diff options
Diffstat (limited to 'uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom')
25 files changed, 39738 insertions, 0 deletions
diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/external/jquery/jquery.js b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/external/jquery/jquery.js new file mode 100644 index 00000000..d513758a --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/external/jquery/jquery.js @@ -0,0 +1,9815 @@ +/*!
+ * jQuery JavaScript Library v1.10.2
+ * http://jquery.com/
+ *
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ *
+ * Copyright 2005, 2013 jQuery Foundation, Inc. and other contributors
+ * Released under the MIT license
+ * http://jquery.org/license
+ *
+ * Date: 2013-07-03T13:48Z
+ */
+(function (window, undefined) {
+
+// Can't do this because several apps including ASP.NET trace
+// the stack via arguments.caller.callee and Firefox dies if
+// you try to trace through "use strict" call chains. (#13335)
+// Support: Firefox 18+
+//"use strict";
+ var
+ // The deferred used on DOM ready
+ readyList,
+
+ // A central reference to the root jQuery(document)
+ rootjQuery,
+
+ // Support: IE<10
+ // For `typeof xmlNode.method` instead of `xmlNode.method !== undefined`
+ core_strundefined = typeof undefined,
+
+ // Use the correct document accordingly with window argument (sandbox)
+ location = window.location,
+ document = window.document,
+ docElem = document.documentElement,
+
+ // Map over jQuery in case of overwrite
+ _jQuery = window.jQuery,
+
+ // Map over the $ in case of overwrite
+ _$ = window.$,
+
+ // [[Class]] -> type pairs
+ class2type = {},
+
+ // List of deleted data cache ids, so we can reuse them
+ core_deletedIds = [],
+
+ core_version = "1.10.2",
+
+ // Save a reference to some core methods
+ core_concat = core_deletedIds.concat,
+ core_push = core_deletedIds.push,
+ core_slice = core_deletedIds.slice,
+ core_indexOf = core_deletedIds.indexOf,
+ core_toString = class2type.toString,
+ core_hasOwn = class2type.hasOwnProperty,
+ core_trim = core_version.trim,
+
+ // Define a local copy of jQuery
+ jQuery = function (selector, context) {
+ // The jQuery object is actually just the init constructor 'enhanced'
+ return new jQuery.fn.init(selector, context, rootjQuery);
+ },
+
+ // Used for matching numbers
+ core_pnum = /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,
+
+ // Used for splitting on whitespace
+ core_rnotwhite = /\S+/g,
+
+ // Make sure we trim BOM and NBSP (here's looking at you, Safari 5.0 and IE)
+ rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,
+
+ // A simple way to check for HTML strings
+ // Prioritize #id over <tag> to avoid XSS via location.hash (#9521)
+ // Strict HTML recognition (#11290: must start with <)
+ rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]*))$/,
+
+ // Match a standalone tag
+ rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>|)$/,
+
+ // JSON RegExp
+ rvalidchars = /^[\],:{}\s]*$/,
+ rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g,
+ rvalidescape = /\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g,
+ rvalidtokens = /"[^"\\\r\n]*"|true|false|null|-?(?:\d+\.|)\d+(?:[eE][+-]?\d+|)/g,
+
+ // Matches dashed string for camelizing
+ rmsPrefix = /^-ms-/,
+ rdashAlpha = /-([\da-z])/gi,
+
+ // Used by jQuery.camelCase as callback to replace()
+ fcamelCase = function (all, letter) {
+ return letter.toUpperCase();
+ },
+
+ // The ready event handler
+ completed = function (event) {
+
+ // readyState === "complete" is good enough for us to call the dom ready in oldIE
+ if (document.addEventListener || event.type === "load" || document.readyState === "complete") {
+ detach();
+ jQuery.ready();
+ }
+ },
+ // Clean-up method for dom ready events
+ detach = function () {
+ if (document.addEventListener) {
+ document.removeEventListener("DOMContentLoaded", completed, false);
+ window.removeEventListener("load", completed, false);
+
+ } else {
+ document.detachEvent("onreadystatechange", completed);
+ window.detachEvent("onload", completed);
+ }
+ };
+
+ jQuery.fn = jQuery.prototype = {
+ // The current version of jQuery being used
+ jquery: core_version,
+
+ constructor: jQuery,
+ init: function (selector, context, rootjQuery) {
+ var match, elem;
+
+ // HANDLE: $(""), $(null), $(undefined), $(false)
+ if (!selector) {
+ return this;
+ }
+
+ // Handle HTML strings
+ if (typeof selector === "string") {
+ if (selector.charAt(0) === "<" && selector.charAt(selector.length - 1) === ">" && selector.length >= 3) {
+ // Assume that strings that start and end with <> are HTML and skip the regex check
+ match = [null, selector, null];
+
+ } else {
+ match = rquickExpr.exec(selector);
+ }
+
+ // Match html or make sure no context is specified for #id
+ if (match && (match[1] || !context)) {
+
+ // HANDLE: $(html) -> $(array)
+ if (match[1]) {
+ context = context instanceof jQuery ? context[0] : context;
+
+ // scripts is true for back-compat
+ jQuery.merge(this, jQuery.parseHTML(
+ match[1],
+ context && context.nodeType ? context.ownerDocument || context : document,
+ true
+ ));
+
+ // HANDLE: $(html, props)
+ if (rsingleTag.test(match[1]) && jQuery.isPlainObject(context)) {
+ for (match in context) {
+ // Properties of context are called as methods if possible
+ if (jQuery.isFunction(this[match])) {
+ this[match](context[match]);
+
+ // ...and otherwise set as attributes
+ } else {
+ this.attr(match, context[match]);
+ }
+ }
+ }
+
+ return this;
+
+ // HANDLE: $(#id)
+ } else {
+ elem = document.getElementById(match[2]);
+
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ if (elem && elem.parentNode) {
+ // Handle the case where IE and Opera return items
+ // by name instead of ID
+ if (elem.id !== match[2]) {
+ return rootjQuery.find(selector);
+ }
+
+ // Otherwise, we inject the element directly into the jQuery object
+ this.length = 1;
+ this[0] = elem;
+ }
+
+ this.context = document;
+ this.selector = selector;
+ return this;
+ }
+
+ // HANDLE: $(expr, $(...))
+ } else if (!context || context.jquery) {
+ return ( context || rootjQuery ).find(selector);
+
+ // HANDLE: $(expr, context)
+ // (which is just equivalent to: $(context).find(expr)
+ } else {
+ return this.constructor(context).find(selector);
+ }
+
+ // HANDLE: $(DOMElement)
+ } else if (selector.nodeType) {
+ this.context = this[0] = selector;
+ this.length = 1;
+ return this;
+
+ // HANDLE: $(function)
+ // Shortcut for document ready
+ } else if (jQuery.isFunction(selector)) {
+ return rootjQuery.ready(selector);
+ }
+
+ if (selector.selector !== undefined) {
+ this.selector = selector.selector;
+ this.context = selector.context;
+ }
+
+ return jQuery.makeArray(selector, this);
+ },
+
+ // Start with an empty selector
+ selector: "",
+
+ // The default length of a jQuery object is 0
+ length: 0,
+
+ toArray: function () {
+ return core_slice.call(this);
+ },
+
+ // Get the Nth element in the matched element set OR
+ // Get the whole matched element set as a clean array
+ get: function (num) {
+ return num == null ?
+
+ // Return a 'clean' array
+ this.toArray() :
+
+ // Return just the object
+ ( num < 0 ? this[this.length + num] : this[num] );
+ },
+
+ // Take an array of elements and push it onto the stack
+ // (returning the new matched element set)
+ pushStack: function (elems) {
+
+ // Build a new jQuery matched element set
+ var ret = jQuery.merge(this.constructor(), elems);
+
+ // Add the old object onto the stack (as a reference)
+ ret.prevObject = this;
+ ret.context = this.context;
+
+ // Return the newly-formed element set
+ return ret;
+ },
+
+ // Execute a callback for every element in the matched set.
+ // (You can seed the arguments with an array of args, but this is
+ // only used internally.)
+ each: function (callback, args) {
+ return jQuery.each(this, callback, args);
+ },
+
+ ready: function (fn) {
+ // Add the callback
+ jQuery.ready.promise().done(fn);
+
+ return this;
+ },
+
+ slice: function () {
+ return this.pushStack(core_slice.apply(this, arguments));
+ },
+
+ first: function () {
+ return this.eq(0);
+ },
+
+ last: function () {
+ return this.eq(-1);
+ },
+
+ eq: function (i) {
+ var len = this.length,
+ j = +i + ( i < 0 ? len : 0 );
+ return this.pushStack(j >= 0 && j < len ? [this[j]] : []);
+ },
+
+ map: function (callback) {
+ return this.pushStack(jQuery.map(this, function (elem, i) {
+ return callback.call(elem, i, elem);
+ }));
+ },
+
+ end: function () {
+ return this.prevObject || this.constructor(null);
+ },
+
+ // For internal use only.
+ // Behaves like an Array's method, not like a jQuery method.
+ push: core_push,
+ sort: [].sort,
+ splice: [].splice
+ };
+
+// Give the init function the jQuery prototype for later instantiation
+ jQuery.fn.init.prototype = jQuery.fn;
+
+ jQuery.extend = jQuery.fn.extend = function () {
+ var src, copyIsArray, copy, name, options, clone,
+ target = arguments[0] || {},
+ i = 1,
+ length = arguments.length,
+ deep = false;
+
+ // Handle a deep copy situation
+ if (typeof target === "boolean") {
+ deep = target;
+ target = arguments[1] || {};
+ // skip the boolean and the target
+ i = 2;
+ }
+
+ // Handle case when target is a string or something (possible in deep copy)
+ if (typeof target !== "object" && !jQuery.isFunction(target)) {
+ target = {};
+ }
+
+ // extend jQuery itself if only one argument is passed
+ if (length === i) {
+ target = this;
+ --i;
+ }
+
+ for (; i < length; i++) {
+ // Only deal with non-null/undefined values
+ if ((options = arguments[i]) != null) {
+ // Extend the base object
+ for (name in options) {
+ src = target[name];
+ copy = options[name];
+
+ // Prevent never-ending loop
+ if (target === copy) {
+ continue;
+ }
+
+ // Recurse if we're merging plain objects or arrays
+ if (deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) )) {
+ if (copyIsArray) {
+ copyIsArray = false;
+ clone = src && jQuery.isArray(src) ? src : [];
+
+ } else {
+ clone = src && jQuery.isPlainObject(src) ? src : {};
+ }
+
+ // Never move original objects, clone them
+ target[name] = jQuery.extend(deep, clone, copy);
+
+ // Don't bring in undefined values
+ } else if (copy !== undefined) {
+ target[name] = copy;
+ }
+ }
+ }
+ }
+
+ // Return the modified object
+ return target;
+ };
+
+ jQuery.extend({
+ // Unique for each copy of jQuery on the page
+ // Non-digits removed to match rinlinejQuery
+ expando: "jQuery" + ( core_version + Math.random() ).replace(/\D/g, ""),
+
+ noConflict: function (deep) {
+ if (window.$ === jQuery) {
+ window.$ = _$;
+ }
+
+ if (deep && window.jQuery === jQuery) {
+ window.jQuery = _jQuery;
+ }
+
+ return jQuery;
+ },
+
+ // Is the DOM ready to be used? Set to true once it occurs.
+ isReady: false,
+
+ // A counter to track how many items to wait for before
+ // the ready event fires. See #6781
+ readyWait: 1,
+
+ // Hold (or release) the ready event
+ holdReady: function (hold) {
+ if (hold) {
+ jQuery.readyWait++;
+ } else {
+ jQuery.ready(true);
+ }
+ },
+
+ // Handle when the DOM is ready
+ ready: function (wait) {
+
+ // Abort if there are pending holds or we're already ready
+ if (wait === true ? --jQuery.readyWait : jQuery.isReady) {
+ return;
+ }
+
+ // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+ if (!document.body) {
+ return setTimeout(jQuery.ready);
+ }
+
+ // Remember that the DOM is ready
+ jQuery.isReady = true;
+
+ // If a normal DOM Ready event fired, decrement, and wait if need be
+ if (wait !== true && --jQuery.readyWait > 0) {
+ return;
+ }
+
+ // If there are functions bound, to execute
+ readyList.resolveWith(document, [jQuery]);
+
+ // Trigger any bound ready events
+ if (jQuery.fn.trigger) {
+ jQuery(document).trigger("ready").off("ready");
+ }
+ },
+
+ // See test/unit/core.js for details concerning isFunction.
+ // Since version 1.3, DOM methods and functions like alert
+ // aren't supported. They return false on IE (#2968).
+ isFunction: function (obj) {
+ return jQuery.type(obj) === "function";
+ },
+
+ isArray: Array.isArray || function (obj) {
+ return jQuery.type(obj) === "array";
+ },
+
+ isWindow: function (obj) {
+ /* jshint eqeqeq: false */
+ return obj != null && obj == obj.window;
+ },
+
+ isNumeric: function (obj) {
+ return !isNaN(parseFloat(obj)) && isFinite(obj);
+ },
+
+ type: function (obj) {
+ if (obj == null) {
+ return String(obj);
+ }
+ return typeof obj === "object" || typeof obj === "function" ?
+ class2type[core_toString.call(obj)] || "object" :
+ typeof obj;
+ },
+
+ isPlainObject: function (obj) {
+ var key;
+
+ // Must be an Object.
+ // Because of IE, we also have to check the presence of the constructor property.
+ // Make sure that DOM nodes and window objects don't pass through, as well
+ if (!obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow(obj)) {
+ return false;
+ }
+
+ try {
+ // Not own constructor property must be Object
+ if (obj.constructor && !core_hasOwn.call(obj, "constructor") && !core_hasOwn.call(obj.constructor.prototype, "isPrototypeOf")) {
+ return false;
+ }
+ } catch (e) {
+ // IE8,9 Will throw exceptions on certain host objects #9897
+ return false;
+ }
+
+ // Support: IE<9
+ // Handle iteration over inherited properties before own properties.
+ if (jQuery.support.ownLast) {
+ for (key in obj) {
+ return core_hasOwn.call(obj, key);
+ }
+ }
+
+ // Own properties are enumerated firstly, so to speed up,
+ // if last one is own, then all properties are own.
+ for (key in obj) {
+ }
+
+ return key === undefined || core_hasOwn.call(obj, key);
+ },
+
+ isEmptyObject: function (obj) {
+ var name;
+ for (name in obj) {
+ return false;
+ }
+ return true;
+ },
+
+ error: function (msg) {
+ throw new Error(msg);
+ },
+
+ // data: string of html
+ // context (optional): If specified, the fragment will be created in this context, defaults to document
+ // keepScripts (optional): If true, will include scripts passed in the html string
+ parseHTML: function (data, context, keepScripts) {
+ if (!data || typeof data !== "string") {
+ return null;
+ }
+ if (typeof context === "boolean") {
+ keepScripts = context;
+ context = false;
+ }
+ context = context || document;
+
+ var parsed = rsingleTag.exec(data),
+ scripts = !keepScripts && [];
+
+ // Single tag
+ if (parsed) {
+ return [context.createElement(parsed[1])];
+ }
+
+ parsed = jQuery.buildFragment([data], context, scripts);
+ if (scripts) {
+ jQuery(scripts).remove();
+ }
+ return jQuery.merge([], parsed.childNodes);
+ },
+
+ parseJSON: function (data) {
+ // Attempt to parse using the native JSON parser first
+ if (window.JSON && window.JSON.parse) {
+ return window.JSON.parse(data);
+ }
+
+ if (data === null) {
+ return data;
+ }
+
+ if (typeof data === "string") {
+
+ // Make sure leading/trailing whitespace is removed (IE can't handle it)
+ data = jQuery.trim(data);
+
+ if (data) {
+ // Make sure the incoming data is actual JSON
+ // Logic borrowed from http://json.org/json2.js
+ if (rvalidchars.test(data.replace(rvalidescape, "@")
+ .replace(rvalidtokens, "]")
+ .replace(rvalidbraces, ""))) {
+
+ return ( new Function("return " + data) )();
+ }
+ }
+ }
+
+ jQuery.error("Invalid JSON: " + data);
+ },
+
+ // Cross-browser xml parsing
+ parseXML: function (data) {
+ var xml, tmp;
+ if (!data || typeof data !== "string") {
+ return null;
+ }
+ try {
+ if (window.DOMParser) { // Standard
+ tmp = new DOMParser();
+ xml = tmp.parseFromString(data, "text/xml");
+ } else { // IE
+ xml = new ActiveXObject("Microsoft.XMLDOM");
+ xml.async = "false";
+ xml.loadXML(data);
+ }
+ } catch (e) {
+ xml = undefined;
+ }
+ if (!xml || !xml.documentElement || xml.getElementsByTagName("parsererror").length) {
+ jQuery.error("Invalid XML: " + data);
+ }
+ return xml;
+ },
+
+ noop: function () {
+ },
+
+ // Evaluates a script in a global context
+ // Workarounds based on findings by Jim Driscoll
+ // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context
+ globalEval: function (data) {
+ if (data && jQuery.trim(data)) {
+ // We use execScript on Internet Explorer
+ // We use an anonymous function so that context is window
+ // rather than jQuery in Firefox
+ ( window.execScript || function (data) {
+ window["eval"].call(window, data);
+ } )(data);
+ }
+ },
+
+ // Convert dashed to camelCase; used by the css and data modules
+ // Microsoft forgot to hump their vendor prefix (#9572)
+ camelCase: function (string) {
+ return string.replace(rmsPrefix, "ms-").replace(rdashAlpha, fcamelCase);
+ },
+
+ nodeName: function (elem, name) {
+ return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
+ },
+
+ // args is for internal usage only
+ each: function (obj, callback, args) {
+ var value,
+ i = 0,
+ length = obj.length,
+ isArray = isArraylike(obj);
+
+ if (args) {
+ if (isArray) {
+ for (; i < length; i++) {
+ value = callback.apply(obj[i], args);
+
+ if (value === false) {
+ break;
+ }
+ }
+ } else {
+ for (i in obj) {
+ value = callback.apply(obj[i], args);
+
+ if (value === false) {
+ break;
+ }
+ }
+ }
+
+ // A special, fast, case for the most common use of each
+ } else {
+ if (isArray) {
+ for (; i < length; i++) {
+ value = callback.call(obj[i], i, obj[i]);
+
+ if (value === false) {
+ break;
+ }
+ }
+ } else {
+ for (i in obj) {
+ value = callback.call(obj[i], i, obj[i]);
+
+ if (value === false) {
+ break;
+ }
+ }
+ }
+ }
+
+ return obj;
+ },
+
+ // Use native String.trim function wherever possible
+ trim: core_trim && !core_trim.call("\uFEFF\xA0") ?
+ function (text) {
+ return text == null ?
+ "" :
+ core_trim.call(text);
+ } :
+
+ // Otherwise use our own trimming functionality
+ function (text) {
+ return text == null ?
+ "" :
+ ( text + "" ).replace(rtrim, "");
+ },
+
+ // results is for internal usage only
+ makeArray: function (arr, results) {
+ var ret = results || [];
+
+ if (arr != null) {
+ if (isArraylike(Object(arr))) {
+ jQuery.merge(ret,
+ typeof arr === "string" ?
+ [arr] : arr
+ );
+ } else {
+ core_push.call(ret, arr);
+ }
+ }
+
+ return ret;
+ },
+
+ inArray: function (elem, arr, i) {
+ var len;
+
+ if (arr) {
+ if (core_indexOf) {
+ return core_indexOf.call(arr, elem, i);
+ }
+
+ len = arr.length;
+ i = i ? i < 0 ? Math.max(0, len + i) : i : 0;
+
+ for (; i < len; i++) {
+ // Skip accessing in sparse arrays
+ if (i in arr && arr[i] === elem) {
+ return i;
+ }
+ }
+ }
+
+ return -1;
+ },
+
+ merge: function (first, second) {
+ var l = second.length,
+ i = first.length,
+ j = 0;
+
+ if (typeof l === "number") {
+ for (; j < l; j++) {
+ first[i++] = second[j];
+ }
+ } else {
+ while (second[j] !== undefined) {
+ first[i++] = second[j++];
+ }
+ }
+
+ first.length = i;
+
+ return first;
+ },
+
+ grep: function (elems, callback, inv) {
+ var retVal,
+ ret = [],
+ i = 0,
+ length = elems.length;
+ inv = !!inv;
+
+ // Go through the array, only saving the items
+ // that pass the validator function
+ for (; i < length; i++) {
+ retVal = !!callback(elems[i], i);
+ if (inv !== retVal) {
+ ret.push(elems[i]);
+ }
+ }
+
+ return ret;
+ },
+
+ // arg is for internal usage only
+ map: function (elems, callback, arg) {
+ var value,
+ i = 0,
+ length = elems.length,
+ isArray = isArraylike(elems),
+ ret = [];
+
+ // Go through the array, translating each of the items to their
+ if (isArray) {
+ for (; i < length; i++) {
+ value = callback(elems[i], i, arg);
+
+ if (value != null) {
+ ret[ret.length] = value;
+ }
+ }
+
+ // Go through every key on the object,
+ } else {
+ for (i in elems) {
+ value = callback(elems[i], i, arg);
+
+ if (value != null) {
+ ret[ret.length] = value;
+ }
+ }
+ }
+
+ // Flatten any nested arrays
+ return core_concat.apply([], ret);
+ },
+
+ // A global GUID counter for objects
+ guid: 1,
+
+ // Bind a function to a context, optionally partially applying any
+ // arguments.
+ proxy: function (fn, context) {
+ var args, proxy, tmp;
+
+ if (typeof context === "string") {
+ tmp = fn[context];
+ context = fn;
+ fn = tmp;
+ }
+
+ // Quick check to determine if target is callable, in the spec
+ // this throws a TypeError, but we will just return undefined.
+ if (!jQuery.isFunction(fn)) {
+ return undefined;
+ }
+
+ // Simulated bind
+ args = core_slice.call(arguments, 2);
+ proxy = function () {
+ return fn.apply(context || this, args.concat(core_slice.call(arguments)));
+ };
+
+ // Set the guid of unique handler to the same of original handler, so it can be removed
+ proxy.guid = fn.guid = fn.guid || jQuery.guid++;
+
+ return proxy;
+ },
+
+ // Multifunctional method to get and set values of a collection
+ // The value/s can optionally be executed if it's a function
+ access: function (elems, fn, key, value, chainable, emptyGet, raw) {
+ var i = 0,
+ length = elems.length,
+ bulk = key == null;
+
+ // Sets many values
+ if (jQuery.type(key) === "object") {
+ chainable = true;
+ for (i in key) {
+ jQuery.access(elems, fn, i, key[i], true, emptyGet, raw);
+ }
+
+ // Sets one value
+ } else if (value !== undefined) {
+ chainable = true;
+
+ if (!jQuery.isFunction(value)) {
+ raw = true;
+ }
+
+ if (bulk) {
+ // Bulk operations run against the entire set
+ if (raw) {
+ fn.call(elems, value);
+ fn = null;
+
+ // ...except when executing function values
+ } else {
+ bulk = fn;
+ fn = function (elem, key, value) {
+ return bulk.call(jQuery(elem), value);
+ };
+ }
+ }
+
+ if (fn) {
+ for (; i < length; i++) {
+ fn(elems[i], key, raw ? value : value.call(elems[i], i, fn(elems[i], key)));
+ }
+ }
+ }
+
+ return chainable ?
+ elems :
+
+ // Gets
+ bulk ?
+ fn.call(elems) :
+ length ? fn(elems[0], key) : emptyGet;
+ },
+
+ now: function () {
+ return ( new Date() ).getTime();
+ },
+
+ // A method for quickly swapping in/out CSS properties to get correct calculations.
+ // Note: this method belongs to the css module but it's needed here for the support module.
+ // If support gets modularized, this method should be moved back to the css module.
+ swap: function (elem, options, callback, args) {
+ var ret, name,
+ old = {};
+
+ // Remember the old values, and insert the new ones
+ for (name in options) {
+ old[name] = elem.style[name];
+ elem.style[name] = options[name];
+ }
+
+ ret = callback.apply(elem, args || []);
+
+ // Revert the old values
+ for (name in options) {
+ elem.style[name] = old[name];
+ }
+
+ return ret;
+ }
+ });
+
+ jQuery.ready.promise = function (obj) {
+ if (!readyList) {
+
+ readyList = jQuery.Deferred();
+
+ // Catch cases where $(document).ready() is called after the browser event has already occurred.
+ // we once tried to use readyState "interactive" here, but it caused issues like the one
+ // discovered by ChrisS here: http://bugs.jquery.com/ticket/12282#comment:15
+ if (document.readyState === "complete") {
+ // Handle it asynchronously to allow scripts the opportunity to delay ready
+ setTimeout(jQuery.ready);
+
+ // Standards-based browsers support DOMContentLoaded
+ } else if (document.addEventListener) {
+ // Use the handy event callback
+ document.addEventListener("DOMContentLoaded", completed, false);
+
+ // A fallback to window.onload, that will always work
+ window.addEventListener("load", completed, false);
+
+ // If IE event model is used
+ } else {
+ // Ensure firing before onload, maybe late but safe also for iframes
+ document.attachEvent("onreadystatechange", completed);
+
+ // A fallback to window.onload, that will always work
+ window.attachEvent("onload", completed);
+
+ // If IE and not a frame
+ // continually check to see if the document is ready
+ var top = false;
+
+ try {
+ top = window.frameElement == null && document.documentElement;
+ } catch (e) {
+ }
+
+ if (top && top.doScroll) {
+ (function doScrollCheck() {
+ if (!jQuery.isReady) {
+
+ try {
+ // Use the trick by Diego Perini
+ // http://javascript.nwbox.com/IEContentLoaded/
+ top.doScroll("left");
+ } catch (e) {
+ return setTimeout(doScrollCheck, 50);
+ }
+
+ // detach all dom ready events
+ detach();
+
+ // and execute any waiting functions
+ jQuery.ready();
+ }
+ })();
+ }
+ }
+ }
+ return readyList.promise(obj);
+ };
+
+// Populate the class2type map
+ jQuery.each("Boolean Number String Function Array Date RegExp Object Error".split(" "), function (i, name) {
+ class2type["[object " + name + "]"] = name.toLowerCase();
+ });
+
+ function isArraylike(obj) {
+ var length = obj.length,
+ type = jQuery.type(obj);
+
+ if (jQuery.isWindow(obj)) {
+ return false;
+ }
+
+ if (obj.nodeType === 1 && length) {
+ return true;
+ }
+
+ return type === "array" || type !== "function" &&
+ ( length === 0 ||
+ typeof length === "number" && length > 0 && ( length - 1 ) in obj );
+ }
+
+// All jQuery objects should point back to these
+ rootjQuery = jQuery(document);
+ /*!
+ * Sizzle CSS Selector Engine v1.10.2
+ * http://sizzlejs.com/
+ *
+ * Copyright 2013 jQuery Foundation, Inc. and other contributors
+ * Released under the MIT license
+ * http://jquery.org/license
+ *
+ * Date: 2013-07-03
+ */
+ (function (window, undefined) {
+
+ var i,
+ support,
+ cachedruns,
+ Expr,
+ getText,
+ isXML,
+ compile,
+ outermostContext,
+ sortInput,
+
+ // Local document vars
+ setDocument,
+ document,
+ docElem,
+ documentIsHTML,
+ rbuggyQSA,
+ rbuggyMatches,
+ matches,
+ contains,
+
+ // Instance-specific data
+ expando = "sizzle" + -(new Date()),
+ preferredDoc = window.document,
+ dirruns = 0,
+ done = 0,
+ classCache = createCache(),
+ tokenCache = createCache(),
+ compilerCache = createCache(),
+ hasDuplicate = false,
+ sortOrder = function (a, b) {
+ if (a === b) {
+ hasDuplicate = true;
+ return 0;
+ }
+ return 0;
+ },
+
+ // General-purpose constants
+ strundefined = typeof undefined,
+ MAX_NEGATIVE = 1 << 31,
+
+ // Instance methods
+ hasOwn = ({}).hasOwnProperty,
+ arr = [],
+ pop = arr.pop,
+ push_native = arr.push,
+ push = arr.push,
+ slice = arr.slice,
+ // Use a stripped-down indexOf if we can't use a native one
+ indexOf = arr.indexOf || function (elem) {
+ var i = 0,
+ len = this.length;
+ for (; i < len; i++) {
+ if (this[i] === elem) {
+ return i;
+ }
+ }
+ return -1;
+ },
+
+ booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",
+
+ // Regular expressions
+
+ // Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace
+ whitespace = "[\\x20\\t\\r\\n\\f]",
+ // http://www.w3.org/TR/css3-syntax/#characters
+ characterEncoding = "(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",
+
+ // Loosely modeled on CSS identifier characters
+ // An unquoted value should be a CSS identifier http://www.w3.org/TR/css3-selectors/#attribute-selectors
+ // Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier
+ identifier = characterEncoding.replace("w", "w#"),
+
+ // Acceptable operators http://www.w3.org/TR/selectors/#attribute-selectors
+ attributes = "\\[" + whitespace + "*(" + characterEncoding + ")" + whitespace +
+ "*(?:([*^$|!~]?=)" + whitespace + "*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|(" + identifier + ")|)|)" + whitespace + "*\\]",
+
+ // Prefer arguments quoted,
+ // then not containing pseudos/brackets,
+ // then attribute selectors/non-parenthetical expressions,
+ // then anything else
+ // These preferences are here to reduce the number of selectors
+ // needing tokenize in the PSEUDO preFilter
+ pseudos = ":(" + characterEncoding + ")(?:\\(((['\"])((?:\\\\.|[^\\\\])*?)\\3|((?:\\\\.|[^\\\\()[\\]]|" + attributes.replace(3, 8) + ")*)|.*)\\)|)",
+
+ // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
+ rtrim = new RegExp("^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g"),
+
+ rcomma = new RegExp("^" + whitespace + "*," + whitespace + "*"),
+ rcombinators = new RegExp("^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + "*"),
+
+ rsibling = new RegExp(whitespace + "*[+~]"),
+ rattributeQuotes = new RegExp("=" + whitespace + "*([^\\]'\"]*)" + whitespace + "*\\]", "g"),
+
+ rpseudo = new RegExp(pseudos),
+ ridentifier = new RegExp("^" + identifier + "$"),
+
+ matchExpr = {
+ "ID": new RegExp("^#(" + characterEncoding + ")"),
+ "CLASS": new RegExp("^\\.(" + characterEncoding + ")"),
+ "TAG": new RegExp("^(" + characterEncoding.replace("w", "w*") + ")"),
+ "ATTR": new RegExp("^" + attributes),
+ "PSEUDO": new RegExp("^" + pseudos),
+ "CHILD": new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace +
+ "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace +
+ "*(\\d+)|))" + whitespace + "*\\)|)", "i"),
+ "bool": new RegExp("^(?:" + booleans + ")$", "i"),
+ // For use in libraries implementing .is()
+ // We use this for POS matching in `select`
+ "needsContext": new RegExp("^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" +
+ whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i")
+ },
+
+ rnative = /^[^{]+\{\s*\[native \w/,
+
+ // Easily-parseable/retrievable ID or TAG or CLASS selectors
+ rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,
+
+ rinputs = /^(?:input|select|textarea|button)$/i,
+ rheader = /^h\d$/i,
+
+ rescape = /'|\\/g,
+
+ // CSS escapes http://www.w3.org/TR/CSS21/syndata.html#escaped-characters
+ runescape = new RegExp("\\\\([\\da-f]{1,6}" + whitespace + "?|(" + whitespace + ")|.)", "ig"),
+ funescape = function (_, escaped, escapedWhitespace) {
+ var high = "0x" + escaped - 0x10000;
+ // NaN means non-codepoint
+ // Support: Firefox
+ // Workaround erroneous numeric interpretation of +"0x"
+ return high !== high || escapedWhitespace ?
+ escaped :
+ // BMP codepoint
+ high < 0 ?
+ String.fromCharCode(high + 0x10000) :
+ // Supplemental Plane codepoint (surrogate pair)
+ String.fromCharCode(high >> 10 | 0xD800, high & 0x3FF | 0xDC00);
+ };
+
+// Optimize for push.apply( _, NodeList )
+ try {
+ push.apply(
+ (arr = slice.call(preferredDoc.childNodes)),
+ preferredDoc.childNodes
+ );
+ // Support: Android<4.0
+ // Detect silently failing push.apply
+ arr[preferredDoc.childNodes.length].nodeType;
+ } catch (e) {
+ push = {
+ apply: arr.length ?
+
+ // Leverage slice if possible
+ function (target, els) {
+ push_native.apply(target, slice.call(els));
+ } :
+
+ // Support: IE<9
+ // Otherwise append directly
+ function (target, els) {
+ var j = target.length,
+ i = 0;
+ // Can't trust NodeList.length
+ while ((target[j++] = els[i++])) {
+ }
+ target.length = j - 1;
+ }
+ };
+ }
+
+ function Sizzle(selector, context, results, seed) {
+ var match, elem, m, nodeType,
+ // QSA vars
+ i, groups, old, nid, newContext, newSelector;
+
+ if (( context ? context.ownerDocument || context : preferredDoc ) !== document) {
+ setDocument(context);
+ }
+
+ context = context || document;
+ results = results || [];
+
+ if (!selector || typeof selector !== "string") {
+ return results;
+ }
+
+ if ((nodeType = context.nodeType) !== 1 && nodeType !== 9) {
+ return [];
+ }
+
+ if (documentIsHTML && !seed) {
+
+ // Shortcuts
+ if ((match = rquickExpr.exec(selector))) {
+ // Speed-up: Sizzle("#ID")
+ if ((m = match[1])) {
+ if (nodeType === 9) {
+ elem = context.getElementById(m);
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ if (elem && elem.parentNode) {
+ // Handle the case where IE, Opera, and Webkit return items
+ // by name instead of ID
+ if (elem.id === m) {
+ results.push(elem);
+ return results;
+ }
+ } else {
+ return results;
+ }
+ } else {
+ // Context is not a document
+ if (context.ownerDocument && (elem = context.ownerDocument.getElementById(m)) &&
+ contains(context, elem) && elem.id === m) {
+ results.push(elem);
+ return results;
+ }
+ }
+
+ // Speed-up: Sizzle("TAG")
+ } else if (match[2]) {
+ push.apply(results, context.getElementsByTagName(selector));
+ return results;
+
+ // Speed-up: Sizzle(".CLASS")
+ } else if ((m = match[3]) && support.getElementsByClassName && context.getElementsByClassName) {
+ push.apply(results, context.getElementsByClassName(m));
+ return results;
+ }
+ }
+
+ // QSA path
+ if (support.qsa && (!rbuggyQSA || !rbuggyQSA.test(selector))) {
+ nid = old = expando;
+ newContext = context;
+ newSelector = nodeType === 9 && selector;
+
+ // qSA works strangely on Element-rooted queries
+ // We can work around this by specifying an extra ID on the root
+ // and working up from there (Thanks to Andrew Dupont for the technique)
+ // IE 8 doesn't work on object elements
+ if (nodeType === 1 && context.nodeName.toLowerCase() !== "object") {
+ groups = tokenize(selector);
+
+ if ((old = context.getAttribute("id"))) {
+ nid = old.replace(rescape, "\\$&");
+ } else {
+ context.setAttribute("id", nid);
+ }
+ nid = "[id='" + nid + "'] ";
+
+ i = groups.length;
+ while (i--) {
+ groups[i] = nid + toSelector(groups[i]);
+ }
+ newContext = rsibling.test(selector) && context.parentNode || context;
+ newSelector = groups.join(",");
+ }
+
+ if (newSelector) {
+ try {
+ push.apply(results,
+ newContext.querySelectorAll(newSelector)
+ );
+ return results;
+ } catch (qsaError) {
+ } finally {
+ if (!old) {
+ context.removeAttribute("id");
+ }
+ }
+ }
+ }
+ }
+
+ // All others
+ return select(selector.replace(rtrim, "$1"), context, results, seed);
+ }
+
+ /**
+ * Create key-value caches of limited size
+ * @returns {Function(string, Object)} Returns the Object data after storing it on itself with
+ * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)
+ * deleting the oldest entry
+ */
+ function createCache() {
+ var keys = [];
+
+ function cache(key, value) {
+ // Use (key + " ") to avoid collision with native prototype properties (see Issue #157)
+ if (keys.push(key += " ") > Expr.cacheLength) {
+ // Only keep the most recent entries
+ delete cache[keys.shift()];
+ }
+ return (cache[key] = value);
+ }
+
+ return cache;
+ }
+
+ /**
+ * Mark a function for special use by Sizzle
+ * @param {Function} fn The function to mark
+ */
+ function markFunction(fn) {
+ fn[expando] = true;
+ return fn;
+ }
+
+ /**
+ * Support testing using an element
+ * @param {Function} fn Passed the created div and expects a boolean result
+ */
+ function assert(fn) {
+ var div = document.createElement("div");
+
+ try {
+ return !!fn(div);
+ } catch (e) {
+ return false;
+ } finally {
+ // Remove from its parent by default
+ if (div.parentNode) {
+ div.parentNode.removeChild(div);
+ }
+ // release memory in IE
+ div = null;
+ }
+ }
+
+ /**
+ * Adds the same handler for all of the specified attrs
+ * @param {String} attrs Pipe-separated list of attributes
+ * @param {Function} handler The method that will be applied
+ */
+ function addHandle(attrs, handler) {
+ var arr = attrs.split("|"),
+ i = attrs.length;
+
+ while (i--) {
+ Expr.attrHandle[arr[i]] = handler;
+ }
+ }
+
+ /**
+ * Checks document order of two siblings
+ * @param {Element} a
+ * @param {Element} b
+ * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b
+ */
+ function siblingCheck(a, b) {
+ var cur = b && a,
+ diff = cur && a.nodeType === 1 && b.nodeType === 1 &&
+ ( ~b.sourceIndex || MAX_NEGATIVE ) -
+ ( ~a.sourceIndex || MAX_NEGATIVE );
+
+ // Use IE sourceIndex if available on both nodes
+ if (diff) {
+ return diff;
+ }
+
+ // Check if b follows a
+ if (cur) {
+ while ((cur = cur.nextSibling)) {
+ if (cur === b) {
+ return -1;
+ }
+ }
+ }
+
+ return a ? 1 : -1;
+ }
+
+ /**
+ * Returns a function to use in pseudos for input types
+ * @param {String} type
+ */
+ function createInputPseudo(type) {
+ return function (elem) {
+ var name = elem.nodeName.toLowerCase();
+ return name === "input" && elem.type === type;
+ };
+ }
+
+ /**
+ * Returns a function to use in pseudos for buttons
+ * @param {String} type
+ */
+ function createButtonPseudo(type) {
+ return function (elem) {
+ var name = elem.nodeName.toLowerCase();
+ return (name === "input" || name === "button") && elem.type === type;
+ };
+ }
+
+ /**
+ * Returns a function to use in pseudos for positionals
+ * @param {Function} fn
+ */
+ function createPositionalPseudo(fn) {
+ return markFunction(function (argument) {
+ argument = +argument;
+ return markFunction(function (seed, matches) {
+ var j,
+ matchIndexes = fn([], seed.length, argument),
+ i = matchIndexes.length;
+
+ // Match elements found at the specified indexes
+ while (i--) {
+ if (seed[(j = matchIndexes[i])]) {
+ seed[j] = !(matches[j] = seed[j]);
+ }
+ }
+ });
+ });
+ }
+
+ /**
+ * Detect xml
+ * @param {Element|Object} elem An element or a document
+ */
+ isXML = Sizzle.isXML = function (elem) {
+ // documentElement is verified for cases where it doesn't yet exist
+ // (such as loading iframes in IE - #4833)
+ var documentElement = elem && (elem.ownerDocument || elem).documentElement;
+ return documentElement ? documentElement.nodeName !== "HTML" : false;
+ };
+
+// Expose support vars for convenience
+ support = Sizzle.support = {};
+
+ /**
+ * Sets document-related variables once based on the current document
+ * @param {Element|Object} [doc] An element or document object to use to set the document
+ * @returns {Object} Returns the current document
+ */
+ setDocument = Sizzle.setDocument = function (node) {
+ var doc = node ? node.ownerDocument || node : preferredDoc,
+ parent = doc.defaultView;
+
+ // If no document and documentElement is available, return
+ if (doc === document || doc.nodeType !== 9 || !doc.documentElement) {
+ return document;
+ }
+
+ // Set our document
+ document = doc;
+ docElem = doc.documentElement;
+
+ // Support tests
+ documentIsHTML = !isXML(doc);
+
+ // Support: IE>8
+ // If iframe document is assigned to "document" variable and if iframe has been reloaded,
+ // IE will throw "permission denied" error when accessing "document" variable, see jQuery #13936
+ // IE6-8 do not support the defaultView property so parent will be undefined
+ if (parent && parent.attachEvent && parent !== parent.top) {
+ parent.attachEvent("onbeforeunload", function () {
+ setDocument();
+ });
+ }
+
+ /* Attributes
+ ---------------------------------------------------------------------- */
+
+ // Support: IE<8
+ // Verify that getAttribute really returns attributes and not properties (excepting IE8 booleans)
+ support.attributes = assert(function (div) {
+ div.className = "i";
+ return !div.getAttribute("className");
+ });
+
+ /* getElement(s)By*
+ ---------------------------------------------------------------------- */
+
+ // Check if getElementsByTagName("*") returns only elements
+ support.getElementsByTagName = assert(function (div) {
+ div.appendChild(doc.createComment(""));
+ return !div.getElementsByTagName("*").length;
+ });
+
+ // Check if getElementsByClassName can be trusted
+ support.getElementsByClassName = assert(function (div) {
+ div.innerHTML = "<div class='a'></div><div class='a i'></div>";
+
+ // Support: Safari<4
+ // Catch class over-caching
+ div.firstChild.className = "i";
+ // Support: Opera<10
+ // Catch gEBCN failure to find non-leading classes
+ return div.getElementsByClassName("i").length === 2;
+ });
+
+ // Support: IE<10
+ // Check if getElementById returns elements by name
+ // The broken getElementById methods don't pick up programatically-set names,
+ // so use a roundabout getElementsByName test
+ support.getById = assert(function (div) {
+ docElem.appendChild(div).id = expando;
+ return !doc.getElementsByName || !doc.getElementsByName(expando).length;
+ });
+
+ // ID find and filter
+ if (support.getById) {
+ Expr.find["ID"] = function (id, context) {
+ if (typeof context.getElementById !== strundefined && documentIsHTML) {
+ var m = context.getElementById(id);
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ return m && m.parentNode ? [m] : [];
+ }
+ };
+ Expr.filter["ID"] = function (id) {
+ var attrId = id.replace(runescape, funescape);
+ return function (elem) {
+ return elem.getAttribute("id") === attrId;
+ };
+ };
+ } else {
+ // Support: IE6/7
+ // getElementById is not reliable as a find shortcut
+ delete Expr.find["ID"];
+
+ Expr.filter["ID"] = function (id) {
+ var attrId = id.replace(runescape, funescape);
+ return function (elem) {
+ var node = typeof elem.getAttributeNode !== strundefined && elem.getAttributeNode("id");
+ return node && node.value === attrId;
+ };
+ };
+ }
+
+ // Tag
+ Expr.find["TAG"] = support.getElementsByTagName ?
+ function (tag, context) {
+ if (typeof context.getElementsByTagName !== strundefined) {
+ return context.getElementsByTagName(tag);
+ }
+ } :
+ function (tag, context) {
+ var elem,
+ tmp = [],
+ i = 0,
+ results = context.getElementsByTagName(tag);
+
+ // Filter out possible comments
+ if (tag === "*") {
+ while ((elem = results[i++])) {
+ if (elem.nodeType === 1) {
+ tmp.push(elem);
+ }
+ }
+
+ return tmp;
+ }
+ return results;
+ };
+
+ // Class
+ Expr.find["CLASS"] = support.getElementsByClassName && function (className, context) {
+ if (typeof context.getElementsByClassName !== strundefined && documentIsHTML) {
+ return context.getElementsByClassName(className);
+ }
+ };
+
+ /* QSA/matchesSelector
+ ---------------------------------------------------------------------- */
+
+ // QSA and matchesSelector support
+
+ // matchesSelector(:active) reports false when true (IE9/Opera 11.5)
+ rbuggyMatches = [];
+
+ // qSa(:focus) reports false when true (Chrome 21)
+ // We allow this because of a bug in IE8/9 that throws an error
+ // whenever `document.activeElement` is accessed on an iframe
+ // So, we allow :focus to pass through QSA all the time to avoid the IE error
+ // See http://bugs.jquery.com/ticket/13378
+ rbuggyQSA = [];
+
+ if ((support.qsa = rnative.test(doc.querySelectorAll))) {
+ // Build QSA regex
+ // Regex strategy adopted from Diego Perini
+ assert(function (div) {
+ // Select is set to empty string on purpose
+ // This is to test IE's treatment of not explicitly
+ // setting a boolean content attribute,
+ // since its presence should be enough
+ // http://bugs.jquery.com/ticket/12359
+ div.innerHTML = "<select><option selected=''></option></select>";
+
+ // Support: IE8
+ // Boolean attributes and "value" are not treated correctly
+ if (!div.querySelectorAll("[selected]").length) {
+ rbuggyQSA.push("\\[" + whitespace + "*(?:value|" + booleans + ")");
+ }
+
+ // Webkit/Opera - :checked should return selected option elements
+ // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+ // IE8 throws error here and will not see later tests
+ if (!div.querySelectorAll(":checked").length) {
+ rbuggyQSA.push(":checked");
+ }
+ });
+
+ assert(function (div) {
+
+ // Support: Opera 10-12/IE8
+ // ^= $= *= and empty values
+ // Should not select anything
+ // Support: Windows 8 Native Apps
+ // The type attribute is restricted during .innerHTML assignment
+ var input = doc.createElement("input");
+ input.setAttribute("type", "hidden");
+ div.appendChild(input).setAttribute("t", "");
+
+ if (div.querySelectorAll("[t^='']").length) {
+ rbuggyQSA.push("[*^$]=" + whitespace + "*(?:''|\"\")");
+ }
+
+ // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)
+ // IE8 throws error here and will not see later tests
+ if (!div.querySelectorAll(":enabled").length) {
+ rbuggyQSA.push(":enabled", ":disabled");
+ }
+
+ // Opera 10-11 does not throw on post-comma invalid pseudos
+ div.querySelectorAll("*,:x");
+ rbuggyQSA.push(",.*:");
+ });
+ }
+
+ if ((support.matchesSelector = rnative.test((matches = docElem.webkitMatchesSelector ||
+ docElem.mozMatchesSelector ||
+ docElem.oMatchesSelector ||
+ docElem.msMatchesSelector)))) {
+
+ assert(function (div) {
+ // Check to see if it's possible to do matchesSelector
+ // on a disconnected node (IE 9)
+ support.disconnectedMatch = matches.call(div, "div");
+
+ // This should fail with an exception
+ // Gecko does not error, returns false instead
+ matches.call(div, "[s!='']:x");
+ rbuggyMatches.push("!=", pseudos);
+ });
+ }
+
+ rbuggyQSA = rbuggyQSA.length && new RegExp(rbuggyQSA.join("|"));
+ rbuggyMatches = rbuggyMatches.length && new RegExp(rbuggyMatches.join("|"));
+
+ /* Contains
+ ---------------------------------------------------------------------- */
+
+ // Element contains another
+ // Purposefully does not implement inclusive descendent
+ // As in, an element does not contain itself
+ contains = rnative.test(docElem.contains) || docElem.compareDocumentPosition ?
+ function (a, b) {
+ var adown = a.nodeType === 9 ? a.documentElement : a,
+ bup = b && b.parentNode;
+ return a === bup || !!( bup && bup.nodeType === 1 && (
+ adown.contains ?
+ adown.contains(bup) :
+ a.compareDocumentPosition && a.compareDocumentPosition(bup) & 16
+ ));
+ } :
+ function (a, b) {
+ if (b) {
+ while ((b = b.parentNode)) {
+ if (b === a) {
+ return true;
+ }
+ }
+ }
+ return false;
+ };
+
+ /* Sorting
+ ---------------------------------------------------------------------- */
+
+ // Document order sorting
+ sortOrder = docElem.compareDocumentPosition ?
+ function (a, b) {
+
+ // Flag for duplicate removal
+ if (a === b) {
+ hasDuplicate = true;
+ return 0;
+ }
+
+ var compare = b.compareDocumentPosition && a.compareDocumentPosition && a.compareDocumentPosition(b);
+
+ if (compare) {
+ // Disconnected nodes
+ if (compare & 1 ||
+ (!support.sortDetached && b.compareDocumentPosition(a) === compare)) {
+
+ // Choose the first element that is related to our preferred document
+ if (a === doc || contains(preferredDoc, a)) {
+ return -1;
+ }
+ if (b === doc || contains(preferredDoc, b)) {
+ return 1;
+ }
+
+ // Maintain original order
+ return sortInput ?
+ ( indexOf.call(sortInput, a) - indexOf.call(sortInput, b) ) :
+ 0;
+ }
+
+ return compare & 4 ? -1 : 1;
+ }
+
+ // Not directly comparable, sort on existence of method
+ return a.compareDocumentPosition ? -1 : 1;
+ } :
+ function (a, b) {
+ var cur,
+ i = 0,
+ aup = a.parentNode,
+ bup = b.parentNode,
+ ap = [a],
+ bp = [b];
+
+ // Exit early if the nodes are identical
+ if (a === b) {
+ hasDuplicate = true;
+ return 0;
+
+ // Parentless nodes are either documents or disconnected
+ } else if (!aup || !bup) {
+ return a === doc ? -1 :
+ b === doc ? 1 :
+ aup ? -1 :
+ bup ? 1 :
+ sortInput ?
+ ( indexOf.call(sortInput, a) - indexOf.call(sortInput, b) ) :
+ 0;
+
+ // If the nodes are siblings, we can do a quick check
+ } else if (aup === bup) {
+ return siblingCheck(a, b);
+ }
+
+ // Otherwise we need full lists of their ancestors for comparison
+ cur = a;
+ while ((cur = cur.parentNode)) {
+ ap.unshift(cur);
+ }
+ cur = b;
+ while ((cur = cur.parentNode)) {
+ bp.unshift(cur);
+ }
+
+ // Walk down the tree looking for a discrepancy
+ while (ap[i] === bp[i]) {
+ i++;
+ }
+
+ return i ?
+ // Do a sibling check if the nodes have a common ancestor
+ siblingCheck(ap[i], bp[i]) :
+
+ // Otherwise nodes in our document sort first
+ ap[i] === preferredDoc ? -1 :
+ bp[i] === preferredDoc ? 1 :
+ 0;
+ };
+
+ return doc;
+ };
+
+ Sizzle.matches = function (expr, elements) {
+ return Sizzle(expr, null, null, elements);
+ };
+
+ Sizzle.matchesSelector = function (elem, expr) {
+ // Set document vars if needed
+ if (( elem.ownerDocument || elem ) !== document) {
+ setDocument(elem);
+ }
+
+ // Make sure that attribute selectors are quoted
+ expr = expr.replace(rattributeQuotes, "='$1']");
+
+ if (support.matchesSelector && documentIsHTML &&
+ ( !rbuggyMatches || !rbuggyMatches.test(expr) ) &&
+ ( !rbuggyQSA || !rbuggyQSA.test(expr) )) {
+
+ try {
+ var ret = matches.call(elem, expr);
+
+ // IE 9's matchesSelector returns false on disconnected nodes
+ if (ret || support.disconnectedMatch ||
+ // As well, disconnected nodes are said to be in a document
+ // fragment in IE 9
+ elem.document && elem.document.nodeType !== 11) {
+ return ret;
+ }
+ } catch (e) {
+ }
+ }
+
+ return Sizzle(expr, document, null, [elem]).length > 0;
+ };
+
+ Sizzle.contains = function (context, elem) {
+ // Set document vars if needed
+ if (( context.ownerDocument || context ) !== document) {
+ setDocument(context);
+ }
+ return contains(context, elem);
+ };
+
+ Sizzle.attr = function (elem, name) {
+ // Set document vars if needed
+ if (( elem.ownerDocument || elem ) !== document) {
+ setDocument(elem);
+ }
+
+ var fn = Expr.attrHandle[name.toLowerCase()],
+ // Don't get fooled by Object.prototype properties (jQuery #13807)
+ val = fn && hasOwn.call(Expr.attrHandle, name.toLowerCase()) ?
+ fn(elem, name, !documentIsHTML) :
+ undefined;
+
+ return val === undefined ?
+ support.attributes || !documentIsHTML ?
+ elem.getAttribute(name) :
+ (val = elem.getAttributeNode(name)) && val.specified ?
+ val.value :
+ null :
+ val;
+ };
+
+ Sizzle.error = function (msg) {
+ throw new Error("Syntax error, unrecognized expression: " + msg);
+ };
+
+ /**
+ * Document sorting and removing duplicates
+ * @param {ArrayLike} results
+ */
+ Sizzle.uniqueSort = function (results) {
+ var elem,
+ duplicates = [],
+ j = 0,
+ i = 0;
+
+ // Unless we *know* we can detect duplicates, assume their presence
+ hasDuplicate = !support.detectDuplicates;
+ sortInput = !support.sortStable && results.slice(0);
+ results.sort(sortOrder);
+
+ if (hasDuplicate) {
+ while ((elem = results[i++])) {
+ if (elem === results[i]) {
+ j = duplicates.push(i);
+ }
+ }
+ while (j--) {
+ results.splice(duplicates[j], 1);
+ }
+ }
+
+ return results;
+ };
+
+ /**
+ * Utility function for retrieving the text value of an array of DOM nodes
+ * @param {Array|Element} elem
+ */
+ getText = Sizzle.getText = function (elem) {
+ var node,
+ ret = "",
+ i = 0,
+ nodeType = elem.nodeType;
+
+ if (!nodeType) {
+ // If no nodeType, this is expected to be an array
+ for (; (node = elem[i]); i++) {
+ // Do not traverse comment nodes
+ ret += getText(node);
+ }
+ } else if (nodeType === 1 || nodeType === 9 || nodeType === 11) {
+ // Use textContent for elements
+ // innerText usage removed for consistency of new lines (see #11153)
+ if (typeof elem.textContent === "string") {
+ return elem.textContent;
+ } else {
+ // Traverse its children
+ for (elem = elem.firstChild; elem; elem = elem.nextSibling) {
+ ret += getText(elem);
+ }
+ }
+ } else if (nodeType === 3 || nodeType === 4) {
+ return elem.nodeValue;
+ }
+ // Do not include comment or processing instruction nodes
+
+ return ret;
+ };
+
+ Expr = Sizzle.selectors = {
+
+ // Can be adjusted by the user
+ cacheLength: 50,
+
+ createPseudo: markFunction,
+
+ match: matchExpr,
+
+ attrHandle: {},
+
+ find: {},
+
+ relative: {
+ ">": {dir: "parentNode", first: true},
+ " ": {dir: "parentNode"},
+ "+": {dir: "previousSibling", first: true},
+ "~": {dir: "previousSibling"}
+ },
+
+ preFilter: {
+ "ATTR": function (match) {
+ match[1] = match[1].replace(runescape, funescape);
+
+ // Move the given value to match[3] whether quoted or unquoted
+ match[3] = ( match[4] || match[5] || "" ).replace(runescape, funescape);
+
+ if (match[2] === "~=") {
+ match[3] = " " + match[3] + " ";
+ }
+
+ return match.slice(0, 4);
+ },
+
+ "CHILD": function (match) {
+ /* matches from matchExpr["CHILD"]
+ 1 type (only|nth|...)
+ 2 what (child|of-type)
+ 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...)
+ 4 xn-component of xn+y argument ([+-]?\d*n|)
+ 5 sign of xn-component
+ 6 x of xn-component
+ 7 sign of y-component
+ 8 y of y-component
+ */
+ match[1] = match[1].toLowerCase();
+
+ if (match[1].slice(0, 3) === "nth") {
+ // nth-* requires argument
+ if (!match[3]) {
+ Sizzle.error(match[0]);
+ }
+
+ // numeric x and y parameters for Expr.filter.CHILD
+ // remember that false/true cast respectively to 0/1
+ match[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === "even" || match[3] === "odd" ) );
+ match[5] = +( ( match[7] + match[8] ) || match[3] === "odd" );
+
+ // other types prohibit arguments
+ } else if (match[3]) {
+ Sizzle.error(match[0]);
+ }
+
+ return match;
+ },
+
+ "PSEUDO": function (match) {
+ var excess,
+ unquoted = !match[5] && match[2];
+
+ if (matchExpr["CHILD"].test(match[0])) {
+ return null;
+ }
+
+ // Accept quoted arguments as-is
+ if (match[3] && match[4] !== undefined) {
+ match[2] = match[4];
+
+ // Strip excess characters from unquoted arguments
+ } else if (unquoted && rpseudo.test(unquoted) &&
+ // Get excess from tokenize (recursively)
+ (excess = tokenize(unquoted, true)) &&
+ // advance to the next closing parenthesis
+ (excess = unquoted.indexOf(")", unquoted.length - excess) - unquoted.length)) {
+
+ // excess is a negative index
+ match[0] = match[0].slice(0, excess);
+ match[2] = unquoted.slice(0, excess);
+ }
+
+ // Return only captures needed by the pseudo filter method (type and argument)
+ return match.slice(0, 3);
+ }
+ },
+
+ filter: {
+
+ "TAG": function (nodeNameSelector) {
+ var nodeName = nodeNameSelector.replace(runescape, funescape).toLowerCase();
+ return nodeNameSelector === "*" ?
+ function () {
+ return true;
+ } :
+ function (elem) {
+ return elem.nodeName && elem.nodeName.toLowerCase() === nodeName;
+ };
+ },
+
+ "CLASS": function (className) {
+ var pattern = classCache[className + " "];
+
+ return pattern ||
+ (pattern = new RegExp("(^|" + whitespace + ")" + className + "(" + whitespace + "|$)")) &&
+ classCache(className, function (elem) {
+ return pattern.test(typeof elem.className === "string" && elem.className || typeof elem.getAttribute !== strundefined && elem.getAttribute("class") || "");
+ });
+ },
+
+ "ATTR": function (name, operator, check) {
+ return function (elem) {
+ var result = Sizzle.attr(elem, name);
+
+ if (result == null) {
+ return operator === "!=";
+ }
+ if (!operator) {
+ return true;
+ }
+
+ result += "";
+
+ return operator === "=" ? result === check :
+ operator === "!=" ? result !== check :
+ operator === "^=" ? check && result.indexOf(check) === 0 :
+ operator === "*=" ? check && result.indexOf(check) > -1 :
+ operator === "$=" ? check && result.slice(-check.length) === check :
+ operator === "~=" ? ( " " + result + " " ).indexOf(check) > -1 :
+ operator === "|=" ? result === check || result.slice(0, check.length + 1) === check + "-" :
+ false;
+ };
+ },
+
+ "CHILD": function (type, what, argument, first, last) {
+ var simple = type.slice(0, 3) !== "nth",
+ forward = type.slice(-4) !== "last",
+ ofType = what === "of-type";
+
+ return first === 1 && last === 0 ?
+
+ // Shortcut for :nth-*(n)
+ function (elem) {
+ return !!elem.parentNode;
+ } :
+
+ function (elem, context, xml) {
+ var cache, outerCache, node, diff, nodeIndex, start,
+ dir = simple !== forward ? "nextSibling" : "previousSibling",
+ parent = elem.parentNode,
+ name = ofType && elem.nodeName.toLowerCase(),
+ useCache = !xml && !ofType;
+
+ if (parent) {
+
+ // :(first|last|only)-(child|of-type)
+ if (simple) {
+ while (dir) {
+ node = elem;
+ while ((node = node[dir])) {
+ if (ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1) {
+ return false;
+ }
+ }
+ // Reverse direction for :only-* (if we haven't yet done so)
+ start = dir = type === "only" && !start && "nextSibling";
+ }
+ return true;
+ }
+
+ start = [forward ? parent.firstChild : parent.lastChild];
+
+ // non-xml :nth-child(...) stores cache data on `parent`
+ if (forward && useCache) {
+ // Seek `elem` from a previously-cached index
+ outerCache = parent[expando] || (parent[expando] = {});
+ cache = outerCache[type] || [];
+ nodeIndex = cache[0] === dirruns && cache[1];
+ diff = cache[0] === dirruns && cache[2];
+ node = nodeIndex && parent.childNodes[nodeIndex];
+
+ while ((node = ++nodeIndex && node && node[dir] ||
+
+ // Fallback to seeking `elem` from the start
+ (diff = nodeIndex = 0) || start.pop())) {
+
+ // When found, cache indexes on `parent` and break
+ if (node.nodeType === 1 && ++diff && node === elem) {
+ outerCache[type] = [dirruns, nodeIndex, diff];
+ break;
+ }
+ }
+
+ // Use previously-cached element index if available
+ } else if (useCache && (cache = (elem[expando] || (elem[expando] = {}))[type]) && cache[0] === dirruns) {
+ diff = cache[1];
+
+ // xml :nth-child(...) or :nth-last-child(...) or :nth(-last)?-of-type(...)
+ } else {
+ // Use the same loop as above to seek `elem` from the start
+ while ((node = ++nodeIndex && node && node[dir] ||
+ (diff = nodeIndex = 0) || start.pop())) {
+
+ if (( ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1 ) && ++diff) {
+ // Cache the index of each encountered element
+ if (useCache) {
+ (node[expando] || (node[expando] = {}))[type] = [dirruns, diff];
+ }
+
+ if (node === elem) {
+ break;
+ }
+ }
+ }
+ }
+
+ // Incorporate the offset, then check against cycle size
+ diff -= last;
+ return diff === first || ( diff % first === 0 && diff / first >= 0 );
+ }
+ };
+ },
+
+ "PSEUDO": function (pseudo, argument) {
+ // pseudo-class names are case-insensitive
+ // http://www.w3.org/TR/selectors/#pseudo-classes
+ // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
+ // Remember that setFilters inherits from pseudos
+ var args,
+ fn = Expr.pseudos[pseudo] || Expr.setFilters[pseudo.toLowerCase()] ||
+ Sizzle.error("unsupported pseudo: " + pseudo);
+
+ // The user may use createPseudo to indicate that
+ // arguments are needed to create the filter function
+ // just as Sizzle does
+ if (fn[expando]) {
+ return fn(argument);
+ }
+
+ // But maintain support for old signatures
+ if (fn.length > 1) {
+ args = [pseudo, pseudo, "", argument];
+ return Expr.setFilters.hasOwnProperty(pseudo.toLowerCase()) ?
+ markFunction(function (seed, matches) {
+ var idx,
+ matched = fn(seed, argument),
+ i = matched.length;
+ while (i--) {
+ idx = indexOf.call(seed, matched[i]);
+ seed[idx] = !( matches[idx] = matched[i] );
+ }
+ }) :
+ function (elem) {
+ return fn(elem, 0, args);
+ };
+ }
+
+ return fn;
+ }
+ },
+
+ pseudos: {
+ // Potentially complex pseudos
+ "not": markFunction(function (selector) {
+ // Trim the selector passed to compile
+ // to avoid treating leading and trailing
+ // spaces as combinators
+ var input = [],
+ results = [],
+ matcher = compile(selector.replace(rtrim, "$1"));
+
+ return matcher[expando] ?
+ markFunction(function (seed, matches, context, xml) {
+ var elem,
+ unmatched = matcher(seed, null, xml, []),
+ i = seed.length;
+
+ // Match elements unmatched by `matcher`
+ while (i--) {
+ if ((elem = unmatched[i])) {
+ seed[i] = !(matches[i] = elem);
+ }
+ }
+ }) :
+ function (elem, context, xml) {
+ input[0] = elem;
+ matcher(input, null, xml, results);
+ return !results.pop();
+ };
+ }),
+
+ "has": markFunction(function (selector) {
+ return function (elem) {
+ return Sizzle(selector, elem).length > 0;
+ };
+ }),
+
+ "contains": markFunction(function (text) {
+ return function (elem) {
+ return ( elem.textContent || elem.innerText || getText(elem) ).indexOf(text) > -1;
+ };
+ }),
+
+ // "Whether an element is represented by a :lang() selector
+ // is based solely on the element's language value
+ // being equal to the identifier C,
+ // or beginning with the identifier C immediately followed by "-".
+ // The matching of C against the element's language value is performed case-insensitively.
+ // The identifier C does not have to be a valid language name."
+ // http://www.w3.org/TR/selectors/#lang-pseudo
+ "lang": markFunction(function (lang) {
+ // lang value must be a valid identifier
+ if (!ridentifier.test(lang || "")) {
+ Sizzle.error("unsupported lang: " + lang);
+ }
+ lang = lang.replace(runescape, funescape).toLowerCase();
+ return function (elem) {
+ var elemLang;
+ do {
+ if ((elemLang = documentIsHTML ?
+ elem.lang :
+ elem.getAttribute("xml:lang") || elem.getAttribute("lang"))) {
+
+ elemLang = elemLang.toLowerCase();
+ return elemLang === lang || elemLang.indexOf(lang + "-") === 0;
+ }
+ } while ((elem = elem.parentNode) && elem.nodeType === 1);
+ return false;
+ };
+ }),
+
+ // Miscellaneous
+ "target": function (elem) {
+ var hash = window.location && window.location.hash;
+ return hash && hash.slice(1) === elem.id;
+ },
+
+ "root": function (elem) {
+ return elem === docElem;
+ },
+
+ "focus": function (elem) {
+ return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex);
+ },
+
+ // Boolean properties
+ "enabled": function (elem) {
+ return elem.disabled === false;
+ },
+
+ "disabled": function (elem) {
+ return elem.disabled === true;
+ },
+
+ "checked": function (elem) {
+ // In CSS3, :checked should return both checked and selected elements
+ // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+ var nodeName = elem.nodeName.toLowerCase();
+ return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected);
+ },
+
+ "selected": function (elem) {
+ // Accessing this property makes selected-by-default
+ // options in Safari work properly
+ if (elem.parentNode) {
+ elem.parentNode.selectedIndex;
+ }
+
+ return elem.selected === true;
+ },
+
+ // Contents
+ "empty": function (elem) {
+ // http://www.w3.org/TR/selectors/#empty-pseudo
+ // :empty is only affected by element nodes and content nodes(including text(3), cdata(4)),
+ // not comment, processing instructions, or others
+ // Thanks to Diego Perini for the nodeName shortcut
+ // Greater than "@" means alpha characters (specifically not starting with "#" or "?")
+ for (elem = elem.firstChild; elem; elem = elem.nextSibling) {
+ if (elem.nodeName > "@" || elem.nodeType === 3 || elem.nodeType === 4) {
+ return false;
+ }
+ }
+ return true;
+ },
+
+ "parent": function (elem) {
+ return !Expr.pseudos["empty"](elem);
+ },
+
+ // Element/input types
+ "header": function (elem) {
+ return rheader.test(elem.nodeName);
+ },
+
+ "input": function (elem) {
+ return rinputs.test(elem.nodeName);
+ },
+
+ "button": function (elem) {
+ var name = elem.nodeName.toLowerCase();
+ return name === "input" && elem.type === "button" || name === "button";
+ },
+
+ "text": function (elem) {
+ var attr;
+ // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc)
+ // use getAttribute instead to test this case
+ return elem.nodeName.toLowerCase() === "input" &&
+ elem.type === "text" &&
+ ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === elem.type );
+ },
+
+ // Position-in-collection
+ "first": createPositionalPseudo(function () {
+ return [0];
+ }),
+
+ "last": createPositionalPseudo(function (matchIndexes, length) {
+ return [length - 1];
+ }),
+
+ "eq": createPositionalPseudo(function (matchIndexes, length, argument) {
+ return [argument < 0 ? argument + length : argument];
+ }),
+
+ "even": createPositionalPseudo(function (matchIndexes, length) {
+ var i = 0;
+ for (; i < length; i += 2) {
+ matchIndexes.push(i);
+ }
+ return matchIndexes;
+ }),
+
+ "odd": createPositionalPseudo(function (matchIndexes, length) {
+ var i = 1;
+ for (; i < length; i += 2) {
+ matchIndexes.push(i);
+ }
+ return matchIndexes;
+ }),
+
+ "lt": createPositionalPseudo(function (matchIndexes, length, argument) {
+ var i = argument < 0 ? argument + length : argument;
+ for (; --i >= 0;) {
+ matchIndexes.push(i);
+ }
+ return matchIndexes;
+ }),
+
+ "gt": createPositionalPseudo(function (matchIndexes, length, argument) {
+ var i = argument < 0 ? argument + length : argument;
+ for (; ++i < length;) {
+ matchIndexes.push(i);
+ }
+ return matchIndexes;
+ })
+ }
+ };
+
+ Expr.pseudos["nth"] = Expr.pseudos["eq"];
+
+// Add button/input type pseudos
+ for (i in {radio: true, checkbox: true, file: true, password: true, image: true}) {
+ Expr.pseudos[i] = createInputPseudo(i);
+ }
+ for (i in {submit: true, reset: true}) {
+ Expr.pseudos[i] = createButtonPseudo(i);
+ }
+
+// Easy API for creating new setFilters
+ function setFilters() {
+ }
+
+ setFilters.prototype = Expr.filters = Expr.pseudos;
+ Expr.setFilters = new setFilters();
+
+ function tokenize(selector, parseOnly) {
+ var matched, match, tokens, type,
+ soFar, groups, preFilters,
+ cached = tokenCache[selector + " "];
+
+ if (cached) {
+ return parseOnly ? 0 : cached.slice(0);
+ }
+
+ soFar = selector;
+ groups = [];
+ preFilters = Expr.preFilter;
+
+ while (soFar) {
+
+ // Comma and first run
+ if (!matched || (match = rcomma.exec(soFar))) {
+ if (match) {
+ // Don't consume trailing commas as valid
+ soFar = soFar.slice(match[0].length) || soFar;
+ }
+ groups.push(tokens = []);
+ }
+
+ matched = false;
+
+ // Combinators
+ if ((match = rcombinators.exec(soFar))) {
+ matched = match.shift();
+ tokens.push({
+ value: matched,
+ // Cast descendant combinators to space
+ type: match[0].replace(rtrim, " ")
+ });
+ soFar = soFar.slice(matched.length);
+ }
+
+ // Filters
+ for (type in Expr.filter) {
+ if ((match = matchExpr[type].exec(soFar)) && (!preFilters[type] ||
+ (match = preFilters[type](match)))) {
+ matched = match.shift();
+ tokens.push({
+ value: matched,
+ type: type,
+ matches: match
+ });
+ soFar = soFar.slice(matched.length);
+ }
+ }
+
+ if (!matched) {
+ break;
+ }
+ }
+
+ // Return the length of the invalid excess
+ // if we're just parsing
+ // Otherwise, throw an error or return tokens
+ return parseOnly ?
+ soFar.length :
+ soFar ?
+ Sizzle.error(selector) :
+ // Cache the tokens
+ tokenCache(selector, groups).slice(0);
+ }
+
+ function toSelector(tokens) {
+ var i = 0,
+ len = tokens.length,
+ selector = "";
+ for (; i < len; i++) {
+ selector += tokens[i].value;
+ }
+ return selector;
+ }
+
+ function addCombinator(matcher, combinator, base) {
+ var dir = combinator.dir,
+ checkNonElements = base && dir === "parentNode",
+ doneName = done++;
+
+ return combinator.first ?
+ // Check against closest ancestor/preceding element
+ function (elem, context, xml) {
+ while ((elem = elem[dir])) {
+ if (elem.nodeType === 1 || checkNonElements) {
+ return matcher(elem, context, xml);
+ }
+ }
+ } :
+
+ // Check against all ancestor/preceding elements
+ function (elem, context, xml) {
+ var data, cache, outerCache,
+ dirkey = dirruns + " " + doneName;
+
+ // We can't set arbitrary data on XML nodes, so they don't benefit from dir caching
+ if (xml) {
+ while ((elem = elem[dir])) {
+ if (elem.nodeType === 1 || checkNonElements) {
+ if (matcher(elem, context, xml)) {
+ return true;
+ }
+ }
+ }
+ } else {
+ while ((elem = elem[dir])) {
+ if (elem.nodeType === 1 || checkNonElements) {
+ outerCache = elem[expando] || (elem[expando] = {});
+ if ((cache = outerCache[dir]) && cache[0] === dirkey) {
+ if ((data = cache[1]) === true || data === cachedruns) {
+ return data === true;
+ }
+ } else {
+ cache = outerCache[dir] = [dirkey];
+ cache[1] = matcher(elem, context, xml) || cachedruns;
+ if (cache[1] === true) {
+ return true;
+ }
+ }
+ }
+ }
+ }
+ };
+ }
+
+ function elementMatcher(matchers) {
+ return matchers.length > 1 ?
+ function (elem, context, xml) {
+ var i = matchers.length;
+ while (i--) {
+ if (!matchers[i](elem, context, xml)) {
+ return false;
+ }
+ }
+ return true;
+ } :
+ matchers[0];
+ }
+
+ function condense(unmatched, map, filter, context, xml) {
+ var elem,
+ newUnmatched = [],
+ i = 0,
+ len = unmatched.length,
+ mapped = map != null;
+
+ for (; i < len; i++) {
+ if ((elem = unmatched[i])) {
+ if (!filter || filter(elem, context, xml)) {
+ newUnmatched.push(elem);
+ if (mapped) {
+ map.push(i);
+ }
+ }
+ }
+ }
+
+ return newUnmatched;
+ }
+
+ function setMatcher(preFilter, selector, matcher, postFilter, postFinder, postSelector) {
+ if (postFilter && !postFilter[expando]) {
+ postFilter = setMatcher(postFilter);
+ }
+ if (postFinder && !postFinder[expando]) {
+ postFinder = setMatcher(postFinder, postSelector);
+ }
+ return markFunction(function (seed, results, context, xml) {
+ var temp, i, elem,
+ preMap = [],
+ postMap = [],
+ preexisting = results.length,
+
+ // Get initial elements from seed or context
+ elems = seed || multipleContexts(selector || "*", context.nodeType ? [context] : context, []),
+
+ // Prefilter to get matcher input, preserving a map for seed-results synchronization
+ matcherIn = preFilter && ( seed || !selector ) ?
+ condense(elems, preMap, preFilter, context, xml) :
+ elems,
+
+ matcherOut = matcher ?
+ // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,
+ postFinder || ( seed ? preFilter : preexisting || postFilter ) ?
+
+ // ...intermediate processing is necessary
+ [] :
+
+ // ...otherwise use results directly
+ results :
+ matcherIn;
+
+ // Find primary matches
+ if (matcher) {
+ matcher(matcherIn, matcherOut, context, xml);
+ }
+
+ // Apply postFilter
+ if (postFilter) {
+ temp = condense(matcherOut, postMap);
+ postFilter(temp, [], context, xml);
+
+ // Un-match failing elements by moving them back to matcherIn
+ i = temp.length;
+ while (i--) {
+ if ((elem = temp[i])) {
+ matcherOut[postMap[i]] = !(matcherIn[postMap[i]] = elem);
+ }
+ }
+ }
+
+ if (seed) {
+ if (postFinder || preFilter) {
+ if (postFinder) {
+ // Get the final matcherOut by condensing this intermediate into postFinder contexts
+ temp = [];
+ i = matcherOut.length;
+ while (i--) {
+ if ((elem = matcherOut[i])) {
+ // Restore matcherIn since elem is not yet a final match
+ temp.push((matcherIn[i] = elem));
+ }
+ }
+ postFinder(null, (matcherOut = []), temp, xml);
+ }
+
+ // Move matched elements from seed to results to keep them synchronized
+ i = matcherOut.length;
+ while (i--) {
+ if ((elem = matcherOut[i]) &&
+ (temp = postFinder ? indexOf.call(seed, elem) : preMap[i]) > -1) {
+
+ seed[temp] = !(results[temp] = elem);
+ }
+ }
+ }
+
+ // Add elements to results, through postFinder if defined
+ } else {
+ matcherOut = condense(
+ matcherOut === results ?
+ matcherOut.splice(preexisting, matcherOut.length) :
+ matcherOut
+ );
+ if (postFinder) {
+ postFinder(null, results, matcherOut, xml);
+ } else {
+ push.apply(results, matcherOut);
+ }
+ }
+ });
+ }
+
+ function matcherFromTokens(tokens) {
+ var checkContext, matcher, j,
+ len = tokens.length,
+ leadingRelative = Expr.relative[tokens[0].type],
+ implicitRelative = leadingRelative || Expr.relative[" "],
+ i = leadingRelative ? 1 : 0,
+
+ // The foundational matcher ensures that elements are reachable from top-level context(s)
+ matchContext = addCombinator(function (elem) {
+ return elem === checkContext;
+ }, implicitRelative, true),
+ matchAnyContext = addCombinator(function (elem) {
+ return indexOf.call(checkContext, elem) > -1;
+ }, implicitRelative, true),
+ matchers = [function (elem, context, xml) {
+ return ( !leadingRelative && ( xml || context !== outermostContext ) ) || (
+ (checkContext = context).nodeType ?
+ matchContext(elem, context, xml) :
+ matchAnyContext(elem, context, xml) );
+ }];
+
+ for (; i < len; i++) {
+ if ((matcher = Expr.relative[tokens[i].type])) {
+ matchers = [addCombinator(elementMatcher(matchers), matcher)];
+ } else {
+ matcher = Expr.filter[tokens[i].type].apply(null, tokens[i].matches);
+
+ // Return special upon seeing a positional matcher
+ if (matcher[expando]) {
+ // Find the next relative operator (if any) for proper handling
+ j = ++i;
+ for (; j < len; j++) {
+ if (Expr.relative[tokens[j].type]) {
+ break;
+ }
+ }
+ return setMatcher(
+ i > 1 && elementMatcher(matchers),
+ i > 1 && toSelector(
+ // If the preceding token was a descendant combinator, insert an implicit any-element `*`
+ tokens.slice(0, i - 1).concat({value: tokens[i - 2].type === " " ? "*" : ""})
+ ).replace(rtrim, "$1"),
+ matcher,
+ i < j && matcherFromTokens(tokens.slice(i, j)),
+ j < len && matcherFromTokens((tokens = tokens.slice(j))),
+ j < len && toSelector(tokens)
+ );
+ }
+ matchers.push(matcher);
+ }
+ }
+
+ return elementMatcher(matchers);
+ }
+
+ function matcherFromGroupMatchers(elementMatchers, setMatchers) {
+ // A counter to specify which element is currently being matched
+ var matcherCachedRuns = 0,
+ bySet = setMatchers.length > 0,
+ byElement = elementMatchers.length > 0,
+ superMatcher = function (seed, context, xml, results, expandContext) {
+ var elem, j, matcher,
+ setMatched = [],
+ matchedCount = 0,
+ i = "0",
+ unmatched = seed && [],
+ outermost = expandContext != null,
+ contextBackup = outermostContext,
+ // We must always have either seed elements or context
+ elems = seed || byElement && Expr.find["TAG"]("*", expandContext && context.parentNode || context),
+ // Use integer dirruns iff this is the outermost matcher
+ dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1);
+
+ if (outermost) {
+ outermostContext = context !== document && context;
+ cachedruns = matcherCachedRuns;
+ }
+
+ // Add elements passing elementMatchers directly to results
+ // Keep `i` a string if there are no elements so `matchedCount` will be "00" below
+ for (; (elem = elems[i]) != null; i++) {
+ if (byElement && elem) {
+ j = 0;
+ while ((matcher = elementMatchers[j++])) {
+ if (matcher(elem, context, xml)) {
+ results.push(elem);
+ break;
+ }
+ }
+ if (outermost) {
+ dirruns = dirrunsUnique;
+ cachedruns = ++matcherCachedRuns;
+ }
+ }
+
+ // Track unmatched elements for set filters
+ if (bySet) {
+ // They will have gone through all possible matchers
+ if ((elem = !matcher && elem)) {
+ matchedCount--;
+ }
+
+ // Lengthen the array for every element, matched or not
+ if (seed) {
+ unmatched.push(elem);
+ }
+ }
+ }
+
+ // Apply set filters to unmatched elements
+ matchedCount += i;
+ if (bySet && i !== matchedCount) {
+ j = 0;
+ while ((matcher = setMatchers[j++])) {
+ matcher(unmatched, setMatched, context, xml);
+ }
+
+ if (seed) {
+ // Reintegrate element matches to eliminate the need for sorting
+ if (matchedCount > 0) {
+ while (i--) {
+ if (!(unmatched[i] || setMatched[i])) {
+ setMatched[i] = pop.call(results);
+ }
+ }
+ }
+
+ // Discard index placeholder values to get only actual matches
+ setMatched = condense(setMatched);
+ }
+
+ // Add matches to results
+ push.apply(results, setMatched);
+
+ // Seedless set matches succeeding multiple successful matchers stipulate sorting
+ if (outermost && !seed && setMatched.length > 0 &&
+ ( matchedCount + setMatchers.length ) > 1) {
+
+ Sizzle.uniqueSort(results);
+ }
+ }
+
+ // Override manipulation of globals by nested matchers
+ if (outermost) {
+ dirruns = dirrunsUnique;
+ outermostContext = contextBackup;
+ }
+
+ return unmatched;
+ };
+
+ return bySet ?
+ markFunction(superMatcher) :
+ superMatcher;
+ }
+
+ compile = Sizzle.compile = function (selector, group /* Internal Use Only */) {
+ var i,
+ setMatchers = [],
+ elementMatchers = [],
+ cached = compilerCache[selector + " "];
+
+ if (!cached) {
+ // Generate a function of recursive functions that can be used to check each element
+ if (!group) {
+ group = tokenize(selector);
+ }
+ i = group.length;
+ while (i--) {
+ cached = matcherFromTokens(group[i]);
+ if (cached[expando]) {
+ setMatchers.push(cached);
+ } else {
+ elementMatchers.push(cached);
+ }
+ }
+
+ // Cache the compiled function
+ cached = compilerCache(selector, matcherFromGroupMatchers(elementMatchers, setMatchers));
+ }
+ return cached;
+ };
+
+ function multipleContexts(selector, contexts, results) {
+ var i = 0,
+ len = contexts.length;
+ for (; i < len; i++) {
+ Sizzle(selector, contexts[i], results);
+ }
+ return results;
+ }
+
+ function select(selector, context, results, seed) {
+ var i, tokens, token, type, find,
+ match = tokenize(selector);
+
+ if (!seed) {
+ // Try to minimize operations if there is only one group
+ if (match.length === 1) {
+
+ // Take a shortcut and set the context if the root selector is an ID
+ tokens = match[0] = match[0].slice(0);
+ if (tokens.length > 2 && (token = tokens[0]).type === "ID" &&
+ support.getById && context.nodeType === 9 && documentIsHTML &&
+ Expr.relative[tokens[1].type]) {
+
+ context = ( Expr.find["ID"](token.matches[0].replace(runescape, funescape), context) || [] )[0];
+ if (!context) {
+ return results;
+ }
+ selector = selector.slice(tokens.shift().value.length);
+ }
+
+ // Fetch a seed set for right-to-left matching
+ i = matchExpr["needsContext"].test(selector) ? 0 : tokens.length;
+ while (i--) {
+ token = tokens[i];
+
+ // Abort if we hit a combinator
+ if (Expr.relative[(type = token.type)]) {
+ break;
+ }
+ if ((find = Expr.find[type])) {
+ // Search, expanding context for leading sibling combinators
+ if ((seed = find(
+ token.matches[0].replace(runescape, funescape),
+ rsibling.test(tokens[0].type) && context.parentNode || context
+ ))) {
+
+ // If seed is empty or no tokens remain, we can return early
+ tokens.splice(i, 1);
+ selector = seed.length && toSelector(tokens);
+ if (!selector) {
+ push.apply(results, seed);
+ return results;
+ }
+
+ break;
+ }
+ }
+ }
+ }
+ }
+
+ // Compile and execute a filtering function
+ // Provide `match` to avoid retokenization if we modified the selector above
+ compile(selector, match)(
+ seed,
+ context,
+ !documentIsHTML,
+ results,
+ rsibling.test(selector)
+ );
+ return results;
+ }
+
+// One-time assignments
+
+// Sort stability
+ support.sortStable = expando.split("").sort(sortOrder).join("") === expando;
+
+// Support: Chrome<14
+// Always assume duplicates if they aren't passed to the comparison function
+ support.detectDuplicates = hasDuplicate;
+
+// Initialize against the default document
+ setDocument();
+
+// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27)
+// Detached nodes confoundingly follow *each other*
+ support.sortDetached = assert(function (div1) {
+ // Should return 1, but returns 4 (following)
+ return div1.compareDocumentPosition(document.createElement("div")) & 1;
+ });
+
+// Support: IE<8
+// Prevent attribute/property "interpolation"
+// http://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx
+ if (!assert(function (div) {
+ div.innerHTML = "<a href='#'></a>";
+ return div.firstChild.getAttribute("href") === "#";
+ })) {
+ addHandle("type|href|height|width", function (elem, name, isXML) {
+ if (!isXML) {
+ return elem.getAttribute(name, name.toLowerCase() === "type" ? 1 : 2);
+ }
+ });
+ }
+
+// Support: IE<9
+// Use defaultValue in place of getAttribute("value")
+ if (!support.attributes || !assert(function (div) {
+ div.innerHTML = "<input/>";
+ div.firstChild.setAttribute("value", "");
+ return div.firstChild.getAttribute("value") === "";
+ })) {
+ addHandle("value", function (elem, name, isXML) {
+ if (!isXML && elem.nodeName.toLowerCase() === "input") {
+ return elem.defaultValue;
+ }
+ });
+ }
+
+// Support: IE<9
+// Use getAttributeNode to fetch booleans when getAttribute lies
+ if (!assert(function (div) {
+ return div.getAttribute("disabled") == null;
+ })) {
+ addHandle(booleans, function (elem, name, isXML) {
+ var val;
+ if (!isXML) {
+ return (val = elem.getAttributeNode(name)) && val.specified ?
+ val.value :
+ elem[name] === true ? name.toLowerCase() : null;
+ }
+ });
+ }
+
+ jQuery.find = Sizzle;
+ jQuery.expr = Sizzle.selectors;
+ jQuery.expr[":"] = jQuery.expr.pseudos;
+ jQuery.unique = Sizzle.uniqueSort;
+ jQuery.text = Sizzle.getText;
+ jQuery.isXMLDoc = Sizzle.isXML;
+ jQuery.contains = Sizzle.contains;
+
+
+ })(window);
+// String to Object options format cache
+ var optionsCache = {};
+
+// Convert String-formatted options into Object-formatted ones and store in cache
+ function createOptions(options) {
+ var object = optionsCache[options] = {};
+ jQuery.each(options.match(core_rnotwhite) || [], function (_, flag) {
+ object[flag] = true;
+ });
+ return object;
+ }
+
+ /*
+ * Create a callback list using the following parameters:
+ *
+ * options: an optional list of space-separated options that will change how
+ * the callback list behaves or a more traditional option object
+ *
+ * By default a callback list will act like an event callback list and can be
+ * "fired" multiple times.
+ *
+ * Possible options:
+ *
+ * once: will ensure the callback list can only be fired once (like a Deferred)
+ *
+ * memory: will keep track of previous values and will call any callback added
+ * after the list has been fired right away with the latest "memorized"
+ * values (like a Deferred)
+ *
+ * unique: will ensure a callback can only be added once (no duplicate in the list)
+ *
+ * stopOnFalse: interrupt callings when a callback returns false
+ *
+ */
+ jQuery.Callbacks = function (options) {
+
+ // Convert options from String-formatted to Object-formatted if needed
+ // (we check in cache first)
+ options = typeof options === "string" ?
