT_SCHEMA_PATH);
+
+ return Simulator.builder()
+ .withVesUrl(vesUrl)
+ .withDuration(duration)
+ .withInterval(interval)
+ .withMessageBody(messageBody)
+ .build();
}
} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/client/HttpClientAdapter.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/client/HttpClientAdapter.java
index 35f0b6820..47f2e3112 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/client/HttpClientAdapter.java
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/client/HttpClientAdapter.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -20,57 +20,7 @@
package org.onap.pnfsimulator.simulator.client;
-import java.io.IOException;
-import java.io.UnsupportedEncodingException;
-import org.apache.http.HttpResponse;
-import org.apache.http.client.HttpClient;
-import org.apache.http.client.config.RequestConfig;
-import org.apache.http.client.methods.HttpPost;
-import org.apache.http.entity.StringEntity;
-import org.apache.http.impl.client.HttpClientBuilder;
-import org.apache.logging.log4j.LogManager;
-import org.apache.logging.log4j.Logger;
+public interface HttpClientAdapter {
-public class HttpClientAdapter {
-
- private static final Logger LOGGER = LogManager.getLogger(HttpClientAdapter.class);
- private static final String CONTENT_TYPE = "Content-Type";
- private static final String APPLICATION_JSON = "application/json";
-
- private HttpClient client;
- private String url;
-
- public HttpClientAdapter(String url) {
-
- RequestConfig config = RequestConfig.custom()
- .setConnectTimeout(1000)
- .setConnectionRequestTimeout(1000)
- .setSocketTimeout(1000)
- .build();
-
- this.client = HttpClientBuilder
- .create()
- .setDefaultRequestConfig(config)
- .build();
-
- this.url = url;
- }
-
- public void sendMsg(String content) {
- try {
- HttpPost request = createRequest(content);
- HttpResponse response = client.execute(request);
- LOGGER.info("MESSAGE SENT, VES RESPONSE CODE: {}", response.getStatusLine());
- } catch (IOException e) {
- LOGGER.info("ERROR SENDING MESSAGE TO VES: {}", e.getMessage());
- }
- }
-
- private HttpPost createRequest(String content) throws UnsupportedEncodingException {
- StringEntity stringEntity = new StringEntity(content);
- HttpPost request = new HttpPost(url);
- request.addHeader(CONTENT_TYPE, APPLICATION_JSON);
- request.setEntity(stringEntity);
- return request;
- }
+ void send(String content, String url);
}
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/client/HttpClientAdapterImpl.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/client/HttpClientAdapterImpl.java
new file mode 100644
index 000000000..db1ea1578
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/client/HttpClientAdapterImpl.java
@@ -0,0 +1,87 @@
+/*
+ * ============LICENSE_START=======================================================
+ * PNF-REGISTRATION-HANDLER
+ * ================================================================================
+ * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.pnfsimulator.simulator.client;
+
+import static org.onap.pnfsimulator.logging.MDCVariables.REQUEST_ID;
+import static org.onap.pnfsimulator.logging.MDCVariables.X_INVOCATION_ID;
+import static org.onap.pnfsimulator.logging.MDCVariables.X_ONAP_REQUEST_ID;
+
+import java.io.IOException;
+import java.io.UnsupportedEncodingException;
+import java.util.UUID;
+import org.apache.http.HttpResponse;
+import org.apache.http.client.HttpClient;
+import org.apache.http.client.config.RequestConfig;
+import org.apache.http.client.methods.HttpPost;
+import org.apache.http.entity.StringEntity;
+import org.apache.http.impl.client.HttpClientBuilder;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+import org.slf4j.MDC;
+import org.slf4j.Marker;
+import org.slf4j.MarkerFactory;
+
+public class HttpClientAdapterImpl implements HttpClientAdapter {
+
+ private static final Logger LOGGER = LoggerFactory.getLogger(HttpClientAdapterImpl.class);
+ private static final String CONTENT_TYPE = "Content-Type";
+ private static final String APPLICATION_JSON = "application/json";
+ private final Marker INVOKE = MarkerFactory.getMarker("INVOKE");
+ private static final RequestConfig CONFIG = RequestConfig.custom()
+ .setConnectTimeout(1000)
+ .setConnectionRequestTimeout(1000)
+ .setSocketTimeout(1000)
+ .build();
+
+ private HttpClient client;
+
+ public HttpClientAdapterImpl() {
+ this.client = HttpClientBuilder
+ .create()
+ .setDefaultRequestConfig(CONFIG)
+ .build();
+ }
+
+ @Override
+ public void send(String content, String url) {
+ try {
+ HttpPost request = createRequest(content, url);
+ HttpResponse response = client.execute(request);
+ LOGGER.info(INVOKE, "Message sent, ves response code: {}", response.getStatusLine());
+ } catch (IOException e) {
+ LOGGER.warn("Error sending message to ves: {}", e.getMessage());
+ }
+ }
+
+ HttpClientAdapterImpl(HttpClient client) {
+ this.client = client;
+ }
+
+ private HttpPost createRequest(String content, String url) throws UnsupportedEncodingException {
+ HttpPost request = new HttpPost(url);
+ StringEntity stringEntity = new StringEntity(content);
+ request.addHeader(CONTENT_TYPE, APPLICATION_JSON);
+ request.addHeader(X_ONAP_REQUEST_ID, MDC.get(REQUEST_ID));
+ request.addHeader(X_INVOCATION_ID, UUID.randomUUID().toString());
+ request.setEntity(stringEntity);
+ return request;
+ }
+} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/validation/JSONValidator.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/validation/JSONValidator.java
new file mode 100644
index 000000000..89135f9b4
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/validation/JSONValidator.java
@@ -0,0 +1,66 @@
+/*
+ * ============LICENSE_START=======================================================
+ * PNF-REGISTRATION-HANDLER
+ * ================================================================================
+ * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.pnfsimulator.simulator.validation;
+
+import com.fasterxml.jackson.databind.JsonNode;
+import com.github.fge.jackson.JsonLoader;
+import com.github.fge.jsonschema.core.exceptions.ProcessingException;
+import com.github.fge.jsonschema.core.report.LogLevel;
+import com.github.fge.jsonschema.core.report.ProcessingMessage;
+import com.github.fge.jsonschema.core.report.ProcessingReport;
+import com.github.fge.jsonschema.main.JsonSchema;
+import com.github.fge.jsonschema.main.JsonSchemaFactory;
+import com.google.gson.JsonParser;
+import java.io.FileReader;
+import java.io.IOException;
+import java.util.stream.Collectors;
+import java.util.stream.StreamSupport;
+
+public class JSONValidator {
+
+ public void validate(String data, String jsonSchemaPath)
+ throws ValidationException, ProcessingException, IOException {
+ String jsonSchema = readJsonSchemaAsString(jsonSchemaPath);
+ JsonNode jsonData = JsonLoader.fromString(data);
+ ProcessingReport report = createJsonSchema(jsonSchema).validate(jsonData);
+
+ if (!report.isSuccess()) {
+ throw new ValidationException(constructValidationErrors(report));
+ }
+ }
+
+ private String readJsonSchemaAsString(String schemaPath) throws IOException {
+ try (FileReader reader = new FileReader(schemaPath)) {
+ return new JsonParser().parse(reader).toString();
+ }
+ }
+
+ private JsonSchema createJsonSchema(String schema) throws ProcessingException, IOException {
+ return JsonSchemaFactory.byDefault().getJsonSchema(JsonLoader.fromString(schema));
+ }
+
+ private String constructValidationErrors(ProcessingReport report) {
+ return StreamSupport.stream(report.spliterator(), false)
+ .filter(entry -> entry.getLogLevel() == LogLevel.ERROR)
+ .map(ProcessingMessage::getMessage)
+ .collect(Collectors.joining("\n"));
+ }
+}
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/validation/ParamsValidator.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/validation/ParamsValidator.java
deleted file mode 100644
index 3c8459473..000000000
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/validation/ParamsValidator.java
+++ /dev/null
@@ -1,121 +0,0 @@
-/*-
- * ============LICENSE_START=======================================================
- * org.onap.integration
- * ================================================================================
- * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
- * ================================================================================
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- * ============LICENSE_END=========================================================
- */
-
-package org.onap.pnfsimulator.simulator.validation;
-