+ ( optionsCache[options] || createOptions(options) ) :
+ jQuery.extend({}, options);
+
+ var // Flag to know if list is currently firing
+ firing,
+ // Last fire value (for non-forgettable lists)
+ memory,
+ // Flag to know if list was already fired
+ fired,
+ // End of the loop when firing
+ firingLength,
+ // Index of currently firing callback (modified by remove if needed)
+ firingIndex,
+ // First callback to fire (used internally by add and fireWith)
+ firingStart,
+ // Actual callback list
+ list = [],
+ // Stack of fire calls for repeatable lists
+ stack = !options.once && [],
+ // Fire callbacks
+ fire = function (data) {
+ memory = options.memory && data;
+ fired = true;
+ firingIndex = firingStart || 0;
+ firingStart = 0;
+ firingLength = list.length;
+ firing = true;
+ for (; list && firingIndex < firingLength; firingIndex++) {
+ if (list[firingIndex].apply(data[0], data[1]) === false && options.stopOnFalse) {
+ memory = false; // To prevent further calls using add
+ break;
+ }
+ }
+ firing = false;
+ if (list) {
+ if (stack) {
+ if (stack.length) {
+ fire(stack.shift());
+ }
+ } else if (memory) {
+ list = [];
+ } else {
+ self.disable();
+ }
+ }
+ },
+ // Actual Callbacks object
+ self = {
+ // Add a callback or a collection of callbacks to the list
+ add: function () {
+ if (list) {
+ // First, we save the current length
+ var start = list.length;
+ (function add(args) {
+ jQuery.each(args, function (_, arg) {
+ var type = jQuery.type(arg);
+ if (type === "function") {
+ if (!options.unique || !self.has(arg)) {
+ list.push(arg);
+ }
+ } else if (arg && arg.length && type !== "string") {
+ // Inspect recursively
+ add(arg);
+ }
+ });
+ })(arguments);
+ // Do we need to add the callbacks to the
+ // current firing batch?
+ if (firing) {
+ firingLength = list.length;
+ // With memory, if we're not firing then
+ // we should call right away
+ } else if (memory) {
+ firingStart = start;
+ fire(memory);
+ }
+ }
+ return this;
+ },
+ // Remove a callback from the list
+ remove: function () {
+ if (list) {
+ jQuery.each(arguments, function (_, arg) {
+ var index;
+ while (( index = jQuery.inArray(arg, list, index) ) > -1) {
+ list.splice(index, 1);
+ // Handle firing indexes
+ if (firing) {
+ if (index <= firingLength) {
+ firingLength--;
+ }
+ if (index <= firingIndex) {
+ firingIndex--;
+ }
+ }
+ }
+ });
+ }
+ return this;
+ },
+ // Check if a given callback is in the list.
+ // If no argument is given, return whether or not list has callbacks attached.
+ has: function (fn) {
+ return fn ? jQuery.inArray(fn, list) > -1 : !!( list && list.length );
+ },
+ // Remove all callbacks from the list
+ empty: function () {
+ list = [];
+ firingLength = 0;
+ return this;
+ },
+ // Have the list do nothing anymore
+ disable: function () {
+ list = stack = memory = undefined;
+ return this;
+ },
+ // Is it disabled?
+ disabled: function () {
+ return !list;
+ },
+ // Lock the list in its current state
+ lock: function () {
+ stack = undefined;
+ if (!memory) {
+ self.disable();
+ }
+ return this;
+ },
+ // Is it locked?
+ locked: function () {
+ return !stack;
+ },
+ // Call all callbacks with the given context and arguments
+ fireWith: function (context, args) {
+ if (list && ( !fired || stack )) {
+ args = args || [];
+ args = [context, args.slice ? args.slice() : args];
+ if (firing) {
+ stack.push(args);
+ } else {
+ fire(args);
+ }
+ }
+ return this;
+ },
+ // Call all the callbacks with the given arguments
+ fire: function () {
+ self.fireWith(this, arguments);
+ return this;
+ },
+ // To know if the callbacks have already been called at least once
+ fired: function () {
+ return !!fired;
+ }
+ };
+
+ return self;
+ };
+ jQuery.extend({
+
+ Deferred: function (func) {
+ var tuples = [
+ // action, add listener, listener list, final state
+ ["resolve", "done", jQuery.Callbacks("once memory"), "resolved"],
+ ["reject", "fail", jQuery.Callbacks("once memory"), "rejected"],
+ ["notify", "progress", jQuery.Callbacks("memory")]
+ ],
+ state = "pending",
+ promise = {
+ state: function () {
+ return state;
+ },
+ always: function () {
+ deferred.done(arguments).fail(arguments);
+ return this;
+ },
+ then: function (/* fnDone, fnFail, fnProgress */) {
+ var fns = arguments;
+ return jQuery.Deferred(function (newDefer) {
+ jQuery.each(tuples, function (i, tuple) {
+ var action = tuple[0],
+ fn = jQuery.isFunction(fns[i]) && fns[i];
+ // deferred[ done | fail | progress ] for forwarding actions to newDefer
+ deferred[tuple[1]](function () {
+ var returned = fn && fn.apply(this, arguments);
+ if (returned && jQuery.isFunction(returned.promise)) {
+ returned.promise()
+ .done(newDefer.resolve)
+ .fail(newDefer.reject)
+ .progress(newDefer.notify);
+ } else {
+ newDefer[action + "With"](this === promise ? newDefer.promise() : this, fn ? [returned] : arguments);
+ }
+ });
+ });
+ fns = null;
+ }).promise();
+ },
+ // Get a promise for this deferred
+ // If obj is provided, the promise aspect is added to the object
+ promise: function (obj) {
+ return obj != null ? jQuery.extend(obj, promise) : promise;
+ }
+ },
+ deferred = {};
+
+ // Keep pipe for back-compat
+ promise.pipe = promise.then;
+
+ // Add list-specific methods
+ jQuery.each(tuples, function (i, tuple) {
+ var list = tuple[2],
+ stateString = tuple[3];
+
+ // promise[ done | fail | progress ] = list.add
+ promise[tuple[1]] = list.add;
+
+ // Handle state
+ if (stateString) {
+ list.add(function () {
+ // state = [ resolved | rejected ]
+ state = stateString;
+
+ // [ reject_list | resolve_list ].disable; progress_list.lock
+ }, tuples[i ^ 1][2].disable, tuples[2][2].lock);
+ }
+
+ // deferred[ resolve | reject | notify ]
+ deferred[tuple[0]] = function () {
+ deferred[tuple[0] + "With"](this === deferred ? promise : this, arguments);
+ return this;
+ };
+ deferred[tuple[0] + "With"] = list.fireWith;
+ });
+
+ // Make the deferred a promise
+ promise.promise(deferred);
+
+ // Call given func if any
+ if (func) {
+ func.call(deferred, deferred);
+ }
+
+ // All done!
+ return deferred;
+ },
+
+ // Deferred helper
+ when: function (subordinate /* , ..., subordinateN */) {
+ var i = 0,
+ resolveValues = core_slice.call(arguments),
+ length = resolveValues.length,
+
+ // the count of uncompleted subordinates
+ remaining = length !== 1 || ( subordinate && jQuery.isFunction(subordinate.promise) ) ? length : 0,
+
+ // the master Deferred. If resolveValues consist of only a single Deferred, just use that.
+ deferred = remaining === 1 ? subordinate : jQuery.Deferred(),
+
+ // Update function for both resolve and progress values
+ updateFunc = function (i, contexts, values) {
+ return function (value) {
+ contexts[i] = this;
+ values[i] = arguments.length > 1 ? core_slice.call(arguments) : value;
+ if (values === progressValues) {
+ deferred.notifyWith(contexts, values);
+ } else if (!( --remaining )) {
+ deferred.resolveWith(contexts, values);
+ }
+ };
+ },
+
+ progressValues, progressContexts, resolveContexts;
+
+ // add listeners to Deferred subordinates; treat others as resolved
+ if (length > 1) {
+ progressValues = new Array(length);
+ progressContexts = new Array(length);
+ resolveContexts = new Array(length);
+ for (; i < length; i++) {
+ if (resolveValues[i] && jQuery.isFunction(resolveValues[i].promise)) {
+ resolveValues[i].promise()
+ .done(updateFunc(i, resolveContexts, resolveValues))
+ .fail(deferred.reject)
+ .progress(updateFunc(i, progressContexts, progressValues));
+ } else {
+ --remaining;
+ }
+ }
+ }
+
+ // if we're not waiting on anything, resolve the master
+ if (!remaining) {
+ deferred.resolveWith(resolveContexts, resolveValues);
+ }
+
+ return deferred.promise();
+ }
+ });
+ jQuery.support = (function (support) {
+
+ var all, a, input, select, fragment, opt, eventName, isSupported, i,
+ div = document.createElement("div");
+
+ // Setup
+ div.setAttribute("className", "t");
+ div.innerHTML = " <link/><table></table><a href='/a'>a</a><input type='checkbox'/>";
+
+ // Finish early in limited (non-browser) environments
+ all = div.getElementsByTagName("*") || [];
+ a = div.getElementsByTagName("a")[0];
+ if (!a || !a.style || !all.length) {
+ return support;
+ }
+
+ // First batch of tests
+ select = document.createElement("select");
+ opt = select.appendChild(document.createElement("option"));
+ input = div.getElementsByTagName("input")[0];
+
+ a.style.cssText = "top:1px;float:left;opacity:.5";
+
+ // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7)
+ support.getSetAttribute = div.className !== "t";
+
+ // IE strips leading whitespace when .innerHTML is used
+ support.leadingWhitespace = div.firstChild.nodeType === 3;
+
+ // Make sure that tbody elements aren't automatically inserted
+ // IE will insert them into empty tables
+ support.tbody = !div.getElementsByTagName("tbody").length;
+
+ // Make sure that link elements get serialized correctly by innerHTML
+ // This requires a wrapper element in IE
+ support.htmlSerialize = !!div.getElementsByTagName("link").length;
+
+ // Get the style information from getAttribute
+ // (IE uses .cssText instead)
+ support.style = /top/.test(a.getAttribute("style"));
+
+ // Make sure that URLs aren't manipulated
+ // (IE normalizes it by default)
+ support.hrefNormalized = a.getAttribute("href") === "/a";
+
+ // Make sure that element opacity exists
+ // (IE uses filter instead)
+ // Use a regex to work around a WebKit issue. See #5145
+ support.opacity = /^0.5/.test(a.style.opacity);
+
+ // Verify style float existence
+ // (IE uses styleFloat instead of cssFloat)
+ support.cssFloat = !!a.style.cssFloat;
+
+ // Check the default checkbox/radio value ("" on WebKit; "on" elsewhere)
+ support.checkOn = !!input.value;
+
+ // Make sure that a selected-by-default option has a working selected property.
+ // (WebKit defaults to false instead of true, IE too, if it's in an optgroup)
+ support.optSelected = opt.selected;
+
+ // Tests for enctype support on a form (#6743)
+ support.enctype = !!document.createElement("form").enctype;
+
+ // Makes sure cloning an html5 element does not cause problems
+ // Where outerHTML is undefined, this still works
+ support.html5Clone = document.createElement("nav").cloneNode(true).outerHTML !== "<:nav></:nav>";
+
+ // Will be defined later
+ support.inlineBlockNeedsLayout = false;
+ support.shrinkWrapBlocks = false;
+ support.pixelPosition = false;
+ support.deleteExpando = true;
+ support.noCloneEvent = true;
+ support.reliableMarginRight = true;
+ support.boxSizingReliable = true;
+
+ // Make sure checked status is properly cloned
+ input.checked = true;
+ support.noCloneChecked = input.cloneNode(true).checked;
+
+ // Make sure that the options inside disabled selects aren't marked as disabled
+ // (WebKit marks them as disabled)
+ select.disabled = true;
+ support.optDisabled = !opt.disabled;
+
+ // Support: IE<9
+ try {
+ delete div.test;
+ } catch (e) {
+ support.deleteExpando = false;
+ }
+
+ // Check if we can trust getAttribute("value")
+ input = document.createElement("input");
+ input.setAttribute("value", "");
+ support.input = input.getAttribute("value") === "";
+
+ // Check if an input maintains its value after becoming a radio
+ input.value = "t";
+ input.setAttribute("type", "radio");
+ support.radioValue = input.value === "t";
+
+ // #11217 - WebKit loses check when the name is after the checked attribute
+ input.setAttribute("checked", "t");
+ input.setAttribute("name", "t");
+
+ fragment = document.createDocumentFragment();
+ fragment.appendChild(input);
+
+ // Check if a disconnected checkbox will retain its checked
+ // value of true after appended to the DOM (IE6/7)
+ support.appendChecked = input.checked;
+
+ // WebKit doesn't clone checked state correctly in fragments
+ support.checkClone = fragment.cloneNode(true).cloneNode(true).lastChild.checked;
+
+ // Support: IE<9
+ // Opera does not clone events (and typeof div.attachEvent === undefined).
+ // IE9-10 clones events bound via attachEvent, but they don't trigger with .click()
+ if (div.attachEvent) {
+ div.attachEvent("onclick", function () {
+ support.noCloneEvent = false;
+ });
+
+ div.cloneNode(true).click();
+ }
+
+ // Support: IE<9 (lack submit/change bubble), Firefox 17+ (lack focusin event)
+ // Beware of CSP restrictions (https://developer.mozilla.org/en/Security/CSP)
+ for (i in {submit: true, change: true, focusin: true}) {
+ div.setAttribute(eventName = "on" + i, "t");
+
+ support[i + "Bubbles"] = eventName in window || div.attributes[eventName].expando === false;
+ }
+
+ div.style.backgroundClip = "content-box";
+ div.cloneNode(true).style.backgroundClip = "";
+ support.clearCloneStyle = div.style.backgroundClip === "content-box";
+
+ // Support: IE<9
+ // Iteration over object's inherited properties before its own.
+ for (i in jQuery(support)) {
+ break;
+ }
+ support.ownLast = i !== "0";
+
+ // Run tests that need a body at doc ready
+ jQuery(function () {
+ var container, marginDiv, tds,
+ divReset = "padding:0;margin:0;border:0;display:block;box-sizing:content-box;-moz-box-sizing:content-box;-webkit-box-sizing:content-box;",
+ body = document.getElementsByTagName("body")[0];
+
+ if (!body) {
+ // Return for frameset docs that don't have a body
+ return;
+ }
+
+ container = document.createElement("div");
+ container.style.cssText = "border:0;width:0;height:0;position:absolute;top:0;left:-9999px;margin-top:1px";
+
+ body.appendChild(container).appendChild(div);
+
+ // Support: IE8
+ // Check if table cells still have offsetWidth/Height when they are set
+ // to display:none and there are still other visible table cells in a
+ // table row; if so, offsetWidth/Height are not reliable for use when
+ // determining if an element has been hidden directly using
+ // display:none (it is still safe to use offsets if a parent element is
+ // hidden; don safety goggles and see bug #4512 for more information).
+ div.innerHTML = "<table><tr><td></td><td>t</td></tr></table>";
+ tds = div.getElementsByTagName("td");
+ tds[0].style.cssText = "padding:0;margin:0;border:0;display:none";
+ isSupported = ( tds[0].offsetHeight === 0 );
+
+ tds[0].style.display = "";
+ tds[1].style.display = "none";
+
+ // Support: IE8
+ // Check if empty table cells still have offsetWidth/Height
+ support.reliableHiddenOffsets = isSupported && ( tds[0].offsetHeight === 0 );
+
+ // Check box-sizing and margin behavior.
+ div.innerHTML = "";
+ div.style.cssText = "box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;";
+
+ // Workaround failing boxSizing test due to offsetWidth returning wrong value
+ // with some non-1 values of body zoom, ticket #13543
+ jQuery.swap(body, body.style.zoom != null ? {zoom: 1} : {}, function () {
+ support.boxSizing = div.offsetWidth === 4;
+ });
+
+ // Use window.getComputedStyle because jsdom on node.js will break without it.
+ if (window.getComputedStyle) {
+ support.pixelPosition = ( window.getComputedStyle(div, null) || {} ).top !== "1%";
+ support.boxSizingReliable = ( window.getComputedStyle(div, null) || {width: "4px"} ).width === "4px";
+
+ // Check if div with explicit width and no margin-right incorrectly
+ // gets computed margin-right based on width of container. (#3333)
+ // Fails in WebKit before Feb 2011 nightlies
+ // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
+ marginDiv = div.appendChild(document.createElement("div"));
+ marginDiv.style.cssText = div.style.cssText = divReset;
+ marginDiv.style.marginRight = marginDiv.style.width = "0";
+ div.style.width = "1px";
+
+ support.reliableMarginRight = !parseFloat(( window.getComputedStyle(marginDiv, null) || {} ).marginRight);
+ }
+
+ if (typeof div.style.zoom !== core_strundefined) {
+ // Support: IE<8
+ // Check if natively block-level elements act like inline-block
+ // elements when setting their display to 'inline' and giving
+ // them layout
+ div.innerHTML = "";
+ div.style.cssText = divReset + "width:1px;padding:1px;display:inline;zoom:1";
+ support.inlineBlockNeedsLayout = ( div.offsetWidth === 3 );
+
+ // Support: IE6
+ // Check if elements with layout shrink-wrap their children
+ div.style.display = "block";
+ div.innerHTML = "<div></div>";
+ div.firstChild.style.width = "5px";
+ support.shrinkWrapBlocks = ( div.offsetWidth !== 3 );
+
+ if (support.inlineBlockNeedsLayout) {
+ // Prevent IE 6 from affecting layout for positioned elements #11048
+ // Prevent IE from shrinking the body in IE 7 mode #12869
+ // Support: IE<8
+ body.style.zoom = 1;
+ }
+ }
+
+ body.removeChild(container);
+
+ // Null elements to avoid leaks in IE
+ container = div = tds = marginDiv = null;
+ });
+
+ // Null elements to avoid leaks in IE
+ all = select = fragment = opt = a = input = null;
+
+ return support;
+ })({});
+
+ var rbrace = /(?:\{[\s\S]*\}|\[[\s\S]*\])$/,
+ rmultiDash = /([A-Z])/g;
+
+ function internalData(elem, name, data, pvt /* Internal Use Only */) {
+ if (!jQuery.acceptData(elem)) {
+ return;
+ }
+
+ var ret, thisCache,
+ internalKey = jQuery.expando,
+
+ // We have to handle DOM nodes and JS objects differently because IE6-7
+ // can't GC object references properly across the DOM-JS boundary
+ isNode = elem.nodeType,
+
+ // Only DOM nodes need the global jQuery cache; JS object data is
+ // attached directly to the object so GC can occur automatically
+ cache = isNode ? jQuery.cache : elem,
+
+ // Only defining an ID for JS objects if its cache already exists allows
+ // the code to shortcut on the same path as a DOM node with no cache
+ id = isNode ? elem[internalKey] : elem[internalKey] && internalKey;
+
+ // Avoid doing any more work than we need to when trying to get data on an
+ // object that has no data at all
+ if ((!id || !cache[id] || (!pvt && !cache[id].data)) && data === undefined && typeof name === "string") {
+ return;
+ }
+
+ if (!id) {
+ // Only DOM nodes need a new unique ID for each element since their data
+ // ends up in the global cache
+ if (isNode) {
+ id = elem[internalKey] = core_deletedIds.pop() || jQuery.guid++;
+ } else {
+ id = internalKey;
+ }
+ }
+
+ if (!cache[id]) {
+ // Avoid exposing jQuery metadata on plain JS objects when the object
+ // is serialized using JSON.stringify
+ cache[id] = isNode ? {} : {toJSON: jQuery.noop};
+ }
+
+ // An object can be passed to jQuery.data instead of a key/value pair; this gets
+ // shallow copied over onto the existing cache
+ if (typeof name === "object" || typeof name === "function") {
+ if (pvt) {
+ cache[id] = jQuery.extend(cache[id], name);
+ } else {
+ cache[id].data = jQuery.extend(cache[id].data, name);
+ }
+ }
+
+ thisCache = cache[id];
+
+ // jQuery data() is stored in a separate object inside the object's internal data
+ // cache in order to avoid key collisions between internal data and user-defined
+ // data.
+ if (!pvt) {
+ if (!thisCache.data) {
+ thisCache.data = {};
+ }
+
+ thisCache = thisCache.data;
+ }
+
+ if (data !== undefined) {
+ thisCache[jQuery.camelCase(name)] = data;
+ }
+
+ // Check for both converted-to-camel and non-converted data property names
+ // If a data property was specified
+ if (typeof name === "string") {
+
+ // First Try to find as-is property data
+ ret = thisCache[name];
+
+ // Test for null|undefined property data
+ if (ret == null) {
+
+ // Try to find the camelCased property
+ ret = thisCache[jQuery.camelCase(name)];
+ }
+ } else {
+ ret = thisCache;
+ }
+
+ return ret;
+ }
+
+ function internalRemoveData(elem, name, pvt) {
+ if (!jQuery.acceptData(elem)) {
+ return;
+ }
+
+ var thisCache, i,
+ isNode = elem.nodeType,
+
+ // See jQuery.data for more information
+ cache = isNode ? jQuery.cache : elem,
+ id = isNode ? elem[jQuery.expando] : jQuery.expando;
+
+ // If there is already no cache entry for this object, there is no
+ // purpose in continuing
+ if (!cache[id]) {
+ return;
+ }
+
+ if (name) {
+
+ thisCache = pvt ? cache[id] : cache[id].data;
+
+ if (thisCache) {
+
+ // Support array or space separated string names for data keys
+ if (!jQuery.isArray(name)) {
+
+ // try the string as a key before any manipulation
+ if (name in thisCache) {
+ name = [name];
+ } else {
+
+ // split the camel cased version by spaces unless a key with the spaces exists
+ name = jQuery.camelCase(name);
+ if (name in thisCache) {
+ name = [name];
+ } else {
+ name = name.split(" ");
+ }
+ }
+ } else {
+ // If "name" is an array of keys...
+ // When data is initially created, via ("key", "val") signature,
+ // keys will be converted to camelCase.
+ // Since there is no way to tell _how_ a key was added, remove
+ // both plain key and camelCase key. #12786
+ // This will only penalize the array argument path.
+ name = name.concat(jQuery.map(name, jQuery.camelCase));
+ }
+
+ i = name.length;
+ while (i--) {
+ delete thisCache[name[i]];
+ }
+
+ // If there is no data left in the cache, we want to continue
+ // and let the cache object itself get destroyed
+ if (pvt ? !isEmptyDataObject(thisCache) : !jQuery.isEmptyObject(thisCache)) {
+ return;
+ }
+ }
+ }
+
+ // See jQuery.data for more information
+ if (!pvt) {
+ delete cache[id].data;
+
+ // Don't destroy the parent cache unless the internal data object
+ // had been the only thing left in it
+ if (!isEmptyDataObject(cache[id])) {
+ return;
+ }
+ }
+
+ // Destroy the cache
+ if (isNode) {
+ jQuery.cleanData([elem], true);
+
+ // Use delete when supported for expandos or `cache` is not a window per isWindow (#10080)
+ /* jshint eqeqeq: false */
+ } else if (jQuery.support.deleteExpando || cache != cache.window) {
+ /* jshint eqeqeq: true */
+ delete cache[id];
+
+ // When all else fails, null
+ } else {
+ cache[id] = null;
+ }
+ }
+
+ jQuery.extend({
+ cache: {},
+
+ // The following elements throw uncatchable exceptions if you
+ // attempt to add expando properties to them.
+ noData: {
+ "applet": true,
+ "embed": true,
+ // Ban all objects except for Flash (which handle expandos)
+ "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000"
+ },
+
+ hasData: function (elem) {
+ elem = elem.nodeType ? jQuery.cache[elem[jQuery.expando]] : elem[jQuery.expando];
+ return !!elem && !isEmptyDataObject(elem);
+ },
+
+ data: function (elem, name, data) {
+ return internalData(elem, name, data);
+ },
+
+ removeData: function (elem, name) {
+ return internalRemoveData(elem, name);
+ },
+
+ // For internal use only.
+ _data: function (elem, name, data) {
+ return internalData(elem, name, data, true);
+ },
+
+ _removeData: function (elem, name) {
+ return internalRemoveData(elem, name, true);
+ },
+
+ // A method for determining if a DOM node can handle the data expando
+ acceptData: function (elem) {
+ // Do not set data on non-element because it will not be cleared (#8335).
+ if (elem.nodeType && elem.nodeType !== 1 && elem.nodeType !== 9) {
+ return false;
+ }
+
+ var noData = elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()];
+
+ // nodes accept data unless otherwise specified; rejection can be conditional
+ return !noData || noData !== true && elem.getAttribute("classid") === noData;
+ }
+ });
+
+ jQuery.fn.extend({
+ data: function (key, value) {
+ var attrs, name,
+ data = null,
+ i = 0,
+ elem = this[0];
+
+ // Special expections of .data basically thwart jQuery.access,
+ // so implement the relevant behavior ourselves
+
+ // Gets all values
+ if (key === undefined) {
+ if (this.length) {
+ data = jQuery.data(elem);
+
+ if (elem.nodeType === 1 && !jQuery._data(elem, "parsedAttrs")) {
+ attrs = elem.attributes;
+ for (; i < attrs.length; i++) {
+ name = attrs[i].name;
+
+ if (name.indexOf("data-") === 0) {
+ name = jQuery.camelCase(name.slice(5));
+
+ dataAttr(elem, name, data[name]);
+ }
+ }
+ jQuery._data(elem, "parsedAttrs", true);
+ }
+ }
+
+ return data;
+ }
+
+ // Sets multiple values
+ if (typeof key === "object") {
+ return this.each(function () {
+ jQuery.data(this, key);
+ });
+ }
+
+ return arguments.length > 1 ?
+
+ // Sets one value
+ this.each(function () {
+ jQuery.data(this, key, value);
+ }) :
+
+ // Gets one value
+ // Try to fetch any internally stored data first
+ elem ? dataAttr(elem, key, jQuery.data(elem, key)) : null;
+ },
+
+ removeData: function (key) {
+ return this.each(function () {
+ jQuery.removeData(this, key);
+ });
+ }
+ });
+
+ function dataAttr(elem, key, data) {
+ // If nothing was found internally, try to fetch any
+ // data from the HTML5 data-* attribute
+ if (data === undefined && elem.nodeType === 1) {
+
+ var name = "data-" + key.replace(rmultiDash, "-$1").toLowerCase();
+
+ data = elem.getAttribute(name);
+
+ if (typeof data === "string") {
+ try {
+ data = data === "true" ? true :
+ data === "false" ? false :
+ data === "null" ? null :
+ // Only convert to a number if it doesn't change the string
+ +data + "" === data ? +data :
+ rbrace.test(data) ? jQuery.parseJSON(data) :
+ data;
+ } catch (e) {
+ }
+
+ // Make sure we set the data so it isn't changed later
+ jQuery.data(elem, key, data);
+
+ } else {
+ data = undefined;
+ }
+ }
+
+ return data;
+ }
+
+// checks a cache object for emptiness
+ function isEmptyDataObject(obj) {
+ var name;
+ for (name in obj) {
+
+ // if the public data object is empty, the private is still empty
+ if (name === "data" && jQuery.isEmptyObject(obj[name])) {
+ continue;
+ }
+ if (name !== "toJSON") {
+ return false;
+ }
+ }
+
+ return true;
+ }
+
+ jQuery.extend({
+ queue: function (elem, type, data) {
+ var queue;
+
+ if (elem) {
+ type = ( type || "fx" ) + "queue";
+ queue = jQuery._data(elem, type);
+
+ // Speed up dequeue by getting out quickly if this is just a lookup
+ if (data) {
+ if (!queue || jQuery.isArray(data)) {
+ queue = jQuery._data(elem, type, jQuery.makeArray(data));
+ } else {
+ queue.push(data);
+ }
+ }
+ return queue || [];
+ }
+ },
+
+ dequeue: function (elem, type) {
+ type = type || "fx";
+
+ var queue = jQuery.queue(elem, type),
+ startLength = queue.length,
+ fn = queue.shift(),
+ hooks = jQuery._queueHooks(elem, type),
+ next = function () {
+ jQuery.dequeue(elem, type);
+ };
+
+ // If the fx queue is dequeued, always remove the progress sentinel
+ if (fn === "inprogress") {
+ fn = queue.shift();
+ startLength--;
+ }
+
+ if (fn) {
+
+ // Add a progress sentinel to prevent the fx queue from being
+ // automatically dequeued
+ if (type === "fx") {
+ queue.unshift("inprogress");
+ }
+
+ // clear up the last queue stop function
+ delete hooks.stop;
+ fn.call(elem, next, hooks);
+ }
+
+ if (!startLength && hooks) {
+ hooks.empty.fire();
+ }
+ },
+
+ // not intended for public consumption - generates a queueHooks object, or returns the current one
+ _queueHooks: function (elem, type) {
+ var key = type + "queueHooks";
+ return jQuery._data(elem, key) || jQuery._data(elem, key, {
+ empty: jQuery.Callbacks("once memory").add(function () {
+ jQuery._removeData(elem, type + "queue");
+ jQuery._removeData(elem, key);
+ })
+ });
+ }
+ });
+
+ jQuery.fn.extend({
+ queue: function (type, data) {
+ var setter = 2;
+
+ if (typeof type !== "string") {
+ data = type;
+ type = "fx";
+ setter--;
+ }
+
+ if (arguments.length < setter) {
+ return jQuery.queue(this[0], type);
+ }
+
+ return data === undefined ?
+ this :
+ this.each(function () {
+ var queue = jQuery.queue(this, type, data);
+
+ // ensure a hooks for this queue
+ jQuery._queueHooks(this, type);
+
+ if (type === "fx" && queue[0] !== "inprogress") {
+ jQuery.dequeue(this, type);
+ }
+ });
+ },
+ dequeue: function (type) {
+ return this.each(function () {
+ jQuery.dequeue(this, type);
+ });
+ },
+ // Based off of the plugin by Clint Helfers, with permission.
+ // http://blindsignals.com/index.php/2009/07/jquery-delay/
+ delay: function (time, type) {
+ time = jQuery.fx ? jQuery.fx.speeds[time] || time : time;
+ type = type || "fx";
+
+ return this.queue(type, function (next, hooks) {
+ var timeout = setTimeout(next, time);
+ hooks.stop = function () {
+ clearTimeout(timeout);
+ };
+ });
+ },
+ clearQueue: function (type) {
+ return this.queue(type || "fx", []);
+ },
+ // Get a promise resolved when queues of a certain type
+ // are emptied (fx is the type by default)
+ promise: function (type, obj) {
+ var tmp,
+ count = 1,
+ defer = jQuery.Deferred(),
+ elements = this,
+ i = this.length,
+ resolve = function () {
+ if (!( --count )) {
+ defer.resolveWith(elements, [elements]);
+ }
+ };
+
+ if (typeof type !== "string") {
+ obj = type;
+ type = undefined;
+ }
+ type = type || "fx";
+
+ while (i--) {
+ tmp = jQuery._data(elements[i], type + "queueHooks");
+ if (tmp && tmp.empty) {
+ count++;
+ tmp.empty.add(resolve);
+ }
+ }
+ resolve();
+ return defer.promise(obj);
+ }
+ });
+ var nodeHook, boolHook,
+ rclass = /[\t\r\n\f]/g,
+ rreturn = /\r/g,
+ rfocusable = /^(?:input|select|textarea|button|object)$/i,
+ rclickable = /^(?:a|area)$/i,
+ ruseDefault = /^(?:checked|selected)$/i,
+ getSetAttribute = jQuery.support.getSetAttribute,
+ getSetInput = jQuery.support.input;
+
+ jQuery.fn.extend({
+ attr: function (name, value) {
+ return jQuery.access(this, jQuery.attr, name, value, arguments.length > 1);
+ },
+
+ removeAttr: function (name) {
+ return this.each(function () {
+ jQuery.removeAttr(this, name);
+ });
+ },
+
+ prop: function (name, value) {
+ return jQuery.access(this, jQuery.prop, name, value, arguments.length > 1);
+ },
+
+ removeProp: function (name) {
+ name = jQuery.propFix[name] || name;
+ return this.each(function () {
+ // try/catch handles cases where IE balks (such as removing a property on window)
+ try {
+ this[name] = undefined;
+ delete this[name];
+ } catch (e) {
+ }
+ });
+ },
+
+ addClass: function (value) {
+ var classes, elem, cur, clazz, j,
+ i = 0,
+ len = this.length,
+ proceed = typeof value === "string" && value;
+
+ if (jQuery.isFunction(value)) {
+ return this.each(function (j) {
+ jQuery(this).addClass(value.call(this, j, this.className));
+ });
+ }
+
+ if (proceed) {
+ // The disjunction here is for better compressibility (see removeClass)
+ classes = ( value || "" ).match(core_rnotwhite) || [];
+
+ for (; i < len; i++) {
+ elem = this[i];
+ cur = elem.nodeType === 1 && ( elem.className ?
+ ( " " + elem.className + " " ).replace(rclass, " ") :
+ " "
+ );
+
+ if (cur) {
+ j = 0;
+ while ((clazz = classes[j++])) {
+ if (cur.indexOf(" " + clazz + " ") < 0) {
+ cur += clazz + " ";
+ }
+ }
+ elem.className = jQuery.trim(cur);
+
+ }
+ }
+ }
+
+ return this;
+ },
+
+ removeClass: function (value) {
+ var classes, elem, cur, clazz, j,
+ i = 0,
+ len = this.length,
+ proceed = arguments.length === 0 || typeof value === "string" && value;
+
+ if (jQuery.isFunction(value)) {
+ return this.each(function (j) {
+ jQuery(this).removeClass(value.call(this, j, this.className));
+ });
+ }
+ if (proceed) {
+ classes = ( value || "" ).match(core_rnotwhite) || [];
+
+ for (; i < len; i++) {
+ elem = this[i];
+ // This expression is here for better compressibility (see addClass)
+ cur = elem.nodeType === 1 && ( elem.className ?
+ ( " " + elem.className + " " ).replace(rclass, " ") :
+ ""
+ );
+
+ if (cur) {
+ j = 0;
+ while ((clazz = classes[j++])) {
+ // Remove *all* instances
+ while (cur.indexOf(" " + clazz + " ") >= 0) {
+ cur = cur.replace(" " + clazz + " ", " ");
+ }
+ }
+ elem.className = value ? jQuery.trim(cur) : "";
+ }
+ }
+ }
+
+ return this;
+ },
+
+ toggleClass: function (value, stateVal) {
+ var type = typeof value;
+
+ if (typeof stateVal === "boolean" && type === "string") {
+ return stateVal ? this.addClass(value) : this.removeClass(value);
+ }
+
+ if (jQuery.isFunction(value)) {
+ return this.each(function (i) {
+ jQuery(this).toggleClass(value.call(this, i, this.className, stateVal), stateVal);
+ });
+ }
+
+ return this.each(function () {
+ if (type === "string") {
+ // toggle individual class names
+ var className,
+ i = 0,
+ self = jQuery(this),
+ classNames = value.match(core_rnotwhite) || [];
+
+ while ((className = classNames[i++])) {
+ // check each className given, space separated list
+ if (self.hasClass(className)) {
+ self.removeClass(className);
+ } else {
+ self.addClass(className);
+ }
+ }
+
+ // Toggle whole class name
+ } else if (type === core_strundefined || type === "boolean") {
+ if (this.className) {
+ // store className if set
+ jQuery._data(this, "__className__", this.className);
+ }
+
+ // If the element has a class name or if we're passed "false",
+ // then remove the whole classname (if there was one, the above saved it).
+ // Otherwise bring back whatever was previously saved (if anything),
+ // falling back to the empty string if nothing was stored.
+ this.className = this.className || value === false ? "" : jQuery._data(this, "__className__") || "";
+ }
+ });
+ },
+
+ hasClass: function (selector) {
+ var className = " " + selector + " ",
+ i = 0,
+ l = this.length;
+ for (; i < l; i++) {
+ if (this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf(className) >= 0) {
+ return true;
+ }
+ }
+
+ return false;
+ },
+
+ val: function (value) {
+ var ret, hooks, isFunction,
+ elem = this[0];
+
+ if (!arguments.length) {
+ if (elem) {
+ hooks = jQuery.valHooks[elem.type] || jQuery.valHooks[elem.nodeName.toLowerCase()];
+
+ if (hooks && "get" in hooks && (ret = hooks.get(elem, "value")) !== undefined) {
+ return ret;
+ }
+
+ ret = elem.value;
+
+ return typeof ret === "string" ?
+ // handle most common string cases
+ ret.replace(rreturn, "") :
+ // handle cases where value is null/undef or number
+ ret == null ? "" : ret;
+ }
+
+ return;
+ }
+
+ isFunction = jQuery.isFunction(value);
+
+ return this.each(function (i) {
+ var val;
+
+ if (this.nodeType !== 1) {
+ return;
+ }
+
+ if (isFunction) {
+ val = value.call(this, i, jQuery(this).val());
+ } else {
+ val = value;
+ }
+
+ // Treat null/undefined as ""; convert numbers to string
+ if (val == null) {
+ val = "";
+ } else if (typeof val === "number") {
+ val += "";
+ } else if (jQuery.isArray(val)) {
+ val = jQuery.map(val, function (value) {
+ return value == null ? "" : value + "";
+ });
+ }
+
+ hooks = jQuery.valHooks[this.type] || jQuery.valHooks[this.nodeName.toLowerCase()];
+
+ // If set returns undefined, fall back to normal setting
+ if (!hooks || !("set" in hooks) || hooks.set(this, val, "value") === undefined) {
+ this.value = val;
+ }
+ });
+ }
+ });
+
+ jQuery.extend({
+ valHooks: {
+ option: {
+ get: function (elem) {
+ // Use proper attribute retrieval(#6932, #12072)
+ var val = jQuery.find.attr(elem, "value");
+ return val != null ?
+ val :
+ elem.text;
+ }
+ },
+ select: {
+ get: function (elem) {
+ var value, option,
+ options = elem.options,
+ index = elem.selectedIndex,
+ one = elem.type === "select-one" || index < 0,
+ values = one ? null : [],
+ max = one ? index + 1 : options.length,
+ i = index < 0 ?
+ max :
+ one ? index : 0;
+
+ // Loop through all the selected options
+ for (; i < max; i++) {
+ option = options[i];
+
+ // oldIE doesn't update selected after form reset (#2551)
+ if (( option.selected || i === index ) &&
+ // Don't return options that are disabled or in a disabled optgroup
+ ( jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null ) &&
+ ( !option.parentNode.disabled || !jQuery.nodeName(option.parentNode, "optgroup") )) {
+
+ // Get the specific value for the option
+ value = jQuery(option).val();
+
+ // We don't need an array for one selects
+ if (one) {
+ return value;
+ }
+
+ // Multi-Selects return an array
+ values.push(value);
+ }
+ }
+
+ return values;
+ },
+
+ set: function (elem, value) {
+ var optionSet, option,
+ options = elem.options,
+ values = jQuery.makeArray(value),
+ i = options.length;
+
+ while (i--) {
+ option = options[i];
+ if ((option.selected = jQuery.inArray(jQuery(option).val(), values) >= 0)) {
+ optionSet = true;
+ }
+ }
+
+ // force browsers to behave consistently when non-matching value is set
+ if (!optionSet) {
+ elem.selectedIndex = -1;
+ }
+ return values;
+ }
+ }
+ },
+
+ attr: function (elem, name, value) {
+ var hooks, ret,
+ nType = elem.nodeType;
+
+ // don't get/set attributes on text, comment and attribute nodes
+ if (!elem || nType === 3 || nType === 8 || nType === 2) {
+ return;
+ }
+
+ // Fallback to prop when attributes are not supported
+ if (typeof elem.getAttribute === core_strundefined) {
+ return jQuery.prop(elem, name, value);
+ }
+
+ // All attributes are lowercase
+ // Grab necessary hook if one is defined
+ if (nType !== 1 || !jQuery.isXMLDoc(elem)) {
+ name = name.toLowerCase();
+ hooks = jQuery.attrHooks[name] ||
+ ( jQuery.expr.match.bool.test(name) ? boolHook : nodeHook );
+ }
+
+ if (value !== undefined) {
+
+ if (value === null) {
+ jQuery.removeAttr(elem, name);
+
+ } else if (hooks && "set" in hooks && (ret = hooks.set(elem, value, name)) !== undefined) {
+ return ret;
+
+ } else {
+ elem.setAttribute(name, value + "");
+ return value;
+ }
+
+ } else if (hooks && "get" in hooks && (ret = hooks.get(elem, name)) !== null) {
+ return ret;
+
+ } else {
+ ret = jQuery.find.attr(elem, name);
+
+ // Non-existent attributes return null, we normalize to undefined
+ return ret == null ?
+ undefined :
+ ret;
+ }
+ },
+
+ removeAttr: function (elem, value) {
+ var name, propName,
+ i = 0,
+ attrNames = value && value.match(core_rnotwhite);
+
+ if (attrNames && elem.nodeType === 1) {
+ while ((name = attrNames[i++])) {
+ propName = jQuery.propFix[name] || name;
+
+ // Boolean attributes get special treatment (#10870)
+ if (jQuery.expr.match.bool.test(name)) {
+ // Set corresponding property to false
+ if (getSetInput && getSetAttribute || !ruseDefault.test(name)) {
+ elem[propName] = false;
+ // Support: IE<9
+ // Also clear defaultChecked/defaultSelected (if appropriate)
+ } else {
+ elem[jQuery.camelCase("default-" + name)] =
+ elem[propName] = false;
+ }
+
+ // See #9699 for explanation of this approach (setting first, then removal)
+ } else {
+ jQuery.attr(elem, name, "");
+ }
+
+ elem.removeAttribute(getSetAttribute ? name : propName);
+ }
+ }
+ },
+
+ attrHooks: {
+ type: {
+ set: function (elem, value) {
+ if (!jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input")) {
+ // Setting the type on a radio button after the value resets the value in IE6-9
+ // Reset value to default in case type is set after value during creation
+ var val = elem.value;
+ elem.setAttribute("type", value);
+ if (val) {
+ elem.value = val;
+ }
+ return value;
+ }
+ }
+ }
+ },
+
+ propFix: {
+ "for": "htmlFor",
+ "class": "className"
+ },
+
+ prop: function (elem, name, value) {
+ var ret, hooks, notxml,
+ nType = elem.nodeType;
+
+ // don't get/set properties on text, comment and attribute nodes
+ if (!elem || nType === 3 || nType === 8 || nType === 2) {
+ return;
+ }
+
+ notxml = nType !== 1 || !jQuery.isXMLDoc(elem);
+
+ if (notxml) {
+ // Fix name and attach hooks
+ name = jQuery.propFix[name] || name;
+ hooks = jQuery.propHooks[name];
+ }
+
+ if (value !== undefined) {
+ return hooks && "set" in hooks && (ret = hooks.set(elem, value, name)) !== undefined ?
+ ret :
+ ( elem[name] = value );
+
+ } else {
+ return hooks && "get" in hooks && (ret = hooks.get(elem, name)) !== null ?
+ ret :
+ elem[name];
+ }
+ },
+
+ propHooks: {
+ tabIndex: {
+ get: function (elem) {
+ // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
+ // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
+ // Use proper attribute retrieval(#12072)
+ var tabindex = jQuery.find.attr(elem, "tabindex");
+
+ return tabindex ?
+ parseInt(tabindex, 10) :
+ rfocusable.test(elem.nodeName) || rclickable.test(elem.nodeName) && elem.href ?
+ 0 :
+ -1;
+ }
+ }
+ }
+ });
+
+// Hooks for boolean attributes
+ boolHook = {
+ set: function (elem, value, name) {
+ if (value === false) {
+ // Remove boolean attributes when set to false
+ jQuery.removeAttr(elem, name);
+ } else if (getSetInput && getSetAttribute || !ruseDefault.test(name)) {
+ // IE<8 needs the *property* name
+ elem.setAttribute(!getSetAttribute && jQuery.propFix[name] || name, name);
+
+ // Use defaultChecked and defaultSelected for oldIE
+ } else {
+ elem[jQuery.camelCase("default-" + name)] = elem[name] = true;
+ }
+
+ return name;
+ }
+ };
+ jQuery.each(jQuery.expr.match.bool.source.match(/\w+/g), function (i, name) {
+ var getter = jQuery.expr.attrHandle[name] || jQuery.find.attr;
+
+ jQuery.expr.attrHandle[name] = getSetInput && getSetAttribute || !ruseDefault.test(name) ?
+ function (elem, name, isXML) {
+ var fn = jQuery.expr.attrHandle[name],
+ ret = isXML ?
+ undefined :
+ /* jshint eqeqeq: false */
+ (jQuery.expr.attrHandle[name] = undefined) !=
+ getter(elem, name, isXML) ?
+
+ name.toLowerCase() :
+ null;
+ jQuery.expr.attrHandle[name] = fn;
+ return ret;
+ } :
+ function (elem, name, isXML) {
+ return isXML ?
+ undefined :
+ elem[jQuery.camelCase("default-" + name)] ?
+ name.toLowerCase() :
+ null;
+ };
+ });
+
+// fix oldIE attroperties
+ if (!getSetInput || !getSetAttribute) {
+ jQuery.attrHooks.value = {
+ set: function (elem, value, name) {
+ if (jQuery.nodeName(elem, "input")) {
+ // Does not return so that setAttribute is also used
+ elem.defaultValue = value;
+ } else {
+ // Use nodeHook if defined (#1954); otherwise setAttribute is fine
+ return nodeHook && nodeHook.set(elem, value, name);
+ }
+ }
+ };
+ }
+
+// IE6/7 do not support getting/setting some attributes with get/setAttribute
+ if (!getSetAttribute) {
+
+ // Use this for any attribute in IE6/7
+ // This fixes almost every IE6/7 issue
+ nodeHook = {
+ set: function (elem, value, name) {
+ // Set the existing or create a new attribute node
+ var ret = elem.getAttributeNode(name);
+ if (!ret) {
+ elem.setAttributeNode(
+ (ret = elem.ownerDocument.createAttribute(name))
+ );
+ }
+
+ ret.value = value += "";
+
+ // Break association with cloned elements by also using setAttribute (#9646)
+ return name === "value" || value === elem.getAttribute(name) ?
+ value :
+ undefined;
+ }
+ };
+ jQuery.expr.attrHandle.id = jQuery.expr.attrHandle.name = jQuery.expr.attrHandle.coords =
+ // Some attributes are constructed with empty-string values when not defined
+ function (elem, name, isXML) {
+ var ret;
+ return isXML ?
+ undefined :
+ (ret = elem.getAttributeNode(name)) && ret.value !== "" ?
+ ret.value :
+ null;
+ };
+ jQuery.valHooks.button = {
+ get: function (elem, name) {
+ var ret = elem.getAttributeNode(name);
+ return ret && ret.specified ?
+ ret.value :
+ undefined;
+ },
+ set: nodeHook.set
+ };
+
+ // Set contenteditable to false on removals(#10429)
+ // Setting to empty string throws an error as an invalid value
+ jQuery.attrHooks.contenteditable = {
+ set: function (elem, value, name) {
+ nodeHook.set(elem, value === "" ? false : value, name);
+ }
+ };
+
+ // Set width and height to auto instead of 0 on empty string( Bug #8150 )
+ // This is for removals
+ jQuery.each(["width", "height"], function (i, name) {
+ jQuery.attrHooks[name] = {
+ set: function (elem, value) {
+ if (value === "") {
+ elem.setAttribute(name, "auto");
+ return value;
+ }
+ }
+ };
+ });
+ }
+
+
+// Some attributes require a special call on IE
+// http://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx
+ if (!jQuery.support.hrefNormalized) {
+ // href/src property should get the full normalized URL (#10299/#12915)
+ jQuery.each(["href", "src"], function (i, name) {
+ jQuery.propHooks[name] = {
+ get: function (elem) {
+ return elem.getAttribute(name, 4);
+ }
+ };
+ });
+ }
+
+ if (!jQuery.support.style) {
+ jQuery.attrHooks.style = {
+ get: function (elem) {
+ // Return undefined in the case of empty string
+ // Note: IE uppercases css property names, but if we were to .toLowerCase()
+ // .cssText, that would destroy case senstitivity in URL's, like in "background"
+ return elem.style.cssText || undefined;
+ },
+ set: function (elem, value) {
+ return ( elem.style.cssText = value + "" );
+ }
+ };
+ }
+
+// Safari mis-reports the default selected property of an option
+// Accessing the parent's selectedIndex property fixes it
+ if (!jQuery.support.optSelected) {
+ jQuery.propHooks.selected = {
+ get: function (elem) {
+ var parent = elem.parentNode;
+
+ if (parent) {
+ parent.selectedIndex;
+
+ // Make sure that it also works with optgroups, see #5701
+ if (parent.parentNode) {
+ parent.parentNode.selectedIndex;
+ }
+ }
+ return null;
+ }
+ };
+ }
+
+ jQuery.each([
+ "tabIndex",
+ "readOnly",
+ "maxLength",
+ "cellSpacing",
+ "cellPadding",
+ "rowSpan",
+ "colSpan",
+ "useMap",
+ "frameBorder",
+ "contentEditable"
+ ], function () {
+ jQuery.propFix[this.toLowerCase()] = this;
+ });
+
+// IE6/7 call enctype encoding
+ if (!jQuery.support.enctype) {
+ jQuery.propFix.enctype = "encoding";
+ }
+
+// Radios and checkboxes getter/setter
+ jQuery.each(["radio", "checkbox"], function () {
+ jQuery.valHooks[this] = {
+ set: function (elem, value) {
+ if (jQuery.isArray(value)) {
+ return ( elem.checked = jQuery.inArray(jQuery(elem).val(), value) >= 0 );
+ }
+ }
+ };
+ if (!jQuery.support.checkOn) {
+ jQuery.valHooks[this].get = function (elem) {
+ // Support: Webkit
+ // "" is returned instead of "on" if a value isn't specified
+ return elem.getAttribute("value") === null ? "on" : elem.value;
+ };
+ }
+ });
+ var rformElems = /^(?:input|select|textarea)$/i,
+ rkeyEvent = /^key/,
+ rmouseEvent = /^(?:mouse|contextmenu)|click/,
+ rfocusMorph = /^(?:focusinfocus|focusoutblur)$/,
+ rtypenamespace = /^([^.]*)(?:\.(.+)|)$/;
+
+ function returnTrue() {
+ return true;
+ }
+
+ function returnFalse() {
+ return false;
+ }
+
+ function safeActiveElement() {
+ try {
+ return document.activeElement;
+ } catch (err) {
+ }
+ }
+
+ /*
+ * Helper functions for managing events -- not part of the public interface.
+ * Props to Dean Edwards' addEvent library for many of the ideas.
+ */
+ jQuery.event = {
+
+ global: {},
+
+ add: function (elem, types, handler, data, selector) {
+ var tmp, events, t, handleObjIn,
+ special, eventHandle, handleObj,
+ handlers, type, namespaces, origType,
+ elemData = jQuery._data(elem);
+
+ // Don't attach events to noData or text/comment nodes (but allow plain objects)
+ if (!elemData) {
+ return;
+ }
+
+ // Caller can pass in an object of custom data in lieu of the handler
+ if (handler.handler) {
+ handleObjIn = handler;
+ handler = handleObjIn.handler;
+ selector = handleObjIn.selector;
+ }
+
+ // Make sure that the handler has a unique ID, used to find/remove it later
+ if (!handler.guid) {
+ handler.guid = jQuery.guid++;
+ }
+
+ // Init the element's event structure and main handler, if this is the first
+ if (!(events = elemData.events)) {
+ events = elemData.events = {};
+ }
+ if (!(eventHandle = elemData.handle)) {
+ eventHandle = elemData.handle = function (e) {
+ // Discard the second event of a jQuery.event.trigger() and
+ // when an event is called after a page has unloaded
+ return typeof jQuery !== core_strundefined && (!e || jQuery.event.triggered !== e.type) ?
+ jQuery.event.dispatch.apply(eventHandle.elem, arguments) :
+ undefined;
+ };
+ // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events
+ eventHandle.elem = elem;
+ }
+
+ // Handle multiple events separated by a space
+ types = ( types || "" ).match(core_rnotwhite) || [""];
+ t = types.length;
+ while (t--) {
+ tmp = rtypenamespace.exec(types[t]) || [];
+ type = origType = tmp[1];
+ namespaces = ( tmp[2] || "" ).split(".").sort();
+
+ // There *must* be a type, no attaching namespace-only handlers
+ if (!type) {
+ continue;
+ }
+
+ // If event changes its type, use the special event handlers for the changed type
+ special = jQuery.event.special[type] || {};
+
+ // If selector defined, determine special event api type, otherwise given type
+ type = ( selector ? special.delegateType : special.bindType ) || type;
+
+ // Update special based on newly reset type
+ special = jQuery.event.special[type] || {};
+
+ // handleObj is passed to all event handlers
+ handleObj = jQuery.extend({
+ type: type,
+ origType: origType,
+ data: data,
+ handler: handler,
+ guid: handler.guid,
+ selector: selector,
+ needsContext: selector && jQuery.expr.match.needsContext.test(selector),
+ namespace: namespaces.join(".")
+ }, handleObjIn);
+
+ // Init the event handler queue if we're the first
+ if (!(handlers = events[type])) {
+ handlers = events[type] = [];
+ handlers.delegateCount = 0;
+
+ // Only use addEventListener/attachEvent if the special events handler returns false
+ if (!special.setup || special.setup.call(elem, data, namespaces, eventHandle) === false) {
+ // Bind the global event handler to the element
+ if (elem.addEventListener) {
+ elem.addEventListener(type, eventHandle, false);
+
+ } else if (elem.attachEvent) {
+ elem.attachEvent("on" + type, eventHandle);
+ }
+ }
+ }
+
+ if (special.add) {
+ special.add.call(elem, handleObj);
+
+ if (!handleObj.handler.guid) {
+ handleObj.handler.guid = handler.guid;
+ }
+ }
+
+ // Add to the element's handler list, delegates in front
+ if (selector) {
+ handlers.splice(handlers.delegateCount++, 0, handleObj);
+ } else {
+ handlers.push(handleObj);
+ }
+
+ // Keep track of which events have ever been used, for event optimization
+ jQuery.event.global[type] = true;
+ }
+
+ // Nullify elem to prevent memory leaks in IE
+ elem = null;
+ },
+
+ // Detach an event or set of events from an element
+ remove: function (elem, types, handler, selector, mappedTypes) {
+ var j, handleObj, tmp,
+ origCount, t, events,
+ special, handlers, type,
+ namespaces, origType,
+ elemData = jQuery.hasData(elem) && jQuery._data(elem);
+
+ if (!elemData || !(events = elemData.events)) {
+ return;
+ }
+
+ // Once for each type.namespace in types; type may be omitted
+ types = ( types || "" ).match(core_rnotwhite) || [""];
+ t = types.length;
+ while (t--) {
+ tmp = rtypenamespace.exec(types[t]) || [];
+ type = origType = tmp[1];
+ namespaces = ( tmp[2] || "" ).split(".").sort();
+
+ // Unbind all events (on this namespace, if provided) for the element
+ if (!type) {
+ for (type in events) {
+ jQuery.event.remove(elem, type + types[t], handler, selector, true);
+ }
+ continue;
+ }
+
+ special = jQuery.event.special[type] || {};
+ type = ( selector ? special.delegateType : special.bindType ) || type;
+ handlers = events[type] || [];
+ tmp = tmp[2] && new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)");
+
+ // Remove matching events
+ origCount = j = handlers.length;
+ while (j--) {
+ handleObj = handlers[j];
+
+ if (( mappedTypes || origType === handleObj.origType ) &&
+ ( !handler || handler.guid === handleObj.guid ) &&
+ ( !tmp || tmp.test(handleObj.namespace) ) &&
+ ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector )) {
+ handlers.splice(j, 1);
+
+ if (handleObj.selector) {
+ handlers.delegateCount--;
+ }
+ if (special.remove) {
+ special.remove.call(elem, handleObj);
+ }
+ }
+ }
+
+ // Remove generic event handler if we removed something and no more handlers exist
+ // (avoids potential for endless recursion during removal of special event handlers)
+ if (origCount && !handlers.length) {
+ if (!special.teardown || special.teardown.call(elem, namespaces, elemData.handle) === false) {
+ jQuery.removeEvent(elem, type, elemData.handle);
+ }
+
+ delete events[type];
+ }
+ }
+
+ // Remove the expando if it's no longer used
+ if (jQuery.isEmptyObject(events)) {
+ delete elemData.handle;
+
+ // removeData also checks for emptiness and clears the expando if empty
+ // so use it instead of delete
+ jQuery._removeData(elem, "events");
+ }
+ },
+
+ trigger: function (event, data, elem, onlyHandlers) {
+ var handle, ontype, cur,
+ bubbleType, special, tmp, i,
+ eventPath = [elem || document],
+ type = core_hasOwn.call(event, "type") ? event.type : event,
+ namespaces = core_hasOwn.call(event, "namespace") ? event.namespace.split(".") : [];
+
+ cur = tmp = elem = elem || document;
+
+ // Don't do events on text and comment nodes
+ if (elem.nodeType === 3 || elem.nodeType === 8) {
+ return;
+ }
+
+ // focus/blur morphs to focusin/out; ensure we're not firing them right now
+ if (rfocusMorph.test(type + jQuery.event.triggered)) {
+ return;
+ }
+
+ if (type.indexOf(".") >= 0) {
+ // Namespaced trigger; create a regexp to match event type in handle()
+ namespaces = type.split(".");
+ type = namespaces.shift();
+ namespaces.sort();
+ }
+ ontype = type.indexOf(":") < 0 && "on" + type;
+
+ // Caller can pass in a jQuery.Event object, Object, or just an event type string
+ event = event[jQuery.expando] ?
+ event :
+ new jQuery.Event(type, typeof event === "object" && event);
+
+ // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true)
+ event.isTrigger = onlyHandlers ? 2 : 3;
+ event.namespace = namespaces.join(".");
+ event.namespace_re = event.namespace ?
+ new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") :
+ null;
+
+ // Clean up the event in case it is being reused
+ event.result = undefined;
+ if (!event.target) {
+ event.target = elem;
+ }
+
+ // Clone any incoming data and prepend the event, creating the handler arg list
+ data = data == null ?
+ [event] :
+ jQuery.makeArray(data, [event]);
+
+ // Allow special events to draw outside the lines
+ special = jQuery.event.special[type] || {};
+ if (!onlyHandlers && special.trigger && special.trigger.apply(elem, data) === false) {
+ return;
+ }
+
+ // Determine event propagation path in advance, per W3C events spec (#9951)
+ // Bubble up to document, then to window; watch for a global ownerDocument var (#9724)
+ if (!onlyHandlers && !special.noBubble && !jQuery.isWindow(elem)) {
+
+ bubbleType = special.delegateType || type;
+ if (!rfocusMorph.test(bubbleType + type)) {
+ cur = cur.parentNode;
+ }
+ for (; cur; cur = cur.parentNode) {
+ eventPath.push(cur);
+ tmp = cur;
+ }
+
+ // Only add window if we got to document (e.g., not plain obj or detached DOM)
+ if (tmp === (elem.ownerDocument || document)) {
+ eventPath.push(tmp.defaultView || tmp.parentWindow || window);
+ }
+ }
+
+ // Fire handlers on the event path
+ i = 0;
+ while ((cur = eventPath[i++]) && !event.isPropagationStopped()) {
+
+ event.type = i > 1 ?
+ bubbleType :
+ special.bindType || type;
+
+ // jQuery handler
+ handle = ( jQuery._data(cur, "events") || {} )[event.type] && jQuery._data(cur, "handle");
+ if (handle) {
+ handle.apply(cur, data);
+ }
+
+ // Native handler
+ handle = ontype && cur[ontype];
+ if (handle && jQuery.acceptData(cur) && handle.apply && handle.apply(cur, data) === false) {
+ event.preventDefault();
+ }
+ }
+ event.type = type;
+
+ // If nobody prevented the default action, do it now
+ if (!onlyHandlers && !event.isDefaultPrevented()) {
+
+ if ((!special._default || special._default.apply(eventPath.pop(), data) === false) &&
+ jQuery.acceptData(elem)) {
+
+ // Call a native DOM method on the target with the same name name as the event.
+ // Can't use an .isFunction() check here because IE6/7 fails that test.
+ // Don't do default actions on window, that's where global variables be (#6170)
+ if (ontype && elem[type] && !jQuery.isWindow(elem)) {
+
+ // Don't re-trigger an onFOO event when we call its FOO() method
+ tmp = elem[ontype];
+
+ if (tmp) {
+ elem[ontype] = null;
+ }
+
+ // Prevent re-triggering of the same event, since we already bubbled it above
+ jQuery.event.triggered = type;
+ try {
+ elem[type]();
+ } catch (e) {
+ // IE<9 dies on focus/blur to hidden element (#1486,#12518)
+ // only reproducible on winXP IE8 native, not IE9 in IE8 mode
+ }
+ jQuery.event.triggered = undefined;
+
+ if (tmp) {
+ elem[ontype] = tmp;
+ }
+ }
+ }
+ }
+
+ return event.result;
+ },
+
+ dispatch: function (event) {
+
+ // Make a writable jQuery.Event from the native event object
+ event = jQuery.event.fix(event);
+
+ var i, ret, handleObj, matched, j,
+ handlerQueue = [],
+ args = core_slice.call(arguments),
+ handlers = ( jQuery._data(this, "events") || {} )[event.type] || [],
+ special = jQuery.event.special[event.type] || {};
+
+ // Use the fix-ed jQuery.Event rather than the (read-only) native event
+ args[0] = event;
+ event.delegateTarget = this;
+
+ // Call the preDispatch hook for the mapped type, and let it bail if desired
+ if (special.preDispatch && special.preDispatch.call(this, event) === false) {
+ return;
+ }
+
+ // Determine handlers
+ handlerQueue = jQuery.event.handlers.call(this, event, handlers);
+
+ // Run delegates first; they may want to stop propagation beneath us
+ i = 0;
+ while ((matched = handlerQueue[i++]) && !event.isPropagationStopped()) {
+ event.currentTarget = matched.elem;
+
+ j = 0;
+ while ((handleObj = matched.handlers[j++]) && !event.isImmediatePropagationStopped()) {
+
+ // Triggered event must either 1) have no namespace, or
+ // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace).
+ if (!event.namespace_re || event.namespace_re.test(handleObj.namespace)) {
+
+ event.handleObj = handleObj;
+ event.data = handleObj.data;
+
+ ret = ( (jQuery.event.special[handleObj.origType] || {}).handle || handleObj.handler )
+ .apply(matched.elem, args);
+
+ if (ret !== undefined) {
+ if ((event.result = ret) === false) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ }
+ }
+ }
+ }
+
+ // Call the postDispatch hook for the mapped type
+ if (special.postDispatch) {
+ special.postDispatch.call(this, event);
+ }
+
+ return event.result;
+ },
+
+ handlers: function (event, handlers) {
+ var sel, handleObj, matches, i,
+ handlerQueue = [],
+ delegateCount = handlers.delegateCount,
+ cur = event.target;
+
+ // Find delegate handlers
+ // Black-hole SVG <use> instance trees (#13180)
+ // Avoid non-left-click bubbling in Firefox (#3861)
+ if (delegateCount && cur.nodeType && (!event.button || event.type !== "click")) {
+
+ /* jshint eqeqeq: false */
+ for (; cur != this; cur = cur.parentNode || this) {
+ /* jshint eqeqeq: true */
+
+ // Don't check non-elements (#13208)
+ // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764)
+ if (cur.nodeType === 1 && (cur.disabled !== true || event.type !== "click")) {
+ matches = [];
+ for (i = 0; i < delegateCount; i++) {
+ handleObj = handlers[i];
+
+ // Don't conflict with Object.prototype properties (#13203)
+ sel = handleObj.selector + " ";
+
+ if (matches[sel] === undefined) {
+ matches[sel] = handleObj.needsContext ?
+ jQuery(sel, this).index(cur) >= 0 :
+ jQuery.find(sel, this, null, [cur]).length;
+ }
+ if (matches[sel]) {
+ matches.push(handleObj);
+ }
+ }
+ if (matches.length) {
+ handlerQueue.push({elem: cur, handlers: matches});
+ }
+ }
+ }
+ }
+
+ // Add the remaining (directly-bound) handlers
+ if (delegateCount < handlers.length) {
+ handlerQueue.push({elem: this, handlers: handlers.slice(delegateCount)});
+ }
+
+ return handlerQueue;
+ },
+
+ fix: function (event) {
+ if (event[jQuery.expando]) {
+ return event;
+ }
+
+ // Create a writable copy of the event object and normalize some properties
+ var i, prop, copy,
+ type = event.type,
+ originalEvent = event,
+ fixHook = this.fixHooks[type];
+
+ if (!fixHook) {
+ this.fixHooks[type] = fixHook =
+ rmouseEvent.test(type) ? this.mouseHooks :
+ rkeyEvent.test(type) ? this.keyHooks :
+ {};
+ }
+ copy = fixHook.props ? this.props.concat(fixHook.props) : this.props;
+
+ event = new jQuery.Event(originalEvent);
+
+ i = copy.length;
+ while (i--) {
+ prop = copy[i];
+ event[prop] = originalEvent[prop];
+ }
+
+ // Support: IE<9
+ // Fix target property (#1925)
+ if (!event.target) {
+ event.target = originalEvent.srcElement || document;
+ }
+
+ // Support: Chrome 23+, Safari?
+ // Target should not be a text node (#504, #13143)
+ if (event.target.nodeType === 3) {
+ event.target = event.target.parentNode;
+ }
+
+ // Support: IE<9
+ // For mouse/key events, metaKey==false if it's undefined (#3368, #11328)
+ event.metaKey = !!event.metaKey;
+
+ return fixHook.filter ? fixHook.filter(event, originalEvent) : event;
+ },
+
+ // Includes some event props shared by KeyEvent and MouseEvent
+ props: "altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),
+
+ fixHooks: {},
+
+ keyHooks: {
+ props: "char charCode key keyCode".split(" "),
+ filter: function (event, original) {
+
+ // Add which for key events
+ if (event.which == null) {
+ event.which = original.charCode != null ? original.charCode : original.keyCode;
+ }
+
+ return event;
+ }
+ },
+
+ mouseHooks: {
+ props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),
+ filter: function (event, original) {
+ var body, eventDoc, doc,
+ button = original.button,
+ fromElement = original.fromElement;
+
+ // Calculate pageX/Y if missing and clientX/Y available
+ if (event.pageX == null && original.clientX != null) {
+ eventDoc = event.target.ownerDocument || document;
+ doc = eventDoc.documentElement;
+ body = eventDoc.body;
+
+ event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 );
+ event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 );
+ }
+
+ // Add relatedTarget, if necessary
+ if (!event.relatedTarget && fromElement) {
+ event.relatedTarget = fromElement === event.target ? original.toElement : fromElement;
+ }
+
+ // Add which for click: 1 === left; 2 === middle; 3 === right
+ // Note: button is not normalized, so don't use it
+ if (!event.which && button !== undefined) {
+ event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) );
+ }
+
+ return event;
+ }
+ },
+
+ special: {
+ load: {
+ // Prevent triggered image.load events from bubbling to window.load
+ noBubble: true
+ },
+ focus: {
+ // Fire native event if possible so blur/focus sequence is correct
+ trigger: function () {
+ if (this !== safeActiveElement() && this.focus) {
+ try {
+ this.focus();
+ return false;
+ } catch (e) {
+ // Support: IE<9
+ // If we error on focus to hidden element (#1486, #12518),
+ // let .trigger() run the handlers
+ }
+ }
+ },
+ delegateType: "focusin"
+ },
+ blur: {
+ trigger: function () {
+ if (this === safeActiveElement() && this.blur) {
+ this.blur();
+ return false;
+ }
+ },
+ delegateType: "focusout"
+ },
+ click: {
+ // For checkbox, fire native event so checked state will be right
+ trigger: function () {
+ if (jQuery.nodeName(this, "input") && this.type === "checkbox" && this.click) {
+ this.click();
+ return false;
+ }
+ },
+
+ // For cross-browser consistency, don't fire native .click() on links
+ _default: function (event) {
+ return jQuery.nodeName(event.target, "a");
+ }
+ },
+
+ beforeunload: {
+ postDispatch: function (event) {
+
+ // Even when returnValue equals to undefined Firefox will still show alert
+ if (event.result !== undefined) {
+ event.originalEvent.returnValue = event.result;
+ }
+ }
+ }
+ },
+
+ simulate: function (type, elem, event, bubble) {
+ // Piggyback on a donor event to simulate a different one.
+ // Fake originalEvent to avoid donor's stopPropagation, but if the
+ // simulated event prevents default then we do the same on the donor.
+ var e = jQuery.extend(
+ new jQuery.Event(),
+ event,
+ {
+ type: type,
+ isSimulated: true,
+ originalEvent: {}
+ }
+ );
+ if (bubble) {
+ jQuery.event.trigger(e, null, elem);
+ } else {
+ jQuery.event.dispatch.call(elem, e);
+ }
+ if (e.isDefaultPrevented()) {
+ event.preventDefault();
+ }
+ }
+ };
+
+ jQuery.removeEvent = document.removeEventListener ?
+ function (elem, type, handle) {
+ if (elem.removeEventListener) {
+ elem.removeEventListener(type, handle, false);
+ }
+ } :
+ function (elem, type, handle) {
+ var name = "on" + type;
+
+ if (elem.detachEvent) {
+
+ // #8545, #7054, preventing memory leaks for custom events in IE6-8
+ // detachEvent needed property on element, by name of that event, to properly expose it to GC
+ if (typeof elem[name] === core_strundefined) {
+ elem[name] = null;
+ }
+
+ elem.detachEvent(name, handle);
+ }
+ };
+
+ jQuery.Event = function (src, props) {
+ // Allow instantiation without the 'new' keyword
+ if (!(this instanceof jQuery.Event)) {
+ return new jQuery.Event(src, props);
+ }
+
+ // Event object
+ if (src && src.type) {
+ this.originalEvent = src;
+ this.type = src.type;
+
+ // Events bubbling up the document may have been marked as prevented
+ // by a handler lower down the tree; reflect the correct value.
+ this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false ||
+ src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse;
+
+ // Event type
+ } else {
+ this.type = src;
+ }
+
+ // Put explicitly provided properties onto the event object
+ if (props) {
+ jQuery.extend(this, props);
+ }
+
+ // Create a timestamp if incoming event doesn't have one
+ this.timeStamp = src && src.timeStamp || jQuery.now();
+
+ // Mark it as fixed
+ this[jQuery.expando] = true;
+ };
+
+// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
+// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
+ jQuery.Event.prototype = {
+ isDefaultPrevented: returnFalse,
+ isPropagationStopped: returnFalse,
+ isImmediatePropagationStopped: returnFalse,
+
+ preventDefault: function () {
+ var e = this.originalEvent;
+
+ this.isDefaultPrevented = returnTrue;
+ if (!e) {
+ return;
+ }
+
+ // If preventDefault exists, run it on the original event
+ if (e.preventDefault) {
+ e.preventDefault();
+
+ // Support: IE
+ // Otherwise set the returnValue property of the original event to false
+ } else {
+ e.returnValue = false;
+ }
+ },
+ stopPropagation: function () {
+ var e = this.originalEvent;
+
+ this.isPropagationStopped = returnTrue;
+ if (!e) {
+ return;
+ }
+ // If stopPropagation exists, run it on the original event
+ if (e.stopPropagation) {
+ e.stopPropagation();
+ }
+
+ // Support: IE
+ // Set the cancelBubble property of the original event to true
+ e.cancelBubble = true;
+ },
+ stopImmediatePropagation: function () {
+ this.isImmediatePropagationStopped = returnTrue;
+ this.stopPropagation();
+ }
+ };
+
+// Create mouseenter/leave events using mouseover/out and event-time checks
+ jQuery.each({
+ mouseenter: "mouseover",
+ mouseleave: "mouseout"
+ }, function (orig, fix) {
+ jQuery.event.special[orig] = {
+ delegateType: fix,
+ bindType: fix,
+
+ handle: function (event) {
+ var ret,
+ target = this,
+ related = event.relatedTarget,
+ handleObj = event.handleObj;
+
+ // For mousenter/leave call the handler if related is outside the target.
+ // NB: No relatedTarget if the mouse left/entered the browser window
+ if (!related || (related !== target && !jQuery.contains(target, related))) {
+ event.type = handleObj.origType;
+ ret = handleObj.handler.apply(this, arguments);
+ event.type = fix;
+ }
+ return ret;
+ }
+ };
+ });
+
+// IE submit delegation
+ if (!jQuery.support.submitBubbles) {
+
+ jQuery.event.special.submit = {
+ setup: function () {
+ // Only need this for delegated form submit events
+ if (jQuery.nodeName(this, "form")) {
+ return false;
+ }
+
+ // Lazy-add a submit handler when a descendant form may potentially be submitted
+ jQuery.event.add(this, "click._submit keypress._submit", function (e) {
+ // Node name check avoids a VML-related crash in IE (#9807)
+ var elem = e.target,
+ form = jQuery.nodeName(elem, "input") || jQuery.nodeName(elem, "button") ? elem.form : undefined;
+ if (form && !jQuery._data(form, "submitBubbles")) {
+ jQuery.event.add(form, "submit._submit", function (event) {
+ event._submit_bubble = true;
+ });
+ jQuery._data(form, "submitBubbles", true);
+ }
+ });
+ // return undefined since we don't need an event listener
+ },
+
+ postDispatch: function (event) {
+ // If form was submitted by the user, bubble the event up the tree
+ if (event._submit_bubble) {
+ delete event._submit_bubble;
+ if (this.parentNode && !event.isTrigger) {
+ jQuery.event.simulate("submit", this.parentNode, event, true);
+ }
+ }
+ },
+
+ teardown: function () {
+ // Only need this for delegated form submit events
+ if (jQuery.nodeName(this, "form")) {
+ return false;
+ }
+
+ // Remove delegated handlers; cleanData eventually reaps submit handlers attached above
+ jQuery.event.remove(this, "._submit");
+ }
+ };
+ }
+
+// IE change delegation and checkbox/radio fix
+ if (!jQuery.support.changeBubbles) {
+
+ jQuery.event.special.change = {
+
+ setup: function () {
+
+ if (rformElems.test(this.nodeName)) {
+ // IE doesn't fire change on a check/radio until blur; trigger it on click
+ // after a propertychange. Eat the blur-change in special.change.handle.
+ // This still fires onchange a second time for check/radio after blur.
+ if (this.type === "checkbox" || this.type === "radio") {
+ jQuery.event.add(this, "propertychange._change", function (event) {
+ if (event.originalEvent.propertyName === "checked") {
+ this._just_changed = true;
+ }
+ });
+ jQuery.event.add(this, "click._change", function (event) {
+ if (this._just_changed && !event.isTrigger) {
+ this._just_changed = false;
+ }
+ // Allow triggered, simulated change events (#11500)
+ jQuery.event.simulate("change", this, event, true);
+ });
+ }
+ return false;
+ }
+ // Delegated event; lazy-add a change handler on descendant inputs
+ jQuery.event.add(this, "beforeactivate._change", function (e) {
+ var elem = e.target;
+
+ if (rformElems.test(elem.nodeName) && !jQuery._data(elem, "changeBubbles")) {
+ jQuery.event.add(elem, "change._change", function (event) {
+ if (this.parentNode && !event.isSimulated && !event.isTrigger) {
+ jQuery.event.simulate("change", this.parentNode, event, true);
+ }
+ });
+ jQuery._data(elem, "changeBubbles", true);
+ }
+ });
+ },
+
+ handle: function (event) {
+ var elem = event.target;
+
+ // Swallow native change events from checkbox/radio, we already triggered them above
+ if (this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox")) {
+ return event.handleObj.handler.apply(this, arguments);
+ }
+ },
+
+ teardown: function () {
+ jQuery.event.remove(this, "._change");
+
+ return !rformElems.test(this.nodeName);
+ }
+ };
+ }
+
+// Create "bubbling" focus and blur events
+ if (!jQuery.support.focusinBubbles) {
+ jQuery.each({focus: "focusin", blur: "focusout"}, function (orig, fix) {
+
+ // Attach a single capturing handler while someone wants focusin/focusout
+ var attaches = 0,
+ handler = function (event) {
+ jQuery.event.simulate(fix, event.target, jQuery.event.fix(event), true);
+ };
+
+ jQuery.event.special[fix] = {
+ setup: function () {
+ if (attaches++ === 0) {
+ document.addEventListener(orig, handler, true);
+ }
+ },
+ teardown: function () {
+ if (--attaches === 0) {
+ document.removeEventListener(orig, handler, true);
+ }
+ }
+ };
+ });
+ }
+
+ jQuery.fn.extend({
+
+ on: function (types, selector, data, fn, /*INTERNAL*/ one) {
+ var type, origFn;
+
+ // Types can be a map of types/handlers
+ if (typeof types === "object") {
+ // ( types-Object, selector, data )
+ if (typeof selector !== "string") {
+ // ( types-Object, data )
+ data = data || selector;
+ selector = undefined;
+ }
+ for (type in types) {
+ this.on(type, selector, data, types[type], one);
+ }
+ return this;
+ }
+
+ if (data == null && fn == null) {
+ // ( types, fn )
+ fn = selector;
+ data = selector = undefined;
+ } else if (fn == null) {
+ if (typeof selector === "string") {
+ // ( types, selector, fn )
+ fn = data;
+ data = undefined;
+ } else {
+ // ( types, data, fn )
+ fn = data;
+ data = selector;
+ selector = undefined;
+ }
+ }
+ if (fn === false) {
+ fn = returnFalse;
+ } else if (!fn) {
+ return this;
+ }
+
+ if (one === 1) {
+ origFn = fn;
+ fn = function (event) {
+ // Can use an empty set, since event contains the info
+ jQuery().off(event);
+ return origFn.apply(this, arguments);
+ };
+ // Use same guid so caller can remove using origFn
+ fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ );
+ }
+ return this.each(function () {
+ jQuery.event.add(this, types, fn, data, selector);
+ });
+ },
+ one: function (types, selector, data, fn) {
+ return this.on(types, selector, data, fn, 1);
+ },
+ off: function (types, selector, fn) {
+ var handleObj, type;
+ if (types && types.preventDefault && types.handleObj) {
+ // ( event ) dispatched jQuery.Event
+ handleObj = types.handleObj;
+ jQuery(types.delegateTarget).off(
+ handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType,
+ handleObj.selector,
+ handleObj.handler
+ );
+ return this;
+ }
+ if (typeof types === "object") {
+ // ( types-object [, selector] )
+ for (type in types) {
+ this.off(type, selector, types[type]);
+ }
+ return this;
+ }
+ if (selector === false || typeof selector === "function") {
+ // ( types [, fn] )
+ fn = selector;
+ selector = undefined;
+ }
+ if (fn === false) {
+ fn = returnFalse;
+ }
+ return this.each(function () {
+ jQuery.event.remove(this, types, fn, selector);
+ });
+ },
+
+ trigger: function (type, data) {
+ return this.each(function () {
+ jQuery.event.trigger(type, data, this);
+ });
+ },
+ triggerHandler: function (type, data) {
+ var elem = this[0];
+ if (elem) {
+ return jQuery.event.trigger(type, data, elem, true);
+ }
+ }
+ });
+ var isSimple = /^.[^:#\[\.,]*$/,
+ rparentsprev = /^(?:parents|prev(?:Until|All))/,
+ rneedsContext = jQuery.expr.match.needsContext,
+ // methods guaranteed to produce a unique set when starting from a unique set
+ guaranteedUnique = {
+ children: true,
+ contents: true,
+ next: true,
+ prev: true
+ };
+
+ jQuery.fn.extend({
+ find: function (selector) {
+ var i,
+ ret = [],
+ self = this,
+ len = self.length;
+
+ if (typeof selector !== "string") {
+ return this.pushStack(jQuery(selector).filter(function () {
+ for (i = 0; i < len; i++) {
+ if (jQuery.contains(self[i], this)) {
+ return true;
+ }
+ }
+ }));
+ }
+
+ for (i = 0; i < len; i++) {
+ jQuery.find(selector, self[i], ret);
+ }
+
+ // Needed because $( selector, context ) becomes $( context ).find( selector )
+ ret = this.pushStack(len > 1 ? jQuery.unique(ret) : ret);
+ ret.selector = this.selector ? this.selector + " " + selector : selector;
+ return ret;
+ },
+
+ has: function (target) {
+ var i,
+ targets = jQuery(target, this),
+ len = targets.length;
+
+ return this.filter(function () {
+ for (i = 0; i < len; i++) {
+ if (jQuery.contains(this, targets[i])) {
+ return true;
+ }
+ }
+ });
+ },
+
+ not: function (selector) {
+ return this.pushStack(winnow(this, selector || [], true));
+ },
+
+ filter: function (selector) {
+ return this.pushStack(winnow(this, selector || [], false));
+ },
+
+ is: function (selector) {
+ return !!winnow(
+ this,
+
+ // If this is a positional/relative selector, check membership in the returned set
+ // so $("p:first").is("p:last") won't return true for a doc with two "p".
+ typeof selector === "string" && rneedsContext.test(selector) ?
+ jQuery(selector) :
+ selector || [],
+ false
+ ).length;
+ },
+
+ closest: function (selectors, context) {
+ var cur,
+ i = 0,
+ l = this.length,
+ ret = [],
+ pos = rneedsContext.test(selectors) || typeof selectors !== "string" ?
+ jQuery(selectors, context || this.context) :
+ 0;
+
+ for (; i < l; i++) {
+ for (cur = this[i]; cur && cur !== context; cur = cur.parentNode) {
+ // Always skip document fragments
+ if (cur.nodeType < 11 && (pos ?
+ pos.index(cur) > -1 :
+
+ // Don't pass non-elements to Sizzle
+ cur.nodeType === 1 &&
+ jQuery.find.matchesSelector(cur, selectors))) {
+
+ cur = ret.push(cur);
+ break;
+ }
+ }
+ }
+
+ return this.pushStack(ret.length > 1 ? jQuery.unique(ret) : ret);
+ },
+
+ // Determine the position of an element within
+ // the matched set of elements
+ index: function (elem) {
+
+ // No argument, return index in parent
+ if (!elem) {
+ return ( this[0] && this[0].parentNode ) ? this.first().prevAll().length : -1;
+ }
+
+ // index in selector
+ if (typeof elem === "string") {
+ return jQuery.inArray(this[0], jQuery(elem));
+ }
+
+ // Locate the position of the desired element
+ return jQuery.inArray(
+ // If it receives a jQuery object, the first element is used
+ elem.jquery ? elem[0] : elem, this);
+ },
+
+ add: function (selector, context) {
+ var set = typeof selector === "string" ?
+ jQuery(selector, context) :
+ jQuery.makeArray(selector && selector.nodeType ? [selector] : selector),
+ all = jQuery.merge(this.get(), set);
+
+ return this.pushStack(jQuery.unique(all));
+ },
+
+ addBack: function (selector) {
+ return this.add(selector == null ?
+ this.prevObject : this.prevObject.filter(selector)
+ );
+ }
+ });
+
+ function sibling(cur, dir) {
+ do {
+ cur = cur[dir];
+ } while (cur && cur.nodeType !== 1);
+
+ return cur;
+ }
+
+ jQuery.each({
+ parent: function (elem) {
+ var parent = elem.parentNode;
+ return parent && parent.nodeType !== 11 ? parent : null;
+ },
+ parents: function (elem) {
+ return jQuery.dir(elem, "parentNode");
+ },
+ parentsUntil: function (elem, i, until) {
+ return jQuery.dir(elem, "parentNode", until);
+ },
+ next: function (elem) {
+ return sibling(elem, "nextSibling");
+ },
+ prev: function (elem) {
+ return sibling(elem, "previousSibling");
+ },
+ nextAll: function (elem) {
+ return jQuery.dir(elem, "nextSibling");
+ },
+ prevAll: function (elem) {
+ return jQuery.dir(elem, "previousSibling");
+ },
+ nextUntil: function (elem, i, until) {
+ return jQuery.dir(elem, "nextSibling", until);
+ },
+ prevUntil: function (elem, i, until) {
+ return jQuery.dir(elem, "previousSibling", until);
+ },
+ siblings: function (elem) {
+ return jQuery.sibling(( elem.parentNode || {} ).firstChild, elem);
+ },
+ children: function (elem) {
+ return jQuery.sibling(elem.firstChild);
+ },
+ contents: function (elem) {
+ return jQuery.nodeName(elem, "iframe") ?
+ elem.contentDocument || elem.contentWindow.document :
+ jQuery.merge([], elem.childNodes);
+ }
+ }, function (name, fn) {
+ jQuery.fn[name] = function (until, selector) {
+ var ret = jQuery.map(this, fn, until);
+
+ if (name.slice(-5) !== "Until") {
+ selector = until;
+ }
+
+ if (selector && typeof selector === "string") {
+ ret = jQuery.filter(selector, ret);
+ }
+
+ if (this.length > 1) {
+ // Remove duplicates
+ if (!guaranteedUnique[name]) {
+ ret = jQuery.unique(ret);
+ }
+
+ // Reverse order for parents* and prev-derivatives
+ if (rparentsprev.test(name)) {
+ ret = ret.reverse();
+ }
+ }
+
+ return this.pushStack(ret);
+ };
+ });
+
+ jQuery.extend({
+ filter: function (expr, elems, not) {
+ var elem = elems[0];
+
+ if (not) {
+ expr = ":not(" + expr + ")";
+ }
+
+ return elems.length === 1 && elem.nodeType === 1 ?
+ jQuery.find.matchesSelector(elem, expr) ? [elem] : [] :
+ jQuery.find.matches(expr, jQuery.grep(elems, function (elem) {
+ return elem.nodeType === 1;
+ }));
+ },
+
+ dir: function (elem, dir, until) {
+ var matched = [],
+ cur = elem[dir];
+
+ while (cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery(cur).is(until))) {
+ if (cur.nodeType === 1) {
+ matched.push(cur);
+ }
+ cur = cur[dir];
+ }
+ return matched;
+ },
+
+ sibling: function (n, elem) {
+ var r = [];
+
+ for (; n; n = n.nextSibling) {
+ if (n.nodeType === 1 && n !== elem) {
+ r.push(n);
+ }
+ }
+
+ return r;
+ }
+ });
+
+// Implement the identical functionality for filter and not
+ function winnow(elements, qualifier, not) {
+ if (jQuery.isFunction(qualifier)) {
+ return jQuery.grep(elements, function (elem, i) {
+ /* jshint -W018 */
+ return !!qualifier.call(elem, i, elem) !== not;
+ });
+
+ }
+
+ if (qualifier.nodeType) {
+ return jQuery.grep(elements, function (elem) {
+ return ( elem === qualifier ) !== not;
+ });
+
+ }
+
+ if (typeof qualifier === "string") {
+ if (isSimple.test(qualifier)) {
+ return jQuery.filter(qualifier, elements, not);
+ }
+
+ qualifier = jQuery.filter(qualifier, elements);
+ }
+
+ return jQuery.grep(elements, function (elem) {
+ return ( jQuery.inArray(elem, qualifier) >= 0 ) !== not;
+ });
+ }
+
+ function createSafeFragment(document) {
+ var list = nodeNames.split("|"),
+ safeFrag = document.createDocumentFragment();
+
+ if (safeFrag.createElement) {
+ while (list.length) {
+ safeFrag.createElement(
+ list.pop()
+ );
+ }
+ }
+ return safeFrag;
+ }
+
+ var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|" +
+ "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",
+ rinlinejQuery = / jQuery\d+="(?:null|\d+)"/g,
+ rnoshimcache = new RegExp("<(?:" + nodeNames + ")[\\s/>]", "i"),
+ rleadingWhitespace = /^\s+/,
+ rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,
+ rtagName = /<([\w:]+)/,
+ rtbody = /<tbody/i,
+ rhtml = /<|&#?\w+;/,
+ rnoInnerhtml = /<(?:script|style|link)/i,
+ manipulation_rcheckableType = /^(?:checkbox|radio)$/i,
+ // checked="checked" or checked
+ rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
+ rscriptType = /^$|\/(?:java|ecma)script/i,
+ rscriptTypeMasked = /^true\/(.*)/,
+ rcleanScript = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g,
+
+ // We have to close these tags to support XHTML (#13200)
+ wrapMap = {
+ option: [1, "<select multiple='multiple'>", "</select>"],
+ legend: [1, "<fieldset>", "</fieldset>"],
+ area: [1, "<map>", "</map>"],
+ param: [1, "<object>", "</object>"],
+ thead: [1, "<table>", "</table>"],
+ tr: [2, "<table><tbody>", "</tbody></table>"],
+ col: [2, "<table><tbody></tbody><colgroup>", "</colgroup></table>"],
+ td: [3, "<table><tbody><tr>", "</tr></tbody></table>"],
+
+ // IE6-8 can't serialize link, script, style, or any html5 (NoScope) tags,
+ // unless wrapped in a div with non-breaking characters in front of it.
+ _default: jQuery.support.htmlSerialize ? [0, "", ""] : [1, "X<div>", "</div>"]
+ },
+ safeFragment = createSafeFragment(document),
+ fragmentDiv = safeFragment.appendChild(document.createElement("div"));
+
+ wrapMap.optgroup = wrapMap.option;
+ wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
+ wrapMap.th = wrapMap.td;
+
+ jQuery.fn.extend({
+ text: function (value) {
+ return jQuery.access(this, function (value) {
+ return value === undefined ?
+ jQuery.text(this) :
+ this.empty().append(( this[0] && this[0].ownerDocument || document ).createTextNode(value));
+ }, null, value, arguments.length);
+ },
+
+ append: function () {
+ return this.domManip(arguments, function (elem) {
+ if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) {
+ var target = manipulationTarget(this, elem);
+ target.appendChild(elem);
+ }
+ });
+ },
+
+ prepend: function () {
+ return this.domManip(arguments, function (elem) {
+ if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) {
+ var target = manipulationTarget(this, elem);
+ target.insertBefore(elem, target.firstChild);
+ }
+ });
+ },
+
+ before: function () {
+ return this.domManip(arguments, function (elem) {
+ if (this.parentNode) {
+ this.parentNode.insertBefore(elem, this);
+ }
+ });
+ },
+
+ after: function () {
+ return this.domManip(arguments, function (elem) {
+ if (this.parentNode) {
+ this.parentNode.insertBefore(elem, this.nextSibling);
+ }
+ });
+ },
+
+ // keepData is for internal use only--do not document
+ remove: function (selector, keepData) {
+ var elem,
+ elems = selector ? jQuery.filter(selector, this) : this,
+ i = 0;
+
+ for (; (elem = elems[i]) != null; i++) {
+
+ if (!keepData && elem.nodeType === 1) {
+ jQuery.cleanData(getAll(elem));
+ }
+
+ if (elem.parentNode) {
+ if (keepData && jQuery.contains(elem.ownerDocument, elem)) {
+ setGlobalEval(getAll(elem, "script"));
+ }
+ elem.parentNode.removeChild(elem);
+ }
+ }
+
+ return this;
+ },
+
+ empty: function () {
+ var elem,
+ i = 0;
+
+ for (; (elem = this[i]) != null; i++) {
+ // Remove element nodes and prevent memory leaks
+ if (elem.nodeType === 1) {
+ jQuery.cleanData(getAll(elem, false));
+ }
+
+ // Remove any remaining nodes
+ while (elem.firstChild) {
+ elem.removeChild(elem.firstChild);
+ }
+
+ // If this is a select, ensure that it displays empty (#12336)
+ // Support: IE<9
+ if (elem.options && jQuery.nodeName(elem, "select")) {
+ elem.options.length = 0;
+ }
+ }
+
+ return this;
+ },
+
+ clone: function (dataAndEvents, deepDataAndEvents) {
+ dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
+ deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
+
+ return this.map(function () {
+ return jQuery.clone(this, dataAndEvents, deepDataAndEvents);
+ });
+ },
+
+ html: function (value) {
+ return jQuery.access(this, function (value) {
+ var elem = this[0] || {},
+ i = 0,
+ l = this.length;
+
+ if (value === undefined) {
+ return elem.nodeType === 1 ?
+ elem.innerHTML.replace(rinlinejQuery, "") :
+ undefined;
+ }
+
+ // See if we can take a shortcut and just use innerHTML
+ if (typeof value === "string" && !rnoInnerhtml.test(value) &&
+ ( jQuery.support.htmlSerialize || !rnoshimcache.test(value) ) &&
+ ( jQuery.support.leadingWhitespace || !rleadingWhitespace.test(value) ) && !wrapMap[( rtagName.exec(value) || ["", ""] )[1].toLowerCase()]) {
+
+ value = value.replace(rxhtmlTag, "<$1></$2>");
+
+ try {
+ for (; i < l; i++) {
+ // Remove element nodes and prevent memory leaks
+ elem = this[i] || {};
+ if (elem.nodeType === 1) {
+ jQuery.cleanData(getAll(elem, false));
+ elem.innerHTML = value;
+ }
+ }
+
+ elem = 0;
+
+ // If using innerHTML throws an exception, use the fallback method
+ } catch (e) {
+ }
+ }
+
+ if (elem) {
+ this.empty().append(value);
+ }
+ }, null, value, arguments.length);
+ },
+
+ replaceWith: function () {
+ var
+ // Snapshot the DOM in case .domManip sweeps something relevant into its fragment
+ args = jQuery.map(this, function (elem) {
+ return [elem.nextSibling, elem.parentNode];
+ }),
+ i = 0;
+
+ // Make the changes, replacing each context element with the new content
+ this.domManip(arguments, function (elem) {
+ var next = args[i++],
+ parent = args[i++];
+
+ if (parent) {
+ // Don't use the snapshot next if it has moved (#13810)
+ if (next && next.parentNode !== parent) {
+ next = this.nextSibling;
+ }
+ jQuery(this).remove();
+ parent.insertBefore(elem, next);
+ }
+ // Allow new content to include elements from the context set
+ }, true);
+
+ // Force removal if there was no new content (e.g., from empty arguments)
+ return i ? this : this.remove();
+ },
+
+ detach: function (selector) {
+ return this.remove(selector, true);
+ },
+
+ domManip: function (args, callback, allowIntersection) {
+
+ // Flatten any nested arrays
+ args = core_concat.apply([], args);
+
+ var first, node, hasScripts,
+ scripts, doc, fragment,
+ i = 0,
+ l = this.length,
+ set = this,
+ iNoClone = l - 1,
+ value = args[0],
+ isFunction = jQuery.isFunction(value);
+
+ // We can't cloneNode fragments that contain checked, in WebKit
+ if (isFunction || !( l <= 1 || typeof value !== "string" || jQuery.support.checkClone || !rchecked.test(value) )) {
+ return this.each(function (index) {
+ var self = set.eq(index);
+ if (isFunction) {
+ args[0] = value.call(this, index, self.html());
+ }
+ self.domManip(args, callback, allowIntersection);
+ });
+ }
+
+ if (l) {
+ fragment = jQuery.buildFragment(args, this[0].ownerDocument, false, !allowIntersection && this);
+ first = fragment.firstChild;
+
+ if (fragment.childNodes.length === 1) {
+ fragment = first;
+ }
+
+ if (first) {
+ scripts = jQuery.map(getAll(fragment, "script"), disableScript);
+ hasScripts = scripts.length;
+
+ // Use the original fragment for the last item instead of the first because it can end up
+ // being emptied incorrectly in certain situations (#8070).
+ for (; i < l; i++) {
+ node = fragment;
+
+ if (i !== iNoClone) {
+ node = jQuery.clone(node, true, true);
+
+ // Keep references to cloned scripts for later restoration
+ if (hasScripts) {
+ jQuery.merge(scripts, getAll(node, "script"));
+ }
+ }
+
+ callback.call(this[i], node, i);
+ }
+
+ if (hasScripts) {
+ doc = scripts[scripts.length - 1].ownerDocument;
+
+ // Reenable scripts
+ jQuery.map(scripts, restoreScript);
+
+ // Evaluate executable scripts on first document insertion
+ for (i = 0; i < hasScripts; i++) {
+ node = scripts[i];
+ if (rscriptType.test(node.type || "") && !jQuery._data(node, "globalEval") && jQuery.contains(doc, node)) {
+
+ if (node.src) {
+ // Hope ajax is available...
+ jQuery._evalUrl(node.src);
+ } else {
+ jQuery.globalEval(( node.text || node.textContent || node.innerHTML || "" ).replace(rcleanScript, ""));
+ }
+ }
+ }
+ }
+
+ // Fix #11809: Avoid leaking memory
+ fragment = first = null;
+ }
+ }
+
+ return this;
+ }
+ });
+
+// Support: IE<8
+// Manipulating tables requires a tbody
+ function manipulationTarget(elem, content) {
+ return jQuery.nodeName(elem, "table") &&
+ jQuery.nodeName(content.nodeType === 1 ? content : content.firstChild, "tr") ?
+
+ elem.getElementsByTagName("tbody")[0] ||
+ elem.appendChild(elem.ownerDocument.createElement("tbody")) :
+ elem;
+ }
+
+// Replace/restore the type attribute of script elements for safe DOM manipulation
+ function disableScript(elem) {
+ elem.type = (jQuery.find.attr(elem, "type") !== null) + "/" + elem.type;
+ return elem;
+ }
+
+ function restoreScript(elem) {
+ var match = rscriptTypeMasked.exec(elem.type);
+ if (match) {
+ elem.type = match[1];
+ } else {
+ elem.removeAttribute("type");
+ }
+ return elem;
+ }
+
+// Mark scripts as having already been evaluated
+ function setGlobalEval(elems, refElements) {
+ var elem,
+ i = 0;
+ for (; (elem = elems[i]) != null; i++) {
+ jQuery._data(elem, "globalEval", !refElements || jQuery._data(refElements[i], "globalEval"));
+ }
+ }
+
+ function cloneCopyEvent(src, dest) {
+
+ if (dest.nodeType !== 1 || !jQuery.hasData(src)) {
+ return;
+ }
+
+ var type, i, l,
+ oldData = jQuery._data(src),
+ curData = jQuery._data(dest, oldData),
+ events = oldData.events;
+
+ if (events) {
+ delete curData.handle;
+ curData.events = {};
+
+ for (type in events) {
+ for (i = 0, l = events[type].length; i < l; i++) {
+ jQuery.event.add(dest, type, events[type][i]);
+ }
+ }
+ }
+
+ // make the cloned public data object a copy from the original
+ if (curData.data) {
+ curData.data = jQuery.extend({}, curData.data);
+ }
+ }
+
+ function fixCloneNodeIssues(src, dest) {
+ var nodeName, e, data;
+
+ // We do not need to do anything for non-Elements
+ if (dest.nodeType !== 1) {
+ return;
+ }
+
+ nodeName = dest.nodeName.toLowerCase();
+
+ // IE6-8 copies events bound via attachEvent when using cloneNode.
+ if (!jQuery.support.noCloneEvent && dest[jQuery.expando]) {
+ data = jQuery._data(dest);
+
+ for (e in data.events) {
+ jQuery.removeEvent(dest, e, data.handle);
+ }
+
+ // Event data gets referenced instead of copied if the expando gets copied too
+ dest.removeAttribute(jQuery.expando);
+ }
+
+ // IE blanks contents when cloning scripts, and tries to evaluate newly-set text
+ if (nodeName === "script" && dest.text !== src.text) {
+ disableScript(dest).text = src.text;
+ restoreScript(dest);
+
+ // IE6-10 improperly clones children of object elements using classid.
+ // IE10 throws NoModificationAllowedError if parent is null, #12132.
+ } else if (nodeName === "object") {
+ if (dest.parentNode) {
+ dest.outerHTML = src.outerHTML;
+ }
+
+ // This path appears unavoidable for IE9. When cloning an object
+ // element in IE9, the outerHTML strategy above is not sufficient.
+ // If the src has innerHTML and the destination does not,
+ // copy the src.innerHTML into the dest.innerHTML. #10324
+ if (jQuery.support.html5Clone && ( src.innerHTML && !jQuery.trim(dest.innerHTML) )) {
+ dest.innerHTML = src.innerHTML;
+ }
+
+ } else if (nodeName === "input" && manipulation_rcheckableType.test(src.type)) {
+ // IE6-8 fails to persist the checked state of a cloned checkbox
+ // or radio button. Worse, IE6-7 fail to give the cloned element
+ // a checked appearance if the defaultChecked value isn't also set
+
+ dest.defaultChecked = dest.checked = src.checked;
+
+ // IE6-7 get confused and end up setting the value of a cloned
+ // checkbox/radio button to an empty string instead of "on"
+ if (dest.value !== src.value) {
+ dest.value = src.value;
+ }
+
+ // IE6-8 fails to return the selected option to the default selected
+ // state when cloning options
+ } else if (nodeName === "option") {
+ dest.defaultSelected = dest.selected = src.defaultSelected;
+
+ // IE6-8 fails to set the defaultValue to the correct value when
+ // cloning other types of input fields
+ } else if (nodeName === "input" || nodeName === "textarea") {
+ dest.defaultValue = src.defaultValue;
+ }
+ }
+
+ jQuery.each({
+ appendTo: "append",
+ prependTo: "prepend",
+ insertBefore: "before",
+ insertAfter: "after",
+ replaceAll: "replaceWith"
+ }, function (name, original) {
+ jQuery.fn[name] = function (selector) {
+ var elems,
+ i = 0,
+ ret = [],
+ insert = jQuery(selector),
+ last = insert.length - 1;
+
+ for (; i <= last; i++) {
+ elems = i === last ? this : this.clone(true);
+ jQuery(insert[i])[original](elems);
+
+ // Modern browsers can apply jQuery collections as arrays, but oldIE needs a .get()
+ core_push.apply(ret, elems.get());
+ }
+
+ return this.pushStack(ret);
+ };
+ });
+
+ function getAll(context, tag) {
+ var elems, elem,
+ i = 0,
+ found = typeof context.getElementsByTagName !== core_strundefined ? context.getElementsByTagName(tag || "*") :
+ typeof context.querySelectorAll !== core_strundefined ? context.querySelectorAll(tag || "*") :
+ undefined;
+
+ if (!found) {
+ for (found = [], elems = context.childNodes || context; (elem = elems[i]) != null; i++) {
+ if (!tag || jQuery.nodeName(elem, tag)) {
+ found.push(elem);
+ } else {
+ jQuery.merge(found, getAll(elem, tag));
+ }
+ }
+ }
+
+ return tag === undefined || tag && jQuery.nodeName(context, tag) ?
+ jQuery.merge([context], found) :
+ found;
+ }
+
+// Used in buildFragment, fixes the defaultChecked property
+ function fixDefaultChecked(elem) {
+ if (manipulation_rcheckableType.test(elem.type)) {
+ elem.defaultChecked = elem.checked;
+ }
+ }
+
+ jQuery.extend({
+ clone: function (elem, dataAndEvents, deepDataAndEvents) {
+ var destElements, node, clone, i, srcElements,
+ inPage = jQuery.contains(elem.ownerDocument, elem);
+
+ if (jQuery.support.html5Clone || jQuery.isXMLDoc(elem) || !rnoshimcache.test("<" + elem.nodeName + ">")) {
+ clone = elem.cloneNode(true);
+
+ // IE<=8 does not properly clone detached, unknown element nodes
+ } else {
+ fragmentDiv.innerHTML = elem.outerHTML;
+ fragmentDiv.removeChild(clone = fragmentDiv.firstChild);
+ }
+
+ if ((!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) &&
+ (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem)) {
+
+ // We eschew Sizzle here for performance reasons: http://jsperf.com/getall-vs-sizzle/2
+ destElements = getAll(clone);
+ srcElements = getAll(elem);
+
+ // Fix all IE cloning issues
+ for (i = 0; (node = srcElements[i]) != null; ++i) {
+ // Ensure that the destination node is not null; Fixes #9587
+ if (destElements[i]) {
+ fixCloneNodeIssues(node, destElements[i]);
+ }
+ }
+ }
+
+ // Copy the events from the original to the clone
+ if (dataAndEvents) {
+ if (deepDataAndEvents) {
+ srcElements = srcElements || getAll(elem);
+ destElements = destElements || getAll(clone);
+
+ for (i = 0; (node = srcElements[i]) != null; i++) {
+ cloneCopyEvent(node, destElements[i]);
+ }
+ } else {
+ cloneCopyEvent(elem, clone);
+ }
+ }
+
+ // Preserve script evaluation history
+ destElements = getAll(clone, "script");
+ if (destElements.length > 0) {
+ setGlobalEval(destElements, !inPage && getAll(elem, "script"));
+ }
+
+ destElements = srcElements = node = null;
+
+ // Return the cloned set
+ return clone;
+ },
+
+ buildFragment: function (elems, context, scripts, selection) {
+ var j, elem, contains,
+ tmp, tag, tbody, wrap,
+ l = elems.length,
+
+ // Ensure a safe fragment
+ safe = createSafeFragment(context),
+
+ nodes = [],
+ i = 0;
+
+ for (; i < l; i++) {
+ elem = elems[i];
+
+ if (elem || elem === 0) {
+
+ // Add nodes directly
+ if (jQuery.type(elem) === "object") {
+ jQuery.merge(nodes, elem.nodeType ? [elem] : elem);
+
+ // Convert non-html into a text node
+ } else if (!rhtml.test(elem)) {
+ nodes.push(context.createTextNode(elem));
+
+ // Convert html into DOM nodes
+ } else {
+ tmp = tmp || safe.appendChild(context.createElement("div"));
+
+ // Deserialize a standard representation
+ tag = ( rtagName.exec(elem) || ["", ""] )[1].toLowerCase();
+ wrap = wrapMap[tag] || wrapMap._default;
+
+ tmp.innerHTML = wrap[1] + elem.replace(rxhtmlTag, "<$1></$2>") + wrap[2];
+
+ // Descend through wrappers to the right content
+ j = wrap[0];
+ while (j--) {
+ tmp = tmp.lastChild;
+ }
+
+ // Manually add leading whitespace removed by IE
+ if (!jQuery.support.leadingWhitespace && rleadingWhitespace.test(elem)) {
+ nodes.push(context.createTextNode(rleadingWhitespace.exec(elem)[0]));
+ }
+
+ // Remove IE's autoinserted <tbody> from table fragments
+ if (!jQuery.support.tbody) {
+
+ // String was a <table>, *may* have spurious <tbody>
+ elem = tag === "table" && !rtbody.test(elem) ?
+ tmp.firstChild :
+
+ // String was a bare <thead> or <tfoot>
+ wrap[1] === "<table>" && !rtbody.test(elem) ?
+ tmp :
+ 0;
+
+ j = elem && elem.childNodes.length;
+ while (j--) {
+ if (jQuery.nodeName((tbody = elem.childNodes[j]), "tbody") && !tbody.childNodes.length) {
+ elem.removeChild(tbody);
+ }
+ }
+ }
+
+ jQuery.merge(nodes, tmp.childNodes);
+
+ // Fix #12392 for WebKit and IE > 9
+ tmp.textContent = "";
+
+ // Fix #12392 for oldIE
+ while (tmp.firstChild) {
+ tmp.removeChild(tmp.firstChild);
+ }
+
+ // Remember the top-level container for proper cleanup
+ tmp = safe.lastChild;
+ }
+ }
+ }
+
+ // Fix #11356: Clear elements from fragment
+ if (tmp) {
+ safe.removeChild(tmp);
+ }
+
+ // Reset defaultChecked for any radios and checkboxes
+ // about to be appended to the DOM in IE 6/7 (#8060)
+ if (!jQuery.support.appendChecked) {
+ jQuery.grep(getAll(nodes, "input"), fixDefaultChecked);
+ }
+
+ i = 0;
+ while ((elem = nodes[i++])) {
+
+ // #4087 - If origin and destination elements are the same, and this is
+ // that element, do not do anything
+ if (selection && jQuery.inArray(elem, selection) !== -1) {
+ continue;
+ }
+
+ contains = jQuery.contains(elem.ownerDocument, elem);
+
+ // Append to fragment
+ tmp = getAll(safe.appendChild(elem), "script");
+
+ // Preserve script evaluation history
+ if (contains) {
+ setGlobalEval(tmp);
+ }
+
+ // Capture executables
+ if (scripts) {
+ j = 0;
+ while ((elem = tmp[j++])) {
+ if (rscriptType.test(elem.type || "")) {
+ scripts.push(elem);
+ }
+ }
+ }
+ }
+
+ tmp = null;
+
+ return safe;
+ },
+
+ cleanData: function (elems, /* internal */ acceptData) {
+ var elem, type, id, data,
+ i = 0,
+ internalKey = jQuery.expando,
+ cache = jQuery.cache,
+ deleteExpando = jQuery.support.deleteExpando,
+ special = jQuery.event.special;
+
+ for (; (elem = elems[i]) != null; i++) {
+
+ if (acceptData || jQuery.acceptData(elem)) {
+
+ id = elem[internalKey];
+ data = id && cache[id];
+
+ if (data) {
+ if (data.events) {
+ for (type in data.events) {
+ if (special[type]) {
+ jQuery.event.remove(elem, type);
+
+ // This is a shortcut to avoid jQuery.event.remove's overhead
+ } else {
+ jQuery.removeEvent(elem, type, data.handle);
+ }
+ }
+ }
+
+ // Remove cache only if it was not already removed by jQuery.event.remove
+ if (cache[id]) {
+
+ delete cache[id];
+
+ // IE does not allow us to delete expando properties from nodes,
+ // nor does it have a removeAttribute function on Document nodes;
+ // we must handle all of these cases
+ if (deleteExpando) {
+ delete elem[internalKey];
+
+ } else if (typeof elem.removeAttribute !== core_strundefined) {
+ elem.removeAttribute(internalKey);
+
+ } else {
+ elem[internalKey] = null;
+ }
+
+ core_deletedIds.push(id);
+ }
+ }
+ }
+ }
+ },
+
+ _evalUrl: function (url) {
+ return jQuery.ajax({
+ url: url,
+ type: "GET",
+ dataType: "script",
+ async: false,
+ global: false,
+ "throws": true
+ });
+ }
+ });
+ jQuery.fn.extend({
+ wrapAll: function (html) {
+ if (jQuery.isFunction(html)) {
+ return this.each(function (i) {
+ jQuery(this).wrapAll(html.call(this, i));
+ });
+ }
+
+ if (this[0]) {
+ // The elements to wrap the target around
+ var wrap = jQuery(html, this[0].ownerDocument).eq(0).clone(true);
+
+ if (this[0].parentNode) {
+ wrap.insertBefore(this[0]);
+ }
+
+ wrap.map(function () {
+ var elem = this;
+
+ while (elem.firstChild && elem.firstChild.nodeType === 1) {
+ elem = elem.firstChild;
+ }
+
+ return elem;
+ }).append(this);
+ }
+
+ return this;
+ },
+
+ wrapInner: function (html) {
+ if (jQuery.isFunction(html)) {
+ return this.each(function (i) {
+ jQuery(this).wrapInner(html.call(this, i));
+ });
+ }
+
+ return this.each(function () {
+ var self = jQuery(this),
+ contents = self.contents();
+
+ if (contents.length) {
+ contents.wrapAll(html);
+
+ } else {
+ self.append(html);
+ }
+ });
+ },
+
+ wrap: function (html) {
+ var isFunction = jQuery.isFunction(html);
+
+ return this.each(function (i) {
+ jQuery(this).wrapAll(isFunction ? html.call(this, i) : html);
+ });
+ },
+
+ unwrap: function () {
+ return this.parent().each(function () {
+ if (!jQuery.nodeName(this, "body")) {
+ jQuery(this).replaceWith(this.childNodes);
+ }
+ }).end();
+ }
+ });
+ var iframe, getStyles, curCSS,
+ ralpha = /alpha\([^)]*\)/i,
+ ropacity = /opacity\s*=\s*([^)]*)/,
+ rposition = /^(top|right|bottom|left)$/,
+ // swappable if display is none or starts with table except "table", "table-cell", or "table-caption"
+ // see here for display values: https://developer.mozilla.org/en-US/docs/CSS/display
+ rdisplayswap = /^(none|table(?!-c[ea]).+)/,
+ rmargin = /^margin/,
+ rnumsplit = new RegExp("^(" + core_pnum + ")(.*)$", "i"),
+ rnumnonpx = new RegExp("^(" + core_pnum + ")(?!px)[a-z%]+$", "i"),
+ rrelNum = new RegExp("^([+-])=(" + core_pnum + ")", "i"),
+ elemdisplay = {BODY: "block"},
+
+ cssShow = {position: "absolute", visibility: "hidden", display: "block"},
+ cssNormalTransform = {
+ letterSpacing: 0,
+ fontWeight: 400
+ },
+
+ cssExpand = ["Top", "Right", "Bottom", "Left"],
+ cssPrefixes = ["Webkit", "O", "Moz", "ms"];
+
+// return a css property mapped to a potentially vendor prefixed property
+ function vendorPropName(style, name) {
+
+ // shortcut for names that are not vendor prefixed
+ if (name in style) {
+ return name;
+ }
+
+ // check for vendor prefixed names
+ var capName = name.charAt(0).toUpperCase() + name.slice(1),
+ origName = name,
+ i = cssPrefixes.length;
+
+ while (i--) {
+ name = cssPrefixes[i] + capName;
+ if (name in style) {
+ return name;
+ }
+ }
+
+ return origName;
+ }
+
+ function isHidden(elem, el) {
+ // isHidden might be called from jQuery#filter function;
+ // in that case, element will be second argument
+ elem = el || elem;
+ return jQuery.css(elem, "display") === "none" || !jQuery.contains(elem.ownerDocument, elem);
+ }
+
+ function showHide(elements, show) {
+ var display, elem, hidden,
+ values = [],
+ index = 0,
+ length = elements.length;
+
+ for (; index < length; index++) {
+ elem = elements[index];
+ if (!elem.style) {
+ continue;
+ }
+
+ values[index] = jQuery._data(elem, "olddisplay");
+ display = elem.style.display;
+ if (show) {
+ // Reset the inline display of this element to learn if it is
+ // being hidden by cascaded rules or not
+ if (!values[index] && display === "none") {
+ elem.style.display = "";
+ }
+
+ // Set elements which have been overridden with display: none
+ // in a stylesheet to whatever the default browser style is
+ // for such an element
+ if (elem.style.display === "" && isHidden(elem)) {
+ values[index] = jQuery._data(elem, "olddisplay", css_defaultDisplay(elem.nodeName));
+ }
+ } else {
+
+ if (!values[index]) {
+ hidden = isHidden(elem);
+
+ if (display && display !== "none" || !hidden) {
+ jQuery._data(elem, "olddisplay", hidden ? display : jQuery.css(elem, "display"));
+ }
+ }
+ }
+ }
+
+ // Set the display of most of the elements in a second loop
+ // to avoid the constant reflow
+ for (index = 0; index < length; index++) {
+ elem = elements[index];
+ if (!elem.style) {
+ continue;
+ }
+ if (!show || elem.style.display === "none" || elem.style.display === "") {
+ elem.style.display = show ? values[index] || "" : "none";
+ }
+ }
+
+ return elements;
+ }
+
+ jQuery.fn.extend({
+ css: function (name, value) {
+ return jQuery.access(this, function (elem, name, value) {
+ var len, styles,
+ map = {},
+ i = 0;
+
+ if (jQuery.isArray(name)) {
+ styles = getStyles(elem);
+ len = name.length;
+
+ for (; i < len; i++) {
+ map[name[i]] = jQuery.css(elem, name[i], false, styles);
+ }
+
+ return map;
+ }
+
+ return value !== undefined ?
+ jQuery.style(elem, name, value) :
+ jQuery.css(elem, name);
+ }, name, value, arguments.length > 1);
+ },
+ show: function () {
+ return showHide(this, true);
+ },
+ hide: function () {
+ return showHide(this);
+ },
+ toggle: function (state) {
+ if (typeof state === "boolean") {
+ return state ? this.show() : this.hide();
+ }
+
+ return this.each(function () {
+ if (isHidden(this)) {
+ jQuery(this).show();
+ } else {
+ jQuery(this).hide();
+ }
+ });
+ }
+ });
+
+ jQuery.extend({
+ // Add in style property hooks for overriding the default
+ // behavior of getting and setting a style property
+ cssHooks: {
+ opacity: {
+ get: function (elem, computed) {
+ if (computed) {
+ // We should always get a number back from opacity
+ var ret = curCSS(elem, "opacity");
+ return ret === "" ? "1" : ret;
+ }
+ }
+ }
+ },
+
+ // Don't automatically add "px" to these possibly-unitless properties
+ cssNumber: {
+ "columnCount": true,
+ "fillOpacity": true,
+ "fontWeight": true,
+ "lineHeight": true,
+ "opacity": true,
+ "order": true,
+ "orphans": true,
+ "widows": true,
+ "zIndex": true,
+ "zoom": true
+ },
+
+ // Add in properties whose names you wish to fix before
+ // setting or getting the value
+ cssProps: {
+ // normalize float css property
+ "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat"
+ },
+
+ // Get and set the style property on a DOM Node
+ style: function (elem, name, value, extra) {
+ // Don't set styles on text and comment nodes
+ if (!elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style) {
+ return;
+ }
+
+ // Make sure that we're working with the right name
+ var ret, type, hooks,
+ origName = jQuery.camelCase(name),
+ style = elem.style;
+
+ name = jQuery.cssProps[origName] || ( jQuery.cssProps[origName] = vendorPropName(style, origName) );
+
+ // gets hook for the prefixed version
+ // followed by the unprefixed version
+ hooks = jQuery.cssHooks[name] || jQuery.cssHooks[origName];
+
+ // Check if we're setting a value
+ if (value !== undefined) {
+ type = typeof value;
+
+ // convert relative number strings (+= or -=) to relative numbers. #7345
+ if (type === "string" && (ret = rrelNum.exec(value))) {
+ value = ( ret[1] + 1 ) * ret[2] + parseFloat(jQuery.css(elem, name));
+ // Fixes bug #9237
+ type = "number";
+ }
+
+ // Make sure that NaN and null values aren't set. See: #7116
+ if (value == null || type === "number" && isNaN(value)) {
+ return;
+ }
+
+ // If a number was passed in, add 'px' to the (except for certain CSS properties)
+ if (type === "number" && !jQuery.cssNumber[origName]) {
+ value += "px";
+ }
+
+ // Fixes #8908, it can be done more correctly by specifing setters in cssHooks,
+ // but it would mean to define eight (for every problematic property) identical functions
+ if (!jQuery.support.clearCloneStyle && value === "" && name.indexOf("background") === 0) {
+ style[name] = "inherit";
+ }
+
+ // If a hook was provided, use that value, otherwise just set the specified value
+ if (!hooks || !("set" in hooks) || (value = hooks.set(elem, value, extra)) !== undefined) {
+
+ // Wrapped to prevent IE from throwing errors when 'invalid' values are provided
+ // Fixes bug #5509
+ try {
+ style[name] = value;
+ } catch (e) {
+ }
+ }
+
+ } else {
+ // If a hook was provided get the non-computed value from there
+ if (hooks && "get" in hooks && (ret = hooks.get(elem, false, extra)) !== undefined) {
+ return ret;
+ }
+
+ // Otherwise just get the value from the style object
+ return style[name];
+ }
+ },
+
+ css: function (elem, name, extra, styles) {
+ var num, val, hooks,
+ origName = jQuery.camelCase(name);
+
+ // Make sure that we're working with the right name
+ name = jQuery.cssProps[origName] || ( jQuery.cssProps[origName] = vendorPropName(elem.style, origName) );
+
+ // gets hook for the prefixed version
+ // followed by the unprefixed version
+ hooks = jQuery.cssHooks[name] || jQuery.cssHooks[origName];
+
+ // If a hook was provided get the computed value from there
+ if (hooks && "get" in hooks) {
+ val = hooks.get(elem, true, extra);
+ }
+
+ // Otherwise, if a way to get the computed value exists, use that
+ if (val === undefined) {
+ val = curCSS(elem, name, styles);
+ }
+
+ //convert "normal" to computed value
+ if (val === "normal" && name in cssNormalTransform) {
+ val = cssNormalTransform[name];
+ }
+
+ // Return, converting to number if forced or a qualifier was provided and val looks numeric
+ if (extra === "" || extra) {
+ num = parseFloat(val);
+ return extra === true || jQuery.isNumeric(num) ? num || 0 : val;
+ }
+ return val;
+ }
+ });
+
+// NOTE: we've included the "window" in window.getComputedStyle
+// because jsdom on node.js will break without it.
+ if (window.getComputedStyle) {
+ getStyles = function (elem) {
+ return window.getComputedStyle(elem, null);
+ };
+
+ curCSS = function (elem, name, _computed) {
+ var width, minWidth, maxWidth,
+ computed = _computed || getStyles(elem),
+
+ // getPropertyValue is only needed for .css('filter') in IE9, see #12537
+ ret = computed ? computed.getPropertyValue(name) || computed[name] : undefined,
+ style = elem.style;
+
+ if (computed) {
+
+ if (ret === "" && !jQuery.contains(elem.ownerDocument, elem)) {
+ ret = jQuery.style(elem, name);
+ }
+
+ // A tribute to the "awesome hack by Dean Edwards"
+ // Chrome < 17 and Safari 5.0 uses "computed value" instead of "used value" for margin-right
+ // Safari 5.1.7 (at least) returns percentage for a larger set of values, but width seems to be reliably pixels
+ // this is against the CSSOM draft spec: http://dev.w3.org/csswg/cssom/#resolved-values
+ if (rnumnonpx.test(ret) && rmargin.test(name)) {
+
+ // Remember the original values
+ width = style.width;
+ minWidth = style.minWidth;
+ maxWidth = style.maxWidth;
+
+ // Put in the new values to get a computed value out
+ style.minWidth = style.maxWidth = style.width = ret;
+ ret = computed.width;
+
+ // Revert the changed values
+ style.width = width;
+ style.minWidth = minWidth;
+ style.maxWidth = maxWidth;
+ }
+ }
+
+ return ret;
+ };
+ } else if (document.documentElement.currentStyle) {
+ getStyles = function (elem) {
+ return elem.currentStyle;
+ };
+
+ curCSS = function (elem, name, _computed) {
+ var left, rs, rsLeft,
+ computed = _computed || getStyles(elem),
+ ret = computed ? computed[name] : undefined,
+ style = elem.style;
+
+ // Avoid setting ret to empty string here
+ // so we don't default to auto
+ if (ret == null && style && style[name]) {
+ ret = style[name];
+ }
+
+ // From the awesome hack by Dean Edwards
+ // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
+
+ // If we're not dealing with a regular pixel number
+ // but a number that has a weird ending, we need to convert it to pixels
+ // but not position css attributes, as those are proportional to the parent element instead
+ // and we can't measure the parent instead because it might trigger a "stacking dolls" problem
+ if (rnumnonpx.test(ret) && !rposition.test(name)) {
+
+ // Remember the original values
+ left = style.left;
+ rs = elem.runtimeStyle;
+ rsLeft = rs && rs.left;
+
+ // Put in the new values to get a computed value out
+ if (rsLeft) {
+ rs.left = elem.currentStyle.left;
+ }
+ style.left = name === "fontSize" ? "1em" : ret;
+ ret = style.pixelLeft + "px";
+
+ // Revert the changed values
+ style.left = left;
+ if (rsLeft) {
+ rs.left = rsLeft;
+ }
+ }
+
+ return ret === "" ? "auto" : ret;
+ };
+ }
+
+ function setPositiveNumber(elem, value, subtract) {
+ var matches = rnumsplit.exec(value);
+ return matches ?
+ // Guard against undefined "subtract", e.g., when used as in cssHooks
+ Math.max(0, matches[1] - ( subtract || 0 )) + ( matches[2] || "px" ) :
+ value;
+ }
+
+ function augmentWidthOrHeight(elem, name, extra, isBorderBox, styles) {
+ var i = extra === ( isBorderBox ? "border" : "content" ) ?
+ // If we already have the right measurement, avoid augmentation
+ 4 :
+ // Otherwise initialize for horizontal or vertical properties
+ name === "width" ? 1 : 0,
+
+ val = 0;
+
+ for (; i < 4; i += 2) {
+ // both box models exclude margin, so add it if we want it
+ if (extra === "margin") {
+ val += jQuery.css(elem, extra + cssExpand[i], true, styles);
+ }
+
+ if (isBorderBox) {
+ // border-box includes padding, so remove it if we want content
+ if (extra === "content") {
+ val -= jQuery.css(elem, "padding" + cssExpand[i], true, styles);
+ }
+
+ // at this point, extra isn't border nor margin, so remove border
+ if (extra !== "margin") {
+ val -= jQuery.css(elem, "border" + cssExpand[i] + "Width", true, styles);
+ }
+ } else {
+ // at this point, extra isn't content, so add padding
+ val += jQuery.css(elem, "padding" + cssExpand[i], true, styles);
+
+ // at this point, extra isn't content nor padding, so add border
+ if (extra !== "padding") {
+ val += jQuery.css(elem, "border" + cssExpand[i] + "Width", true, styles);
+ }
+ }
+ }
+
+ return val;
+ }
+
+ function getWidthOrHeight(elem, name, extra) {
+
+ // Start with offset property, which is equivalent to the border-box value
+ var valueIsBorderBox = true,
+ val = name === "width" ? elem.offsetWidth : elem.offsetHeight,
+ styles = getStyles(elem),
+ isBorderBox = jQuery.support.boxSizing && jQuery.css(elem, "boxSizing", false, styles) === "border-box";
+
+ // some non-html elements return undefined for offsetWidth, so check for null/undefined
+ // svg - https://bugzilla.mozilla.org/show_bug.cgi?id=649285
+ // MathML - https://bugzilla.mozilla.org/show_bug.cgi?id=491668
+ if (val <= 0 || val == null) {
+ // Fall back to computed then uncomputed css if necessary
+ val = curCSS(elem, name, styles);
+ if (val < 0 || val == null) {
+ val = elem.style[name];
+ }
+
+ // Computed unit is not pixels. Stop here and return.
+ if (rnumnonpx.test(val)) {
+ return val;
+ }
+
+ // we need the check for style in case a browser which returns unreliable values
+ // for getComputedStyle silently falls back to the reliable elem.style
+ valueIsBorderBox = isBorderBox && ( jQuery.support.boxSizingReliable || val === elem.style[name] );
+
+ // Normalize "", auto, and prepare for extra
+ val = parseFloat(val) || 0;
+ }
+
+ // use the active box-sizing model to add/subtract irrelevant styles
+ return ( val +
+ augmentWidthOrHeight(
+ elem,
+ name,
+ extra || ( isBorderBox ? "border" : "content" ),
+ valueIsBorderBox,
+ styles
+ )
+ ) + "px";
+ }
+
+// Try to determine the default display value of an element
+ function css_defaultDisplay(nodeName) {
+ var doc = document,
+ display = elemdisplay[nodeName];
+
+ if (!display) {
+ display = actualDisplay(nodeName, doc);
+
+ // If the simple way fails, read from inside an iframe
+ if (display === "none" || !display) {
+ // Use the already-created iframe if possible
+ iframe = ( iframe ||
+ jQuery("<iframe frameborder='0' width='0' height='0'/>")
+ .css("cssText", "display:block !important")
+ ).appendTo(doc.documentElement);
+
+ // Always write a new HTML skeleton so Webkit and Firefox don't choke on reuse
+ doc = ( iframe[0].contentWindow || iframe[0].contentDocument ).document;
+ doc.write("<!doctype html><html><body>");
+ doc.close();
+
+ display = actualDisplay(nodeName, doc);
+ iframe.detach();
+ }
+
+ // Store the correct default display
+ elemdisplay[nodeName] = display;
+ }
+
+ return display;
+ }
+
+// Called ONLY from within css_defaultDisplay
+ function actualDisplay(name, doc) {
+ var elem = jQuery(doc.createElement(name)).appendTo(doc.body),
+ display = jQuery.css(elem[0], "display");
+ elem.remove();
+ return display;
+ }
+
+ jQuery.each(["height", "width"], function (i, name) {
+ jQuery.cssHooks[name] = {
+ get: function (elem, computed, extra) {
+ if (computed) {
+ // certain elements can have dimension info if we invisibly show them
+ // however, it must have a current display style that would benefit from this
+ return elem.offsetWidth === 0 && rdisplayswap.test(jQuery.css(elem, "display")) ?
+ jQuery.swap(elem, cssShow, function () {
+ return getWidthOrHeight(elem, name, extra);
+ }) :
+ getWidthOrHeight(elem, name, extra);
+ }
+ },
+
+ set: function (elem, value, extra) {
+ var styles = extra && getStyles(elem);
+ return setPositiveNumber(elem, value, extra ?
+ augmentWidthOrHeight(
+ elem,
+ name,
+ extra,
+ jQuery.support.boxSizing && jQuery.css(elem, "boxSizing", false, styles) === "border-box",
+ styles
+ ) : 0
+ );
+ }
+ };
+ });
+
+ if (!jQuery.support.opacity) {
+ jQuery.cssHooks.opacity = {
+ get: function (elem, computed) {
+ // IE uses filters for opacity
+ return ropacity.test((computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "") ?
+ ( 0.01 * parseFloat(RegExp.$1) ) + "" :
+ computed ? "1" : "";
+ },
+
+ set: function (elem, value) {
+ var style = elem.style,
+ currentStyle = elem.currentStyle,
+ opacity = jQuery.isNumeric(value) ? "alpha(opacity=" + value * 100 + ")" : "",
+ filter = currentStyle && currentStyle.filter || style.filter || "";
+
+ // IE has trouble with opacity if it does not have layout
+ // Force it by setting the zoom level
+ style.zoom = 1;
+
+ // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652
+ // if value === "", then remove inline opacity #12685
+ if (( value >= 1 || value === "" ) &&
+ jQuery.trim(filter.replace(ralpha, "")) === "" &&
+ style.removeAttribute) {
+
+ // Setting style.filter to null, "" & " " still leave "filter:" in the cssText
+ // if "filter:" is present at all, clearType is disabled, we want to avoid this
+ // style.removeAttribute is IE Only, but so apparently is this code path...
+ style.removeAttribute("filter");
+
+ // if there is no filter style applied in a css rule or unset inline opacity, we are done
+ if (value === "" || currentStyle && !currentStyle.filter) {
+ return;
+ }
+ }
+
+ // otherwise, set new filter values
+ style.filter = ralpha.test(filter) ?
+ filter.replace(ralpha, opacity) :
+ filter + " " + opacity;
+ }
+ };
+ }
+
+// These hooks cannot be added until DOM ready because the support test
+// for it is not run until after DOM ready
+ jQuery(function () {
+ if (!jQuery.support.reliableMarginRight) {
+ jQuery.cssHooks.marginRight = {
+ get: function (elem, computed) {
+ if (computed) {
+ // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
+ // Work around by temporarily setting element display to inline-block
+ return jQuery.swap(elem, {"display": "inline-block"},
+ curCSS, [elem, "marginRight"]);
+ }
+ }
+ };
+ }
+
+ // Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084
+ // getComputedStyle returns percent when specified for top/left/bottom/right
+ // rather than make the css module depend on the offset module, we just check for it here
+ if (!jQuery.support.pixelPosition && jQuery.fn.position) {
+ jQuery.each(["top", "left"], function (i, prop) {
+ jQuery.cssHooks[prop] = {
+ get: function (elem, computed) {
+ if (computed) {
+ computed = curCSS(elem, prop);
+ // if curCSS returns percentage, fallback to offset
+ return rnumnonpx.test(computed) ?
+ jQuery(elem).position()[prop] + "px" :
+ computed;
+ }
+ }
+ };
+ });
+ }
+
+ });
+
+ if (jQuery.expr && jQuery.expr.filters) {
+ jQuery.expr.filters.hidden = function (elem) {
+ // Support: Opera <= 12.12
+ // Opera reports offsetWidths and offsetHeights less than zero on some elements
+ return elem.offsetWidth <= 0 && elem.offsetHeight <= 0 ||
+ (!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || jQuery.css(elem, "display")) === "none");
+ };
+
+ jQuery.expr.filters.visible = function (elem) {
+ return !jQuery.expr.filters.hidden(elem);
+ };
+ }
+
+// These hooks are used by animate to expand properties
+ jQuery.each({
+ margin: "",
+ padding: "",
+ border: "Width"
+ }, function (prefix, suffix) {
+ jQuery.cssHooks[prefix + suffix] = {
+ expand: function (value) {
+ var i = 0,
+ expanded = {},
+
+ // assumes a single number if not a string
+ parts = typeof value === "string" ? value.split(" ") : [value];
+
+ for (; i < 4; i++) {
+ expanded[prefix + cssExpand[i] + suffix] =
+ parts[i] || parts[i - 2] || parts[0];
+ }
+
+ return expanded;
+ }
+ };
+
+ if (!rmargin.test(prefix)) {
+ jQuery.cssHooks[prefix + suffix].set = setPositiveNumber;
+ }
+ });
+ var r20 = /%20/g,
+ rbracket = /\[\]$/,
+ rCRLF = /\r?\n/g,
+ rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i,
+ rsubmittable = /^(?:input|select|textarea|keygen)/i;
+
+ jQuery.fn.extend({
+ serialize: function () {
+ return jQuery.param(this.serializeArray());
+ },
+ serializeArray: function () {
+ return this.map(function () {
+ // Can add propHook for "elements" to filter or add form elements
+ var elements = jQuery.prop(this, "elements");
+ return elements ? jQuery.makeArray(elements) : this;
+ })
+ .filter(function () {
+ var type = this.type;
+ // Use .is(":disabled") so that fieldset[disabled] works
+ return this.name && !jQuery(this).is(":disabled") &&
+ rsubmittable.test(this.nodeName) && !rsubmitterTypes.test(type) &&
+ ( this.checked || !manipulation_rcheckableType.test(type) );
+ })
+ .map(function (i, elem) {
+ var val = jQuery(this).val();
+
+ return val == null ?
+ null :
+ jQuery.isArray(val) ?
+ jQuery.map(val, function (val) {
+ return {name: elem.name, value: val.replace(rCRLF, "\r\n")};
+ }) :
+ {name: elem.name, value: val.replace(rCRLF, "\r\n")};
+ }).get();
+ }
+ });
+
+//Serialize an array of form elements or a set of
+//key/values into a query string
+ jQuery.param = function (a, traditional) {
+ var prefix,
+ s = [],
+ add = function (key, value) {
+ // If value is a function, invoke it and return its value
+ value = jQuery.isFunction(value) ? value() : ( value == null ? "" : value );
+ s[s.length] = encodeURIComponent(key) + "=" + encodeURIComponent(value);
+ };
+
+ // Set traditional to true for jQuery <= 1.3.2 behavior.
+ if (traditional === undefined) {
+ traditional = jQuery.ajaxSettings && jQuery.ajaxSettings.traditional;
+ }
+
+ // If an array was passed in, assume that it is an array of form elements.
+ if (jQuery.isArray(a) || ( a.jquery && !jQuery.isPlainObject(a) )) {
+ // Serialize the form elements
+ jQuery.each(a, function () {
+ add(this.name, this.value);
+ });
+
+ } else {
+ // If traditional, encode the "old" way (the way 1.3.2 or older
+ // did it), otherwise encode params recursively.
+ for (prefix in a) {
+ buildParams(prefix, a[prefix], traditional, add);
+ }
+ }
+
+ // Return the resulting serialization
+ return s.join("&").replace(r20, "+");
+ };
+
+ function buildParams(prefix, obj, traditional, add) {
+ var name;
+
+ if (jQuery.isArray(obj)) {
+ // Serialize array item.
+ jQuery.each(obj, function (i, v) {
+ if (traditional || rbracket.test(prefix)) {
+ // Treat each array item as a scalar.
+ add(prefix, v);
+
+ } else {
+ // Item is non-scalar (array or object), encode its numeric index.
+ buildParams(prefix + "[" + ( typeof v === "object" ? i : "" ) + "]", v, traditional, add);
+ }
+ });
+
+ } else if (!traditional && jQuery.type(obj) === "object") {
+ // Serialize object item.
+ for (name in obj) {
+ buildParams(prefix + "[" + name + "]", obj[name], traditional, add);
+ }
+
+ } else {
+ // Serialize scalar item.
+ add(prefix, obj);
+ }
+ }
+
+ jQuery.each(("blur focus focusin focusout load resize scroll unload click dblclick " +
+ "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
+ "change select submit keydown keypress keyup error contextmenu").split(" "), function (i, name) {
+
+ // Handle event binding
+ jQuery.fn[name] = function (data, fn) {
+ return arguments.length > 0 ?
+ this.on(name, null, data, fn) :
+ this.trigger(name);
+ };
+ });
+
+ jQuery.fn.extend({
+ hover: function (fnOver, fnOut) {
+ return this.mouseenter(fnOver).mouseleave(fnOut || fnOver);
+ },
+
+ bind: function (types, data, fn) {
+ return this.on(types, null, data, fn);
+ },
+ unbind: function (types, fn) {
+ return this.off(types, null, fn);
+ },
+
+ delegate: function (selector, types, data, fn) {
+ return this.on(types, selector, data, fn);
+ },
+ undelegate: function (selector, types, fn) {
+ // ( namespace ) or ( selector, types [, fn] )
+ return arguments.length === 1 ? this.off(selector, "**") : this.off(types, selector || "**", fn);
+ }
+ });
+ var
+ // Document location
+ ajaxLocParts,
+ ajaxLocation,
+ ajax_nonce = jQuery.now(),
+
+ ajax_rquery = /\?/,
+ rhash = /#.*$/,
+ rts = /([?&])_=[^&]*/,
+ rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL
+ // #7653, #8125, #8152: local protocol detection
+ rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/,
+ rnoContent = /^(?:GET|HEAD)$/,
+ rprotocol = /^\/\//,
+ rurl = /^([\w.+-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/,
+
+ // Keep a copy of the old load method
+ _load = jQuery.fn.load,
+
+ /* Prefilters
+ * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
+ * 2) These are called:
+ * - BEFORE asking for a transport
+ * - AFTER param serialization (s.data is a string if s.processData is true)
+ * 3) key is the dataType
+ * 4) the catchall symbol "*" can be used
+ * 5) execution will start with transport dataType and THEN continue down to "*" if needed
+ */
+ prefilters = {},
+
+ /* Transports bindings
+ * 1) key is the dataType
+ * 2) the catchall symbol "*" can be used
+ * 3) selection will start with transport dataType and THEN go to "*" if needed
+ */
+ transports = {},
+
+ // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression
+ allTypes = "*/".concat("*");
+
+// #8138, IE may throw an exception when accessing
+// a field from window.location if document.domain has been set
+ try {
+ ajaxLocation = location.href;
+ } catch (e) {
+ // Use the href attribute of an A element
+ // since IE will modify it given document.location
+ ajaxLocation = document.createElement("a");
+ ajaxLocation.href = "";
+ ajaxLocation = ajaxLocation.href;
+ }
+
+// Segment location into parts
+ ajaxLocParts = rurl.exec(ajaxLocation.toLowerCase()) || [];
+
+// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
+ function addToPrefiltersOrTransports(structure) {
+
+ // dataTypeExpression is optional and defaults to "*"
+ return function (dataTypeExpression, func) {
+
+ if (typeof dataTypeExpression !== "string") {
+ func = dataTypeExpression;
+ dataTypeExpression = "*";
+ }
+
+ var dataType,
+ i = 0,
+ dataTypes = dataTypeExpression.toLowerCase().match(core_rnotwhite) || [];
+
+ if (jQuery.isFunction(func)) {
+ // For each dataType in the dataTypeExpression
+ while ((dataType = dataTypes[i++])) {
+ // Prepend if requested
+ if (dataType[0] === "+") {
+ dataType = dataType.slice(1) || "*";
+ (structure[dataType] = structure[dataType] || []).unshift(func);
+
+ // Otherwise append
+ } else {
+ (structure[dataType] = structure[dataType] || []).push(func);
+ }
+ }
+ }
+ };
+ }
+
+// Base inspection function for prefilters and transports
+ function inspectPrefiltersOrTransports(structure, options, originalOptions, jqXHR) {
+
+ var inspected = {},
+ seekingTransport = ( structure === transports );
+
+ function inspect(dataType) {
+ var selected;
+ inspected[dataType] = true;
+ jQuery.each(structure[dataType] || [], function (_, prefilterOrFactory) {
+ var dataTypeOrTransport = prefilterOrFactory(options, originalOptions, jqXHR);
+ if (typeof dataTypeOrTransport === "string" && !seekingTransport && !inspected[dataTypeOrTransport]) {
+ options.dataTypes.unshift(dataTypeOrTransport);
+ inspect(dataTypeOrTransport);
+ return false;
+ } else if (seekingTransport) {
+ return !( selected = dataTypeOrTransport );
+ }
+ });
+ return selected;
+ }
+
+ return inspect(options.dataTypes[0]) || !inspected["*"] && inspect("*");
+ }
+
+// A special extend for ajax options
+// that takes "flat" options (not to be deep extended)
+// Fixes #9887
+ function ajaxExtend(target, src) {
+ var deep, key,
+ flatOptions = jQuery.ajaxSettings.flatOptions || {};
+
+ for (key in src) {
+ if (src[key] !== undefined) {
+ ( flatOptions[key] ? target : ( deep || (deep = {}) ) )[key] = src[key];
+ }
+ }
+ if (deep) {
+ jQuery.extend(true, target, deep);
+ }
+
+ return target;
+ }
+
+ jQuery.fn.load = function (url, params, callback) {
+ if (typeof url !== "string" && _load) {
+ return _load.apply(this, arguments);
+ }
+
+ var selector, response, type,
+ self = this,
+ off = url.indexOf(" ");
+
+ if (off >= 0) {
+ selector = url.slice(off, url.length);
+ url = url.slice(0, off);
+ }
+
+ // If it's a function
+ if (jQuery.isFunction(params)) {
+
+ // We assume that it's the callback
+ callback = params;
+ params = undefined;
+
+ // Otherwise, build a param string
+ } else if (params && typeof params === "object") {
+ type = "POST";
+ }
+
+ // If we have elements to modify, make the request
+ if (self.length > 0) {
+ jQuery.ajax({
+ url: url,
+
+ // if "type" variable is undefined, then "GET" method will be used
+ type: type,
+ dataType: "html",
+ data: params
+ }).done(function (responseText) {
+
+ // Save response for use in complete callback
+ response = arguments;
+
+ self.html(selector ?
+
+ // If a selector was specified, locate the right elements in a dummy div
+ // Exclude scripts to avoid IE 'Permission Denied' errors
+ jQuery("<div>").append(jQuery.parseHTML(responseText)).find(selector) :
+
+ // Otherwise use the full result
+ responseText);
+
+ }).complete(callback && function (jqXHR, status) {
+ self.each(callback, response || [jqXHR.responseText, status, jqXHR]);
+ });
+ }
+
+ return this;
+ };
+
+// Attach a bunch of functions for handling common AJAX events
+ jQuery.each(["ajaxStart", "ajaxStop", "ajaxComplete", "ajaxError", "ajaxSuccess", "ajaxSend"], function (i, type) {
+ jQuery.fn[type] = function (fn) {
+ return this.on(type, fn);
+ };
+ });
+
+ jQuery.extend({
+
+ // Counter for holding the number of active queries
+ active: 0,
+
+ // Last-Modified header cache for next request
+ lastModified: {},
+ etag: {},
+
+ ajaxSettings: {
+ url: ajaxLocation,
+ type: "GET",
+ isLocal: rlocalProtocol.test(ajaxLocParts[1]),
+ global: true,
+ processData: true,
+ async: true,
+ contentType: "application/x-www-form-urlencoded; charset=UTF-8",
+ /*
+ timeout: 0,
+ data: null,
+ dataType: null,
+ username: null,
+ password: null,
+ cache: null,
+ throws: false,
+ traditional: false,
+ headers: {},
+ */
+
+ accepts: {
+ "*": allTypes,
+ text: "text/plain",
+ html: "text/html",
+ xml: "application/xml, text/xml",
+ json: "application/json, text/javascript"
+ },
+
+ contents: {
+ xml: /xml/,
+ html: /html/,
+ json: /json/
+ },
+
+ responseFields: {
+ xml: "responseXML",
+ text: "responseText",
+ json: "responseJSON"
+ },
+
+ // Data converters
+ // Keys separate source (or catchall "*") and destination types with a single space
+ converters: {
+
+ // Convert anything to text
+ "* text": String,
+
+ // Text to html (true = no transformation)
+ "text html": true,
+
+ // Evaluate text as a json expression
+ "text json": jQuery.parseJSON,
+
+ // Parse text as xml
+ "text xml": jQuery.parseXML
+ },
+
+ // For options that shouldn't be deep extended:
+ // you can add your own custom options here if
+ // and when you create one that shouldn't be
+ // deep extended (see ajaxExtend)
+ flatOptions: {
+ url: true,
+ context: true
+ }
+ },
+
+ // Creates a full fledged settings object into target
+ // with both ajaxSettings and settings fields.
+ // If target is omitted, writes into ajaxSettings.
+ ajaxSetup: function (target, settings) {
+ return settings ?
+
+ // Building a settings object
+ ajaxExtend(ajaxExtend(target, jQuery.ajaxSettings), settings) :
+
+ // Extending ajaxSettings
+ ajaxExtend(jQuery.ajaxSettings, target);
+ },
+
+ ajaxPrefilter: addToPrefiltersOrTransports(prefilters),
+ ajaxTransport: addToPrefiltersOrTransports(transports),
+
+ // Main method
+ ajax: function (url, options) {
+
+ // If url is an object, simulate pre-1.5 signature
+ if (typeof url === "object") {
+ options = url;
+ url = undefined;
+ }
+
+ // Force options to be an object
+ options = options || {};
+
+ var // Cross-domain detection vars
+ parts,
+ // Loop variable
+ i,
+ // URL without anti-cache param
+ cacheURL,
+ // Response headers as string
+ responseHeadersString,
+ // timeout handle
+ timeoutTimer,
+
+ // To know if global events are to be dispatched
+ fireGlobals,
+
+ transport,
+ // Response headers
+ responseHeaders,
+ // Create the final options object
+ s = jQuery.ajaxSetup({}, options),
+ // Callbacks context
+ callbackContext = s.context || s,
+ // Context for global events is callbackContext if it is a DOM node or jQuery collection
+ globalEventContext = s.context && ( callbackContext.nodeType || callbackContext.jquery ) ?
+ jQuery(callbackContext) :
+ jQuery.event,
+ // Deferreds
+ deferred = jQuery.Deferred(),
+ completeDeferred = jQuery.Callbacks("once memory"),
+ // Status-dependent callbacks
+ statusCode = s.statusCode || {},
+ // Headers (they are sent all at once)
+ requestHeaders = {},
+ requestHeadersNames = {},
+ // The jqXHR state
+ state = 0,
+ // Default abort message
+ strAbort = "canceled",
+ // Fake xhr
+ jqXHR = {
+ readyState: 0,
+
+ // Builds headers hashtable if needed
+ getResponseHeader: function (key) {
+ var match;
+ if (state === 2) {
+ if (!responseHeaders) {
+ responseHeaders = {};
+ while ((match = rheaders.exec(responseHeadersString))) {
+ responseHeaders[match[1].toLowerCase()] = match[2];
+ }
+ }
+ match = responseHeaders[key.toLowerCase()];
+ }
+ return match == null ? null : match;
+ },
+
+ // Raw string
+ getAllResponseHeaders: function () {
+ return state === 2 ? responseHeadersString : null;
+ },
+
+ // Caches the header
+ setRequestHeader: function (name, value) {
+ var lname = name.toLowerCase();
+ if (!state) {
+ name = requestHeadersNames[lname] = requestHeadersNames[lname] || name;
+ requestHeaders[name] = value;
+ }
+ return this;
+ },
+
+ // Overrides response content-type header
+ overrideMimeType: function (type) {
+ if (!state) {
+ s.mimeType = type;
+ }
+ return this;
+ },
+
+ // Status-dependent callbacks
+ statusCode: function (map) {
+ var code;
+ if (map) {
+ if (state < 2) {
+ for (code in map) {
+ // Lazy-add the new callback in a way that preserves old ones
+ statusCode[code] = [statusCode[code], map[code]];
+ }
+ } else {
+ // Execute the appropriate callbacks
+ jqXHR.always(map[jqXHR.status]);
+ }
+ }
+ return this;
+ },
+
+ // Cancel the request
+ abort: function (statusText) {
+ var finalText = statusText || strAbort;
+ if (transport) {
+ transport.abort(finalText);
+ }
+ done(0, finalText);
+ return this;
+ }
+ };
+
+ // Attach deferreds
+ deferred.promise(jqXHR).complete = completeDeferred.add;
+ jqXHR.success = jqXHR.done;
+ jqXHR.error = jqXHR.fail;
+
+ // Remove hash character (#7531: and string promotion)
+ // Add protocol if not provided (#5866: IE7 issue with protocol-less urls)
+ // Handle falsy url in the settings object (#10093: consistency with old signature)
+ // We also use the url parameter if available
+ s.url = ( ( url || s.url || ajaxLocation ) + "" ).replace(rhash, "").replace(rprotocol, ajaxLocParts[1] + "//");
+
+ // Alias method option to type as per ticket #12004
+ s.type = options.method || options.type || s.method || s.type;
+
+ // Extract dataTypes list
+ s.dataTypes = jQuery.trim(s.dataType || "*").toLowerCase().match(core_rnotwhite) || [""];
+
+ // A cross-domain request is in order when we have a protocol:host:port mismatch
+ if (s.crossDomain == null) {
+ parts = rurl.exec(s.url.toLowerCase());
+ s.crossDomain = !!( parts &&
+ ( parts[1] !== ajaxLocParts[1] || parts[2] !== ajaxLocParts[2] ||
+ ( parts[3] || ( parts[1] === "http:" ? "80" : "443" ) ) !==
+ ( ajaxLocParts[3] || ( ajaxLocParts[1] === "http:" ? "80" : "443" ) ) )
+ );
+ }
+
+ // Convert data if not already a string
+ if (s.data && s.processData && typeof s.data !== "string") {
+ s.data = jQuery.param(s.data, s.traditional);
+ }
+
+ // Apply prefilters
+ inspectPrefiltersOrTransports(prefilters, s, options, jqXHR);
+
+ // If request was aborted inside a prefilter, stop there
+ if (state === 2) {
+ return jqXHR;
+ }
+
+ // We can fire global events as of now if asked to
+ fireGlobals = s.global;
+
+ // Watch for a new set of requests
+ if (fireGlobals && jQuery.active++ === 0) {
+ jQuery.event.trigger("ajaxStart");
+ }
+
+ // Uppercase the type
+ s.type = s.type.toUpperCase();
+
+ // Determine if request has content
+ s.hasContent = !rnoContent.test(s.type);
+
+ // Save the URL in case we're toying with the If-Modified-Since
+ // and/or If-None-Match header later on
+ cacheURL = s.url;
+
+ // More options handling for requests with no content
+ if (!s.hasContent) {
+
+ // If data is available, append data to url
+ if (s.data) {
+ cacheURL = ( s.url += ( ajax_rquery.test(cacheURL) ? "&" : "?" ) + s.data );
+ // #9682: remove data so that it's not used in an eventual retry
+ delete s.data;
+ }
+
+ // Add anti-cache in url if needed
+ if (s.cache === false) {
+ s.url = rts.test(cacheURL) ?
+
+ // If there is already a '_' parameter, set its value
+ cacheURL.replace(rts, "$1_=" + ajax_nonce++) :
+
+ // Otherwise add one to the end
+ cacheURL + ( ajax_rquery.test(cacheURL) ? "&" : "?" ) + "_=" + ajax_nonce++;
+ }
+ }
+
+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+ if (s.ifModified) {
+ if (jQuery.lastModified[cacheURL]) {
+ jqXHR.setRequestHeader("If-Modified-Since", jQuery.lastModified[cacheURL]);
+ }
+ if (jQuery.etag[cacheURL]) {
+ jqXHR.setRequestHeader("If-None-Match", jQuery.etag[cacheURL]);
+ }
+ }
+
+ // Set the correct header, if data is being sent
+ if (s.data && s.hasContent && s.contentType !== false || options.contentType) {
+ jqXHR.setRequestHeader("Content-Type", s.contentType);
+ }
+
+ // Set the Accepts header for the server, depending on the dataType
+ jqXHR.setRequestHeader(
+ "Accept",
+ s.dataTypes[0] && s.accepts[s.dataTypes[0]] ?
+ s.accepts[s.dataTypes[0]] + ( s.dataTypes[0] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) :
+ s.accepts["*"]
+ );
+
+ // Check for headers option
+ for (i in s.headers) {
+ jqXHR.setRequestHeader(i, s.headers[i]);
+ }
+
+ // Allow custom headers/mimetypes and early abort
+ if (s.beforeSend && ( s.beforeSend.call(callbackContext, jqXHR, s) === false || state === 2 )) {
+ // Abort if not done already and return
+ return jqXHR.abort();
+ }
+
+ // aborting is no longer a cancellation
+ strAbort = "abort";
+
+ // Install callbacks on deferreds
+ for (i in {success: 1, error: 1, complete: 1}) {
+ jqXHR[i](s[i]);
+ }
+
+ // Get transport
+ transport = inspectPrefiltersOrTransports(transports, s, options, jqXHR);
+
+ // If no transport, we auto-abort
+ if (!transport) {
+ done(-1, "No Transport");
+ } else {
+ jqXHR.readyState = 1;
+
+ // Send global event
+ if (fireGlobals) {
+ globalEventContext.trigger("ajaxSend", [jqXHR, s]);
+ }
+ // Timeout
+ if (s.async && s.timeout > 0) {
+ timeoutTimer = setTimeout(function () {
+ jqXHR.abort("timeout");
+ }, s.timeout);
+ }
+
+ try {
+ state = 1;
+ transport.send(requestHeaders, done);
+ } catch (e) {
+ // Propagate exception as error if not done
+ if (state < 2) {
+ done(-1, e);
+ // Simply rethrow otherwise
+ } else {
+ throw e;
+ }
+ }
+ }
+
+ // Callback for when everything is done
+ function done(status, nativeStatusText, responses, headers) {
+ var isSuccess, success, error, response, modified,
+ statusText = nativeStatusText;
+
+ // Called once
+ if (state === 2) {
+ return;
+ }
+
+ // State is "done" now
+ state = 2;
+
+ // Clear timeout if it exists
+ if (timeoutTimer) {
+ clearTimeout(timeoutTimer);
+ }
+
+ // Dereference transport for early garbage collection
+ // (no matter how long the jqXHR object will be used)
+ transport = undefined;
+
+ // Cache response headers
+ responseHeadersString = headers || "";
+
+ // Set readyState
+ jqXHR.readyState = status > 0 ? 4 : 0;
+
+ // Determine if successful
+ isSuccess = status >= 200 && status < 300 || status === 304;
+
+ // Get response data
+ if (responses) {
+ response = ajaxHandleResponses(s, jqXHR, responses);
+ }
+
+ // Convert no matter what (that way responseXXX fields are always set)
+ response = ajaxConvert(s, response, jqXHR, isSuccess);
+
+ // If successful, handle type chaining
+ if (isSuccess) {
+
+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+ if (s.ifModified) {
+ modified = jqXHR.getResponseHeader("Last-Modified");
+ if (modified) {
+ jQuery.lastModified[cacheURL] = modified;
+ }
+ modified = jqXHR.getResponseHeader("etag");
+ if (modified) {
+ jQuery.etag[cacheURL] = modified;
+ }
+ }
+
+ // if no content
+ if (status === 204 || s.type === "HEAD") {
+ statusText = "nocontent";
+
+ // if not modified
+ } else if (status === 304) {
+ statusText = "notmodified";
+
+ // If we have data, let's convert it
+ } else {
+ statusText = response.state;
+ success = response.data;
+ error = response.error;
+ isSuccess = !error;
+ }
+ } else {
+ // We extract error from statusText
+ // then normalize statusText and status for non-aborts
+ error = statusText;
+ if (status || !statusText) {
+ statusText = "error";
+ if (status < 0) {
+ status = 0;
+ }
+ }
+ }
+
+ // Set data for the fake xhr object
+ jqXHR.status = status;
+ jqXHR.statusText = ( nativeStatusText || statusText ) + "";
+
+ // Success/Error
+ if (isSuccess) {
+ deferred.resolveWith(callbackContext, [success, statusText, jqXHR]);
+ } else {
+ deferred.rejectWith(callbackContext, [jqXHR, statusText, error]);
+ }
+
+ // Status-dependent callbacks
+ jqXHR.statusCode(statusCode);
+ statusCode = undefined;
+
+ if (fireGlobals) {
+ globalEventContext.trigger(isSuccess ? "ajaxSuccess" : "ajaxError",
+ [jqXHR, s, isSuccess ? success : error]);
+ }
+
+ // Complete
+ completeDeferred.fireWith(callbackContext, [jqXHR, statusText]);
+
+ if (fireGlobals) {
+ globalEventContext.trigger("ajaxComplete", [jqXHR, s]);
+ // Handle the global AJAX counter
+ if (!( --jQuery.active )) {
+ jQuery.event.trigger("ajaxStop");
+ }
+ }
+ }
+
+ return jqXHR;
+ },
+
+ getJSON: function (url, data, callback) {
+ return jQuery.get(url, data, callback, "json");
+ },
+
+ getScript: function (url, callback) {
+ return jQuery.get(url, undefined, callback, "script");
+ }
+ });
+
+ jQuery.each(["get", "post"], function (i, method) {
+ jQuery[method] = function (url, data, callback, type) {
+ // shift arguments if data argument was omitted
+ if (jQuery.isFunction(data)) {
+ type = type || callback;
+ callback = data;
+ data = undefined;
+ }
+
+ return jQuery.ajax({
+ url: url,
+ type: method,
+ dataType: type,
+ data: data,
+ success: callback
+ });
+ };
+ });
+
+ /* Handles responses to an ajax request:
+ * - finds the right dataType (mediates between content-type and expected dataType)
+ * - returns the corresponding response
+ */
+ function ajaxHandleResponses(s, jqXHR, responses) {
+ var firstDataType, ct, finalDataType, type,
+ contents = s.contents,
+ dataTypes = s.dataTypes;
+
+ // Remove auto dataType and get content-type in the process
+ while (dataTypes[0] === "*") {
+ dataTypes.shift();
+ if (ct === undefined) {
+ ct = s.mimeType || jqXHR.getResponseHeader("Content-Type");
+ }
+ }
+
+ // Check if we're dealing with a known content-type
+ if (ct) {
+ for (type in contents) {
+ if (contents[type] && contents[type].test(ct)) {
+ dataTypes.unshift(type);
+ break;
+ }
+ }
+ }
+
+ // Check to see if we have a response for the expected dataType
+ if (dataTypes[0] in responses) {
+ finalDataType = dataTypes[0];
+ } else {
+ // Try convertible dataTypes
+ for (type in responses) {
+ if (!dataTypes[0] || s.converters[type + " " + dataTypes[0]]) {
+ finalDataType = type;
+ break;
+ }
+ if (!firstDataType) {
+ firstDataType = type;
+ }
+ }
+ // Or just use first one
+ finalDataType = finalDataType || firstDataType;
+ }
+
+ // If we found a dataType
+ // We add the dataType to the list if needed
+ // and return the corresponding response
+ if (finalDataType) {
+ if (finalDataType !== dataTypes[0]) {
+ dataTypes.unshift(finalDataType);
+ }
+ return responses[finalDataType];
+ }
+ }
+
+ /* Chain conversions given the request and the original response
+ * Also sets the responseXXX fields on the jqXHR instance
+ */
+ function ajaxConvert(s, response, jqXHR, isSuccess) {
+ var conv2, current, conv, tmp, prev,
+ converters = {},
+ // Work with a copy of dataTypes in case we need to modify it for conversion
+ dataTypes = s.dataTypes.slice();
+
+ // Create converters map with lowercased keys
+ if (dataTypes[1]) {
+ for (conv in s.converters) {
+ converters[conv.toLowerCase()] = s.converters[conv];
+ }
+ }
+
+ current = dataTypes.shift();
+
+ // Convert to each sequential dataType
+ while (current) {
+
+ if (s.responseFields[current]) {
+ jqXHR[s.responseFields[current]] = response;
+ }
+
+ // Apply the dataFilter if provided
+ if (!prev && isSuccess && s.dataFilter) {
+ response = s.dataFilter(response, s.dataType);
+ }
+
+ prev = current;
+ current = dataTypes.shift();
+
+ if (current) {
+
+ // There's only work to do if current dataType is non-auto
+ if (current === "*") {
+
+ current = prev;
+
+ // Convert response if prev dataType is non-auto and differs from current
+ } else if (prev !== "*" && prev !== current) {
+
+ // Seek a direct converter
+ conv = converters[prev + " " + current] || converters["* " + current];
+
+ // If none found, seek a pair
+ if (!conv) {
+ for (conv2 in converters) {
+
+ // If conv2 outputs current
+ tmp = conv2.split(" ");
+ if (tmp[1] === current) {
+
+ // If prev can be converted to accepted input
+ conv = converters[prev + " " + tmp[0]] ||
+ converters["* " + tmp[0]];
+ if (conv) {
+ // Condense equivalence converters
+ if (conv === true) {
+ conv = converters[conv2];
+
+ // Otherwise, insert the intermediate dataType
+ } else if (converters[conv2] !== true) {
+ current = tmp[0];
+ dataTypes.unshift(tmp[1]);
+ }
+ break;
+ }
+ }
+ }
+ }
+
+ // Apply converter (if not an equivalence)
+ if (conv !== true) {
+
+ // Unless errors are allowed to bubble, catch and return them
+ if (conv && s["throws"]) {
+ response = conv(response);
+ } else {
+ try {
+ response = conv(response);
+ } catch (e) {
+ return {
+ state: "parsererror",
+ error: conv ? e : "No conversion from " + prev + " to " + current
+ };
+ }
+ }
+ }
+ }
+ }
+ }
+
+ return {state: "success", data: response};
+ }
+
+// Install script dataType
+ jQuery.ajaxSetup({
+ accepts: {
+ script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"
+ },
+ contents: {
+ script: /(?:java|ecma)script/
+ },
+ converters: {
+ "text script": function (text) {
+ jQuery.globalEval(text);
+ return text;
+ }
+ }
+ });
+
+// Handle cache's special case and global
+ jQuery.ajaxPrefilter("script", function (s) {
+ if (s.cache === undefined) {
+ s.cache = false;
+ }
+ if (s.crossDomain) {
+ s.type = "GET";
+ s.global = false;
+ }
+ });
+
+// Bind script tag hack transport
+ jQuery.ajaxTransport("script", function (s) {
+
+ // This transport only deals with cross domain requests
+ if (s.crossDomain) {
+
+ var script,
+ head = document.head || jQuery("head")[0] || document.documentElement;
+
+ return {
+
+ send: function (_, callback) {
+
+ script = document.createElement("script");
+
+ script.async = true;
+
+ if (s.scriptCharset) {
+ script.charset = s.scriptCharset;
+ }
+
+ script.src = s.url;
+
+ // Attach handlers for all browsers
+ script.onload = script.onreadystatechange = function (_, isAbort) {
+
+ if (isAbort || !script.readyState || /loaded|complete/.test(script.readyState)) {
+
+ // Handle memory leak in IE
+ script.onload = script.onreadystatechange = null;
+
+ // Remove the script
+ if (script.parentNode) {
+ script.parentNode.removeChild(script);
+ }
+
+ // Dereference the script
+ script = null;
+
+ // Callback if not abort
+ if (!isAbort) {
+ callback(200, "success");
+ }
+ }
+ };
+
+ // Circumvent IE6 bugs with base elements (#2709 and #4378) by prepending
+ // Use native DOM manipulation to avoid our domManip AJAX trickery
+ head.insertBefore(script, head.firstChild);
+ },
+
+ abort: function () {
+ if (script) {
+ script.onload(undefined, true);
+ }
+ }
+ };
+ }
+ });
+ var oldCallbacks = [],
+ rjsonp = /(=)\?(?=&|$)|\?\?/;
+
+// Default jsonp settings
+ jQuery.ajaxSetup({
+ jsonp: "callback",
+ jsonpCallback: function () {
+ var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( ajax_nonce++ ) );
+ this[callback] = true;
+ return callback;
+ }
+ });
+
+// Detect, normalize options and install callbacks for jsonp requests
+ jQuery.ajaxPrefilter("json jsonp", function (s, originalSettings, jqXHR) {
+
+ var callbackName, overwritten, responseContainer,
+ jsonProp = s.jsonp !== false && ( rjsonp.test(s.url) ?
+ "url" :
+ typeof s.data === "string" && !( s.contentType || "" ).indexOf("application/x-www-form-urlencoded") && rjsonp.test(s.data) && "data"
+ );
+
+ // Handle iff the expected data type is "jsonp" or we have a parameter to set
+ if (jsonProp || s.dataTypes[0] === "jsonp") {
+
+ // Get callback name, remembering preexisting value associated with it
+ callbackName = s.jsonpCallback = jQuery.isFunction(s.jsonpCallback) ?
+ s.jsonpCallback() :
+ s.jsonpCallback;
+
+ // Insert callback into url or form data
+ if (jsonProp) {
+ s[jsonProp] = s[jsonProp].replace(rjsonp, "$1" + callbackName);
+ } else if (s.jsonp !== false) {
+ s.url += ( ajax_rquery.test(s.url) ? "&" : "?" ) + s.jsonp + "=" + callbackName;
+ }
+
+ // Use data converter to retrieve json after script execution
+ s.converters["script json"] = function () {
+ if (!responseContainer) {
+ jQuery.error(callbackName + " was not called");
+ }
+ return responseContainer[0];
+ };
+
+ // force json dataType
+ s.dataTypes[0] = "json";
+
+ // Install callback
+ overwritten = window[callbackName];
+ window[callbackName] = function () {
+ responseContainer = arguments;
+ };
+
+ // Clean-up function (fires after converters)
+ jqXHR.always(function () {
+ // Restore preexisting value
+ window[callbackName] = overwritten;
+
+ // Save back as free
+ if (s[callbackName]) {
+ // make sure that re-using the options doesn't screw things around
+ s.jsonpCallback = originalSettings.jsonpCallback;
+
+ // save the callback name for future use
+ oldCallbacks.push(callbackName);
+ }
+
+ // Call if it was a function and we have a response
+ if (responseContainer && jQuery.isFunction(overwritten)) {
+ overwritten(responseContainer[0]);
+ }
+
+ responseContainer = overwritten = undefined;
+ });
+
+ // Delegate to script
+ return "script";
+ }
+ });
+ var xhrCallbacks, xhrSupported,
+ xhrId = 0,
+ // #5280: Internet Explorer will keep connections alive if we don't abort on unload
+ xhrOnUnloadAbort = window.ActiveXObject && function () {
+ // Abort all pending requests
+ var key;
+ for (key in xhrCallbacks) {
+ xhrCallbacks[key](undefined, true);
+ }
+ };
+
+// Functions to create xhrs
+ function createStandardXHR() {
+ try {
+ return new window.XMLHttpRequest();
+ } catch (e) {
+ }
+ }
+
+ function createActiveXHR() {
+ try {
+ return new window.ActiveXObject("Microsoft.XMLHTTP");
+ } catch (e) {
+ }
+ }
+
+// Create the request object
+// (This is still attached to ajaxSettings for backward compatibility)
+ jQuery.ajaxSettings.xhr = window.ActiveXObject ?
+ /* Microsoft failed to properly
+ * implement the XMLHttpRequest in IE7 (can't request local files),
+ * so we use the ActiveXObject when it is available
+ * Additionally XMLHttpRequest can be disabled in IE7/IE8 so
+ * we need a fallback.
+ */
+ function () {
+ return !this.isLocal && createStandardXHR() || createActiveXHR();
+ } :
+ // For all other browsers, use the standard XMLHttpRequest object
+ createStandardXHR;
+
+// Determine support properties
+ xhrSupported = jQuery.ajaxSettings.xhr();
+ jQuery.support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported );
+ xhrSupported = jQuery.support.ajax = !!xhrSupported;
+
+// Create transport if the browser can provide an xhr
+ if (xhrSupported) {
+
+ jQuery.ajaxTransport(function (s) {
+ // Cross domain only allowed if supported through XMLHttpRequest
+ if (!s.crossDomain || jQuery.support.cors) {
+
+ var callback;
+
+ return {
+ send: function (headers, complete) {
+
+ // Get a new xhr
+ var handle, i,
+ xhr = s.xhr();
+
+ // Open the socket
+ // Passing null username, generates a login popup on Opera (#2865)
+ if (s.username) {
+ xhr.open(s.type, s.url, s.async, s.username, s.password);
+ } else {
+ xhr.open(s.type, s.url, s.async);
+ }
+
+ // Apply custom fields if provided
+ if (s.xhrFields) {
+ for (i in s.xhrFields) {
+ xhr[i] = s.xhrFields[i];
+ }
+ }
+
+ // Override mime type if needed
+ if (s.mimeType && xhr.overrideMimeType) {
+ xhr.overrideMimeType(s.mimeType);
+ }
+
+ // X-Requested-With header
+ // For cross-domain requests, seeing as conditions for a preflight are
+ // akin to a jigsaw puzzle, we simply never set it to be sure.
+ // (it can always be set on a per-request basis or even using ajaxSetup)
+ // For same-domain requests, won't change header if already provided.
+ if (!s.crossDomain && !headers["X-Requested-With"]) {
+ headers["X-Requested-With"] = "XMLHttpRequest";
+ }
+
+ // Need an extra try/catch for cross domain requests in Firefox 3
+ try {
+ for (i in headers) {
+ xhr.setRequestHeader(i, headers[i]);
+ }
+ } catch (err) {
+ }
+
+ // Do send the request
+ // This may raise an exception which is actually
+ // handled in jQuery.ajax (so no try/catch here)
+ xhr.send(( s.hasContent && s.data ) || null);
+
+ // Listener
+ callback = function (_, isAbort) {
+ var status, responseHeaders, statusText, responses;
+
+ // Firefox throws exceptions when accessing properties
+ // of an xhr when a network error occurred
+ // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE)
+ try {
+
+ // Was never called and is aborted or complete
+ if (callback && ( isAbort || xhr.readyState === 4 )) {
+
+ // Only called once
+ callback = undefined;
+
+ // Do not keep as active anymore
+ if (handle) {
+ xhr.onreadystatechange = jQuery.noop;
+ if (xhrOnUnloadAbort) {
+ delete xhrCallbacks[handle];
+ }
+ }
+
+ // If it's an abort
+ if (isAbort) {
+ // Abort it manually if needed
+ if (xhr.readyState !== 4) {
+ xhr.abort();
+ }
+ } else {
+ responses = {};
+ status = xhr.status;
+ responseHeaders = xhr.getAllResponseHeaders();
+
+ // When requesting binary data, IE6-9 will throw an exception
+ // on any attempt to access responseText (#11426)
+ if (typeof xhr.responseText === "string") {
+ responses.text = xhr.responseText;
+ }
+
+ // Firefox throws an exception when accessing
+ // statusText for faulty cross-domain requests
+ try {
+ statusText = xhr.statusText;
+ } catch (e) {
+ // We normalize with Webkit giving an empty statusText
+ statusText = "";
+ }
+
+ // Filter status for non standard behaviors
+
+ // If the request is local and we have data: assume a success
+ // (success with no data won't get notified, that's the best we
+ // can do given current implementations)
+ if (!status && s.isLocal && !s.crossDomain) {
+ status = responses.text ? 200 : 404;
+ // IE - #1450: sometimes returns 1223 when it should be 204
+ } else if (status === 1223) {
+ status = 204;
+ }
+ }
+ }
+ } catch (firefoxAccessException) {
+ if (!isAbort) {
+ complete(-1, firefoxAccessException);
+ }
+ }
+
+ // Call complete if needed
+ if (responses) {
+ complete(status, statusText, responses, responseHeaders);
+ }
+ };
+
+ if (!s.async) {
+ // if we're in sync mode we fire the callback
+ callback();
+ } else if (xhr.readyState === 4) {
+ // (IE6 & IE7) if it's in cache and has been
+ // retrieved directly we need to fire the callback
+ setTimeout(callback);
+ } else {
+ handle = ++xhrId;
+ if (xhrOnUnloadAbort) {
+ // Create the active xhrs callbacks list if needed
+ // and attach the unload handler
+ if (!xhrCallbacks) {
+ xhrCallbacks = {};
+ jQuery(window).unload(xhrOnUnloadAbort);
+ }
+ // Add to list of active xhrs callbacks
+ xhrCallbacks[handle] = callback;
+ }
+ xhr.onreadystatechange = callback;
+ }
+ },
+
+ abort: function () {
+ if (callback) {
+ callback(undefined, true);
+ }
+ }
+ };
+ }
+ });
+ }
+ var fxNow, timerId,
+ rfxtypes = /^(?:toggle|show|hide)$/,
+ rfxnum = new RegExp("^(?:([+-])=|)(" + core_pnum + ")([a-z%]*)$", "i"),
+ rrun = /queueHooks$/,
+ animationPrefilters = [defaultPrefilter],
+ tweeners = {
+ "*": [function (prop, value) {
+ var tween = this.createTween(prop, value),
+ target = tween.cur(),
+ parts = rfxnum.exec(value),
+ unit = parts && parts[3] || ( jQuery.cssNumber[prop] ? "" : "px" ),
+
+ // Starting value computation is required for potential unit mismatches
+ start = ( jQuery.cssNumber[prop] || unit !== "px" && +target ) &&
+ rfxnum.exec(jQuery.css(tween.elem, prop)),
+ scale = 1,
+ maxIterations = 20;
+
+ if (start && start[3] !== unit) {
+ // Trust units reported by jQuery.css
+ unit = unit || start[3];
+
+ // Make sure we update the tween properties later on
+ parts = parts || [];
+
+ // Iteratively approximate from a nonzero starting point
+ start = +target || 1;
+
+ do {
+ // If previous iteration zeroed out, double until we get *something*
+ // Use a string for doubling factor so we don't accidentally see scale as unchanged below
+ scale = scale || ".5";
+
+ // Adjust and apply
+ start = start / scale;
+ jQuery.style(tween.elem, prop, start + unit);
+
+ // Update scale, tolerating zero or NaN from tween.cur()
+ // And breaking the loop if scale is unchanged or perfect, or if we've just had enough
+ } while (scale !== (scale = tween.cur() / target) && scale !== 1 && --maxIterations);
+ }
+
+ // Update tween properties
+ if (parts) {
+ start = tween.start = +start || +target || 0;
+ tween.unit = unit;
+ // If a +=/-= token was provided, we're doing a relative animation
+ tween.end = parts[1] ?