-import static org.onap.pnfsimulator.message.MessageConstants.MESSAGE_INTERVAL;
-import static org.onap.pnfsimulator.message.MessageConstants.PNF_OAM_IPV4_ADDRESS;
-import static org.onap.pnfsimulator.message.MessageConstants.PNF_OAM_IPV6_ADDRESS;
-import static org.onap.pnfsimulator.message.MessageConstants.PNF_SERIAL_NUMBER;
-import static org.onap.pnfsimulator.message.MessageConstants.PNF_VENDOR_NAME;
-import static org.onap.pnfsimulator.message.MessageConstants.TEST_DURATION;
-import static org.onap.pnfsimulator.message.MessageConstants.VES_SERVER_URL;
-
-import com.google.common.collect.ImmutableMap;
-import java.util.List;
-import java.util.Map;
-import java.util.Map.Entry;
-import java.util.function.BiPredicate;
-import java.util.stream.Collectors;
-import java.util.stream.Stream;
-import org.apache.commons.lang3.StringUtils;
-import org.json.JSONObject;
-
-
-public class ParamsValidator {
-
- private final static String MISSING_PARAMS_MESSAGE = "Following mandatory params are missing:\n";
-
- private final Map<String, BiPredicate<String, JSONObject>> simulatorParamsValidators = ImmutableMap
- .<String, BiPredicate<String, JSONObject>>builder()
- .put(VES_SERVER_URL, this::isDefined)
- .put(TEST_DURATION, this::isNumeric)
- .put(MESSAGE_INTERVAL, this::isNumeric)
- .build();
-
- private final Map<String, BiPredicate<String, JSONObject>> messageParamsValidators = ImmutableMap
- .<String, BiPredicate<String, JSONObject>>builder()
- .put(PNF_SERIAL_NUMBER, this::isDefined)
- .put(PNF_VENDOR_NAME, this::isDefined)
- .put(PNF_OAM_IPV4_ADDRESS, this::isDefined)
- .put(PNF_OAM_IPV6_ADDRESS, this::isDefined)
- .build();
-
- private JSONObject simulatorParams;
- private JSONObject messageParams;
-
- private ParamsValidator(JSONObject simulatorParams, JSONObject messageParams) {
- this.simulatorParams = simulatorParams;
- this.messageParams = messageParams;
- }
-
- public static ParamsValidator forParams(JSONObject simulatorParams, JSONObject messageParams) {
- return new ParamsValidator(simulatorParams, messageParams);
- }
-
- public void validate() throws ValidationException {
-
- Stream<String> missingSimulatorParams = simulatorParamsValidators
- .entrySet()
- .stream()
- .filter(entry -> !entry.getValue().test(entry.getKey(), simulatorParams))
- .map(Entry::getKey);
-
- Stream<String> missingMessageParams = messageParamsValidators
- .entrySet()
- .stream()
- .filter(entry -> !entry.getValue().test(entry.getKey(), messageParams))
- .map(Entry::getKey);
-
- List<String> missingParams = Stream
- .concat(missingMessageParams, missingSimulatorParams)
- .collect(Collectors.toList());
-
- resolveMissingIP(missingParams);
-
- if (!missingParams.isEmpty()) {
- throw new ValidationException(constructMessage(missingParams));
- }
- }
-
- private String constructMessage(List<String> missingParams) {
-
- return MISSING_PARAMS_MESSAGE + missingParams
- .stream()
- .collect(Collectors.joining("\n"));
- }
-
- private boolean isNumeric(String param, JSONObject container) {
- return isDefined(param, container) && StringUtils.isNumeric(container.getString(param));
- }
-
- private boolean isDefined(String param, JSONObject container) {
-
- return container.has(param) && !container.getString(param).isEmpty();
- }
-
- private void resolveMissingIP(List<String> missingParams) {
- // if only one IP is missing clear the error
- if (!(missingParams.contains(PNF_OAM_IPV4_ADDRESS) && missingParams.contains(PNF_OAM_IPV6_ADDRESS))) {
- missingParams.remove(PNF_OAM_IPV4_ADDRESS);
- missingParams.remove(PNF_OAM_IPV6_ADDRESS);
- }
- }
-}
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/validation/ValidationException.java b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/validation/ValidationException.java
index 086997f85..a9349174a 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/validation/ValidationException.java
+++ b/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/simulator/validation/ValidationException.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
diff --git a/test/mocks/pnfsimulator/src/main/resources/log4j2.xml b/test/mocks/pnfsimulator/src/main/resources/log4j2.xml
deleted file mode 100644
index d3941d32d..000000000
--- a/test/mocks/pnfsimulator/src/main/resources/log4j2.xml
+++ /dev/null
@@ -1,24 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-<Configuration status="WARN">
- <Properties>
- <Property name="log4j.logLevel" value="info"/>
- </Properties>
- <Appenders>
- <Console name="Console" target="SYSTEM_OUT">
- <PatternLayout pattern="%d{ISO8601} +%r [%t] %-5p %c %x - %m%n"/>
- </Console>
- <Console name="ColorConsole" target="SYSTEM_OUT">
- <PatternLayout
- pattern="%style{%d{ISO8601} +%r}{yellow} %highlight{%-5level}{STYLE=Logback} %style{[%t]}{yellow} %style{%c{1.}}{BRIGHT} %message%n"/>
- </Console>
- <File name="File" fileName="/var/log/pnfsimulator.log">
- <PatternLayout pattern="%d{ISO8601} +%r [%t] %-5p %c %x - %m%n"/>
- </File>
- </Appenders>
- <Loggers>
- <Root level="${sys:log4j.logLevel}">
- <AppenderRef ref="File"/>
- <AppenderRef ref="ColorConsole"/>
- </Root>
- </Loggers>
-</Configuration>
diff --git a/test/mocks/pnfsimulator/src/main/resources/logback.xml b/test/mocks/pnfsimulator/src/main/resources/logback.xml
new file mode 100644
index 000000000..de34b9ae3
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/main/resources/logback.xml
@@ -0,0 +1,50 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<Configuration complete="true" compact="true">
+
+ <Property name="outputFilename" value="pnfsimulator_output"/>
+ <Property name="log-path" value="/var/log/ONAP/pnfsimulator"/>
+ <Property name="archive" value="/var/log/ONAP/pnfsimulator/archive"/>
+ <property name="maxFileSize" value="50MB"/>
+ <property name="maxHistory" value="30"/>
+ <property name="totalSizeCap" value="10GB"/>
+
+ <appender name="Console" target="SYSTEM_OUT" class="ch.qos.logback.core.ConsoleAppender">
+ <encoder>
+ <Pattern>%nopexception%logger
+ |%date{yyyy-MM-dd'T'HH:mm:ss.SSSXXX,UTC}
+ |%level
+ |%replace(%replace(%message){'\t','\\\\t'}){'\n','\\\\n'}
+ |%replace(%replace(%mdc){'\t','\\\\t'}){'\n','\\\\n'}
+ |%replace(%replace(%rootException){'\t','\\\\t'}){'\n','\\\\n'}
+ |%replace(%replace(%marker){'\t','\\\\t'}){'\n','\\\\n'}
+ |%thread
+ |%n</Pattern>
+ </encoder>
+ </appender>
+
+ <appender name="ROLLING-FILE" class="ch.qos.logback.core.rolling.RollingFileAppender">
+ <encoder>
+ <pattern>%nopexception%logger
+ |%date{yyyy-MM-dd'T'HH:mm:ss.SSSXXX,UTC}
+ |%level
+ |%replace(%replace(%message){'\t','\\\\t'}){'\n','\\\\n'}
+ |%replace(%replace(%mdc){'\t','\\\\t'}){'\n','\\\\n'}
+ |%replace(%replace(%rootException){'\t','\\\\t'}){'\n','\\\\n'}
+ |%replace(%replace(%marker){'\t','\\\\t'}){'\n','\\\\n'}
+ |%thread
+ |%n</pattern>
+ </encoder>
+ <File>${log-path}/${outputFilename}.log</File>
+ <rollingPolicy class="ch.qos.logback.core.rolling.SizeAndTimeBasedRollingPolicy">
+ <FileNamePattern>${archive}/${outputFilename}.%d{yyyy-MM-dd}.%i.log.zip</FileNamePattern>
+ <MaxFileSize>${maxFileSize}</MaxFileSize>
+ <MaxHistory>${maxHistory}</MaxHistory>
+ <TotalSizeCap>${totalSizeCap}</TotalSizeCap>
+ </rollingPolicy>
+ </appender>
+
+ <root level="info">
+ <appender-ref ref="Console" />
+ <appender-ref ref="ROLLING-FILE" />
+ </root>
+</Configuration>
diff --git a/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/message/JSONObjectFactoryTest.java b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/message/JSONObjectFactoryTest.java
new file mode 100644
index 000000000..bc3d17f79
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/message/JSONObjectFactoryTest.java
@@ -0,0 +1,69 @@
+/*
+ * ============LICENSE_START=======================================================
+ * PNF-REGISTRATION-HANDLER
+ * ================================================================================
+ * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.pnfsimulator.message;
+
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertTrue;
+import static org.onap.pnfsimulator.message.MessageConstants.*;
+
+import org.json.JSONObject;
+import org.junit.jupiter.api.Test;
+
+public class JSONObjectFactoryTest {
+
+ @Test
+ public void generateConstantCommonEventHeader_shouldCreateProperly(){
+ JSONObject commonEventHeader = JSONObjectFactory.generateConstantCommonEventHeader();
+ assertEquals(10,commonEventHeader.toMap().size());
+ assertTrue(commonEventHeader.has(DOMAIN));
+ assertTrue(commonEventHeader.has(EVENT_ID));
+ assertTrue(commonEventHeader.has(EVENT_TYPE));
+ assertTrue(commonEventHeader.has(LAST_EPOCH_MICROSEC));
+ assertTrue(commonEventHeader.has(PRIORITY));