+ start + ( parts[1] + 1 ) * parts[2] :
+ +parts[2];
+ }
+
+ return tween;
+ }]
+ };
+
+// Animations created synchronously will run synchronously
+ function createFxNow() {
+ setTimeout(function () {
+ fxNow = undefined;
+ });
+ return ( fxNow = jQuery.now() );
+ }
+
+ function createTween(value, prop, animation) {
+ var tween,
+ collection = ( tweeners[prop] || [] ).concat(tweeners["*"]),
+ index = 0,
+ length = collection.length;
+ for (; index < length; index++) {
+ if ((tween = collection[index].call(animation, prop, value))) {
+
+ // we're done with this property
+ return tween;
+ }
+ }
+ }
+
+ function Animation(elem, properties, options) {
+ var result,
+ stopped,
+ index = 0,
+ length = animationPrefilters.length,
+ deferred = jQuery.Deferred().always(function () {
+ // don't match elem in the :animated selector
+ delete tick.elem;
+ }),
+ tick = function () {
+ if (stopped) {
+ return false;
+ }
+ var currentTime = fxNow || createFxNow(),
+ remaining = Math.max(0, animation.startTime + animation.duration - currentTime),
+ // archaic crash bug won't allow us to use 1 - ( 0.5 || 0 ) (#12497)
+ temp = remaining / animation.duration || 0,
+ percent = 1 - temp,
+ index = 0,
+ length = animation.tweens.length;
+
+ for (; index < length; index++) {
+ animation.tweens[index].run(percent);
+ }
+
+ deferred.notifyWith(elem, [animation, percent, remaining]);
+
+ if (percent < 1 && length) {
+ return remaining;
+ } else {
+ deferred.resolveWith(elem, [animation]);
+ return false;
+ }
+ },
+ animation = deferred.promise({
+ elem: elem,
+ props: jQuery.extend({}, properties),
+ opts: jQuery.extend(true, {specialEasing: {}}, options),
+ originalProperties: properties,
+ originalOptions: options,
+ startTime: fxNow || createFxNow(),
+ duration: options.duration,
+ tweens: [],
+ createTween: function (prop, end) {
+ var tween = jQuery.Tween(elem, animation.opts, prop, end,
+ animation.opts.specialEasing[prop] || animation.opts.easing);
+ animation.tweens.push(tween);
+ return tween;
+ },
+ stop: function (gotoEnd) {
+ var index = 0,
+ // if we are going to the end, we want to run all the tweens
+ // otherwise we skip this part
+ length = gotoEnd ? animation.tweens.length : 0;
+ if (stopped) {
+ return this;
+ }
+ stopped = true;
+ for (; index < length; index++) {
+ animation.tweens[index].run(1);
+ }
+
+ // resolve when we played the last frame
+ // otherwise, reject
+ if (gotoEnd) {
+ deferred.resolveWith(elem, [animation, gotoEnd]);
+ } else {
+ deferred.rejectWith(elem, [animation, gotoEnd]);
+ }
+ return this;
+ }
+ }),
+ props = animation.props;
+
+ propFilter(props, animation.opts.specialEasing);
+
+ for (; index < length; index++) {
+ result = animationPrefilters[index].call(animation, elem, props, animation.opts);
+ if (result) {
+ return result;
+ }
+ }
+
+ jQuery.map(props, createTween, animation);
+
+ if (jQuery.isFunction(animation.opts.start)) {
+ animation.opts.start.call(elem, animation);
+ }
+
+ jQuery.fx.timer(
+ jQuery.extend(tick, {
+ elem: elem,
+ anim: animation,
+ queue: animation.opts.queue
+ })
+ );
+
+ // attach callbacks from options
+ return animation.progress(animation.opts.progress)
+ .done(animation.opts.done, animation.opts.complete)
+ .fail(animation.opts.fail)
+ .always(animation.opts.always);
+ }
+
+ function propFilter(props, specialEasing) {
+ var index, name, easing, value, hooks;
+
+ // camelCase, specialEasing and expand cssHook pass
+ for (index in props) {
+ name = jQuery.camelCase(index);
+ easing = specialEasing[name];
+ value = props[index];
+ if (jQuery.isArray(value)) {
+ easing = value[1];
+ value = props[index] = value[0];
+ }
+
+ if (index !== name) {
+ props[name] = value;
+ delete props[index];
+ }
+
+ hooks = jQuery.cssHooks[name];
+ if (hooks && "expand" in hooks) {
+ value = hooks.expand(value);
+ delete props[name];
+
+ // not quite $.extend, this wont overwrite keys already present.
+ // also - reusing 'index' from above because we have the correct "name"
+ for (index in value) {
+ if (!( index in props )) {
+ props[index] = value[index];
+ specialEasing[index] = easing;
+ }
+ }
+ } else {
+ specialEasing[name] = easing;
+ }
+ }
+ }
+
+ jQuery.Animation = jQuery.extend(Animation, {
+
+ tweener: function (props, callback) {
+ if (jQuery.isFunction(props)) {
+ callback = props;
+ props = ["*"];
+ } else {
+ props = props.split(" ");
+ }
+
+ var prop,
+ index = 0,
+ length = props.length;
+
+ for (; index < length; index++) {
+ prop = props[index];
+ tweeners[prop] = tweeners[prop] || [];
+ tweeners[prop].unshift(callback);
+ }
+ },
+
+ prefilter: function (callback, prepend) {
+ if (prepend) {
+ animationPrefilters.unshift(callback);
+ } else {
+ animationPrefilters.push(callback);
+ }
+ }
+ });
+
+ function defaultPrefilter(elem, props, opts) {
+ /* jshint validthis: true */
+ var prop, value, toggle, tween, hooks, oldfire,
+ anim = this,
+ orig = {},
+ style = elem.style,
+ hidden = elem.nodeType && isHidden(elem),
+ dataShow = jQuery._data(elem, "fxshow");
+
+ // handle queue: false promises
+ if (!opts.queue) {
+ hooks = jQuery._queueHooks(elem, "fx");
+ if (hooks.unqueued == null) {
+ hooks.unqueued = 0;
+ oldfire = hooks.empty.fire;
+ hooks.empty.fire = function () {
+ if (!hooks.unqueued) {
+ oldfire();
+ }
+ };
+ }
+ hooks.unqueued++;
+
+ anim.always(function () {
+ // doing this makes sure that the complete handler will be called
+ // before this completes
+ anim.always(function () {
+ hooks.unqueued--;
+ if (!jQuery.queue(elem, "fx").length) {
+ hooks.empty.fire();
+ }
+ });
+ });
+ }
+
+ // height/width overflow pass
+ if (elem.nodeType === 1 && ( "height" in props || "width" in props )) {
+ // Make sure that nothing sneaks out
+ // Record all 3 overflow attributes because IE does not
+ // change the overflow attribute when overflowX and
+ // overflowY are set to the same value
+ opts.overflow = [style.overflow, style.overflowX, style.overflowY];
+
+ // Set display property to inline-block for height/width
+ // animations on inline elements that are having width/height animated
+ if (jQuery.css(elem, "display") === "inline" &&
+ jQuery.css(elem, "float") === "none") {
+
+ // inline-level elements accept inline-block;
+ // block-level elements need to be inline with layout
+ if (!jQuery.support.inlineBlockNeedsLayout || css_defaultDisplay(elem.nodeName) === "inline") {
+ style.display = "inline-block";
+
+ } else {
+ style.zoom = 1;
+ }
+ }
+ }
+
+ if (opts.overflow) {
+ style.overflow = "hidden";
+ if (!jQuery.support.shrinkWrapBlocks) {
+ anim.always(function () {
+ style.overflow = opts.overflow[0];
+ style.overflowX = opts.overflow[1];
+ style.overflowY = opts.overflow[2];
+ });
+ }
+ }
+
+
+ // show/hide pass
+ for (prop in props) {
+ value = props[prop];
+ if (rfxtypes.exec(value)) {
+ delete props[prop];
+ toggle = toggle || value === "toggle";
+ if (value === ( hidden ? "hide" : "show" )) {
+ continue;
+ }
+ orig[prop] = dataShow && dataShow[prop] || jQuery.style(elem, prop);
+ }
+ }
+
+ if (!jQuery.isEmptyObject(orig)) {
+ if (dataShow) {
+ if ("hidden" in dataShow) {
+ hidden = dataShow.hidden;
+ }
+ } else {
+ dataShow = jQuery._data(elem, "fxshow", {});
+ }
+
+ // store state if its toggle - enables .stop().toggle() to "reverse"
+ if (toggle) {
+ dataShow.hidden = !hidden;
+ }
+ if (hidden) {
+ jQuery(elem).show();
+ } else {
+ anim.done(function () {
+ jQuery(elem).hide();
+ });
+ }
+ anim.done(function () {
+ var prop;
+ jQuery._removeData(elem, "fxshow");
+ for (prop in orig) {
+ jQuery.style(elem, prop, orig[prop]);
+ }
+ });
+ for (prop in orig) {
+ tween = createTween(hidden ? dataShow[prop] : 0, prop, anim);
+
+ if (!( prop in dataShow )) {
+ dataShow[prop] = tween.start;
+ if (hidden) {
+ tween.end = tween.start;
+ tween.start = prop === "width" || prop === "height" ? 1 : 0;
+ }
+ }
+ }
+ }
+ }
+
+ function Tween(elem, options, prop, end, easing) {
+ return new Tween.prototype.init(elem, options, prop, end, easing);
+ }
+
+ jQuery.Tween = Tween;
+
+ Tween.prototype = {
+ constructor: Tween,
+ init: function (elem, options, prop, end, easing, unit) {
+ this.elem = elem;
+ this.prop = prop;
+ this.easing = easing || "swing";
+ this.options = options;
+ this.start = this.now = this.cur();
+ this.end = end;
+ this.unit = unit || ( jQuery.cssNumber[prop] ? "" : "px" );
+ },
+ cur: function () {
+ var hooks = Tween.propHooks[this.prop];
+
+ return hooks && hooks.get ?
+ hooks.get(this) :
+ Tween.propHooks._default.get(this);
+ },
+ run: function (percent) {
+ var eased,
+ hooks = Tween.propHooks[this.prop];
+
+ if (this.options.duration) {
+ this.pos = eased = jQuery.easing[this.easing](
+ percent, this.options.duration * percent, 0, 1, this.options.duration
+ );
+ } else {
+ this.pos = eased = percent;
+ }
+ this.now = ( this.end - this.start ) * eased + this.start;
+
+ if (this.options.step) {
+ this.options.step.call(this.elem, this.now, this);
+ }
+
+ if (hooks && hooks.set) {
+ hooks.set(this);
+ } else {
+ Tween.propHooks._default.set(this);
+ }
+ return this;
+ }
+ };
+
+ Tween.prototype.init.prototype = Tween.prototype;
+
+ Tween.propHooks = {
+ _default: {
+ get: function (tween) {
+ var result;
+
+ if (tween.elem[tween.prop] != null &&
+ (!tween.elem.style || tween.elem.style[tween.prop] == null)) {
+ return tween.elem[tween.prop];
+ }
+
+ // passing an empty string as a 3rd parameter to .css will automatically
+ // attempt a parseFloat and fallback to a string if the parse fails
+ // so, simple values such as "10px" are parsed to Float.
+ // complex values such as "rotate(1rad)" are returned as is.
+ result = jQuery.css(tween.elem, tween.prop, "");
+ // Empty strings, null, undefined and "auto" are converted to 0.
+ return !result || result === "auto" ? 0 : result;
+ },
+ set: function (tween) {
+ // use step hook for back compat - use cssHook if its there - use .style if its
+ // available and use plain properties where available
+ if (jQuery.fx.step[tween.prop]) {
+ jQuery.fx.step[tween.prop](tween);
+ } else if (tween.elem.style && ( tween.elem.style[jQuery.cssProps[tween.prop]] != null || jQuery.cssHooks[tween.prop] )) {
+ jQuery.style(tween.elem, tween.prop, tween.now + tween.unit);
+ } else {
+ tween.elem[tween.prop] = tween.now;
+ }
+ }
+ }
+ };
+
+// Support: IE <=9
+// Panic based approach to setting things on disconnected nodes
+
+ Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
+ set: function (tween) {
+ if (tween.elem.nodeType && tween.elem.parentNode) {
+ tween.elem[tween.prop] = tween.now;
+ }
+ }
+ };
+
+ jQuery.each(["toggle", "show", "hide"], function (i, name) {
+ var cssFn = jQuery.fn[name];
+ jQuery.fn[name] = function (speed, easing, callback) {
+ return speed == null || typeof speed === "boolean" ?
+ cssFn.apply(this, arguments) :
+ this.animate(genFx(name, true), speed, easing, callback);
+ };
+ });
+
+ jQuery.fn.extend({
+ fadeTo: function (speed, to, easing, callback) {
+
+ // show any hidden elements after setting opacity to 0
+ return this.filter(isHidden).css("opacity", 0).show()
+
+ // animate to the value specified
+ .end().animate({opacity: to}, speed, easing, callback);
+ },
+ animate: function (prop, speed, easing, callback) {
+ var empty = jQuery.isEmptyObject(prop),
+ optall = jQuery.speed(speed, easing, callback),
+ doAnimation = function () {
+ // Operate on a copy of prop so per-property easing won't be lost
+ var anim = Animation(this, jQuery.extend({}, prop), optall);
+
+ // Empty animations, or finishing resolves immediately
+ if (empty || jQuery._data(this, "finish")) {
+ anim.stop(true);
+ }
+ };
+ doAnimation.finish = doAnimation;
+
+ return empty || optall.queue === false ?
+ this.each(doAnimation) :
+ this.queue(optall.queue, doAnimation);
+ },
+ stop: function (type, clearQueue, gotoEnd) {
+ var stopQueue = function (hooks) {
+ var stop = hooks.stop;
+ delete hooks.stop;
+ stop(gotoEnd);
+ };
+
+ if (typeof type !== "string") {
+ gotoEnd = clearQueue;
+ clearQueue = type;
+ type = undefined;
+ }
+ if (clearQueue && type !== false) {
+ this.queue(type || "fx", []);
+ }
+
+ return this.each(function () {
+ var dequeue = true,
+ index = type != null && type + "queueHooks",
+ timers = jQuery.timers,
+ data = jQuery._data(this);
+
+ if (index) {
+ if (data[index] && data[index].stop) {
+ stopQueue(data[index]);
+ }
+ } else {
+ for (index in data) {
+ if (data[index] && data[index].stop && rrun.test(index)) {
+ stopQueue(data[index]);
+ }
+ }
+ }
+
+ for (index = timers.length; index--;) {
+ if (timers[index].elem === this && (type == null || timers[index].queue === type)) {
+ timers[index].anim.stop(gotoEnd);
+ dequeue = false;
+ timers.splice(index, 1);
+ }
+ }
+
+ // start the next in the queue if the last step wasn't forced
+ // timers currently will call their complete callbacks, which will dequeue
+ // but only if they were gotoEnd
+ if (dequeue || !gotoEnd) {
+ jQuery.dequeue(this, type);
+ }
+ });
+ },
+ finish: function (type) {
+ if (type !== false) {
+ type = type || "fx";
+ }
+ return this.each(function () {
+ var index,
+ data = jQuery._data(this),
+ queue = data[type + "queue"],
+ hooks = data[type + "queueHooks"],
+ timers = jQuery.timers,
+ length = queue ? queue.length : 0;
+
+ // enable finishing flag on private data
+ data.finish = true;
+
+ // empty the queue first
+ jQuery.queue(this, type, []);
+
+ if (hooks && hooks.stop) {
+ hooks.stop.call(this, true);
+ }
+
+ // look for any active animations, and finish them
+ for (index = timers.length; index--;) {
+ if (timers[index].elem === this && timers[index].queue === type) {
+ timers[index].anim.stop(true);
+ timers.splice(index, 1);
+ }
+ }
+
+ // look for any animations in the old queue and finish them
+ for (index = 0; index < length; index++) {
+ if (queue[index] && queue[index].finish) {
+ queue[index].finish.call(this);
+ }
+ }
+
+ // turn off finishing flag
+ delete data.finish;
+ });
+ }
+ });
+
+// Generate parameters to create a standard animation
+ function genFx(type, includeWidth) {
+ var which,
+ attrs = {height: type},
+ i = 0;
+
+ // if we include width, step value is 1 to do all cssExpand values,
+ // if we don't include width, step value is 2 to skip over Left and Right
+ includeWidth = includeWidth ? 1 : 0;
+ for (; i < 4; i += 2 - includeWidth) {
+ which = cssExpand[i];
+ attrs["margin" + which] = attrs["padding" + which] = type;
+ }
+
+ if (includeWidth) {
+ attrs.opacity = attrs.width = type;
+ }
+
+ return attrs;
+ }
+
+// Generate shortcuts for custom animations
+ jQuery.each({
+ slideDown: genFx("show"),
+ slideUp: genFx("hide"),
+ slideToggle: genFx("toggle"),
+ fadeIn: {opacity: "show"},
+ fadeOut: {opacity: "hide"},
+ fadeToggle: {opacity: "toggle"}
+ }, function (name, props) {
+ jQuery.fn[name] = function (speed, easing, callback) {
+ return this.animate(props, speed, easing, callback);
+ };
+ });
+
+ jQuery.speed = function (speed, easing, fn) {
+ var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : {
+ complete: fn || !fn && easing ||
+ jQuery.isFunction(speed) && speed,
+ duration: speed,
+ easing: fn && easing || easing && !jQuery.isFunction(easing) && easing
+ };
+
+ opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
+ opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[opt.duration] : jQuery.fx.speeds._default;
+
+ // normalize opt.queue - true/undefined/null -> "fx"
+ if (opt.queue == null || opt.queue === true) {
+ opt.queue = "fx";
+ }
+
+ // Queueing
+ opt.old = opt.complete;
+
+ opt.complete = function () {
+ if (jQuery.isFunction(opt.old)) {
+ opt.old.call(this);
+ }
+
+ if (opt.queue) {
+ jQuery.dequeue(this, opt.queue);
+ }
+ };
+
+ return opt;
+ };
+
+ jQuery.easing = {
+ linear: function (p) {
+ return p;
+ },
+ swing: function (p) {
+ return 0.5 - Math.cos(p * Math.PI) / 2;
+ }
+ };
+
+ jQuery.timers = [];
+ jQuery.fx = Tween.prototype.init;
+ jQuery.fx.tick = function () {
+ var timer,
+ timers = jQuery.timers,
+ i = 0;
+
+ fxNow = jQuery.now();
+
+ for (; i < timers.length; i++) {
+ timer = timers[i];
+ // Checks the timer has not already been removed
+ if (!timer() && timers[i] === timer) {
+ timers.splice(i--, 1);
+ }
+ }
+
+ if (!timers.length) {
+ jQuery.fx.stop();
+ }
+ fxNow = undefined;
+ };
+
+ jQuery.fx.timer = function (timer) {
+ if (timer() && jQuery.timers.push(timer)) {
+ jQuery.fx.start();
+ }
+ };
+
+ jQuery.fx.interval = 13;
+
+ jQuery.fx.start = function () {
+ if (!timerId) {
+ timerId = setInterval(jQuery.fx.tick, jQuery.fx.interval);
+ }
+ };
+
+ jQuery.fx.stop = function () {
+ clearInterval(timerId);
+ timerId = null;
+ };
+
+ jQuery.fx.speeds = {
+ slow: 600,
+ fast: 200,
+ // Default speed
+ _default: 400
+ };
+
+// Back Compat <1.8 extension point
+ jQuery.fx.step = {};
+
+ if (jQuery.expr && jQuery.expr.filters) {
+ jQuery.expr.filters.animated = function (elem) {
+ return jQuery.grep(jQuery.timers, function (fn) {
+ return elem === fn.elem;
+ }).length;
+ };
+ }
+ jQuery.fn.offset = function (options) {
+ if (arguments.length) {
+ return options === undefined ?
+ this :
+ this.each(function (i) {
+ jQuery.offset.setOffset(this, options, i);
+ });
+ }
+
+ var docElem, win,
+ box = {top: 0, left: 0},
+ elem = this[0],
+ doc = elem && elem.ownerDocument;
+
+ if (!doc) {
+ return;
+ }
+
+ docElem = doc.documentElement;
+
+ // Make sure it's not a disconnected DOM node
+ if (!jQuery.contains(docElem, elem)) {
+ return box;
+ }
+
+ // If we don't have gBCR, just use 0,0 rather than error
+ // BlackBerry 5, iOS 3 (original iPhone)
+ if (typeof elem.getBoundingClientRect !== core_strundefined) {
+ box = elem.getBoundingClientRect();
+ }
+ win = getWindow(doc);
+ return {
+ top: box.top + ( win.pageYOffset || docElem.scrollTop ) - ( docElem.clientTop || 0 ),
+ left: box.left + ( win.pageXOffset || docElem.scrollLeft ) - ( docElem.clientLeft || 0 )
+ };
+ };
+
+ jQuery.offset = {
+
+ setOffset: function (elem, options, i) {
+ var position = jQuery.css(elem, "position");
+
+ // set position first, in-case top/left are set even on static elem
+ if (position === "static") {
+ elem.style.position = "relative";
+ }
+
+ var curElem = jQuery(elem),
+ curOffset = curElem.offset(),
+ curCSSTop = jQuery.css(elem, "top"),
+ curCSSLeft = jQuery.css(elem, "left"),
+ calculatePosition = ( position === "absolute" || position === "fixed" ) && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1,
+ props = {}, curPosition = {}, curTop, curLeft;
+
+ // need to be able to calculate position if either top or left is auto and position is either absolute or fixed
+ if (calculatePosition) {
+ curPosition = curElem.position();
+ curTop = curPosition.top;
+ curLeft = curPosition.left;
+ } else {
+ curTop = parseFloat(curCSSTop) || 0;
+ curLeft = parseFloat(curCSSLeft) || 0;
+ }
+
+ if (jQuery.isFunction(options)) {
+ options = options.call(elem, i, curOffset);
+ }
+
+ if (options.top != null) {
+ props.top = ( options.top - curOffset.top ) + curTop;
+ }
+ if (options.left != null) {
+ props.left = ( options.left - curOffset.left ) + curLeft;
+ }
+
+ if ("using" in options) {
+ options.using.call(elem, props);
+ } else {
+ curElem.css(props);
+ }
+ }
+ };
+
+
+ jQuery.fn.extend({
+
+ position: function () {
+ if (!this[0]) {
+ return;
+ }
+
+ var offsetParent, offset,
+ parentOffset = {top: 0, left: 0},
+ elem = this[0];
+
+ // fixed elements are offset from window (parentOffset = {top:0, left: 0}, because it is it's only offset parent
+ if (jQuery.css(elem, "position") === "fixed") {
+ // we assume that getBoundingClientRect is available when computed position is fixed
+ offset = elem.getBoundingClientRect();
+ } else {
+ // Get *real* offsetParent
+ offsetParent = this.offsetParent();
+
+ // Get correct offsets
+ offset = this.offset();
+ if (!jQuery.nodeName(offsetParent[0], "html")) {
+ parentOffset = offsetParent.offset();
+ }
+
+ // Add offsetParent borders
+ parentOffset.top += jQuery.css(offsetParent[0], "borderTopWidth", true);
+ parentOffset.left += jQuery.css(offsetParent[0], "borderLeftWidth", true);
+ }
+
+ // Subtract parent offsets and element margins
+ // note: when an element has margin: auto the offsetLeft and marginLeft
+ // are the same in Safari causing offset.left to incorrectly be 0
+ return {
+ top: offset.top - parentOffset.top - jQuery.css(elem, "marginTop", true),
+ left: offset.left - parentOffset.left - jQuery.css(elem, "marginLeft", true)
+ };
+ },
+
+ offsetParent: function () {
+ return this.map(function () {
+ var offsetParent = this.offsetParent || docElem;
+ while (offsetParent && ( !jQuery.nodeName(offsetParent, "html") && jQuery.css(offsetParent, "position") === "static" )) {
+ offsetParent = offsetParent.offsetParent;
+ }
+ return offsetParent || docElem;
+ });
+ }
+ });
+
+
+// Create scrollLeft and scrollTop methods
+ jQuery.each({scrollLeft: "pageXOffset", scrollTop: "pageYOffset"}, function (method, prop) {
+ var top = /Y/.test(prop);
+
+ jQuery.fn[method] = function (val) {
+ return jQuery.access(this, function (elem, method, val) {
+ var win = getWindow(elem);
+
+ if (val === undefined) {
+ return win ? (prop in win) ? win[prop] :
+ win.document.documentElement[method] :
+ elem[method];
+ }
+
+ if (win) {
+ win.scrollTo(
+ !top ? val : jQuery(win).scrollLeft(),
+ top ? val : jQuery(win).scrollTop()
+ );
+
+ } else {
+ elem[method] = val;
+ }
+ }, method, val, arguments.length, null);
+ };
+ });
+
+ function getWindow(elem) {
+ return jQuery.isWindow(elem) ?
+ elem :
+ elem.nodeType === 9 ?
+ elem.defaultView || elem.parentWindow :
+ false;
+ }
+
+// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods
+ jQuery.each({Height: "height", Width: "width"}, function (name, type) {
+ jQuery.each({padding: "inner" + name, content: type, "": "outer" + name}, function (defaultExtra, funcName) {
+ // margin is only for outerHeight, outerWidth
+ jQuery.fn[funcName] = function (margin, value) {
+ var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ),
+ extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" );
+
+ return jQuery.access(this, function (elem, type, value) {
+ var doc;
+
+ if (jQuery.isWindow(elem)) {
+ // As of 5/8/2012 this will yield incorrect results for Mobile Safari, but there
+ // isn't a whole lot we can do. See pull request at this URL for discussion:
+ // https://github.com/jquery/jquery/pull/764
+ return elem.document.documentElement["client" + name];
+ }
+
+ // Get document width or height
+ if (elem.nodeType === 9) {
+ doc = elem.documentElement;
+
+ // Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height], whichever is greatest
+ // unfortunately, this causes bug #3838 in IE6/8 only, but there is currently no good, small way to fix it.
+ return Math.max(
+ elem.body["scroll" + name], doc["scroll" + name],
+ elem.body["offset" + name], doc["offset" + name],
+ doc["client" + name]
+ );
+ }
+
+ return value === undefined ?
+ // Get width or height on the element, requesting but not forcing parseFloat
+ jQuery.css(elem, type, extra) :
+
+ // Set width or height on the element
+ jQuery.style(elem, type, value, extra);
+ }, type, chainable ? margin : undefined, chainable, null);
+ };
+ });
+ });
+// Limit scope pollution from any deprecated API
+// (function() {
+
+// The number of elements contained in the matched element set
+ jQuery.fn.size = function () {
+ return this.length;
+ };
+
+ jQuery.fn.andSelf = jQuery.fn.addBack;
+
+// })();
+ if (typeof module === "object" && module && typeof module.exports === "object") {
+ // Expose jQuery as module.exports in loaders that implement the Node
+ // module pattern (including browserify). Do not create the global, since
+ // the user will be storing it themselves locally, and globals are frowned
+ // upon in the Node module world.
+ module.exports = jQuery;
+ } else {
+ // Otherwise expose jQuery to the global object as usual
+ window.jQuery = window.$ = jQuery;
+
+ // Register as a named AMD module, since jQuery can be concatenated with other
+ // files that may use define, but not via a proper concatenation script that
+ // understands anonymous AMD modules. A named AMD is safest and most robust
+ // way to register. Lowercase jquery is used because AMD module names are
+ // derived from file names, and jQuery is normally delivered in a lowercase
+ // file name. Do this after creating the global so that if an AMD module wants
+ // to call noConflict to hide this version of jQuery, it will work.
+ if (typeof define === "function" && define.amd) {
+ define("jquery", [], function () {
+ return jQuery;
+ });
+ }
+ }
+
+})(window);
diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/Thumbs.db b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/Thumbs.db Binary files differnew file mode 100644 index 00000000..db4be920 --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/Thumbs.db diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_diagonals-thick_18_b81900_40x40.png b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_diagonals-thick_18_b81900_40x40.png Binary files differnew file mode 100644 index 00000000..993e5313 --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_diagonals-thick_18_b81900_40x40.png diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_diagonals-thick_20_666666_40x40.png b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_diagonals-thick_20_666666_40x40.png Binary files differnew file mode 100644 index 00000000..1d5a926e --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_diagonals-thick_20_666666_40x40.png diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_flat_10_000000_40x100.png b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_flat_10_000000_40x100.png Binary files differnew file mode 100644 index 00000000..41c12149 --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_flat_10_000000_40x100.png diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_glass_100_f6f6f6_1x400.png b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_glass_100_f6f6f6_1x400.png Binary files differnew file mode 100644 index 00000000..23e558b3 --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_glass_100_f6f6f6_1x400.png diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_glass_100_fdf5ce_1x400.png b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_glass_100_fdf5ce_1x400.png Binary files differnew file mode 100644 index 00000000..fa412f54 --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_glass_100_fdf5ce_1x400.png diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_glass_65_ffffff_1x400.png b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_glass_65_ffffff_1x400.png Binary files differnew file mode 100644 index 00000000..d27cbce9 --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_glass_65_ffffff_1x400.png diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_gloss-wave_35_f6a828_500x100.png b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_gloss-wave_35_f6a828_500x100.png Binary files differnew file mode 100644 index 00000000..5eb316d0 --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_gloss-wave_35_f6a828_500x100.png diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_highlight-soft_100_eeeeee_1x100.png b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_highlight-soft_100_eeeeee_1x100.png Binary files differnew file mode 100644 index 00000000..99fc8beb --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_highlight-soft_100_eeeeee_1x100.png diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_highlight-soft_75_ffe45c_1x100.png b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_highlight-soft_75_ffe45c_1x100.png Binary files differnew file mode 100644 index 00000000..6994a1c6 --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-bg_highlight-soft_75_ffe45c_1x100.png diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-icons_222222_256x240.png b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-icons_222222_256x240.png Binary files differnew file mode 100644 index 00000000..e9c8e16a --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-icons_222222_256x240.png diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-icons_228ef1_256x240.png b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-icons_228ef1_256x240.png Binary files differnew file mode 100644 index 00000000..8d68c543 --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-icons_228ef1_256x240.png diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-icons_ef8c08_256x240.png b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-icons_ef8c08_256x240.png Binary files differnew file mode 100644 index 00000000..18bbfe82 --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-icons_ef8c08_256x240.png diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-icons_ffd27a_256x240.png b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-icons_ffd27a_256x240.png Binary files differnew file mode 100644 index 00000000..4435b497 --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-icons_ffd27a_256x240.png diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-icons_ffffff_256x240.png b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-icons_ffffff_256x240.png Binary files differnew file mode 100644 index 00000000..4d66f596 --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/images/ui-icons_ffffff_256x240.png diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/index.html b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/index.html new file mode 100644 index 00000000..6ce5ce11 --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/index.html @@ -0,0 +1,684 @@ +<!doctype html>
+<html lang="us">
+<head>
+ <meta charset="utf-8">
+ <title>jQuery UI Example Page</title>
+ <link href="jquery-ui.css" rel="stylesheet">
+ <style>
+ body {
+ font: 62.5% "Trebuchet MS", sans-serif;
+ margin: 50px;
+ }
+
+ .demoHeaders {
+ margin-top: 2em;
+ }
+
+ #dialog-link {
+ padding: .4em 1em .4em 20px;
+ text-decoration: none;
+ position: relative;
+ }
+
+ #dialog-link span.ui-icon {
+ margin: 0 5px 0 0;
+ position: absolute;
+ left: .2em;
+ top: 50%;
+ margin-top: -8px;
+ }
+
+ #icons {
+ margin: 0;
+ padding: 0;
+ }
+
+ #icons li {
+ margin: 2px;
+ position: relative;
+ padding: 4px 0;
+ cursor: pointer;
+ float: left;
+ list-style: none;
+ }
+
+ #icons span.ui-icon {
+ float: left;
+ margin: 0 4px;
+ }
+
+ .fakewindowcontain .ui-widget-overlay {
+ position: absolute;
+ }
+
+ select {
+ width: 200px;
+ }
+ </style>
+</head>
+<body>
+
+<h1>Welcome to jQuery UI!</h1>
+
+<div class="ui-widget">
+ <p>This page demonstrates the widgets and theme you selected in Download Builder. Please make sure you are using
+ them with a compatible jQuery version.</p>
+</div>
+
+<h1>YOUR COMPONENTS:</h1>
+
+
+<!-- Accordion -->
+<h2 class="demoHeaders">Accordion</h2>
+
+<div id="accordion">
+ <h3>First</h3>
+
+ <div>Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet.</div>
+ <h3>Second</h3>
+
+ <div>Phasellus mattis tincidunt nibh.</div>
+ <h3>Third</h3>
+
+ <div>Nam dui erat, auctor a, dignissim quis.</div>
+</div>
+
+
+<!-- Autocomplete -->
+<h2 class="demoHeaders">Autocomplete</h2>
+
+<div>
+ <input id="autocomplete" title="type "a"">
+</div>
+
+
+<!-- Button -->
+<h2 class="demoHeaders">Button</h2>
+<button id="button">A button element</button>
+<form style="margin-top: 1em;">
+ <div id="radioset">
+ <input type="radio" id="radio1" name="radio"><label for="radio1">Choice 1</label>
+ <input type="radio" id="radio2" name="radio" checked="checked"><label for="radio2">Choice 2</label>
+ <input type="radio" id="radio3" name="radio"><label for="radio3">Choice 3</label>
+ </div>
+</form>
+
+
+<!-- Tabs -->
+<h2 class="demoHeaders">Tabs</h2>
+
+<div id="tabs">
+ <ul>
+ <li><a href="#tabs-1">First</a></li>
+ <li><a href="#tabs-2">Second</a></li>
+ <li><a href="#tabs-3">Third</a></li>
+ </ul>
+ <div id="tabs-1">Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut
+ labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut
+ aliquip ex ea commodo consequat.
+ </div>
+ <div id="tabs-2">Phasellus mattis tincidunt nibh. Cras orci urna, blandit id, pretium vel, aliquet ornare, felis.
+ Maecenas scelerisque sem non nisl. Fusce sed lorem in enim dictum bibendum.
+ </div>
+ <div id="tabs-3">Nam dui erat, auctor a, dignissim quis, sollicitudin eu, felis. Pellentesque nisi urna, interdum
+ eget, sagittis et, consequat vestibulum, lacus. Mauris porttitor ullamcorper augue.
+ </div>
+</div>
+
+
+<!-- Dialog NOTE: Dialog is not generated by UI in this demo so it can be visually styled in themeroller-->
+<h2 class="demoHeaders">Dialog</h2>
+
+<p><a href="#" id="dialog-link" class="ui-state-default ui-corner-all"><span class="ui-icon ui-icon-newwin"></span>Open
+ Dialog</a></p>
+
+<h2 class="demoHeaders">Overlay and Shadow Classes <em>(not currently used in UI widgets)</em></h2>
+
+<div style="position: relative; width: 96%; height: 200px; padding:1% 2%; overflow:hidden;" class="fakewindowcontain">
+ <p>Lorem ipsum dolor sit amet, Nulla nec tortor. Donec id elit quis purus consectetur consequat. </p>
+
+ <p>Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante.
+ Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi
+ in orci. </p>
+
+ <p>Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam. Nullam feugiat
+ cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo vitae, pharetra
+ mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat. </p>
+
+ <p>Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante.
+ Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi
+ in orci. Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam. </p>
+
+ <p>Nullam feugiat cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo
+ vitae, pharetra mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat. Nam
+ congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante. </p>
+
+ <p>Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi
+ in orci. Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam. Nullam
+ feugiat cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo vitae,
+ pharetra mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat. Nam congue
+ semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. </p>
+
+ <!-- ui-dialog -->
+ <div class="ui-overlay">
+ <div class="ui-widget-overlay"></div>
+ <div class="ui-widget-shadow ui-corner-all"
+ style="width: 302px; height: 152px; position: absolute; left: 50px; top: 30px;"></div>
+ </div>
+ <div style="position: absolute; width: 280px; height: 130px;left: 50px; top: 30px; padding: 10px;"
+ class="ui-widget ui-widget-content ui-corner-all">
+ <div class="ui-dialog-content ui-widget-content" style="background: none; border: 0;">
+ <p>Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et
+ dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip
+ ex ea commodo consequat.</p>
+ </div>
+ </div>
+
+</div>
+
+<!-- ui-dialog -->
+<div id="dialog" title="Dialog Title">
+ <p>Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore
+ magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo
+ consequat.</p>
+</div>
+
+
+<h2 class="demoHeaders">Framework Icons (content color preview)</h2>
+<ul id="icons" class="ui-widget ui-helper-clearfix">
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-n"><span
+ class="ui-icon ui-icon-carat-1-n"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-ne"><span
+ class="ui-icon ui-icon-carat-1-ne"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-e"><span
+ class="ui-icon ui-icon-carat-1-e"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-se"><span
+ class="ui-icon ui-icon-carat-1-se"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-s"><span
+ class="ui-icon ui-icon-carat-1-s"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-sw"><span
+ class="ui-icon ui-icon-carat-1-sw"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-w"><span
+ class="ui-icon ui-icon-carat-1-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-nw"><span
+ class="ui-icon ui-icon-carat-1-nw"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-carat-2-n-s"><span
+ class="ui-icon ui-icon-carat-2-n-s"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-carat-2-e-w"><span
+ class="ui-icon ui-icon-carat-2-e-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-n"><span
+ class="ui-icon ui-icon-triangle-1-n"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-ne"><span
+ class="ui-icon ui-icon-triangle-1-ne"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-e"><span
+ class="ui-icon ui-icon-triangle-1-e"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-se"><span
+ class="ui-icon ui-icon-triangle-1-se"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-s"><span
+ class="ui-icon ui-icon-triangle-1-s"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-sw"><span
+ class="ui-icon ui-icon-triangle-1-sw"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-w"><span
+ class="ui-icon ui-icon-triangle-1-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-nw"><span
+ class="ui-icon ui-icon-triangle-1-nw"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-2-n-s"><span
+ class="ui-icon ui-icon-triangle-2-n-s"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-2-e-w"><span
+ class="ui-icon ui-icon-triangle-2-e-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-n"><span
+ class="ui-icon ui-icon-arrow-1-n"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-ne"><span
+ class="ui-icon ui-icon-arrow-1-ne"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-e"><span
+ class="ui-icon ui-icon-arrow-1-e"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-se"><span
+ class="ui-icon ui-icon-arrow-1-se"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-s"><span
+ class="ui-icon ui-icon-arrow-1-s"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-sw"><span
+ class="ui-icon ui-icon-arrow-1-sw"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-w"><span
+ class="ui-icon ui-icon-arrow-1-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-nw"><span
+ class="ui-icon ui-icon-arrow-1-nw"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-2-n-s"><span
+ class="ui-icon ui-icon-arrow-2-n-s"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-2-ne-sw"><span
+ class="ui-icon ui-icon-arrow-2-ne-sw"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-2-e-w"><span
+ class="ui-icon ui-icon-arrow-2-e-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-2-se-nw"><span
+ class="ui-icon ui-icon-arrow-2-se-nw"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowstop-1-n"><span
+ class="ui-icon ui-icon-arrowstop-1-n"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowstop-1-e"><span
+ class="ui-icon ui-icon-arrowstop-1-e"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowstop-1-s"><span
+ class="ui-icon ui-icon-arrowstop-1-s"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowstop-1-w"><span
+ class="ui-icon ui-icon-arrowstop-1-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-n"><span
+ class="ui-icon ui-icon-arrowthick-1-n"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-ne"><span
+ class="ui-icon ui-icon-arrowthick-1-ne"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-e"><span
+ class="ui-icon ui-icon-arrowthick-1-e"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-se"><span
+ class="ui-icon ui-icon-arrowthick-1-se"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-s"><span
+ class="ui-icon ui-icon-arrowthick-1-s"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-sw"><span
+ class="ui-icon ui-icon-arrowthick-1-sw"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-w"><span
+ class="ui-icon ui-icon-arrowthick-1-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-nw"><span
+ class="ui-icon ui-icon-arrowthick-1-nw"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-2-n-s"><span
+ class="ui-icon ui-icon-arrowthick-2-n-s"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-2-ne-sw"><span
+ class="ui-icon ui-icon-arrowthick-2-ne-sw"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-2-e-w"><span
+ class="ui-icon ui-icon-arrowthick-2-e-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-2-se-nw"><span
+ class="ui-icon ui-icon-arrowthick-2-se-nw"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthickstop-1-n"><span
+ class="ui-icon ui-icon-arrowthickstop-1-n"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthickstop-1-e"><span
+ class="ui-icon ui-icon-arrowthickstop-1-e"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthickstop-1-s"><span
+ class="ui-icon ui-icon-arrowthickstop-1-s"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthickstop-1-w"><span
+ class="ui-icon ui-icon-arrowthickstop-1-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturnthick-1-w"><span
+ class="ui-icon ui-icon-arrowreturnthick-1-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturnthick-1-n"><span
+ class="ui-icon ui-icon-arrowreturnthick-1-n"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturnthick-1-e"><span
+ class="ui-icon ui-icon-arrowreturnthick-1-e"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturnthick-1-s"><span
+ class="ui-icon ui-icon-arrowreturnthick-1-s"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturn-1-w"><span
+ class="ui-icon ui-icon-arrowreturn-1-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturn-1-n"><span
+ class="ui-icon ui-icon-arrowreturn-1-n"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturn-1-e"><span
+ class="ui-icon ui-icon-arrowreturn-1-e"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturn-1-s"><span
+ class="ui-icon ui-icon-arrowreturn-1-s"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowrefresh-1-w"><span
+ class="ui-icon ui-icon-arrowrefresh-1-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowrefresh-1-n"><span
+ class="ui-icon ui-icon-arrowrefresh-1-n"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowrefresh-1-e"><span
+ class="ui-icon ui-icon-arrowrefresh-1-e"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrowrefresh-1-s"><span
+ class="ui-icon ui-icon-arrowrefresh-1-s"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-4"><span class="ui-icon ui-icon-arrow-4"></span>
+ </li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-4-diag"><span
+ class="ui-icon ui-icon-arrow-4-diag"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-extlink"><span class="ui-icon ui-icon-extlink"></span>
+ </li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-newwin"><span class="ui-icon ui-icon-newwin"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-refresh"><span class="ui-icon ui-icon-refresh"></span>
+ </li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-shuffle"><span class="ui-icon ui-icon-shuffle"></span>
+ </li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-transfer-e-w"><span
+ class="ui-icon ui-icon-transfer-e-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-transferthick-e-w"><span
+ class="ui-icon ui-icon-transferthick-e-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-folder-collapsed"><span
+ class="ui-icon ui-icon-folder-collapsed"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-folder-open"><span
+ class="ui-icon ui-icon-folder-open"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-document"><span class="ui-icon ui-icon-document"></span>
+ </li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-document-b"><span
+ class="ui-icon ui-icon-document-b"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-note"><span class="ui-icon ui-icon-note"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-mail-closed"><span
+ class="ui-icon ui-icon-mail-closed"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-mail-open"><span
+ class="ui-icon ui-icon-mail-open"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-suitcase"><span class="ui-icon ui-icon-suitcase"></span>
+ </li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-comment"><span class="ui-icon ui-icon-comment"></span>
+ </li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-person"><span class="ui-icon ui-icon-person"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-print"><span class="ui-icon ui-icon-print"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-trash"><span class="ui-icon ui-icon-trash"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-locked"><span class="ui-icon ui-icon-locked"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-unlocked"><span class="ui-icon ui-icon-unlocked"></span>
+ </li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-bookmark"><span class="ui-icon ui-icon-bookmark"></span>
+ </li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-tag"><span class="ui-icon ui-icon-tag"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-home"><span class="ui-icon ui-icon-home"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-flag"><span class="ui-icon ui-icon-flag"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-calculator"><span
+ class="ui-icon ui-icon-calculator"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-cart"><span class="ui-icon ui-icon-cart"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-pencil"><span class="ui-icon ui-icon-pencil"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-clock"><span class="ui-icon ui-icon-clock"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-disk"><span class="ui-icon ui-icon-disk"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-calendar"><span class="ui-icon ui-icon-calendar"></span>
+ </li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-zoomin"><span class="ui-icon ui-icon-zoomin"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-zoomout"><span class="ui-icon ui-icon-zoomout"></span>
+ </li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-search"><span class="ui-icon ui-icon-search"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-wrench"><span class="ui-icon ui-icon-wrench"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-gear"><span class="ui-icon ui-icon-gear"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-heart"><span class="ui-icon ui-icon-heart"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-star"><span class="ui-icon ui-icon-star"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-link"><span class="ui-icon ui-icon-link"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-cancel"><span class="ui-icon ui-icon-cancel"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-plus"><span class="ui-icon ui-icon-plus"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-plusthick"><span
+ class="ui-icon ui-icon-plusthick"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-minus"><span class="ui-icon ui-icon-minus"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-minusthick"><span
+ class="ui-icon ui-icon-minusthick"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-close"><span class="ui-icon ui-icon-close"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-closethick"><span
+ class="ui-icon ui-icon-closethick"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-key"><span class="ui-icon ui-icon-key"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-lightbulb"><span
+ class="ui-icon ui-icon-lightbulb"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-scissors"><span class="ui-icon ui-icon-scissors"></span>
+ </li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-clipboard"><span
+ class="ui-icon ui-icon-clipboard"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-copy"><span class="ui-icon ui-icon-copy"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-contact"><span class="ui-icon ui-icon-contact"></span>
+ </li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-image"><span class="ui-icon ui-icon-image"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-video"><span class="ui-icon ui-icon-video"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-script"><span class="ui-icon ui-icon-script"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-alert"><span class="ui-icon ui-icon-alert"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-info"><span class="ui-icon ui-icon-info"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-notice"><span class="ui-icon ui-icon-notice"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-help"><span class="ui-icon ui-icon-help"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-check"><span class="ui-icon ui-icon-check"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-bullet"><span class="ui-icon ui-icon-bullet"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-radio-off"><span
+ class="ui-icon ui-icon-radio-off"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-radio-on"><span class="ui-icon ui-icon-radio-on"></span>
+ </li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-pin-w"><span class="ui-icon ui-icon-pin-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-pin-s"><span class="ui-icon ui-icon-pin-s"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-play"><span class="ui-icon ui-icon-play"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-pause"><span class="ui-icon ui-icon-pause"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-seek-next"><span
+ class="ui-icon ui-icon-seek-next"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-seek-prev"><span
+ class="ui-icon ui-icon-seek-prev"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-seek-end"><span class="ui-icon ui-icon-seek-end"></span>
+ </li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-seek-first"><span
+ class="ui-icon ui-icon-seek-first"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-stop"><span class="ui-icon ui-icon-stop"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-eject"><span class="ui-icon ui-icon-eject"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-volume-off"><span
+ class="ui-icon ui-icon-volume-off"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-volume-on"><span
+ class="ui-icon ui-icon-volume-on"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-power"><span class="ui-icon ui-icon-power"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-signal-diag"><span
+ class="ui-icon ui-icon-signal-diag"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-signal"><span class="ui-icon ui-icon-signal"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-battery-0"><span
+ class="ui-icon ui-icon-battery-0"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-battery-1"><span
+ class="ui-icon ui-icon-battery-1"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-battery-2"><span
+ class="ui-icon ui-icon-battery-2"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-battery-3"><span
+ class="ui-icon ui-icon-battery-3"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-circle-plus"><span
+ class="ui-icon ui-icon-circle-plus"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-circle-minus"><span
+ class="ui-icon ui-icon-circle-minus"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-circle-close"><span
+ class="ui-icon ui-icon-circle-close"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-circle-triangle-e"><span
+ class="ui-icon ui-icon-circle-triangle-e"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-circle-triangle-s"><span
+ class="ui-icon ui-icon-circle-triangle-s"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-circle-triangle-w"><span
+ class="ui-icon ui-icon-circle-triangle-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-circle-triangle-n"><span
+ class="ui-icon ui-icon-circle-triangle-n"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-circle-arrow-e"><span
+ class="ui-icon ui-icon-circle-arrow-e"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-circle-arrow-s"><span
+ class="ui-icon ui-icon-circle-arrow-s"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-circle-arrow-w"><span
+ class="ui-icon ui-icon-circle-arrow-w"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-circle-arrow-n"><span
+ class="ui-icon ui-icon-circle-arrow-n"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-circle-zoomin"><span
+ class="ui-icon ui-icon-circle-zoomin"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-circle-zoomout"><span
+ class="ui-icon ui-icon-circle-zoomout"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-circle-check"><span
+ class="ui-icon ui-icon-circle-check"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-circlesmall-plus"><span
+ class="ui-icon ui-icon-circlesmall-plus"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-circlesmall-minus"><span
+ class="ui-icon ui-icon-circlesmall-minus"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-circlesmall-close"><span
+ class="ui-icon ui-icon-circlesmall-close"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-squaresmall-plus"><span
+ class="ui-icon ui-icon-squaresmall-plus"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-squaresmall-minus"><span
+ class="ui-icon ui-icon-squaresmall-minus"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-squaresmall-close"><span
+ class="ui-icon ui-icon-squaresmall-close"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-grip-dotted-vertical"><span
+ class="ui-icon ui-icon-grip-dotted-vertical"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-grip-dotted-horizontal"><span
+ class="ui-icon ui-icon-grip-dotted-horizontal"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-grip-solid-vertical"><span
+ class="ui-icon ui-icon-grip-solid-vertical"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-grip-solid-horizontal"><span
+ class="ui-icon ui-icon-grip-solid-horizontal"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-gripsmall-diagonal-se"><span
+ class="ui-icon ui-icon-gripsmall-diagonal-se"></span></li>
+ <li class="ui-state-default ui-corner-all" title=".ui-icon-grip-diagonal-se"><span
+ class="ui-icon ui-icon-grip-diagonal-se"></span></li>
+</ul>
+
+
+<!-- Slider -->
+<h2 class="demoHeaders">Slider</h2>
+
+<div id="slider"></div>
+
+
+<!-- Datepicker -->
+<h2 class="demoHeaders">Datepicker</h2>
+
+<div id="datepicker"></div>
+
+
+<!-- Progressbar -->
+<h2 class="demoHeaders">Progressbar</h2>
+
+<div id="progressbar"></div>
+
+
+<!-- Progressbar -->
+<h2 class="demoHeaders">Selectmenu</h2>
+<select id="selectmenu">
+ <option>Slower</option>
+ <option>Slow</option>
+ <option selected="selected">Medium</option>
+ <option>Fast</option>
+ <option>Faster</option>
+</select>
+
+
+<!-- Spinner -->
+<h2 class="demoHeaders">Spinner</h2>
+<input id="spinner">
+
+
+<!-- Menu -->
+<h2 class="demoHeaders">Menu</h2>
+<ul style="width:100px;" id="menu">
+ <li>Item 1</li>
+ <li>Item 2</li>
+ <li>Item 3
+ <ul>
+ <li>Item 3-1</li>
+ <li>Item 3-2</li>
+ <li>Item 3-3</li>
+ <li>Item 3-4</li>
+ <li>Item 3-5</li>
+ </ul>
+ </li>
+ <li>Item 4</li>
+ <li>Item 5</li>
+</ul>
+
+
+<!-- Tooltip -->
+<h2 class="demoHeaders">Tooltip</h2>
+
+<p id="tooltip">
+ <a href="#" title="That's what this widget is">Tooltips</a> can be attached to any element. When you hover
+ the element with your mouse, the title attribute is displayed in a little box next to the element, just like a
+ native tooltip.
+</p>
+
+
+<!-- Highlight / Error -->
+<h2 class="demoHeaders">Highlight / Error</h2>
+
+<div class="ui-widget">
+ <div class="ui-state-highlight ui-corner-all" style="margin-top: 20px; padding: 0 .7em;">
+ <p><span class="ui-icon ui-icon-info" style="float: left; margin-right: .3em;"></span>
+ <strong>Hey!</strong> Sample ui-state-highlight style.</p>
+ </div>
+</div>
+<br>
+
+<div class="ui-widget">
+ <div class="ui-state-error ui-corner-all" style="padding: 0 .7em;">
+ <p><span class="ui-icon ui-icon-alert" style="float: left; margin-right: .3em;"></span>
+ <strong>Alert:</strong> Sample ui-state-error style.</p>
+ </div>
+</div>
+
+<script src="external/jquery/jquery.js"></script>
+<script src="jquery-ui.js"></script>
+<script>
+
+ $("#accordion").accordion();
+
+
+ var availableTags = [
+ "ActionScript",
+ "AppleScript",
+ "Asp",
+ "BASIC",
+ "C",
+ "C++",
+ "Clojure",
+ "COBOL",
+ "ColdFusion",
+ "Erlang",
+ "Fortran",
+ "Groovy",
+ "Haskell",
+ "Java",
+ "JavaScript",
+ "Lisp",
+ "Perl",
+ "PHP",
+ "Python",
+ "Ruby",
+ "Scala",
+ "Scheme"
+ ];
+ $("#autocomplete").autocomplete({
+ source: availableTags
+ });
+
+
+ $("#button").button();
+ $("#radioset").buttonset();
+
+
+ $("#tabs").tabs();
+
+
+ $("#dialog").dialog({
+ autoOpen: false,
+ width: 400,
+ buttons: [
+ {
+ text: "Ok",
+ click: function () {
+ $(this).dialog("close");
+ }
+ },
+ {
+ text: "Cancel",
+ click: function () {
+ $(this).dialog("close");
+ }
+ }
+ ]
+ });
+
+ // Link to open the dialog
+ $("#dialog-link").click(function (event) {
+ $("#dialog").dialog("open");
+ event.preventDefault();
+ });
+
+
+ $("#datepicker").datepicker({
+ inline: true
+ });
+
+
+ $("#slider").slider({
+ range: true,
+ values: [17, 67]
+ });
+
+
+ $("#progressbar").progressbar({
+ value: 20
+ });
+
+
+ $("#spinner").spinner();
+
+
+ $("#menu").menu();
+
+
+ $("#tooltip").tooltip();
+
+
+ $("#selectmenu").selectmenu();
+
+
+ // Hover states on the static widgets
+ $("#dialog-link, #icons li").hover(
+ function () {
+ $(this).addClass("ui-state-hover");
+ },
+ function () {
+ $(this).removeClass("ui-state-hover");
+ }
+ );
+</script>
+</body>
+</html>
diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.css b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.css new file mode 100644 index 00000000..c7ec789e --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.css @@ -0,0 +1,1908 @@ +/*! jQuery UI - v1.11.4 - 2015-04-16
+* http://jqueryui.com
+* Includes: core.css, draggable.css, resizable.css, selectable.css, sortable.css, accordion.css, autocomplete.css, button.css, datepicker.css, dialog.css, menu.css, progressbar.css, selectmenu.css, slider.css, spinner.css, tabs.css, tooltip.css, theme.css
+* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS%2CTahoma%2CVerdana%2CArial%2Csans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=gloss_wave&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=highlight_soft&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=glass&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=glass&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=glass&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=highlight_soft&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=diagonals_thick&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=diagonals_thick&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=flat&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px
+* Copyright 2015 jQuery Foundation and other contributors; Licensed MIT */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden {
+ display: none;
+}
+
+.ui-helper-hidden-accessible {
+ border: 0;
+ clip: rect(0 0 0 0);
+ height: 1px;
+ margin: -1px;
+ overflow: hidden;
+ padding: 0;
+ position: absolute;
+ width: 1px;
+}
+
+.ui-helper-reset {
+ margin: 0;
+ padding: 0;
+ border: 0;
+ outline: 0;
+ line-height: 1.3;
+ text-decoration: none;
+ font-size: 100%;
+ list-style: none;
+}
+
+.ui-helper-clearfix:before,
+.ui-helper-clearfix:after {
+ content: "";
+ display: table;
+ border-collapse: collapse;
+}
+
+.ui-helper-clearfix:after {
+ clear: both;
+}
+
+.ui-helper-clearfix {
+ min-height: 0; /* support: IE7 */
+}
+
+.ui-helper-zfix {
+ width: 100%;
+ height: 100%;
+ top: 0;
+ left: 0;
+ position: absolute;
+ opacity: 0;
+ filter: Alpha(Opacity=0); /* support: IE8 */
+}
+
+.ui-front {
+ z-index: 100;
+}
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled {
+ cursor: default !important;
+}
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon {
+ display: block;
+ text-indent: -99999px;
+ overflow: hidden;
+ background-repeat: no-repeat;
+}
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay {
+ position: fixed;
+ top: 0;
+ left: 0;
+ width: 100%;
+ height: 100%;
+}
+
+.ui-draggable-handle {
+ -ms-touch-action: none;
+ touch-action: none;
+}
+
+.ui-resizable {
+ position: relative;
+}
+
+.ui-resizable-handle {
+ position: absolute;
+ font-size: 0.1px;
+ display: block;
+ -ms-touch-action: none;
+ touch-action: none;
+}
+
+.ui-resizable-disabled .ui-resizable-handle,
+.ui-resizable-autohide .ui-resizable-handle {
+ display: none;
+}
+
+.ui-resizable-n {
+ cursor: n-resize;
+ height: 7px;
+ width: 100%;
+ top: -5px;
+ left: 0;
+}
+
+.ui-resizable-s {
+ cursor: s-resize;
+ height: 7px;
+ width: 100%;
+ bottom: -5px;
+ left: 0;
+}
+
+.ui-resizable-e {
+ cursor: e-resize;
+ width: 7px;
+ right: -5px;
+ top: 0;
+ height: 100%;
+}
+
+.ui-resizable-w {
+ cursor: w-resize;
+ width: 7px;
+ left: -5px;
+ top: 0;
+ height: 100%;
+}
+
+.ui-resizable-se {
+ cursor: se-resize;
+ width: 12px;
+ height: 12px;
+ right: 1px;
+ bottom: 1px;
+}
+
+.ui-resizable-sw {
+ cursor: sw-resize;
+ width: 9px;
+ height: 9px;
+ left: -5px;
+ bottom: -5px;
+}
+
+.ui-resizable-nw {
+ cursor: nw-resize;
+ width: 9px;
+ height: 9px;
+ left: -5px;
+ top: -5px;
+}
+
+.ui-resizable-ne {
+ cursor: ne-resize;
+ width: 9px;
+ height: 9px;
+ right: -5px;
+ top: -5px;
+}
+
+.ui-selectable {
+ -ms-touch-action: none;
+ touch-action: none;
+}
+
+.ui-selectable-helper {
+ position: absolute;
+ z-index: 100;
+ border: 1px dotted black;
+}
+
+.ui-sortable-handle {
+ -ms-touch-action: none;
+ touch-action: none;
+}
+
+.ui-accordion .ui-accordion-header {
+ display: block;
+ cursor: pointer;
+ position: relative;
+ margin: 2px 0 0 0;
+ padding: .5em .5em .5em .7em;
+ min-height: 0; /* support: IE7 */
+ font-size: 100%;
+}
+
+.ui-accordion .ui-accordion-icons {
+ padding-left: 2.2em;
+}
+
+.ui-accordion .ui-accordion-icons .ui-accordion-icons {
+ padding-left: 2.2em;
+}
+
+.ui-accordion .ui-accordion-header .ui-accordion-header-icon {
+ position: absolute;
+ left: .5em;
+ top: 50%;
+ margin-top: -8px;
+}
+
+.ui-accordion .ui-accordion-content {
+ padding: 1em 2.2em;
+ border-top: 0;
+ overflow: auto;
+}
+
+.ui-autocomplete {
+ position: absolute;
+ top: 0;
+ left: 0;
+ cursor: default;
+}
+
+.ui-button {
+ display: inline-block;
+ position: relative;
+ padding: 0;
+ line-height: normal;
+ margin-right: .1em;
+ cursor: pointer;
+ vertical-align: middle;
+ text-align: center;
+ overflow: visible; /* removes extra width in IE */
+}
+
+.ui-button,
+.ui-button:link,
+.ui-button:visited,
+.ui-button:hover,
+.ui-button:active {
+ text-decoration: none;
+}
+
+/* to make room for the icon, a width needs to be set here */
+.ui-button-icon-only {
+ width: 2.2em;
+}
+
+/* button elements seem to need a little more width */
+button.ui-button-icon-only {
+ width: 2.4em;
+}
+
+.ui-button-icons-only {
+ width: 3.4em;
+}
+
+button.ui-button-icons-only {
+ width: 3.7em;
+}
+
+/* button text element */
+.ui-button .ui-button-text {
+ display: block;
+ line-height: normal;
+}
+
+.ui-button-text-only .ui-button-text {
+ padding: .4em 1em;
+}
+
+.ui-button-icon-only .ui-button-text,
+.ui-button-icons-only .ui-button-text {
+ padding: .4em;
+ text-indent: -9999999px;
+}
+
+.ui-button-text-icon-primary .ui-button-text,
+.ui-button-text-icons .ui-button-text {
+ padding: .4em 1em .4em 2.1em;
+}
+
+.ui-button-text-icon-secondary .ui-button-text,
+.ui-button-text-icons .ui-button-text {
+ padding: .4em 2.1em .4em 1em;
+}
+
+.ui-button-text-icons .ui-button-text {
+ padding-left: 2.1em;
+ padding-right: 2.1em;
+}
+
+/* no icon support for input elements, provide padding by default */
+input.ui-button {
+ padding: .4em 1em;
+}
+
+/* button icon element(s) */
+.ui-button-icon-only .ui-icon,
+.ui-button-text-icon-primary .ui-icon,
+.ui-button-text-icon-secondary .ui-icon,
+.ui-button-text-icons .ui-icon,
+.ui-button-icons-only .ui-icon {
+ position: absolute;
+ top: 50%;
+ margin-top: -8px;
+}
+
+.ui-button-icon-only .ui-icon {
+ left: 50%;
+ margin-left: -8px;
+}
+
+.ui-button-text-icon-primary .ui-button-icon-primary,
+.ui-button-text-icons .ui-button-icon-primary,
+.ui-button-icons-only .ui-button-icon-primary {
+ left: .5em;
+}
+
+.ui-button-text-icon-secondary .ui-button-icon-secondary,
+.ui-button-text-icons .ui-button-icon-secondary,
+.ui-button-icons-only .ui-button-icon-secondary {
+ right: .5em;
+}
+
+/* button sets */
+.ui-buttonset {
+ margin-right: 7px;
+}
+
+.ui-buttonset .ui-button {
+ margin-left: 0;
+ margin-right: -.3em;
+}
+
+/* workarounds */
+/* reset extra padding in Firefox, see h5bp.com/l */
+input.ui-button::-moz-focus-inner,
+button.ui-button::-moz-focus-inner {
+ border: 0;
+ padding: 0;
+}
+
+.ui-datepicker {
+ width: 17em;
+ padding: .2em .2em 0;
+ display: none;
+}
+
+.ui-datepicker .ui-datepicker-header {
+ position: relative;
+ padding: .2em 0;
+}
+
+.ui-datepicker .ui-datepicker-prev,
+.ui-datepicker .ui-datepicker-next {
+ position: absolute;
+ top: 2px;
+ width: 1.8em;
+ height: 1.8em;
+}
+
+.ui-datepicker .ui-datepicker-prev-hover,
+.ui-datepicker .ui-datepicker-next-hover {
+ top: 1px;
+}
+
+.ui-datepicker .ui-datepicker-prev {
+ left: 2px;
+}
+
+.ui-datepicker .ui-datepicker-next {
+ right: 2px;
+}
+
+.ui-datepicker .ui-datepicker-prev-hover {
+ left: 1px;
+}
+
+.ui-datepicker .ui-datepicker-next-hover {
+ right: 1px;
+}
+
+.ui-datepicker .ui-datepicker-prev span,
+.ui-datepicker .ui-datepicker-next span {
+ display: block;
+ position: absolute;
+ left: 50%;
+ margin-left: -8px;
+ top: 50%;
+ margin-top: -8px;
+}
+
+.ui-datepicker .ui-datepicker-title {
+ margin: 0 2.3em;
+ line-height: 1.8em;
+ text-align: center;
+}
+
+.ui-datepicker .ui-datepicker-title select {
+ font-size: 1em;
+ margin: 1px 0;
+}
+
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year {
+ width: 45%;
+}
+
+.ui-datepicker table {
+ width: 100%;
+ font-size: .9em;
+ border-collapse: collapse;
+ margin: 0 0 .4em;
+}
+
+.ui-datepicker th {
+ padding: .7em .3em;
+ text-align: center;
+ font-weight: bold;
+ border: 0;
+}
+
+.ui-datepicker td {
+ border: 0;
+ padding: 1px;
+}
+
+.ui-datepicker td span,
+.ui-datepicker td a {
+ display: block;
+ padding: .2em;
+ text-align: right;
+ text-decoration: none;
+}
+
+.ui-datepicker .ui-datepicker-buttonpane {
+ background-image: none;
+ margin: .7em 0 0 0;
+ padding: 0 .2em;
+ border-left: 0;
+ border-right: 0;
+ border-bottom: 0;
+}
+
+.ui-datepicker .ui-datepicker-buttonpane button {
+ float: right;
+ margin: .5em .2em .4em;
+ cursor: pointer;
+ padding: .2em .6em .3em .6em;
+ width: auto;
+ overflow: visible;
+}
+
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current {
+ float: left;
+}
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi {
+ width: auto;
+}
+
+.ui-datepicker-multi .ui-datepicker-group {
+ float: left;
+}
+
+.ui-datepicker-multi .ui-datepicker-group table {
+ width: 95%;
+ margin: 0 auto .4em;
+}
+
+.ui-datepicker-multi-2 .ui-datepicker-group {
+ width: 50%;
+}
+
+.ui-datepicker-multi-3 .ui-datepicker-group {
+ width: 33.3%;
+}
+
+.ui-datepicker-multi-4 .ui-datepicker-group {
+ width: 25%;
+}
+
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header,
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header {
+ border-left-width: 0;
+}
+
+.ui-datepicker-multi .ui-datepicker-buttonpane {
+ clear: left;
+}
+
+.ui-datepicker-row-break {
+ clear: both;
+ width: 100%;
+ font-size: 0;
+}
+
+/* RTL support */
+.ui-datepicker-rtl {
+ direction: rtl;
+}
+
+.ui-datepicker-rtl .ui-datepicker-prev {
+ right: 2px;
+ left: auto;
+}
+
+.ui-datepicker-rtl .ui-datepicker-next {
+ left: 2px;
+ right: auto;
+}
+
+.ui-datepicker-rtl .ui-datepicker-prev:hover {
+ right: 1px;
+ left: auto;
+}
+
+.ui-datepicker-rtl .ui-datepicker-next:hover {
+ left: 1px;
+ right: auto;
+}
+
+.ui-datepicker-rtl .ui-datepicker-buttonpane {
+ clear: right;
+}
+
+.ui-datepicker-rtl .ui-datepicker-buttonpane button {
+ float: left;
+}
+
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current,
+.ui-datepicker-rtl .ui-datepicker-group {
+ float: right;
+}
+
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header,
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header {
+ border-right-width: 0;
+ border-left-width: 1px;
+}
+
+.ui-dialog {
+ overflow: hidden;
+ position: absolute;
+ top: 0;
+ left: 0;
+ padding: .2em;
+ outline: 0;
+}
+
+.ui-dialog .ui-dialog-titlebar {
+ padding: .4em 1em;
+ position: relative;
+}
+
+.ui-dialog .ui-dialog-title {
+ float: left;
+ margin: .1em 0;
+ white-space: nowrap;
+ width: 90%;
+ overflow: hidden;
+ text-overflow: ellipsis;
+}
+
+.ui-dialog .ui-dialog-titlebar-close {
+ position: absolute;
+ right: .3em;
+ top: 50%;
+ width: 20px;
+ margin: -10px 0 0 0;
+ padding: 1px;
+ height: 20px;
+}
+
+.ui-dialog .ui-dialog-content {
+ position: relative;
+ border: 0;
+ padding: .5em 1em;
+ background: none;
+ overflow: auto;
+}
+
+.ui-dialog .ui-dialog-buttonpane {
+ text-align: left;
+ border-width: 1px 0 0 0;
+ background-image: none;
+ margin-top: .5em;
+ padding: .3em 1em .5em .4em;
+}
+
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset {
+ float: right;
+}
+
+.ui-dialog .ui-dialog-buttonpane button {
+ margin: .5em .4em .5em 0;
+ cursor: pointer;
+}
+
+.ui-dialog .ui-resizable-se {
+ width: 12px;
+ height: 12px;
+ right: -5px;
+ bottom: -5px;
+ background-position: 16px 16px;
+}
+
+.ui-draggable .ui-dialog-titlebar {
+ cursor: move;
+}
+
+.ui-menu {
+ list-style: none;
+ padding: 0;
+ margin: 0;
+ display: block;
+ outline: none;
+}
+
+.ui-menu .ui-menu {
+ position: absolute;
+}
+
+.ui-menu .ui-menu-item {
+ position: relative;
+ margin: 0;
+ padding: 3px 1em 3px .4em;
+ cursor: pointer;
+ min-height: 0; /* support: IE7 */
+ /* support: IE10, see #8844 */
+ list-style-image: url("data:image/gif;base64,R0lGODlhAQABAIAAAAAAAP///yH5BAEAAAAALAAAAAABAAEAAAIBRAA7");
+}
+
+.ui-menu .ui-menu-divider {
+ margin: 5px 0;
+ height: 0;
+ font-size: 0;
+ line-height: 0;
+ border-width: 1px 0 0 0;
+}
+
+.ui-menu .ui-state-focus,
+.ui-menu .ui-state-active {
+ margin: -1px;
+}
+
+/* icon support */
+.ui-menu-icons {
+ position: relative;
+}
+
+.ui-menu-icons .ui-menu-item {
+ padding-left: 2em;
+}
+
+/* left-aligned */
+.ui-menu .ui-icon {
+ position: absolute;
+ top: 0;
+ bottom: 0;
+ left: .2em;
+ margin: auto 0;
+}
+
+/* right-aligned */
+.ui-menu .ui-menu-icon {
+ left: auto;
+ right: 0;
+}
+
+.ui-progressbar {
+ height: 2em;
+ text-align: left;
+ overflow: hidden;
+}
+
+.ui-progressbar .ui-progressbar-value {
+ margin: -1px;
+ height: 100%;
+}
+
+.ui-progressbar .ui-progressbar-overlay {
+ background: url("data:image/gif;base64,R0lGODlhKAAoAIABAAAAAP///yH/C05FVFNDQVBFMi4wAwEAAAAh+QQJAQABACwAAAAAKAAoAAACkYwNqXrdC52DS06a7MFZI+4FHBCKoDeWKXqymPqGqxvJrXZbMx7Ttc+w9XgU2FB3lOyQRWET2IFGiU9m1frDVpxZZc6bfHwv4c1YXP6k1Vdy292Fb6UkuvFtXpvWSzA+HycXJHUXiGYIiMg2R6W459gnWGfHNdjIqDWVqemH2ekpObkpOlppWUqZiqr6edqqWQAAIfkECQEAAQAsAAAAACgAKAAAApSMgZnGfaqcg1E2uuzDmmHUBR8Qil95hiPKqWn3aqtLsS18y7G1SzNeowWBENtQd+T1JktP05nzPTdJZlR6vUxNWWjV+vUWhWNkWFwxl9VpZRedYcflIOLafaa28XdsH/ynlcc1uPVDZxQIR0K25+cICCmoqCe5mGhZOfeYSUh5yJcJyrkZWWpaR8doJ2o4NYq62lAAACH5BAkBAAEALAAAAAAoACgAAAKVDI4Yy22ZnINRNqosw0Bv7i1gyHUkFj7oSaWlu3ovC8GxNso5fluz3qLVhBVeT/Lz7ZTHyxL5dDalQWPVOsQWtRnuwXaFTj9jVVh8pma9JjZ4zYSj5ZOyma7uuolffh+IR5aW97cHuBUXKGKXlKjn+DiHWMcYJah4N0lYCMlJOXipGRr5qdgoSTrqWSq6WFl2ypoaUAAAIfkECQEAAQAsAAAAACgAKAAAApaEb6HLgd/iO7FNWtcFWe+ufODGjRfoiJ2akShbueb0wtI50zm02pbvwfWEMWBQ1zKGlLIhskiEPm9R6vRXxV4ZzWT2yHOGpWMyorblKlNp8HmHEb/lCXjcW7bmtXP8Xt229OVWR1fod2eWqNfHuMjXCPkIGNileOiImVmCOEmoSfn3yXlJWmoHGhqp6ilYuWYpmTqKUgAAIfkECQEAAQAsAAAAACgAKAAAApiEH6kb58biQ3FNWtMFWW3eNVcojuFGfqnZqSebuS06w5V80/X02pKe8zFwP6EFWOT1lDFk8rGERh1TTNOocQ61Hm4Xm2VexUHpzjymViHrFbiELsefVrn6XKfnt2Q9G/+Xdie499XHd2g4h7ioOGhXGJboGAnXSBnoBwKYyfioubZJ2Hn0RuRZaflZOil56Zp6iioKSXpUAAAh+QQJAQABACwAAAAAKAAoAAACkoQRqRvnxuI7kU1a1UU5bd5tnSeOZXhmn5lWK3qNTWvRdQxP8qvaC+/yaYQzXO7BMvaUEmJRd3TsiMAgswmNYrSgZdYrTX6tSHGZO73ezuAw2uxuQ+BbeZfMxsexY35+/Qe4J1inV0g4x3WHuMhIl2jXOKT2Q+VU5fgoSUI52VfZyfkJGkha6jmY+aaYdirq+lQAACH5BAkBAAEALAAAAAAoACgAAAKWBIKpYe0L3YNKToqswUlvznigd4wiR4KhZrKt9Upqip61i9E3vMvxRdHlbEFiEXfk9YARYxOZZD6VQ2pUunBmtRXo1Lf8hMVVcNl8JafV38aM2/Fu5V16Bn63r6xt97j09+MXSFi4BniGFae3hzbH9+hYBzkpuUh5aZmHuanZOZgIuvbGiNeomCnaxxap2upaCZsq+1kAACH5BAkBAAEALAAAAAAoACgAAAKXjI8By5zf4kOxTVrXNVlv1X0d8IGZGKLnNpYtm8Lr9cqVeuOSvfOW79D9aDHizNhDJidFZhNydEahOaDH6nomtJjp1tutKoNWkvA6JqfRVLHU/QUfau9l2x7G54d1fl995xcIGAdXqMfBNadoYrhH+Mg2KBlpVpbluCiXmMnZ2Sh4GBqJ+ckIOqqJ6LmKSllZmsoq6wpQAAAh+QQJAQABACwAAAAAKAAoAAAClYx/oLvoxuJDkU1a1YUZbJ59nSd2ZXhWqbRa2/gF8Gu2DY3iqs7yrq+xBYEkYvFSM8aSSObE+ZgRl1BHFZNr7pRCavZ5BW2142hY3AN/zWtsmf12p9XxxFl2lpLn1rseztfXZjdIWIf2s5dItwjYKBgo9yg5pHgzJXTEeGlZuenpyPmpGQoKOWkYmSpaSnqKileI2FAAACH5BAkBAAEALAAAAAAoACgAAAKVjB+gu+jG4kORTVrVhRlsnn2dJ3ZleFaptFrb+CXmO9OozeL5VfP99HvAWhpiUdcwkpBH3825AwYdU8xTqlLGhtCosArKMpvfa1mMRae9VvWZfeB2XfPkeLmm18lUcBj+p5dnN8jXZ3YIGEhYuOUn45aoCDkp16hl5IjYJvjWKcnoGQpqyPlpOhr3aElaqrq56Bq7VAAAOw==");
+ height: 100%;
+ filter: alpha(opacity=25); /* support: IE8 */
+ opacity: 0.25;
+}
+
+.ui-progressbar-indeterminate .ui-progressbar-value {
+ background-image: none;
+}
+
+.ui-selectmenu-menu {
+ padding: 0;
+ margin: 0;
+ position: absolute;
+ top: 0;
+ left: 0;
+ display: none;
+}
+
+.ui-selectmenu-menu .ui-menu {
+ overflow: auto;
+ /* Support: IE7 */
+ overflow-x: hidden;
+ padding-bottom: 1px;
+}
+
+.ui-selectmenu-menu .ui-menu .ui-selectmenu-optgroup {
+ font-size: 1em;
+ font-weight: bold;
+ line-height: 1.5;
+ padding: 2px 0.4em;
+ margin: 0.5em 0 0 0;
+ height: auto;
+ border: 0;
+}
+
+.ui-selectmenu-open {
+ display: block;
+}
+
+.ui-selectmenu-button {
+ display: inline-block;
+ overflow: hidden;
+ position: relative;
+ text-decoration: none;
+ cursor: pointer;
+}
+
+.ui-selectmenu-button span.ui-icon {
+ right: 0.5em;
+ left: auto;
+ margin-top: -8px;
+ position: absolute;
+ top: 50%;
+}
+
+.ui-selectmenu-button span.ui-selectmenu-text {
+ text-align: left;
+ padding: 0.4em 2.1em 0.4em 1em;
+ display: block;
+ line-height: 1.4;
+ overflow: hidden;
+ text-overflow: ellipsis;
+ white-space: nowrap;
+}
+
+.ui-slider {
+ position: relative;
+ text-align: left;
+}
+
+.ui-slider .ui-slider-handle {
+ position: absolute;
+ z-index: 2;
+ width: 1.2em;
+ height: 1.2em;
+ cursor: default;
+ -ms-touch-action: none;
+ touch-action: none;
+}
+
+.ui-slider .ui-slider-range {
+ position: absolute;
+ z-index: 1;
+ font-size: .7em;
+ display: block;
+ border: 0;
+ background-position: 0 0;
+}
+
+/* support: IE8 - See #6727 */
+.ui-slider.ui-state-disabled .ui-slider-handle,
+.ui-slider.ui-state-disabled .ui-slider-range {
+ filter: inherit;
+}
+
+.ui-slider-horizontal {
+ height: .8em;
+}
+
+.ui-slider-horizontal .ui-slider-handle {
+ top: -.3em;
+ margin-left: -.6em;
+}
+
+.ui-slider-horizontal .ui-slider-range {
+ top: 0;
+ height: 100%;
+}
+
+.ui-slider-horizontal .ui-slider-range-min {
+ left: 0;
+}
+
+.ui-slider-horizontal .ui-slider-range-max {
+ right: 0;
+}
+
+.ui-slider-vertical {
+ width: .8em;
+ height: 100px;
+}
+
+.ui-slider-vertical .ui-slider-handle {
+ left: -.3em;
+ margin-left: 0;
+ margin-bottom: -.6em;
+}
+
+.ui-slider-vertical .ui-slider-range {
+ left: 0;
+ width: 100%;
+}
+
+.ui-slider-vertical .ui-slider-range-min {
+ bottom: 0;
+}
+
+.ui-slider-vertical .ui-slider-range-max {
+ top: 0;
+}
+
+.ui-spinner {
+ position: relative;
+ display: inline-block;
+ overflow: hidden;
+ padding: 0;
+ vertical-align: middle;
+}
+
+.ui-spinner-input {
+ border: none;
+ background: none;
+ color: inherit;
+ padding: 0;
+ margin: .2em 0;
+ vertical-align: middle;
+ margin-left: .4em;
+ margin-right: 22px;
+}
+
+.ui-spinner-button {
+ width: 16px;
+ height: 50%;
+ font-size: .5em;
+ padding: 0;
+ margin: 0;
+ text-align: center;
+ position: absolute;
+ cursor: default;
+ display: block;
+ overflow: hidden;
+ right: 0;
+}
+
+/* more specificity required here to override default borders */
+.ui-spinner a.ui-spinner-button {
+ border-top: none;
+ border-bottom: none;
+ border-right: none;
+}
+
+/* vertically center icon */
+.ui-spinner .ui-icon {
+ position: absolute;
+ margin-top: -8px;
+ top: 50%;
+ left: 0;
+}
+
+.ui-spinner-up {
+ top: 0;
+}
+
+.ui-spinner-down {
+ bottom: 0;
+}
+
+/* TR overrides */
+.ui-spinner .ui-icon-triangle-1-s {
+ /* need to fix icons sprite */
+ background-position: -65px -16px;
+}
+
+.ui-tabs {
+ position: relative; /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+ padding: .2em;
+}
+
+.ui-tabs .ui-tabs-nav {
+ margin: 0;
+ padding: .2em .2em 0;
+}
+
+.ui-tabs .ui-tabs-nav li {
+ list-style: none;
+ float: left;
+ position: relative;
+ top: 0;
+ margin: 1px .2em 0 0;
+ border-bottom-width: 0;
+ padding: 0;
+ white-space: nowrap;
+}
+
+.ui-tabs .ui-tabs-nav .ui-tabs-anchor {
+ float: left;
+ padding: .5em 1em;
+ text-decoration: none;
+}
+
+.ui-tabs .ui-tabs-nav li.ui-tabs-active {
+ margin-bottom: -1px;
+ padding-bottom: 1px;
+}
+
+.ui-tabs .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor,
+.ui-tabs .ui-tabs-nav li.ui-state-disabled .ui-tabs-anchor,
+.ui-tabs .ui-tabs-nav li.ui-tabs-loading .ui-tabs-anchor {
+ cursor: text;
+}
+
+.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor {
+ cursor: pointer;
+}
+
+.ui-tabs .ui-tabs-panel {
+ display: block;
+ border-width: 0;
+ padding: 1em 1.4em;
+ background: none;
+}
+
+.ui-tooltip {
+ padding: 8px;
+ position: absolute;
+ z-index: 9999;
+ max-width: 300px;
+ -webkit-box-shadow: 0 0 5px #aaa;
+ box-shadow: 0 0 5px #aaa;
+}
+
+body .ui-tooltip {
+ border-width: 2px;
+}
+
+/* Component containers
+----------------------------------*/
+.ui-widget {
+ font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif;
+ font-size: 1.1em;
+}
+
+.ui-widget .ui-widget {
+ font-size: 1em;
+}
+
+.ui-widget input,
+.ui-widget select,
+.ui-widget textarea,
+.ui-widget button {
+ font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif;
+ font-size: 1em;
+}
+
+.ui-widget-content {
+ border: 1px solid #dddddd;
+ background: #eeeeee url("images/ui-bg_highlight-soft_100_eeeeee_1x100.png") 50% top repeat-x;
+ color: #333333;
+}
+
+.ui-widget-content a {
+ color: #333333;
+}
+
+.ui-widget-header {
+ border: 1px solid #e78f08;
+ background: #f6a828 url("images/ui-bg_gloss-wave_35_f6a828_500x100.png") 50% 50% repeat-x;
+ color: #ffffff;
+ font-weight: bold;
+}
+
+.ui-widget-header a {
+ color: #ffffff;
+}
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default,
+.ui-widget-content .ui-state-default,
+.ui-widget-header .ui-state-default {
+ border: 1px solid #cccccc;
+ background: #f6f6f6 url("images/ui-bg_glass_100_f6f6f6_1x400.png") 50% 50% repeat-x;
+ font-weight: bold;
+ color: #1c94c4;
+}
+
+.ui-state-default a,
+.ui-state-default a:link,
+.ui-state-default a:visited {
+ color: #1c94c4;
+ text-decoration: none;
+}
+
+.ui-state-hover,
+.ui-widget-content .ui-state-hover,
+.ui-widget-header .ui-state-hover,
+.ui-state-focus,
+.ui-widget-content .ui-state-focus,
+.ui-widget-header .ui-state-focus {
+ border: 1px solid #fbcb09;
+ background: #fdf5ce url("images/ui-bg_glass_100_fdf5ce_1x400.png") 50% 50% repeat-x;
+ font-weight: bold;
+ color: #c77405;
+}
+
+.ui-state-hover a,
+.ui-state-hover a:hover,
+.ui-state-hover a:link,
+.ui-state-hover a:visited,
+.ui-state-focus a,
+.ui-state-focus a:hover,
+.ui-state-focus a:link,
+.ui-state-focus a:visited {
+ color: #c77405;
+ text-decoration: none;
+}
+
+.ui-state-active,
+.ui-widget-content .ui-state-active,
+.ui-widget-header .ui-state-active {
+ border: 1px solid #fbd850;
+ background: #ffffff url("images/ui-bg_glass_65_ffffff_1x400.png") 50% 50% repeat-x;
+ font-weight: bold;
+ color: #eb8f00;
+}
+
+.ui-state-active a,
+.ui-state-active a:link,
+.ui-state-active a:visited {
+ color: #eb8f00;
+ text-decoration: none;
+}
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight,
+.ui-widget-content .ui-state-highlight,
+.ui-widget-header .ui-state-highlight {
+ border: 1px solid #fed22f;
+ background: #ffe45c url("images/ui-bg_highlight-soft_75_ffe45c_1x100.png") 50% top repeat-x;
+ color: #363636;
+}
+
+.ui-state-highlight a,
+.ui-widget-content .ui-state-highlight a,
+.ui-widget-header .ui-state-highlight a {
+ color: #363636;
+}
+
+.ui-state-error,
+.ui-widget-content .ui-state-error,
+.ui-widget-header .ui-state-error {
+ border: 1px solid #cd0a0a;
+ background: #b81900 url("images/ui-bg_diagonals-thick_18_b81900_40x40.png") 50% 50% repeat;
+ color: #ffffff;
+}
+
+.ui-state-error a,
+.ui-widget-content .ui-state-error a,
+.ui-widget-header .ui-state-error a {
+ color: #ffffff;
+}
+
+.ui-state-error-text,
+.ui-widget-content .ui-state-error-text,
+.ui-widget-header .ui-state-error-text {
+ color: #ffffff;
+}
+
+.ui-priority-primary,
+.ui-widget-content .ui-priority-primary,
+.ui-widget-header .ui-priority-primary {
+ font-weight: bold;
+}
+
+.ui-priority-secondary,
+.ui-widget-content .ui-priority-secondary,
+.ui-widget-header .ui-priority-secondary {
+ opacity: .7;
+ filter: Alpha(Opacity=70); /* support: IE8 */
+ font-weight: normal;
+}
+
+.ui-state-disabled,
+.ui-widget-content .ui-state-disabled,
+.ui-widget-header .ui-state-disabled {
+ opacity: .35;
+ filter: Alpha(Opacity=35); /* support: IE8 */
+ background-image: none;
+}
+
+.ui-state-disabled .ui-icon {
+ filter: Alpha(Opacity=35); /* support: IE8 - See #6059 */
+}
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon {
+ width: 16px;
+ height: 16px;
+}
+
+.ui-icon,
+.ui-widget-content .ui-icon {
+ background-image: url("images/ui-icons_222222_256x240.png");
+}
+
+.ui-widget-header .ui-icon {
+ background-image: url("images/ui-icons_ffffff_256x240.png");
+}
+
+.ui-state-default .ui-icon {
+ background-image: url("images/ui-icons_ef8c08_256x240.png");
+}
+
+.ui-state-hover .ui-icon,
+.ui-state-focus .ui-icon {
+ background-image: url("images/ui-icons_ef8c08_256x240.png");
+}
+
+.ui-state-active .ui-icon {
+ background-image: url("images/ui-icons_ef8c08_256x240.png");
+}
+
+.ui-state-highlight .ui-icon {
+ background-image: url("images/ui-icons_228ef1_256x240.png");
+}
+
+.ui-state-error .ui-icon,
+.ui-state-error-text .ui-icon {
+ background-image: url("images/ui-icons_ffd27a_256x240.png");
+}
+
+/* positioning */
+.ui-icon-blank {
+ background-position: 16px 16px;
+}
+
+.ui-icon-carat-1-n {
+ background-position: 0 0;
+}
+
+.ui-icon-carat-1-ne {
+ background-position: -16px 0;
+}
+
+.ui-icon-carat-1-e {
+ background-position: -32px 0;
+}
+
+.ui-icon-carat-1-se {
+ background-position: -48px 0;
+}
+
+.ui-icon-carat-1-s {
+ background-position: -64px 0;
+}
+
+.ui-icon-carat-1-sw {
+ background-position: -80px 0;
+}
+
+.ui-icon-carat-1-w {
+ background-position: -96px 0;
+}
+
+.ui-icon-carat-1-nw {
+ background-position: -112px 0;
+}
+
+.ui-icon-carat-2-n-s {
+ background-position: -128px 0;
+}
+
+.ui-icon-carat-2-e-w {
+ background-position: -144px 0;
+}
+
+.ui-icon-triangle-1-n {
+ background-position: 0 -16px;
+}
+
+.ui-icon-triangle-1-ne {
+ background-position: -16px -16px;
+}
+
+.ui-icon-triangle-1-e {
+ background-position: -32px -16px;
+}
+
+.ui-icon-triangle-1-se {
+ background-position: -48px -16px;
+}
+
+.ui-icon-triangle-1-s {
+ background-position: -64px -16px;
+}
+
+.ui-icon-triangle-1-sw {
+ background-position: -80px -16px;
+}
+
+.ui-icon-triangle-1-w {
+ background-position: -96px -16px;
+}
+
+.ui-icon-triangle-1-nw {
+ background-position: -112px -16px;
+}
+
+.ui-icon-triangle-2-n-s {
+ background-position: -128px -16px;
+}
+
+.ui-icon-triangle-2-e-w {
+ background-position: -144px -16px;
+}
+
+.ui-icon-arrow-1-n {
+ background-position: 0 -32px;
+}
+
+.ui-icon-arrow-1-ne {
+ background-position: -16px -32px;
+}
+
+.ui-icon-arrow-1-e {
+ background-position: -32px -32px;
+}
+
+.ui-icon-arrow-1-se {
+ background-position: -48px -32px;
+}
+
+.ui-icon-arrow-1-s {
+ background-position: -64px -32px;
+}
+
+.ui-icon-arrow-1-sw {
+ background-position: -80px -32px;
+}
+
+.ui-icon-arrow-1-w {
+ background-position: -96px -32px;
+}
+
+.ui-icon-arrow-1-nw {
+ background-position: -112px -32px;
+}
+
+.ui-icon-arrow-2-n-s {
+ background-position: -128px -32px;
+}
+
+.ui-icon-arrow-2-ne-sw {
+ background-position: -144px -32px;
+}
+
+.ui-icon-arrow-2-e-w {
+ background-position: -160px -32px;
+}
+
+.ui-icon-arrow-2-se-nw {
+ background-position: -176px -32px;
+}
+
+.ui-icon-arrowstop-1-n {
+ background-position: -192px -32px;
+}
+
+.ui-icon-arrowstop-1-e {
+ background-position: -208px -32px;
+}
+
+.ui-icon-arrowstop-1-s {
+ background-position: -224px -32px;
+}
+
+.ui-icon-arrowstop-1-w {
+ background-position: -240px -32px;
+}
+
+.ui-icon-arrowthick-1-n {
+ background-position: 0 -48px;
+}
+
+.ui-icon-arrowthick-1-ne {
+ background-position: -16px -48px;
+}
+
+.ui-icon-arrowthick-1-e {
+ background-position: -32px -48px;
+}
+
+.ui-icon-arrowthick-1-se {
+ background-position: -48px -48px;
+}
+
+.ui-icon-arrowthick-1-s {
+ background-position: -64px -48px;
+}
+
+.ui-icon-arrowthick-1-sw {
+ background-position: -80px -48px;
+}
+
+.ui-icon-arrowthick-1-w {
+ background-position: -96px -48px;
+}
+
+.ui-icon-arrowthick-1-nw {
+ background-position: -112px -48px;
+}
+
+.ui-icon-arrowthick-2-n-s {
+ background-position: -128px -48px;
+}
+
+.ui-icon-arrowthick-2-ne-sw {
+ background-position: -144px -48px;
+}
+
+.ui-icon-arrowthick-2-e-w {
+ background-position: -160px -48px;
+}
+
+.ui-icon-arrowthick-2-se-nw {
+ background-position: -176px -48px;
+}
+
+.ui-icon-arrowthickstop-1-n {
+ background-position: -192px -48px;
+}
+
+.ui-icon-arrowthickstop-1-e {
+ background-position: -208px -48px;
+}
+
+.ui-icon-arrowthickstop-1-s {
+ background-position: -224px -48px;
+}
+
+.ui-icon-arrowthickstop-1-w {
+ background-position: -240px -48px;
+}
+
+.ui-icon-arrowreturnthick-1-w {
+ background-position: 0 -64px;
+}
+
+.ui-icon-arrowreturnthick-1-n {
+ background-position: -16px -64px;
+}
+
+.ui-icon-arrowreturnthick-1-e {
+ background-position: -32px -64px;
+}
+
+.ui-icon-arrowreturnthick-1-s {
+ background-position: -48px -64px;
+}
+
+.ui-icon-arrowreturn-1-w {
+ background-position: -64px -64px;
+}
+
+.ui-icon-arrowreturn-1-n {
+ background-position: -80px -64px;
+}
+
+.ui-icon-arrowreturn-1-e {
+ background-position: -96px -64px;
+}
+
+.ui-icon-arrowreturn-1-s {
+ background-position: -112px -64px;
+}
+
+.ui-icon-arrowrefresh-1-w {
+ background-position: -128px -64px;
+}
+
+.ui-icon-arrowrefresh-1-n {
+ background-position: -144px -64px;
+}
+
+.ui-icon-arrowrefresh-1-e {
+ background-position: -160px -64px;
+}
+
+.ui-icon-arrowrefresh-1-s {
+ background-position: -176px -64px;
+}
+
+.ui-icon-arrow-4 {
+ background-position: 0 -80px;
+}
+
+.ui-icon-arrow-4-diag {
+ background-position: -16px -80px;
+}
+
+.ui-icon-extlink {
+ background-position: -32px -80px;
+}
+
+.ui-icon-newwin {
+ background-position: -48px -80px;
+}
+
+.ui-icon-refresh {
+ background-position: -64px -80px;
+}
+
+.ui-icon-shuffle {
+ background-position: -80px -80px;
+}
+
+.ui-icon-transfer-e-w {
+ background-position: -96px -80px;
+}
+
+.ui-icon-transferthick-e-w {
+ background-position: -112px -80px;
+}
+
+.ui-icon-folder-collapsed {
+ background-position: 0 -96px;
+}
+
+.ui-icon-folder-open {
+ background-position: -16px -96px;
+}
+
+.ui-icon-document {
+ background-position: -32px -96px;
+}
+
+.ui-icon-document-b {
+ background-position: -48px -96px;
+}
+
+.ui-icon-note {
+ background-position: -64px -96px;
+}
+
+.ui-icon-mail-closed {
+ background-position: -80px -96px;
+}
+
+.ui-icon-mail-open {
+ background-position: -96px -96px;
+}
+
+.ui-icon-suitcase {
+ background-position: -112px -96px;
+}
+
+.ui-icon-comment {
+ background-position: -128px -96px;
+}
+
+.ui-icon-person {
+ background-position: -144px -96px;
+}
+
+.ui-icon-print {
+ background-position: -160px -96px;
+}
+
+.ui-icon-trash {
+ background-position: -176px -96px;
+}
+
+.ui-icon-locked {
+ background-position: -192px -96px;
+}
+
+.ui-icon-unlocked {
+ background-position: -208px -96px;
+}
+
+.ui-icon-bookmark {
+ background-position: -224px -96px;
+}
+
+.ui-icon-tag {
+ background-position: -240px -96px;
+}
+
+.ui-icon-home {
+ background-position: 0 -112px;
+}
+
+.ui-icon-flag {
+ background-position: -16px -112px;
+}
+
+.ui-icon-calendar {
+ background-position: -32px -112px;
+}
+
+.ui-icon-cart {
+ background-position: -48px -112px;
+}
+
+.ui-icon-pencil {
+ background-position: -64px -112px;
+}
+
+.ui-icon-clock {
+ background-position: -80px -112px;
+}
+
+.ui-icon-disk {
+ background-position: -96px -112px;
+}
+
+.ui-icon-calculator {
+ background-position: -112px -112px;
+}
+
+.ui-icon-zoomin {
+ background-position: -128px -112px;
+}
+
+.ui-icon-zoomout {
+ background-position: -144px -112px;
+}
+
+.ui-icon-search {
+ background-position: -160px -112px;
+}
+
+.ui-icon-wrench {
+ background-position: -176px -112px;
+}
+
+.ui-icon-gear {
+ background-position: -192px -112px;
+}
+
+.ui-icon-heart {
+ background-position: -208px -112px;
+}
+
+.ui-icon-star {
+ background-position: -224px -112px;
+}
+
+.ui-icon-link {
+ background-position: -240px -112px;
+}
+
+.ui-icon-cancel {
+ background-position: 0 -128px;
+}
+
+.ui-icon-plus {
+ background-position: -16px -128px;
+}
+
+.ui-icon-plusthick {
+ background-position: -32px -128px;
+}
+
+.ui-icon-minus {
+ background-position: -48px -128px;
+}
+
+.ui-icon-minusthick {
+ background-position: -64px -128px;
+}
+
+.ui-icon-close {
+ background-position: -80px -128px;
+}
+
+.ui-icon-closethick {
+ background-position: -96px -128px;
+}
+
+.ui-icon-key {
+ background-position: -112px -128px;
+}
+
+.ui-icon-lightbulb {
+ background-position: -128px -128px;
+}
+
+.ui-icon-scissors {
+ background-position: -144px -128px;
+}
+
+.ui-icon-clipboard {
+ background-position: -160px -128px;
+}
+
+.ui-icon-copy {
+ background-position: -176px -128px;
+}
+
+.ui-icon-contact {
+ background-position: -192px -128px;
+}
+
+.ui-icon-image {
+ background-position: -208px -128px;
+}
+
+.ui-icon-video {
+ background-position: -224px -128px;
+}
+
+.ui-icon-script {
+ background-position: -240px -128px;
+}
+
+.ui-icon-alert {
+ background-position: 0 -144px;
+}
+
+.ui-icon-info {
+ background-position: -16px -144px;
+}
+
+.ui-icon-notice {
+ background-position: -32px -144px;
+}
+
+.ui-icon-help {
+ background-position: -48px -144px;
+}
+
+.ui-icon-check {
+ background-position: -64px -144px;
+}
+
+.ui-icon-bullet {
+ background-position: -80px -144px;
+}
+
+.ui-icon-radio-on {
+ background-position: -96px -144px;
+}
+
+.ui-icon-radio-off {
+ background-position: -112px -144px;
+}
+
+.ui-icon-pin-w {
+ background-position: -128px -144px;
+}
+
+.ui-icon-pin-s {
+ background-position: -144px -144px;
+}
+
+.ui-icon-play {
+ background-position: 0 -160px;
+}
+
+.ui-icon-pause {
+ background-position: -16px -160px;
+}
+
+.ui-icon-seek-next {
+ background-position: -32px -160px;
+}
+
+.ui-icon-seek-prev {
+ background-position: -48px -160px;
+}
+
+.ui-icon-seek-end {
+ background-position: -64px -160px;
+}
+
+.ui-icon-seek-start {
+ background-position: -80px -160px;
+}
+
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first {
+ background-position: -80px -160px;
+}
+
+.ui-icon-stop {
+ background-position: -96px -160px;
+}
+
+.ui-icon-eject {
+ background-position: -112px -160px;
+}
+
+.ui-icon-volume-off {
+ background-position: -128px -160px;
+}
+
+.ui-icon-volume-on {
+ background-position: -144px -160px;
+}
+
+.ui-icon-power {
+ background-position: 0 -176px;
+}
+
+.ui-icon-signal-diag {
+ background-position: -16px -176px;
+}
+
+.ui-icon-signal {
+ background-position: -32px -176px;
+}
+
+.ui-icon-battery-0 {
+ background-position: -48px -176px;
+}
+
+.ui-icon-battery-1 {
+ background-position: -64px -176px;
+}
+
+.ui-icon-battery-2 {
+ background-position: -80px -176px;
+}
+
+.ui-icon-battery-3 {
+ background-position: -96px -176px;
+}
+
+.ui-icon-circle-plus {
+ background-position: 0 -192px;
+}
+
+.ui-icon-circle-minus {
+ background-position: -16px -192px;
+}
+
+.ui-icon-circle-close {
+ background-position: -32px -192px;
+}
+
+.ui-icon-circle-triangle-e {
+ background-position: -48px -192px;
+}
+
+.ui-icon-circle-triangle-s {
+ background-position: -64px -192px;
+}
+
+.ui-icon-circle-triangle-w {
+ background-position: -80px -192px;
+}
+
+.ui-icon-circle-triangle-n {
+ background-position: -96px -192px;
+}
+
+.ui-icon-circle-arrow-e {
+ background-position: -112px -192px;
+}
+
+.ui-icon-circle-arrow-s {
+ background-position: -128px -192px;
+}
+
+.ui-icon-circle-arrow-w {
+ background-position: -144px -192px;
+}
+
+.ui-icon-circle-arrow-n {
+ background-position: -160px -192px;
+}
+
+.ui-icon-circle-zoomin {
+ background-position: -176px -192px;
+}
+
+.ui-icon-circle-zoomout {
+ background-position: -192px -192px;
+}
+
+.ui-icon-circle-check {
+ background-position: -208px -192px;
+}
+
+.ui-icon-circlesmall-plus {
+ background-position: 0 -208px;
+}
+
+.ui-icon-circlesmall-minus {
+ background-position: -16px -208px;
+}
+
+.ui-icon-circlesmall-close {
+ background-position: -32px -208px;
+}
+
+.ui-icon-squaresmall-plus {
+ background-position: -48px -208px;
+}
+
+.ui-icon-squaresmall-minus {
+ background-position: -64px -208px;
+}
+
+.ui-icon-squaresmall-close {
+ background-position: -80px -208px;
+}
+
+.ui-icon-grip-dotted-vertical {
+ background-position: 0 -224px;
+}
+
+.ui-icon-grip-dotted-horizontal {
+ background-position: -16px -224px;
+}
+
+.ui-icon-grip-solid-vertical {
+ background-position: -32px -224px;
+}
+
+.ui-icon-grip-solid-horizontal {
+ background-position: -48px -224px;
+}
+
+.ui-icon-gripsmall-diagonal-se {
+ background-position: -64px -224px;
+}
+
+.ui-icon-grip-diagonal-se {
+ background-position: -80px -224px;
+}
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-all,
+.ui-corner-top,
+.ui-corner-left,
+.ui-corner-tl {
+ border-top-left-radius: 4px;
+}
+
+.ui-corner-all,
+.ui-corner-top,
+.ui-corner-right,
+.ui-corner-tr {
+ border-top-right-radius: 4px;
+}
+
+.ui-corner-all,
+.ui-corner-bottom,
+.ui-corner-left,
+.ui-corner-bl {
+ border-bottom-left-radius: 4px;
+}
+
+.ui-corner-all,
+.ui-corner-bottom,
+.ui-corner-right,
+.ui-corner-br {
+ border-bottom-right-radius: 4px;
+}
+
+/* Overlays */
+.ui-widget-overlay {
+ background: #666666 url("images/ui-bg_diagonals-thick_20_666666_40x40.png") 50% 50% repeat;
+ opacity: .5;
+ filter: Alpha(Opacity=50); /* support: IE8 */
+}
+
+.ui-widget-shadow {
+ margin: -5px 0 0 -5px;
+ padding: 5px;
+ background: #000000 url("images/ui-bg_flat_10_000000_40x100.png") 50% 50% repeat-x;
+ opacity: .2;
+ filter: Alpha(Opacity=20); /* support: IE8 */
+ border-radius: 5px;
+}
diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.js b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.js new file mode 100644 index 00000000..cbaf2b50 --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.js @@ -0,0 +1,16753 @@ +/*! jQuery UI - v1.11.4 - 2015-04-12
+ * http://jqueryui.com
+ * Includes: core.js, widget.js, mouse.js, position.js, draggable.js, droppable.js, resizable.js, selectable.js, sortable.js, accordion.js, autocomplete.js, button.js, datepicker.js, dialog.js, menu.js, progressbar.js, selectmenu.js, slider.js, spinner.js, tabs.js, tooltip.js, effect.js, effect-blind.js, effect-bounce.js, effect-clip.js, effect-drop.js, effect-explode.js, effect-fade.js, effect-fold.js, effect-highlight.js, effect-puff.js, effect-pulsate.js, effect-scale.js, effect-shake.js, effect-size.js, effect-slide.js, effect-transfer.js
+ * Copyright 2015 jQuery Foundation and other contributors; Licensed MIT */
+
+(function (factory) {
+ if (typeof define === "function" && define.amd) {
+
+ // AMD. Register as an anonymous module.
+ define(["jquery"], factory);
+ } else {
+
+ // Browser globals
+ factory(jQuery);
+ }
+}(function ($) {
+ /*!
+ * jQuery UI Core 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/category/ui-core/
+ */
+
+
+// $.ui might exist from components with no dependencies, e.g., $.ui.position
+ $.ui = $.ui || {};
+
+ $.extend($.ui, {
+ version: "1.11.4",
+
+ keyCode: {
+ BACKSPACE: 8,
+ COMMA: 188,
+ DELETE: 46,
+ DOWN: 40,
+ END: 35,
+ ENTER: 13,
+ ESCAPE: 27,
+ HOME: 36,
+ LEFT: 37,
+ PAGE_DOWN: 34,
+ PAGE_UP: 33,
+ PERIOD: 190,
+ RIGHT: 39,
+ SPACE: 32,
+ TAB: 9,
+ UP: 38
+ }
+ });
+
+// plugins
+ $.fn.extend({
+ scrollParent: function (includeHidden) {
+ var position = this.css("position"),
+ excludeStaticParent = position === "absolute",
+ overflowRegex = includeHidden ? /(auto|scroll|hidden)/ : /(auto|scroll)/,
+ scrollParent = this.parents().filter(function () {
+ var parent = $(this);
+ if (excludeStaticParent && parent.css("position") === "static") {
+ return false;
+ }
+ return overflowRegex.test(parent.css("overflow") + parent.css("overflow-y") + parent.css("overflow-x"));
+ }).eq(0);
+
+ return position === "fixed" || !scrollParent.length ? $(this[0].ownerDocument || document) : scrollParent;
+ },
+
+ uniqueId: (function () {
+ var uuid = 0;
+
+ return function () {
+ return this.each(function () {
+ if (!this.id) {
+ this.id = "ui-id-" + ( ++uuid );
+ }
+ });
+ };
+ })(),
+
+ removeUniqueId: function () {
+ return this.each(function () {
+ if (/^ui-id-\d+$/.test(this.id)) {
+ $(this).removeAttr("id");
+ }
+ });
+ }
+ });
+
+// selectors
+ function focusable(element, isTabIndexNotNaN) {
+ var map, mapName, img,
+ nodeName = element.nodeName.toLowerCase();
+ if ("area" === nodeName) {
+ map = element.parentNode;
+ mapName = map.name;
+ if (!element.href || !mapName || map.nodeName.toLowerCase() !== "map") {
+ return false;
+ }
+ img = $("img[usemap='#" + mapName + "']")[0];
+ return !!img && visible(img);
+ }
+ return ( /^(input|select|textarea|button|object)$/.test(nodeName) ?
+ !element.disabled :
+ "a" === nodeName ?
+ element.href || isTabIndexNotNaN :
+ isTabIndexNotNaN) &&
+ // the element and all of its ancestors must be visible
+ visible(element);
+ }
+
+ function visible(element) {
+ return $.expr.filters.visible(element) && !$(element).parents().addBack().filter(function () {
+ return $.css(this, "visibility") === "hidden";
+ }).length;
+ }
+
+ $.extend($.expr[":"], {
+ data: $.expr.createPseudo ?
+ $.expr.createPseudo(function (dataName) {
+ return function (elem) {
+ return !!$.data(elem, dataName);
+ };
+ }) :
+ // support: jQuery <1.8
+ function (elem, i, match) {
+ return !!$.data(elem, match[3]);
+ },
+
+ focusable: function (element) {
+ return focusable(element, !isNaN($.attr(element, "tabindex")));
+ },
+
+ tabbable: function (element) {
+ var tabIndex = $.attr(element, "tabindex"),
+ isTabIndexNaN = isNaN(tabIndex);
+ return ( isTabIndexNaN || tabIndex >= 0 ) && focusable(element, !isTabIndexNaN);
+ }
+ });
+
+// support: jQuery <1.8
+ if (!$("<a>").outerWidth(1).jquery) {
+ $.each(["Width", "Height"], function (i, name) {
+ var side = name === "Width" ? ["Left", "Right"] : ["Top", "Bottom"],
+ type = name.toLowerCase(),
+ orig = {
+ innerWidth: $.fn.innerWidth,
+ innerHeight: $.fn.innerHeight,
+ outerWidth: $.fn.outerWidth,
+ outerHeight: $.fn.outerHeight
+ };
+
+ function reduce(elem, size, border, margin) {
+ $.each(side, function () {
+ size -= parseFloat($.css(elem, "padding" + this)) || 0;
+ if (border) {
+ size -= parseFloat($.css(elem, "border" + this + "Width")) || 0;
+ }
+ if (margin) {
+ size -= parseFloat($.css(elem, "margin" + this)) || 0;
+ }
+ });
+ return size;
+ }
+
+ $.fn["inner" + name] = function (size) {
+ if (size === undefined) {
+ return orig["inner" + name].call(this);
+ }
+
+ return this.each(function () {
+ $(this).css(type, reduce(this, size) + "px");
+ });
+ };
+
+ $.fn["outer" + name] = function (size, margin) {
+ if (typeof size !== "number") {
+ return orig["outer" + name].call(this, size);
+ }
+
+ return this.each(function () {
+ $(this).css(type, reduce(this, size, true, margin) + "px");
+ });
+ };
+ });
+ }
+
+// support: jQuery <1.8
+ if (!$.fn.addBack) {
+ $.fn.addBack = function (selector) {
+ return this.add(selector == null ?
+ this.prevObject : this.prevObject.filter(selector)
+ );
+ };
+ }
+
+// support: jQuery 1.6.1, 1.6.2 (http://bugs.jquery.com/ticket/9413)
+ if ($("<a>").data("a-b", "a").removeData("a-b").data("a-b")) {
+ $.fn.removeData = (function (removeData) {
+ return function (key) {
+ if (arguments.length) {
+ return removeData.call(this, $.camelCase(key));
+ } else {
+ return removeData.call(this);
+ }
+ };
+ })($.fn.removeData);
+ }
+
+// deprecated
+ $.ui.ie = !!/msie [\w.]+/.exec(navigator.userAgent.toLowerCase());
+
+ $.fn.extend({
+ focus: (function (orig) {
+ return function (delay, fn) {
+ return typeof delay === "number" ?
+ this.each(function () {
+ var elem = this;
+ setTimeout(function () {
+ $(elem).focus();
+ if (fn) {
+ fn.call(elem);
+ }
+ }, delay);
+ }) :
+ orig.apply(this, arguments);
+ };
+ })($.fn.focus),
+
+ disableSelection: (function () {
+ var eventType = "onselectstart" in document.createElement("div") ?
+ "selectstart" :
+ "mousedown";
+
+ return function () {
+ return this.bind(eventType + ".ui-disableSelection", function (event) {
+ event.preventDefault();
+ });
+ };
+ })(),
+
+ enableSelection: function () {
+ return this.unbind(".ui-disableSelection");
+ },
+
+ zIndex: function (zIndex) {
+ if (zIndex !== undefined) {
+ return this.css("zIndex", zIndex);
+ }
+
+ if (this.length) {
+ var elem = $(this[0]), position, value;
+ while (elem.length && elem[0] !== document) {
+ // Ignore z-index if position is set to a value where z-index is ignored by the browser
+ // This makes behavior of this function consistent across browsers
+ // WebKit always returns auto if the element is positioned
+ position = elem.css("position");
+ if (position === "absolute" || position === "relative" || position === "fixed") {
+ // IE returns 0 when zIndex is not specified
+ // other browsers return a string
+ // we ignore the case of nested elements with an explicit value of 0
+ // <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
+ value = parseInt(elem.css("zIndex"), 10);
+ if (!isNaN(value) && value !== 0) {
+ return value;
+ }
+ }
+ elem = elem.parent();
+ }
+ }
+
+ return 0;
+ }
+ });
+
+// $.ui.plugin is deprecated. Use $.widget() extensions instead.
+ $.ui.plugin = {
+ add: function (module, option, set) {
+ var i,
+ proto = $.ui[module].prototype;
+ for (i in set) {
+ proto.plugins[i] = proto.plugins[i] || [];
+ proto.plugins[i].push([option, set[i]]);
+ }
+ },
+ call: function (instance, name, args, allowDisconnected) {
+ var i,
+ set = instance.plugins[name];
+
+ if (!set) {
+ return;
+ }
+
+ if (!allowDisconnected && ( !instance.element[0].parentNode || instance.element[0].parentNode.nodeType === 11 )) {
+ return;
+ }
+
+ for (i = 0; i < set.length; i++) {
+ if (instance.options[set[i][0]]) {
+ set[i][1].apply(instance.element, args);
+ }
+ }
+ }
+ };
+
+
+ /*!
+ * jQuery UI Widget 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/jQuery.widget/
+ */
+
+
+ var widget_uuid = 0,
+ widget_slice = Array.prototype.slice;
+
+ $.cleanData = (function (orig) {
+ return function (elems) {
+ var events, elem, i;
+ for (i = 0; (elem = elems[i]) != null; i++) {
+ try {
+
+ // Only trigger remove when necessary to save time
+ events = $._data(elem, "events");
+ if (events && events.remove) {
+ $(elem).triggerHandler("remove");
+ }
+
+ // http://bugs.jquery.com/ticket/8235
+ } catch (e) {
+ }
+ }
+ orig(elems);
+ };
+ })($.cleanData);
+
+ $.widget = function (name, base, prototype) {
+ var fullName, existingConstructor, constructor, basePrototype,
+ // proxiedPrototype allows the provided prototype to remain unmodified
+ // so that it can be used as a mixin for multiple widgets (#8876)
+ proxiedPrototype = {},
+ namespace = name.split(".")[0];
+
+ name = name.split(".")[1];
+ fullName = namespace + "-" + name;
+
+ if (!prototype) {
+ prototype = base;
+ base = $.Widget;
+ }
+
+ // create selector for plugin
+ $.expr[":"][fullName.toLowerCase()] = function (elem) {
+ return !!$.data(elem, fullName);
+ };
+
+ $[namespace] = $[namespace] || {};
+ existingConstructor = $[namespace][name];
+ constructor = $[namespace][name] = function (options, element) {
+ // allow instantiation without "new" keyword
+ if (!this._createWidget) {
+ return new constructor(options, element);
+ }
+
+ // allow instantiation without initializing for simple inheritance
+ // must use "new" keyword (the code above always passes args)
+ if (arguments.length) {
+ this._createWidget(options, element);
+ }
+ };
+ // extend with the existing constructor to carry over any static properties
+ $.extend(constructor, existingConstructor, {
+ version: prototype.version,
+ // copy the object used to create the prototype in case we need to
+ // redefine the widget later
+ _proto: $.extend({}, prototype),
+ // track widgets that inherit from this widget in case this widget is
+ // redefined after a widget inherits from it
+ _childConstructors: []
+ });
+
+ basePrototype = new base();
+ // we need to make the options hash a property directly on the new instance
+ // otherwise we'll modify the options hash on the prototype that we're
+ // inheriting from
+ basePrototype.options = $.widget.extend({}, basePrototype.options);
+ $.each(prototype, function (prop, value) {
+ if (!$.isFunction(value)) {
+ proxiedPrototype[prop] = value;
+ return;
+ }
+ proxiedPrototype[prop] = (function () {
+ var _super = function () {
+ return base.prototype[prop].apply(this, arguments);
+ },
+ _superApply = function (args) {
+ return base.prototype[prop].apply(this, args);
+ };
+ return function () {
+ var __super = this._super,
+ __superApply = this._superApply,
+ returnValue;
+
+ this._super = _super;
+ this._superApply = _superApply;
+
+ returnValue = value.apply(this, arguments);
+
+ this._super = __super;
+ this._superApply = __superApply;
+
+ return returnValue;
+ };
+ })();
+ });
+ constructor.prototype = $.widget.extend(basePrototype, {
+ // TODO: remove support for widgetEventPrefix
+ // always use the name + a colon as the prefix, e.g., draggable:start
+ // don't prefix for widgets that aren't DOM-based
+ widgetEventPrefix: existingConstructor ? (basePrototype.widgetEventPrefix || name) : name
+ }, proxiedPrototype, {
+ constructor: constructor,
+ namespace: namespace,
+ widgetName: name,
+ widgetFullName: fullName
+ });
+
+ // If this widget is being redefined then we need to find all widgets that
+ // are inheriting from it and redefine all of them so that they inherit from
+ // the new version of this widget. We're essentially trying to replace one
+ // level in the prototype chain.
+ if (existingConstructor) {
+ $.each(existingConstructor._childConstructors, function (i, child) {
+ var childPrototype = child.prototype;
+
+ // redefine the child widget using the same prototype that was
+ // originally used, but inherit from the new version of the base
+ $.widget(childPrototype.namespace + "." + childPrototype.widgetName, constructor, child._proto);
+ });
+ // remove the list of existing child constructors from the old constructor
+ // so the old child constructors can be garbage collected
+ delete existingConstructor._childConstructors;
+ } else {
+ base._childConstructors.push(constructor);
+ }
+
+ $.widget.bridge(name, constructor);
+
+ return constructor;
+ };
+
+ $.widget.extend = function (target) {
+ var input = widget_slice.call(arguments, 1),
+ inputIndex = 0,
+ inputLength = input.length,
+ key,
+ value;
+ for (; inputIndex < inputLength; inputIndex++) {
+ for (key in input[inputIndex]) {
+ value = input[inputIndex][key];
+ if (input[inputIndex].hasOwnProperty(key) && value !== undefined) {
+ // Clone objects
+ if ($.isPlainObject(value)) {
+ target[key] = $.isPlainObject(target[key]) ?
+ $.widget.extend({}, target[key], value) :
+ // Don't extend strings, arrays, etc. with objects
+ $.widget.extend({}, value);
+ // Copy everything else by reference
+ } else {
+ target[key] = value;
+ }
+ }
+ }
+ }
+ return target;
+ };
+
+ $.widget.bridge = function (name, object) {
+ var fullName = object.prototype.widgetFullName || name;
+ $.fn[name] = function (options) {
+ var isMethodCall = typeof options === "string",
+ args = widget_slice.call(arguments, 1),
+ returnValue = this;
+
+ if (isMethodCall) {
+ this.each(function () {
+ var methodValue,
+ instance = $.data(this, fullName);
+ if (options === "instance") {
+ returnValue = instance;
+ return false;
+ }
+ if (!instance) {
+ return $.error("cannot call methods on " + name + " prior to initialization; " +
+ "attempted to call method '" + options + "'");
+ }
+ if (!$.isFunction(instance[options]) || options.charAt(0) === "_") {
+ return $.error("no such method '" + options + "' for " + name + " widget instance");
+ }
+ methodValue = instance[options].apply(instance, args);
+ if (methodValue !== instance && methodValue !== undefined) {
+ returnValue = methodValue && methodValue.jquery ?
+ returnValue.pushStack(methodValue.get()) :
+ methodValue;
+ return false;
+ }
+ });
+ } else {
+
+ // Allow multiple hashes to be passed on init
+ if (args.length) {
+ options = $.widget.extend.apply(null, [options].concat(args));
+ }
+
+ this.each(function () {
+ var instance = $.data(this, fullName);
+ if (instance) {
+ instance.option(options || {});
+ if (instance._init) {
+ instance._init();
+ }
+ } else {
+ $.data(this, fullName, new object(options, this));
+ }
+ });
+ }
+
+ return returnValue;
+ };
+ };
+
+ $.Widget = function (/* options, element */) {
+ };
+ $.Widget._childConstructors = [];
+
+ $.Widget.prototype = {
+ widgetName: "widget",
+ widgetEventPrefix: "",
+ defaultElement: "<div>",
+ options: {
+ disabled: false,
+
+ // callbacks
+ create: null
+ },
+ _createWidget: function (options, element) {
+ element = $(element || this.defaultElement || this)[0];
+ this.element = $(element);
+ this.uuid = widget_uuid++;
+ this.eventNamespace = "." + this.widgetName + this.uuid;
+
+ this.bindings = $();
+ this.hoverable = $();
+ this.focusable = $();
+
+ if (element !== this) {
+ $.data(element, this.widgetFullName, this);
+ this._on(true, this.element, {
+ remove: function (event) {
+ if (event.target === element) {
+ this.destroy();
+ }
+ }
+ });
+ this.document = $(element.style ?
+ // element within the document
+ element.ownerDocument :
+ // element is window or document
+ element.document || element);
+ this.window = $(this.document[0].defaultView || this.document[0].parentWindow);
+ }
+
+ this.options = $.widget.extend({},
+ this.options,
+ this._getCreateOptions(),
+ options);
+
+ this._create();
+ this._trigger("create", null, this._getCreateEventData());
+ this._init();
+ },
+ _getCreateOptions: $.noop,
+ _getCreateEventData: $.noop,
+ _create: $.noop,
+ _init: $.noop,
+
+ destroy: function () {
+ this._destroy();
+ // we can probably remove the unbind calls in 2.0
+ // all event bindings should go through this._on()
+ this.element
+ .unbind(this.eventNamespace)
+ .removeData(this.widgetFullName)
+ // support: jquery <1.6.3
+ // http://bugs.jquery.com/ticket/9413
+ .removeData($.camelCase(this.widgetFullName));
+ this.widget()
+ .unbind(this.eventNamespace)
+ .removeAttr("aria-disabled")
+ .removeClass(
+ this.widgetFullName + "-disabled " +
+ "ui-state-disabled");
+
+ // clean up events and states
+ this.bindings.unbind(this.eventNamespace);
+ this.hoverable.removeClass("ui-state-hover");
+ this.focusable.removeClass("ui-state-focus");
+ },
+ _destroy: $.noop,
+
+ widget: function () {
+ return this.element;
+ },
+
+ option: function (key, value) {
+ var options = key,
+ parts,
+ curOption,
+ i;
+
+ if (arguments.length === 0) {
+ // don't return a reference to the internal hash
+ return $.widget.extend({}, this.options);
+ }
+
+ if (typeof key === "string") {
+ // handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } }
+ options = {};
+ parts = key.split(".");
+ key = parts.shift();
+ if (parts.length) {
+ curOption = options[key] = $.widget.extend({}, this.options[key]);
+ for (i = 0; i < parts.length - 1; i++) {
+ curOption[parts[i]] = curOption[parts[i]] || {};
+ curOption = curOption[parts[i]];
+ }
+ key = parts.pop();
+ if (arguments.length === 1) {
+ return curOption[key] === undefined ? null : curOption[key];
+ }
+ curOption[key] = value;
+ } else {
+ if (arguments.length === 1) {
+ return this.options[key] === undefined ? null : this.options[key];
+ }
+ options[key] = value;
+ }
+ }
+
+ this._setOptions(options);
+
+ return this;
+ },
+ _setOptions: function (options) {
+ var key;
+
+ for (key in options) {
+ this._setOption(key, options[key]);
+ }
+
+ return this;
+ },
+ _setOption: function (key, value) {
+ this.options[key] = value;
+
+ if (key === "disabled") {
+ this.widget()
+ .toggleClass(this.widgetFullName + "-disabled", !!value);
+
+ // If the widget is becoming disabled, then nothing is interactive
+ if (value) {
+ this.hoverable.removeClass("ui-state-hover");
+ this.focusable.removeClass("ui-state-focus");
+ }
+ }
+
+ return this;
+ },
+
+ enable: function () {
+ return this._setOptions({disabled: false});
+ },
+ disable: function () {
+ return this._setOptions({disabled: true});
+ },
+
+ _on: function (suppressDisabledCheck, element, handlers) {
+ var delegateElement,
+ instance = this;
+
+ // no suppressDisabledCheck flag, shuffle arguments
+ if (typeof suppressDisabledCheck !== "boolean") {
+ handlers = element;
+ element = suppressDisabledCheck;
+ suppressDisabledCheck = false;
+ }
+
+ // no element argument, shuffle and use this.element
+ if (!handlers) {
+ handlers = element;
+ element = this.element;
+ delegateElement = this.widget();
+ } else {
+ element = delegateElement = $(element);
+ this.bindings = this.bindings.add(element);
+ }
+
+ $.each(handlers, function (event, handler) {
+ function handlerProxy() {
+ // allow widgets to customize the disabled handling
+ // - disabled as an array instead of boolean
+ // - disabled class as method for disabling individual parts
+ if (!suppressDisabledCheck &&
+ ( instance.options.disabled === true ||
+ $(this).hasClass("ui-state-disabled") )) {
+ return;
+ }
+ return ( typeof handler === "string" ? instance[handler] : handler )
+ .apply(instance, arguments);
+ }
+
+ // copy the guid so direct unbinding works
+ if (typeof handler !== "string") {
+ handlerProxy.guid = handler.guid =
+ handler.guid || handlerProxy.guid || $.guid++;
+ }
+
+ var match = event.match(/^([\w:-]*)\s*(.*)$/),
+ eventName = match[1] + instance.eventNamespace,
+ selector = match[2];
+ if (selector) {
+ delegateElement.delegate(selector, eventName, handlerProxy);
+ } else {
+ element.bind(eventName, handlerProxy);
+ }
+ });
+ },
+
+ _off: function (element, eventName) {
+ eventName = (eventName || "").split(" ").join(this.eventNamespace + " ") +
+ this.eventNamespace;
+ element.unbind(eventName).undelegate(eventName);
+
+ // Clear the stack to avoid memory leaks (#10056)
+ this.bindings = $(this.bindings.not(element).get());
+ this.focusable = $(this.focusable.not(element).get());
+ this.hoverable = $(this.hoverable.not(element).get());
+ },
+
+ _delay: function (handler, delay) {
+ function handlerProxy() {
+ return ( typeof handler === "string" ? instance[handler] : handler )
+ .apply(instance, arguments);
+ }
+
+ var instance = this;
+ return setTimeout(handlerProxy, delay || 0);
+ },
+
+ _hoverable: function (element) {
+ this.hoverable = this.hoverable.add(element);
+ this._on(element, {
+ mouseenter: function (event) {
+ $(event.currentTarget).addClass("ui-state-hover");
+ },
+ mouseleave: function (event) {
+ $(event.currentTarget).removeClass("ui-state-hover");
+ }
+ });
+ },
+
+ _focusable: function (element) {
+ this.focusable = this.focusable.add(element);
+ this._on(element, {
+ focusin: function (event) {
+ $(event.currentTarget).addClass("ui-state-focus");
+ },
+ focusout: function (event) {
+ $(event.currentTarget).removeClass("ui-state-focus");
+ }
+ });
+ },
+
+ _trigger: function (type, event, data) {
+ var prop, orig,
+ callback = this.options[type];
+
+ data = data || {};
+ event = $.Event(event);
+ event.type = ( type === this.widgetEventPrefix ?
+ type :
+ this.widgetEventPrefix + type ).toLowerCase();
+ // the original event may come from any element
+ // so we need to reset the target on the new event
+ event.target = this.element[0];
+
+ // copy original event properties over to the new event
+ orig = event.originalEvent;
+ if (orig) {
+ for (prop in orig) {
+ if (!( prop in event )) {
+ event[prop] = orig[prop];
+ }
+ }
+ }
+
+ this.element.trigger(event, data);
+ return !( $.isFunction(callback) &&
+ callback.apply(this.element[0], [event].concat(data)) === false ||
+ event.isDefaultPrevented() );
+ }
+ };
+
+ $.each({show: "fadeIn", hide: "fadeOut"}, function (method, defaultEffect) {
+ $.Widget.prototype["_" + method] = function (element, options, callback) {
+ if (typeof options === "string") {
+ options = {effect: options};
+ }
+ var hasOptions,
+ effectName = !options ?
+ method :
+ options === true || typeof options === "number" ?
+ defaultEffect :
+ options.effect || defaultEffect;
+ options = options || {};
+ if (typeof options === "number") {
+ options = {duration: options};
+ }
+ hasOptions = !$.isEmptyObject(options);
+ options.complete = callback;
+ if (options.delay) {
+ element.delay(options.delay);
+ }
+ if (hasOptions && $.effects && $.effects.effect[effectName]) {
+ element[method](options);
+ } else if (effectName !== method && element[effectName]) {
+ element[effectName](options.duration, options.easing, callback);
+ } else {
+ element.queue(function (next) {
+ $(this)[method]();
+ if (callback) {
+ callback.call(element[0]);
+ }
+ next();
+ });
+ }
+ };
+ });
+
+ var widget = $.widget;
+
+
+ /*!
+ * jQuery UI Mouse 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/mouse/
+ */
+
+
+ var mouseHandled = false;
+ $(document).mouseup(function () {
+ mouseHandled = false;
+ });
+
+ var mouse = $.widget("ui.mouse", {
+ version: "1.11.4",
+ options: {
+ cancel: "input,textarea,button,select,option",
+ distance: 1,
+ delay: 0
+ },
+ _mouseInit: function () {
+ var that = this;
+
+ this.element
+ .bind("mousedown." + this.widgetName, function (event) {
+ return that._mouseDown(event);
+ })
+ .bind("click." + this.widgetName, function (event) {
+ if (true === $.data(event.target, that.widgetName + ".preventClickEvent")) {
+ $.removeData(event.target, that.widgetName + ".preventClickEvent");
+ event.stopImmediatePropagation();
+ return false;
+ }
+ });
+
+ this.started = false;
+ },
+
+ // TODO: make sure destroying one instance of mouse doesn't mess with
+ // other instances of mouse
+ _mouseDestroy: function () {
+ this.element.unbind("." + this.widgetName);
+ if (this._mouseMoveDelegate) {
+ this.document
+ .unbind("mousemove." + this.widgetName, this._mouseMoveDelegate)
+ .unbind("mouseup." + this.widgetName, this._mouseUpDelegate);
+ }
+ },
+
+ _mouseDown: function (event) {
+ // don't let more than one widget handle mouseStart
+ if (mouseHandled) {
+ return;
+ }
+
+ this._mouseMoved = false;
+
+ // we may have missed mouseup (out of window)
+ (this._mouseStarted && this._mouseUp(event));
+
+ this._mouseDownEvent = event;
+
+ var that = this,
+ btnIsLeft = (event.which === 1),
+ // event.target.nodeName works around a bug in IE 8 with
+ // disabled inputs (#7620)
+ elIsCancel = (typeof this.options.cancel === "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false);
+ if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
+ return true;
+ }
+
+ this.mouseDelayMet = !this.options.delay;
+ if (!this.mouseDelayMet) {
+ this._mouseDelayTimer = setTimeout(function () {
+ that.mouseDelayMet = true;
+ }, this.options.delay);
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted = (this._mouseStart(event) !== false);
+ if (!this._mouseStarted) {
+ event.preventDefault();
+ return true;
+ }
+ }
+
+ // Click event may never have fired (Gecko & Opera)
+ if (true === $.data(event.target, this.widgetName + ".preventClickEvent")) {
+ $.removeData(event.target, this.widgetName + ".preventClickEvent");
+ }
+
+ // these delegates are required to keep context
+ this._mouseMoveDelegate = function (event) {
+ return that._mouseMove(event);
+ };
+ this._mouseUpDelegate = function (event) {
+ return that._mouseUp(event);
+ };
+
+ this.document
+ .bind("mousemove." + this.widgetName, this._mouseMoveDelegate)
+ .bind("mouseup." + this.widgetName, this._mouseUpDelegate);
+
+ event.preventDefault();
+
+ mouseHandled = true;
+ return true;
+ },
+
+ _mouseMove: function (event) {
+ // Only check for mouseups outside the document if you've moved inside the document
+ // at least once. This prevents the firing of mouseup in the case of IE<9, which will
+ // fire a mousemove event if content is placed under the cursor. See #7778
+ // Support: IE <9
+ if (this._mouseMoved) {
+ // IE mouseup check - mouseup happened when mouse was out of window
+ if ($.ui.ie && ( !document.documentMode || document.documentMode < 9 ) && !event.button) {
+ return this._mouseUp(event);
+
+ // Iframe mouseup check - mouseup occurred in another document
+ } else if (!event.which) {
+ return this._mouseUp(event);
+ }
+ }
+
+ if (event.which || event.button) {
+ this._mouseMoved = true;
+ }
+
+ if (this._mouseStarted) {
+ this._mouseDrag(event);
+ return event.preventDefault();
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted =
+ (this._mouseStart(this._mouseDownEvent, event) !== false);
+ (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+ }
+
+ return !this._mouseStarted;
+ },
+
+ _mouseUp: function (event) {
+ this.document
+ .unbind("mousemove." + this.widgetName, this._mouseMoveDelegate)
+ .unbind("mouseup." + this.widgetName, this._mouseUpDelegate);
+
+ if (this._mouseStarted) {
+ this._mouseStarted = false;
+
+ if (event.target === this._mouseDownEvent.target) {
+ $.data(event.target, this.widgetName + ".preventClickEvent", true);
+ }
+
+ this._mouseStop(event);
+ }
+
+ mouseHandled = false;
+ return false;
+ },
+
+ _mouseDistanceMet: function (event) {
+ return (Math.max(
+ Math.abs(this._mouseDownEvent.pageX - event.pageX),
+ Math.abs(this._mouseDownEvent.pageY - event.pageY)
+ ) >= this.options.distance
+ );
+ },
+
+ _mouseDelayMet: function (/* event */) {
+ return this.mouseDelayMet;
+ },
+
+ // These are placeholder methods, to be overriden by extending plugin
+ _mouseStart: function (/* event */) {
+ },
+ _mouseDrag: function (/* event */) {
+ },
+ _mouseStop: function (/* event */) {
+ },
+ _mouseCapture: function (/* event */) {
+ return true;
+ }
+ });
+
+
+ /*!
+ * jQuery UI Position 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/position/
+ */
+
+ (function () {
+
+ $.ui = $.ui || {};
+
+ var cachedScrollbarWidth, supportsOffsetFractions,
+ max = Math.max,
+ abs = Math.abs,
+ round = Math.round,
+ rhorizontal = /left|center|right/,
+ rvertical = /top|center|bottom/,
+ roffset = /[\+\-]\d+(\.[\d]+)?%?/,
+ rposition = /^\w+/,
+ rpercent = /%$/,
+ _position = $.fn.position;
+
+ function getOffsets(offsets, width, height) {
+ return [
+ parseFloat(offsets[0]) * ( rpercent.test(offsets[0]) ? width / 100 : 1 ),
+ parseFloat(offsets[1]) * ( rpercent.test(offsets[1]) ? height / 100 : 1 )
+ ];
+ }
+
+ function parseCss(element, property) {
+ return parseInt($.css(element, property), 10) || 0;
+ }
+
+ function getDimensions(elem) {
+ var raw = elem[0];
+ if (raw.nodeType === 9) {
+ return {
+ width: elem.width(),
+ height: elem.height(),
+ offset: {top: 0, left: 0}
+ };
+ }
+ if ($.isWindow(raw)) {
+ return {
+ width: elem.width(),
+ height: elem.height(),
+ offset: {top: elem.scrollTop(), left: elem.scrollLeft()}
+ };
+ }
+ if (raw.preventDefault) {
+ return {
+ width: 0,
+ height: 0,
+ offset: {top: raw.pageY, left: raw.pageX}
+ };
+ }
+ return {
+ width: elem.outerWidth(),
+ height: elem.outerHeight(),
+ offset: elem.offset()
+ };
+ }
+
+ $.position = {
+ scrollbarWidth: function () {
+ if (cachedScrollbarWidth !== undefined) {
+ return cachedScrollbarWidth;
+ }
+ var w1, w2,
+ div = $("<div style='display:block;position:absolute;width:50px;height:50px;overflow:hidden;'><div style='height:100px;width:auto;'></div></div>"),
+ innerDiv = div.children()[0];
+
+ $("body").append(div);
+ w1 = innerDiv.offsetWidth;
+ div.css("overflow", "scroll");
+
+ w2 = innerDiv.offsetWidth;
+
+ if (w1 === w2) {
+ w2 = div[0].clientWidth;
+ }
+
+ div.remove();
+
+ return (cachedScrollbarWidth = w1 - w2);
+ },
+ getScrollInfo: function (within) {
+ var overflowX = within.isWindow || within.isDocument ? "" :
+ within.element.css("overflow-x"),
+ overflowY = within.isWindow || within.isDocument ? "" :
+ within.element.css("overflow-y"),
+ hasOverflowX = overflowX === "scroll" ||
+ ( overflowX === "auto" && within.width < within.element[0].scrollWidth ),
+ hasOverflowY = overflowY === "scroll" ||
+ ( overflowY === "auto" && within.height < within.element[0].scrollHeight );
+ return {
+ width: hasOverflowY ? $.position.scrollbarWidth() : 0,
+ height: hasOverflowX ? $.position.scrollbarWidth() : 0
+ };
+ },
+ getWithinInfo: function (element) {
+ var withinElement = $(element || window),
+ isWindow = $.isWindow(withinElement[0]),
+ isDocument = !!withinElement[0] && withinElement[0].nodeType === 9;
+ return {
+ element: withinElement,
+ isWindow: isWindow,
+ isDocument: isDocument,
+ offset: withinElement.offset() || {left: 0, top: 0},
+ scrollLeft: withinElement.scrollLeft(),
+ scrollTop: withinElement.scrollTop(),
+
+ // support: jQuery 1.6.x
+ // jQuery 1.6 doesn't support .outerWidth/Height() on documents or windows
+ width: isWindow || isDocument ? withinElement.width() : withinElement.outerWidth(),
+ height: isWindow || isDocument ? withinElement.height() : withinElement.outerHeight()
+ };
+ }
+ };
+
+ $.fn.position = function (options) {
+ if (!options || !options.of) {
+ return _position.apply(this, arguments);
+ }
+
+ // make a copy, we don't want to modify arguments
+ options = $.extend({}, options);
+
+ var atOffset, targetWidth, targetHeight, targetOffset, basePosition, dimensions,
+ target = $(options.of),
+ within = $.position.getWithinInfo(options.within),
+ scrollInfo = $.position.getScrollInfo(within),
+ collision = ( options.collision || "flip" ).split(" "),
+ offsets = {};
+
+ dimensions = getDimensions(target);
+ if (target[0].preventDefault) {
+ // force left top to allow flipping
+ options.at = "left top";
+ }
+ targetWidth = dimensions.width;
+ targetHeight = dimensions.height;
+ targetOffset = dimensions.offset;
+ // clone to reuse original targetOffset later
+ basePosition = $.extend({}, targetOffset);
+
+ // force my and at to have valid horizontal and vertical positions
+ // if a value is missing or invalid, it will be converted to center
+ $.each(["my", "at"], function () {
+ var pos = ( options[this] || "" ).split(" "),
+ horizontalOffset,
+ verticalOffset;
+
+ if (pos.length === 1) {
+ pos = rhorizontal.test(pos[0]) ?
+ pos.concat(["center"]) :
+ rvertical.test(pos[0]) ?
+ ["center"].concat(pos) :
+ ["center", "center"];
+ }
+ pos[0] = rhorizontal.test(pos[0]) ? pos[0] : "center";
+ pos[1] = rvertical.test(pos[1]) ? pos[1] : "center";
+
+ // calculate offsets
+ horizontalOffset = roffset.exec(pos[0]);
+ verticalOffset = roffset.exec(pos[1]);
+ offsets[this] = [
+ horizontalOffset ? horizontalOffset[0] : 0,
+ verticalOffset ? verticalOffset[0] : 0
+ ];
+
+ // reduce to just the positions without the offsets
+ options[this] = [
+ rposition.exec(pos[0])[0],
+ rposition.exec(pos[1])[0]
+ ];
+ });
+
+ // normalize collision option
+ if (collision.length === 1) {
+ collision[1] = collision[0];
+ }
+
+ if (options.at[0] === "right") {
+ basePosition.left += targetWidth;
+ } else if (options.at[0] === "center") {
+ basePosition.left += targetWidth / 2;
+ }
+
+ if (options.at[1] === "bottom") {
+ basePosition.top += targetHeight;
+ } else if (options.at[1] === "center") {
+ basePosition.top += targetHeight / 2;
+ }
+
+ atOffset = getOffsets(offsets.at, targetWidth, targetHeight);
+ basePosition.left += atOffset[0];
+ basePosition.top += atOffset[1];
+
+ return this.each(function () {
+ var collisionPosition, using,
+ elem = $(this),
+ elemWidth = elem.outerWidth(),
+ elemHeight = elem.outerHeight(),
+ marginLeft = parseCss(this, "marginLeft"),
+ marginTop = parseCss(this, "marginTop"),
+ collisionWidth = elemWidth + marginLeft + parseCss(this, "marginRight") + scrollInfo.width,
+ collisionHeight = elemHeight + marginTop + parseCss(this, "marginBottom") + scrollInfo.height,
+ position = $.extend({}, basePosition),
+ myOffset = getOffsets(offsets.my, elem.outerWidth(), elem.outerHeight());
+
+ if (options.my[0] === "right") {
+ position.left -= elemWidth;
+ } else if (options.my[0] === "center") {
+ position.left -= elemWidth / 2;
+ }
+
+ if (options.my[1] === "bottom") {
+ position.top -= elemHeight;
+ } else if (options.my[1] === "center") {
+ position.top -= elemHeight / 2;
+ }
+
+ position.left += myOffset[0];
+ position.top += myOffset[1];
+
+ // if the browser doesn't support fractions, then round for consistent results
+ if (!supportsOffsetFractions) {
+ position.left = round(position.left);
+ position.top = round(position.top);
+ }
+
+ collisionPosition = {
+ marginLeft: marginLeft,
+ marginTop: marginTop
+ };
+
+ $.each(["left", "top"], function (i, dir) {
+ if ($.ui.position[collision[i]]) {
+ $.ui.position[collision[i]][dir](position, {
+ targetWidth: targetWidth,
+ targetHeight: targetHeight,
+ elemWidth: elemWidth,
+ elemHeight: elemHeight,
+ collisionPosition: collisionPosition,
+ collisionWidth: collisionWidth,
+ collisionHeight: collisionHeight,
+ offset: [atOffset[0] + myOffset[0], atOffset [1] + myOffset[1]],
+ my: options.my,
+ at: options.at,
+ within: within,
+ elem: elem
+ });
+ }
+ });
+
+ if (options.using) {
+ // adds feedback as second argument to using callback, if present
+ using = function (props) {
+ var left = targetOffset.left - position.left,
+ right = left + targetWidth - elemWidth,
+ top = targetOffset.top - position.top,
+ bottom = top + targetHeight - elemHeight,
+ feedback = {
+ target: {
+ element: target,
+ left: targetOffset.left,
+ top: targetOffset.top,
+ width: targetWidth,
+ height: targetHeight
+ },
+ element: {
+ element: elem,
+ left: position.left,
+ top: position.top,
+ width: elemWidth,
+ height: elemHeight
+ },
+ horizontal: right < 0 ? "left" : left > 0 ? "right" : "center",
+ vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle"
+ };
+ if (targetWidth < elemWidth && abs(left + right) < targetWidth) {
+ feedback.horizontal = "center";
+ }
+ if (targetHeight < elemHeight && abs(top + bottom) < targetHeight) {
+ feedback.vertical = "middle";
+ }
+ if (max(abs(left), abs(right)) > max(abs(top), abs(bottom))) {
+ feedback.important = "horizontal";
+ } else {
+ feedback.important = "vertical";
+ }
+ options.using.call(this, props, feedback);
+ };
+ }
+
+ elem.offset($.extend(position, {using: using}));
+ });
+ };
+
+ $.ui.position = {
+ fit: {
+ left: function (position, data) {
+ var within = data.within,
+ withinOffset = within.isWindow ? within.scrollLeft : within.offset.left,
+ outerWidth = within.width,
+ collisionPosLeft = position.left - data.collisionPosition.marginLeft,
+ overLeft = withinOffset - collisionPosLeft,
+ overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset,
+ newOverRight;
+
+ // element is wider than within
+ if (data.collisionWidth > outerWidth) {
+ // element is initially over the left side of within
+ if (overLeft > 0 && overRight <= 0) {
+ newOverRight = position.left + overLeft + data.collisionWidth - outerWidth - withinOffset;
+ position.left += overLeft - newOverRight;
+ // element is initially over right side of within
+ } else if (overRight > 0 && overLeft <= 0) {
+ position.left = withinOffset;
+ // element is initially over both left and right sides of within
+ } else {
+ if (overLeft > overRight) {
+ position.left = withinOffset + outerWidth - data.collisionWidth;
+ } else {
+ position.left = withinOffset;
+ }
+ }
+ // too far left -> align with left edge
+ } else if (overLeft > 0) {
+ position.left += overLeft;
+ // too far right -> align with right edge
+ } else if (overRight > 0) {
+ position.left -= overRight;
+ // adjust based on position and margin
+ } else {
+ position.left = max(position.left - collisionPosLeft, position.left);
+ }
+ },
+ top: function (position, data) {
+ var within = data.within,
+ withinOffset = within.isWindow ? within.scrollTop : within.offset.top,
+ outerHeight = data.within.height,
+ collisionPosTop = position.top - data.collisionPosition.marginTop,
+ overTop = withinOffset - collisionPosTop,
+ overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset,
+ newOverBottom;
+
+ // element is taller than within
+ if (data.collisionHeight > outerHeight) {
+ // element is initially over the top of within
+ if (overTop > 0 && overBottom <= 0) {
+ newOverBottom = position.top + overTop + data.collisionHeight - outerHeight - withinOffset;
+ position.top += overTop - newOverBottom;
+ // element is initially over bottom of within
+ } else if (overBottom > 0 && overTop <= 0) {
+ position.top = withinOffset;
+ // element is initially over both top and bottom of within
+ } else {
+ if (overTop > overBottom) {
+ position.top = withinOffset + outerHeight - data.collisionHeight;
+ } else {
+ position.top = withinOffset;
+ }
+ }
+ // too far up -> align with top
+ } else if (overTop > 0) {
+ position.top += overTop;
+ // too far down -> align with bottom edge
+ } else if (overBottom > 0) {
+ position.top -= overBottom;
+ // adjust based on position and margin
+ } else {
+ position.top = max(position.top - collisionPosTop, position.top);
+ }
+ }
+ },
+ flip: {
+ left: function (position, data) {
+ var within = data.within,
+ withinOffset = within.offset.left + within.scrollLeft,
+ outerWidth = within.width,
+ offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left,
+ collisionPosLeft = position.left - data.collisionPosition.marginLeft,
+ overLeft = collisionPosLeft - offsetLeft,
+ overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft,
+ myOffset = data.my[0] === "left" ?
+ -data.elemWidth :
+ data.my[0] === "right" ?
+ data.elemWidth :
+ 0,
+ atOffset = data.at[0] === "left" ?
+ data.targetWidth :
+ data.at[0] === "right" ?
+ -data.targetWidth :
+ 0,
+ offset = -2 * data.offset[0],
+ newOverRight,
+ newOverLeft;
+
+ if (overLeft < 0) {
+ newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth - outerWidth - withinOffset;
+ if (newOverRight < 0 || newOverRight < abs(overLeft)) {
+ position.left += myOffset + atOffset + offset;
+ }
+ } else if (overRight > 0) {
+ newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset + atOffset + offset - offsetLeft;
+ if (newOverLeft > 0 || abs(newOverLeft) < overRight) {
+ position.left += myOffset + atOffset + offset;
+ }
+ }
+ },
+ top: function (position, data) {
+ var within = data.within,
+ withinOffset = within.offset.top + within.scrollTop,
+ outerHeight = within.height,
+ offsetTop = within.isWindow ? within.scrollTop : within.offset.top,
+ collisionPosTop = position.top - data.collisionPosition.marginTop,
+ overTop = collisionPosTop - offsetTop,
+ overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop,
+ top = data.my[1] === "top",
+ myOffset = top ?
+ -data.elemHeight :
+ data.my[1] === "bottom" ?
+ data.elemHeight :
+ 0,
+ atOffset = data.at[1] === "top" ?
+ data.targetHeight :
+ data.at[1] === "bottom" ?
+ -data.targetHeight :
+ 0,
+ offset = -2 * data.offset[1],
+ newOverTop,
+ newOverBottom;
+ if (overTop < 0) {
+ newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight - outerHeight - withinOffset;
+ if (newOverBottom < 0 || newOverBottom < abs(overTop)) {
+ position.top += myOffset + atOffset + offset;
+ }
+ } else if (overBottom > 0) {
+ newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset + offset - offsetTop;
+ if (newOverTop > 0 || abs(newOverTop) < overBottom) {
+ position.top += myOffset + atOffset + offset;
+ }
+ }
+ }
+ },
+ flipfit: {
+ left: function () {
+ $.ui.position.flip.left.apply(this, arguments);
+ $.ui.position.fit.left.apply(this, arguments);
+ },
+ top: function () {
+ $.ui.position.flip.top.apply(this, arguments);
+ $.ui.position.fit.top.apply(this, arguments);
+ }
+ }
+ };
+
+// fraction support test
+ (function () {
+ var testElement, testElementParent, testElementStyle, offsetLeft, i,
+ body = document.getElementsByTagName("body")[0],
+ div = document.createElement("div");
+
+ //Create a "fake body" for testing based on method used in jQuery.support
+ testElement = document.createElement(body ? "div" : "body");
+ testElementStyle = {
+ visibility: "hidden",
+ width: 0,
+ height: 0,
+ border: 0,
+ margin: 0,
+ background: "none"
+ };
+ if (body) {
+ $.extend(testElementStyle, {
+ position: "absolute",
+ left: "-1000px",
+ top: "-1000px"
+ });
+ }
+ for (i in testElementStyle) {
+ testElement.style[i] = testElementStyle[i];
+ }
+ testElement.appendChild(div);
+ testElementParent = body || document.documentElement;
+ testElementParent.insertBefore(testElement, testElementParent.firstChild);
+
+ div.style.cssText = "position: absolute; left: 10.7432222px;";
+
+ offsetLeft = $(div).offset().left;
+ supportsOffsetFractions = offsetLeft > 10 && offsetLeft < 11;
+
+ testElement.innerHTML = "";
+ testElementParent.removeChild(testElement);
+ })();
+
+ })();
+
+ var position = $.ui.position;
+
+
+ /*!
+ * jQuery UI Draggable 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/draggable/
+ */
+
+
+ $.widget("ui.draggable", $.ui.mouse, {
+ version: "1.11.4",
+ widgetEventPrefix: "drag",
+ options: {
+ addClasses: true,
+ appendTo: "parent",
+ axis: false,
+ connectToSortable: false,
+ containment: false,
+ cursor: "auto",
+ cursorAt: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ iframeFix: false,
+ opacity: false,
+ refreshPositions: false,
+ revert: false,
+ revertDuration: 500,
+ scope: "default",
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ snap: false,
+ snapMode: "both",
+ snapTolerance: 20,
+ stack: false,
+ zIndex: false,
+
+ // callbacks
+ drag: null,
+ start: null,
+ stop: null
+ },
+ _create: function () {
+
+ if (this.options.helper === "original") {
+ this._setPositionRelative();
+ }
+ if (this.options.addClasses) {
+ this.element.addClass("ui-draggable");
+ }
+ if (this.options.disabled) {
+ this.element.addClass("ui-draggable-disabled");
+ }
+ this._setHandleClassName();
+
+ this._mouseInit();
+ },
+
+ _setOption: function (key, value) {
+ this._super(key, value);
+ if (key === "handle") {
+ this._removeHandleClassName();
+ this._setHandleClassName();
+ }
+ },
+
+ _destroy: function () {
+ if (( this.helper || this.element ).is(".ui-draggable-dragging")) {
+ this.destroyOnClear = true;
+ return;
+ }
+ this.element.removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");
+ this._removeHandleClassName();
+ this._mouseDestroy();
+ },
+
+ _mouseCapture: function (event) {
+ var o = this.options;
+
+ this._blurActiveElement(event);
+
+ // among others, prevent a drag on a resizable-handle
+ if (this.helper || o.disabled || $(event.target).closest(".ui-resizable-handle").length > 0) {
+ return false;
+ }
+
+ //Quit if we're not on a valid handle
+ this.handle = this._getHandle(event);
+ if (!this.handle) {
+ return false;
+ }
+
+ this._blockFrames(o.iframeFix === true ? "iframe" : o.iframeFix);
+
+ return true;
+
+ },
+
+ _blockFrames: function (selector) {
+ this.iframeBlocks = this.document.find(selector).map(function () {
+ var iframe = $(this);
+
+ return $("<div>")
+ .css("position", "absolute")
+ .appendTo(iframe.parent())
+ .outerWidth(iframe.outerWidth())
+ .outerHeight(iframe.outerHeight())
+ .offset(iframe.offset())[0];
+ });
+ },
+
+ _unblockFrames: function () {
+ if (this.iframeBlocks) {
+ this.iframeBlocks.remove();
+ delete this.iframeBlocks;
+ }
+ },
+
+ _blurActiveElement: function (event) {
+ var document = this.document[0];
+
+ // Only need to blur if the event occurred on the draggable itself, see #10527
+ if (!this.handleElement.is(event.target)) {
+ return;
+ }
+
+ // support: IE9
+ // IE9 throws an "Unspecified error" accessing document.activeElement from an <iframe>
+ try {
+
+ // Support: IE9, IE10
+ // If the <body> is blurred, IE will switch windows, see #9520
+ if (document.activeElement && document.activeElement.nodeName.toLowerCase() !== "body") {
+
+ // Blur any element that currently has focus, see #4261
+ $(document.activeElement).blur();
+ }
+ } catch (error) {
+ }
+ },
+
+ _mouseStart: function (event) {
+
+ var o = this.options;
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ this.helper.addClass("ui-draggable-dragging");
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ //If ddmanager is used for droppables, set the global draggable
+ if ($.ui.ddmanager) {
+ $.ui.ddmanager.current = this;
+ }
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Store the helper's css position
+ this.cssPosition = this.helper.css("position");
+ this.scrollParent = this.helper.scrollParent(true);
+ this.offsetParent = this.helper.offsetParent();
+ this.hasFixedAncestor = this.helper.parents().filter(function () {
+ return $(this).css("position") === "fixed";
+ }).length > 0;
+
+ //The element's absolute position on the page minus margins
+ this.positionAbs = this.element.offset();
+ this._refreshOffsets(event);
+
+ //Generate the original position
+ this.originalPosition = this.position = this._generatePosition(event, false);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if "cursorAt" is supplied
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+ //Set a containment if given in the options
+ this._setContainment();
+
+ //Trigger event + callbacks
+ if (this._trigger("start", event) === false) {
+ this._clear();
+ return false;
+ }
+
+ //Recache the helper size
+ this._cacheHelperProportions();
+
+ //Prepare the droppable offsets
+ if ($.ui.ddmanager && !o.dropBehaviour) {
+ $.ui.ddmanager.prepareOffsets(this, event);
+ }
+
+ // Reset helper's right/bottom css if they're set and set explicit width/height instead
+ // as this prevents resizing of elements with right/bottom set (see #7772)
+ this._normalizeRightBottom();
+
+ this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+
+ //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003)
+ if ($.ui.ddmanager) {
+ $.ui.ddmanager.dragStart(this, event);
+ }
+
+ return true;
+ },
+
+ _refreshOffsets: function (event) {
+ this.offset = {
+ top: this.positionAbs.top - this.margins.top,
+ left: this.positionAbs.left - this.margins.left,
+ scroll: false,
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset()
+ };
+
+ this.offset.click = {
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ };
+ },
+
+ _mouseDrag: function (event, noPropagation) {
+ // reset any necessary cached properties (see #5009)
+ if (this.hasFixedAncestor) {
+ this.offset.parent = this._getParentOffset();
+ }
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event, true);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Call plugins and callbacks and use the resulting position if something is returned
+ if (!noPropagation) {
+ var ui = this._uiHash();
+ if (this._trigger("drag", event, ui) === false) {
+ this._mouseUp({});
+ return false;
+ }
+ this.position = ui.position;
+ }
+
+ this.helper[0].style.left = this.position.left + "px";
+ this.helper[0].style.top = this.position.top + "px";
+
+ if ($.ui.ddmanager) {
+ $.ui.ddmanager.drag(this, event);
+ }
+
+ return false;
+ },
+
+ _mouseStop: function (event) {
+
+ //If we are using droppables, inform the manager about the drop
+ var that = this,
+ dropped = false;
+ if ($.ui.ddmanager && !this.options.dropBehaviour) {
+ dropped = $.ui.ddmanager.drop(this, event);
+ }
+
+ //if a drop comes from outside (a sortable)
+ if (this.dropped) {
+ dropped = this.dropped;
+ this.dropped = false;
+ }
+
+ if ((this.options.revert === "invalid" && !dropped) || (this.options.revert === "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
+ $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function () {
+ if (that._trigger("stop", event) !== false) {
+ that._clear();
+ }
+ });
+ } else {
+ if (this._trigger("stop", event) !== false) {
+ this._clear();
+ }
+ }
+
+ return false;
+ },
+
+ _mouseUp: function (event) {
+ this._unblockFrames();
+
+ //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003)
+ if ($.ui.ddmanager) {
+ $.ui.ddmanager.dragStop(this, event);
+ }
+
+ // Only need to focus if the event occurred on the draggable itself, see #10527
+ if (this.handleElement.is(event.target)) {
+ // The interaction is over; whether or not the click resulted in a drag, focus the element
+ this.element.focus();
+ }
+
+ return $.ui.mouse.prototype._mouseUp.call(this, event);
+ },
+
+ cancel: function () {
+
+ if (this.helper.is(".ui-draggable-dragging")) {
+ this._mouseUp({});
+ } else {
+ this._clear();
+ }
+
+ return this;
+
+ },
+
+ _getHandle: function (event) {
+ return this.options.handle ?
+ !!$(event.target).closest(this.element.find(this.options.handle)).length :
+ true;
+ },
+
+ _setHandleClassName: function () {
+ this.handleElement = this.options.handle ?
+ this.element.find(this.options.handle) : this.element;
+ this.handleElement.addClass("ui-draggable-handle");
+ },
+
+ _removeHandleClassName: function () {
+ this.handleElement.removeClass("ui-draggable-handle");
+ },
+
+ _createHelper: function (event) {
+
+ var o = this.options,
+ helperIsFunction = $.isFunction(o.helper),
+ helper = helperIsFunction ?
+ $(o.helper.apply(this.element[0], [event])) :
+ ( o.helper === "clone" ?
+ this.element.clone().removeAttr("id") :
+ this.element );
+
+ if (!helper.parents("body").length) {
+ helper.appendTo((o.appendTo === "parent" ? this.element[0].parentNode : o.appendTo));
+ }
+
+ // http://bugs.jqueryui.com/ticket/9446
+ // a helper function can return the original element
+ // which wouldn't have been set to relative in _create
+ if (helperIsFunction && helper[0] === this.element[0]) {
+ this._setPositionRelative();
+ }
+
+ if (helper[0] !== this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) {
+ helper.css("position", "absolute");
+ }
+
+ return helper;
+
+ },
+
+ _setPositionRelative: function () {
+ if (!( /^(?:r|a|f)/ ).test(this.element.css("position"))) {
+ this.element[0].style.position = "relative";
+ }
+ },
+
+ _adjustOffsetFromHelper: function (obj) {
+ if (typeof obj === "string") {
+ obj = obj.split(" ");
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ("left" in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ("right" in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ("top" in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ("bottom" in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
+ },
+
+ _isRootNode: function (element) {
+ return ( /(html|body)/i ).test(element.tagName) || element === this.document[0];
+ },
+
+ _getParentOffset: function () {
+
+ //Get the offsetParent and cache its position
+ var po = this.offsetParent.offset(),
+ document = this.document[0];
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if (this.cssPosition === "absolute" && this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if (this._isRootNode(this.offsetParent[0])) {
+ po = {top: 0, left: 0};
+ }
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"), 10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"), 10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function () {
+ if (this.cssPosition !== "relative") {
+ return {top: 0, left: 0};
+ }
+
+ var p = this.element.position(),
+ scrollIsRootNode = this._isRootNode(this.scrollParent[0]);
+
+ return {
+ top: p.top - ( parseInt(this.helper.css("top"), 10) || 0 ) + ( !scrollIsRootNode ? this.scrollParent.scrollTop() : 0 ),
+ left: p.left - ( parseInt(this.helper.css("left"), 10) || 0 ) + ( !scrollIsRootNode ? this.scrollParent.scrollLeft() : 0 )
+ };
+
+ },
+
+ _cacheMargins: function () {
+ this.margins = {
+ left: (parseInt(this.element.css("marginLeft"), 10) || 0),
+ top: (parseInt(this.element.css("marginTop"), 10) || 0),
+ right: (parseInt(this.element.css("marginRight"), 10) || 0),
+ bottom: (parseInt(this.element.css("marginBottom"), 10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function () {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function () {
+
+ var isUserScrollable, c, ce,
+ o = this.options,
+ document = this.document[0];
+
+ this.relativeContainer = null;
+
+ if (!o.containment) {
+ this.containment = null;
+ return;
+ }
+
+ if (o.containment === "window") {
+ this.containment = [
+ $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left,
+ $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top,
+ $(window).scrollLeft() + $(window).width() - this.helperProportions.width - this.margins.left,
+ $(window).scrollTop() + ( $(window).height() || document.body.parentNode.scrollHeight ) - this.helperProportions.height - this.margins.top
+ ];
+ return;
+ }
+
+ if (o.containment === "document") {
+ this.containment = [
+ 0,
+ 0,
+ $(document).width() - this.helperProportions.width - this.margins.left,
+ ( $(document).height() || document.body.parentNode.scrollHeight ) - this.helperProportions.height - this.margins.top
+ ];
+ return;
+ }
+
+ if (o.containment.constructor === Array) {
+ this.containment = o.containment;
+ return;
+ }
+
+ if (o.containment === "parent") {
+ o.containment = this.helper[0].parentNode;
+ }
+
+ c = $(o.containment);
+ ce = c[0];
+
+ if (!ce) {
+ return;
+ }
+
+ isUserScrollable = /(scroll|auto)/.test(c.css("overflow"));
+
+ this.containment = [
+ ( parseInt(c.css("borderLeftWidth"), 10) || 0 ) + ( parseInt(c.css("paddingLeft"), 10) || 0 ),
+ ( parseInt(c.css("borderTopWidth"), 10) || 0 ) + ( parseInt(c.css("paddingTop"), 10) || 0 ),
+ ( isUserScrollable ? Math.max(ce.scrollWidth, ce.offsetWidth) : ce.offsetWidth ) -
+ ( parseInt(c.css("borderRightWidth"), 10) || 0 ) -
+ ( parseInt(c.css("paddingRight"), 10) || 0 ) -
+ this.helperProportions.width -
+ this.margins.left -
+ this.margins.right,
+ ( isUserScrollable ? Math.max(ce.scrollHeight, ce.offsetHeight) : ce.offsetHeight ) -
+ ( parseInt(c.css("borderBottomWidth"), 10) || 0 ) -
+ ( parseInt(c.css("paddingBottom"), 10) || 0 ) -
+ this.helperProportions.height -
+ this.margins.top -
+ this.margins.bottom
+ ];
+ this.relativeContainer = c;
+ },
+
+ _convertPositionTo: function (d, pos) {
+
+ if (!pos) {
+ pos = this.position;
+ }
+
+ var mod = d === "absolute" ? 1 : -1,
+ scrollIsRootNode = this._isRootNode(this.scrollParent[0]);
+
+ return {
+ top: (
+ pos.top + // The absolute mouse position
+ this.offset.relative.top * mod + // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.top * mod - // The offsetParent's offset without borders (offset + border)
+ ( ( this.cssPosition === "fixed" ? -this.offset.scroll.top : ( scrollIsRootNode ? 0 : this.offset.scroll.top ) ) * mod)
+ ),
+ left: (
+ pos.left + // The absolute mouse position
+ this.offset.relative.left * mod + // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.left * mod - // The offsetParent's offset without borders (offset + border)
+ ( ( this.cssPosition === "fixed" ? -this.offset.scroll.left : ( scrollIsRootNode ? 0 : this.offset.scroll.left ) ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function (event, constrainPosition) {
+
+ var containment, co, top, left,
+ o = this.options,
+ scrollIsRootNode = this._isRootNode(this.scrollParent[0]),
+ pageX = event.pageX,
+ pageY = event.pageY;
+
+ // Cache the scroll
+ if (!scrollIsRootNode || !this.offset.scroll) {
+ this.offset.scroll = {
+ top: this.scrollParent.scrollTop(),
+ left: this.scrollParent.scrollLeft()
+ };
+ }
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ // If we are not dragging yet, we won't check for options
+ if (constrainPosition) {
+ if (this.containment) {
+ if (this.relativeContainer) {
+ co = this.relativeContainer.offset();
+ containment = [
+ this.containment[0] + co.left,
+ this.containment[1] + co.top,
+ this.containment[2] + co.left,
+ this.containment[3] + co.top
+ ];
+ } else {
+ containment = this.containment;
+ }
+
+ if (event.pageX - this.offset.click.left < containment[0]) {
+ pageX = containment[0] + this.offset.click.left;
+ }
+ if (event.pageY - this.offset.click.top < containment[1]) {
+ pageY = containment[1] + this.offset.click.top;
+ }
+ if (event.pageX - this.offset.click.left > containment[2]) {
+ pageX = containment[2] + this.offset.click.left;
+ }
+ if (event.pageY - this.offset.click.top > containment[3]) {
+ pageY = containment[3] + this.offset.click.top;
+ }
+ }
+
+ if (o.grid) {
+ //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950)
+ top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY;
+ pageY = containment ? ((top - this.offset.click.top >= containment[1] || top - this.offset.click.top > containment[3]) ? top : ((top - this.offset.click.top >= containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX;
+ pageX = containment ? ((left - this.offset.click.left >= containment[0] || left - this.offset.click.left > containment[2]) ? left : ((left - this.offset.click.left >= containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ if (o.axis === "y") {
+ pageX = this.originalPageX;
+ }
+
+ if (o.axis === "x") {
+ pageY = this.originalPageY;
+ }
+ }
+
+ return {
+ top: (
+ pageY - // The absolute mouse position
+ this.offset.click.top - // Click offset (relative to the element)
+ this.offset.relative.top - // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.top + // The offsetParent's offset without borders (offset + border)
+ ( this.cssPosition === "fixed" ? -this.offset.scroll.top : ( scrollIsRootNode ? 0 : this.offset.scroll.top ) )
+ ),
+ left: (
+ pageX - // The absolute mouse position
+ this.offset.click.left - // Click offset (relative to the element)
+ this.offset.relative.left - // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.left + // The offsetParent's offset without borders (offset + border)
+ ( this.cssPosition === "fixed" ? -this.offset.scroll.left : ( scrollIsRootNode ? 0 : this.offset.scroll.left ) )
+ )
+ };
+
+ },
+
+ _clear: function () {
+ this.helper.removeClass("ui-draggable-dragging");
+ if (this.helper[0] !== this.element[0] && !this.cancelHelperRemoval) {
+ this.helper.remove();
+ }
+ this.helper = null;
+ this.cancelHelperRemoval = false;
+ if (this.destroyOnClear) {
+ this.destroy();
+ }
+ },
+
+ _normalizeRightBottom: function () {
+ if (this.options.axis !== "y" && this.helper.css("right") !== "auto") {
+ this.helper.width(this.helper.width());
+ this.helper.css("right", "auto");
+ }
+ if (this.options.axis !== "x" && this.helper.css("bottom") !== "auto") {
+ this.helper.height(this.helper.height());
+ this.helper.css("bottom", "auto");
+ }
+ },
+
+ // From now on bulk stuff - mainly helpers
+
+ _trigger: function (type, event, ui) {
+ ui = ui || this._uiHash();
+ $.ui.plugin.call(this, type, [event, ui, this], true);
+
+ // Absolute position and offset (see #6884 ) have to be recalculated after plugins
+ if (/^(drag|start|stop)/.test(type)) {
+ this.positionAbs = this._convertPositionTo("absolute");
+ ui.offset = this.positionAbs;
+ }
+ return $.Widget.prototype._trigger.call(this, type, event, ui);
+ },
+
+ plugins: {},
+
+ _uiHash: function () {
+ return {
+ helper: this.helper,
+ position: this.position,
+ originalPosition: this.originalPosition,
+ offset: this.positionAbs
+ };
+ }
+
+ });
+
+ $.ui.plugin.add("draggable", "connectToSortable", {
+ start: function (event, ui, draggable) {
+ var uiSortable = $.extend({}, ui, {
+ item: draggable.element
+ });
+
+ draggable.sortables = [];
+ $(draggable.options.connectToSortable).each(function () {
+ var sortable = $(this).sortable("instance");
+
+ if (sortable && !sortable.options.disabled) {
+ draggable.sortables.push(sortable);
+
+ // refreshPositions is called at drag start to refresh the containerCache
+ // which is used in drag. This ensures it's initialized and synchronized
+ // with any changes that might have happened on the page since initialization.
+ sortable.refreshPositions();
+ sortable._trigger("activate", event, uiSortable);
+ }
+ });
+ },
+ stop: function (event, ui, draggable) {
+ var uiSortable = $.extend({}, ui, {
+ item: draggable.element
+ });
+
+ draggable.cancelHelperRemoval = false;
+
+ $.each(draggable.sortables, function () {
+ var sortable = this;
+
+ if (sortable.isOver) {
+ sortable.isOver = 0;
+
+ // Allow this sortable to handle removing the helper
+ draggable.cancelHelperRemoval = true;
+ sortable.cancelHelperRemoval = false;
+
+ // Use _storedCSS To restore properties in the sortable,
+ // as this also handles revert (#9675) since the draggable
+ // may have modified them in unexpected ways (#8809)
+ sortable._storedCSS = {
+ position: sortable.placeholder.css("position"),
+ top: sortable.placeholder.css("top"),
+ left: sortable.placeholder.css("left")
+ };
+
+ sortable._mouseStop(event);
+
+ // Once drag has ended, the sortable should return to using
+ // its original helper, not the shared helper from draggable
+ sortable.options.helper = sortable.options._helper;
+ } else {
+ // Prevent this Sortable from removing the helper.
+ // However, don't set the draggable to remove the helper
+ // either as another connected Sortable may yet handle the removal.
+ sortable.cancelHelperRemoval = true;
+
+ sortable._trigger("deactivate", event, uiSortable);
+ }
+ });
+ },
+ drag: function (event, ui, draggable) {
+ $.each(draggable.sortables, function () {
+ var innermostIntersecting = false,
+ sortable = this;
+
+ // Copy over variables that sortable's _intersectsWith uses
+ sortable.positionAbs = draggable.positionAbs;
+ sortable.helperProportions = draggable.helperProportions;
+ sortable.offset.click = draggable.offset.click;
+
+ if (sortable._intersectsWith(sortable.containerCache)) {
+ innermostIntersecting = true;
+
+ $.each(draggable.sortables, function () {
+ // Copy over variables that sortable's _intersectsWith uses
+ this.positionAbs = draggable.positionAbs;
+ this.helperProportions = draggable.helperProportions;
+ this.offset.click = draggable.offset.click;
+
+ if (this !== sortable &&
+ this._intersectsWith(this.containerCache) &&
+ $.contains(sortable.element[0], this.element[0])) {
+ innermostIntersecting = false;
+ }
+
+ return innermostIntersecting;
+ });
+ }
+
+ if (innermostIntersecting) {
+ // If it intersects, we use a little isOver variable and set it once,
+ // so that the move-in stuff gets fired only once.
+ if (!sortable.isOver) {
+ sortable.isOver = 1;
+
+ // Store draggable's parent in case we need to reappend to it later.
+ draggable._parent = ui.helper.parent();
+
+ sortable.currentItem = ui.helper
+ .appendTo(sortable.element)
+ .data("ui-sortable-item", true);
+
+ // Store helper option to later restore it
+ sortable.options._helper = sortable.options.helper;
+
+ sortable.options.helper = function () {
+ return ui.helper[0];
+ };
+
+ // Fire the start events of the sortable with our passed browser event,
+ // and our own helper (so it doesn't create a new one)
+ event.target = sortable.currentItem[0];
+ sortable._mouseCapture(event, true);
+ sortable._mouseStart(event, true, true);
+
+ // Because the browser event is way off the new appended portlet,
+ // modify necessary variables to reflect the changes
+ sortable.offset.click.top = draggable.offset.click.top;
+ sortable.offset.click.left = draggable.offset.click.left;
+ sortable.offset.parent.left -= draggable.offset.parent.left -
+ sortable.offset.parent.left;
+ sortable.offset.parent.top -= draggable.offset.parent.top -
+ sortable.offset.parent.top;
+
+ draggable._trigger("toSortable", event);
+
+ // Inform draggable that the helper is in a valid drop zone,
+ // used solely in the revert option to handle "valid/invalid".
+ draggable.dropped = sortable.element;
+
+ // Need to refreshPositions of all sortables in the case that
+ // adding to one sortable changes the location of the other sortables (#9675)
+ $.each(draggable.sortables, function () {
+ this.refreshPositions();
+ });
+
+ // hack so receive/update callbacks work (mostly)
+ draggable.currentItem = draggable.element;
+ sortable.fromOutside = draggable;
+ }
+
+ if (sortable.currentItem) {
+ sortable._mouseDrag(event);
+ // Copy the sortable's position because the draggable's can potentially reflect
+ // a relative position, while sortable is always absolute, which the dragged
+ // element has now become. (#8809)
+ ui.position = sortable.position;
+ }
+ } else {
+ // If it doesn't intersect with the sortable, and it intersected before,
+ // we fake the drag stop of the sortable, but make sure it doesn't remove
+ // the helper by using cancelHelperRemoval.
+ if (sortable.isOver) {
+
+ sortable.isOver = 0;
+ sortable.cancelHelperRemoval = true;
+
+ // Calling sortable's mouseStop would trigger a revert,
+ // so revert must be temporarily false until after mouseStop is called.