+ assertTrue(commonEventHeader.has(SEQUENCE));
+ assertTrue(commonEventHeader.has(START_EPOCH_MICROSEC));
+ assertTrue(commonEventHeader.has(INTERNAL_HEADER_FIELDS));
+ assertTrue(commonEventHeader.has(VERSION));
+ assertEquals(commonEventHeader.get(DOMAIN),PNF_REGISTRATION);
+ assertEquals(commonEventHeader.get(EVENT_TYPE),PNF_REGISTRATION);
+ assertEquals(commonEventHeader.get(PRIORITY),PRIORITY_NORMAL);
+ assertEquals(commonEventHeader.get(SEQUENCE),SEQUENCE_NUMBER);
+ assertEquals(commonEventHeader.get(VERSION),VERSION_NUMBER);
+ assertEquals(commonEventHeader.get(VES_EVENT_LISTENER_VERSION),VES_EVENT_LISTENER_VERSION_NUMBER);
+ }
+
+ @Test
+ public void generateConstantPnfRegistrationFields_shouldCreateProperly(){
+ JSONObject pnfRegistrationFields = JSONObjectFactory.generatePnfRegistrationFields();
+ assertEquals(3,pnfRegistrationFields.toMap().size());
+ assertTrue(pnfRegistrationFields.has(PNF_REGISTRATION_FIELDS_VERSION));
+ assertEquals(pnfRegistrationFields.get(PNF_REGISTRATION_FIELDS_VERSION), PNF_REGISTRATION_FIELDS_VERSION_VALUE);
+ assertTrue(pnfRegistrationFields.has(PNF_LAST_SERVICE_DATE));
+ assertTrue(pnfRegistrationFields.has(PNF_MANUFACTURE_DATE));
+ }
+
+ @Test
+ public void generateEventId_shouldCreateProperly(){
+ String eventId = JSONObjectFactory.generateEventId();
+ assertTrue(eventId.startsWith("registration_"));
+ }
+
+}
diff --git a/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/message/MessageProviderTest.java b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/message/MessageProviderTest.java
index 41df397a7..3d1f25397 100644
--- a/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/message/MessageProviderTest.java
+++ b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/message/MessageProviderTest.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -24,22 +24,9 @@ import static org.junit.jupiter.api.Assertions.assertEquals;
import static org.junit.jupiter.api.Assertions.assertThrows;
import static org.junit.jupiter.api.Assertions.assertTrue;
import static org.onap.pnfsimulator.message.MessageConstants.COMMON_EVENT_HEADER;
-import static org.onap.pnfsimulator.message.MessageConstants.DOMAIN;
-import static org.onap.pnfsimulator.message.MessageConstants.EVENT_ID;
-import static org.onap.pnfsimulator.message.MessageConstants.EVENT_TYPE;
-import static org.onap.pnfsimulator.message.MessageConstants.INTERNAL_HEADER_FIELDS;
-import static org.onap.pnfsimulator.message.MessageConstants.LAST_EPOCH_MICROSEC;
-import static org.onap.pnfsimulator.message.MessageConstants.OTHER_FIELDS;
-import static org.onap.pnfsimulator.message.MessageConstants.OTHER_FIELDS_VERSION;
-import static org.onap.pnfsimulator.message.MessageConstants.PNF_LAST_SERVICE_DATE;
-import static org.onap.pnfsimulator.message.MessageConstants.PNF_MANUFACTURE_DATE;
-import static org.onap.pnfsimulator.message.MessageConstants.PRIORITY;
-import static org.onap.pnfsimulator.message.MessageConstants.SEQUENCE;
-import static org.onap.pnfsimulator.message.MessageConstants.START_EPOCH_MICROSEC;
-import static org.onap.pnfsimulator.message.MessageConstants.VERSION;
import static org.onap.pnfsimulator.message.MessageConstants.EVENT;
+import static org.onap.pnfsimulator.message.MessageConstants.PNF_REGISTRATION_FIELDS;
-import java.util.UUID;
import org.json.JSONObject;
import org.junit.jupiter.api.BeforeAll;
import org.junit.jupiter.api.Test;
@@ -47,7 +34,7 @@ import org.junit.jupiter.api.Test;
public class MessageProviderTest {
private static final String testParamsJson =
- "{\"key1\": \"val1\",\"key2\": \"val2\",\"pnfKey3\": \"pnfVal3\",\"key4\": \"val4\"}";
+ "{\"key1\": \"val1\",\"key2\": \"val2\",\"pnf_key3\": \"pnfVal3\",\"key4\": \"val4\"}";
private static MessageProvider messageProvider;
@@ -69,19 +56,19 @@ public class MessageProviderTest {
JSONObject event = message.getJSONObject(EVENT);
JSONObject commonEventHeader = event.getJSONObject(COMMON_EVENT_HEADER);
- JSONObject otherFields = event.getJSONObject(OTHER_FIELDS);
+ JSONObject pnfRegistrationFields = event.getJSONObject(PNF_REGISTRATION_FIELDS);
- JSONObject expectedCommonEventHeader = generateConstantCommonEventHeader();
- JSONObject expectedOtherFields = generateConstantOtherFields();
+ JSONObject expectedCommonEventHeader = JSONObjectFactory.generateConstantCommonEventHeader();
+ JSONObject expectedPnfRegistrationFields = JSONObjectFactory.generatePnfRegistrationFields();
expectedCommonEventHeader
.toMap()
.forEach((key, val) -> assertTrue(commonEventHeader.has(key),
() -> String.format("Key %s is not present", key)));
- expectedOtherFields
+ expectedPnfRegistrationFields
.toMap()
- .forEach((key, val) -> assertTrue(otherFields.has(key),
+ .forEach((key, val) -> assertTrue(pnfRegistrationFields.has(key),
() -> String.format("Key %s is not present", key)));
}
@@ -93,41 +80,12 @@ public class MessageProviderTest {
JSONObject event = message.getJSONObject(EVENT);
JSONObject commonEventHeader = event.getJSONObject(COMMON_EVENT_HEADER);
- JSONObject otherFields = event.getJSONObject(OTHER_FIELDS);
+ JSONObject pnfRegistrationFields = event.getJSONObject(PNF_REGISTRATION_FIELDS);
- assertEquals("pnfVal3", otherFields.getString("pnfKey3"));
+ assertEquals("pnfVal3", pnfRegistrationFields.getString("key3"));
assertEquals("val1", commonEventHeader.getString("key1"));
assertEquals("val2", commonEventHeader.getString("key2"));
assertEquals("val4", commonEventHeader.getString("key4"));
}
-
- private JSONObject generateConstantCommonEventHeader() {
-
- JSONObject commonEventHeader = new JSONObject();
- long timestamp = System.currentTimeMillis();
-
- commonEventHeader.put(DOMAIN, "other");
- commonEventHeader.put(EVENT_ID, UUID.randomUUID() + "-reg");
- commonEventHeader.put(EVENT_TYPE, "pnfRegistration");
- commonEventHeader.put(LAST_EPOCH_MICROSEC, timestamp);
- commonEventHeader.put(PRIORITY, "Normal");
- commonEventHeader.put(SEQUENCE, 0);
- commonEventHeader.put(START_EPOCH_MICROSEC, timestamp);
- commonEventHeader.put(INTERNAL_HEADER_FIELDS, new JSONObject());
- commonEventHeader.put(VERSION, 3);
-
- return commonEventHeader;
- }
-
- private JSONObject generateConstantOtherFields() {
- JSONObject otherFields = new JSONObject();
-
- otherFields.put(OTHER_FIELDS_VERSION, 1);
- otherFields.put(PNF_LAST_SERVICE_DATE, 1517206400);
- otherFields.put(PNF_MANUFACTURE_DATE, 1516406400);
-
- return otherFields;
- }
-
}
diff --git a/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/NetconfConfigurationCheckingTaskTest.java b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/NetconfConfigurationCheckingTaskTest.java
new file mode 100644
index 000000000..99cae00df
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/NetconfConfigurationCheckingTaskTest.java
@@ -0,0 +1,94 @@
+/*
+ * ============LICENSE_START=======================================================
+ * PNF-REGISTRATION-HANDLER
+ * ================================================================================
+ * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.pnfsimulator.netconfmonitor;
+
+import static org.mockito.ArgumentMatchers.any;
+import static org.mockito.Mockito.never;
+import static org.mockito.Mockito.verify;
+import static org.mockito.Mockito.when;
+
+import com.tailf.jnc.JNCException;
+import java.io.IOException;
+import org.junit.jupiter.api.BeforeEach;
+import org.junit.jupiter.api.Test;
+import org.mockito.Mock;
+import org.mockito.MockitoAnnotations;
+import org.onap.pnfsimulator.netconfmonitor.netconf.NetconfConfigurationCache;
+import org.onap.pnfsimulator.netconfmonitor.netconf.NetconfConfigurationReader;
+import org.onap.pnfsimulator.netconfmonitor.netconf.NetconfConfigurationWriter;
+
+class NetconfConfigurationCheckingTaskTest {
+
+ private NetconfConfigurationCheckingTask checkingTask;
+
+ @Mock
+ private NetconfConfigurationReader reader;
+ @Mock
+ private NetconfConfigurationWriter writer;
+ @Mock
+ private NetconfConfigurationCache cache;
+
+ @BeforeEach
+ void setup() {
+ MockitoAnnotations.initMocks(this);
+ checkingTask = new NetconfConfigurationCheckingTask(reader, writer, cache);
+ }
+
+ @Test
+ void run_should_update_configuration_when_changed() throws IOException, JNCException {
+ String configuration = "newConfiguration";
+ when(reader.read()).thenReturn(configuration);
+ when(cache.getConfiguration()).thenReturn("oldConfiguration");
+
+ checkingTask.run();
+
+ verify(reader).read();
+ verify(cache).getConfiguration();
+ verify(writer).writeToFile(configuration);
+ verify(cache).update(configuration);
+ }
+
+ @Test
+ void run_should_not_update_configuration_when_same() throws IOException, JNCException {