+ sortable.options._revert = sortable.options.revert;
+ sortable.options.revert = false;
+
+ sortable._trigger("out", event, sortable._uiHash(sortable));
+ sortable._mouseStop(event, true);
+
+ // restore sortable behaviors that were modfied
+ // when the draggable entered the sortable area (#9481)
+ sortable.options.revert = sortable.options._revert;
+ sortable.options.helper = sortable.options._helper;
+
+ if (sortable.placeholder) {
+ sortable.placeholder.remove();
+ }
+
+ // Restore and recalculate the draggable's offset considering the sortable
+ // may have modified them in unexpected ways. (#8809, #10669)
+ ui.helper.appendTo(draggable._parent);
+ draggable._refreshOffsets(event);
+ ui.position = draggable._generatePosition(event, true);
+
+ draggable._trigger("fromSortable", event);
+
+ // Inform draggable that the helper is no longer in a valid drop zone
+ draggable.dropped = false;
+
+ // Need to refreshPositions of all sortables just in case removing
+ // from one sortable changes the location of other sortables (#9675)
+ $.each(draggable.sortables, function () {
+ this.refreshPositions();
+ });
+ }
+ }
+ });
+ }
+ });
+
+ $.ui.plugin.add("draggable", "cursor", {
+ start: function (event, ui, instance) {
+ var t = $("body"),
+ o = instance.options;
+
+ if (t.css("cursor")) {
+ o._cursor = t.css("cursor");
+ }
+ t.css("cursor", o.cursor);
+ },
+ stop: function (event, ui, instance) {
+ var o = instance.options;
+ if (o._cursor) {
+ $("body").css("cursor", o._cursor);
+ }
+ }
+ });
+
+ $.ui.plugin.add("draggable", "opacity", {
+ start: function (event, ui, instance) {
+ var t = $(ui.helper),
+ o = instance.options;
+ if (t.css("opacity")) {
+ o._opacity = t.css("opacity");
+ }
+ t.css("opacity", o.opacity);
+ },
+ stop: function (event, ui, instance) {
+ var o = instance.options;
+ if (o._opacity) {
+ $(ui.helper).css("opacity", o._opacity);
+ }
+ }
+ });
+
+ $.ui.plugin.add("draggable", "scroll", {
+ start: function (event, ui, i) {
+ if (!i.scrollParentNotHidden) {
+ i.scrollParentNotHidden = i.helper.scrollParent(false);
+ }
+
+ if (i.scrollParentNotHidden[0] !== i.document[0] && i.scrollParentNotHidden[0].tagName !== "HTML") {
+ i.overflowOffset = i.scrollParentNotHidden.offset();
+ }
+ },
+ drag: function (event, ui, i) {
+
+ var o = i.options,
+ scrolled = false,
+ scrollParent = i.scrollParentNotHidden[0],
+ document = i.document[0];
+
+ if (scrollParent !== document && scrollParent.tagName !== "HTML") {
+ if (!o.axis || o.axis !== "x") {
+ if (( i.overflowOffset.top + scrollParent.offsetHeight ) - event.pageY < o.scrollSensitivity) {
+ scrollParent.scrollTop = scrolled = scrollParent.scrollTop + o.scrollSpeed;
+ } else if (event.pageY - i.overflowOffset.top < o.scrollSensitivity) {
+ scrollParent.scrollTop = scrolled = scrollParent.scrollTop - o.scrollSpeed;
+ }
+ }
+
+ if (!o.axis || o.axis !== "y") {
+ if (( i.overflowOffset.left + scrollParent.offsetWidth ) - event.pageX < o.scrollSensitivity) {
+ scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft + o.scrollSpeed;
+ } else if (event.pageX - i.overflowOffset.left < o.scrollSensitivity) {
+ scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft - o.scrollSpeed;
+ }
+ }
+
+ } else {
+
+ if (!o.axis || o.axis !== "x") {
+ if (event.pageY - $(document).scrollTop() < o.scrollSensitivity) {
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ } else if ($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) {
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+ }
+ }
+
+ if (!o.axis || o.axis !== "y") {
+ if (event.pageX - $(document).scrollLeft() < o.scrollSensitivity) {
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ } else if ($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) {
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+ }
+ }
+
+ }
+
+ if (scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) {
+ $.ui.ddmanager.prepareOffsets(i, event);
+ }
+
+ }
+ });
+
+ $.ui.plugin.add("draggable", "snap", {
+ start: function (event, ui, i) {
+
+ var o = i.options;
+
+ i.snapElements = [];
+
+ $(o.snap.constructor !== String ? ( o.snap.items || ":data(ui-draggable)" ) : o.snap).each(function () {
+ var $t = $(this),
+ $o = $t.offset();
+ if (this !== i.element[0]) {
+ i.snapElements.push({
+ item: this,
+ width: $t.outerWidth(), height: $t.outerHeight(),
+ top: $o.top, left: $o.left
+ });
+ }
+ });
+
+ },
+ drag: function (event, ui, inst) {
+
+ var ts, bs, ls, rs, l, r, t, b, i, first,
+ o = inst.options,
+ d = o.snapTolerance,
+ x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+ y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+ for (i = inst.snapElements.length - 1; i >= 0; i--) {
+
+ l = inst.snapElements[i].left - inst.margins.left;
+ r = l + inst.snapElements[i].width;
+ t = inst.snapElements[i].top - inst.margins.top;
+ b = t + inst.snapElements[i].height;
+
+ if (x2 < l - d || x1 > r + d || y2 < t - d || y1 > b + d || !$.contains(inst.snapElements[i].item.ownerDocument, inst.snapElements[i].item)) {
+ if (inst.snapElements[i].snapping) {
+ (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), {snapItem: inst.snapElements[i].item})));
+ }
+ inst.snapElements[i].snapping = false;
+ continue;
+ }
+
+ if (o.snapMode !== "inner") {
+ ts = Math.abs(t - y2) <= d;
+ bs = Math.abs(b - y1) <= d;
+ ls = Math.abs(l - x2) <= d;
+ rs = Math.abs(r - x1) <= d;
+ if (ts) {
+ ui.position.top = inst._convertPositionTo("relative", {
+ top: t - inst.helperProportions.height,
+ left: 0
+ }).top;
+ }
+ if (bs) {
+ ui.position.top = inst._convertPositionTo("relative", {top: b, left: 0}).top;
+ }
+ if (ls) {
+ ui.position.left = inst._convertPositionTo("relative", {
+ top: 0,
+ left: l - inst.helperProportions.width
+ }).left;
+ }
+ if (rs) {
+ ui.position.left = inst._convertPositionTo("relative", {top: 0, left: r}).left;
+ }
+ }
+
+ first = (ts || bs || ls || rs);
+
+ if (o.snapMode !== "outer") {
+ ts = Math.abs(t - y1) <= d;
+ bs = Math.abs(b - y2) <= d;
+ ls = Math.abs(l - x1) <= d;
+ rs = Math.abs(r - x2) <= d;
+ if (ts) {
+ ui.position.top = inst._convertPositionTo("relative", {top: t, left: 0}).top;
+ }
+ if (bs) {
+ ui.position.top = inst._convertPositionTo("relative", {
+ top: b - inst.helperProportions.height,
+ left: 0
+ }).top;
+ }
+ if (ls) {
+ ui.position.left = inst._convertPositionTo("relative", {top: 0, left: l}).left;
+ }
+ if (rs) {
+ ui.position.left = inst._convertPositionTo("relative", {
+ top: 0,
+ left: r - inst.helperProportions.width
+ }).left;
+ }
+ }
+
+ if (!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) {
+ (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), {snapItem: inst.snapElements[i].item})));
+ }
+ inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+
+ }
+
+ }
+ });
+
+ $.ui.plugin.add("draggable", "stack", {
+ start: function (event, ui, instance) {
+ var min,
+ o = instance.options,
+ group = $.makeArray($(o.stack)).sort(function (a, b) {
+ return (parseInt($(a).css("zIndex"), 10) || 0) - (parseInt($(b).css("zIndex"), 10) || 0);
+ });
+
+ if (!group.length) {
+ return;
+ }
+
+ min = parseInt($(group[0]).css("zIndex"), 10) || 0;
+ $(group).each(function (i) {
+ $(this).css("zIndex", min + i);
+ });
+ this.css("zIndex", (min + group.length));
+ }
+ });
+
+ $.ui.plugin.add("draggable", "zIndex", {
+ start: function (event, ui, instance) {
+ var t = $(ui.helper),
+ o = instance.options;
+
+ if (t.css("zIndex")) {
+ o._zIndex = t.css("zIndex");
+ }
+ t.css("zIndex", o.zIndex);
+ },
+ stop: function (event, ui, instance) {
+ var o = instance.options;
+
+ if (o._zIndex) {
+ $(ui.helper).css("zIndex", o._zIndex);
+ }
+ }
+ });
+
+ var draggable = $.ui.draggable;
+
+
+ /*!
+ * jQuery UI Droppable 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/droppable/
+ */
+
+
+ $.widget("ui.droppable", {
+ version: "1.11.4",
+ widgetEventPrefix: "drop",
+ options: {
+ accept: "*",
+ activeClass: false,
+ addClasses: true,
+ greedy: false,
+ hoverClass: false,
+ scope: "default",
+ tolerance: "intersect",
+
+ // callbacks
+ activate: null,
+ deactivate: null,
+ drop: null,
+ out: null,
+ over: null
+ },
+ _create: function () {
+
+ var proportions,
+ o = this.options,
+ accept = o.accept;
+
+ this.isover = false;
+ this.isout = true;
+
+ this.accept = $.isFunction(accept) ? accept : function (d) {
+ return d.is(accept);
+ };
+
+ this.proportions = function (/* valueToWrite */) {
+ if (arguments.length) {
+ // Store the droppable's proportions
+ proportions = arguments[0];
+ } else {
+ // Retrieve or derive the droppable's proportions
+ return proportions ?
+ proportions :
+ proportions = {
+ width: this.element[0].offsetWidth,
+ height: this.element[0].offsetHeight
+ };
+ }
+ };
+
+ this._addToManager(o.scope);
+
+ o.addClasses && this.element.addClass("ui-droppable");
+
+ },
+
+ _addToManager: function (scope) {
+ // Add the reference and positions to the manager
+ $.ui.ddmanager.droppables[scope] = $.ui.ddmanager.droppables[scope] || [];
+ $.ui.ddmanager.droppables[scope].push(this);
+ },
+
+ _splice: function (drop) {
+ var i = 0;
+ for (; i < drop.length; i++) {
+ if (drop[i] === this) {
+ drop.splice(i, 1);
+ }
+ }
+ },
+
+ _destroy: function () {
+ var drop = $.ui.ddmanager.droppables[this.options.scope];
+
+ this._splice(drop);
+
+ this.element.removeClass("ui-droppable ui-droppable-disabled");
+ },
+
+ _setOption: function (key, value) {
+
+ if (key === "accept") {
+ this.accept = $.isFunction(value) ? value : function (d) {
+ return d.is(value);
+ };
+ } else if (key === "scope") {
+ var drop = $.ui.ddmanager.droppables[this.options.scope];
+
+ this._splice(drop);
+ this._addToManager(value);
+ }
+
+ this._super(key, value);
+ },
+
+ _activate: function (event) {
+ var draggable = $.ui.ddmanager.current;
+ if (this.options.activeClass) {
+ this.element.addClass(this.options.activeClass);
+ }
+ if (draggable) {
+ this._trigger("activate", event, this.ui(draggable));
+ }
+ },
+
+ _deactivate: function (event) {
+ var draggable = $.ui.ddmanager.current;
+ if (this.options.activeClass) {
+ this.element.removeClass(this.options.activeClass);
+ }
+ if (draggable) {
+ this._trigger("deactivate", event, this.ui(draggable));
+ }
+ },
+
+ _over: function (event) {
+
+ var draggable = $.ui.ddmanager.current;
+
+ // Bail if draggable and droppable are same element
+ if (!draggable || ( draggable.currentItem || draggable.element )[0] === this.element[0]) {
+ return;
+ }
+
+ if (this.accept.call(this.element[0], ( draggable.currentItem || draggable.element ))) {
+ if (this.options.hoverClass) {
+ this.element.addClass(this.options.hoverClass);
+ }
+ this._trigger("over", event, this.ui(draggable));
+ }
+
+ },
+
+ _out: function (event) {
+
+ var draggable = $.ui.ddmanager.current;
+
+ // Bail if draggable and droppable are same element
+ if (!draggable || ( draggable.currentItem || draggable.element )[0] === this.element[0]) {
+ return;
+ }
+
+ if (this.accept.call(this.element[0], ( draggable.currentItem || draggable.element ))) {
+ if (this.options.hoverClass) {
+ this.element.removeClass(this.options.hoverClass);
+ }
+ this._trigger("out", event, this.ui(draggable));
+ }
+
+ },
+
+ _drop: function (event, custom) {
+
+ var draggable = custom || $.ui.ddmanager.current,
+ childrenIntersection = false;
+
+ // Bail if draggable and droppable are same element
+ if (!draggable || ( draggable.currentItem || draggable.element )[0] === this.element[0]) {
+ return false;
+ }
+
+ this.element.find(":data(ui-droppable)").not(".ui-draggable-dragging").each(function () {
+ var inst = $(this).droppable("instance");
+ if (
+ inst.options.greedy && !inst.options.disabled &&
+ inst.options.scope === draggable.options.scope &&
+ inst.accept.call(inst.element[0], ( draggable.currentItem || draggable.element )) &&
+ $.ui.intersect(draggable, $.extend(inst, {offset: inst.element.offset()}), inst.options.tolerance, event)
+ ) {
+ childrenIntersection = true;
+ return false;
+ }
+ });
+ if (childrenIntersection) {
+ return false;
+ }
+
+ if (this.accept.call(this.element[0], ( draggable.currentItem || draggable.element ))) {
+ if (this.options.activeClass) {
+ this.element.removeClass(this.options.activeClass);
+ }
+ if (this.options.hoverClass) {
+ this.element.removeClass(this.options.hoverClass);
+ }
+ this._trigger("drop", event, this.ui(draggable));
+ return this.element;
+ }
+
+ return false;
+
+ },
+
+ ui: function (c) {
+ return {
+ draggable: ( c.currentItem || c.element ),
+ helper: c.helper,
+ position: c.position,
+ offset: c.positionAbs
+ };
+ }
+
+ });
+
+ $.ui.intersect = (function () {
+ function isOverAxis(x, reference, size) {
+ return ( x >= reference ) && ( x < ( reference + size ) );
+ }
+
+ return function (draggable, droppable, toleranceMode, event) {
+
+ if (!droppable.offset) {
+ return false;
+ }
+
+ var x1 = ( draggable.positionAbs || draggable.position.absolute ).left + draggable.margins.left,
+ y1 = ( draggable.positionAbs || draggable.position.absolute ).top + draggable.margins.top,
+ x2 = x1 + draggable.helperProportions.width,
+ y2 = y1 + draggable.helperProportions.height,
+ l = droppable.offset.left,
+ t = droppable.offset.top,
+ r = l + droppable.proportions().width,
+ b = t + droppable.proportions().height;
+
+ switch (toleranceMode) {
+ case "fit":
+ return ( l <= x1 && x2 <= r && t <= y1 && y2 <= b );
+ case "intersect":
+ return ( l < x1 + ( draggable.helperProportions.width / 2 ) && // Right Half
+ x2 - ( draggable.helperProportions.width / 2 ) < r && // Left Half
+ t < y1 + ( draggable.helperProportions.height / 2 ) && // Bottom Half
+ y2 - ( draggable.helperProportions.height / 2 ) < b ); // Top Half
+ case "pointer":
+ return isOverAxis(event.pageY, t, droppable.proportions().height) && isOverAxis(event.pageX, l, droppable.proportions().width);
+ case "touch":
+ return (
+ ( y1 >= t && y1 <= b ) || // Top edge touching
+ ( y2 >= t && y2 <= b ) || // Bottom edge touching
+ ( y1 < t && y2 > b ) // Surrounded vertically
+ ) && (
+ ( x1 >= l && x1 <= r ) || // Left edge touching
+ ( x2 >= l && x2 <= r ) || // Right edge touching
+ ( x1 < l && x2 > r ) // Surrounded horizontally
+ );
+ default:
+ return false;
+ }
+ };
+ })();
+
+ /*
+ This manager tracks offsets of draggables and droppables
+ */
+ $.ui.ddmanager = {
+ current: null,
+ droppables: {"default": []},
+ prepareOffsets: function (t, event) {
+
+ var i, j,
+ m = $.ui.ddmanager.droppables[t.options.scope] || [],
+ type = event ? event.type : null, // workaround for #2317
+ list = ( t.currentItem || t.element ).find(":data(ui-droppable)").addBack();
+
+ droppablesLoop: for (i = 0; i < m.length; i++) {
+
+ // No disabled and non-accepted
+ if (m[i].options.disabled || ( t && !m[i].accept.call(m[i].element[0], ( t.currentItem || t.element )) )) {
+ continue;
+ }
+
+ // Filter out elements in the current dragged item
+ for (j = 0; j < list.length; j++) {
+ if (list[j] === m[i].element[0]) {
+ m[i].proportions().height = 0;
+ continue droppablesLoop;
+ }
+ }
+
+ m[i].visible = m[i].element.css("display") !== "none";
+ if (!m[i].visible) {
+ continue;
+ }
+
+ // Activate the droppable if used directly from draggables
+ if (type === "mousedown") {
+ m[i]._activate.call(m[i], event);
+ }
+
+ m[i].offset = m[i].element.offset();
+ m[i].proportions({width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight});
+
+ }
+
+ },
+ drop: function (draggable, event) {
+
+ var dropped = false;
+ // Create a copy of the droppables in case the list changes during the drop (#9116)
+ $.each(( $.ui.ddmanager.droppables[draggable.options.scope] || [] ).slice(), function () {
+
+ if (!this.options) {
+ return;
+ }
+ if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance, event)) {
+ dropped = this._drop.call(this, event) || dropped;
+ }
+
+ if (!this.options.disabled && this.visible && this.accept.call(this.element[0], ( draggable.currentItem || draggable.element ))) {
+ this.isout = true;
+ this.isover = false;
+ this._deactivate.call(this, event);
+ }
+
+ });
+ return dropped;
+
+ },
+ dragStart: function (draggable, event) {
+ // Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003)
+ draggable.element.parentsUntil("body").bind("scroll.droppable", function () {
+ if (!draggable.options.refreshPositions) {
+ $.ui.ddmanager.prepareOffsets(draggable, event);
+ }
+ });
+ },
+ drag: function (draggable, event) {
+
+ // If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
+ if (draggable.options.refreshPositions) {
+ $.ui.ddmanager.prepareOffsets(draggable, event);
+ }
+
+ // Run through all droppables and check their positions based on specific tolerance options
+ $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function () {
+
+ if (this.options.disabled || this.greedyChild || !this.visible) {
+ return;
+ }
+
+ var parentInstance, scope, parent,
+ intersects = $.ui.intersect(draggable, this, this.options.tolerance, event),
+ c = !intersects && this.isover ? "isout" : ( intersects && !this.isover ? "isover" : null );
+ if (!c) {
+ return;
+ }
+
+ if (this.options.greedy) {
+ // find droppable parents with same scope
+ scope = this.options.scope;
+ parent = this.element.parents(":data(ui-droppable)").filter(function () {
+ return $(this).droppable("instance").options.scope === scope;
+ });
+
+ if (parent.length) {
+ parentInstance = $(parent[0]).droppable("instance");
+ parentInstance.greedyChild = ( c === "isover" );
+ }
+ }
+
+ // we just moved into a greedy child
+ if (parentInstance && c === "isover") {
+ parentInstance.isover = false;
+ parentInstance.isout = true;
+ parentInstance._out.call(parentInstance, event);
+ }
+
+ this[c] = true;
+ this[c === "isout" ? "isover" : "isout"] = false;
+ this[c === "isover" ? "_over" : "_out"].call(this, event);
+
+ // we just moved out of a greedy child
+ if (parentInstance && c === "isout") {
+ parentInstance.isout = false;
+ parentInstance.isover = true;
+ parentInstance._over.call(parentInstance, event);
+ }
+ });
+
+ },
+ dragStop: function (draggable, event) {
+ draggable.element.parentsUntil("body").unbind("scroll.droppable");
+ // Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003)
+ if (!draggable.options.refreshPositions) {
+ $.ui.ddmanager.prepareOffsets(draggable, event);
+ }
+ }
+ };
+
+ var droppable = $.ui.droppable;
+
+
+ /*!
+ * jQuery UI Resizable 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/resizable/
+ */
+
+
+ $.widget("ui.resizable", $.ui.mouse, {
+ version: "1.11.4",
+ widgetEventPrefix: "resize",
+ options: {
+ alsoResize: false,
+ animate: false,
+ animateDuration: "slow",
+ animateEasing: "swing",
+ aspectRatio: false,
+ autoHide: false,
+ containment: false,
+ ghost: false,
+ grid: false,
+ handles: "e,s,se",
+ helper: false,
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 10,
+ minWidth: 10,
+ // See #7960
+ zIndex: 90,
+
+ // callbacks
+ resize: null,
+ start: null,
+ stop: null
+ },
+
+ _num: function (value) {
+ return parseInt(value, 10) || 0;
+ },
+
+ _isNumber: function (value) {
+ return !isNaN(parseInt(value, 10));
+ },
+
+ _hasScroll: function (el, a) {
+
+ if ($(el).css("overflow") === "hidden") {
+ return false;
+ }
+
+ var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop",
+ has = false;
+
+ if (el[scroll] > 0) {
+ return true;
+ }
+
+ // TODO: determine which cases actually cause this to happen
+ // if the element doesn't have the scroll set, see if it's possible to
+ // set the scroll
+ el[scroll] = 1;
+ has = ( el[scroll] > 0 );
+ el[scroll] = 0;
+ return has;
+ },
+
+ _create: function () {
+
+ var n, i, handle, axis, hname,
+ that = this,
+ o = this.options;
+ this.element.addClass("ui-resizable");
+
+ $.extend(this, {
+ _aspectRatio: !!(o.aspectRatio),
+ aspectRatio: o.aspectRatio,
+ originalElement: this.element,
+ _proportionallyResizeElements: [],
+ _helper: o.helper || o.ghost || o.animate ? o.helper || "ui-resizable-helper" : null
+ });
+
+ // Wrap the element if it cannot hold child nodes
+ if (this.element[0].nodeName.match(/^(canvas|textarea|input|select|button|img)$/i)) {
+
+ this.element.wrap(
+ $("<div class='ui-wrapper' style='overflow: hidden;'></div>").css({
+ position: this.element.css("position"),
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight(),
+ top: this.element.css("top"),
+ left: this.element.css("left")
+ })
+ );
+
+ this.element = this.element.parent().data(
+ "ui-resizable", this.element.resizable("instance")
+ );
+
+ this.elementIsWrapper = true;
+
+ this.element.css({
+ marginLeft: this.originalElement.css("marginLeft"),
+ marginTop: this.originalElement.css("marginTop"),
+ marginRight: this.originalElement.css("marginRight"),
+ marginBottom: this.originalElement.css("marginBottom")
+ });
+ this.originalElement.css({
+ marginLeft: 0,
+ marginTop: 0,
+ marginRight: 0,
+ marginBottom: 0
+ });
+ // support: Safari
+ // Prevent Safari textarea resize
+ this.originalResizeStyle = this.originalElement.css("resize");
+ this.originalElement.css("resize", "none");
+
+ this._proportionallyResizeElements.push(this.originalElement.css({
+ position: "static",
+ zoom: 1,
+ display: "block"
+ }));
+
+ // support: IE9
+ // avoid IE jump (hard set the margin)
+ this.originalElement.css({margin: this.originalElement.css("margin")});
+
+ this._proportionallyResize();
+ }
+
+ this.handles = o.handles ||
+ ( !$(".ui-resizable-handle", this.element).length ?
+ "e,s,se" : {
+ n: ".ui-resizable-n",
+ e: ".ui-resizable-e",
+ s: ".ui-resizable-s",
+ w: ".ui-resizable-w",
+ se: ".ui-resizable-se",
+ sw: ".ui-resizable-sw",
+ ne: ".ui-resizable-ne",
+ nw: ".ui-resizable-nw"
+ } );
+
+ this._handles = $();
+ if (this.handles.constructor === String) {
+
+ if (this.handles === "all") {
+ this.handles = "n,e,s,w,se,sw,ne,nw";
+ }
+
+ n = this.handles.split(",");
+ this.handles = {};
+
+ for (i = 0; i < n.length; i++) {
+
+ handle = $.trim(n[i]);
+ hname = "ui-resizable-" + handle;
+ axis = $("<div class='ui-resizable-handle " + hname + "'></div>");
+
+ axis.css({zIndex: o.zIndex});
+
+ // TODO : What's going on here?
+ if ("se" === handle) {
+ axis.addClass("ui-icon ui-icon-gripsmall-diagonal-se");
+ }
+
+ this.handles[handle] = ".ui-resizable-" + handle;
+ this.element.append(axis);
+ }
+
+ }
+
+ this._renderAxis = function (target) {
+
+ var i, axis, padPos, padWrapper;
+
+ target = target || this.element;
+
+ for (i in this.handles) {
+
+ if (this.handles[i].constructor === String) {
+ this.handles[i] = this.element.children(this.handles[i]).first().show();
+ } else if (this.handles[i].jquery || this.handles[i].nodeType) {
+ this.handles[i] = $(this.handles[i]);
+ this._on(this.handles[i], {"mousedown": that._mouseDown});
+ }
+
+ if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/^(textarea|input|select|button)$/i)) {
+
+ axis = $(this.handles[i], this.element);
+
+ padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
+
+ padPos = ["padding",
+ /ne|nw|n/.test(i) ? "Top" :
+ /se|sw|s/.test(i) ? "Bottom" :
+ /^e$/.test(i) ? "Right" : "Left"].join("");
+
+ target.css(padPos, padWrapper);
+
+ this._proportionallyResize();
+ }
+
+ this._handles = this._handles.add(this.handles[i]);
+ }
+ };
+
+ // TODO: make renderAxis a prototype function
+ this._renderAxis(this.element);
+
+ this._handles = this._handles.add(this.element.find(".ui-resizable-handle"));
+ this._handles.disableSelection();
+
+ this._handles.mouseover(function () {
+ if (!that.resizing) {
+ if (this.className) {
+ axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
+ }
+ that.axis = axis && axis[1] ? axis[1] : "se";
+ }
+ });
+
+ if (o.autoHide) {
+ this._handles.hide();
+ $(this.element)
+ .addClass("ui-resizable-autohide")
+ .mouseenter(function () {
+ if (o.disabled) {
+ return;
+ }
+ $(this).removeClass("ui-resizable-autohide");
+ that._handles.show();
+ })
+ .mouseleave(function () {
+ if (o.disabled) {
+ return;
+ }
+ if (!that.resizing) {
+ $(this).addClass("ui-resizable-autohide");
+ that._handles.hide();
+ }
+ });
+ }
+
+ this._mouseInit();
+ },
+
+ _destroy: function () {
+
+ this._mouseDestroy();
+
+ var wrapper,
+ _destroy = function (exp) {
+ $(exp)
+ .removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
+ .removeData("resizable")
+ .removeData("ui-resizable")
+ .unbind(".resizable")
+ .find(".ui-resizable-handle")
+ .remove();
+ };
+
+ // TODO: Unwrap at same DOM position
+ if (this.elementIsWrapper) {
+ _destroy(this.element);
+ wrapper = this.element;
+ this.originalElement.css({
+ position: wrapper.css("position"),
+ width: wrapper.outerWidth(),
+ height: wrapper.outerHeight(),
+ top: wrapper.css("top"),
+ left: wrapper.css("left")
+ }).insertAfter(wrapper);
+ wrapper.remove();
+ }
+
+ this.originalElement.css("resize", this.originalResizeStyle);
+ _destroy(this.originalElement);
+
+ return this;
+ },
+
+ _mouseCapture: function (event) {
+ var i, handle,
+ capture = false;
+
+ for (i in this.handles) {
+ handle = $(this.handles[i])[0];
+ if (handle === event.target || $.contains(handle, event.target)) {
+ capture = true;
+ }
+ }
+
+ return !this.options.disabled && capture;
+ },
+
+ _mouseStart: function (event) {
+
+ var curleft, curtop, cursor,
+ o = this.options,
+ el = this.element;
+
+ this.resizing = true;
+
+ this._renderProxy();
+
+ curleft = this._num(this.helper.css("left"));
+ curtop = this._num(this.helper.css("top"));
+
+ if (o.containment) {
+ curleft += $(o.containment).scrollLeft() || 0;
+ curtop += $(o.containment).scrollTop() || 0;
+ }
+
+ this.offset = this.helper.offset();
+ this.position = {left: curleft, top: curtop};
+
+ this.size = this._helper ? {
+ width: this.helper.width(),
+ height: this.helper.height()
+ } : {
+ width: el.width(),
+ height: el.height()
+ };
+
+ this.originalSize = this._helper ? {
+ width: el.outerWidth(),
+ height: el.outerHeight()
+ } : {
+ width: el.width(),
+ height: el.height()
+ };
+
+ this.sizeDiff = {
+ width: el.outerWidth() - el.width(),
+ height: el.outerHeight() - el.height()
+ };
+
+ this.originalPosition = {left: curleft, top: curtop};
+ this.originalMousePosition = {left: event.pageX, top: event.pageY};
+
+ this.aspectRatio = (typeof o.aspectRatio === "number") ?
+ o.aspectRatio :
+ ((this.originalSize.width / this.originalSize.height) || 1);
+
+ cursor = $(".ui-resizable-" + this.axis).css("cursor");
+ $("body").css("cursor", cursor === "auto" ? this.axis + "-resize" : cursor);
+
+ el.addClass("ui-resizable-resizing");
+ this._propagate("start", event);
+ return true;
+ },
+
+ _mouseDrag: function (event) {
+
+ var data, props,
+ smp = this.originalMousePosition,
+ a = this.axis,
+ dx = (event.pageX - smp.left) || 0,
+ dy = (event.pageY - smp.top) || 0,
+ trigger = this._change[a];
+
+ this._updatePrevProperties();
+
+ if (!trigger) {
+ return false;
+ }
+
+ data = trigger.apply(this, [event, dx, dy]);
+
+ this._updateVirtualBoundaries(event.shiftKey);
+ if (this._aspectRatio || event.shiftKey) {
+ data = this._updateRatio(data, event);
+ }
+
+ data = this._respectSize(data, event);
+
+ this._updateCache(data);
+
+ this._propagate("resize", event);
+
+ props = this._applyChanges();
+
+ if (!this._helper && this._proportionallyResizeElements.length) {
+ this._proportionallyResize();
+ }
+
+ if (!$.isEmptyObject(props)) {
+ this._updatePrevProperties();
+ this._trigger("resize", event, this.ui());
+ this._applyChanges();
+ }
+
+ return false;
+ },
+
+ _mouseStop: function (event) {
+
+ this.resizing = false;
+ var pr, ista, soffseth, soffsetw, s, left, top,
+ o = this.options, that = this;
+
+ if (this._helper) {
+
+ pr = this._proportionallyResizeElements;
+ ista = pr.length && (/textarea/i).test(pr[0].nodeName);
+ soffseth = ista && this._hasScroll(pr[0], "left") ? 0 : that.sizeDiff.height;
+ soffsetw = ista ? 0 : that.sizeDiff.width;
+
+ s = {
+ width: (that.helper.width() - soffsetw),
+ height: (that.helper.height() - soffseth)
+ };
+ left = (parseInt(that.element.css("left"), 10) +
+ (that.position.left - that.originalPosition.left)) || null;
+ top = (parseInt(that.element.css("top"), 10) +
+ (that.position.top - that.originalPosition.top)) || null;
+
+ if (!o.animate) {
+ this.element.css($.extend(s, {top: top, left: left}));
+ }
+
+ that.helper.height(that.size.height);
+ that.helper.width(that.size.width);
+
+ if (this._helper && !o.animate) {
+ this._proportionallyResize();
+ }
+ }
+
+ $("body").css("cursor", "auto");
+
+ this.element.removeClass("ui-resizable-resizing");
+
+ this._propagate("stop", event);
+
+ if (this._helper) {
+ this.helper.remove();
+ }
+
+ return false;
+
+ },
+
+ _updatePrevProperties: function () {
+ this.prevPosition = {
+ top: this.position.top,
+ left: this.position.left
+ };
+ this.prevSize = {
+ width: this.size.width,
+ height: this.size.height
+ };
+ },
+
+ _applyChanges: function () {
+ var props = {};
+
+ if (this.position.top !== this.prevPosition.top) {
+ props.top = this.position.top + "px";
+ }
+ if (this.position.left !== this.prevPosition.left) {
+ props.left = this.position.left + "px";
+ }
+ if (this.size.width !== this.prevSize.width) {
+ props.width = this.size.width + "px";
+ }
+ if (this.size.height !== this.prevSize.height) {
+ props.height = this.size.height + "px";
+ }
+
+ this.helper.css(props);
+
+ return props;
+ },
+
+ _updateVirtualBoundaries: function (forceAspectRatio) {
+ var pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b,
+ o = this.options;
+
+ b = {
+ minWidth: this._isNumber(o.minWidth) ? o.minWidth : 0,
+ maxWidth: this._isNumber(o.maxWidth) ? o.maxWidth : Infinity,
+ minHeight: this._isNumber(o.minHeight) ? o.minHeight : 0,
+ maxHeight: this._isNumber(o.maxHeight) ? o.maxHeight : Infinity
+ };
+
+ if (this._aspectRatio || forceAspectRatio) {
+ pMinWidth = b.minHeight * this.aspectRatio;
+ pMinHeight = b.minWidth / this.aspectRatio;
+ pMaxWidth = b.maxHeight * this.aspectRatio;
+ pMaxHeight = b.maxWidth / this.aspectRatio;
+
+ if (pMinWidth > b.minWidth) {
+ b.minWidth = pMinWidth;
+ }
+ if (pMinHeight > b.minHeight) {
+ b.minHeight = pMinHeight;
+ }
+ if (pMaxWidth < b.maxWidth) {
+ b.maxWidth = pMaxWidth;
+ }
+ if (pMaxHeight < b.maxHeight) {
+ b.maxHeight = pMaxHeight;
+ }
+ }
+ this._vBoundaries = b;
+ },
+
+ _updateCache: function (data) {
+ this.offset = this.helper.offset();
+ if (this._isNumber(data.left)) {
+ this.position.left = data.left;
+ }
+ if (this._isNumber(data.top)) {
+ this.position.top = data.top;
+ }
+ if (this._isNumber(data.height)) {
+ this.size.height = data.height;
+ }
+ if (this._isNumber(data.width)) {
+ this.size.width = data.width;
+ }
+ },
+
+ _updateRatio: function (data) {
+
+ var cpos = this.position,
+ csize = this.size,
+ a = this.axis;
+
+ if (this._isNumber(data.height)) {
+ data.width = (data.height * this.aspectRatio);
+ } else if (this._isNumber(data.width)) {
+ data.height = (data.width / this.aspectRatio);
+ }
+
+ if (a === "sw") {
+ data.left = cpos.left + (csize.width - data.width);
+ data.top = null;
+ }
+ if (a === "nw") {
+ data.top = cpos.top + (csize.height - data.height);
+ data.left = cpos.left + (csize.width - data.width);
+ }
+
+ return data;
+ },
+
+ _respectSize: function (data) {
+
+ var o = this._vBoundaries,
+ a = this.axis,
+ ismaxw = this._isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width),
+ ismaxh = this._isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
+ isminw = this._isNumber(data.width) && o.minWidth && (o.minWidth > data.width),
+ isminh = this._isNumber(data.height) && o.minHeight && (o.minHeight > data.height),
+ dw = this.originalPosition.left + this.originalSize.width,
+ dh = this.position.top + this.size.height,
+ cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
+ if (isminw) {
+ data.width = o.minWidth;
+ }
+ if (isminh) {
+ data.height = o.minHeight;
+ }
+ if (ismaxw) {
+ data.width = o.maxWidth;
+ }
+ if (ismaxh) {
+ data.height = o.maxHeight;
+ }
+
+ if (isminw && cw) {
+ data.left = dw - o.minWidth;
+ }
+ if (ismaxw && cw) {
+ data.left = dw - o.maxWidth;
+ }
+ if (isminh && ch) {
+ data.top = dh - o.minHeight;
+ }
+ if (ismaxh && ch) {
+ data.top = dh - o.maxHeight;
+ }
+
+ // Fixing jump error on top/left - bug #2330
+ if (!data.width && !data.height && !data.left && data.top) {
+ data.top = null;
+ } else if (!data.width && !data.height && !data.top && data.left) {
+ data.left = null;
+ }
+
+ return data;
+ },
+
+ _getPaddingPlusBorderDimensions: function (element) {
+ var i = 0,
+ widths = [],
+ borders = [
+ element.css("borderTopWidth"),
+ element.css("borderRightWidth"),
+ element.css("borderBottomWidth"),
+ element.css("borderLeftWidth")
+ ],
+ paddings = [
+ element.css("paddingTop"),
+ element.css("paddingRight"),
+ element.css("paddingBottom"),
+ element.css("paddingLeft")
+ ];
+
+ for (; i < 4; i++) {
+ widths[i] = ( parseInt(borders[i], 10) || 0 );
+ widths[i] += ( parseInt(paddings[i], 10) || 0 );
+ }
+
+ return {
+ height: widths[0] + widths[2],
+ width: widths[1] + widths[3]
+ };
+ },
+
+ _proportionallyResize: function () {
+
+ if (!this._proportionallyResizeElements.length) {
+ return;
+ }
+
+ var prel,
+ i = 0,
+ element = this.helper || this.element;
+
+ for (; i < this._proportionallyResizeElements.length; i++) {
+
+ prel = this._proportionallyResizeElements[i];
+
+ // TODO: Seems like a bug to cache this.outerDimensions
+ // considering that we are in a loop.
+ if (!this.outerDimensions) {
+ this.outerDimensions = this._getPaddingPlusBorderDimensions(prel);
+ }
+
+ prel.css({
+ height: (element.height() - this.outerDimensions.height) || 0,
+ width: (element.width() - this.outerDimensions.width) || 0
+ });
+
+ }
+
+ },
+
+ _renderProxy: function () {
+
+ var el = this.element, o = this.options;
+ this.elementOffset = el.offset();
+
+ if (this._helper) {
+
+ this.helper = this.helper || $("<div style='overflow:hidden;'></div>");
+
+ this.helper.addClass(this._helper).css({
+ width: this.element.outerWidth() - 1,
+ height: this.element.outerHeight() - 1,
+ position: "absolute",
+ left: this.elementOffset.left + "px",
+ top: this.elementOffset.top + "px",
+ zIndex: ++o.zIndex //TODO: Don't modify option
+ });
+
+ this.helper
+ .appendTo("body")
+ .disableSelection();
+
+ } else {
+ this.helper = this.element;
+ }
+
+ },
+
+ _change: {
+ e: function (event, dx) {
+ return {width: this.originalSize.width + dx};
+ },
+ w: function (event, dx) {
+ var cs = this.originalSize, sp = this.originalPosition;
+ return {left: sp.left + dx, width: cs.width - dx};
+ },
+ n: function (event, dx, dy) {
+ var cs = this.originalSize, sp = this.originalPosition;
+ return {top: sp.top + dy, height: cs.height - dy};
+ },
+ s: function (event, dx, dy) {
+ return {height: this.originalSize.height + dy};
+ },
+ se: function (event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments),
+ this._change.e.apply(this, [event, dx, dy]));
+ },
+ sw: function (event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments),
+ this._change.w.apply(this, [event, dx, dy]));
+ },
+ ne: function (event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments),
+ this._change.e.apply(this, [event, dx, dy]));
+ },
+ nw: function (event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments),
+ this._change.w.apply(this, [event, dx, dy]));
+ }
+ },
+
+ _propagate: function (n, event) {
+ $.ui.plugin.call(this, n, [event, this.ui()]);
+ (n !== "resize" && this._trigger(n, event, this.ui()));
+ },
+
+ plugins: {},
+
+ ui: function () {
+ return {
+ originalElement: this.originalElement,
+ element: this.element,
+ helper: this.helper,
+ position: this.position,
+ size: this.size,
+ originalSize: this.originalSize,
+ originalPosition: this.originalPosition
+ };
+ }
+
+ });
+
+ /*
+ * Resizable Extensions
+ */
+
+ $.ui.plugin.add("resizable", "animate", {
+
+ stop: function (event) {
+ var that = $(this).resizable("instance"),
+ o = that.options,
+ pr = that._proportionallyResizeElements,
+ ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && that._hasScroll(pr[0], "left") ? 0 : that.sizeDiff.height,
+ soffsetw = ista ? 0 : that.sizeDiff.width,
+ style = {width: (that.size.width - soffsetw), height: (that.size.height - soffseth)},
+ left = (parseInt(that.element.css("left"), 10) +
+ (that.position.left - that.originalPosition.left)) || null,
+ top = (parseInt(that.element.css("top"), 10) +
+ (that.position.top - that.originalPosition.top)) || null;
+
+ that.element.animate(
+ $.extend(style, top && left ? {top: top, left: left} : {}), {
+ duration: o.animateDuration,
+ easing: o.animateEasing,
+ step: function () {
+
+ var data = {
+ width: parseInt(that.element.css("width"), 10),
+ height: parseInt(that.element.css("height"), 10),
+ top: parseInt(that.element.css("top"), 10),
+ left: parseInt(that.element.css("left"), 10)
+ };
+
+ if (pr && pr.length) {
+ $(pr[0]).css({width: data.width, height: data.height});
+ }
+
+ // propagating resize, and updating values for each animation step
+ that._updateCache(data);
+ that._propagate("resize", event);
+
+ }
+ }
+ );
+ }
+
+ });
+
+ $.ui.plugin.add("resizable", "containment", {
+
+ start: function () {
+ var element, p, co, ch, cw, width, height,
+ that = $(this).resizable("instance"),
+ o = that.options,
+ el = that.element,
+ oc = o.containment,
+ ce = ( oc instanceof $ ) ? oc.get(0) : ( /parent/.test(oc) ) ? el.parent().get(0) : oc;
+
+ if (!ce) {
+ return;
+ }
+
+ that.containerElement = $(ce);
+
+ if (/document/.test(oc) || oc === document) {
+ that.containerOffset = {
+ left: 0,
+ top: 0
+ };
+ that.containerPosition = {
+ left: 0,
+ top: 0
+ };
+
+ that.parentData = {
+ element: $(document),
+ left: 0,
+ top: 0,
+ width: $(document).width(),
+ height: $(document).height() || document.body.parentNode.scrollHeight
+ };
+ } else {
+ element = $(ce);
+ p = [];
+ $(["Top", "Right", "Left", "Bottom"]).each(function (i, name) {
+ p[i] = that._num(element.css("padding" + name));
+ });
+
+ that.containerOffset = element.offset();
+ that.containerPosition = element.position();
+ that.containerSize = {
+ height: ( element.innerHeight() - p[3] ),
+ width: ( element.innerWidth() - p[1] )
+ };
+
+ co = that.containerOffset;
+ ch = that.containerSize.height;
+ cw = that.containerSize.width;
+ width = ( that._hasScroll(ce, "left") ? ce.scrollWidth : cw );
+ height = ( that._hasScroll(ce) ? ce.scrollHeight : ch );
+
+ that.parentData = {
+ element: ce,
+ left: co.left,
+ top: co.top,
+ width: width,
+ height: height
+ };
+ }
+ },
+
+ resize: function (event) {
+ var woset, hoset, isParent, isOffsetRelative,
+ that = $(this).resizable("instance"),
+ o = that.options,
+ co = that.containerOffset,
+ cp = that.position,
+ pRatio = that._aspectRatio || event.shiftKey,
+ cop = {
+ top: 0,
+ left: 0
+ },
+ ce = that.containerElement,
+ continueResize = true;
+
+ if (ce[0] !== document && ( /static/ ).test(ce.css("position"))) {
+ cop = co;
+ }
+
+ if (cp.left < ( that._helper ? co.left : 0 )) {
+ that.size.width = that.size.width +
+ ( that._helper ?
+ ( that.position.left - co.left ) :
+ ( that.position.left - cop.left ) );
+
+ if (pRatio) {
+ that.size.height = that.size.width / that.aspectRatio;
+ continueResize = false;
+ }
+ that.position.left = o.helper ? co.left : 0;
+ }
+
+ if (cp.top < ( that._helper ? co.top : 0 )) {
+ that.size.height = that.size.height +
+ ( that._helper ?
+ ( that.position.top - co.top ) :
+ that.position.top );
+
+ if (pRatio) {
+ that.size.width = that.size.height * that.aspectRatio;
+ continueResize = false;
+ }
+ that.position.top = that._helper ? co.top : 0;
+ }
+
+ isParent = that.containerElement.get(0) === that.element.parent().get(0);
+ isOffsetRelative = /relative|absolute/.test(that.containerElement.css("position"));
+
+ if (isParent && isOffsetRelative) {
+ that.offset.left = that.parentData.left + that.position.left;
+ that.offset.top = that.parentData.top + that.position.top;
+ } else {
+ that.offset.left = that.element.offset().left;
+ that.offset.top = that.element.offset().top;
+ }
+
+ woset = Math.abs(that.sizeDiff.width +
+ (that._helper ?
+ that.offset.left - cop.left :
+ (that.offset.left - co.left)));
+
+ hoset = Math.abs(that.sizeDiff.height +
+ (that._helper ?
+ that.offset.top - cop.top :
+ (that.offset.top - co.top)));
+
+ if (woset + that.size.width >= that.parentData.width) {
+ that.size.width = that.parentData.width - woset;
+ if (pRatio) {
+ that.size.height = that.size.width / that.aspectRatio;
+ continueResize = false;
+ }
+ }
+
+ if (hoset + that.size.height >= that.parentData.height) {
+ that.size.height = that.parentData.height - hoset;
+ if (pRatio) {
+ that.size.width = that.size.height * that.aspectRatio;
+ continueResize = false;
+ }
+ }
+
+ if (!continueResize) {
+ that.position.left = that.prevPosition.left;
+ that.position.top = that.prevPosition.top;
+ that.size.width = that.prevSize.width;
+ that.size.height = that.prevSize.height;
+ }
+ },
+
+ stop: function () {
+ var that = $(this).resizable("instance"),
+ o = that.options,
+ co = that.containerOffset,
+ cop = that.containerPosition,
+ ce = that.containerElement,
+ helper = $(that.helper),
+ ho = helper.offset(),
+ w = helper.outerWidth() - that.sizeDiff.width,
+ h = helper.outerHeight() - that.sizeDiff.height;
+
+ if (that._helper && !o.animate && ( /relative/ ).test(ce.css("position"))) {
+ $(this).css({
+ left: ho.left - cop.left - co.left,
+ width: w,
+ height: h
+ });
+ }
+
+ if (that._helper && !o.animate && ( /static/ ).test(ce.css("position"))) {
+ $(this).css({
+ left: ho.left - cop.left - co.left,
+ width: w,
+ height: h
+ });
+ }
+ }
+ });
+
+ $.ui.plugin.add("resizable", "alsoResize", {
+
+ start: function () {
+ var that = $(this).resizable("instance"),
+ o = that.options;
+
+ $(o.alsoResize).each(function () {
+ var el = $(this);
+ el.data("ui-resizable-alsoresize", {
+ width: parseInt(el.width(), 10), height: parseInt(el.height(), 10),
+ left: parseInt(el.css("left"), 10), top: parseInt(el.css("top"), 10)
+ });
+ });
+ },
+
+ resize: function (event, ui) {
+ var that = $(this).resizable("instance"),
+ o = that.options,
+ os = that.originalSize,
+ op = that.originalPosition,
+ delta = {
+ height: (that.size.height - os.height) || 0,
+ width: (that.size.width - os.width) || 0,
+ top: (that.position.top - op.top) || 0,
+ left: (that.position.left - op.left) || 0
+ };
+
+ $(o.alsoResize).each(function () {
+ var el = $(this), start = $(this).data("ui-resizable-alsoresize"), style = {},
+ css = el.parents(ui.originalElement[0]).length ?
+ ["width", "height"] :
+ ["width", "height", "top", "left"];
+
+ $.each(css, function (i, prop) {
+ var sum = (start[prop] || 0) + (delta[prop] || 0);
+ if (sum && sum >= 0) {
+ style[prop] = sum || null;
+ }
+ });
+
+ el.css(style);
+ });
+ },
+
+ stop: function () {
+ $(this).removeData("resizable-alsoresize");
+ }
+ });
+
+ $.ui.plugin.add("resizable", "ghost", {
+
+ start: function () {
+
+ var that = $(this).resizable("instance"), o = that.options, cs = that.size;
+
+ that.ghost = that.originalElement.clone();
+ that.ghost
+ .css({
+ opacity: 0.25,
+ display: "block",
+ position: "relative",
+ height: cs.height,
+ width: cs.width,
+ margin: 0,
+ left: 0,
+ top: 0
+ })
+ .addClass("ui-resizable-ghost")
+ .addClass(typeof o.ghost === "string" ? o.ghost : "");
+
+ that.ghost.appendTo(that.helper);
+
+ },
+
+ resize: function () {
+ var that = $(this).resizable("instance");
+ if (that.ghost) {
+ that.ghost.css({
+ position: "relative",
+ height: that.size.height,
+ width: that.size.width
+ });
+ }
+ },
+
+ stop: function () {
+ var that = $(this).resizable("instance");
+ if (that.ghost && that.helper) {
+ that.helper.get(0).removeChild(that.ghost.get(0));
+ }
+ }
+
+ });
+
+ $.ui.plugin.add("resizable", "grid", {
+
+ resize: function () {
+ var outerDimensions,
+ that = $(this).resizable("instance"),
+ o = that.options,
+ cs = that.size,
+ os = that.originalSize,
+ op = that.originalPosition,
+ a = that.axis,
+ grid = typeof o.grid === "number" ? [o.grid, o.grid] : o.grid,
+ gridX = (grid[0] || 1),
+ gridY = (grid[1] || 1),
+ ox = Math.round((cs.width - os.width) / gridX) * gridX,
+ oy = Math.round((cs.height - os.height) / gridY) * gridY,
+ newWidth = os.width + ox,
+ newHeight = os.height + oy,
+ isMaxWidth = o.maxWidth && (o.maxWidth < newWidth),
+ isMaxHeight = o.maxHeight && (o.maxHeight < newHeight),
+ isMinWidth = o.minWidth && (o.minWidth > newWidth),
+ isMinHeight = o.minHeight && (o.minHeight > newHeight);
+
+ o.grid = grid;
+
+ if (isMinWidth) {
+ newWidth += gridX;
+ }
+ if (isMinHeight) {
+ newHeight += gridY;
+ }
+ if (isMaxWidth) {
+ newWidth -= gridX;
+ }
+ if (isMaxHeight) {
+ newHeight -= gridY;
+ }
+
+ if (/^(se|s|e)$/.test(a)) {
+ that.size.width = newWidth;
+ that.size.height = newHeight;
+ } else if (/^(ne)$/.test(a)) {
+ that.size.width = newWidth;
+ that.size.height = newHeight;
+ that.position.top = op.top - oy;
+ } else if (/^(sw)$/.test(a)) {
+ that.size.width = newWidth;
+ that.size.height = newHeight;
+ that.position.left = op.left - ox;
+ } else {
+ if (newHeight - gridY <= 0 || newWidth - gridX <= 0) {
+ outerDimensions = that._getPaddingPlusBorderDimensions(this);
+ }
+
+ if (newHeight - gridY > 0) {
+ that.size.height = newHeight;
+ that.position.top = op.top - oy;
+ } else {
+ newHeight = gridY - outerDimensions.height;
+ that.size.height = newHeight;
+ that.position.top = op.top + os.height - newHeight;
+ }
+ if (newWidth - gridX > 0) {
+ that.size.width = newWidth;
+ that.position.left = op.left - ox;
+ } else {
+ newWidth = gridX - outerDimensions.width;
+ that.size.width = newWidth;
+ that.position.left = op.left + os.width - newWidth;
+ }
+ }
+ }
+
+ });
+
+ var resizable = $.ui.resizable;
+
+
+ /*!
+ * jQuery UI Selectable 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/selectable/
+ */
+
+
+ var selectable = $.widget("ui.selectable", $.ui.mouse, {
+ version: "1.11.4",
+ options: {
+ appendTo: "body",
+ autoRefresh: true,
+ distance: 0,
+ filter: "*",
+ tolerance: "touch",
+
+ // callbacks
+ selected: null,
+ selecting: null,
+ start: null,
+ stop: null,
+ unselected: null,
+ unselecting: null
+ },
+ _create: function () {
+ var selectees,
+ that = this;
+
+ this.element.addClass("ui-selectable");
+
+ this.dragged = false;
+
+ // cache selectee children based on filter
+ this.refresh = function () {
+ selectees = $(that.options.filter, that.element[0]);
+ selectees.addClass("ui-selectee");
+ selectees.each(function () {
+ var $this = $(this),
+ pos = $this.offset();
+ $.data(this, "selectable-item", {
+ element: this,
+ $element: $this,
+ left: pos.left,
+ top: pos.top,
+ right: pos.left + $this.outerWidth(),
+ bottom: pos.top + $this.outerHeight(),
+ startselected: false,
+ selected: $this.hasClass("ui-selected"),
+ selecting: $this.hasClass("ui-selecting"),
+ unselecting: $this.hasClass("ui-unselecting")
+ });
+ });
+ };
+ this.refresh();
+
+ this.selectees = selectees.addClass("ui-selectee");
+
+ this._mouseInit();
+
+ this.helper = $("<div class='ui-selectable-helper'></div>");
+ },
+
+ _destroy: function () {
+ this.selectees
+ .removeClass("ui-selectee")
+ .removeData("selectable-item");
+ this.element
+ .removeClass("ui-selectable ui-selectable-disabled");
+ this._mouseDestroy();
+ },
+
+ _mouseStart: function (event) {
+ var that = this,
+ options = this.options;
+
+ this.opos = [event.pageX, event.pageY];
+
+ if (this.options.disabled) {
+ return;
+ }
+
+ this.selectees = $(options.filter, this.element[0]);
+
+ this._trigger("start", event);
+
+ $(options.appendTo).append(this.helper);
+ // position helper (lasso)
+ this.helper.css({
+ "left": event.pageX,
+ "top": event.pageY,
+ "width": 0,
+ "height": 0
+ });
+
+ if (options.autoRefresh) {
+ this.refresh();
+ }
+
+ this.selectees.filter(".ui-selected").each(function () {
+ var selectee = $.data(this, "selectable-item");
+ selectee.startselected = true;
+ if (!event.metaKey && !event.ctrlKey) {
+ selectee.$element.removeClass("ui-selected");
+ selectee.selected = false;
+ selectee.$element.addClass("ui-unselecting");
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ that._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ });
+
+ $(event.target).parents().addBack().each(function () {
+ var doSelect,
+ selectee = $.data(this, "selectable-item");
+ if (selectee) {
+ doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass("ui-selected");
+ selectee.$element
+ .removeClass(doSelect ? "ui-unselecting" : "ui-selected")
+ .addClass(doSelect ? "ui-selecting" : "ui-unselecting");
+ selectee.unselecting = !doSelect;
+ selectee.selecting = doSelect;
+ selectee.selected = doSelect;
+ // selectable (UN)SELECTING callback
+ if (doSelect) {
+ that._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ } else {
+ that._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ return false;
+ }
+ });
+
+ },
+
+ _mouseDrag: function (event) {
+
+ this.dragged = true;
+
+ if (this.options.disabled) {
+ return;
+ }
+
+ var tmp,
+ that = this,
+ options = this.options,
+ x1 = this.opos[0],
+ y1 = this.opos[1],
+ x2 = event.pageX,
+ y2 = event.pageY;
+
+ if (x1 > x2) {
+ tmp = x2;
+ x2 = x1;
+ x1 = tmp;
+ }
+ if (y1 > y2) {
+ tmp = y2;
+ y2 = y1;
+ y1 = tmp;
+ }
+ this.helper.css({left: x1, top: y1, width: x2 - x1, height: y2 - y1});
+
+ this.selectees.each(function () {
+ var selectee = $.data(this, "selectable-item"),
+ hit = false;
+
+ //prevent helper from being selected if appendTo: selectable
+ if (!selectee || selectee.element === that.element[0]) {
+ return;
+ }
+
+ if (options.tolerance === "touch") {
+ hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
+ } else if (options.tolerance === "fit") {
+ hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
+ }
+
+ if (hit) {
+ // SELECT
+ if (selectee.selected) {
+ selectee.$element.removeClass("ui-selected");
+ selectee.selected = false;
+ }
+ if (selectee.unselecting) {
+ selectee.$element.removeClass("ui-unselecting");
+ selectee.unselecting = false;
+ }
+ if (!selectee.selecting) {
+ selectee.$element.addClass("ui-selecting");
+ selectee.selecting = true;
+ // selectable SELECTING callback
+ that._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ }
+ } else {
+ // UNSELECT
+ if (selectee.selecting) {
+ if ((event.metaKey || event.ctrlKey) && selectee.startselected) {
+ selectee.$element.removeClass("ui-selecting");
+ selectee.selecting = false;
+ selectee.$element.addClass("ui-selected");
+ selectee.selected = true;
+ } else {
+ selectee.$element.removeClass("ui-selecting");
+ selectee.selecting = false;
+ if (selectee.startselected) {
+ selectee.$element.addClass("ui-unselecting");
+ selectee.unselecting = true;
+ }
+ // selectable UNSELECTING callback
+ that._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ if (selectee.selected) {
+ if (!event.metaKey && !event.ctrlKey && !selectee.startselected) {
+ selectee.$element.removeClass("ui-selected");
+ selectee.selected = false;
+
+ selectee.$element.addClass("ui-unselecting");
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ that._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ }
+ });
+
+ return false;
+ },
+
+ _mouseStop: function (event) {
+ var that = this;
+
+ this.dragged = false;
+
+ $(".ui-unselecting", this.element[0]).each(function () {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass("ui-unselecting");
+ selectee.unselecting = false;
+ selectee.startselected = false;
+ that._trigger("unselected", event, {
+ unselected: selectee.element
+ });
+ });
+ $(".ui-selecting", this.element[0]).each(function () {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass("ui-selecting").addClass("ui-selected");
+ selectee.selecting = false;
+ selectee.selected = true;
+ selectee.startselected = true;
+ that._trigger("selected", event, {
+ selected: selectee.element
+ });
+ });
+ this._trigger("stop", event);
+
+ this.helper.remove();
+
+ return false;
+ }
+
+ });
+
+
+ /*!
+ * jQuery UI Sortable 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/sortable/
+ */
+
+
+ var sortable = $.widget("ui.sortable", $.ui.mouse, {
+ version: "1.11.4",
+ widgetEventPrefix: "sort",
+ ready: false,
+ options: {
+ appendTo: "parent",
+ axis: false,
+ connectWith: false,
+ containment: false,
+ cursor: "auto",
+ cursorAt: false,
+ dropOnEmpty: true,
+ forcePlaceholderSize: false,
+ forceHelperSize: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ items: "> *",
+ opacity: false,
+ placeholder: false,
+ revert: false,
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ scope: "default",
+ tolerance: "intersect",
+ zIndex: 1000,
+
+ // callbacks
+ activate: null,
+ beforeStop: null,
+ change: null,
+ deactivate: null,
+ out: null,
+ over: null,
+ receive: null,
+ remove: null,
+ sort: null,
+ start: null,
+ stop: null,
+ update: null
+ },
+
+ _isOverAxis: function (x, reference, size) {
+ return ( x >= reference ) && ( x < ( reference + size ) );
+ },
+
+ _isFloating: function (item) {
+ return (/left|right/).test(item.css("float")) || (/inline|table-cell/).test(item.css("display"));
+ },
+
+ _create: function () {
+ this.containerCache = {};
+ this.element.addClass("ui-sortable");
+
+ //Get the items
+ this.refresh();
+
+ //Let's determine the parent's offset
+ this.offset = this.element.offset();
+
+ //Initialize mouse events for interaction
+ this._mouseInit();
+
+ this._setHandleClassName();
+
+ //We're ready to go
+ this.ready = true;
+
+ },
+
+ _setOption: function (key, value) {
+ this._super(key, value);
+
+ if (key === "handle") {
+ this._setHandleClassName();
+ }
+ },
+
+ _setHandleClassName: function () {
+ this.element.find(".ui-sortable-handle").removeClass("ui-sortable-handle");
+ $.each(this.items, function () {
+ ( this.instance.options.handle ?
+ this.item.find(this.instance.options.handle) : this.item )
+ .addClass("ui-sortable-handle");
+ });
+ },
+
+ _destroy: function () {
+ this.element
+ .removeClass("ui-sortable ui-sortable-disabled")
+ .find(".ui-sortable-handle")
+ .removeClass("ui-sortable-handle");
+ this._mouseDestroy();
+
+ for (var i = this.items.length - 1; i >= 0; i--) {
+ this.items[i].item.removeData(this.widgetName + "-item");
+ }
+
+ return this;
+ },
+
+ _mouseCapture: function (event, overrideHandle) {
+ var currentItem = null,
+ validHandle = false,
+ that = this;
+
+ if (this.reverting) {
+ return false;
+ }
+
+ if (this.options.disabled || this.options.type === "static") {
+ return false;
+ }
+
+ //We have to refresh the items data once first
+ this._refreshItems(event);
+
+ //Find out if the clicked node (or one of its parents) is a actual item in this.items
+ $(event.target).parents().each(function () {
+ if ($.data(this, that.widgetName + "-item") === that) {
+ currentItem = $(this);
+ return false;
+ }
+ });
+ if ($.data(event.target, that.widgetName + "-item") === that) {
+ currentItem = $(event.target);
+ }
+
+ if (!currentItem) {
+ return false;
+ }
+ if (this.options.handle && !overrideHandle) {
+ $(this.options.handle, currentItem).find("*").addBack().each(function () {
+ if (this === event.target) {
+ validHandle = true;
+ }
+ });
+ if (!validHandle) {
+ return false;
+ }
+ }
+
+ this.currentItem = currentItem;
+ this._removeCurrentsFromItems();
+ return true;
+
+ },
+
+ _mouseStart: function (event, overrideHandle, noActivation) {
+
+ var i, body,
+ o = this.options;
+
+ this.currentContainer = this;
+
+ //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
+ this.refreshPositions();
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Get the next scrolling parent
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.currentItem.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ // Only after we got the offset, we can change the helper's position to absolute
+ // TODO: Still need to figure out a way to make relative sorting possible
+ this.helper.css("position", "absolute");
+ this.cssPosition = this.helper.css("position");
+
+ //Generate the original position
+ this.originalPosition = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if "cursorAt" is supplied
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+ //Cache the former DOM position
+ this.domPosition = {prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0]};
+
+ //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
+ if (this.helper[0] !== this.currentItem[0]) {
+ this.currentItem.hide();
+ }
+
+ //Create the placeholder
+ this._createPlaceholder();
+
+ //Set a containment if given in the options
+ if (o.containment) {
+ this._setContainment();
+ }
+
+ if (o.cursor && o.cursor !== "auto") { // cursor option
+ body = this.document.find("body");
+
+ // support: IE
+ this.storedCursor = body.css("cursor");
+ body.css("cursor", o.cursor);
+
+ this.storedStylesheet = $("<style>*{ cursor: " + o.cursor + " !important; }</style>").appendTo(body);
+ }
+
+ if (o.opacity) { // opacity option
+ if (this.helper.css("opacity")) {
+ this._storedOpacity = this.helper.css("opacity");
+ }
+ this.helper.css("opacity", o.opacity);
+ }
+
+ if (o.zIndex) { // zIndex option
+ if (this.helper.css("zIndex")) {
+ this._storedZIndex = this.helper.css("zIndex");
+ }
+ this.helper.css("zIndex", o.zIndex);
+ }
+
+ //Prepare scrolling
+ if (this.scrollParent[0] !== this.document[0] && this.scrollParent[0].tagName !== "HTML") {
+ this.overflowOffset = this.scrollParent.offset();
+ }
+
+ //Call callbacks
+ this._trigger("start", event, this._uiHash());
+
+ //Recache the helper size
+ if (!this._preserveHelperProportions) {
+ this._cacheHelperProportions();
+ }
+
+
+ //Post "activate" events to possible containers
+ if (!noActivation) {
+ for (i = this.containers.length - 1; i >= 0; i--) {
+ this.containers[i]._trigger("activate", event, this._uiHash(this));
+ }
+ }
+
+ //Prepare possible droppables
+ if ($.ui.ddmanager) {
+ $.ui.ddmanager.current = this;
+ }
+
+ if ($.ui.ddmanager && !o.dropBehaviour) {
+ $.ui.ddmanager.prepareOffsets(this, event);
+ }
+
+ this.dragging = true;
+
+ this.helper.addClass("ui-sortable-helper");
+ this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+
+ },
+
+ _mouseDrag: function (event) {
+ var i, item, itemElement, intersection,
+ o = this.options,
+ scrolled = false;
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ if (!this.lastPositionAbs) {
+ this.lastPositionAbs = this.positionAbs;
+ }
+
+ //Do scrolling
+ if (this.options.scroll) {
+ if (this.scrollParent[0] !== this.document[0] && this.scrollParent[0].tagName !== "HTML") {
+
+ if ((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) {
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
+ } else if (event.pageY - this.overflowOffset.top < o.scrollSensitivity) {
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
+ }
+
+ if ((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) {
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
+ } else if (event.pageX - this.overflowOffset.left < o.scrollSensitivity) {
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
+ }
+
+ } else {
+
+ if (event.pageY - this.document.scrollTop() < o.scrollSensitivity) {
+ scrolled = this.document.scrollTop(this.document.scrollTop() - o.scrollSpeed);
+ } else if (this.window.height() - (event.pageY - this.document.scrollTop()) < o.scrollSensitivity) {
+ scrolled = this.document.scrollTop(this.document.scrollTop() + o.scrollSpeed);
+ }
+
+ if (event.pageX - this.document.scrollLeft() < o.scrollSensitivity) {
+ scrolled = this.document.scrollLeft(this.document.scrollLeft() - o.scrollSpeed);
+ } else if (this.window.width() - (event.pageX - this.document.scrollLeft()) < o.scrollSensitivity) {
+ scrolled = this.document.scrollLeft(this.document.scrollLeft() + o.scrollSpeed);
+ }
+
+ }
+
+ if (scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) {
+ $.ui.ddmanager.prepareOffsets(this, event);
+ }
+ }
+
+ //Regenerate the absolute position used for position checks
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Set the helper position
+ if (!this.options.axis || this.options.axis !== "y") {
+ this.helper[0].style.left = this.position.left + "px";
+ }
+ if (!this.options.axis || this.options.axis !== "x") {
+ this.helper[0].style.top = this.position.top + "px";
+ }
+
+ //Rearrange
+ for (i = this.items.length - 1; i >= 0; i--) {
+
+ //Cache variables and intersection, continue if no intersection
+ item = this.items[i];
+ itemElement = item.item[0];
+ intersection = this._intersectsWithPointer(item);
+ if (!intersection) {
+ continue;
+ }
+
+ // Only put the placeholder inside the current Container, skip all
+ // items from other containers. This works because when moving
+ // an item from one container to another the
+ // currentContainer is switched before the placeholder is moved.
+ //
+ // Without this, moving items in "sub-sortables" can cause
+ // the placeholder to jitter between the outer and inner container.
+ if (item.instance !== this.currentContainer) {
+ continue;
+ }
+
+ // cannot intersect with itself
+ // no useless actions that have been done before
+ // no action if the item moved is the parent of the item checked
+ if (itemElement !== this.currentItem[0] &&
+ this.placeholder[intersection === 1 ? "next" : "prev"]()[0] !== itemElement && !$.contains(this.placeholder[0], itemElement) &&
+ (this.options.type === "semi-dynamic" ? !$.contains(this.element[0], itemElement) : true)
+ ) {
+
+ this.direction = intersection === 1 ? "down" : "up";
+
+ if (this.options.tolerance === "pointer" || this._intersectsWithSides(item)) {
+ this._rearrange(event, item);
+ } else {
+ break;
+ }
+
+ this._trigger("change", event, this._uiHash());
+ break;
+ }
+ }
+
+ //Post events to containers
+ this._contactContainers(event);
+
+ //Interconnect with droppables
+ if ($.ui.ddmanager) {
+ $.ui.ddmanager.drag(this, event);
+ }
+
+ //Call callbacks
+ this._trigger("sort", event, this._uiHash());
+
+ this.lastPositionAbs = this.positionAbs;
+ return false;
+
+ },
+
+ _mouseStop: function (event, noPropagation) {
+
+ if (!event) {
+ return;
+ }
+
+ //If we are using droppables, inform the manager about the drop
+ if ($.ui.ddmanager && !this.options.dropBehaviour) {
+ $.ui.ddmanager.drop(this, event);
+ }
+
+ if (this.options.revert) {
+ var that = this,
+ cur = this.placeholder.offset(),
+ axis = this.options.axis,
+ animation = {};
+
+ if (!axis || axis === "x") {
+ animation.left = cur.left - this.offset.parent.left - this.margins.left + (this.offsetParent[0] === this.document[0].body ? 0 : this.offsetParent[0].scrollLeft);
+ }
+ if (!axis || axis === "y") {
+ animation.top = cur.top - this.offset.parent.top - this.margins.top + (this.offsetParent[0] === this.document[0].body ? 0 : this.offsetParent[0].scrollTop);
+ }
+ this.reverting = true;
+ $(this.helper).animate(animation, parseInt(this.options.revert, 10) || 500, function () {
+ that._clear(event);
+ });
+ } else {
+ this._clear(event, noPropagation);
+ }
+
+ return false;
+
+ },
+
+ cancel: function () {
+
+ if (this.dragging) {
+
+ this._mouseUp({target: null});
+
+ if (this.options.helper === "original") {
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ } else {
+ this.currentItem.show();
+ }
+
+ //Post deactivating events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--) {
+ this.containers[i]._trigger("deactivate", null, this._uiHash(this));
+ if (this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", null, this._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ if (this.placeholder) {
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ if (this.placeholder[0].parentNode) {
+ this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+ }
+ if (this.options.helper !== "original" && this.helper && this.helper[0].parentNode) {
+ this.helper.remove();
+ }
+
+ $.extend(this, {
+ helper: null,
+ dragging: false,
+ reverting: false,
+ _noFinalSort: null
+ });
+
+ if (this.domPosition.prev) {
+ $(this.domPosition.prev).after(this.currentItem);
+ } else {
+ $(this.domPosition.parent).prepend(this.currentItem);
+ }
+ }
+
+ return this;
+
+ },
+
+ serialize: function (o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected),
+ str = [];
+ o = o || {};
+
+ $(items).each(function () {
+ var res = ($(o.item || this).attr(o.attribute || "id") || "").match(o.expression || (/(.+)[\-=_](.+)/));
+ if (res) {
+ str.push((o.key || res[1] + "[]") + "=" + (o.key && o.expression ? res[1] : res[2]));
+ }
+ });
+
+ if (!str.length && o.key) {
+ str.push(o.key + "=");
+ }
+
+ return str.join("&");
+
+ },
+
+ toArray: function (o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected),
+ ret = [];
+
+ o = o || {};
+
+ items.each(function () {
+ ret.push($(o.item || this).attr(o.attribute || "id") || "");
+ });
+ return ret;
+
+ },
+
+ /* Be careful with the following core functions */
+ _intersectsWith: function (item) {
+
+ var x1 = this.positionAbs.left,
+ x2 = x1 + this.helperProportions.width,
+ y1 = this.positionAbs.top,
+ y2 = y1 + this.helperProportions.height,
+ l = item.left,
+ r = l + item.width,
+ t = item.top,
+ b = t + item.height,
+ dyClick = this.offset.click.top,
+ dxClick = this.offset.click.left,
+ isOverElementHeight = ( this.options.axis === "x" ) || ( ( y1 + dyClick ) > t && ( y1 + dyClick ) < b ),
+ isOverElementWidth = ( this.options.axis === "y" ) || ( ( x1 + dxClick ) > l && ( x1 + dxClick ) < r ),
+ isOverElement = isOverElementHeight && isOverElementWidth;
+
+ if (this.options.tolerance === "pointer" ||
+ this.options.forcePointerForContainers ||
+ (this.options.tolerance !== "pointer" && this.helperProportions[this.floating ? "width" : "height"] > item[this.floating ? "width" : "height"])
+ ) {
+ return isOverElement;
+ } else {
+
+ return (l < x1 + (this.helperProportions.width / 2) && // Right Half
+ x2 - (this.helperProportions.width / 2) < r && // Left Half
+ t < y1 + (this.helperProportions.height / 2) && // Bottom Half
+ y2 - (this.helperProportions.height / 2) < b ); // Top Half
+
+ }
+ },
+
+ _intersectsWithPointer: function (item) {
+
+ var isOverElementHeight = (this.options.axis === "x") || this._isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
+ isOverElementWidth = (this.options.axis === "y") || this._isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
+ isOverElement = isOverElementHeight && isOverElementWidth,
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (!isOverElement) {
+ return false;
+ }
+
+ return this.floating ?
+ ( ((horizontalDirection && horizontalDirection === "right") || verticalDirection === "down") ? 2 : 1 )
+ : ( verticalDirection && (verticalDirection === "down" ? 2 : 1) );
+
+ },
+
+ _intersectsWithSides: function (item) {
+
+ var isOverBottomHalf = this._isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height / 2), item.height),
+ isOverRightHalf = this._isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width / 2), item.width),
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (this.floating && horizontalDirection) {
+ return ((horizontalDirection === "right" && isOverRightHalf) || (horizontalDirection === "left" && !isOverRightHalf));
+ } else {
+ return verticalDirection && ((verticalDirection === "down" && isOverBottomHalf) || (verticalDirection === "up" && !isOverBottomHalf));
+ }
+
+ },
+
+ _getDragVerticalDirection: function () {
+ var delta = this.positionAbs.top - this.lastPositionAbs.top;
+ return delta !== 0 && (delta > 0 ? "down" : "up");
+ },
+
+ _getDragHorizontalDirection: function () {
+ var delta = this.positionAbs.left - this.lastPositionAbs.left;
+ return delta !== 0 && (delta > 0 ? "right" : "left");
+ },
+
+ refresh: function (event) {
+ this._refreshItems(event);
+ this._setHandleClassName();
+ this.refreshPositions();
+ return this;
+ },
+
+ _connectWith: function () {
+ var options = this.options;
+ return options.connectWith.constructor === String ? [options.connectWith] : options.connectWith;
+ },
+
+ _getItemsAsjQuery: function (connected) {
+
+ var i, j, cur, inst,
+ items = [],
+ queries = [],
+ connectWith = this._connectWith();
+
+ if (connectWith && connected) {
+ for (i = connectWith.length - 1; i >= 0; i--) {
+ cur = $(connectWith[i], this.document[0]);
+ for (j = cur.length - 1; j >= 0; j--) {
+ inst = $.data(cur[j], this.widgetFullName);
+ if (inst && inst !== this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), inst]);
+ }
+ }
+ }
+ }
+
+ queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, {
+ options: this.options,
+ item: this.currentItem
+ }) : $(this.options.items, this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), this]);
+
+ function addItems() {
+ items.push(this);
+ }
+
+ for (i = queries.length - 1; i >= 0; i--) {
+ queries[i][0].each(addItems);
+ }
+
+ return $(items);
+
+ },
+
+ _removeCurrentsFromItems: function () {
+
+ var list = this.currentItem.find(":data(" + this.widgetName + "-item)");
+
+ this.items = $.grep(this.items, function (item) {
+ for (var j = 0; j < list.length; j++) {
+ if (list[j] === item.item[0]) {
+ return false;
+ }
+ }
+ return true;
+ });
+
+ },
+
+ _refreshItems: function (event) {
+
+ this.items = [];
+ this.containers = [this];
+
+ var i, j, cur, inst, targetData, _queries, item, queriesLength,
+ items = this.items,
+ queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, {item: this.currentItem}) : $(this.options.items, this.element), this]],
+ connectWith = this._connectWith();
+
+ if (connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down
+ for (i = connectWith.length - 1; i >= 0; i--) {
+ cur = $(connectWith[i], this.document[0]);
+ for (j = cur.length - 1; j >= 0; j--) {
+ inst = $.data(cur[j], this.widgetFullName);
+ if (inst && inst !== this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, {item: this.currentItem}) : $(inst.options.items, inst.element), inst]);
+ this.containers.push(inst);
+ }
+ }
+ }
+ }
+
+ for (i = queries.length - 1; i >= 0; i--) {
+ targetData = queries[i][1];
+ _queries = queries[i][0];
+
+ for (j = 0, queriesLength = _queries.length; j < queriesLength; j++) {
+ item = $(_queries[j]);
+
+ item.data(this.widgetName + "-item", targetData); // Data for target checking (mouse manager)
+
+ items.push({
+ item: item,
+ instance: targetData,
+ width: 0, height: 0,
+ left: 0, top: 0
+ });
+ }
+ }
+
+ },
+
+ refreshPositions: function (fast) {
+
+ // Determine whether items are being displayed horizontally
+ this.floating = this.items.length ?
+ this.options.axis === "x" || this._isFloating(this.items[0].item) :
+ false;
+
+ //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
+ if (this.offsetParent && this.helper) {
+ this.offset.parent = this._getParentOffset();
+ }
+
+ var i, item, t, p;
+
+ for (i = this.items.length - 1; i >= 0; i--) {
+ item = this.items[i];
+
+ //We ignore calculating positions of all connected containers when we're not over them
+ if (item.instance !== this.currentContainer && this.currentContainer && item.item[0] !== this.currentItem[0]) {
+ continue;
+ }
+
+ t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
+
+ if (!fast) {
+ item.width = t.outerWidth();
+ item.height = t.outerHeight();
+ }
+
+ p = t.offset();
+ item.left = p.left;
+ item.top = p.top;
+ }
+
+ if (this.options.custom && this.options.custom.refreshContainers) {
+ this.options.custom.refreshContainers.call(this);
+ } else {
+ for (i = this.containers.length - 1; i >= 0; i--) {
+ p = this.containers[i].element.offset();
+ this.containers[i].containerCache.left = p.left;
+ this.containers[i].containerCache.top = p.top;
+ this.containers[i].containerCache.width = this.containers[i].element.outerWidth();
+ this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
+ }
+ }
+
+ return this;
+ },
+
+ _createPlaceholder: function (that) {
+ that = that || this;
+ var className,
+ o = that.options;
+
+ if (!o.placeholder || o.placeholder.constructor === String) {
+ className = o.placeholder;
+ o.placeholder = {
+ element: function () {
+
+ var nodeName = that.currentItem[0].nodeName.toLowerCase(),
+ element = $("<" + nodeName + ">", that.document[0])
+ .addClass(className || that.currentItem[0].className + " ui-sortable-placeholder")
+ .removeClass("ui-sortable-helper");
+
+ if (nodeName === "tbody") {
+ that._createTrPlaceholder(
+ that.currentItem.find("tr").eq(0),
+ $("<tr>", that.document[0]).appendTo(element)
+ );
+ } else if (nodeName === "tr") {
+ that._createTrPlaceholder(that.currentItem, element);
+ } else if (nodeName === "img") {
+ element.attr("src", that.currentItem.attr("src"));
+ }
+
+ if (!className) {
+ element.css("visibility", "hidden");
+ }
+
+ return element;
+ },
+ update: function (container, p) {
+
+ // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
+ // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
+ if (className && !o.forcePlaceholderSize) {
+ return;
+ }
+
+ //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
+ if (!p.height()) {
+ p.height(that.currentItem.innerHeight() - parseInt(that.currentItem.css("paddingTop") || 0, 10) - parseInt(that.currentItem.css("paddingBottom") || 0, 10));
+ }
+ if (!p.width()) {
+ p.width(that.currentItem.innerWidth() - parseInt(that.currentItem.css("paddingLeft") || 0, 10) - parseInt(that.currentItem.css("paddingRight") || 0, 10));
+ }
+ }
+ };
+ }
+
+ //Create the placeholder
+ that.placeholder = $(o.placeholder.element.call(that.element, that.currentItem));
+
+ //Append it after the actual current item
+ that.currentItem.after(that.placeholder);
+
+ //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
+ o.placeholder.update(that, that.placeholder);
+
+ },
+
+ _createTrPlaceholder: function (sourceTr, targetTr) {
+ var that = this;
+
+ sourceTr.children().each(function () {
+ $("<td> </td>", that.document[0])
+ .attr("colspan", $(this).attr("colspan") || 1)
+ .appendTo(targetTr);
+ });
+ },
+
+ _contactContainers: function (event) {
+ var i, j, dist, itemWithLeastDistance, posProperty, sizeProperty, cur, nearBottom, floating, axis,
+ innermostContainer = null,
+ innermostIndex = null;
+
+ // get innermost container that intersects with item
+ for (i = this.containers.length - 1; i >= 0; i--) {
+
+ // never consider a container that's located within the item itself
+ if ($.contains(this.currentItem[0], this.containers[i].element[0])) {
+ continue;
+ }
+
+ if (this._intersectsWith(this.containers[i].containerCache)) {
+
+ // if we've already found a container and it's more "inner" than this, then continue
+ if (innermostContainer && $.contains(this.containers[i].element[0], innermostContainer.element[0])) {
+ continue;
+ }
+
+ innermostContainer = this.containers[i];
+ innermostIndex = i;
+
+ } else {
+ // container doesn't intersect. trigger "out" event if necessary
+ if (this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", event, this._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ // if no intersecting containers found, return
+ if (!innermostContainer) {
+ return;
+ }
+
+ // move the item into the container if it's not there already
+ if (this.containers.length === 1) {
+ if (!this.containers[innermostIndex].containerCache.over) {
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ }
+ } else {
+
+ //When entering a new container, we will find the item with the least distance and append our item near it
+ dist = 10000;
+ itemWithLeastDistance = null;
+ floating = innermostContainer.floating || this._isFloating(this.currentItem);
+ posProperty = floating ? "left" : "top";
+ sizeProperty = floating ? "width" : "height";
+ axis = floating ? "clientX" : "clientY";
+
+ for (j = this.items.length - 1; j >= 0; j--) {
+ if (!$.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) {
+ continue;
+ }
+ if (this.items[j].item[0] === this.currentItem[0]) {
+ continue;
+ }
+
+ cur = this.items[j].item.offset()[posProperty];
+ nearBottom = false;
+ if (event[axis] - cur > this.items[j][sizeProperty] / 2) {
+ nearBottom = true;
+ }
+
+ if (Math.abs(event[axis] - cur) < dist) {
+ dist = Math.abs(event[axis] - cur);
+ itemWithLeastDistance = this.items[j];
+ this.direction = nearBottom ? "up" : "down";
+ }
+ }
+
+ //Check if dropOnEmpty is enabled
+ if (!itemWithLeastDistance && !this.options.dropOnEmpty) {
+ return;
+ }
+
+ if (this.currentContainer === this.containers[innermostIndex]) {
+ if (!this.currentContainer.containerCache.over) {
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash());
+ this.currentContainer.containerCache.over = 1;
+ }
+ return;
+ }
+
+ itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true);
+ this._trigger("change", event, this._uiHash());
+ this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
+ this.currentContainer = this.containers[innermostIndex];
+
+ //Update the placeholder
+ this.options.placeholder.update(this.currentContainer, this.placeholder);
+
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ }
+
+
+ },
+
+ _createHelper: function (event) {
+
+ var o = this.options,
+ helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper === "clone" ? this.currentItem.clone() : this.currentItem);
+
+ //Add the helper to the DOM if that didn't happen already
+ if (!helper.parents("body").length) {
+ $(o.appendTo !== "parent" ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
+ }
+
+ if (helper[0] === this.currentItem[0]) {
+ this._storedCSS = {
+ width: this.currentItem[0].style.width,
+ height: this.currentItem[0].style.height,
+ position: this.currentItem.css("position"),
+ top: this.currentItem.css("top"),
+ left: this.currentItem.css("left")
+ };
+ }
+
+ if (!helper[0].style.width || o.forceHelperSize) {
+ helper.width(this.currentItem.width());
+ }
+ if (!helper[0].style.height || o.forceHelperSize) {
+ helper.height(this.currentItem.height());
+ }
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function (obj) {
+ if (typeof obj === "string") {
+ obj = obj.split(" ");
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ("left" in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ("right" in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ("top" in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ("bottom" in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
+ },
+
+ _getParentOffset: function () {
+
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if (this.cssPosition === "absolute" && this.scrollParent[0] !== this.document[0] && $.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ // This needs to be actually done for all browsers, since pageX/pageY includes this information
+ // with an ugly IE fix
+ if (this.offsetParent[0] === this.document[0].body || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() === "html" && $.ui.ie)) {
+ po = {top: 0, left: 0};
+ }
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"), 10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"), 10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function () {
+
+ if (this.cssPosition === "relative") {
+ var p = this.currentItem.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"), 10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"), 10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return {top: 0, left: 0};
+ }
+
+ },
+
+ _cacheMargins: function () {
+ this.margins = {
+ left: (parseInt(this.currentItem.css("marginLeft"), 10) || 0),
+ top: (parseInt(this.currentItem.css("marginTop"), 10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function () {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function () {
+
+ var ce, co, over,
+ o = this.options;
+ if (o.containment === "parent") {
+ o.containment = this.helper[0].parentNode;
+ }
+ if (o.containment === "document" || o.containment === "window") {
+ this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ o.containment === "document" ? this.document.width() : this.window.width() - this.helperProportions.width - this.margins.left,
+ (o.containment === "document" ? this.document.width() : this.window.height() || this.document[0].body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+ }
+
+ if (!(/^(document|window|parent)$/).test(o.containment)) {
+ ce = $(o.containment)[0];
+ co = $(o.containment).offset();
+ over = ($(ce).css("overflow") !== "hidden");
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"), 10) || 0) + (parseInt($(ce).css("paddingLeft"), 10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"), 10) || 0) + (parseInt($(ce).css("paddingTop"), 10) || 0) - this.margins.top,
+ co.left + (over ? Math.max(ce.scrollWidth, ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"), 10) || 0) - (parseInt($(ce).css("paddingRight"), 10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top + (over ? Math.max(ce.scrollHeight, ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"), 10) || 0) - (parseInt($(ce).css("paddingBottom"), 10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ }
+
+ },
+
+ _convertPositionTo: function (d, pos) {
+
+ if (!pos) {
+ pos = this.position;
+ }
+ var mod = d === "absolute" ? 1 : -1,
+ scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== this.document[0] && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent,
+ scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top + // The absolute mouse position
+ this.offset.relative.top * mod + // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.top * mod - // The offsetParent's offset without borders (offset + border)
+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left + // The absolute mouse position
+ this.offset.relative.left * mod + // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.left * mod - // The offsetParent's offset without borders (offset + border)
+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function (event) {
+
+ var top, left,
+ o = this.options,
+ pageX = event.pageX,
+ pageY = event.pageY,
+ scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== this.document[0] && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ // This is another very weird special case that only happens for relative elements:
+ // 1. If the css position is relative
+ // 2. and the scroll parent is the document or similar to the offset parent
+ // we have to refresh the relative offset during the scroll so there are no jumps
+ if (this.cssPosition === "relative" && !(this.scrollParent[0] !== this.document[0] && this.scrollParent[0] !== this.offsetParent[0])) {
+ this.offset.relative = this._getRelativeOffset();
+ }
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if (this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if (this.containment) {
+ if (event.pageX - this.offset.click.left < this.containment[0]) {
+ pageX = this.containment[0] + this.offset.click.left;
+ }
+ if (event.pageY - this.offset.click.top < this.containment[1]) {
+ pageY = this.containment[1] + this.offset.click.top;
+ }
+ if (event.pageX - this.offset.click.left > this.containment[2]) {
+ pageX = this.containment[2] + this.offset.click.left;
+ }
+ if (event.pageY - this.offset.click.top > this.containment[3]) {
+ pageY = this.containment[3] + this.offset.click.top;
+ }
+ }
+
+ if (o.grid) {
+ top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? ( (top - this.offset.click.top >= this.containment[1] && top - this.offset.click.top <= this.containment[3]) ? top : ((top - this.offset.click.top >= this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? ( (left - this.offset.click.left >= this.containment[0] && left - this.offset.click.left <= this.containment[2]) ? left : ((left - this.offset.click.left >= this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY - // The absolute mouse position
+ this.offset.click.top - // Click offset (relative to the element)
+ this.offset.relative.top - // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.top + // The offsetParent's offset without borders (offset + border)
+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX - // The absolute mouse position
+ this.offset.click.left - // Click offset (relative to the element)
+ this.offset.relative.left - // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.left + // The offsetParent's offset without borders (offset + border)
+ ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _rearrange: function (event, i, a, hardRefresh) {
+
+ a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction === "down" ? i.item[0] : i.item[0].nextSibling));
+
+ //Various things done here to improve the performance:
+ // 1. we create a setTimeout, that calls refreshPositions
+ // 2. on the instance, we have a counter variable, that get's higher after every append
+ // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
+ // 4. this lets only the last addition to the timeout stack through
+ this.counter = this.counter ? ++this.counter : 1;
+ var counter = this.counter;
+
+ this._delay(function () {
+ if (counter === this.counter) {
+ this.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
+ }
+ });
+
+ },
+
+ _clear: function (event, noPropagation) {
+
+ this.reverting = false;
+ // We delay all events that have to be triggered to after the point where the placeholder has been removed and
+ // everything else normalized again
+ var i,
+ delayedTriggers = [];
+
+ // We first have to update the dom position of the actual currentItem
+ // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
+ if (!this._noFinalSort && this.currentItem.parent().length) {
+ this.placeholder.before(this.currentItem);
+ }
+ this._noFinalSort = null;
+
+ if (this.helper[0] === this.currentItem[0]) {
+ for (i in this._storedCSS) {
+ if (this._storedCSS[i] === "auto" || this._storedCSS[i] === "static") {
+ this._storedCSS[i] = "";
+ }
+ }
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ } else {
+ this.currentItem.show();
+ }
+
+ if (this.fromOutside && !noPropagation) {
+ delayedTriggers.push(function (event) {
+ this._trigger("receive", event, this._uiHash(this.fromOutside));
+ });
+ }
+ if ((this.fromOutside || this.domPosition.prev !== this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent !== this.currentItem.parent()[0]) && !noPropagation) {
+ delayedTriggers.push(function (event) {
+ this._trigger("update", event, this._uiHash());
+ }); //Trigger update callback if the DOM position has changed
+ }
+
+ // Check if the items Container has Changed and trigger appropriate
+ // events.
+ if (this !== this.currentContainer) {
+ if (!noPropagation) {
+ delayedTriggers.push(function (event) {
+ this._trigger("remove", event, this._uiHash());
+ });
+ delayedTriggers.push((function (c) {
+ return function (event) {
+ c._trigger("receive", event, this._uiHash(this));
+ };
+ }).call(this, this.currentContainer));
+ delayedTriggers.push((function (c) {
+ return function (event) {
+ c._trigger("update", event, this._uiHash(this));
+ };
+ }).call(this, this.currentContainer));
+ }
+ }
+
+
+ //Post events to containers
+ function delayEvent(type, instance, container) {
+ return function (event) {
+ container._trigger(type, event, instance._uiHash(instance));
+ };
+ }
+
+ for (i = this.containers.length - 1; i >= 0; i--) {
+ if (!noPropagation) {
+ delayedTriggers.push(delayEvent("deactivate", this, this.containers[i]));
+ }
+ if (this.containers[i].containerCache.over) {
+ delayedTriggers.push(delayEvent("out", this, this.containers[i]));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ //Do what was originally in plugins
+ if (this.storedCursor) {
+ this.document.find("body").css("cursor", this.storedCursor);
+ this.storedStylesheet.remove();
+ }
+ if (this._storedOpacity) {
+ this.helper.css("opacity", this._storedOpacity);
+ }
+ if (this._storedZIndex) {
+ this.helper.css("zIndex", this._storedZIndex === "auto" ? "" : this._storedZIndex);
+ }
+
+ this.dragging = false;
+
+ if (!noPropagation) {
+ this._trigger("beforeStop", event, this._uiHash());
+ }
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+
+ if (!this.cancelHelperRemoval) {
+ if (this.helper[0] !== this.currentItem[0]) {
+ this.helper.remove();
+ }
+ this.helper = null;
+ }
+
+ if (!noPropagation) {
+ for (i = 0; i < delayedTriggers.length; i++) {
+ delayedTriggers[i].call(this, event);
+ } //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+
+ this.fromOutside = false;
+ return !this.cancelHelperRemoval;
+
+ },
+
+ _trigger: function () {
+ if ($.Widget.prototype._trigger.apply(this, arguments) === false) {
+ this.cancel();
+ }
+ },
+
+ _uiHash: function (_inst) {
+ var inst = _inst || this;
+ return {
+ helper: inst.helper,
+ placeholder: inst.placeholder || $([]),
+ position: inst.position,
+ originalPosition: inst.originalPosition,
+ offset: inst.positionAbs,
+ item: inst.currentItem,
+ sender: _inst ? _inst.element : null
+ };
+ }
+
+ });
+
+
+ /*!
+ * jQuery UI Accordion 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/accordion/
+ */
+
+
+ var accordion = $.widget("ui.accordion", {
+ version: "1.11.4",
+ options: {
+ active: 0,
+ animate: {},
+ collapsible: false,
+ event: "click",
+ header: "> li > :first-child,> :not(li):even",
+ heightStyle: "auto",
+ icons: {
+ activeHeader: "ui-icon-triangle-1-s",
+ header: "ui-icon-triangle-1-e"
+ },
+
+ // callbacks
+ activate: null,
+ beforeActivate: null
+ },
+
+ hideProps: {
+ borderTopWidth: "hide",
+ borderBottomWidth: "hide",
+ paddingTop: "hide",
+ paddingBottom: "hide",
+ height: "hide"
+ },
+
+ showProps: {
+ borderTopWidth: "show",
+ borderBottomWidth: "show",
+ paddingTop: "show",
+ paddingBottom: "show",
+ height: "show"
+ },
+
+ _create: function () {
+ var options = this.options;
+ this.prevShow = this.prevHide = $();
+ this.element.addClass("ui-accordion ui-widget ui-helper-reset")
+ // ARIA
+ .attr("role", "tablist");
+
+ // don't allow collapsible: false and active: false / null
+ if (!options.collapsible && (options.active === false || options.active == null)) {
+ options.active = 0;
+ }
+
+ this._processPanels();
+ // handle negative values
+ if (options.active < 0) {
+ options.active += this.headers.length;
+ }
+ this._refresh();
+ },
+
+ _getCreateEventData: function () {
+ return {
+ header: this.active,
+ panel: !this.active.length ? $() : this.active.next()
+ };
+ },
+
+ _createIcons: function () {
+ var icons = this.options.icons;
+ if (icons) {
+ $("<span>")
+ .addClass("ui-accordion-header-icon ui-icon " + icons.header)
+ .prependTo(this.headers);
+ this.active.children(".ui-accordion-header-icon")
+ .removeClass(icons.header)
+ .addClass(icons.activeHeader);
+ this.headers.addClass("ui-accordion-icons");
+ }
+ },
+
+ _destroyIcons: function () {
+ this.headers
+ .removeClass("ui-accordion-icons")
+ .children(".ui-accordion-header-icon")
+ .remove();
+ },
+
+ _destroy: function () {
+ var contents;
+
+ // clean up main element
+ this.element
+ .removeClass("ui-accordion ui-widget ui-helper-reset")
+ .removeAttr("role");
+
+ // clean up headers
+ this.headers
+ .removeClass("ui-accordion-header ui-accordion-header-active ui-state-default " +
+ "ui-corner-all ui-state-active ui-state-disabled ui-corner-top")
+ .removeAttr("role")
+ .removeAttr("aria-expanded")
+ .removeAttr("aria-selected")
+ .removeAttr("aria-controls")
+ .removeAttr("tabIndex")
+ .removeUniqueId();
+
+ this._destroyIcons();
+
+ // clean up content panels
+ contents = this.headers.next()
+ .removeClass("ui-helper-reset ui-widget-content ui-corner-bottom " +
+ "ui-accordion-content ui-accordion-content-active ui-state-disabled")
+ .css("display", "")
+ .removeAttr("role")
+ .removeAttr("aria-hidden")
+ .removeAttr("aria-labelledby")
+ .removeUniqueId();
+
+ if (this.options.heightStyle !== "content") {
+ contents.css("height", "");
+ }
+ },
+
+ _setOption: function (key, value) {
+ if (key === "active") {
+ // _activate() will handle invalid values and update this.options
+ this._activate(value);
+ return;
+ }
+
+ if (key === "event") {
+ if (this.options.event) {
+ this._off(this.headers, this.options.event);
+ }
+ this._setupEvents(value);
+ }
+
+ this._super(key, value);
+
+ // setting collapsible: false while collapsed; open first panel
+ if (key === "collapsible" && !value && this.options.active === false) {
+ this._activate(0);
+ }
+
+ if (key === "icons") {
+ this._destroyIcons();
+ if (value) {
+ this._createIcons();
+ }
+ }
+
+ // #5332 - opacity doesn't cascade to positioned elements in IE
+ // so we need to add the disabled class to the headers and panels
+ if (key === "disabled") {
+ this.element
+ .toggleClass("ui-state-disabled", !!value)
+ .attr("aria-disabled", value);
+ this.headers.add(this.headers.next())
+ .toggleClass("ui-state-disabled", !!value);
+ }
+ },
+
+ _keydown: function (event) {
+ if (event.altKey || event.ctrlKey) {
+ return;
+ }
+
+ var keyCode = $.ui.keyCode,
+ length = this.headers.length,
+ currentIndex = this.headers.index(event.target),
+ toFocus = false;
+
+ switch (event.keyCode) {
+ case keyCode.RIGHT:
+ case keyCode.DOWN:
+ toFocus = this.headers[( currentIndex + 1 ) % length];
+ break;
+ case keyCode.LEFT:
+ case keyCode.UP:
+ toFocus = this.headers[( currentIndex - 1 + length ) % length];
+ break;
+ case keyCode.SPACE:
+ case keyCode.ENTER:
+ this._eventHandler(event);
+ break;
+ case keyCode.HOME:
+ toFocus = this.headers[0];
+ break;
+ case keyCode.END:
+ toFocus = this.headers[length - 1];
+ break;
+ }
+
+ if (toFocus) {
+ $(event.target).attr("tabIndex", -1);
+ $(toFocus).attr("tabIndex", 0);
+ toFocus.focus();
+ event.preventDefault();
+ }
+ },
+
+ _panelKeyDown: function (event) {
+ if (event.keyCode === $.ui.keyCode.UP && event.ctrlKey) {
+ $(event.currentTarget).prev().focus();
+ }
+ },
+
+ refresh: function () {
+ var options = this.options;
+ this._processPanels();
+
+ // was collapsed or no panel
+ if (( options.active === false && options.collapsible === true ) || !this.headers.length) {
+ options.active = false;
+ this.active = $();
+ // active false only when collapsible is true
+ } else if (options.active === false) {
+ this._activate(0);
+ // was active, but active panel is gone
+ } else if (this.active.length && !$.contains(this.element[0], this.active[0])) {
+ // all remaining panel are disabled
+ if (this.headers.length === this.headers.find(".ui-state-disabled").length) {
+ options.active = false;
+ this.active = $();
+ // activate previous panel
+ } else {
+ this._activate(Math.max(0, options.active - 1));
+ }
+ // was active, active panel still exists
+ } else {
+ // make sure active index is correct
+ options.active = this.headers.index(this.active);
+ }
+
+ this._destroyIcons();
+
+ this._refresh();
+ },
+
+ _processPanels: function () {
+ var prevHeaders = this.headers,
+ prevPanels = this.panels;
+
+ this.headers = this.element.find(this.options.header)
+ .addClass("ui-accordion-header ui-state-default ui-corner-all");
+
+ this.panels = this.headers.next()
+ .addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom")
+ .filter(":not(.ui-accordion-content-active)")
+ .hide();
+
+ // Avoid memory leaks (#10056)
+ if (prevPanels) {
+ this._off(prevHeaders.not(this.headers));
+ this._off(prevPanels.not(this.panels));
+ }
+ },
+
+ _refresh: function () {
+ var maxHeight,
+ options = this.options,
+ heightStyle = options.heightStyle,
+ parent = this.element.parent();
+
+ this.active = this._findActive(options.active)
+ .addClass("ui-accordion-header-active ui-state-active ui-corner-top")
+ .removeClass("ui-corner-all");
+ this.active.next()
+ .addClass("ui-accordion-content-active")
+ .show();
+
+ this.headers
+ .attr("role", "tab")
+ .each(function () {
+ var header = $(this),
+ headerId = header.uniqueId().attr("id"),
+ panel = header.next(),
+ panelId = panel.uniqueId().attr("id");
+ header.attr("aria-controls", panelId);
+ panel.attr("aria-labelledby", headerId);
+ })
+ .next()
+ .attr("role", "tabpanel");
+
+ this.headers
+ .not(this.active)
+ .attr({
+ "aria-selected": "false",
+ "aria-expanded": "false",
+ tabIndex: -1
+ })
+ .next()
+ .attr({
+ "aria-hidden": "true"
+ })
+ .hide();
+
+ // make sure at least one header is in the tab order
+ if (!this.active.length) {
+ this.headers.eq(0).attr("tabIndex", 0);
+ } else {
+ this.active.attr({
+ "aria-selected": "true",
+ "aria-expanded": "true",
+ tabIndex: 0
+ })
+ .next()
+ .attr({
+ "aria-hidden": "false"
+ });
+ }
+
+ this._createIcons();
+
+ this._setupEvents(options.event);
+
+ if (heightStyle === "fill") {
+ maxHeight = parent.height();
+ this.element.siblings(":visible").each(function () {
+ var elem = $(this),
+ position = elem.css("position");
+
+ if (position === "absolute" || position === "fixed") {
+ return;
+ }
+ maxHeight -= elem.outerHeight(true);
+ });
+
+ this.headers.each(function () {
+ maxHeight -= $(this).outerHeight(true);
+ });
+
+ this.headers.next()
+ .each(function () {
+ $(this).height(Math.max(0, maxHeight -
+ $(this).innerHeight() + $(this).height()));
+ })
+ .css("overflow", "auto");
+ } else if (heightStyle === "auto") {
+ maxHeight = 0;
+ this.headers.next()
+ .each(function () {
+ maxHeight = Math.max(maxHeight, $(this).css("height", "").height());
+ })
+ .height(maxHeight);
+ }
+ },
+
+ _activate: function (index) {
+ var active = this._findActive(index)[0];
+
+ // trying to activate the already active panel
+ if (active === this.active[0]) {
+ return;
+ }
+
+ // trying to collapse, simulate a click on the currently active header
+ active = active || this.active[0];
+
+ this._eventHandler({
+ target: active,
+ currentTarget: active,
+ preventDefault: $.noop
+ });
+ },
+
+ _findActive: function (selector) {
+ return typeof selector === "number" ? this.headers.eq(selector) : $();
+ },
+
+ _setupEvents: function (event) {
+ var events = {
+ keydown: "_keydown"
+ };
+ if (event) {
+ $.each(event.split(" "), function (index, eventName) {
+ events[eventName] = "_eventHandler";
+ });
+ }
+
+ this._off(this.headers.add(this.headers.next()));
+ this._on(this.headers, events);
+ this._on(this.headers.next(), {keydown: "_panelKeyDown"});
+ this._hoverable(this.headers);
+ this._focusable(this.headers);
+ },
+
+ _eventHandler: function (event) {
+ var options = this.options,
+ active = this.active,
+ clicked = $(event.currentTarget),
+ clickedIsActive = clicked[0] === active[0],
+ collapsing = clickedIsActive && options.collapsible,
+ toShow = collapsing ? $() : clicked.next(),
+ toHide = active.next(),
+ eventData = {
+ oldHeader: active,
+ oldPanel: toHide,
+ newHeader: collapsing ? $() : clicked,
+ newPanel: toShow
+ };
+
+ event.preventDefault();
+
+ if (
+ // click on active header, but not collapsible
+ ( clickedIsActive && !options.collapsible ) ||
+ // allow canceling activation
+ ( this._trigger("beforeActivate", event, eventData) === false )) {
+ return;
+ }
+
+ options.active = collapsing ? false : this.headers.index(clicked);
+
+ // when the call to ._toggle() comes after the class changes
+ // it causes a very odd bug in IE 8 (see #6720)
+ this.active = clickedIsActive ? $() : clicked;
+ this._toggle(eventData);
+
+ // switch classes
+ // corner classes on the previously active header stay after the animation
+ active.removeClass("ui-accordion-header-active ui-state-active");
+ if (options.icons) {
+ active.children(".ui-accordion-header-icon")
+ .removeClass(options.icons.activeHeader)
+ .addClass(options.icons.header);
+ }
+
+ if (!clickedIsActive) {
+ clicked
+ .removeClass("ui-corner-all")
+ .addClass("ui-accordion-header-active ui-state-active ui-corner-top");
+ if (options.icons) {
+ clicked.children(".ui-accordion-header-icon")
+ .removeClass(options.icons.header)
+ .addClass(options.icons.activeHeader);
+ }
+
+ clicked
+ .next()
+ .addClass("ui-accordion-content-active");
+ }
+ },
+
+ _toggle: function (data) {
+ var toShow = data.newPanel,
+ toHide = this.prevShow.length ? this.prevShow : data.oldPanel;
+
+ // handle activating a panel during the animation for another activation
+ this.prevShow.add(this.prevHide).stop(true, true);
+ this.prevShow = toShow;
+ this.prevHide = toHide;
+
+ if (this.options.animate) {
+ this._animate(toShow, toHide, data);
+ } else {
+ toHide.hide();
+ toShow.show();
+ this._toggleComplete(data);
+ }
+
+ toHide.attr({
+ "aria-hidden": "true"
+ });
+ toHide.prev().attr({
+ "aria-selected": "false",
+ "aria-expanded": "false"
+ });
+ // if we're switching panels, remove the old header from the tab order
+ // if we're opening from collapsed state, remove the previous header from the tab order
+ // if we're collapsing, then keep the collapsing header in the tab order
+ if (toShow.length && toHide.length) {
+ toHide.prev().attr({
+ "tabIndex": -1,
+ "aria-expanded": "false"
+ });
+ } else if (toShow.length) {
+ this.headers.filter(function () {
+ return parseInt($(this).attr("tabIndex"), 10) === 0;
+ })
+ .attr("tabIndex", -1);
+ }
+
+ toShow
+ .attr("aria-hidden", "false")
+ .prev()
+ .attr({
+ "aria-selected": "true",
+ "aria-expanded": "true",
+ tabIndex: 0
+ });
+ },
+
+ _animate: function (toShow, toHide, data) {
+ var total, easing, duration,
+ that = this,
+ adjust = 0,
+ boxSizing = toShow.css("box-sizing"),
+ down = toShow.length &&
+ ( !toHide.length || ( toShow.index() < toHide.index() ) ),
+ animate = this.options.animate || {},
+ options = down && animate.down || animate,
+ complete = function () {
+ that._toggleComplete(data);
+ };
+
+ if (typeof options === "number") {
+ duration = options;
+ }
+ if (typeof options === "string") {
+ easing = options;
+ }
+ // fall back from options to animation in case of partial down settings
+ easing = easing || options.easing || animate.easing;
+ duration = duration || options.duration || animate.duration;
+
+ if (!toHide.length) {
+ return toShow.animate(this.showProps, duration, easing, complete);
+ }
+ if (!toShow.length) {
+ return toHide.animate(this.hideProps, duration, easing, complete);
+ }
+
+ total = toShow.show().outerHeight();
+ toHide.animate(this.hideProps, {
+ duration: duration,
+ easing: easing,
+ step: function (now, fx) {
+ fx.now = Math.round(now);
+ }
+ });
+ toShow
+ .hide()
+ .animate(this.showProps, {
+ duration: duration,
+ easing: easing,
+ complete: complete,
+ step: function (now, fx) {
+ fx.now = Math.round(now);
+ if (fx.prop !== "height") {
+ if (boxSizing === "content-box") {
+ adjust += fx.now;
+ }
+ } else if (that.options.heightStyle !== "content") {
+ fx.now = Math.round(total - toHide.outerHeight() - adjust);
+ adjust = 0;
+ }
+ }
+ });
+ },
+
+ _toggleComplete: function (data) {
+ var toHide = data.oldPanel;
+
+ toHide
+ .removeClass("ui-accordion-content-active")
+ .prev()
+ .removeClass("ui-corner-top")
+ .addClass("ui-corner-all");
+
+ // Work around for rendering bug in IE (#5421)
+ if (toHide.length) {
+ toHide.parent()[0].className = toHide.parent()[0].className;
+ }
+ this._trigger("activate", null, data);
+ }
+ });
+
+
+ /*!
+ * jQuery UI Menu 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/menu/
+ */
+
+
+ var menu = $.widget("ui.menu", {
+ version: "1.11.4",
+ defaultElement: "<ul>",
+ delay: 300,
+ options: {
+ icons: {
+ submenu: "ui-icon-carat-1-e"
+ },
+ items: "> *",
+ menus: "ul",
+ position: {
+ my: "left-1 top",
+ at: "right top"
+ },
+ role: "menu",
+
+ // callbacks
+ blur: null,
+ focus: null,
+ select: null
+ },
+
+ _create: function () {
+ this.activeMenu = this.element;
+
+ // Flag used to prevent firing of the click handler
+ // as the event bubbles up through nested menus
+ this.mouseHandled = false;
+ this.element
+ .uniqueId()
+ .addClass("ui-menu ui-widget ui-widget-content")
+ .toggleClass("ui-menu-icons", !!this.element.find(".ui-icon").length)
+ .attr({
+ role: this.options.role,
+ tabIndex: 0
+ });
+
+ if (this.options.disabled) {
+ this.element
+ .addClass("ui-state-disabled")
+ .attr("aria-disabled", "true");
+ }
+
+ this._on({
+ // Prevent focus from sticking to links inside menu after clicking
+ // them (focus should always stay on UL during navigation).
+ "mousedown .ui-menu-item": function (event) {
+ event.preventDefault();
+ },
+ "click .ui-menu-item": function (event) {
+ var target = $(event.target);
+ if (!this.mouseHandled && target.not(".ui-state-disabled").length) {
+ this.select(event);
+
+ // Only set the mouseHandled flag if the event will bubble, see #9469.
+ if (!event.isPropagationStopped()) {
+ this.mouseHandled = true;
+ }
+
+ // Open submenu on click
+ if (target.has(".ui-menu").length) {
+ this.expand(event);
+ } else if (!this.element.is(":focus") && $(this.document[0].activeElement).closest(".ui-menu").length) {
+
+ // Redirect focus to the menu
+ this.element.trigger("focus", [true]);
+
+ // If the active item is on the top level, let it stay active.
+ // Otherwise, blur the active item since it is no longer visible.
+ if (this.active && this.active.parents(".ui-menu").length === 1) {
+ clearTimeout(this.timer);
+ }
+ }
+ }
+ },
+ "mouseenter .ui-menu-item": function (event) {
+ // Ignore mouse events while typeahead is active, see #10458.
+ // Prevents focusing the wrong item when typeahead causes a scroll while the mouse
+ // is over an item in the menu
+ if (this.previousFilter) {
+ return;
+ }
+ var target = $(event.currentTarget);
+ // Remove ui-state-active class from siblings of the newly focused menu item
+ // to avoid a jump caused by adjacent elements both having a class with a border
+ target.siblings(".ui-state-active").removeClass("ui-state-active");
+ this.focus(event, target);
+ },
+ mouseleave: "collapseAll",
+ "mouseleave .ui-menu": "collapseAll",
+ focus: function (event, keepActiveItem) {
+ // If there's already an active item, keep it active
+ // If not, activate the first item
+ var item = this.active || this.element.find(this.options.items).eq(0);
+
+ if (!keepActiveItem) {
+ this.focus(event, item);
+ }
+ },
+ blur: function (event) {
+ this._delay(function () {
+ if (!$.contains(this.element[0], this.document[0].activeElement)) {
+ this.collapseAll(event);
+ }
+ });
+ },
+ keydown: "_keydown"
+ });
+
+ this.refresh();
+
+ // Clicks outside of a menu collapse any open menus
+ this._on(this.document, {
+ click: function (event) {
+ if (this._closeOnDocumentClick(event)) {
+ this.collapseAll(event);
+ }
+
+ // Reset the mouseHandled flag
+ this.mouseHandled = false;
+ }
+ });
+ },
+
+ _destroy: function () {
+ // Destroy (sub)menus
+ this.element
+ .removeAttr("aria-activedescendant")
+ .find(".ui-menu").addBack()
+ .removeClass("ui-menu ui-widget ui-widget-content ui-menu-icons ui-front")
+ .removeAttr("role")
+ .removeAttr("tabIndex")
+ .removeAttr("aria-labelledby")
+ .removeAttr("aria-expanded")
+ .removeAttr("aria-hidden")
+ .removeAttr("aria-disabled")
+ .removeUniqueId()
+ .show();
+
+ // Destroy menu items
+ this.element.find(".ui-menu-item")
+ .removeClass("ui-menu-item")
+ .removeAttr("role")
+ .removeAttr("aria-disabled")
+ .removeUniqueId()
+ .removeClass("ui-state-hover")
+ .removeAttr("tabIndex")
+ .removeAttr("role")
+ .removeAttr("aria-haspopup")
+ .children().each(function () {
+ var elem = $(this);
+ if (elem.data("ui-menu-submenu-carat")) {
+ elem.remove();
+ }
+ });
+
+ // Destroy menu dividers
+ this.element.find(".ui-menu-divider").removeClass("ui-menu-divider ui-widget-content");
+ },
+
+ _keydown: function (event) {
+ var match, prev, character, skip,
+ preventDefault = true;
+
+ switch (event.keyCode) {
+ case $.ui.keyCode.PAGE_UP:
+ this.previousPage(event);
+ break;
+ case $.ui.keyCode.PAGE_DOWN:
+ this.nextPage(event);
+ break;
+ case $.ui.keyCode.HOME:
+ this._move("first", "first", event);
+ break;
+ case $.ui.keyCode.END:
+ this._move("last", "last", event);
+ break;
+ case $.ui.keyCode.UP:
+ this.previous(event);
+ break;
+ case $.ui.keyCode.DOWN:
+ this.next(event);
+ break;
+ case $.ui.keyCode.LEFT:
+ this.collapse(event);
+ break;
+ case $.ui.keyCode.RIGHT:
+ if (this.active && !this.active.is(".ui-state-disabled")) {
+ this.expand(event);
+ }
+ break;
+ case $.ui.keyCode.ENTER:
+ case $.ui.keyCode.SPACE:
+ this._activate(event);
+ break;
+ case $.ui.keyCode.ESCAPE:
+ this.collapse(event);
+ break;
+ default:
+ preventDefault = false;
+ prev = this.previousFilter || "";
+ character = String.fromCharCode(event.keyCode);
+ skip = false;
+
+ clearTimeout(this.filterTimer);
+
+ if (character === prev) {
+ skip = true;
+ } else {
+ character = prev + character;
+ }
+
+ match = this._filterMenuItems(character);
+ match = skip && match.index(this.active.next()) !== -1 ?
+ this.active.nextAll(".ui-menu-item") :
+ match;
+
+ // If no matches on the current filter, reset to the last character pressed
+ // to move down the menu to the first item that starts with that character
+ if (!match.length) {
+ character = String.fromCharCode(event.keyCode);
+ match = this._filterMenuItems(character);
+ }
+
+ if (match.length) {
+ this.focus(event, match);
+ this.previousFilter = character;
+ this.filterTimer = this._delay(function () {
+ delete this.previousFilter;
+ }, 1000);
+ } else {
+ delete this.previousFilter;
+ }
+ }
+
+ if (preventDefault) {
+ event.preventDefault();
+ }
+ },
+
+ _activate: function (event) {
+ if (!this.active.is(".ui-state-disabled")) {
+ if (this.active.is("[aria-haspopup='true']")) {
+ this.expand(event);
+ } else {
+ this.select(event);
+ }
+ }
+ },
+
+ refresh: function () {
+ var menus, items,
+ that = this,
+ icon = this.options.icons.submenu,
+ submenus = this.element.find(this.options.menus);
+
+ this.element.toggleClass("ui-menu-icons", !!this.element.find(".ui-icon").length);
+
+ // Initialize nested menus
+ submenus.filter(":not(.ui-menu)")
+ .addClass("ui-menu ui-widget ui-widget-content ui-front")
+ .hide()
+ .attr({
+ role: this.options.role,
+ "aria-hidden": "true",
+ "aria-expanded": "false"
+ })
+ .each(function () {
+ var menu = $(this),
+ item = menu.parent(),
+ submenuCarat = $("<span>")
+ .addClass("ui-menu-icon ui-icon " + icon)
+ .data("ui-menu-submenu-carat", true);
+
+ item
+ .attr("aria-haspopup", "true")
+ .prepend(submenuCarat);
+ menu.attr("aria-labelledby", item.attr("id"));
+ });
+
+ menus = submenus.add(this.element);
+ items = menus.find(this.options.items);
+
+ // Initialize menu-items containing spaces and/or dashes only as dividers
+ items.not(".ui-menu-item").each(function () {
+ var item = $(this);
+ if (that._isDivider(item)) {
+ item.addClass("ui-widget-content ui-menu-divider");
+ }
+ });
+
+ // Don't refresh list items that are already adapted
+ items.not(".ui-menu-item, .ui-menu-divider")
+ .addClass("ui-menu-item")
+ .uniqueId()
+ .attr({
+ tabIndex: -1,
+ role: this._itemRole()
+ });
+
+ // Add aria-disabled attribute to any disabled menu item
+ items.filter(".ui-state-disabled").attr("aria-disabled", "true");
+
+ // If the active item has been removed, blur the menu
+ if (this.active && !$.contains(this.element[0], this.active[0])) {
+ this.blur();
+ }
+ },
+
+ _itemRole: function () {
+ return {
+ menu: "menuitem",
+ listbox: "option"
+ }[this.options.role];
+ },
+
+ _setOption: function (key, value) {
+ if (key === "icons") {
+ this.element.find(".ui-menu-icon")
+ .removeClass(this.options.icons.submenu)
+ .addClass(value.submenu);
+ }
+ if (key === "disabled") {
+ this.element
+ .toggleClass("ui-state-disabled", !!value)
+ .attr("aria-disabled", value);
+ }
+ this._super(key, value);
+ },
+
+ focus: function (event, item) {
+ var nested, focused;
+ this.blur(event, event && event.type === "focus");
+
+ this._scrollIntoView(item);
+
+ this.active = item.first();
+ focused = this.active.addClass("ui-state-focus").removeClass("ui-state-active");
+ // Only update aria-activedescendant if there's a role
+ // otherwise we assume focus is managed elsewhere
+ if (this.options.role) {
+ this.element.attr("aria-activedescendant", focused.attr("id"));
+ }
+
+ // Highlight active parent menu item, if any
+ this.active
+ .parent()
+ .closest(".ui-menu-item")
+ .addClass("ui-state-active");
+
+ if (event && event.type === "keydown") {
+ this._close();
+ } else {
+ this.timer = this._delay(function () {
+ this._close();
+ }, this.delay);
+ }
+
+ nested = item.children(".ui-menu");
+ if (nested.length && event && ( /^mouse/.test(event.type) )) {
+ this._startOpening(nested);
+ }
+ this.activeMenu = item.parent();
+
+ this._trigger("focus", event, {item: item});
+ },
+
+ _scrollIntoView: function (item) {
+ var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight;
+ if (this._hasScroll()) {
+ borderTop = parseFloat($.css(this.activeMenu[0], "borderTopWidth")) || 0;
+ paddingTop = parseFloat($.css(this.activeMenu[0], "paddingTop")) || 0;
+ offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop;
+ scroll = this.activeMenu.scrollTop();
+ elementHeight = this.activeMenu.height();
+ itemHeight = item.outerHeight();
+
+ if (offset < 0) {
+ this.activeMenu.scrollTop(scroll + offset);
+ } else if (offset + itemHeight > elementHeight) {
+ this.activeMenu.scrollTop(scroll + offset - elementHeight + itemHeight);
+ }
+ }
+ },
+
+ blur: function (event, fromFocus) {
+ if (!fromFocus) {
+ clearTimeout(this.timer);
+ }
+
+ if (!this.active) {
+ return;
+ }
+
+ this.active.removeClass("ui-state-focus");
+ this.active = null;
+
+ this._trigger("blur", event, {item: this.active});
+ },
+
+ _startOpening: function (submenu) {
+ clearTimeout(this.timer);
+
+ // Don't open if already open fixes a Firefox bug that caused a .5 pixel
+ // shift in the submenu position when mousing over the carat icon
+ if (submenu.attr("aria-hidden") !== "true") {
+ return;
+ }
+
+ this.timer = this._delay(function () {
+ this._close();
+ this._open(submenu);
+ }, this.delay);
+ },
+
+ _open: function (submenu) {
+ var position = $.extend({
+ of: this.active
+ }, this.options.position);
+
+ clearTimeout(this.timer);
+ this.element.find(".ui-menu").not(submenu.parents(".ui-menu"))
+ .hide()
+ .attr("aria-hidden", "true");
+
+ submenu
+ .show()
+ .removeAttr("aria-hidden")
+ .attr("aria-expanded", "true")
+ .position(position);
+ },
+
+ collapseAll: function (event, all) {
+ clearTimeout(this.timer);
+ this.timer = this._delay(function () {
+ // If we were passed an event, look for the submenu that contains the event
+ var currentMenu = all ? this.element :
+ $(event && event.target).closest(this.element.find(".ui-menu"));
+
+ // If we found no valid submenu ancestor, use the main menu to close all sub menus anyway
+ if (!currentMenu.length) {
+ currentMenu = this.element;
+ }
+
+ this._close(currentMenu);
+
+ this.blur(event);
+ this.activeMenu = currentMenu;
+ }, this.delay);
+ },
+
+ // With no arguments, closes the currently active menu - if nothing is active
+ // it closes all menus. If passed an argument, it will search for menus BELOW
+ _close: function (startMenu) {
+ if (!startMenu) {
+ startMenu = this.active ? this.active.parent() : this.element;
+ }
+
+ startMenu
+ .find(".ui-menu")
+ .hide()
+ .attr("aria-hidden", "true")
+ .attr("aria-expanded", "false")
+ .end()
+ .find(".ui-state-active").not(".ui-state-focus")
+ .removeClass("ui-state-active");
+ },
+
+ _closeOnDocumentClick: function (event) {
+ return !$(event.target).closest(".ui-menu").length;
+ },
+
+ _isDivider: function (item) {
+
+ // Match hyphen, em dash, en dash
+ return !/[^\-\u2014\u2013\s]/.test(item.text());
+ },
+
+ collapse: function (event) {
+ var newItem = this.active &&
+ this.active.parent().closest(".ui-menu-item", this.element);
+ if (newItem && newItem.length) {
+ this._close();
+ this.focus(event, newItem);
+ }
+ },
+
+ expand: function (event) {
+ var newItem = this.active &&
+ this.active
+ .children(".ui-menu ")
+ .find(this.options.items)
+ .first();
+
+ if (newItem && newItem.length) {
+ this._open(newItem.parent());
+
+ // Delay so Firefox will not hide activedescendant change in expanding submenu from AT
+ this._delay(function () {
+ this.focus(event, newItem);
+ });
+ }
+ },
+
+ next: function (event) {
+ this._move("next", "first", event);
+ },
+
+ previous: function (event) {
+ this._move("prev", "last", event);
+ },
+
+ isFirstItem: function () {
+ return this.active && !this.active.prevAll(".ui-menu-item").length;
+ },
+
+ isLastItem: function () {
+ return this.active && !this.active.nextAll(".ui-menu-item").length;
+ },
+
+ _move: function (direction, filter, event) {
+ var next;
+ if (this.active) {
+ if (direction === "first" || direction === "last") {
+ next = this.active
+ [direction === "first" ? "prevAll" : "nextAll"](".ui-menu-item")
+ .eq(-1);
+ } else {
+ next = this.active
+ [direction + "All"](".ui-menu-item")
+ .eq(0);
+ }
+ }
+ if (!next || !next.length || !this.active) {
+ next = this.activeMenu.find(this.options.items)[filter]();
+ }
+
+ this.focus(event, next);
+ },
+
+ nextPage: function (event) {
+ var item, base, height;
+
+ if (!this.active) {
+ this.next(event);
+ return;
+ }
+ if (this.isLastItem()) {
+ return;
+ }
+ if (this._hasScroll()) {
+ base = this.active.offset().top;
+ height = this.element.height();
+ this.active.nextAll(".ui-menu-item").each(function () {
+ item = $(this);
+ return item.offset().top - base - height < 0;
+ });
+
+ this.focus(event, item);
+ } else {
+ this.focus(event, this.activeMenu.find(this.options.items)
+ [!this.active ? "first" : "last"]());
+ }
+ },
+
+ previousPage: function (event) {
+ var item, base, height;
+ if (!this.active) {
+ this.next(event);
+ return;
+ }
+ if (this.isFirstItem()) {
+ return;
+ }
+ if (this._hasScroll()) {
+ base = this.active.offset().top;
+ height = this.element.height();
+ this.active.prevAll(".ui-menu-item").each(function () {
+ item = $(this);
+ return item.offset().top - base + height > 0;
+ });
+
+ this.focus(event, item);
+ } else {
+ this.focus(event, this.activeMenu.find(this.options.items).first());
+ }
+ },
+
+ _hasScroll: function () {
+ return this.element.outerHeight() < this.element.prop("scrollHeight");
+ },
+
+ select: function (event) {
+ // TODO: It should never be possible to not have an active item at this
+ // point, but the tests don't trigger mouseenter before click.
+ this.active = this.active || $(event.target).closest(".ui-menu-item");
+ var ui = {item: this.active};
+ if (!this.active.has(".ui-menu").length) {
+ this.collapseAll(event, true);
+ }
+ this._trigger("select", event, ui);
+ },
+
+ _filterMenuItems: function (character) {
+ var escapedCharacter = character.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&"),
+ regex = new RegExp("^" + escapedCharacter, "i");
+
+ return this.activeMenu
+ .find(this.options.items)
+
+ // Only match on items, not dividers or other content (#10571)
+ .filter(".ui-menu-item")
+ .filter(function () {
+ return regex.test($.trim($(this).text()));
+ });
+ }
+ });
+
+
+ /*!
+ * jQuery UI Autocomplete 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/autocomplete/
+ */
+
+
+ $.widget("ui.autocomplete", {
+ version: "1.11.4",
+ defaultElement: "<input>",
+ options: {
+ appendTo: null,
+ autoFocus: false,
+ delay: 300,
+ minLength: 1,
+ position: {
+ my: "left top",
+ at: "left bottom",
+ collision: "none"
+ },
+ source: null,
+
+ // callbacks
+ change: null,
+ close: null,
+ focus: null,
+ open: null,
+ response: null,
+ search: null,
+ select: null
+ },
+
+ requestIndex: 0,
+ pending: 0,
+
+ _create: function () {
+ // Some browsers only repeat keydown events, not keypress events,
+ // so we use the suppressKeyPress flag to determine if we've already
+ // handled the keydown event. #7269
+ // Unfortunately the code for & in keypress is the same as the up arrow,
+ // so we use the suppressKeyPressRepeat flag to avoid handling keypress
+ // events when we know the keydown event was used to modify the
+ // search term. #7799
+ var suppressKeyPress, suppressKeyPressRepeat, suppressInput,
+ nodeName = this.element[0].nodeName.toLowerCase(),
+ isTextarea = nodeName === "textarea",
+ isInput = nodeName === "input";
+
+ this.isMultiLine =
+ // Textareas are always multi-line
+ isTextarea ? true :
+ // Inputs are always single-line, even if inside a contentEditable element
+ // IE also treats inputs as contentEditable
+ isInput ? false :
+ // All other element types are determined by whether or not they're contentEditable
+ this.element.prop("isContentEditable");
+
+ this.valueMethod = this.element[isTextarea || isInput ? "val" : "text"];
+ this.isNewMenu = true;
+
+ this.element
+ .addClass("ui-autocomplete-input")
+ .attr("autocomplete", "off");
+
+ this._on(this.element, {
+ keydown: function (event) {
+ if (this.element.prop("readOnly")) {
+ suppressKeyPress = true;
+ suppressInput = true;
+ suppressKeyPressRepeat = true;
+ return;
+ }
+
+ suppressKeyPress = false;
+ suppressInput = false;
+ suppressKeyPressRepeat = false;
+ var keyCode = $.ui.keyCode;
+ switch (event.keyCode) {
+ case keyCode.PAGE_UP:
+ suppressKeyPress = true;
+ this._move("previousPage", event);
+ break;
+ case keyCode.PAGE_DOWN:
+ suppressKeyPress = true;
+ this._move("nextPage", event);
+ break;
+ case keyCode.UP:
+ suppressKeyPress = true;
+ this._keyEvent("previous", event);
+ break;
+ case keyCode.DOWN:
+ suppressKeyPress = true;
+ this._keyEvent("next", event);
+ break;
+ case keyCode.ENTER:
+ // when menu is open and has focus
+ if (this.menu.active) {
+ // #6055 - Opera still allows the keypress to occur
+ // which causes forms to submit
+ suppressKeyPress = true;
+ event.preventDefault();
+ this.menu.select(event);
+ }
+ break;
+ case keyCode.TAB:
+ if (this.menu.active) {
+ this.menu.select(event);
+ }
+ break;
+ case keyCode.ESCAPE:
+ if (this.menu.element.is(":visible")) {
+ if (!this.isMultiLine) {
+ this._value(this.term);
+ }
+ this.close(event);
+ // Different browsers have different default behavior for escape
+ // Single press can mean undo or clear
+ // Double press in IE means clear the whole form
+ event.preventDefault();
+ }
+ break;
+ default:
+ suppressKeyPressRepeat = true;
+ // search timeout should be triggered before the input value is changed
+ this._searchTimeout(event);
+ break;
+ }
+ },
+ keypress: function (event) {
+ if (suppressKeyPress) {
+ suppressKeyPress = false;
+ if (!this.isMultiLine || this.menu.element.is(":visible")) {
+ event.preventDefault();
+ }
+ return;
+ }
+ if (suppressKeyPressRepeat) {
+ return;
+ }
+
+ // replicate some key handlers to allow them to repeat in Firefox and Opera
+ var keyCode = $.ui.keyCode;
+ switch (event.keyCode) {
+ case keyCode.PAGE_UP:
+ this._move("previousPage", event);
+ break;
+ case keyCode.PAGE_DOWN:
+ this._move("nextPage", event);
+ break;
+ case keyCode.UP:
+ this._keyEvent("previous", event);
+ break;
+ case keyCode.DOWN:
+ this._keyEvent("next", event);
+ break;
+ }
+ },
+ input: function (event) {
+ if (suppressInput) {
+ suppressInput = false;
+ event.preventDefault();
+ return;
+ }
+ this._searchTimeout(event);
+ },
+ focus: function () {
+ this.selectedItem = null;
+ this.previous = this._value();
+ },
+ blur: function (event) {
+ if (this.cancelBlur) {
+ delete this.cancelBlur;
+ return;
+ }
+
+ clearTimeout(this.searching);
+ this.close(event);
+ this._change(event);
+ }
+ });
+
+ this._initSource();
+ this.menu = $("<ul>")
+ .addClass("ui-autocomplete ui-front")
+ .appendTo(this._appendTo())
+ .menu({
+ // disable ARIA support, the live region takes care of that
+ role: null
+ })
+ .hide()
+ .menu("instance");
+
+ this._on(this.menu.element, {
+ mousedown: function (event) {
+ // prevent moving focus out of the text field
+ event.preventDefault();
+
+ // IE doesn't prevent moving focus even with event.preventDefault()
+ // so we set a flag to know when we should ignore the blur event
+ this.cancelBlur = true;
+ this._delay(function () {
+ delete this.cancelBlur;
+ });
+
+ // clicking on the scrollbar causes focus to shift to the body
+ // but we can't detect a mouseup or a click immediately afterward
+ // so we have to track the next mousedown and close the menu if
+ // the user clicks somewhere outside of the autocomplete
+ var menuElement = this.menu.element[0];
+ if (!$(event.target).closest(".ui-menu-item").length) {
+ this._delay(function () {
+ var that = this;
+ this.document.one("mousedown", function (event) {
+ if (event.target !== that.element[0] &&
+ event.target !== menuElement && !$.contains(menuElement, event.target)) {
+ that.close();
+ }
+ });
+ });
+ }
+ },
+ menufocus: function (event, ui) {
+ var label, item;
+ // support: Firefox
+ // Prevent accidental activation of menu items in Firefox (#7024 #9118)
+ if (this.isNewMenu) {
+ this.isNewMenu = false;
+ if (event.originalEvent && /^mouse/.test(event.originalEvent.type)) {
+ this.menu.blur();
+
+ this.document.one("mousemove", function () {
+ $(event.target).trigger(event.originalEvent);
+ });
+
+ return;
+ }
+ }
+
+ item = ui.item.data("ui-autocomplete-item");
+ if (false !== this._trigger("focus", event, {item: item})) {
+ // use value to match what will end up in the input, if it was a key event
+ if (event.originalEvent && /^key/.test(event.originalEvent.type)) {
+ this._value(item.value);
+ }
+ }
+
+ // Announce the value in the liveRegion
+ label = ui.item.attr("aria-label") || item.value;
+ if (label && $.trim(label).length) {
+ this.liveRegion.children().hide();
+ $("<div>").text(label).appendTo(this.liveRegion);
+ }
+ },
+ menuselect: function (event, ui) {
+ var item = ui.item.data("ui-autocomplete-item"),
+ previous = this.previous;
+
+ // only trigger when focus was lost (click on menu)
+ if (this.element[0] !== this.document[0].activeElement) {
+ this.element.focus();
+ this.previous = previous;
+ // #6109 - IE triggers two focus events and the second
+ // is asynchronous, so we need to reset the previous
+ // term synchronously and asynchronously :-(
+ this._delay(function () {
+ this.previous = previous;
+ this.selectedItem = item;
+ });
+ }
+
+ if (false !== this._trigger("select", event, {item: item})) {
+ this._value(item.value);
+ }
+ // reset the term after the select event
+ // this allows custom select handling to work properly
+ this.term = this._value();
+
+ this.close(event);
+ this.selectedItem = item;
+ }
+ });
+
+ this.liveRegion = $("<span>", {
+ role: "status",
+ "aria-live": "assertive",
+ "aria-relevant": "additions"
+ })
+ .addClass("ui-helper-hidden-accessible")
+ .appendTo(this.document[0].body);
+
+ // turning off autocomplete prevents the browser from remembering the
+ // value when navigating through history, so we re-enable autocomplete
+ // if the page is unloaded before the widget is destroyed. #7790
+ this._on(this.window, {
+ beforeunload: function () {
+ this.element.removeAttr("autocomplete");
+ }
+ });
+ },
+
+ _destroy: function () {
+ clearTimeout(this.searching);
+ this.element
+ .removeClass("ui-autocomplete-input")
+ .removeAttr("autocomplete");
+ this.menu.element.remove();
+ this.liveRegion.remove();
+ },
+
+ _setOption: function (key, value) {
+ this._super(key, value);
+ if (key === "source") {
+ this._initSource();
+ }
+ if (key === "appendTo") {
+ this.menu.element.appendTo(this._appendTo());
+ }
+ if (key === "disabled" && value && this.xhr) {
+ this.xhr.abort();
+ }
+ },
+
+ _appendTo: function () {
+ var element = this.options.appendTo;
+
+ if (element) {
+ element = element.jquery || element.nodeType ?
+ $(element) :
+ this.document.find(element).eq(0);
+ }
+
+ if (!element || !element[0]) {
+ element = this.element.closest(".ui-front");
+ }
+
+ if (!element.length) {
+ element = this.document[0].body;
+ }
+
+ return element;
+ },
+
+ _initSource: function () {
+ var array, url,
+ that = this;
+ if ($.isArray(this.options.source)) {
+ array = this.options.source;
+ this.source = function (request, response) {
+ response($.ui.autocomplete.filter(array, request.term));
+ };
+ } else if (typeof this.options.source === "string") {
+ url = this.options.source;
+ this.source = function (request, response) {
+ if (that.xhr) {
+ that.xhr.abort();
+ }
+ that.xhr = $.ajax({
+ url: url,
+ data: request,
+ dataType: "json",
+ success: function (data) {
+ response(data);
+ },
+ error: function () {
+ response([]);
+ }
+ });
+ };
+ } else {
+ this.source = this.options.source;
+ }
+ },
+
+ _searchTimeout: function (event) {
+ clearTimeout(this.searching);
+ this.searching = this._delay(function () {
+
+ // Search if the value has changed, or if the user retypes the same value (see #7434)
+ var equalValues = this.term === this._value(),
+ menuVisible = this.menu.element.is(":visible"),
+ modifierKey = event.altKey || event.ctrlKey || event.metaKey || event.shiftKey;
+
+ if (!equalValues || ( equalValues && !menuVisible && !modifierKey )) {
+ this.selectedItem = null;
+ this.search(null, event);
+ }
+ }, this.options.delay);
+ },
+
+ search: function (value, event) {
+ value = value != null ? value : this._value();
+
+ // always save the actual value, not the one passed as an argument
+ this.term = this._value();
+
+ if (value.length < this.options.minLength) {
+ return this.close(event);
+ }
+
+ if (this._trigger("search", event) === false) {
+ return;
+ }
+
+ return this._search(value);
+ },
+
+ _search: function (value) {
+ this.pending++;
+ this.element.addClass("ui-autocomplete-loading");
+ this.cancelSearch = false;
+
+ this.source({term: value}, this._response());
+ },
+
+ _response: function () {
+ var index = ++this.requestIndex;
+
+ return $.proxy(function (content) {
+ if (index === this.requestIndex) {
+ this.__response(content);
+ }
+
+ this.pending--;
+ if (!this.pending) {
+ this.element.removeClass("ui-autocomplete-loading");
+ }
+ }, this);
+ },
+
+ __response: function (content) {
+ if (content) {
+ content = this._normalize(content);
+ }
+ this._trigger("response", null, {content: content});
+ if (!this.options.disabled && content && content.length && !this.cancelSearch) {
+ this._suggest(content);
+ this._trigger("open");
+ } else {
+ // use ._close() instead of .close() so we don't cancel future searches
+ this._close();
+ }
+ },
+
+ close: function (event) {
+ this.cancelSearch = true;
+ this._close(event);
+ },
+
+ _close: function (event) {
+ if (this.menu.element.is(":visible")) {
+ this.menu.element.hide();
+ this.menu.blur();
+ this.isNewMenu = true;
+ this._trigger("close", event);
+ }
+ },
+
+ _change: function (event) {
+ if (this.previous !== this._value()) {
+ this._trigger("change", event, {item: this.selectedItem});
+ }
+ },
+
+ _normalize: function (items) {
+ // assume all items have the right format when the first item is complete
+ if (items.length && items[0].label && items[0].value) {
+ return items;
+ }
+ return $.map(items, function (item) {
+ if (typeof item === "string") {
+ return {
+ label: item,
+ value: item
+ };
+ }
+ return $.extend({}, item, {
+ label: item.label || item.value,
+ value: item.value || item.label
+ });
+ });
+ },
+
+ _suggest: function (items) {
+ var ul = this.menu.element.empty();
+ this._renderMenu(ul, items);
+ this.isNewMenu = true;
+ this.menu.refresh();
+
+ // size and position menu
+ ul.show();
+ this._resizeMenu();
+ ul.position($.extend({
+ of: this.element
+ }, this.options.position));
+
+ if (this.options.autoFocus) {
+ this.menu.next();
+ }
+ },
+
+ _resizeMenu: function () {
+ var ul = this.menu.element;
+ ul.outerWidth(Math.max(
+ // Firefox wraps long text (possibly a rounding bug)
+ // so we add 1px to avoid the wrapping (#7513)
+ ul.width("").outerWidth() + 1,
+ this.element.outerWidth()
+ ));
+ },
+
+ _renderMenu: function (ul, items) {
+ var that = this;
+ $.each(items, function (index, item) {
+ that._renderItemData(ul, item);
+ });
+ },
+
+ _renderItemData: function (ul, item) {
+ return this._renderItem(ul, item).data("ui-autocomplete-item", item);
+ },
+
+ _renderItem: function (ul, item) {
+ return $("<li>").text(item.label).appendTo(ul);
+ },
+
+ _move: function (direction, event) {
+ if (!this.menu.element.is(":visible")) {
+ this.search(null, event);
+ return;
+ }
+ if (this.menu.isFirstItem() && /^previous/.test(direction) ||
+ this.menu.isLastItem() && /^next/.test(direction)) {
+
+ if (!this.isMultiLine) {
+ this._value(this.term);
+ }
+
+ this.menu.blur();
+ return;
+ }
+ this.menu[direction](event);
+ },
+
+ widget: function () {
+ return this.menu.element;
+ },
+
+ _value: function () {
+ return this.valueMethod.apply(this.element, arguments);
+ },
+
+ _keyEvent: function (keyEvent, event) {
+ if (!this.isMultiLine || this.menu.element.is(":visible")) {
+ this._move(keyEvent, event);
+
+ // prevents moving cursor to beginning/end of the text field in some browsers
+ event.preventDefault();
+ }
+ }
+ });
+
+ $.extend($.ui.autocomplete, {
+ escapeRegex: function (value) {
+ return value.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&");
+ },
+ filter: function (array, term) {
+ var matcher = new RegExp($.ui.autocomplete.escapeRegex(term), "i");
+ return $.grep(array, function (value) {
+ return matcher.test(value.label || value.value || value);
+ });
+ }
+ });
+
+// live region extension, adding a `messages` option
+// NOTE: This is an experimental API. We are still investigating
+// a full solution for string manipulation and internationalization.
+ $.widget("ui.autocomplete", $.ui.autocomplete, {
+ options: {
+ messages: {
+ noResults: "No search results.",
+ results: function (amount) {
+ return amount + ( amount > 1 ? " results are" : " result is" ) +
+ " available, use up and down arrow keys to navigate.";
+ }
+ }
+ },
+
+ __response: function (content) {
+ var message;
+ this._superApply(arguments);
+ if (this.options.disabled || this.cancelSearch) {
+ return;
+ }
+ if (content && content.length) {
+ message = this.options.messages.results(content.length);
+ } else {
+ message = this.options.messages.noResults;
+ }
+ this.liveRegion.children().hide();
+ $("<div>").text(message).appendTo(this.liveRegion);
+ }
+ });
+
+ var autocomplete = $.ui.autocomplete;
+
+
+ /*!
+ * jQuery UI Button 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/button/
+ */
+
+
+ var lastActive,
+ baseClasses = "ui-button ui-widget ui-state-default ui-corner-all",
+ typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",
+ formResetHandler = function () {
+ var form = $(this);
+ setTimeout(function () {
+ form.find(":ui-button").button("refresh");
+ }, 1);
+ },
+ radioGroup = function (radio) {
+ var name = radio.name,
+ form = radio.form,
+ radios = $([]);
+ if (name) {
+ name = name.replace(/'/g, "\\'");
+ if (form) {
+ radios = $(form).find("[name='" + name + "'][type=radio]");
+ } else {
+ radios = $("[name='" + name + "'][type=radio]", radio.ownerDocument)
+ .filter(function () {
+ return !this.form;
+ });
+ }
+ }
+ return radios;
+ };
+
+ $.widget("ui.button", {
+ version: "1.11.4",
+ defaultElement: "<button>",
+ options: {
+ disabled: null,
+ text: true,
+ label: null,
+ icons: {
+ primary: null,
+ secondary: null
+ }
+ },
+ _create: function () {
+ this.element.closest("form")
+ .unbind("reset" + this.eventNamespace)
+ .bind("reset" + this.eventNamespace, formResetHandler);
+
+ if (typeof this.options.disabled !== "boolean") {
+ this.options.disabled = !!this.element.prop("disabled");
+ } else {
+ this.element.prop("disabled", this.options.disabled);
+ }
+
+ this._determineButtonType();
+ this.hasTitle = !!this.buttonElement.attr("title");
+
+ var that = this,
+ options = this.options,
+ toggleButton = this.type === "checkbox" || this.type === "radio",
+ activeClass = !toggleButton ? "ui-state-active" : "";
+
+ if (options.label === null) {
+ options.label = (this.type === "input" ? this.buttonElement.val() : this.buttonElement.html());
+ }
+
+ this._hoverable(this.buttonElement);
+
+ this.buttonElement
+ .addClass(baseClasses)
+ .attr("role", "button")
+ .bind("mouseenter" + this.eventNamespace, function () {
+ if (options.disabled) {
+ return;
+ }
+ if (this === lastActive) {
+ $(this).addClass("ui-state-active");
+ }
+ })
+ .bind("mouseleave" + this.eventNamespace, function () {
+ if (options.disabled) {
+ return;
+ }
+ $(this).removeClass(activeClass);
+ })
+ .bind("click" + this.eventNamespace, function (event) {
+ if (options.disabled) {
+ event.preventDefault();
+ event.stopImmediatePropagation();
+ }
+ });
+
+ // Can't use _focusable() because the element that receives focus
+ // and the element that gets the ui-state-focus class are different
+ this._on({
+ focus: function () {
+ this.buttonElement.addClass("ui-state-focus");
+ },
+ blur: function () {
+ this.buttonElement.removeClass("ui-state-focus");
+ }
+ });
+
+ if (toggleButton) {
+ this.element.bind("change" + this.eventNamespace, function () {
+ that.refresh();
+ });
+ }
+
+ if (this.type === "checkbox") {
+ this.buttonElement.bind("click" + this.eventNamespace, function () {
+ if (options.disabled) {
+ return false;
+ }
+ });
+ } else if (this.type === "radio") {
+ this.buttonElement.bind("click" + this.eventNamespace, function () {
+ if (options.disabled) {
+ return false;
+ }
+ $(this).addClass("ui-state-active");
+ that.buttonElement.attr("aria-pressed", "true");
+
+ var radio = that.element[0];
+ radioGroup(radio)
+ .not(radio)
+ .map(function () {
+ return $(this).button("widget")[0];
+ })
+ .removeClass("ui-state-active")
+ .attr("aria-pressed", "false");
+ });
+ } else {
+ this.buttonElement
+ .bind("mousedown" + this.eventNamespace, function () {
+ if (options.disabled) {
+ return false;
+ }
+ $(this).addClass("ui-state-active");
+ lastActive = this;
+ that.document.one("mouseup", function () {
+ lastActive = null;
+ });
+ })
+ .bind("mouseup" + this.eventNamespace, function () {
+ if (options.disabled) {
+ return false;
+ }
+ $(this).removeClass("ui-state-active");
+ })
+ .bind("keydown" + this.eventNamespace, function (event) {
+ if (options.disabled) {
+ return false;
+ }
+ if (event.keyCode === $.ui.keyCode.SPACE || event.keyCode === $.ui.keyCode.ENTER) {
+ $(this).addClass("ui-state-active");
+ }
+ })
+ // see #8559, we bind to blur here in case the button element loses
+ // focus between keydown and keyup, it would be left in an "active" state
+ .bind("keyup" + this.eventNamespace + " blur" + this.eventNamespace, function () {
+ $(this).removeClass("ui-state-active");
+ });
+
+ if (this.buttonElement.is("a")) {
+ this.buttonElement.keyup(function (event) {
+ if (event.keyCode === $.ui.keyCode.SPACE) {
+ // TODO pass through original event correctly (just as 2nd argument doesn't work)
+ $(this).click();
+ }
+ });
+ }
+ }
+
+ this._setOption("disabled", options.disabled);
+ this._resetButton();
+ },
+
+ _determineButtonType: function () {
+ var ancestor, labelSelector, checked;
+
+ if (this.element.is("[type=checkbox]")) {
+ this.type = "checkbox";
+ } else if (this.element.is("[type=radio]")) {
+ this.type = "radio";
+ } else if (this.element.is("input")) {
+ this.type = "input";
+ } else {
+ this.type = "button";
+ }
+
+ if (this.type === "checkbox" || this.type === "radio") {
+ // we don't search against the document in case the element
+ // is disconnected from the DOM
+ ancestor = this.element.parents().last();
+ labelSelector = "label[for='" + this.element.attr("id") + "']";
+ this.buttonElement = ancestor.find(labelSelector);
+ if (!this.buttonElement.length) {
+ ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings();
+ this.buttonElement = ancestor.filter(labelSelector);
+ if (!this.buttonElement.length) {
+ this.buttonElement = ancestor.find(labelSelector);
+ }
+ }
+ this.element.addClass("ui-helper-hidden-accessible");
+
+ checked = this.element.is(":checked");
+ if (checked) {
+ this.buttonElement.addClass("ui-state-active");
+ }
+ this.buttonElement.prop("aria-pressed", checked);
+ } else {
+ this.buttonElement = this.element;
+ }
+ },
+
+ widget: function () {
+ return this.buttonElement;
+ },
+
+ _destroy: function () {
+ this.element
+ .removeClass("ui-helper-hidden-accessible");
+ this.buttonElement
+ .removeClass(baseClasses + " ui-state-active " + typeClasses)
+ .removeAttr("role")
+ .removeAttr("aria-pressed")
+ .html(this.buttonElement.find(".ui-button-text").html());
+
+ if (!this.hasTitle) {
+ this.buttonElement.removeAttr("title");
+ }
+ },
+
+ _setOption: function (key, value) {
+ this._super(key, value);
+ if (key === "disabled") {
+ this.widget().toggleClass("ui-state-disabled", !!value);
+ this.element.prop("disabled", !!value);
+ if (value) {
+ if (this.type === "checkbox" || this.type === "radio") {
+ this.buttonElement.removeClass("ui-state-focus");
+ } else {
+ this.buttonElement.removeClass("ui-state-focus ui-state-active");
+ }
+ }
+ return;
+ }
+ this._resetButton();
+ },
+
+ refresh: function () {
+ //See #8237 & #8828
+ var isDisabled = this.element.is("input, button") ? this.element.is(":disabled") : this.element.hasClass("ui-button-disabled");
+
+ if (isDisabled !== this.options.disabled) {
+ this._setOption("disabled", isDisabled);
+ }
+ if (this.type === "radio") {
+ radioGroup(this.element[0]).each(function () {
+ if ($(this).is(":checked")) {
+ $(this).button("widget")
+ .addClass("ui-state-active")
+ .attr("aria-pressed", "true");
+ } else {
+ $(this).button("widget")
+ .removeClass("ui-state-active")
+ .attr("aria-pressed", "false");
+ }
+ });
+ } else if (this.type === "checkbox") {
+ if (this.element.is(":checked")) {
+ this.buttonElement
+ .addClass("ui-state-active")
+ .attr("aria-pressed", "true");
+ } else {
+ this.buttonElement
+ .removeClass("ui-state-active")
+ .attr("aria-pressed", "false");
+ }
+ }
+ },
+
+ _resetButton: function () {
+ if (this.type === "input") {
+ if (this.options.label) {
+ this.element.val(this.options.label);
+ }
+ return;
+ }
+ var buttonElement = this.buttonElement.removeClass(typeClasses),
+ buttonText = $("<span></span>", this.document[0])
+ .addClass("ui-button-text")
+ .html(this.options.label)
+ .appendTo(buttonElement.empty())
+ .text(),
+ icons = this.options.icons,
+ multipleIcons = icons.primary && icons.secondary,
+ buttonClasses = [];
+
+ if (icons.primary || icons.secondary) {
+ if (this.options.text) {
+ buttonClasses.push("ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ));
+ }
+
+ if (icons.primary) {
+ buttonElement.prepend("<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>");
+ }
+
+ if (icons.secondary) {
+ buttonElement.append("<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>");
+ }
+
+ if (!this.options.text) {
+ buttonClasses.push(multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only");
+
+ if (!this.hasTitle) {
+ buttonElement.attr("title", $.trim(buttonText));
+ }
+ }
+ } else {
+ buttonClasses.push("ui-button-text-only");
+ }
+ buttonElement.addClass(buttonClasses.join(" "));
+ }
+ });
+
+ $.widget("ui.buttonset", {
+ version: "1.11.4",
+ options: {
+ items: "button, input[type=button], input[type=submit], input[type=reset], input[type=checkbox], input[type=radio], a, :data(ui-button)"
+ },
+
+ _create: function () {
+ this.element.addClass("ui-buttonset");
+ },
+
+ _init: function () {
+ this.refresh();
+ },
+
+ _setOption: function (key, value) {
+ if (key === "disabled") {
+ this.buttons.button("option", key, value);
+ }
+
+ this._super(key, value);
+ },
+
+ refresh: function () {
+ var rtl = this.element.css("direction") === "rtl",
+ allButtons = this.element.find(this.options.items),
+ existingButtons = allButtons.filter(":ui-button");
+
+ // Initialize new buttons
+ allButtons.not(":ui-button").button();
+
+ // Refresh existing buttons
+ existingButtons.button("refresh");
+
+ this.buttons = allButtons
+ .map(function () {
+ return $(this).button("widget")[0];
+ })
+ .removeClass("ui-corner-all ui-corner-left ui-corner-right")
+ .filter(":first")
+ .addClass(rtl ? "ui-corner-right" : "ui-corner-left")
+ .end()
+ .filter(":last")
+ .addClass(rtl ? "ui-corner-left" : "ui-corner-right")
+ .end()
+ .end();
+ },
+
+ _destroy: function () {
+ this.element.removeClass("ui-buttonset");
+ this.buttons
+ .map(function () {
+ return $(this).button("widget")[0];
+ })
+ .removeClass("ui-corner-left ui-corner-right")
+ .end()
+ .button("destroy");
+ }
+ });
+
+ var button = $.ui.button;
+
+
+ /*!
+ * jQuery UI Datepicker 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/datepicker/
+ */
+
+
+ $.extend($.ui, {datepicker: {version: "1.11.4"}});
+
+ var datepicker_instActive;
+
+ function datepicker_getZindex(elem) {
+ var position, value;
+ while (elem.length && elem[0] !== document) {
+ // Ignore z-index if position is set to a value where z-index is ignored by the browser
+ // This makes behavior of this function consistent across browsers
+ // WebKit always returns auto if the element is positioned
+ position = elem.css("position");
+ if (position === "absolute" || position === "relative" || position === "fixed") {
+ // IE returns 0 when zIndex is not specified
+ // other browsers return a string
+ // we ignore the case of nested elements with an explicit value of 0
+ // <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
+ value = parseInt(elem.css("zIndex"), 10);
+ if (!isNaN(value) && value !== 0) {
+ return value;
+ }
+ }
+ elem = elem.parent();
+ }
+
+ return 0;
+ }
+
+ /* Date picker manager.
+ Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+ Settings for (groups of) date pickers are maintained in an instance object,
+ allowing multiple different settings on the same page. */
+
+ function Datepicker() {
+ this._curInst = null; // The current instance in use
+ this._keyEvent = false; // If the last event was a key event
+ this._disabledInputs = []; // List of date picker inputs that have been disabled
+ this._datepickerShowing = false; // True if the popup picker is showing , false if not
+ this._inDialog = false; // True if showing within a "dialog", false if not
+ this._mainDivId = "ui-datepicker-div"; // The ID of the main datepicker division
+ this._inlineClass = "ui-datepicker-inline"; // The name of the inline marker class
+ this._appendClass = "ui-datepicker-append"; // The name of the append marker class
+ this._triggerClass = "ui-datepicker-trigger"; // The name of the trigger marker class
+ this._dialogClass = "ui-datepicker-dialog"; // The name of the dialog marker class
+ this._disableClass = "ui-datepicker-disabled"; // The name of the disabled covering marker class
+ this._unselectableClass = "ui-datepicker-unselectable"; // The name of the unselectable cell marker class
+ this._currentClass = "ui-datepicker-current-day"; // The name of the current day marker class
+ this._dayOverClass = "ui-datepicker-days-cell-over"; // The name of the day hover marker class
+ this.regional = []; // Available regional settings, indexed by language code
+ this.regional[""] = { // Default regional settings
+ closeText: "Done", // Display text for close link
+ prevText: "Prev", // Display text for previous month link
+ nextText: "Next", // Display text for next month link
+ currentText: "Today", // Display text for current month link
+ monthNames: ["January", "February", "March", "April", "May", "June",
+ "July", "August", "September", "October", "November", "December"], // Names of months for drop-down and formatting
+ monthNamesShort: ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"], // For formatting
+ dayNames: ["Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"], // For formatting
+ dayNamesShort: ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"], // For formatting
+ dayNamesMin: ["Su", "Mo", "Tu", "We", "Th", "Fr", "Sa"], // Column headings for days starting at Sunday
+ weekHeader: "Wk", // Column header for week of the year
+ dateFormat: "mm/dd/yy", // See format options on parseDate
+ firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+ isRTL: false, // True if right-to-left language, false if left-to-right
+ showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+ yearSuffix: "" // Additional text to append to the year in the month headers
+ };
+ this._defaults = { // Global defaults for all the date picker instances
+ showOn: "focus", // "focus" for popup on focus,
+ // "button" for trigger button, or "both" for either
+ showAnim: "fadeIn", // Name of jQuery animation for popup
+ showOptions: {}, // Options for enhanced animations
+ defaultDate: null, // Used when field is blank: actual date,
+ // +/-number for offset from today, null for today
+ appendText: "", // Display text following the input box, e.g. showing the format
+ buttonText: "...", // Text for trigger button
+ buttonImage: "", // URL for trigger button image
+ buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+ hideIfNoPrevNext: false, // True to hide next/previous month links
+ // if not applicable, false to just disable them
+ navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+ gotoCurrent: false, // True if today link goes back to current selection instead
+ changeMonth: false, // True if month can be selected directly, false if only prev/next
+ changeYear: false, // True if year can be selected directly, false if only prev/next
+ yearRange: "c-10:c+10", // Range of years to display in drop-down,
+ // either relative to today's year (-nn:+nn), relative to currently displayed year
+ // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
+ showOtherMonths: false, // True to show dates in other months, false to leave blank
+ selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
+ showWeek: false, // True to show week of the year, false to not show it
+ calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+ // takes a Date and returns the number of the week for it
+ shortYearCutoff: "+10", // Short year values < this are in the current century,
+ // > this are in the previous century,
+ // string value starting with "+" for current year + value
+ minDate: null, // The earliest selectable date, or null for no limit
+ maxDate: null, // The latest selectable date, or null for no limit
+ duration: "fast", // Duration of display/closure
+ beforeShowDay: null, // Function that takes a date and returns an array with
+ // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or "",
+ // [2] = cell title (optional), e.g. $.datepicker.noWeekends
+ beforeShow: null, // Function that takes an input field and
+ // returns a set of custom settings for the date picker
+ onSelect: null, // Define a callback function when a date is selected
+ onChangeMonthYear: null, // Define a callback function when the month or year is changed
+ onClose: null, // Define a callback function when the datepicker is closed
+ numberOfMonths: 1, // Number of months to show at a time
+ showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+ stepMonths: 1, // Number of months to step back/forward
+ stepBigMonths: 12, // Number of months to step back/forward for the big links
+ altField: "", // Selector for an alternate field to store selected dates into
+ altFormat: "", // The date format to use for the alternate field
+ constrainInput: true, // The input is constrained by the current date format
+ showButtonPanel: false, // True to show button panel, false to not show it
+ autoSize: false, // True to size the input for the date format, false to leave as is
+ disabled: false // The initial disabled state
+ };
+ $.extend(this._defaults, this.regional[""]);
+ this.regional.en = $.extend(true, {}, this.regional[""]);
+ this.regional["en-US"] = $.extend(true, {}, this.regional.en);
+ this.dpDiv = datepicker_bindHover($("<div id='" + this._mainDivId + "' class='ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>"));
+ }
+
+ $.extend(Datepicker.prototype, {
+ /* Class name added to elements to indicate already configured with a date picker. */
+ markerClassName: "hasDatepicker",
+
+ //Keep track of the maximum number of rows displayed (see #7043)
+ maxRows: 4,
+
+ // TODO rename to "widget" when switching to widget factory
+ _widgetDatepicker: function () {
+ return this.dpDiv;
+ },
+
+ /* Override the default settings for all instances of the date picker.
+ * @param settings object - the new settings to use as defaults (anonymous object)
+ * @return the manager object
+ */
+ setDefaults: function (settings) {
+ datepicker_extendRemove(this._defaults, settings || {});
+ return this;
+ },
+
+ /* Attach the date picker to a jQuery selection.
+ * @param target element - the target input field or division or span
+ * @param settings object - the new settings to use for this date picker instance (anonymous)
+ */
+ _attachDatepicker: function (target, settings) {
+ var nodeName, inline, inst;
+ nodeName = target.nodeName.toLowerCase();
+ inline = (nodeName === "div" || nodeName === "span");
+ if (!target.id) {
+ this.uuid += 1;
+ target.id = "dp" + this.uuid;
+ }
+ inst = this._newInst($(target), inline);
+ inst.settings = $.extend({}, settings || {});
+ if (nodeName === "input") {
+ this._connectDatepicker(target, inst);
+ } else if (inline) {
+ this._inlineDatepicker(target, inst);
+ }
+ },
+
+ /* Create a new instance object. */
+ _newInst: function (target, inline) {
+ var id = target[0].id.replace(/([^A-Za-z0-9_\-])/g, "\\\\$1"); // escape jQuery meta chars
+ return {
+ id: id, input: target, // associated target
+ selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+ drawMonth: 0, drawYear: 0, // month being drawn
+ inline: inline, // is datepicker inline or not
+ dpDiv: (!inline ? this.dpDiv : // presentation div
+ datepicker_bindHover($("<div class='" + this._inlineClass + " ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>")))
+ };
+ },
+
+ /* Attach the date picker to an input field. */
+ _connectDatepicker: function (target, inst) {
+ var input = $(target);
+ inst.append = $([]);
+ inst.trigger = $([]);
+ if (input.hasClass(this.markerClassName)) {
+ return;
+ }
+ this._attachments(input, inst);
+ input.addClass(this.markerClassName).keydown(this._doKeyDown).
+ keypress(this._doKeyPress).keyup(this._doKeyUp);
+ this._autoSize(inst);
+ $.data(target, "datepicker", inst);
+ //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665)
+ if (inst.settings.disabled) {
+ this._disableDatepicker(target);
+ }
+ },
+
+ /* Make attachments based on settings. */
+ _attachments: function (input, inst) {
+ var showOn, buttonText, buttonImage,
+ appendText = this._get(inst, "appendText"),
+ isRTL = this._get(inst, "isRTL");
+
+ if (inst.append) {
+ inst.append.remove();
+ }
+ if (appendText) {
+ inst.append = $("<span class='" + this._appendClass + "'>" + appendText + "</span>");
+ input[isRTL ? "before" : "after"](inst.append);
+ }
+
+ input.unbind("focus", this._showDatepicker);
+
+ if (inst.trigger) {
+ inst.trigger.remove();
+ }
+
+ showOn = this._get(inst, "showOn");
+ if (showOn === "focus" || showOn === "both") { // pop-up date picker when in the marked field
+ input.focus(this._showDatepicker);
+ }
+ if (showOn === "button" || showOn === "both") { // pop-up date picker when button clicked
+ buttonText = this._get(inst, "buttonText");
+ buttonImage = this._get(inst, "buttonImage");
+ inst.trigger = $(this._get(inst, "buttonImageOnly") ?
+ $("<img/>").addClass(this._triggerClass).
+ attr({src: buttonImage, alt: buttonText, title: buttonText}) :
+ $("<button type='button'></button>").addClass(this._triggerClass).
+ html(!buttonImage ? buttonText : $("<img/>").attr(
+ {src: buttonImage, alt: buttonText, title: buttonText})));
+ input[isRTL ? "before" : "after"](inst.trigger);
+ inst.trigger.click(function () {
+ if ($.datepicker._datepickerShowing && $.datepicker._lastInput === input[0]) {
+ $.datepicker._hideDatepicker();
+ } else if ($.datepicker._datepickerShowing && $.datepicker._lastInput !== input[0]) {
+ $.datepicker._hideDatepicker();
+ $.datepicker._showDatepicker(input[0]);
+ } else {
+ $.datepicker._showDatepicker(input[0]);
+ }
+ return false;
+ });
+ }
+ },
+
+ /* Apply the maximum length for the date format. */
+ _autoSize: function (inst) {
+ if (this._get(inst, "autoSize") && !inst.inline) {
+ var findMax, max, maxI, i,
+ date = new Date(2009, 12 - 1, 20), // Ensure double digits
+ dateFormat = this._get(inst, "dateFormat");
+
+ if (dateFormat.match(/[DM]/)) {
+ findMax = function (names) {
+ max = 0;
+ maxI = 0;
+ for (i = 0; i < names.length; i++) {
+ if (names[i].length > max) {
+ max = names[i].length;
+ maxI = i;
+ }
+ }
+ return maxI;
+ };
+ date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ?
+ "monthNames" : "monthNamesShort"))));
+ date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ?
+ "dayNames" : "dayNamesShort"))) + 20 - date.getDay());
+ }
+ inst.input.attr("size", this._formatDate(inst, date).length);
+ }
+ },
+
+ /* Attach an inline date picker to a div. */
+ _inlineDatepicker: function (target, inst) {
+ var divSpan = $(target);
+ if (divSpan.hasClass(this.markerClassName)) {
+ return;
+ }
+ divSpan.addClass(this.markerClassName).append(inst.dpDiv);
+ $.data(target, "datepicker", inst);
+ this._setDate(inst, this._getDefaultDate(inst), true);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ //If disabled option is true, disable the datepicker before showing it (see ticket #5665)
+ if (inst.settings.disabled) {
+ this._disableDatepicker(target);
+ }
+ // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements
+ // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height
+ inst.dpDiv.css("display", "block");
+ },
+
+ /* Pop-up the date picker in a "dialog" box.
+ * @param input element - ignored
+ * @param date string or Date - the initial date to display
+ * @param onSelect function - the function to call when a date is selected
+ * @param settings object - update the dialog date picker instance's settings (anonymous object)
+ * @param pos int[2] - coordinates for the dialog's position within the screen or
+ * event - with x/y coordinates or
+ * leave empty for default (screen centre)
+ * @return the manager object
+ */
+ _dialogDatepicker: function (input, date, onSelect, settings, pos) {
+ var id, browserWidth, browserHeight, scrollX, scrollY,
+ inst = this._dialogInst; // internal instance
+
+ if (!inst) {
+ this.uuid += 1;
+ id = "dp" + this.uuid;
+ this._dialogInput = $("<input type='text' id='" + id +
+ "' style='position: absolute; top: -100px; width: 0px;'/>");
+ this._dialogInput.keydown(this._doKeyDown);
+ $("body").append(this._dialogInput);
+ inst = this._dialogInst = this._newInst(this._dialogInput, false);
+ inst.settings = {};
+ $.data(this._dialogInput[0], "datepicker", inst);
+ }
+ datepicker_extendRemove(inst.settings, settings || {});
+ date = (date && date.constructor === Date ? this._formatDate(inst, date) : date);
+ this._dialogInput.val(date);
+
+ this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
+ if (!this._pos) {
+ browserWidth = document.documentElement.clientWidth;
+ browserHeight = document.documentElement.clientHeight;
+ scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+ scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+ this._pos = // should use actual width/height below
+ [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
+ }
+
+ // move input on screen for focus, but hidden behind dialog
+ this._dialogInput.css("left", (this._pos[0] + 20) + "px").css("top", this._pos[1] + "px");
+ inst.settings.onSelect = onSelect;
+ this._inDialog = true;
+ this.dpDiv.addClass(this._dialogClass);
+ this._showDatepicker(this._dialogInput[0]);
+ if ($.blockUI) {
+ $.blockUI(this.dpDiv);
+ }
+ $.data(this._dialogInput[0], "datepicker", inst);
+ return this;
+ },
+
+ /* Detach a datepicker from its control.
+ * @param target element - the target input field or division or span
+ */
+ _destroyDatepicker: function (target) {
+ var nodeName,
+ $target = $(target),
+ inst = $.data(target, "datepicker");
+
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+
+ nodeName = target.nodeName.toLowerCase();
+ $.removeData(target, "datepicker");
+ if (nodeName === "input") {
+ inst.append.remove();
+ inst.trigger.remove();
+ $target.removeClass(this.markerClassName).
+ unbind("focus", this._showDatepicker).
+ unbind("keydown", this._doKeyDown).
+ unbind("keypress", this._doKeyPress).
+ unbind("keyup", this._doKeyUp);
+ } else if (nodeName === "div" || nodeName === "span") {
+ $target.removeClass(this.markerClassName).empty();
+ }
+
+ if (datepicker_instActive === inst) {
+ datepicker_instActive = null;
+ }
+ },
+
+ /* Enable the date picker to a jQuery selection.
+ * @param target element - the target input field or division or span
+ */
+ _enableDatepicker: function (target) {
+ var nodeName, inline,
+ $target = $(target),
+ inst = $.data(target, "datepicker");
+
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+
+ nodeName = target.nodeName.toLowerCase();
+ if (nodeName === "input") {
+ target.disabled = false;
+ inst.trigger.filter("button").
+ each(function () {
+ this.disabled = false;
+ }).end().
+ filter("img").css({opacity: "1.0", cursor: ""});
+ } else if (nodeName === "div" || nodeName === "span") {
+ inline = $target.children("." + this._inlineClass);
+ inline.children().removeClass("ui-state-disabled");
+ inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
+ prop("disabled", false);
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function (value) {
+ return (value === target ? null : value);
+ }); // delete entry
+ },
+
+ /* Disable the date picker to a jQuery selection.
+ * @param target element - the target input field or division or span
+ */
+ _disableDatepicker: function (target) {
+ var nodeName, inline,
+ $target = $(target),
+ inst = $.data(target, "datepicker");
+
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+
+ nodeName = target.nodeName.toLowerCase();
+ if (nodeName === "input") {
+ target.disabled = true;
+ inst.trigger.filter("button").
+ each(function () {
+ this.disabled = true;
+ }).end().
+ filter("img").css({opacity: "0.5", cursor: "default"});
+ } else if (nodeName === "div" || nodeName === "span") {
+ inline = $target.children("." + this._inlineClass);
+ inline.children().addClass("ui-state-disabled");
+ inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
+ prop("disabled", true);
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function (value) {
+ return (value === target ? null : value);
+ }); // delete entry
+ this._disabledInputs[this._disabledInputs.length] = target;
+ },
+
+ /* Is the first field in a jQuery collection disabled as a datepicker?
+ * @param target element - the target input field or division or span
+ * @return boolean - true if disabled, false if enabled
+ */
+ _isDisabledDatepicker: function (target) {
+ if (!target) {
+ return false;
+ }
+ for (var i = 0; i < this._disabledInputs.length; i++) {
+ if (this._disabledInputs[i] === target) {
+ return true;
+ }
+ }
+ return false;
+ },
+
+ /* Retrieve the instance data for the target control.
+ * @param target element - the target input field or division or span
+ * @return object - the associated instance data
+ * @throws error if a jQuery problem getting data
+ */
+ _getInst: function (target) {
+ try {
+ return $.data(target, "datepicker");
+ }
+ catch (err) {
+ throw "Missing instance data for this datepicker";
+ }
+ },
+
+ /* Update or retrieve the settings for a date picker attached to an input field or division.
+ * @param target element - the target input field or division or span
+ * @param name object - the new settings to update or
+ * string - the name of the setting to change or retrieve,
+ * when retrieving also "all" for all instance settings or
+ * "defaults" for all global defaults
+ * @param value any - the new value for the setting
+ * (omit if above is an object or to retrieve a value)
+ */
+ _optionDatepicker: function (target, name, value) {
+ var settings, date, minDate, maxDate,
+ inst = this._getInst(target);
+
+ if (arguments.length === 2 && typeof name === "string") {
+ return (name === "defaults" ? $.extend({}, $.datepicker._defaults) :
+ (inst ? (name === "all" ? $.extend({}, inst.settings) :
+ this._get(inst, name)) : null));
+ }
+
+ settings = name || {};
+ if (typeof name === "string") {
+ settings = {};
+ settings[name] = value;
+ }
+
+ if (inst) {
+ if (this._curInst === inst) {
+ this._hideDatepicker();
+ }
+
+ date = this._getDateDatepicker(target, true);
+ minDate = this._getMinMaxDate(inst, "min");
+ maxDate = this._getMinMaxDate(inst, "max");
+ datepicker_extendRemove(inst.settings, settings);
+ // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided
+ if (minDate !== null && settings.dateFormat !== undefined && settings.minDate === undefined) {
+ inst.settings.minDate = this._formatDate(inst, minDate);
+ }
+ if (maxDate !== null && settings.dateFormat !== undefined && settings.maxDate === undefined) {
+ inst.settings.maxDate = this._formatDate(inst, maxDate);
+ }
+ if ("disabled" in settings) {
+ if (settings.disabled) {
+ this._disableDatepicker(target);
+ } else {
+ this._enableDatepicker(target);
+ }
+ }
+ this._attachments($(target), inst);
+ this._autoSize(inst);
+ this._setDate(inst, date);
+ this._updateAlternate(inst);
+ this._updateDatepicker(inst);
+ }
+ },
+
+ // change method deprecated
+ _changeDatepicker: function (target, name, value) {
+ this._optionDatepicker(target, name, value);
+ },
+
+ /* Redraw the date picker attached to an input field or division.
+ * @param target element - the target input field or division or span
+ */
+ _refreshDatepicker: function (target) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Set the dates for a jQuery selection.
+ * @param target element - the target input field or division or span
+ * @param date Date - the new date
+ */
+ _setDateDatepicker: function (target, date) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._setDate(inst, date);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ }
+ },
+
+ /* Get the date(s) for the first entry in a jQuery selection.
+ * @param target element - the target input field or division or span
+ * @param noDefault boolean - true if no default date is to be used
+ * @return Date - the current date
+ */
+ _getDateDatepicker: function (target, noDefault) {
+ var inst = this._getInst(target);
+ if (inst && !inst.inline) {
+ this._setDateFromField(inst, noDefault);
+ }
+ return (inst ? this._getDate(inst) : null);
+ },
+
+ /* Handle keystrokes. */
+ _doKeyDown: function (event) {
+ var onSelect, dateStr, sel,
+ inst = $.datepicker._getInst(event.target),
+ handled = true,
+ isRTL = inst.dpDiv.is(".ui-datepicker-rtl");
+
+ inst._keyEvent = true;
+ if ($.datepicker._datepickerShowing) {
+ switch (event.keyCode) {
+ case 9:
+ $.datepicker._hideDatepicker();
+ handled = false;
+ break; // hide on tab out
+ case 13:
+ sel = $("td." + $.datepicker._dayOverClass + ":not(." +
+ $.datepicker._currentClass + ")", inst.dpDiv);
+ if (sel[0]) {
+ $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
+ }
+
+ onSelect = $.datepicker._get(inst, "onSelect");
+ if (onSelect) {
+ dateStr = $.datepicker._formatDate(inst);
+
+ // trigger custom callback
+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]);
+ } else {
+ $.datepicker._hideDatepicker();
+ }
+
+ return false; // don't submit the form
+ case 27:
+ $.datepicker._hideDatepicker();
+ break; // hide on escape
+ case 33:
+ $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, "stepBigMonths") :
+ -$.datepicker._get(inst, "stepMonths")), "M");
+ break; // previous month/year on page up/+ ctrl
+ case 34:
+ $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, "stepBigMonths") :
+ +$.datepicker._get(inst, "stepMonths")), "M");
+ break; // next month/year on page down/+ ctrl
+ case 35:
+ if (event.ctrlKey || event.metaKey) {
+ $.datepicker._clearDate(event.target);
+ }
+ handled = event.ctrlKey || event.metaKey;
+ break; // clear on ctrl or command +end
+ case 36:
+ if (event.ctrlKey || event.metaKey) {
+ $.datepicker._gotoToday(event.target);
+ }
+ handled = event.ctrlKey || event.metaKey;
+ break; // current on ctrl or command +home
+ case 37:
+ if (event.ctrlKey || event.metaKey) {
+ $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), "D");
+ }
+ handled = event.ctrlKey || event.metaKey;
+ // -1 day on ctrl or command +left
+ if (event.originalEvent.altKey) {
+ $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, "stepBigMonths") :
+ -$.datepicker._get(inst, "stepMonths")), "M");
+ }
+ // next month/year on alt +left on Mac
+ break;
+ case 38:
+ if (event.ctrlKey || event.metaKey) {
+ $.datepicker._adjustDate(event.target, -7, "D");
+ }
+ handled = event.ctrlKey || event.metaKey;
+ break; // -1 week on ctrl or command +up
+ case 39:
+ if (event.ctrlKey || event.metaKey) {
+ $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), "D");
+ }
+ handled = event.ctrlKey || event.metaKey;
+ // +1 day on ctrl or command +right
+ if (event.originalEvent.altKey) {
+ $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, "stepBigMonths") :
+ +$.datepicker._get(inst, "stepMonths")), "M");
+ }
+ // next month/year on alt +right
+ break;
+ case 40:
+ if (event.ctrlKey || event.metaKey) {
+ $.datepicker._adjustDate(event.target, +7, "D");
+ }
+ handled = event.ctrlKey || event.metaKey;
+ break; // +1 week on ctrl or command +down
+ default:
+ handled = false;
+ }
+ } else if (event.keyCode === 36 && event.ctrlKey) { // display the date picker on ctrl+home
+ $.datepicker._showDatepicker(this);
+ } else {
+ handled = false;
+ }
+
+ if (handled) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ },
+
+ /* Filter entered characters - based on date format. */
+ _doKeyPress: function (event) {
+ var chars, chr,
+ inst = $.datepicker._getInst(event.target);
+
+ if ($.datepicker._get(inst, "constrainInput")) {
+ chars = $.datepicker._possibleChars($.datepicker._get(inst, "dateFormat"));
+ chr = String.fromCharCode(event.charCode == null ? event.keyCode : event.charCode);
+ return event.ctrlKey || event.metaKey || (chr < " " || !chars || chars.indexOf(chr) > -1);
+ }
+ },
+
+ /* Synchronise manual entry and field/alternate field. */
+ _doKeyUp: function (event) {
+ var date,
+ inst = $.datepicker._getInst(event.target);
+
+ if (inst.input.val() !== inst.lastVal) {
+ try {
+ date = $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"),
+ (inst.input ? inst.input.val() : null),
+ $.datepicker._getFormatConfig(inst));
+
+ if (date) { // only if valid
+ $.datepicker._setDateFromField(inst);
+ $.datepicker._updateAlternate(inst);
+ $.datepicker._updateDatepicker(inst);
+ }
+ }
+ catch (err) {
+ }
+ }
+ return true;
+ },
+
+ /* Pop-up the date picker for a given input field.