+ String configuration = "configuration";
+ when(reader.read()).thenReturn(configuration);
+ when(cache.getConfiguration()).thenReturn("configuration");
+
+ checkingTask.run();
+
+ verify(reader).read();
+ verify(cache).getConfiguration();
+ verify(writer, never()).writeToFile(configuration);
+ verify(cache, never()).update(configuration);
+ }
+
+ @Test
+ void run_should_not_take_any_action_when_failed_to_read_configuration() throws IOException, JNCException {
+ when(reader.read()).thenThrow(new IOException());
+
+ checkingTask.run();
+
+ verify(reader).read();
+ verify(cache, never()).getConfiguration();
+ verify(writer, never()).writeToFile(any());
+ verify(cache, never()).update(any());
+ }
+} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorServiceConfigurationTest.java b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorServiceConfigurationTest.java
new file mode 100644
index 000000000..02b8423f1
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorServiceConfigurationTest.java
@@ -0,0 +1,72 @@
+/*
+ * ============LICENSE_START=======================================================
+ * PNF-REGISTRATION-HANDLER
+ * ================================================================================
+ * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.pnfsimulator.netconfmonitor;
+
+import static org.junit.jupiter.api.Assertions.assertNotNull;
+import static org.mockito.ArgumentMatchers.any;
+import static org.mockito.Mockito.doReturn;
+import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.spy;
+import static org.mockito.Mockito.verify;
+
+import com.tailf.jnc.JNCException;
+import com.tailf.jnc.NetconfSession;
+import java.io.IOException;
+import org.junit.jupiter.api.BeforeEach;
+import org.junit.jupiter.api.Test;
+import org.mockito.Mock;
+
+class NetconfMonitorServiceConfigurationTest {
+
+ private NetconfMonitorServiceConfiguration configuration;
+
+ @Mock
+ private NetconfSession netconfSession;
+
+ @BeforeEach
+ void setup() {
+ netconfSession = mock(NetconfSession.class);
+ configuration = spy(new NetconfMonitorServiceConfiguration());
+ }
+
+ @Test
+ void readNetconfConfiguration() throws IOException, JNCException {
+ doReturn(netconfSession).when(configuration).createNetconfSession(any());
+
+ assertNotNull(configuration.configurationReader());
+ verify(configuration).createNetconfSession(any());
+ }
+
+ @Test
+ void configurationCacheIsNotNull() {
+ assertNotNull(configuration.configurationCache());
+ }
+
+ @Test
+ void netconfConfigurationWriterIsNotNull() {
+ assertNotNull(configuration.netconfConfigurationWriter());
+ }
+
+ @Test
+ void timerIsNotNull() {
+ assertNotNull(configuration.timer());
+ }
+} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorServiceTest.java b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorServiceTest.java
new file mode 100644
index 000000000..4f5da3309
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/NetconfMonitorServiceTest.java
@@ -0,0 +1,73 @@
+/*
+ * ============LICENSE_START=======================================================
+ * PNF-REGISTRATION-HANDLER
+ * ================================================================================
+ * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.pnfsimulator.netconfmonitor;
+
+import static org.mockito.ArgumentMatchers.anyString;
+import static org.mockito.Mockito.any;
+import static org.mockito.Mockito.anyLong;
+import static org.mockito.Mockito.doNothing;
+import static org.mockito.Mockito.times;
+import static org.mockito.Mockito.verify;
+import static org.mockito.Mockito.when;
+
+import com.tailf.jnc.JNCException;
+import java.io.IOException;
+import java.util.Timer;
+import org.junit.jupiter.api.BeforeEach;
+import org.junit.jupiter.api.Test;
+import org.mockito.Mock;
+import org.mockito.MockitoAnnotations;
+import org.onap.pnfsimulator.netconfmonitor.netconf.NetconfConfigurationCache;
+import org.onap.pnfsimulator.netconfmonitor.netconf.NetconfConfigurationReader;
+import org.onap.pnfsimulator.netconfmonitor.netconf.NetconfConfigurationWriter;
+
+class NetconfMonitorServiceTest {
+
+ private NetconfMonitorService service;
+
+ @Mock
+ private Timer timer;
+ @Mock
+ private NetconfConfigurationReader reader;
+ @Mock
+ private NetconfConfigurationWriter writer;
+ @Mock
+ private NetconfConfigurationCache cache;
+
+ @BeforeEach
+ void setup() {
+ MockitoAnnotations.initMocks(this);
+ service = new NetconfMonitorService(timer, reader, writer, cache);
+ }
+
+ @Test
+ void startNetconfService() throws IOException, JNCException {
+ when(reader.read()).thenReturn("message");
+ doNothing().when(writer).writeToFile(anyString());
+ doNothing().when(cache).update(anyString());
+
+ service.start();
+
+ verify(cache, times(1)).update(anyString());
+ verify(writer, times(1)).writeToFile(anyString());
+ verify(timer, times(1)).scheduleAtFixedRate(any(), anyLong(), anyLong());
+ }
+} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfSessionFactory.java b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationCacheTest.java
index 4f31af5eb..56f62ac50 100644
--- a/test/mocks/pnfsimulator/src/main/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfSessionFactory.java
+++ b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationCacheTest.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -20,20 +20,19 @@
package org.onap.pnfsimulator.netconfmonitor.netconf;
-import com.tailf.jnc.JNCException;
-import com.tailf.jnc.NetconfSession;
-import com.tailf.jnc.SSHConnection;
-import com.tailf.jnc.SSHSession;
+import static org.junit.jupiter.api.Assertions.assertEquals;
-import java.io.IOException;
+import org.junit.jupiter.api.Test;
-public final class NetconfSessionFactory {
- private NetconfSessionFactory() {}
+public class NetconfConfigurationCacheTest {
- public static NetconfSession create(NetconfConnectionParams params) throws IOException, JNCException {
- SSHConnection sshConnection = new SSHConnection(params.address, params.port);
- sshConnection.authenticateWithPassword(params.user, params.password);
- SSHSession sshSession = new SSHSession(sshConnection);
- return new NetconfSession(sshSession);
+ private static final String CONFIGURATION = "sampleConfiguration";
+
+ @Test
+ void changeConfigurationAfterUpdate() {
+ NetconfConfigurationCache configurationCache = new NetconfConfigurationCache();
+ configurationCache.update(CONFIGURATION);
+
+ assertEquals(CONFIGURATION, configurationCache.getConfiguration());
}
-}
+} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationReaderTest.java b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationReaderTest.java
new file mode 100644
index 000000000..65b2bc32e
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationReaderTest.java
@@ -0,0 +1,70 @@
+/*
+ * ============LICENSE_START=======================================================
+ * PNF-REGISTRATION-HANDLER
+ * ================================================================================
+ * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.pnfsimulator.netconfmonitor.netconf;
+
+import static org.junit.jupiter.api.Assertions.assertEquals;
+import static org.mockito.ArgumentMatchers.anyString;
+import static org.mockito.Mockito.verify;
+import static org.mockito.Mockito.when;
+
+import com.tailf.jnc.Element;
+import com.tailf.jnc.JNCException;
+import com.tailf.jnc.NetconfSession;
+import com.tailf.jnc.NodeSet;
+import java.io.IOException;
+import org.junit.jupiter.api.BeforeEach;
+import org.junit.jupiter.api.Test;
+import org.mockito.Mock;
+import org.mockito.MockitoAnnotations;
+
+class NetconfConfigurationReaderTest {
+
+ private static final String NETCONF_MODEL_PATH = "";
+ private static final String EXPECTED_STRING_XML = "<?xml version=\"1.0\"?>";
+ private NetconfConfigurationReader reader;
+
+ @Mock
+ private NetconfSession netconfSession;
+ @Mock
+ private NodeSet nodeSet;
+ @Mock
+ private Element element;
+
+ @BeforeEach
+ void setup() {
+ MockitoAnnotations.initMocks(this);
+ reader = new NetconfConfigurationReader(netconfSession, NETCONF_MODEL_PATH);
+ }
+
+ @Test
+ void properlyReadXML() throws IOException, JNCException {
+ when(netconfSession.getConfig(anyString())).thenReturn(nodeSet);
+ when(nodeSet.first()).thenReturn(element);
+ when(element.toXMLString()).thenReturn(EXPECTED_STRING_XML);
+
+ String result = reader.read();
+
+ verify(netconfSession).getConfig(anyString());
+ verify(nodeSet).first();
+ verify(element).toXMLString();
+ assertEquals(EXPECTED_STRING_XML, result);
+ }
+} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationWriterTest.java b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationWriterTest.java
new file mode 100644
index 000000000..2baee21b7
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/netconfmonitor/netconf/NetconfConfigurationWriterTest.java
@@ -0,0 +1,67 @@
+/*
+ * ============LICENSE_START=======================================================
+ * PNF-REGISTRATION-HANDLER
+ * ================================================================================
+ * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.pnfsimulator.netconfmonitor.netconf;
+
+import static org.junit.jupiter.api.Assertions.assertEquals;
+import static org.junit.jupiter.api.Assertions.assertFalse;
+
+import java.io.File;
+import java.io.IOException;
+import java.nio.file.Files;
+import java.nio.file.Paths;
+import org.apache.commons.io.FileUtils;
+import org.junit.Rule;
+import org.junit.jupiter.api.Test;
+import org.junit.jupiter.migrationsupport.rules.EnableRuleMigrationSupport;
+import org.junit.rules.TemporaryFolder;
+
+@EnableRuleMigrationSupport
+class NetconfConfigurationWriterTest {
+
+ private static final String TEST_CONFIGURATION = "test-configuration";
+
+ @Rule
+ public TemporaryFolder temporaryFolder = new TemporaryFolder();
+
+ @Test
+ void writeToFile_should_write_sample_config_when_directory_exists() throws IOException {
+ File file = temporaryFolder.newFolder("temp");
+ NetconfConfigurationWriter configurationWriter = new NetconfConfigurationWriter(file.getPath());
+
+ configurationWriter.writeToFile(TEST_CONFIGURATION);
+
+ File[] files = file.listFiles();
+ assertEquals(1, files.length);
+
+ String content = FileUtils.readFileToString(files[0], "UTF-8");
+ assertEquals(TEST_CONFIGURATION, content);
+ }
+
+ @Test
+ void writeToFile_should_not_write_config_when_directory_doesnt_exist() {
+ String logFolderPath = "/not/existing/logs";
+ NetconfConfigurationWriter configurationWriter = new NetconfConfigurationWriter(logFolderPath);
+
+ configurationWriter.writeToFile(TEST_CONFIGURATION);
+
+ assertFalse(Files.exists(Paths.get(logFolderPath)));
+ }
+} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/rest/SimulatorControllerTest.java b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/rest/SimulatorControllerTest.java
new file mode 100644
index 000000000..8cb190609
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/rest/SimulatorControllerTest.java
@@ -0,0 +1,195 @@
+/*
+ * ============LICENSE_START=======================================================
+ * PNF-REGISTRATION-HANDLER
+ * ================================================================================
+ * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.pnfsimulator.rest;
+
+import static org.mockito.ArgumentMatchers.anyString;
+import static org.mockito.Mockito.any;
+import static org.mockito.Mockito.doThrow;
+import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.spy;
+import static org.mockito.Mockito.verify;
+import static org.mockito.Mockito.when;
+import static org.springframework.test.web.servlet.request.MockMvcRequestBuilders.get;
+import static org.springframework.test.web.servlet.request.MockMvcRequestBuilders.post;
+import static org.springframework.test.web.servlet.result.MockMvcResultMatchers.jsonPath;
+import static org.springframework.test.web.servlet.result.MockMvcResultMatchers.status;
+
+import java.time.Duration;
+import org.junit.jupiter.api.BeforeEach;
+import org.junit.jupiter.api.Test;
+import org.mockito.InjectMocks;
+import org.mockito.Mock;
+import org.mockito.MockitoAnnotations;
+import org.onap.pnfsimulator.simulator.Simulator;
+import org.onap.pnfsimulator.simulator.SimulatorFactory;
+import org.onap.pnfsimulator.simulator.client.HttpClientAdapter;
+import org.onap.pnfsimulator.simulator.validation.JSONValidator;
+import org.onap.pnfsimulator.simulator.validation.ValidationException;
+import org.springframework.test.web.servlet.MockMvc;
+import org.springframework.test.web.servlet.setup.MockMvcBuilders;
+
+class SimulatorControllerTest {
+
+ private static final String START_URL = "/simulator/start";
+ private static final String STOP_URL = "/simulator/stop";
+ private static final String STATUS_URL = "/simulator/status";
+ private static final String JSON_MSG_EXPRESSION = "$.message";
+ private static final String JSON_STATUS_EXPRESSION = "$.simulatorStatus";
+ private static final String PROPER_JSON = "{\n" +
+ " \"simulatorParams\": {\n" +
+ " \"vesServerUrl\": \"http://10.154.187.70:8080/eventListener/v5\",\n" +
+ " \"testDuration\": \"10\",\n" +
+ " \"messageInterval\": \"1\"\n" +
+ " },\n" +
+ " \"messageParams\": {\n" +
+ " \"pnfSerialNumber\": \"val1\",\n" +
+ " \"pnfVendorName\": \"val2\",\n" +
+ " \"pnfOamIpv4Address\": \"val3\",\n" +
+ " \"pnfOamIpv6Address\": \"val4\",\n" +
+ " \"pnfFamily\": \"val5\",\n" +
+ " \"pnfModelNumber\": \"val6\",\n" +
+ " \"pnfSoftwareVersion\": \"val7\",\n" +
+ " \"pnfType\": \"val8\",\n" +
+ " \"eventName\": \"val9\",\n" +
+ " \"nfNamingCode\": \"val10\",\n" +
+ " \"nfcNamingCode\": \"val11\",\n" +
+ " \"sourceName\": \"val12\",\n" +
+ " \"sourceId\": \"val13\",\n" +
+ " \"reportingEntityName\": \"val14\"\n" +
+ " }\n" +
+ "}";
+ private static final String WRONG_JSON = "{\n" +
+ " \"mes\": {\n" +
+ " \"vesServerUrl\": \"http://10.154.187.70:8080/eventListener/v5\",\n" +
+ " \"testDuration\": \"10\",\n" +
+ " \"messageInterval\": \"1\"\n" +
+ " },\n" +
+ " \"messageParams\": {\n" +
+ " \"sourceName\": \"val12\",\n" +
+ " \"sourceId\": \"val13\",\n" +
+ " \"reportingEntityName\": \"val14\"\n" +
+ " }\n" +
+ "}\n";
+
+ private MockMvc mockMvc;
+
+ @InjectMocks
+ private SimulatorController controller;
+
+ @Mock
+ private SimulatorFactory factory;
+ @Mock
+ private JSONValidator validator;
+
+ private Simulator simulator;
+
+ @BeforeEach
+ void setup() {
+ MockitoAnnotations.initMocks(this);
+ simulator = createEndlessSimulator();
+ mockMvc = MockMvcBuilders
+ .standaloneSetup(controller)
+ .build();
+ }
+
+ private Simulator createEndlessSimulator() {
+ return spy(Simulator.builder()
+ .withCustomHttpClientAdapter(mock(HttpClientAdapter.class))
+ .withInterval(Duration.ofMinutes(1))
+ .build());
+ }
+
+ @Test
+ void wrongJSONFormatOnStart() throws Exception {
+ when(factory.create(any(), any())).thenReturn(simulator);
+ doThrow(new ValidationException("")).when(validator).validate(anyString(), anyString());
+
+ mockMvc.perform(post("/simulator/start").content(WRONG_JSON))
+ .andExpect(status().isBadRequest())
+ .andExpect(jsonPath("$.message").value("Cannot start simulator - Json format " +
+ "is not compatible with schema definitions"));
+ verify(validator).validate(anyString(), anyString());
+ }
+
+ @Test
+ void startSimulatorProperly() throws Exception {
+ startSimulator();
+
+ verify(validator).validate(anyString(), anyString());
+ verify(factory).create(any(), any());
+ verify(simulator).start();
+ }
+
+ @Test
+ void notStartWhenAlreadyRunning() throws Exception {
+ startSimulator();
+
+ mockMvc
+ .perform(post(START_URL).content(PROPER_JSON))
+ .andExpect(status().isBadRequest())
+ .andExpect(jsonPath(JSON_MSG_EXPRESSION).value("Cannot start simulator since it's already running"));
+ }
+
+ @Test
+ void stopSimulatorWhenRunning() throws Exception {
+ startSimulator();
+
+ mockMvc
+ .perform(post(STOP_URL))
+ .andExpect(status().isOk())
+ .andExpect(jsonPath(JSON_MSG_EXPRESSION).value("Simulator successfully stopped"));
+ }
+
+ @Test
+ void getNotRunningMessageWhenOff() throws Exception {
+ mockMvc
+ .perform(post(STOP_URL))
+ .andExpect(status().isBadRequest())
+ .andExpect(jsonPath(JSON_MSG_EXPRESSION).value("Cannot stop simulator, because it's not running"));
+ }
+
+ @Test
+ void getRunningStatusWhenOn() throws Exception {
+ startSimulator();
+
+ mockMvc
+ .perform(get(STATUS_URL))
+ .andExpect(status().isOk())
+ .andExpect(jsonPath(JSON_STATUS_EXPRESSION).value("RUNNING"));
+ }
+
+ @Test
+ void getNotRunningStatusWhenOff() throws Exception {
+ mockMvc
+ .perform(get(STATUS_URL))
+ .andExpect(status().isOk())
+ .andExpect(jsonPath(JSON_STATUS_EXPRESSION).value("NOT RUNNING"));
+ }
+
+ private void startSimulator() throws Exception {
+ when(factory.create(any(), any())).thenReturn(simulator);
+
+ mockMvc
+ .perform(post(START_URL).content(PROPER_JSON))
+ .andExpect(status().isOk())
+ .andExpect(jsonPath(JSON_MSG_EXPRESSION).value("Simulator started"));
+ }
+} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/rest/util/DateUtilTest.java b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/rest/util/DateUtilTest.java
new file mode 100644
index 000000000..99b9af7ec
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/rest/util/DateUtilTest.java
@@ -0,0 +1,38 @@
+/*
+ * ============LICENSE_START=======================================================
+ * PNF-REGISTRATION-HANDLER
+ * ================================================================================
+ * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.pnfsimulator.rest.util;
+
+import static org.junit.jupiter.api.Assertions.assertEquals;
+
+import java.text.SimpleDateFormat;
+import java.util.Calendar;
+import org.junit.jupiter.api.Test;
+
+class DateUtilTest {
+
+ @Test
+ void getFormattedDate() {
+ Calendar currentCalendar = Calendar.getInstance();
+ String expectedResult = String.valueOf(currentCalendar.get(Calendar.YEAR));
+
+ assertEquals(expectedResult, DateUtil.getTimestamp(new SimpleDateFormat("yyyy")));
+ }
+} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/rest/util/ResponseBuilderTest.java b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/rest/util/ResponseBuilderTest.java
index a8147340e..59e1e3b4f 100644
--- a/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/rest/util/ResponseBuilderTest.java
+++ b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/rest/util/ResponseBuilderTest.java
@@ -1,6 +1,6 @@
-/*-
+/*
* ============LICENSE_START=======================================================
- * org.onap.integration
+ * PNF-REGISTRATION-HANDLER
* ================================================================================
* Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
* ================================================================================
@@ -20,40 +20,46 @@
package org.onap.pnfsimulator.rest.util;
-import org.junit.jupiter.api.BeforeEach;
+import static org.junit.jupiter.api.Assertions.assertAll;
+import static org.junit.jupiter.api.Assertions.assertEquals;
+import static org.junit.jupiter.api.Assertions.assertNull;
+
+import java.util.Map;
import org.junit.jupiter.api.Test;
import org.springframework.http.HttpStatus;
import org.springframework.http.ResponseEntity;
-import java.util.Map;
-import static org.junit.jupiter.api.Assertions.*;
public class ResponseBuilderTest {
- private static final int SAMPLE_STATUS_CODE = 200;
- private ResponseBuilder builder;
- @BeforeEach
- void setup() {
- builder = ResponseBuilder.status(SAMPLE_STATUS_CODE);
- }
+ private static final HttpStatus SAMPLE_STATUS = HttpStatus.OK;
@Test
- void checkResponseBodySize() {
- builder.put("sample", "sample");
- ResponseEntity responseEntity = builder.build();
- Map<String, Object> body = (Map<String, Object>) responseEntity.getBody();
+ void response_should_have_empty_body_when_built_immediately() {
+ ResponseEntity responseEntity = ResponseBuilder.status(SAMPLE_STATUS).build();
- assertEquals(body.size(), 1);
+ assertAll(
+ () -> assertEquals(responseEntity.getStatusCode(), SAMPLE_STATUS),
+ () -> assertNull(responseEntity.getBody())
+ );
}
@Test
- void buildProperResponseEntity() {
- ResponseEntity responseEntity = builder.build();
+ void builder_should_set_response_status_and_body() {
+ String key = "key";
+ String value = "value";
+ ResponseEntity response = ResponseBuilder
+ .status(SAMPLE_STATUS)
+ .put(key, value)
+ .build();
+
+ Map<String, Object> body = (Map<String, Object>) response.getBody();
assertAll(
- () -> assertEquals(responseEntity.getStatusCode(), HttpStatus.OK),
- () -> assertNull(responseEntity.getBody())
+ () -> assertEquals(SAMPLE_STATUS, response.getStatusCode()),
+ () -> assertEquals(value, body.get(key))
);
}
+
} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/SimulatorFactoryTest.java b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/SimulatorFactoryTest.java
new file mode 100644
index 000000000..970f8cfaa
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/SimulatorFactoryTest.java
@@ -0,0 +1,80 @@
+/*
+ * ============LICENSE_START=======================================================
+ * PNF-REGISTRATION-HANDLER
+ * ================================================================================
+ * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.pnfsimulator.simulator;
+
+import static org.junit.jupiter.api.Assertions.assertNotNull;
+import static org.junit.jupiter.api.Assertions.assertThrows;
+import static org.onap.pnfsimulator.simulator.TestMessages.INVALID_MESSAGE_PARAMS_1;
+import static org.onap.pnfsimulator.simulator.TestMessages.INVALID_MESSAGE_PARAMS_2;
+import static org.onap.pnfsimulator.simulator.TestMessages.INVALID_MESSAGE_PARAMS_3;
+import static org.onap.pnfsimulator.simulator.TestMessages.INVALID_SIMULATOR_PARAMS;
+import static org.onap.pnfsimulator.simulator.TestMessages.VALID_MESSAGE_PARAMS;
+import static org.onap.pnfsimulator.simulator.TestMessages.VALID_SIMULATOR_PARAMS;
+
+import com.github.fge.jsonschema.core.exceptions.ProcessingException;
+import java.io.IOException;
+import org.json.JSONException;
+import org.junit.jupiter.api.BeforeEach;
+import org.junit.jupiter.api.Disabled;
+import org.junit.jupiter.api.Test;
+import org.onap.pnfsimulator.message.MessageProvider;
+import org.onap.pnfsimulator.simulator.validation.JSONValidator;
+import org.onap.pnfsimulator.simulator.validation.ValidationException;
+
+class SimulatorFactoryTest {
+
+
+ private SimulatorFactory simulatorFactory;
+
+ @BeforeEach
+ void setUp() {
+ simulatorFactory = new SimulatorFactory(new MessageProvider(), new JSONValidator());
+ }
+
+ @Test
+ void should_successfully_create_simulator_given_valid_params_and_valid_output_message()
+ throws ValidationException, IOException, ProcessingException {
+ assertNotNull(simulatorFactory.create(VALID_SIMULATOR_PARAMS, VALID_MESSAGE_PARAMS));
+ }
+
+ @Test
+ void should_throw_given_invalid_params() {
+ assertThrows(
+ JSONException.class,
+ () -> simulatorFactory.create(INVALID_SIMULATOR_PARAMS, VALID_MESSAGE_PARAMS));
+ }
+
+ @Test
+ void should_throw_given_valid_params_and_invalid_output_message() {
+
+ assertThrows(
+ ValidationException.class,
+ () -> simulatorFactory.create(VALID_SIMULATOR_PARAMS, INVALID_MESSAGE_PARAMS_1));
+
+ assertThrows(
+ ValidationException.class,
+ () -> simulatorFactory.create(VALID_SIMULATOR_PARAMS, INVALID_MESSAGE_PARAMS_2));
+
+ assertThrows(
+ ValidationException.class,
+ () -> simulatorFactory.create(VALID_SIMULATOR_PARAMS, INVALID_MESSAGE_PARAMS_3));
+ }
+} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/SimulatorTest.java b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/SimulatorTest.java
new file mode 100644
index 000000000..db9dbd785
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/SimulatorTest.java
@@ -0,0 +1,92 @@
+/*
+ * ============LICENSE_START=======================================================
+ * PNF-REGISTRATION-HANDLER
+ * ================================================================================
+ * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.pnfsimulator.simulator;
+
+import static org.junit.jupiter.api.Assertions.assertFalse;
+import static org.junit.jupiter.api.Assertions.assertTimeout;
+import static org.junit.jupiter.api.Assertions.assertTrue;
+import static org.mockito.Mockito.atLeast;
+import static org.mockito.Mockito.verify;
+
+import java.time.Duration;
+import org.json.JSONObject;
+import org.junit.jupiter.api.Test;
+import org.junit.jupiter.api.function.Executable;
+import org.mockito.Mockito;
+import org.onap.pnfsimulator.simulator.client.HttpClientAdapter;
+
+class SimulatorTest {
+
+ private static final String TEST_VES_URL = "http://test-ves-url";
+
+ @Test
+ void builder_should_create_endless_simulator_when_duration_not_specified() {
+ Simulator simulator = Simulator
+ .builder()
+ .withDuration(Duration.ofSeconds(1))
+ .withVesUrl(TEST_VES_URL).build();
+
+ assertFalse(simulator.isEndless());
+
+ simulator = Simulator
+ .builder()
+ .withVesUrl(TEST_VES_URL).build();
+
+ assertTrue(simulator.isEndless());
+ }
+
+ @Test
+ void simulator_should_send_given_message() {
+
+ JSONObject messageBody = new JSONObject("{\"key\":\"val\"}");
+ HttpClientAdapter httpClientMock = Mockito.mock(HttpClientAdapter.class);
+
+ Simulator simulator = Simulator.builder()
+ .withDuration(Duration.ofMillis(100))
+ .withInterval(Duration.ofMillis(10))
+ .withMessageBody(messageBody)
+ .withCustomHttpClientAdapter(httpClientMock)
+ .withVesUrl(TEST_VES_URL).build();
+
+ simulator.start();
+
+ assertTimeout(Duration.ofMillis(150), (Executable) simulator::join);
+ verify(httpClientMock, atLeast(2)).send(messageBody.toString(), TEST_VES_URL);
+ }
+
+ @Test
+ void simulator_should_stop_when_interrupted() {
+
+ JSONObject messageBody = new JSONObject("{\"key\":\"val\"}");
+ HttpClientAdapter httpClientMock = Mockito.mock(HttpClientAdapter.class);
+
+ Simulator simulator = Simulator.builder()
+ .withInterval(Duration.ofSeconds(1))
+ .withMessageBody(messageBody)
+ .withCustomHttpClientAdapter(httpClientMock)
+ .withVesUrl(TEST_VES_URL).build();
+
+ simulator.start();
+ simulator.interrupt();
+
+ assertTimeout(Duration.ofSeconds(1), (Executable) simulator::join);
+ }
+} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/TestMessages.java b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/TestMessages.java
new file mode 100644
index 000000000..2f166b26f
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/TestMessages.java
@@ -0,0 +1,111 @@
+/*
+ * ============LICENSE_START=======================================================
+ * PNF-REGISTRATION-HANDLER
+ * ================================================================================
+ * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.pnfsimulator.simulator;
+
+import org.json.JSONObject;
+
+final class TestMessages {
+
+ static final JSONObject VALID_SIMULATOR_PARAMS = new JSONObject(
+ "{\n" +
+ " \"vesServerUrl\": \"http://10.42.111.42:8080/eventListener/v5\",\n" +
+ " \"testDuration\": \"10\",\n" +
+ " \"messageInterval\": \"1\"\n" +
+ "}");
+
+
+ static final JSONObject VALID_MESSAGE_PARAMS = new JSONObject(
+ "{\n"
+ + " \"pnf_serialNumber\": \"6061ZW3\",\n"
+ + " \"pnf_vendorName\": \"Nokia\",\n"
+ + " \"pnf_oamV4IpAddress\": \"val3\",\n"
+ + " \"pnf_oamV6IpAddress\": \"val4\",\n"
+ + " \"pnf_unitFamily\": \"BBU\",\n"
+ + " \"pnf_modelNumber\": \"val6\",\n"
+ + " \"pnf_softwareVersion\": \"val7\",\n"
+ + " \"pnf_unitType\": \"val8\",\n"
+ + " \"eventName\": \"pnfRegistration_Nokia_5gDu\",\n"
+ + " \"nfNamingCode\": \"gNB\",\n"
+ + " \"nfcNamingCode\": \"oam\",\n"
+ + " \"sourceName\": \"NOK6061ZW3\",\n"
+ + " \"sourceId\": \"val13\",\n"
+ + " \"reportingEntityName\": \"NOK6061ZW3\"\n"
+ + " }");
+
+ static final JSONObject INVALID_SIMULATOR_PARAMS = new JSONObject(
+ "{\n" +
+ " \"vesServerUrl\": \"http://10.42.111.42:8080/eventListener/v5\",\n" +
+ " \"messageInterval\": \"1\"\n" +
+ "}");
+
+
+ static final JSONObject INVALID_MESSAGE_PARAMS_1 = new JSONObject(
+ "{\n" +
+ " \"pnfSerialNumber\": \"val1\",\n" +
+ " \"pnfVendorName\": \"val2\",\n" +
+ " \"pnfFamily\": \"val5\",\n" +
+ " \"pnfModelNumber\": \"val6\",\n" +
+ " \"pnfSoftwareVersion\": \"val7\",\n" +
+ " \"pnfType\": \"val8\",\n" +
+ " \"eventName\": \"val9\",\n" +
+ " \"nfNamingCode\": \"val10\",\n" +
+ " \"nfcNamingCode\": \"val11\",\n" +
+ " \"sourceName\": \"val12\",\n" +
+ " \"sourceId\": \"val13\",\n" +
+ " \"reportingEntityName\": \"val14\"\n" +
+ "}");
+
+ static final JSONObject INVALID_MESSAGE_PARAMS_2 = new JSONObject(
+ "{\n" +
+ " \"pnfVendorName\": \"val2\",\n" +
+ " \"pnfOamIpv4Address\": \"val3\",\n" +
+ " \"pnfOamIpv6Address\": \"val4\",\n" +
+ " \"pnfFamily\": \"val5\",\n" +
+ " \"pnfModelNumber\": \"val6\",\n" +
+ " \"pnfSoftwareVersion\": \"val7\",\n" +
+ " \"pnfType\": \"val8\",\n" +
+ " \"eventName\": \"val9\",\n" +
+ " \"nfNamingCode\": \"val10\",\n" +
+ " \"nfcNamingCode\": \"val11\",\n" +
+ " \"sourceName\": \"val12\",\n" +
+ " \"sourceId\": \"val13\",\n" +
+ " \"reportingEntityName\": \"val14\"\n" +
+ "}");
+
+ static final JSONObject INVALID_MESSAGE_PARAMS_3 = new JSONObject(
+ "{\n" +
+ " \"pnfSerialNumber\": \"val1\",\n" +
+ " \"pnfOamIpv4Address\": \"val3\",\n" +
+ " \"pnfFamily\": \"val5\",\n" +
+ " \"pnfModelNumber\": \"val6\",\n" +
+ " \"pnfSoftwareVersion\": \"val7\",\n" +
+ " \"pnfType\": \"val8\",\n" +
+ " \"eventName\": \"val9\",\n" +
+ " \"nfNamingCode\": \"val10\",\n" +
+ " \"nfcNamingCode\": \"val11\",\n" +
+ " \"sourceName\": \"val12\",\n" +
+ " \"sourceId\": \"val13\",\n" +
+ " \"reportingEntityName\": \"val14\"\n" +
+ "}");
+
+ private TestMessages() {
+ }
+}
diff --git a/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/client/HttpClientAdapterImplTest.java b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/client/HttpClientAdapterImplTest.java
new file mode 100644
index 000000000..a4fb9eb04
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/client/HttpClientAdapterImplTest.java
@@ -0,0 +1,71 @@
+/*
+ * ============LICENSE_START=======================================================
+ * PNF-REGISTRATION-HANDLER
+ * ================================================================================
+ * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.pnfsimulator.simulator.client;
+
+import static org.mockito.ArgumentMatchers.any;
+import static org.mockito.Mockito.doReturn;
+import static org.mockito.Mockito.doThrow;
+import static org.mockito.Mockito.never;
+import static org.mockito.Mockito.verify;
+import static org.mockito.MockitoAnnotations.initMocks;
+
+import java.io.IOException;
+import org.apache.http.HttpResponse;
+import org.apache.http.client.HttpClient;
+import org.junit.jupiter.api.BeforeEach;
+import org.junit.jupiter.api.Test;
+import org.mockito.Mock;
+
+class HttpClientAdapterImplTest {
+
+ private HttpClientAdapter adapter;
+
+ @Mock
+ private HttpClient httpClient;
+ @Mock
+ private HttpResponse httpResponse;
+
+ @BeforeEach
+ void setup() {
+ initMocks(this);
+ adapter = new HttpClientAdapterImpl(httpClient);
+ }
+
+ @Test
+ void send_should_successfully_send_request_given_valid_url() throws IOException {
+ doReturn(httpResponse).when(httpClient).execute(any());
+
+ adapter.send("test-msg", "http://valid-url");
+
+ verify(httpClient).execute(any());
+ verify(httpResponse).getStatusLine();
+ }
+
+ @Test
+ void send_should_not_send_request_given_invalid_url() throws IOException {
+ doThrow(new IOException("test")).when(httpClient).execute(any());
+
+ adapter.send("test-msg", "http://invalid-url");
+
+ verify(httpClient).execute(any());
+ verify(httpResponse, never()).getStatusLine();
+ }
+}
diff --git a/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/validation/JSONValidatorTest.java b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/validation/JSONValidatorTest.java
new file mode 100644
index 000000000..30dfe065e
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/test/java/org/onap/pnfsimulator/simulator/validation/JSONValidatorTest.java
@@ -0,0 +1,123 @@
+/*
+ * ============LICENSE_START=======================================================
+ * PNF-REGISTRATION-HANDLER
+ * ================================================================================
+ * Copyright (C) 2018 NOKIA Intellectual Property. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.pnfsimulator.simulator.validation;
+
+import static org.junit.jupiter.api.Assertions.assertThrows;
+
+import com.github.fge.jsonschema.core.exceptions.InvalidSchemaException;
+import com.github.fge.jsonschema.core.exceptions.ProcessingException;
+import java.io.IOException;
+import java.net.URL;
+import org.json.JSONObject;
+import org.junit.jupiter.api.BeforeEach;
+import org.junit.jupiter.api.Test;
+
+class JSONValidatorTest {
+
+ private final static String VALID_SCHEMA_NAME = "valid-test-schema.json";
+ private final static String INVALID_SCHEMA_NAME = "invalid-test-schema.json";
+
+ private JSONValidator validator;
+
+ @BeforeEach
+ void setUp() {
+ validator = new JSONValidator();
+ }
+
+ @Test
+ void validate_should_not_throw_given_valid_json() throws ProcessingException, IOException, ValidationException {
+ validator.validate(getValidJsonString(), getResourcePath(VALID_SCHEMA_NAME));
+ }
+
+ @Test
+ void validate_should_not_throw_when_optional_parameter_missing()
+ throws ProcessingException, IOException, ValidationException {
+
+ String invalidJsonString = new JSONObject()
+ .put("key1", "value1")
+ .put("key2", "value2")
+ .toString();
+
+ validator.validate(invalidJsonString, getResourcePath(VALID_SCHEMA_NAME));
+ }
+
+ @Test
+ void validate_should_throw_when_mandatory_parameter_missing() {
+
+ String invalidJsonString = new JSONObject()
+ .put("key1", "value1")
+ .put("key3", "value3")
+ .toString();
+
+ assertThrows(
+ ValidationException.class,
+ () -> validator.validate(invalidJsonString, getResourcePath(VALID_SCHEMA_NAME)));
+ }
+
+ @Test
+ void validate_should_throw_when_invalid_json_format() {
+ String invalidJsonString = "{" +
+ "\"key1\": \"value1\"" +
+ "\"key2\": \"value2" +
+ "}";
+
+ assertThrows(
+ IOException.class,
+ () -> validator.validate(invalidJsonString, getResourcePath(VALID_SCHEMA_NAME)));
+ }
+
+ @Test
+ void validate_should_throw_when_invalid_schema_format() {
+ assertThrows(
+ InvalidSchemaException.class,
+ () -> validator.validate(getValidJsonString(), getResourcePath(INVALID_SCHEMA_NAME)));
+ }
+
+ @Test
+ void validate_should_throw_when_invalid_schema_path() {
+
+ assertThrows(
+ IOException.class,
+ () -> validator.validate(getValidJsonString(), "/not/existing/path/schema.json"));
+ }
+
+ private String getResourcePath(String schemaFileName) {
+ URL result = getClass()
+ .getClassLoader()
+ .getResource(schemaFileName);
+
+ if (result == null) {
+ throw new IllegalArgumentException("Given file doesn't exist");
+ } else {
+ return result
+ .toString()
+ .replace("file:", "");
+ }
+ }
+
+ private String getValidJsonString() {
+ return new JSONObject()
+ .put("key1", "value1")
+ .put("key2", "value2")
+ .put("key3", "value3")
+ .toString();
+ }
+} \ No newline at end of file
diff --git a/test/mocks/pnfsimulator/src/test/resources/invalid-test-schema.json b/test/mocks/pnfsimulator/src/test/resources/invalid-test-schema.json
new file mode 100644
index 000000000..8c37c822b
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/test/resources/invalid-test-schema.json
@@ -0,0 +1,19 @@
+{
+ "type": "object",
+ "$schema": "http://json-schema.org/draft-07/schema#",
+ "properties": {
+ "key1": {
+ "type": "string"
+ },
+ "key2": {
+ "type": "string"
+ },
+ "key3": {
+ "type": "string"
+ },
+ "required": [
+ "key1",
+ "key2"
+ ]
+ }
+}
diff --git a/test/mocks/pnfsimulator/src/test/resources/logback-test.xml b/test/mocks/pnfsimulator/src/test/resources/logback-test.xml
new file mode 100644
index 000000000..d7966fe60
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/test/resources/logback-test.xml
@@ -0,0 +1,49 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<Configuration complete="true" compact="true">
+
+ <Property name="outputFilename" value="pnfsimulator_output"/>
+ <Property name="log-path" value="${java.io.tmpdir}"/>
+ <property name="maxFileSize" value="50MB"/>
+ <property name="maxHistory" value="30"/>
+ <property name="totalSizeCap" value="10GB"/>
+
+ <appender name="Console" target="SYSTEM_OUT" class="ch.qos.logback.core.ConsoleAppender">
+ <encoder>
+ <Pattern>%nopexception%logger
+ |%date{yyyy-MM-dd'T'HH:mm:ss.SSSXXX,UTC}
+ |%level
+ |%replace(%replace(%message){'\t','\\\\t'}){'\n','\\\\n'}
+ |%replace(%replace(%mdc){'\t','\\\\t'}){'\n','\\\\n'}
+ |%replace(%replace(%rootException){'\t','\\\\t'}){'\n','\\\\n'}
+ |%replace(%replace(%marker){'\t','\\\\t'}){'\n','\\\\n'}
+ |%thread
+ |%n</Pattern>
+ </encoder>
+ </appender>
+
+ <appender name="ROLLING-FILE" class="ch.qos.logback.core.rolling.RollingFileAppender">
+ <encoder>
+ <pattern>%nopexception%logger
+ |%date{yyyy-MM-dd'T'HH:mm:ss.SSSXXX,UTC}
+ |%level
+ |%replace(%replace(%message){'\t','\\\\t'}){'\n','\\\\n'}
+ |%replace(%replace(%mdc){'\t','\\\\t'}){'\n','\\\\n'}
+ |%replace(%replace(%rootException){'\t','\\\\t'}){'\n','\\\\n'}
+ |%replace(%replace(%marker){'\t','\\\\t'}){'\n','\\\\n'}
+ |%thread
+ |%n</pattern>
+ </encoder>
+ <File>${log-path}/${outputFilename}.log</File>
+ <rollingPolicy class="ch.qos.logback.core.rolling.SizeAndTimeBasedRollingPolicy">
+ <FileNamePattern>${log-path}/${outputFilename}.%d{yyyy-MM-dd}.%i.log.zip</FileNamePattern>
+ <MaxFileSize>${maxFileSize}</MaxFileSize>
+ <MaxHistory>${maxHistory}</MaxHistory>
+ <TotalSizeCap>${totalSizeCap}</TotalSizeCap>
+ </rollingPolicy>
+ </appender>
+
+ <root level="info">
+ <appender-ref ref="Console" />
+ <appender-ref ref="ROLLING-FILE" />
+ </root>
+</Configuration>
diff --git a/test/mocks/pnfsimulator/src/test/resources/valid-test-schema.json b/test/mocks/pnfsimulator/src/test/resources/valid-test-schema.json
new file mode 100644
index 000000000..26e48a5e8
--- /dev/null
+++ b/test/mocks/pnfsimulator/src/test/resources/valid-test-schema.json
@@ -0,0 +1,19 @@
+{
+ "type": "object",
+ "$schema": "http://json-schema.org/draft-07/schema#",
+ "properties": {
+ "key1": {
+ "type": "string"
+ },
+ "key2": {
+ "type": "string"
+ },
+ "key3": {
+ "type": "string"
+ }
+ },
+ "required": [
+ "key1",
+ "key2"
+ ]
+}
diff --git a/test/mocks/pnfsimulator/ssh/ssh_host_rsa_key b/test/mocks/pnfsimulator/ssh/ssh_host_rsa_key
new file mode 100644
index 000000000..1a3c49e37
--- /dev/null
+++ b/test/mocks/pnfsimulator/ssh/ssh_host_rsa_key
@@ -0,0 +1,54 @@
+-----BEGIN RSA PRIVATE KEY-----
+Proc-Type: 4,ENCRYPTED
+DEK-Info: AES-128-CBC,242034B2C46EE5D70C6017C29024CFAE
+
+33cZKnNILWwb7Xlw4sQLEWp5w72vS8znQr/T4Hd7mCxoxrTJM0Cm3oNM6zK92kMp
+tXtJiT/Mpz6zmlUrKwhcESk+4ovNHGkzVCyYQfofkb5jyYHT92HXA8H1Qd1oyKBA
+8DUDFdFqlW2EZS7joDrU/ImpWkAI4gysbhg40QUeWbjlO/gyzii7/gu6AgZ3RF8l
+hKu4600kk7m3xa28GqMm53k2TVlgAI7JBiFH/aTxeHhntjpO2NRwtQ+YQlx8DveH
+CXw1+RhfWa2CtBPosstuAza+8NPRreIclUjMBKz7FDWIucnMbBhLCoyZyCRctYy5
+exzIkjQ3Uacz0aV9GTNvmJ4HiratKPPsMzCVggk6bxQy+DfvcYdoP/Z8vsLvhCkg
+usOWh5EUDI918rPwwA6O9fZce8QJHp/SY29m5JboafWN9raUMd0Szdc3DcNYK0oR
+04dF7FZuRhrBY8c0xPJV99K9091Hnr9gJU+0dst6naw6z/X5ZXra+pBIPEAFkRdy
+eZLAr9sKsjEhEb+jY1T/PI2sfR1B9dygCZW/nqrpqHKqjxZ034R9AmrpSRiwb8BJ
+1omLjh49J6ys7ibmYk3pC+c4ry1vLlpg9Gr7pD0TJo3F8k826D4pPEzA70X7rVoD
+vZRg+TUKQ9cbECF8+/AuwA+vi12qU4vUPvgdQYl9EgrSpNdNN9St/C6RsNKK8I4D
+vPD2MN8gfxSJrQn/FyZlcujDX0MoX6NbsKKLkUdH/3FnAnjH9wZUCrE+SZFOZkT5
+uki7fa/+6Lc5M5s4v4Qi438lTJD9/PQUJ//WtNMQjZLM3rwgg68syJBZ/WoqqqLw
+585rAORYgXcHH62Vp71yUCwnwVvnPMOkjes01gGluZaCGVZptNRwE38GqED8nGGt
+dOpY7A59BlZAryeXN0UwI5ki6KIG/BeRrNULdkniTYp7zbod+Ac9cDBv1Aczzv04
+rAKlzJ5Ac/ROrqcHb3dJwdNMZA3hLWBRAHw4EtYRyyrn1WHNIKUJJivn3to7h+I5
+7dMQpWSWJ8MFCDBNN0RPmXECZVzwAKjHcGcq4YOZAKOzcHE5u+1GmtjiOhcvsisy
+5xelkqKKwcu+uY6CmlItaxNvyt4tLkS8BsbFDovx44CwDb6YzUkuw8KKPFjGp+H1
+qkqw/Iqqw9f5d8pcK8f5kZWnQOTYEadQvpSz0o8Qod4Kk98HyWl45/83YxK/SV1A
+yaQftzYw8WTpbBC164hKIQamyuZ6CIv8inAIaHs/zFIYNlDtriNDqt+uh/0WPe1b
+Y/7aA6I0cU1DggoXgU8irxHKVfll2Mk9r0wB1lvqvBU/LA6XPh6Crcc6iN+nQAtE
+YXWEdPV0n9mnOug1h+LiU4P5LmShkkm4+Bo3TBOjS3gGz7bzu7d8rWp8S+VUBcKM
+fa0sivE6CC24WMJXGxqs4YhC+3OIGjA2z7vfaLANBCWBycIM6TwtF3MgpX9hSIbL
+mFX7SFTHd/QCOAK930nXp/fpe78RBebyabyJ5tiOoXBQWyVGvqmXroGj6ajWojZT
+QMn8FuQQ+QpbKgFZCxgsQmkLelslcVUpvcqK26FC5t5+FoAfAzmzbVLdTVycAa77
+QDxkcaCgfIJAV/JbHfAZHJaoK2ZM8/xaygpDhRqjgIraCELMcyQR0V3pn3dgTahd
+ynZHxLMzeyyX700kyJEaG1DvA4s4io+C3naRg5te5sH6rgy/Zvq1ldA95husA3rf
+1LGEWnrudsm8mxJo3EfstiBJXltHxrG+kM99PDk3+c+eRAn0iSpFUeMn+2sWZRSZ
+6o7sRoBVAY6wRxi1qBftAnw9FLyhZhpz6Jp33DT3j8L8vD4il9zdv5gU4FZsdT8T
+B+d3/c2wIEuFYQCIrW/A+QVqEastChUexfNMenuj28QySifAXWjiVV8CifseG/OI
+hSn6+EfMVyK00DJEqjUeXH5Om3jxkfY+oldpx+HafITxqcvUsFVDSsP+CZPzhEz5
+HNidv0mH6eDmRwB+Nb1HoYFNdvnotrLotvdLr53POu/q3IM6Co8VAxkHU4cY68a9
+hCrhrTY2HH5kasjvoanf/DbLrj+vwTRvH4MDSOu4a5Wdm3LRjyHgP3RuhbGq61eq
+7MZT1UASPJVFGUe9KlxZDKhJQ8ccvzGkGU5yJdxao27hRDnBaR2l72PCawT5ntgf
+hEmMLmw17g848MET/2jMvbNyyOx9pKlfMv/AJBBU4knGSBDBYnETdocvbwkbVJSe
+4EDu/K+mOCF5dllEgGTCPTazvYBlbgWi+lZtq6eAYLiN4arJ+ScALFSMh+zSwwvM
+xt5RnpSxw1yV2pHlGsQjg9yw9XQX7wEjKeMGjTwiLFAMbwWYJvF6Z6ZmI2LWaS5O
+AmXm/JkHdE8JQzAZwnqZOOpcEB3y8D/vACEBHUMafbkBGHRvFOIcHfB/ozfEyIym
+E5Mo6OWtRTbnpPo0seH4Kx9UY+BvG1Run3fYxcPQqaA7H4jLO1eOZSOfiiOzM8Jf
+l+QrKomqizmyUTUiikC/9memJDz/nqdm7w0r4Zq9UqY0E74OkpYLyspoWVM8Cj4k
+61wPtYXRrJ70UbvVnhX2pMnxRMH6BkU6+SCSzhbo9sNHgP0VtVhXrijTPJJY8Kap
+3hUkQvVlb1Gdl7DeeeJmYGOLxYGjfmj6UcflqXZzorm43E0djw/sCtBc76FFOpsB
+8R8F/ArtsSGsw+KJqK5Uyf+2LzL9BNdv80EiRKkubJ8+ODdRrBMNCT/hPRY7iACX
+UEudm5DA0Ai5NOyUDV7kVyW9C7SFaXoMtG0NO7TL5cBZ63uFpsoBrk+Y4tepgVIx
++8beinOJSBAu7HlTyj4eS2L+TQbPIf7j+UwPh2FKNvloVeXku3IUtyRjfcRlWpct
+5sjAXvtc+elSAVVoX9J1fAltepsRG9sd9iFTNTpiOC6nrvWuVz8jrbCitFuvKYnm
+tD5bqRmGLkqYrwz+MSkA7cFCE50F5WPXVkRxp/bZ1ds+fh/Ymx9UwlsUqgRpHsGb
+ZhpJZALukr2YDGw4mSyTtRE9uhGW7+YFSHp1TL6wEUHAT5GwqrY2MioZ2Da6vVYD
+SZv+uusSWHjaiJpkuoqOOnPfdFDse8Khc4xBsOMLgAc86wfjZtD3gWBcDkRdD81C
+-----END RSA PRIVATE KEY-----
diff --git a/test/mocks/pnfsimulator/ssh/ssh_host_rsa_key.pub b/test/mocks/pnfsimulator/ssh/ssh_host_rsa_key.pub
new file mode 100644
index 000000000..619333558
--- /dev/null
+++ b/test/mocks/pnfsimulator/ssh/ssh_host_rsa_key.pub
@@ -0,0 +1 @@
+ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAACAQCiZJaJfjmjnaJqHTcYG8DkrU1Mr7WAmGR70QVd4mDxmM5vPm26nOv3uDO0sSwjP/sDGyVzlaxwlnfBfVZwJbMMf6sEPMNCLvBSwT4E6vf9rKwXqUIzj8hZuvOd7RPp241Z29CkL6aep6QNSk3NOlu4mxGMv+WJwyoDq8ya+ePEXQgl5QipabAmXFOKk1x15z9tcs9Dw5JvKkCpjpJ7zAd9tkmuiramS9OlETy8BJ0QkMj3ucNuqDsUkUzvKnnWHVcykmacJY3v3D9S4BoqLc1XZTVB4oRg0GlOCqOMQeVLP/jxtzVYiK5EsHbC55qhC9i8IaaSyeN66hgWwIh6FHhPMHr40vRKyliZGK0aBP+paS0V1PvNUW9+sb3ZDB/7mu/0yp06yGpqJAAFRQCZzNqiWbbQy1s/+HQbtUwVr7gnY2jhhAv8bcBPwTtIctg/rO/WDWJJsLzuFnb7fGkFL+EqAt0qozDSL5bDzJgylg00Y6GM1ebvBluNE+71n1TigInlIvKWHKtrAtiHQwXLOS/v3aEoepgJKiwABvYXiB2QNXqxkbrnFoT4+byhmakG3SVmDCDUlbQoDJpKLekwt5dezSuDNdFeC1TxUahfsBcOOG1TOxrsCKJU+ZoMXVXsouAAshpWiSZGZR2imXFLcRfDV5FI2bRZPv+WADzuzsfkJw== \ No newline at end of file