+ * If false returned from beforeShow event handler do not show.
+ * @param input element - the input field attached to the date picker or
+ * event - if triggered by focus
+ */
+ _showDatepicker: function (input) {
+ input = input.target || input;
+ if (input.nodeName.toLowerCase() !== "input") { // find from button/image trigger
+ input = $("input", input.parentNode)[0];
+ }
+
+ if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput === input) { // already here
+ return;
+ }
+
+ var inst, beforeShow, beforeShowSettings, isFixed,
+ offset, showAnim, duration;
+
+ inst = $.datepicker._getInst(input);
+ if ($.datepicker._curInst && $.datepicker._curInst !== inst) {
+ $.datepicker._curInst.dpDiv.stop(true, true);
+ if (inst && $.datepicker._datepickerShowing) {
+ $.datepicker._hideDatepicker($.datepicker._curInst.input[0]);
+ }
+ }
+
+ beforeShow = $.datepicker._get(inst, "beforeShow");
+ beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {};
+ if (beforeShowSettings === false) {
+ return;
+ }
+ datepicker_extendRemove(inst.settings, beforeShowSettings);
+
+ inst.lastVal = null;
+ $.datepicker._lastInput = input;
+ $.datepicker._setDateFromField(inst);
+
+ if ($.datepicker._inDialog) { // hide cursor
+ input.value = "";
+ }
+ if (!$.datepicker._pos) { // position below input
+ $.datepicker._pos = $.datepicker._findPos(input);
+ $.datepicker._pos[1] += input.offsetHeight; // add the height
+ }
+
+ isFixed = false;
+ $(input).parents().each(function () {
+ isFixed |= $(this).css("position") === "fixed";
+ return !isFixed;
+ });
+
+ offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
+ $.datepicker._pos = null;
+ //to avoid flashes on Firefox
+ inst.dpDiv.empty();
+ // determine sizing offscreen
+ inst.dpDiv.css({position: "absolute", display: "block", top: "-1000px"});
+ $.datepicker._updateDatepicker(inst);
+ // fix width for dynamic number of date pickers
+ // and adjust position before showing
+ offset = $.datepicker._checkOffset(inst, offset, isFixed);
+ inst.dpDiv.css({
+ position: ($.datepicker._inDialog && $.blockUI ?
+ "static" : (isFixed ? "fixed" : "absolute")), display: "none",
+ left: offset.left + "px", top: offset.top + "px"
+ });
+
+ if (!inst.inline) {
+ showAnim = $.datepicker._get(inst, "showAnim");
+ duration = $.datepicker._get(inst, "duration");
+ inst.dpDiv.css("z-index", datepicker_getZindex($(input)) + 1);
+ $.datepicker._datepickerShowing = true;
+
+ if ($.effects && $.effects.effect[showAnim]) {
+ inst.dpDiv.show(showAnim, $.datepicker._get(inst, "showOptions"), duration);
+ } else {
+ inst.dpDiv[showAnim || "show"](showAnim ? duration : null);
+ }
+
+ if ($.datepicker._shouldFocusInput(inst)) {
+ inst.input.focus();
+ }
+
+ $.datepicker._curInst = inst;
+ }
+ },
+
+ /* Generate the date picker content. */
+ _updateDatepicker: function (inst) {
+ this.maxRows = 4; //Reset the max number of rows being displayed (see #7043)
+ datepicker_instActive = inst; // for delegate hover events
+ inst.dpDiv.empty().append(this._generateHTML(inst));
+ this._attachHandlers(inst);
+
+ var origyearshtml,
+ numMonths = this._getNumberOfMonths(inst),
+ cols = numMonths[1],
+ width = 17,
+ activeCell = inst.dpDiv.find("." + this._dayOverClass + " a");
+
+ if (activeCell.length > 0) {
+ datepicker_handleMouseover.apply(activeCell.get(0));
+ }
+
+ inst.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");
+ if (cols > 1) {
+ inst.dpDiv.addClass("ui-datepicker-multi-" + cols).css("width", (width * cols) + "em");
+ }
+ inst.dpDiv[(numMonths[0] !== 1 || numMonths[1] !== 1 ? "add" : "remove") +
+ "Class"]("ui-datepicker-multi");
+ inst.dpDiv[(this._get(inst, "isRTL") ? "add" : "remove") +
+ "Class"]("ui-datepicker-rtl");
+
+ if (inst === $.datepicker._curInst && $.datepicker._datepickerShowing && $.datepicker._shouldFocusInput(inst)) {
+ inst.input.focus();
+ }
+
+ // deffered render of the years select (to avoid flashes on Firefox)
+ if (inst.yearshtml) {
+ origyearshtml = inst.yearshtml;
+ setTimeout(function () {
+ //assure that inst.yearshtml didn't change.
+ if (origyearshtml === inst.yearshtml && inst.yearshtml) {
+ inst.dpDiv.find("select.ui-datepicker-year:first").replaceWith(inst.yearshtml);
+ }
+ origyearshtml = inst.yearshtml = null;
+ }, 0);
+ }
+ },
+
+ // #6694 - don't focus the input if it's already focused
+ // this breaks the change event in IE
+ // Support: IE and jQuery <1.9
+ _shouldFocusInput: function (inst) {
+ return inst.input && inst.input.is(":visible") && !inst.input.is(":disabled") && !inst.input.is(":focus");
+ },
+
+ /* Check positioning to remain on screen. */
+ _checkOffset: function (inst, offset, isFixed) {
+ var dpWidth = inst.dpDiv.outerWidth(),
+ dpHeight = inst.dpDiv.outerHeight(),
+ inputWidth = inst.input ? inst.input.outerWidth() : 0,
+ inputHeight = inst.input ? inst.input.outerHeight() : 0,
+ viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()),
+ viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop());
+
+ offset.left -= (this._get(inst, "isRTL") ? (dpWidth - inputWidth) : 0);
+ offset.left -= (isFixed && offset.left === inst.input.offset().left) ? $(document).scrollLeft() : 0;
+ offset.top -= (isFixed && offset.top === (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
+
+ // now check if datepicker is showing outside window viewport - move to a better place if so.
+ offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ?
+ Math.abs(offset.left + dpWidth - viewWidth) : 0);
+ offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ?
+ Math.abs(dpHeight + inputHeight) : 0);
+
+ return offset;
+ },
+
+ /* Find an object's position on the screen. */
+ _findPos: function (obj) {
+ var position,
+ inst = this._getInst(obj),
+ isRTL = this._get(inst, "isRTL");
+
+ while (obj && (obj.type === "hidden" || obj.nodeType !== 1 || $.expr.filters.hidden(obj))) {
+ obj = obj[isRTL ? "previousSibling" : "nextSibling"];
+ }
+
+ position = $(obj).offset();
+ return [position.left, position.top];
+ },
+
+ /* Hide the date picker from view.
+ * @param input element - the input field attached to the date picker
+ */
+ _hideDatepicker: function (input) {
+ var showAnim, duration, postProcess, onClose,
+ inst = this._curInst;
+
+ if (!inst || (input && inst !== $.data(input, "datepicker"))) {
+ return;
+ }
+
+ if (this._datepickerShowing) {
+ showAnim = this._get(inst, "showAnim");
+ duration = this._get(inst, "duration");
+ postProcess = function () {
+ $.datepicker._tidyDialog(inst);
+ };
+
+ // DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed
+ if ($.effects && ( $.effects.effect[showAnim] || $.effects[showAnim] )) {
+ inst.dpDiv.hide(showAnim, $.datepicker._get(inst, "showOptions"), duration, postProcess);
+ } else {
+ inst.dpDiv[(showAnim === "slideDown" ? "slideUp" :
+ (showAnim === "fadeIn" ? "fadeOut" : "hide"))]((showAnim ? duration : null), postProcess);
+ }
+
+ if (!showAnim) {
+ postProcess();
+ }
+ this._datepickerShowing = false;
+
+ onClose = this._get(inst, "onClose");
+ if (onClose) {
+ onClose.apply((inst.input ? inst.input[0] : null), [(inst.input ? inst.input.val() : ""), inst]);
+ }
+
+ this._lastInput = null;
+ if (this._inDialog) {
+ this._dialogInput.css({position: "absolute", left: "0", top: "-100px"});
+ if ($.blockUI) {
+ $.unblockUI();
+ $("body").append(this.dpDiv);
+ }
+ }
+ this._inDialog = false;
+ }
+ },
+
+ /* Tidy up after a dialog display. */
+ _tidyDialog: function (inst) {
+ inst.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar");
+ },
+
+ /* Close date picker if clicked elsewhere. */
+ _checkExternalClick: function (event) {
+ if (!$.datepicker._curInst) {
+ return;
+ }
+
+ var $target = $(event.target),
+ inst = $.datepicker._getInst($target[0]);
+
+ if (( ( $target[0].id !== $.datepicker._mainDivId &&
+ $target.parents("#" + $.datepicker._mainDivId).length === 0 && !$target.hasClass($.datepicker.markerClassName) && !$target.closest("." + $.datepicker._triggerClass).length &&
+ $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) ||
+ ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst !== inst )) {
+ $.datepicker._hideDatepicker();
+ }
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustDate: function (id, offset, period) {
+ var target = $(id),
+ inst = this._getInst(target[0]);
+
+ if (this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ this._adjustInstDate(inst, offset +
+ (period === "M" ? this._get(inst, "showCurrentAtPos") : 0), // undo positioning
+ period);
+ this._updateDatepicker(inst);
+ },
+
+ /* Action for current link. */
+ _gotoToday: function (id) {
+ var date,
+ target = $(id),
+ inst = this._getInst(target[0]);
+
+ if (this._get(inst, "gotoCurrent") && inst.currentDay) {
+ inst.selectedDay = inst.currentDay;
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+ inst.drawYear = inst.selectedYear = inst.currentYear;
+ } else {
+ date = new Date();
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ }
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Action for selecting a new month/year. */
+ _selectMonthYear: function (id, select, period) {
+ var target = $(id),
+ inst = this._getInst(target[0]);
+
+ inst["selected" + (period === "M" ? "Month" : "Year")] =
+ inst["draw" + (period === "M" ? "Month" : "Year")] =
+ parseInt(select.options[select.selectedIndex].value, 10);
+
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Action for selecting a day. */
+ _selectDay: function (id, month, year, td) {
+ var inst,
+ target = $(id);
+
+ if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+
+ inst = this._getInst(target[0]);
+ inst.selectedDay = inst.currentDay = $("a", td).html();
+ inst.selectedMonth = inst.currentMonth = month;
+ inst.selectedYear = inst.currentYear = year;
+ this._selectDate(id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ },
+
+ /* Erase the input field and hide the date picker. */
+ _clearDate: function (id) {
+ var target = $(id);
+ this._selectDate(target, "");
+ },
+
+ /* Update the input field with the selected date. */
+ _selectDate: function (id, dateStr) {
+ var onSelect,
+ target = $(id),
+ inst = this._getInst(target[0]);
+
+ dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
+ if (inst.input) {
+ inst.input.val(dateStr);
+ }
+ this._updateAlternate(inst);
+
+ onSelect = this._get(inst, "onSelect");
+ if (onSelect) {
+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
+ } else if (inst.input) {
+ inst.input.trigger("change"); // fire the change event
+ }
+
+ if (inst.inline) {
+ this._updateDatepicker(inst);
+ } else {
+ this._hideDatepicker();
+ this._lastInput = inst.input[0];
+ if (typeof(inst.input[0]) !== "object") {
+ inst.input.focus(); // restore focus
+ }
+ this._lastInput = null;
+ }
+ },
+
+ /* Update any alternate field to synchronise with the main field. */
+ _updateAlternate: function (inst) {
+ var altFormat, date, dateStr,
+ altField = this._get(inst, "altField");
+
+ if (altField) { // update alternate field too
+ altFormat = this._get(inst, "altFormat") || this._get(inst, "dateFormat");
+ date = this._getDate(inst);
+ dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
+ $(altField).each(function () {
+ $(this).val(dateStr);
+ });
+ }
+ },
+
+ /* Set as beforeShowDay function to prevent selection of weekends.
+ * @param date Date - the date to customise
+ * @return [boolean, string] - is this date selectable?, what is its CSS class?
+ */
+ noWeekends: function (date) {
+ var day = date.getDay();
+ return [(day > 0 && day < 6), ""];
+ },
+
+ /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+ * @param date Date - the date to get the week for
+ * @return number - the number of the week within the year that contains this date
+ */
+ iso8601Week: function (date) {
+ var time,
+ checkDate = new Date(date.getTime());
+
+ // Find Thursday of this week starting on Monday
+ checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7));
+
+ time = checkDate.getTime();
+ checkDate.setMonth(0); // Compare with Jan 1
+ checkDate.setDate(1);
+ return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1;
+ },
+
+ /* Parse a string value into a date object.
+ * See formatDate below for the possible formats.
+ *
+ * @param format string - the expected format of the date
+ * @param value string - the date in the above format
+ * @param settings Object - attributes include:
+ * shortYearCutoff number - the cutoff year for determining the century (optional)
+ * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ * dayNames string[7] - names of the days from Sunday (optional)
+ * monthNamesShort string[12] - abbreviated names of the months (optional)
+ * monthNames string[12] - names of the months (optional)
+ * @return Date - the extracted date value or null if value is blank
+ */
+ parseDate: function (format, value, settings) {
+ if (format == null || value == null) {
+ throw "Invalid arguments";
+ }
+
+ value = (typeof value === "object" ? value.toString() : value + "");
+ if (value === "") {
+ return null;
+ }
+
+ var iFormat, dim, extra,
+ iValue = 0,
+ shortYearCutoffTemp = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff,
+ shortYearCutoff = (typeof shortYearCutoffTemp !== "string" ? shortYearCutoffTemp :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoffTemp, 10)),
+ dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort,
+ dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames,
+ monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort,
+ monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames,
+ year = -1,
+ month = -1,
+ day = -1,
+ doy = -1,
+ literal = false,
+ date,
+ // Check whether a format character is doubled
+ lookAhead = function (match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match);
+ if (matches) {
+ iFormat++;
+ }
+ return matches;
+ },
+ // Extract a number from the string value
+ getNumber = function (match) {
+ var isDoubled = lookAhead(match),
+ size = (match === "@" ? 14 : (match === "!" ? 20 :
+ (match === "y" && isDoubled ? 4 : (match === "o" ? 3 : 2)))),
+ minSize = (match === "y" ? size : 1),
+ digits = new RegExp("^\\d{" + minSize + "," + size + "}"),
+ num = value.substring(iValue).match(digits);
+ if (!num) {
+ throw "Missing number at position " + iValue;
+ }
+ iValue += num[0].length;
+ return parseInt(num[0], 10);
+ },
+ // Extract a name from the string value and convert to an index
+ getName = function (match, shortNames, longNames) {
+ var index = -1,
+ names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) {
+ return [[k, v]];
+ }).sort(function (a, b) {
+ return -(a[1].length - b[1].length);
+ });
+
+ $.each(names, function (i, pair) {
+ var name = pair[1];
+ if (value.substr(iValue, name.length).toLowerCase() === name.toLowerCase()) {
+ index = pair[0];
+ iValue += name.length;
+ return false;
+ }
+ });
+ if (index !== -1) {
+ return index + 1;
+ } else {
+ throw "Unknown name at position " + iValue;
+ }
+ },
+ // Confirm that a literal character matches the string value
+ checkLiteral = function () {
+ if (value.charAt(iValue) !== format.charAt(iFormat)) {
+ throw "Unexpected literal at position " + iValue;
+ }
+ iValue++;
+ };
+
+ for (iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal) {
+ if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
+ literal = false;
+ } else {
+ checkLiteral();
+ }
+ } else {
+ switch (format.charAt(iFormat)) {
+ case "d":
+ day = getNumber("d");
+ break;
+ case "D":
+ getName("D", dayNamesShort, dayNames);
+ break;
+ case "o":
+ doy = getNumber("o");
+ break;
+ case "m":
+ month = getNumber("m");
+ break;
+ case "M":
+ month = getName("M", monthNamesShort, monthNames);
+ break;
+ case "y":
+ year = getNumber("y");
+ break;
+ case "@":
+ date = new Date(getNumber("@"));
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "!":
+ date = new Date((getNumber("!") - this._ticksTo1970) / 10000);
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "'":
+ if (lookAhead("'")) {
+ checkLiteral();
+ } else {
+ literal = true;
+ }
+ break;
+ default:
+ checkLiteral();
+ }
+ }
+ }
+
+ if (iValue < value.length) {
+ extra = value.substr(iValue);
+ if (!/^\s+/.test(extra)) {
+ throw "Extra/unparsed characters found in date: " + extra;
+ }
+ }
+
+ if (year === -1) {
+ year = new Date().getFullYear();
+ } else if (year < 100) {
+ year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+ (year <= shortYearCutoff ? 0 : -100);
+ }
+
+ if (doy > -1) {
+ month = 1;
+ day = doy;
+ do {
+ dim = this._getDaysInMonth(year, month - 1);
+ if (day <= dim) {
+ break;
+ }
+ month++;
+ day -= dim;
+ } while (true);
+ }
+
+ date = this._daylightSavingAdjust(new Date(year, month - 1, day));
+ if (date.getFullYear() !== year || date.getMonth() + 1 !== month || date.getDate() !== day) {
+ throw "Invalid date"; // E.g. 31/02/00
+ }
+ return date;
+ },
+
+ /* Standard date formats. */
+ ATOM: "yy-mm-dd", // RFC 3339 (ISO 8601)
+ COOKIE: "D, dd M yy",
+ ISO_8601: "yy-mm-dd",
+ RFC_822: "D, d M y",
+ RFC_850: "DD, dd-M-y",
+ RFC_1036: "D, d M y",
+ RFC_1123: "D, d M yy",
+ RFC_2822: "D, d M yy",
+ RSS: "D, d M y", // RFC 822
+ TICKS: "!",
+ TIMESTAMP: "@",
+ W3C: "yy-mm-dd", // ISO 8601
+
+ _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) +
+ Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000),
+
+ /* Format a date object into a string value.
+ * The format can be combinations of the following:
+ * d - day of month (no leading zero)
+ * dd - day of month (two digit)
+ * o - day of year (no leading zeros)
+ * oo - day of year (three digit)
+ * D - day name short
+ * DD - day name long
+ * m - month of year (no leading zero)
+ * mm - month of year (two digit)
+ * M - month name short
+ * MM - month name long
+ * y - year (two digit)
+ * yy - year (four digit)
+ * @ - Unix timestamp (ms since 01/01/1970)
+ * ! - Windows ticks (100ns since 01/01/0001)
+ * "..." - literal text
+ * '' - single quote
+ *
+ * @param format string - the desired format of the date
+ * @param date Date - the date value to format
+ * @param settings Object - attributes include:
+ * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ * dayNames string[7] - names of the days from Sunday (optional)
+ * monthNamesShort string[12] - abbreviated names of the months (optional)
+ * monthNames string[12] - names of the months (optional)
+ * @return string - the date in the above format
+ */
+ formatDate: function (format, date, settings) {
+ if (!date) {
+ return "";
+ }
+
+ var iFormat,
+ dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort,
+ dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames,
+ monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort,
+ monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames,
+ // Check whether a format character is doubled
+ lookAhead = function (match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match);
+ if (matches) {
+ iFormat++;
+ }
+ return matches;
+ },
+ // Format a number, with leading zero if necessary
+ formatNumber = function (match, value, len) {
+ var num = "" + value;
+ if (lookAhead(match)) {
+ while (num.length < len) {
+ num = "0" + num;
+ }
+ }
+ return num;
+ },
+ // Format a name, short or long as requested
+ formatName = function (match, value, shortNames, longNames) {
+ return (lookAhead(match) ? longNames[value] : shortNames[value]);
+ },
+ output = "",
+ literal = false;
+
+ if (date) {
+ for (iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal) {
+ if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
+ literal = false;
+ } else {
+ output += format.charAt(iFormat);
+ }
+ } else {
+ switch (format.charAt(iFormat)) {
+ case "d":
+ output += formatNumber("d", date.getDate(), 2);
+ break;
+ case "D":
+ output += formatName("D", date.getDay(), dayNamesShort, dayNames);
+ break;
+ case "o":
+ output += formatNumber("o",
+ Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3);
+ break;
+ case "m":
+ output += formatNumber("m", date.getMonth() + 1, 2);
+ break;
+ case "M":
+ output += formatName("M", date.getMonth(), monthNamesShort, monthNames);
+ break;
+ case "y":
+ output += (lookAhead("y") ? date.getFullYear() :
+ (date.getYear() % 100 < 10 ? "0" : "") + date.getYear() % 100);
+ break;
+ case "@":
+ output += date.getTime();
+ break;
+ case "!":
+ output += date.getTime() * 10000 + this._ticksTo1970;
+ break;
+ case "'":
+ if (lookAhead("'")) {
+ output += "'";
+ } else {
+ literal = true;
+ }
+ break;
+ default:
+ output += format.charAt(iFormat);
+ }
+ }
+ }
+ }
+ return output;
+ },
+
+ /* Extract all possible characters from the date format. */
+ _possibleChars: function (format) {
+ var iFormat,
+ chars = "",
+ literal = false,
+ // Check whether a format character is doubled
+ lookAhead = function (match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match);
+ if (matches) {
+ iFormat++;
+ }
+ return matches;
+ };
+
+ for (iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal) {
+ if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
+ literal = false;
+ } else {
+ chars += format.charAt(iFormat);
+ }
+ } else {
+ switch (format.charAt(iFormat)) {
+ case "d":
+ case "m":
+ case "y":
+ case "@":
+ chars += "0123456789";
+ break;
+ case "D":
+ case "M":
+ return null; // Accept anything
+ case "'":
+ if (lookAhead("'")) {
+ chars += "'";
+ } else {
+ literal = true;
+ }
+ break;
+ default:
+ chars += format.charAt(iFormat);
+ }
+ }
+ }
+ return chars;
+ },
+
+ /* Get a setting value, defaulting if necessary. */
+ _get: function (inst, name) {
+ return inst.settings[name] !== undefined ?
+ inst.settings[name] : this._defaults[name];
+ },
+
+ /* Parse existing date and initialise date picker. */
+ _setDateFromField: function (inst, noDefault) {
+ if (inst.input.val() === inst.lastVal) {
+ return;
+ }
+
+ var dateFormat = this._get(inst, "dateFormat"),
+ dates = inst.lastVal = inst.input ? inst.input.val() : null,
+ defaultDate = this._getDefaultDate(inst),
+ date = defaultDate,
+ settings = this._getFormatConfig(inst);
+
+ try {
+ date = this.parseDate(dateFormat, dates, settings) || defaultDate;
+ } catch (event) {
+ dates = (noDefault ? "" : dates);
+ }
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ inst.currentDay = (dates ? date.getDate() : 0);
+ inst.currentMonth = (dates ? date.getMonth() : 0);
+ inst.currentYear = (dates ? date.getFullYear() : 0);
+ this._adjustInstDate(inst);
+ },
+
+ /* Retrieve the default date shown on opening. */
+ _getDefaultDate: function (inst) {
+ return this._restrictMinMax(inst,
+ this._determineDate(inst, this._get(inst, "defaultDate"), new Date()));
+ },
+
+ /* A date may be specified as an exact value or a relative one. */
+ _determineDate: function (inst, date, defaultDate) {
+ var offsetNumeric = function (offset) {
+ var date = new Date();
+ date.setDate(date.getDate() + offset);
+ return date;
+ },
+ offsetString = function (offset) {
+ try {
+ return $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"),
+ offset, $.datepicker._getFormatConfig(inst));
+ }
+ catch (e) {
+ // Ignore
+ }
+
+ var date = (offset.toLowerCase().match(/^c/) ?
+ $.datepicker._getDate(inst) : null) || new Date(),
+ year = date.getFullYear(),
+ month = date.getMonth(),
+ day = date.getDate(),
+ pattern = /([+\-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,
+ matches = pattern.exec(offset);
+
+ while (matches) {
+ switch (matches[2] || "d") {
+ case "d" :
+ case "D" :
+ day += parseInt(matches[1], 10);
+ break;
+ case "w" :
+ case "W" :
+ day += parseInt(matches[1], 10) * 7;
+ break;
+ case "m" :
+ case "M" :
+ month += parseInt(matches[1], 10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ case "y":
+ case "Y" :
+ year += parseInt(matches[1], 10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ }
+ matches = pattern.exec(offset);
+ }
+ return new Date(year, month, day);
+ },
+ newDate = (date == null || date === "" ? defaultDate : (typeof date === "string" ? offsetString(date) :
+ (typeof date === "number" ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime()))));
+
+ newDate = (newDate && newDate.toString() === "Invalid Date" ? defaultDate : newDate);
+ if (newDate) {
+ newDate.setHours(0);
+ newDate.setMinutes(0);
+ newDate.setSeconds(0);
+ newDate.setMilliseconds(0);
+ }
+ return this._daylightSavingAdjust(newDate);
+ },
+
+ /* Handle switch to/from daylight saving.
+ * Hours may be non-zero on daylight saving cut-over:
+ * > 12 when midnight changeover, but then cannot generate
+ * midnight datetime, so jump to 1AM, otherwise reset.
+ * @param date (Date) the date to check
+ * @return (Date) the corrected date
+ */
+ _daylightSavingAdjust: function (date) {
+ if (!date) {
+ return null;
+ }
+ date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
+ return date;
+ },
+
+ /* Set the date(s) directly. */
+ _setDate: function (inst, date, noChange) {
+ var clear = !date,
+ origMonth = inst.selectedMonth,
+ origYear = inst.selectedYear,
+ newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date()));
+
+ inst.selectedDay = inst.currentDay = newDate.getDate();
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth();
+ inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear();
+ if ((origMonth !== inst.selectedMonth || origYear !== inst.selectedYear) && !noChange) {
+ this._notifyChange(inst);
+ }
+ this._adjustInstDate(inst);
+ if (inst.input) {
+ inst.input.val(clear ? "" : this._formatDate(inst));
+ }
+ },
+
+ /* Retrieve the date(s) directly. */
+ _getDate: function (inst) {
+ var startDate = (!inst.currentYear || (inst.input && inst.input.val() === "") ? null :
+ this._daylightSavingAdjust(new Date(
+ inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return startDate;
+ },
+
+ /* Attach the onxxx handlers. These are declared statically so
+ * they work with static code transformers like Caja.
+ */
+ _attachHandlers: function (inst) {
+ var stepMonths = this._get(inst, "stepMonths"),
+ id = "#" + inst.id.replace(/\\\\/g, "\\");
+ inst.dpDiv.find("[data-handler]").map(function () {
+ var handler = {
+ prev: function () {
+ $.datepicker._adjustDate(id, -stepMonths, "M");
+ },
+ next: function () {
+ $.datepicker._adjustDate(id, +stepMonths, "M");
+ },
+ hide: function () {
+ $.datepicker._hideDatepicker();
+ },
+ today: function () {
+ $.datepicker._gotoToday(id);
+ },
+ selectDay: function () {
+ $.datepicker._selectDay(id, +this.getAttribute("data-month"), +this.getAttribute("data-year"), this);
+ return false;
+ },
+ selectMonth: function () {
+ $.datepicker._selectMonthYear(id, this, "M");
+ return false;
+ },
+ selectYear: function () {
+ $.datepicker._selectMonthYear(id, this, "Y");
+ return false;
+ }
+ };
+ $(this).bind(this.getAttribute("data-event"), handler[this.getAttribute("data-handler")]);
+ });
+ },
+
+ /* Generate the HTML for the current state of the date picker. */
+ _generateHTML: function (inst) {
+ var maxDraw, prevText, prev, nextText, next, currentText, gotoDate,
+ controls, buttonPanel, firstDay, showWeek, dayNames, dayNamesMin,
+ monthNames, monthNamesShort, beforeShowDay, showOtherMonths,
+ selectOtherMonths, defaultDate, html, dow, row, group, col, selectedDate,
+ cornerClass, calender, thead, day, daysInMonth, leadDays, curRows, numRows,
+ printDate, dRow, tbody, daySettings, otherMonth, unselectable,
+ tempDate = new Date(),
+ today = this._daylightSavingAdjust(
+ new Date(tempDate.getFullYear(), tempDate.getMonth(), tempDate.getDate())), // clear time
+ isRTL = this._get(inst, "isRTL"),
+ showButtonPanel = this._get(inst, "showButtonPanel"),
+ hideIfNoPrevNext = this._get(inst, "hideIfNoPrevNext"),
+ navigationAsDateFormat = this._get(inst, "navigationAsDateFormat"),
+ numMonths = this._getNumberOfMonths(inst),
+ showCurrentAtPos = this._get(inst, "showCurrentAtPos"),
+ stepMonths = this._get(inst, "stepMonths"),
+ isMultiMonth = (numMonths[0] !== 1 || numMonths[1] !== 1),
+ currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay))),
+ minDate = this._getMinMaxDate(inst, "min"),
+ maxDate = this._getMinMaxDate(inst, "max"),
+ drawMonth = inst.drawMonth - showCurrentAtPos,
+ drawYear = inst.drawYear;
+
+ if (drawMonth < 0) {
+ drawMonth += 12;
+ drawYear--;
+ }
+ if (maxDate) {
+ maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
+ maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate()));
+ maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
+ while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
+ drawMonth--;
+ if (drawMonth < 0) {
+ drawMonth = 11;
+ drawYear--;
+ }
+ }
+ }
+ inst.drawMonth = drawMonth;
+ inst.drawYear = drawYear;
+
+ prevText = this._get(inst, "prevText");
+ prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
+ this._getFormatConfig(inst)));
+
+ prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
+ "<a class='ui-datepicker-prev ui-corner-all' data-handler='prev' data-event='click'" +
+ " title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "e" : "w") + "'>" + prevText + "</span></a>" :
+ (hideIfNoPrevNext ? "" : "<a class='ui-datepicker-prev ui-corner-all ui-state-disabled' title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "e" : "w") + "'>" + prevText + "</span></a>"));
+
+ nextText = this._get(inst, "nextText");
+ nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
+ this._getFormatConfig(inst)));
+
+ next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
+ "<a class='ui-datepicker-next ui-corner-all' data-handler='next' data-event='click'" +
+ " title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "w" : "e") + "'>" + nextText + "</span></a>" :
+ (hideIfNoPrevNext ? "" : "<a class='ui-datepicker-next ui-corner-all ui-state-disabled' title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "w" : "e") + "'>" + nextText + "</span></a>"));
+
+ currentText = this._get(inst, "currentText");
+ gotoDate = (this._get(inst, "gotoCurrent") && inst.currentDay ? currentDate : today);
+ currentText = (!navigationAsDateFormat ? currentText :
+ this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
+
+ controls = (!inst.inline ? "<button type='button' class='ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all' data-handler='hide' data-event='click'>" +
+ this._get(inst, "closeText") + "</button>" : "");
+
+ buttonPanel = (showButtonPanel) ? "<div class='ui-datepicker-buttonpane ui-widget-content'>" + (isRTL ? controls : "") +
+ (this._isInRange(inst, gotoDate) ? "<button type='button' class='ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all' data-handler='today' data-event='click'" +
+ ">" + currentText + "</button>" : "") + (isRTL ? "" : controls) + "</div>" : "";
+
+ firstDay = parseInt(this._get(inst, "firstDay"), 10);
+ firstDay = (isNaN(firstDay) ? 0 : firstDay);
+
+ showWeek = this._get(inst, "showWeek");
+ dayNames = this._get(inst, "dayNames");
+ dayNamesMin = this._get(inst, "dayNamesMin");
+ monthNames = this._get(inst, "monthNames");
+ monthNamesShort = this._get(inst, "monthNamesShort");
+ beforeShowDay = this._get(inst, "beforeShowDay");
+ showOtherMonths = this._get(inst, "showOtherMonths");
+ selectOtherMonths = this._get(inst, "selectOtherMonths");
+ defaultDate = this._getDefaultDate(inst);
+ html = "";
+ dow;
+ for (row = 0; row < numMonths[0]; row++) {
+ group = "";
+ this.maxRows = 4;
+ for (col = 0; col < numMonths[1]; col++) {
+ selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
+ cornerClass = " ui-corner-all";
+ calender = "";
+ if (isMultiMonth) {
+ calender += "<div class='ui-datepicker-group";
+ if (numMonths[1] > 1) {
+ switch (col) {
+ case 0:
+ calender += " ui-datepicker-group-first";
+ cornerClass = " ui-corner-" + (isRTL ? "right" : "left");
+ break;
+ case numMonths[1] - 1:
+ calender += " ui-datepicker-group-last";
+ cornerClass = " ui-corner-" + (isRTL ? "left" : "right");
+ break;
+ default:
+ calender += " ui-datepicker-group-middle";
+ cornerClass = "";
+ break;
+ }
+ }
+ calender += "'>";
+ }
+ calender += "<div class='ui-datepicker-header ui-widget-header ui-helper-clearfix" + cornerClass + "'>" +
+ (/all|left/.test(cornerClass) && row === 0 ? (isRTL ? next : prev) : "") +
+ (/all|right/.test(cornerClass) && row === 0 ? (isRTL ? prev : next) : "") +
+ this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
+ row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
+ "</div><table class='ui-datepicker-calendar'><thead>" +
+ "<tr>";
+ thead = (showWeek ? "<th class='ui-datepicker-week-col'>" + this._get(inst, "weekHeader") + "</th>" : "");
+ for (dow = 0; dow < 7; dow++) { // days of the week
+ day = (dow + firstDay) % 7;
+ thead += "<th scope='col'" + ((dow + firstDay + 6) % 7 >= 5 ? " class='ui-datepicker-week-end'" : "") + ">" +
+ "<span title='" + dayNames[day] + "'>" + dayNamesMin[day] + "</span></th>";
+ }
+ calender += thead + "</tr></thead><tbody>";
+ daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
+ if (drawYear === inst.selectedYear && drawMonth === inst.selectedMonth) {
+ inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
+ }
+ leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
+ curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate
+ numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043)
+ this.maxRows = numRows;
+ printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
+ for (dRow = 0; dRow < numRows; dRow++) { // create date picker rows
+ calender += "<tr>";
+ tbody = (!showWeek ? "" : "<td class='ui-datepicker-week-col'>" +
+ this._get(inst, "calculateWeek")(printDate) + "</td>");
+ for (dow = 0; dow < 7; dow++) { // create date picker days
+ daySettings = (beforeShowDay ?
+ beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, ""]);
+ otherMonth = (printDate.getMonth() !== drawMonth);
+ unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] ||
+ (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
+ tbody += "<td class='" +
+ ((dow + firstDay + 6) % 7 >= 5 ? " ui-datepicker-week-end" : "") + // highlight weekends
+ (otherMonth ? " ui-datepicker-other-month" : "") + // highlight days from other months
+ ((printDate.getTime() === selectedDate.getTime() && drawMonth === inst.selectedMonth && inst._keyEvent) || // user pressed key
+ (defaultDate.getTime() === printDate.getTime() && defaultDate.getTime() === selectedDate.getTime()) ?
+ // or defaultDate is current printedDate and defaultDate is selectedDate
+ " " + this._dayOverClass : "") + // highlight selected day
+ (unselectable ? " " + this._unselectableClass + " ui-state-disabled" : "") + // highlight unselectable days
+ (otherMonth && !showOtherMonths ? "" : " " + daySettings[1] + // highlight custom dates
+ (printDate.getTime() === currentDate.getTime() ? " " + this._currentClass : "") + // highlight selected day
+ (printDate.getTime() === today.getTime() ? " ui-datepicker-today" : "")) + "'" + // highlight today (if different)
+ ((!otherMonth || showOtherMonths) && daySettings[2] ? " title='" + daySettings[2].replace(/'/g, "'") + "'" : "") + // cell title
+ (unselectable ? "" : " data-handler='selectDay' data-event='click' data-month='" + printDate.getMonth() + "' data-year='" + printDate.getFullYear() + "'") + ">" + // actions
+ (otherMonth && !showOtherMonths ? " " : // display for other months
+ (unselectable ? "<span class='ui-state-default'>" + printDate.getDate() + "</span>" : "<a class='ui-state-default" +
+ (printDate.getTime() === today.getTime() ? " ui-state-highlight" : "") +
+ (printDate.getTime() === currentDate.getTime() ? " ui-state-active" : "") + // highlight selected day
+ (otherMonth ? " ui-priority-secondary" : "") + // distinguish dates from other months
+ "' href='#'>" + printDate.getDate() + "</a>")) + "</td>"; // display selectable date
+ printDate.setDate(printDate.getDate() + 1);
+ printDate = this._daylightSavingAdjust(printDate);
+ }
+ calender += tbody + "</tr>";
+ }
+ drawMonth++;
+ if (drawMonth > 11) {
+ drawMonth = 0;
+ drawYear++;
+ }
+ calender += "</tbody></table>" + (isMultiMonth ? "</div>" +
+ ((numMonths[0] > 0 && col === numMonths[1] - 1) ? "<div class='ui-datepicker-row-break'></div>" : "") : "");
+ group += calender;
+ }
+ html += group;
+ }
+ html += buttonPanel;
+ inst._keyEvent = false;
+ return html;
+ },
+
+ /* Generate the month and year header. */
+ _generateMonthYearHeader: function (inst, drawMonth, drawYear, minDate, maxDate,
+ secondary, monthNames, monthNamesShort) {
+
+ var inMinYear, inMaxYear, month, years, thisYear, determineYear, year, endYear,
+ changeMonth = this._get(inst, "changeMonth"),
+ changeYear = this._get(inst, "changeYear"),
+ showMonthAfterYear = this._get(inst, "showMonthAfterYear"),
+ html = "<div class='ui-datepicker-title'>",
+ monthHtml = "";
+
+ // month selection
+ if (secondary || !changeMonth) {
+ monthHtml += "<span class='ui-datepicker-month'>" + monthNames[drawMonth] + "</span>";
+ } else {
+ inMinYear = (minDate && minDate.getFullYear() === drawYear);
+ inMaxYear = (maxDate && maxDate.getFullYear() === drawYear);
+ monthHtml += "<select class='ui-datepicker-month' data-handler='selectMonth' data-event='change'>";
+ for (month = 0; month < 12; month++) {
+ if ((!inMinYear || month >= minDate.getMonth()) && (!inMaxYear || month <= maxDate.getMonth())) {
+ monthHtml += "<option value='" + month + "'" +
+ (month === drawMonth ? " selected='selected'" : "") +
+ ">" + monthNamesShort[month] + "</option>";
+ }
+ }
+ monthHtml += "</select>";
+ }
+
+ if (!showMonthAfterYear) {
+ html += monthHtml + (secondary || !(changeMonth && changeYear) ? " " : "");
+ }
+
+ // year selection
+ if (!inst.yearshtml) {
+ inst.yearshtml = "";
+ if (secondary || !changeYear) {
+ html += "<span class='ui-datepicker-year'>" + drawYear + "</span>";
+ } else {
+ // determine range of years to display
+ years = this._get(inst, "yearRange").split(":");
+ thisYear = new Date().getFullYear();
+ determineYear = function (value) {
+ var year = (value.match(/c[+\-].*/) ? drawYear + parseInt(value.substring(1), 10) :
+ (value.match(/[+\-].*/) ? thisYear + parseInt(value, 10) :
+ parseInt(value, 10)));
+ return (isNaN(year) ? thisYear : year);
+ };
+ year = determineYear(years[0]);
+ endYear = Math.max(year, determineYear(years[1] || ""));
+ year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
+ endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
+ inst.yearshtml += "<select class='ui-datepicker-year' data-handler='selectYear' data-event='change'>";
+ for (; year <= endYear; year++) {
+ inst.yearshtml += "<option value='" + year + "'" +
+ (year === drawYear ? " selected='selected'" : "") +
+ ">" + year + "</option>";
+ }
+ inst.yearshtml += "</select>";
+
+ html += inst.yearshtml;
+ inst.yearshtml = null;
+ }
+ }
+
+ html += this._get(inst, "yearSuffix");
+ if (showMonthAfterYear) {
+ html += (secondary || !(changeMonth && changeYear) ? " " : "") + monthHtml;
+ }
+ html += "</div>"; // Close datepicker_header
+ return html;
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustInstDate: function (inst, offset, period) {
+ var year = inst.drawYear + (period === "Y" ? offset : 0),
+ month = inst.drawMonth + (period === "M" ? offset : 0),
+ day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + (period === "D" ? offset : 0),
+ date = this._restrictMinMax(inst, this._daylightSavingAdjust(new Date(year, month, day)));
+
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ if (period === "M" || period === "Y") {
+ this._notifyChange(inst);
+ }
+ },
+
+ /* Ensure a date is within any min/max bounds. */
+ _restrictMinMax: function (inst, date) {
+ var minDate = this._getMinMaxDate(inst, "min"),
+ maxDate = this._getMinMaxDate(inst, "max"),
+ newDate = (minDate && date < minDate ? minDate : date);
+ return (maxDate && newDate > maxDate ? maxDate : newDate);
+ },
+
+ /* Notify change of month/year. */
+ _notifyChange: function (inst) {
+ var onChange = this._get(inst, "onChangeMonthYear");
+ if (onChange) {
+ onChange.apply((inst.input ? inst.input[0] : null),
+ [inst.selectedYear, inst.selectedMonth + 1, inst]);
+ }
+ },
+
+ /* Determine the number of months to show. */
+ _getNumberOfMonths: function (inst) {
+ var numMonths = this._get(inst, "numberOfMonths");
+ return (numMonths == null ? [1, 1] : (typeof numMonths === "number" ? [1, numMonths] : numMonths));
+ },
+
+ /* Determine the current maximum date - ensure no time components are set. */
+ _getMinMaxDate: function (inst, minMax) {
+ return this._determineDate(inst, this._get(inst, minMax + "Date"), null);
+ },
+
+ /* Find the number of days in a given month. */
+ _getDaysInMonth: function (year, month) {
+ return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate();
+ },
+
+ /* Find the day of the week of the first of a month. */
+ _getFirstDayOfMonth: function (year, month) {
+ return new Date(year, month, 1).getDay();
+ },
+
+ /* Determines if we should allow a "next/prev" month display change. */
+ _canAdjustMonth: function (inst, offset, curYear, curMonth) {
+ var numMonths = this._getNumberOfMonths(inst),
+ date = this._daylightSavingAdjust(new Date(curYear,
+ curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1));
+
+ if (offset < 0) {
+ date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
+ }
+ return this._isInRange(inst, date);
+ },
+
+ /* Is the given date in the accepted range? */
+ _isInRange: function (inst, date) {
+ var yearSplit, currentYear,
+ minDate = this._getMinMaxDate(inst, "min"),
+ maxDate = this._getMinMaxDate(inst, "max"),
+ minYear = null,
+ maxYear = null,
+ years = this._get(inst, "yearRange");
+ if (years) {
+ yearSplit = years.split(":");
+ currentYear = new Date().getFullYear();
+ minYear = parseInt(yearSplit[0], 10);
+ maxYear = parseInt(yearSplit[1], 10);
+ if (yearSplit[0].match(/[+\-].*/)) {
+ minYear += currentYear;
+ }
+ if (yearSplit[1].match(/[+\-].*/)) {
+ maxYear += currentYear;
+ }
+ }
+
+ return ((!minDate || date.getTime() >= minDate.getTime()) &&
+ (!maxDate || date.getTime() <= maxDate.getTime()) &&
+ (!minYear || date.getFullYear() >= minYear) &&
+ (!maxYear || date.getFullYear() <= maxYear));
+ },
+
+ /* Provide the configuration settings for formatting/parsing. */
+ _getFormatConfig: function (inst) {
+ var shortYearCutoff = this._get(inst, "shortYearCutoff");
+ shortYearCutoff = (typeof shortYearCutoff !== "string" ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+ return {
+ shortYearCutoff: shortYearCutoff,
+ dayNamesShort: this._get(inst, "dayNamesShort"), dayNames: this._get(inst, "dayNames"),
+ monthNamesShort: this._get(inst, "monthNamesShort"), monthNames: this._get(inst, "monthNames")
+ };
+ },
+
+ /* Format the given date for display. */
+ _formatDate: function (inst, day, month, year) {
+ if (!day) {
+ inst.currentDay = inst.selectedDay;
+ inst.currentMonth = inst.selectedMonth;
+ inst.currentYear = inst.selectedYear;
+ }
+ var date = (day ? (typeof day === "object" ? day :
+ this._daylightSavingAdjust(new Date(year, month, day))) :
+ this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return this.formatDate(this._get(inst, "dateFormat"), date, this._getFormatConfig(inst));
+ }
+ });
+
+ /*
+ * Bind hover events for datepicker elements.
+ * Done via delegate so the binding only occurs once in the lifetime of the parent div.
+ * Global datepicker_instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker.
+ */
+ function datepicker_bindHover(dpDiv) {
+ var selector = "button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";
+ return dpDiv.delegate(selector, "mouseout", function () {
+ $(this).removeClass("ui-state-hover");
+ if (this.className.indexOf("ui-datepicker-prev") !== -1) {
+ $(this).removeClass("ui-datepicker-prev-hover");
+ }
+ if (this.className.indexOf("ui-datepicker-next") !== -1) {
+ $(this).removeClass("ui-datepicker-next-hover");
+ }
+ })
+ .delegate(selector, "mouseover", datepicker_handleMouseover);
+ }
+
+ function datepicker_handleMouseover() {
+ if (!$.datepicker._isDisabledDatepicker(datepicker_instActive.inline ? datepicker_instActive.dpDiv.parent()[0] : datepicker_instActive.input[0])) {
+ $(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");
+ $(this).addClass("ui-state-hover");
+ if (this.className.indexOf("ui-datepicker-prev") !== -1) {
+ $(this).addClass("ui-datepicker-prev-hover");
+ }
+ if (this.className.indexOf("ui-datepicker-next") !== -1) {
+ $(this).addClass("ui-datepicker-next-hover");
+ }
+ }
+ }
+
+ /* jQuery extend now ignores nulls! */
+ function datepicker_extendRemove(target, props) {
+ $.extend(target, props);
+ for (var name in props) {
+ if (props[name] == null) {
+ target[name] = props[name];
+ }
+ }
+ return target;
+ }
+
+ /* Invoke the datepicker functionality.
+ @param options string - a command, optionally followed by additional parameters or
+ Object - settings for attaching new datepicker functionality
+ @return jQuery object */
+ $.fn.datepicker = function (options) {
+
+ /* Verify an empty collection wasn't passed - Fixes #6976 */
+ if (!this.length) {
+ return this;
+ }
+
+ /* Initialise the date picker. */
+ if (!$.datepicker.initialized) {
+ $(document).mousedown($.datepicker._checkExternalClick);
+ $.datepicker.initialized = true;
+ }
+
+ /* Append datepicker main container to body if not exist. */
+ if ($("#" + $.datepicker._mainDivId).length === 0) {
+ $("body").append($.datepicker.dpDiv);
+ }
+
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ if (typeof options === "string" && (options === "isDisabled" || options === "getDate" || options === "widget")) {
+ return $.datepicker["_" + options + "Datepicker"].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ }
+ if (options === "option" && arguments.length === 2 && typeof arguments[1] === "string") {
+ return $.datepicker["_" + options + "Datepicker"].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ }
+ return this.each(function () {
+ typeof options === "string" ?
+ $.datepicker["_" + options + "Datepicker"].
+ apply($.datepicker, [this].concat(otherArgs)) :
+ $.datepicker._attachDatepicker(this, options);
+ });
+ };
+
+ $.datepicker = new Datepicker(); // singleton instance
+ $.datepicker.initialized = false;
+ $.datepicker.uuid = new Date().getTime();
+ $.datepicker.version = "1.11.4";
+
+ var datepicker = $.datepicker;
+
+
+ /*!
+ * jQuery UI Dialog 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/dialog/
+ */
+
+
+ var dialog = $.widget("ui.dialog", {
+ version: "1.11.4",
+ options: {
+ appendTo: "body",
+ autoOpen: true,
+ buttons: [],
+ closeOnEscape: true,
+ closeText: "Close",
+ dialogClass: "",
+ draggable: true,
+ hide: null,
+ height: "auto",
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 150,
+ minWidth: 150,
+ modal: false,
+ position: {
+ my: "center",
+ at: "center",
+ of: window,
+ collision: "fit",
+ // Ensure the titlebar is always visible
+ using: function (pos) {
+ var topOffset = $(this).css(pos).offset().top;
+ if (topOffset < 0) {
+ $(this).css("top", pos.top - topOffset);
+ }
+ }
+ },
+ resizable: true,
+ show: null,
+ title: null,
+ width: 300,
+
+ // callbacks
+ beforeClose: null,
+ close: null,
+ drag: null,
+ dragStart: null,
+ dragStop: null,
+ focus: null,
+ open: null,
+ resize: null,
+ resizeStart: null,
+ resizeStop: null
+ },
+
+ sizeRelatedOptions: {
+ buttons: true,
+ height: true,
+ maxHeight: true,
+ maxWidth: true,
+ minHeight: true,
+ minWidth: true,
+ width: true
+ },
+
+ resizableRelatedOptions: {
+ maxHeight: true,
+ maxWidth: true,
+ minHeight: true,
+ minWidth: true
+ },
+
+ _create: function () {
+ this.originalCss = {
+ display: this.element[0].style.display,
+ width: this.element[0].style.width,
+ minHeight: this.element[0].style.minHeight,
+ maxHeight: this.element[0].style.maxHeight,
+ height: this.element[0].style.height
+ };
+ this.originalPosition = {
+ parent: this.element.parent(),
+ index: this.element.parent().children().index(this.element)
+ };
+ this.originalTitle = this.element.attr("title");
+ this.options.title = this.options.title || this.originalTitle;
+
+ this._createWrapper();
+
+ this.element
+ .show()
+ .removeAttr("title")
+ .addClass("ui-dialog-content ui-widget-content")
+ .appendTo(this.uiDialog);
+
+ this._createTitlebar();
+ this._createButtonPane();
+
+ if (this.options.draggable && $.fn.draggable) {
+ this._makeDraggable();
+ }
+ if (this.options.resizable && $.fn.resizable) {
+ this._makeResizable();
+ }
+
+ this._isOpen = false;
+
+ this._trackFocus();
+ },
+
+ _init: function () {
+ if (this.options.autoOpen) {
+ this.open();
+ }
+ },
+
+ _appendTo: function () {
+ var element = this.options.appendTo;
+ if (element && (element.jquery || element.nodeType)) {
+ return $(element);
+ }
+ return this.document.find(element || "body").eq(0);
+ },
+
+ _destroy: function () {
+ var next,
+ originalPosition = this.originalPosition;
+
+ this._untrackInstance();
+ this._destroyOverlay();
+
+ this.element
+ .removeUniqueId()
+ .removeClass("ui-dialog-content ui-widget-content")
+ .css(this.originalCss)
+ // Without detaching first, the following becomes really slow
+ .detach();
+
+ this.uiDialog.stop(true, true).remove();
+
+ if (this.originalTitle) {
+ this.element.attr("title", this.originalTitle);
+ }
+
+ next = originalPosition.parent.children().eq(originalPosition.index);
+ // Don't try to place the dialog next to itself (#8613)
+ if (next.length && next[0] !== this.element[0]) {
+ next.before(this.element);
+ } else {
+ originalPosition.parent.append(this.element);
+ }
+ },
+
+ widget: function () {
+ return this.uiDialog;
+ },
+
+ disable: $.noop,
+ enable: $.noop,
+
+ close: function (event) {
+ var activeElement,
+ that = this;
+
+ if (!this._isOpen || this._trigger("beforeClose", event) === false) {
+ return;
+ }
+
+ this._isOpen = false;
+ this._focusedElement = null;
+ this._destroyOverlay();
+ this._untrackInstance();
+
+ if (!this.opener.filter(":focusable").focus().length) {
+
+ // support: IE9
+ // IE9 throws an "Unspecified error" accessing document.activeElement from an <iframe>
+ try {
+ activeElement = this.document[0].activeElement;
+
+ // Support: IE9, IE10
+ // If the <body> is blurred, IE will switch windows, see #4520
+ if (activeElement && activeElement.nodeName.toLowerCase() !== "body") {
+
+ // Hiding a focused element doesn't trigger blur in WebKit
+ // so in case we have nothing to focus on, explicitly blur the active element
+ // https://bugs.webkit.org/show_bug.cgi?id=47182
+ $(activeElement).blur();
+ }
+ } catch (error) {
+ }
+ }
+
+ this._hide(this.uiDialog, this.options.hide, function () {
+ that._trigger("close", event);
+ });
+ },
+
+ isOpen: function () {
+ return this._isOpen;
+ },
+
+ moveToTop: function () {
+ this._moveToTop();
+ },
+
+ _moveToTop: function (event, silent) {
+ var moved = false,
+ zIndices = this.uiDialog.siblings(".ui-front:visible").map(function () {
+ return +$(this).css("z-index");
+ }).get(),
+ zIndexMax = Math.max.apply(null, zIndices);
+
+ if (zIndexMax >= +this.uiDialog.css("z-index")) {
+ this.uiDialog.css("z-index", zIndexMax + 1);
+ moved = true;
+ }
+
+ if (moved && !silent) {
+ this._trigger("focus", event);
+ }
+ return moved;
+ },
+
+ open: function () {
+ var that = this;
+ if (this._isOpen) {
+ if (this._moveToTop()) {
+ this._focusTabbable();
+ }
+ return;
+ }
+
+ this._isOpen = true;
+ this.opener = $(this.document[0].activeElement);
+
+ this._size();
+ this._position();
+ this._createOverlay();
+ this._moveToTop(null, true);
+
+ // Ensure the overlay is moved to the top with the dialog, but only when
+ // opening. The overlay shouldn't move after the dialog is open so that
+ // modeless dialogs opened after the modal dialog stack properly.
+ if (this.overlay) {
+ this.overlay.css("z-index", this.uiDialog.css("z-index") - 1);
+ }
+
+ this._show(this.uiDialog, this.options.show, function () {
+ that._focusTabbable();
+ that._trigger("focus");
+ });
+
+ // Track the dialog immediately upon openening in case a focus event
+ // somehow occurs outside of the dialog before an element inside the
+ // dialog is focused (#10152)
+ this._makeFocusTarget();
+
+ this._trigger("open");
+ },
+
+ _focusTabbable: function () {
+ // Set focus to the first match:
+ // 1. An element that was focused previously
+ // 2. First element inside the dialog matching [autofocus]
+ // 3. Tabbable element inside the content element
+ // 4. Tabbable element inside the buttonpane
+ // 5. The close button
+ // 6. The dialog itself
+ var hasFocus = this._focusedElement;
+ if (!hasFocus) {
+ hasFocus = this.element.find("[autofocus]");
+ }
+ if (!hasFocus.length) {
+ hasFocus = this.element.find(":tabbable");
+ }
+ if (!hasFocus.length) {
+ hasFocus = this.uiDialogButtonPane.find(":tabbable");
+ }
+ if (!hasFocus.length) {
+ hasFocus = this.uiDialogTitlebarClose.filter(":tabbable");
+ }
+ if (!hasFocus.length) {
+ hasFocus = this.uiDialog;
+ }
+ hasFocus.eq(0).focus();
+ },
+
+ _keepFocus: function (event) {
+ function checkFocus() {
+ var activeElement = this.document[0].activeElement,
+ isActive = this.uiDialog[0] === activeElement ||
+ $.contains(this.uiDialog[0], activeElement);
+ if (!isActive) {
+ this._focusTabbable();
+ }
+ }
+
+ event.preventDefault();
+ checkFocus.call(this);
+ // support: IE
+ // IE <= 8 doesn't prevent moving focus even with event.preventDefault()
+ // so we check again later
+ this._delay(checkFocus);
+ },
+
+ _createWrapper: function () {
+ this.uiDialog = $("<div>")
+ .addClass("ui-dialog ui-widget ui-widget-content ui-corner-all ui-front " +
+ this.options.dialogClass)
+ .hide()
+ .attr({
+ // Setting tabIndex makes the div focusable
+ tabIndex: -1,
+ role: "dialog"
+ })
+ .appendTo(this._appendTo());
+
+ this._on(this.uiDialog, {
+ keydown: function (event) {
+ if (this.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE) {
+ event.preventDefault();
+ this.close(event);
+ return;
+ }
+
+ // prevent tabbing out of dialogs
+ if (event.keyCode !== $.ui.keyCode.TAB || event.isDefaultPrevented()) {
+ return;
+ }
+ var tabbables = this.uiDialog.find(":tabbable"),
+ first = tabbables.filter(":first"),
+ last = tabbables.filter(":last");
+
+ if (( event.target === last[0] || event.target === this.uiDialog[0] ) && !event.shiftKey) {
+ this._delay(function () {
+ first.focus();
+ });
+ event.preventDefault();
+ } else if (( event.target === first[0] || event.target === this.uiDialog[0] ) && event.shiftKey) {
+ this._delay(function () {
+ last.focus();
+ });
+ event.preventDefault();
+ }
+ },
+ mousedown: function (event) {
+ if (this._moveToTop(event)) {
+ this._focusTabbable();
+ }
+ }
+ });
+
+ // We assume that any existing aria-describedby attribute means
+ // that the dialog content is marked up properly
+ // otherwise we brute force the content as the description
+ if (!this.element.find("[aria-describedby]").length) {
+ this.uiDialog.attr({
+ "aria-describedby": this.element.uniqueId().attr("id")
+ });
+ }
+ },
+
+ _createTitlebar: function () {
+ var uiDialogTitle;
+
+ this.uiDialogTitlebar = $("<div>")
+ .addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix")
+ .prependTo(this.uiDialog);
+ this._on(this.uiDialogTitlebar, {
+ mousedown: function (event) {
+ // Don't prevent click on close button (#8838)
+ // Focusing a dialog that is partially scrolled out of view
+ // causes the browser to scroll it into view, preventing the click event
+ if (!$(event.target).closest(".ui-dialog-titlebar-close")) {
+ // Dialog isn't getting focus when dragging (#8063)
+ this.uiDialog.focus();
+ }
+ }
+ });
+
+ // support: IE
+ // Use type="button" to prevent enter keypresses in textboxes from closing the
+ // dialog in IE (#9312)
+ this.uiDialogTitlebarClose = $("<button type='button'></button>")
+ .button({
+ label: this.options.closeText,
+ icons: {
+ primary: "ui-icon-closethick"
+ },
+ text: false
+ })
+ .addClass("ui-dialog-titlebar-close")
+ .appendTo(this.uiDialogTitlebar);
+ this._on(this.uiDialogTitlebarClose, {
+ click: function (event) {
+ event.preventDefault();
+ this.close(event);
+ }
+ });
+
+ uiDialogTitle = $("<span>")
+ .uniqueId()
+ .addClass("ui-dialog-title")
+ .prependTo(this.uiDialogTitlebar);
+ this._title(uiDialogTitle);
+
+ this.uiDialog.attr({
+ "aria-labelledby": uiDialogTitle.attr("id")
+ });
+ },
+
+ _title: function (title) {
+ if (!this.options.title) {
+ title.html(" ");
+ }
+ title.text(this.options.title);
+ },
+
+ _createButtonPane: function () {
+ this.uiDialogButtonPane = $("<div>")
+ .addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix");
+
+ this.uiButtonSet = $("<div>")
+ .addClass("ui-dialog-buttonset")
+ .appendTo(this.uiDialogButtonPane);
+
+ this._createButtons();
+ },
+
+ _createButtons: function () {
+ var that = this,
+ buttons = this.options.buttons;
+
+ // if we already have a button pane, remove it
+ this.uiDialogButtonPane.remove();
+ this.uiButtonSet.empty();
+
+ if ($.isEmptyObject(buttons) || ($.isArray(buttons) && !buttons.length)) {
+ this.uiDialog.removeClass("ui-dialog-buttons");
+ return;
+ }
+
+ $.each(buttons, function (name, props) {
+ var click, buttonOptions;
+ props = $.isFunction(props) ?
+ {click: props, text: name} :
+ props;
+ // Default to a non-submitting button
+ props = $.extend({type: "button"}, props);
+ // Change the context for the click callback to be the main element
+ click = props.click;
+ props.click = function () {
+ click.apply(that.element[0], arguments);
+ };
+ buttonOptions = {
+ icons: props.icons,
+ text: props.showText
+ };
+ delete props.icons;
+ delete props.showText;
+ $("<button></button>", props)
+ .button(buttonOptions)
+ .appendTo(that.uiButtonSet);
+ });
+ this.uiDialog.addClass("ui-dialog-buttons");
+ this.uiDialogButtonPane.appendTo(this.uiDialog);
+ },
+
+ _makeDraggable: function () {
+ var that = this,
+ options = this.options;
+
+ function filteredUi(ui) {
+ return {
+ position: ui.position,
+ offset: ui.offset
+ };
+ }
+
+ this.uiDialog.draggable({
+ cancel: ".ui-dialog-content, .ui-dialog-titlebar-close",
+ handle: ".ui-dialog-titlebar",
+ containment: "document",
+ start: function (event, ui) {
+ $(this).addClass("ui-dialog-dragging");
+ that._blockFrames();
+ that._trigger("dragStart", event, filteredUi(ui));
+ },
+ drag: function (event, ui) {
+ that._trigger("drag", event, filteredUi(ui));
+ },
+ stop: function (event, ui) {
+ var left = ui.offset.left - that.document.scrollLeft(),
+ top = ui.offset.top - that.document.scrollTop();
+
+ options.position = {
+ my: "left top",
+ at: "left" + (left >= 0 ? "+" : "") + left + " " +
+ "top" + (top >= 0 ? "+" : "") + top,
+ of: that.window
+ };
+ $(this).removeClass("ui-dialog-dragging");
+ that._unblockFrames();
+ that._trigger("dragStop", event, filteredUi(ui));
+ }
+ });
+ },
+
+ _makeResizable: function () {
+ var that = this,
+ options = this.options,
+ handles = options.resizable,
+ // .ui-resizable has position: relative defined in the stylesheet
+ // but dialogs have to use absolute or fixed positioning
+ position = this.uiDialog.css("position"),
+ resizeHandles = typeof handles === "string" ?
+ handles :
+ "n,e,s,w,se,sw,ne,nw";
+
+ function filteredUi(ui) {
+ return {
+ originalPosition: ui.originalPosition,
+ originalSize: ui.originalSize,
+ position: ui.position,
+ size: ui.size
+ };
+ }
+
+ this.uiDialog.resizable({
+ cancel: ".ui-dialog-content",
+ containment: "document",
+ alsoResize: this.element,
+ maxWidth: options.maxWidth,
+ maxHeight: options.maxHeight,
+ minWidth: options.minWidth,
+ minHeight: this._minHeight(),
+ handles: resizeHandles,
+ start: function (event, ui) {
+ $(this).addClass("ui-dialog-resizing");
+ that._blockFrames();
+ that._trigger("resizeStart", event, filteredUi(ui));
+ },
+ resize: function (event, ui) {
+ that._trigger("resize", event, filteredUi(ui));
+ },
+ stop: function (event, ui) {
+ var offset = that.uiDialog.offset(),
+ left = offset.left - that.document.scrollLeft(),
+ top = offset.top - that.document.scrollTop();
+
+ options.height = that.uiDialog.height();
+ options.width = that.uiDialog.width();
+ options.position = {
+ my: "left top",
+ at: "left" + (left >= 0 ? "+" : "") + left + " " +
+ "top" + (top >= 0 ? "+" : "") + top,
+ of: that.window
+ };
+ $(this).removeClass("ui-dialog-resizing");
+ that._unblockFrames();
+ that._trigger("resizeStop", event, filteredUi(ui));
+ }
+ })
+ .css("position", position);
+ },
+
+ _trackFocus: function () {
+ this._on(this.widget(), {
+ focusin: function (event) {
+ this._makeFocusTarget();
+ this._focusedElement = $(event.target);
+ }
+ });
+ },
+
+ _makeFocusTarget: function () {
+ this._untrackInstance();
+ this._trackingInstances().unshift(this);
+ },
+
+ _untrackInstance: function () {
+ var instances = this._trackingInstances(),
+ exists = $.inArray(this, instances);
+ if (exists !== -1) {
+ instances.splice(exists, 1);
+ }
+ },
+
+ _trackingInstances: function () {
+ var instances = this.document.data("ui-dialog-instances");
+ if (!instances) {
+ instances = [];
+ this.document.data("ui-dialog-instances", instances);
+ }
+ return instances;
+ },
+
+ _minHeight: function () {
+ var options = this.options;
+
+ return options.height === "auto" ?
+ options.minHeight :
+ Math.min(options.minHeight, options.height);
+ },
+
+ _position: function () {
+ // Need to show the dialog to get the actual offset in the position plugin
+ var isVisible = this.uiDialog.is(":visible");
+ if (!isVisible) {
+ this.uiDialog.show();
+ }
+ this.uiDialog.position(this.options.position);
+ if (!isVisible) {
+ this.uiDialog.hide();
+ }
+ },
+
+ _setOptions: function (options) {
+ var that = this,
+ resize = false,
+ resizableOptions = {};
+
+ $.each(options, function (key, value) {
+ that._setOption(key, value);
+
+ if (key in that.sizeRelatedOptions) {
+ resize = true;
+ }
+ if (key in that.resizableRelatedOptions) {
+ resizableOptions[key] = value;
+ }
+ });
+
+ if (resize) {
+ this._size();
+ this._position();
+ }
+ if (this.uiDialog.is(":data(ui-resizable)")) {
+ this.uiDialog.resizable("option", resizableOptions);
+ }
+ },
+
+ _setOption: function (key, value) {
+ var isDraggable, isResizable,
+ uiDialog = this.uiDialog;
+
+ if (key === "dialogClass") {
+ uiDialog
+ .removeClass(this.options.dialogClass)
+ .addClass(value);
+ }
+
+ if (key === "disabled") {
+ return;
+ }
+
+ this._super(key, value);
+
+ if (key === "appendTo") {
+ this.uiDialog.appendTo(this._appendTo());
+ }
+
+ if (key === "buttons") {
+ this._createButtons();
+ }
+
+ if (key === "closeText") {
+ this.uiDialogTitlebarClose.button({
+ // Ensure that we always pass a string
+ label: "" + value
+ });
+ }
+
+ if (key === "draggable") {
+ isDraggable = uiDialog.is(":data(ui-draggable)");
+ if (isDraggable && !value) {
+ uiDialog.draggable("destroy");
+ }
+
+ if (!isDraggable && value) {
+ this._makeDraggable();
+ }
+ }
+
+ if (key === "position") {
+ this._position();
+ }
+
+ if (key === "resizable") {
+ // currently resizable, becoming non-resizable
+ isResizable = uiDialog.is(":data(ui-resizable)");
+ if (isResizable && !value) {
+ uiDialog.resizable("destroy");
+ }
+
+ // currently resizable, changing handles
+ if (isResizable && typeof value === "string") {
+ uiDialog.resizable("option", "handles", value);
+ }
+
+ // currently non-resizable, becoming resizable
+ if (!isResizable && value !== false) {
+ this._makeResizable();
+ }
+ }
+
+ if (key === "title") {
+ this._title(this.uiDialogTitlebar.find(".ui-dialog-title"));
+ }
+ },
+
+ _size: function () {
+ // If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+ // divs will both have width and height set, so we need to reset them
+ var nonContentHeight, minContentHeight, maxContentHeight,
+ options = this.options;
+
+ // Reset content sizing
+ this.element.show().css({
+ width: "auto",
+ minHeight: 0,
+ maxHeight: "none",
+ height: 0
+ });
+
+ if (options.minWidth > options.width) {
+ options.width = options.minWidth;
+ }
+
+ // reset wrapper sizing
+ // determine the height of all the non-content elements
+ nonContentHeight = this.uiDialog.css({
+ height: "auto",
+ width: options.width
+ })
+ .outerHeight();
+ minContentHeight = Math.max(0, options.minHeight - nonContentHeight);
+ maxContentHeight = typeof options.maxHeight === "number" ?
+ Math.max(0, options.maxHeight - nonContentHeight) :
+ "none";
+
+ if (options.height === "auto") {
+ this.element.css({
+ minHeight: minContentHeight,
+ maxHeight: maxContentHeight,
+ height: "auto"
+ });
+ } else {
+ this.element.height(Math.max(0, options.height - nonContentHeight));
+ }
+
+ if (this.uiDialog.is(":data(ui-resizable)")) {
+ this.uiDialog.resizable("option", "minHeight", this._minHeight());
+ }
+ },
+
+ _blockFrames: function () {
+ this.iframeBlocks = this.document.find("iframe").map(function () {
+ var iframe = $(this);
+
+ return $("<div>")
+ .css({
+ position: "absolute",
+ width: iframe.outerWidth(),
+ height: iframe.outerHeight()
+ })
+ .appendTo(iframe.parent())
+ .offset(iframe.offset())[0];
+ });
+ },
+
+ _unblockFrames: function () {
+ if (this.iframeBlocks) {
+ this.iframeBlocks.remove();
+ delete this.iframeBlocks;
+ }
+ },
+
+ _allowInteraction: function (event) {
+ if ($(event.target).closest(".ui-dialog").length) {
+ return true;
+ }
+
+ // TODO: Remove hack when datepicker implements
+ // the .ui-front logic (#8989)
+ return !!$(event.target).closest(".ui-datepicker").length;
+ },
+
+ _createOverlay: function () {
+ if (!this.options.modal) {
+ return;
+ }
+
+ // We use a delay in case the overlay is created from an
+ // event that we're going to be cancelling (#2804)
+ var isOpening = true;
+ this._delay(function () {
+ isOpening = false;
+ });
+
+ if (!this.document.data("ui-dialog-overlays")) {
+
+ // Prevent use of anchors and inputs
+ // Using _on() for an event handler shared across many instances is
+ // safe because the dialogs stack and must be closed in reverse order
+ this._on(this.document, {
+ focusin: function (event) {
+ if (isOpening) {
+ return;
+ }
+
+ if (!this._allowInteraction(event)) {
+ event.preventDefault();
+ this._trackingInstances()[0]._focusTabbable();
+ }
+ }
+ });
+ }
+
+ this.overlay = $("<div>")
+ .addClass("ui-widget-overlay ui-front")
+ .appendTo(this._appendTo());
+ this._on(this.overlay, {
+ mousedown: "_keepFocus"
+ });
+ this.document.data("ui-dialog-overlays",
+ (this.document.data("ui-dialog-overlays") || 0) + 1);
+ },
+
+ _destroyOverlay: function () {
+ if (!this.options.modal) {
+ return;
+ }
+
+ if (this.overlay) {
+ var overlays = this.document.data("ui-dialog-overlays") - 1;
+
+ if (!overlays) {
+ this.document
+ .unbind("focusin")
+ .removeData("ui-dialog-overlays");
+ } else {
+ this.document.data("ui-dialog-overlays", overlays);
+ }
+
+ this.overlay.remove();
+ this.overlay = null;
+ }
+ }
+ });
+
+
+ /*!
+ * jQuery UI Progressbar 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/progressbar/
+ */
+
+
+ var progressbar = $.widget("ui.progressbar", {
+ version: "1.11.4",
+ options: {
+ max: 100,
+ value: 0,
+
+ change: null,
+ complete: null
+ },
+
+ min: 0,
+
+ _create: function () {
+ // Constrain initial value
+ this.oldValue = this.options.value = this._constrainedValue();
+
+ this.element
+ .addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all")
+ .attr({
+ // Only set static values, aria-valuenow and aria-valuemax are
+ // set inside _refreshValue()
+ role: "progressbar",
+ "aria-valuemin": this.min
+ });
+
+ this.valueDiv = $("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>")
+ .appendTo(this.element);
+
+ this._refreshValue();
+ },
+
+ _destroy: function () {
+ this.element
+ .removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all")
+ .removeAttr("role")
+ .removeAttr("aria-valuemin")
+ .removeAttr("aria-valuemax")
+ .removeAttr("aria-valuenow");
+
+ this.valueDiv.remove();
+ },
+
+ value: function (newValue) {
+ if (newValue === undefined) {
+ return this.options.value;
+ }
+
+ this.options.value = this._constrainedValue(newValue);
+ this._refreshValue();
+ },
+
+ _constrainedValue: function (newValue) {
+ if (newValue === undefined) {
+ newValue = this.options.value;
+ }
+
+ this.indeterminate = newValue === false;
+
+ // sanitize value
+ if (typeof newValue !== "number") {
+ newValue = 0;
+ }
+
+ return this.indeterminate ? false :
+ Math.min(this.options.max, Math.max(this.min, newValue));
+ },
+
+ _setOptions: function (options) {
+ // Ensure "value" option is set after other values (like max)
+ var value = options.value;
+ delete options.value;
+
+ this._super(options);
+
+ this.options.value = this._constrainedValue(value);
+ this._refreshValue();
+ },
+
+ _setOption: function (key, value) {
+ if (key === "max") {
+ // Don't allow a max less than min
+ value = Math.max(this.min, value);
+ }
+ if (key === "disabled") {
+ this.element
+ .toggleClass("ui-state-disabled", !!value)
+ .attr("aria-disabled", value);
+ }
+ this._super(key, value);
+ },
+
+ _percentage: function () {
+ return this.indeterminate ? 100 : 100 * ( this.options.value - this.min ) / ( this.options.max - this.min );
+ },
+
+ _refreshValue: function () {
+ var value = this.options.value,
+ percentage = this._percentage();
+
+ this.valueDiv
+ .toggle(this.indeterminate || value > this.min)
+ .toggleClass("ui-corner-right", value === this.options.max)
+ .width(percentage.toFixed(0) + "%");
+
+ this.element.toggleClass("ui-progressbar-indeterminate", this.indeterminate);
+
+ if (this.indeterminate) {
+ this.element.removeAttr("aria-valuenow");
+ if (!this.overlayDiv) {
+ this.overlayDiv = $("<div class='ui-progressbar-overlay'></div>").appendTo(this.valueDiv);
+ }
+ } else {
+ this.element.attr({
+ "aria-valuemax": this.options.max,
+ "aria-valuenow": value
+ });
+ if (this.overlayDiv) {
+ this.overlayDiv.remove();
+ this.overlayDiv = null;
+ }
+ }
+
+ if (this.oldValue !== value) {
+ this.oldValue = value;
+ this._trigger("change");
+ }
+ if (value === this.options.max) {
+ this._trigger("complete");
+ }
+ }
+ });
+
+
+ /*!
+ * jQuery UI Selectmenu 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/selectmenu
+ */
+
+
+ var selectmenu = $.widget("ui.selectmenu", {
+ version: "1.11.4",
+ defaultElement: "<select>",
+ options: {
+ appendTo: null,
+ disabled: null,
+ icons: {
+ button: "ui-icon-triangle-1-s"
+ },
+ position: {
+ my: "left top",
+ at: "left bottom",
+ collision: "none"
+ },
+ width: null,
+
+ // callbacks
+ change: null,
+ close: null,
+ focus: null,
+ open: null,
+ select: null
+ },
+
+ _create: function () {
+ var selectmenuId = this.element.uniqueId().attr("id");
+ this.ids = {
+ element: selectmenuId,
+ button: selectmenuId + "-button",
+ menu: selectmenuId + "-menu"
+ };
+
+ this._drawButton();
+ this._drawMenu();
+
+ if (this.options.disabled) {
+ this.disable();
+ }
+ },
+
+ _drawButton: function () {
+ var that = this;
+
+ // Associate existing label with the new button
+ this.label = $("label[for='" + this.ids.element + "']").attr("for", this.ids.button);
+ this._on(this.label, {
+ click: function (event) {
+ this.button.focus();
+ event.preventDefault();
+ }
+ });
+
+ // Hide original select element
+ this.element.hide();
+
+ // Create button
+ this.button = $("<span>", {
+ "class": "ui-selectmenu-button ui-widget ui-state-default ui-corner-all",
+ tabindex: this.options.disabled ? -1 : 0,
+ id: this.ids.button,
+ role: "combobox",
+ "aria-expanded": "false",
+ "aria-autocomplete": "list",
+ "aria-owns": this.ids.menu,
+ "aria-haspopup": "true"
+ })
+ .insertAfter(this.element);
+
+ $("<span>", {
+ "class": "ui-icon " + this.options.icons.button
+ })
+ .prependTo(this.button);
+
+ this.buttonText = $("<span>", {
+ "class": "ui-selectmenu-text"
+ })
+ .appendTo(this.button);
+
+ this._setText(this.buttonText, this.element.find("option:selected").text());
+ this._resizeButton();
+
+ this._on(this.button, this._buttonEvents);
+ this.button.one("focusin", function () {
+
+ // Delay rendering the menu items until the button receives focus.
+ // The menu may have already been rendered via a programmatic open.
+ if (!that.menuItems) {
+ that._refreshMenu();
+ }
+ });
+ this._hoverable(this.button);
+ this._focusable(this.button);
+ },
+
+ _drawMenu: function () {
+ var that = this;
+
+ // Create menu
+ this.menu = $("<ul>", {
+ "aria-hidden": "true",
+ "aria-labelledby": this.ids.button,
+ id: this.ids.menu
+ });
+
+ // Wrap menu
+ this.menuWrap = $("<div>", {
+ "class": "ui-selectmenu-menu ui-front"
+ })
+ .append(this.menu)
+ .appendTo(this._appendTo());
+
+ // Initialize menu widget
+ this.menuInstance = this.menu
+ .menu({
+ role: "listbox",
+ select: function (event, ui) {
+ event.preventDefault();
+
+ // support: IE8
+ // If the item was selected via a click, the text selection
+ // will be destroyed in IE
+ that._setSelection();
+
+ that._select(ui.item.data("ui-selectmenu-item"), event);
+ },
+ focus: function (event, ui) {
+ var item = ui.item.data("ui-selectmenu-item");
+
+ // Prevent inital focus from firing and check if its a newly focused item
+ if (that.focusIndex != null && item.index !== that.focusIndex) {
+ that._trigger("focus", event, {item: item});
+ if (!that.isOpen) {
+ that._select(item, event);
+ }
+ }
+ that.focusIndex = item.index;
+
+ that.button.attr("aria-activedescendant",
+ that.menuItems.eq(item.index).attr("id"));
+ }
+ })
+ .menu("instance");
+
+ // Adjust menu styles to dropdown
+ this.menu
+ .addClass("ui-corner-bottom")
+ .removeClass("ui-corner-all");
+
+ // Don't close the menu on mouseleave
+ this.menuInstance._off(this.menu, "mouseleave");
+
+ // Cancel the menu's collapseAll on document click
+ this.menuInstance._closeOnDocumentClick = function () {
+ return false;
+ };
+
+ // Selects often contain empty items, but never contain dividers
+ this.menuInstance._isDivider = function () {
+ return false;
+ };
+ },
+
+ refresh: function () {
+ this._refreshMenu();
+ this._setText(this.buttonText, this._getSelectedItem().text());
+ if (!this.options.width) {
+ this._resizeButton();
+ }
+ },
+
+ _refreshMenu: function () {
+ this.menu.empty();
+
+ var item,
+ options = this.element.find("option");
+
+ if (!options.length) {
+ return;
+ }
+
+ this._parseOptions(options);
+ this._renderMenu(this.menu, this.items);
+
+ this.menuInstance.refresh();
+ this.menuItems = this.menu.find("li").not(".ui-selectmenu-optgroup");
+
+ item = this._getSelectedItem();
+
+ // Update the menu to have the correct item focused
+ this.menuInstance.focus(null, item);
+ this._setAria(item.data("ui-selectmenu-item"));
+
+ // Set disabled state
+ this._setOption("disabled", this.element.prop("disabled"));
+ },
+
+ open: function (event) {
+ if (this.options.disabled) {
+ return;
+ }
+
+ // If this is the first time the menu is being opened, render the items
+ if (!this.menuItems) {
+ this._refreshMenu();
+ } else {
+
+ // Menu clears focus on close, reset focus to selected item
+ this.menu.find(".ui-state-focus").removeClass("ui-state-focus");
+ this.menuInstance.focus(null, this._getSelectedItem());
+ }
+
+ this.isOpen = true;
+ this._toggleAttr();
+ this._resizeMenu();
+ this._position();
+
+ this._on(this.document, this._documentClick);
+
+ this._trigger("open", event);
+ },
+
+ _position: function () {
+ this.menuWrap.position($.extend({of: this.button}, this.options.position));
+ },
+
+ close: function (event) {
+ if (!this.isOpen) {
+ return;
+ }
+
+ this.isOpen = false;
+ this._toggleAttr();
+
+ this.range = null;
+ this._off(this.document);
+
+ this._trigger("close", event);
+ },
+
+ widget: function () {
+ return this.button;
+ },
+
+ menuWidget: function () {
+ return this.menu;
+ },
+
+ _renderMenu: function (ul, items) {
+ var that = this,
+ currentOptgroup = "";
+
+ $.each(items, function (index, item) {
+ if (item.optgroup !== currentOptgroup) {
+ $("<li>", {
+ "class": "ui-selectmenu-optgroup ui-menu-divider" +
+ ( item.element.parent("optgroup").prop("disabled") ?
+ " ui-state-disabled" :
+ "" ),
+ text: item.optgroup
+ })
+ .appendTo(ul);
+
+ currentOptgroup = item.optgroup;
+ }
+
+ that._renderItemData(ul, item);
+ });
+ },
+
+ _renderItemData: function (ul, item) {
+ return this._renderItem(ul, item).data("ui-selectmenu-item", item);
+ },
+
+ _renderItem: function (ul, item) {
+ var li = $("<li>");
+
+ if (item.disabled) {
+ li.addClass("ui-state-disabled");
+ }
+ this._setText(li, item.label);
+
+ return li.appendTo(ul);
+ },
+
+ _setText: function (element, value) {
+ if (value) {
+ element.text(value);
+ } else {
+ element.html(" ");
+ }
+ },
+
+ _move: function (direction, event) {
+ var item, next,
+ filter = ".ui-menu-item";
+
+ if (this.isOpen) {
+ item = this.menuItems.eq(this.focusIndex);
+ } else {
+ item = this.menuItems.eq(this.element[0].selectedIndex);
+ filter += ":not(.ui-state-disabled)";
+ }
+
+ if (direction === "first" || direction === "last") {
+ next = item[direction === "first" ? "prevAll" : "nextAll"](filter).eq(-1);
+ } else {
+ next = item[direction + "All"](filter).eq(0);
+ }
+
+ if (next.length) {
+ this.menuInstance.focus(event, next);
+ }
+ },
+
+ _getSelectedItem: function () {
+ return this.menuItems.eq(this.element[0].selectedIndex);
+ },
+
+ _toggle: function (event) {
+ this[this.isOpen ? "close" : "open"](event);
+ },
+
+ _setSelection: function () {
+ var selection;
+
+ if (!this.range) {
+ return;
+ }
+
+ if (window.getSelection) {
+ selection = window.getSelection();
+ selection.removeAllRanges();
+ selection.addRange(this.range);
+
+ // support: IE8
+ } else {
+ this.range.select();
+ }
+
+ // support: IE
+ // Setting the text selection kills the button focus in IE, but
+ // restoring the focus doesn't kill the selection.
+ this.button.focus();
+ },
+
+ _documentClick: {
+ mousedown: function (event) {
+ if (!this.isOpen) {
+ return;
+ }
+
+ if (!$(event.target).closest(".ui-selectmenu-menu, #" + this.ids.button).length) {
+ this.close(event);
+ }
+ }
+ },
+
+ _buttonEvents: {
+
+ // Prevent text selection from being reset when interacting with the selectmenu (#10144)
+ mousedown: function () {
+ var selection;
+
+ if (window.getSelection) {
+ selection = window.getSelection();
+ if (selection.rangeCount) {
+ this.range = selection.getRangeAt(0);
+ }
+
+ // support: IE8
+ } else {
+ this.range = document.selection.createRange();
+ }
+ },
+
+ click: function (event) {
+ this._setSelection();
+ this._toggle(event);
+ },
+
+ keydown: function (event) {
+ var preventDefault = true;
+ switch (event.keyCode) {
+ case $.ui.keyCode.TAB:
+ case $.ui.keyCode.ESCAPE:
+ this.close(event);
+ preventDefault = false;
+ break;
+ case $.ui.keyCode.ENTER:
+ if (this.isOpen) {
+ this._selectFocusedItem(event);
+ }
+ break;
+ case $.ui.keyCode.UP:
+ if (event.altKey) {
+ this._toggle(event);
+ } else {
+ this._move("prev", event);
+ }
+ break;
+ case $.ui.keyCode.DOWN:
+ if (event.altKey) {
+ this._toggle(event);
+ } else {
+ this._move("next", event);
+ }
+ break;
+ case $.ui.keyCode.SPACE:
+ if (this.isOpen) {
+ this._selectFocusedItem(event);
+ } else {
+ this._toggle(event);
+ }
+ break;
+ case $.ui.keyCode.LEFT:
+ this._move("prev", event);
+ break;
+ case $.ui.keyCode.RIGHT:
+ this._move("next", event);
+ break;
+ case $.ui.keyCode.HOME:
+ case $.ui.keyCode.PAGE_UP:
+ this._move("first", event);
+ break;
+ case $.ui.keyCode.END:
+ case $.ui.keyCode.PAGE_DOWN:
+ this._move("last", event);
+ break;
+ default:
+ this.menu.trigger(event);
+ preventDefault = false;
+ }
+
+ if (preventDefault) {
+ event.preventDefault();
+ }
+ }
+ },
+
+ _selectFocusedItem: function (event) {
+ var item = this.menuItems.eq(this.focusIndex);
+ if (!item.hasClass("ui-state-disabled")) {
+ this._select(item.data("ui-selectmenu-item"), event);
+ }
+ },
+
+ _select: function (item, event) {
+ var oldIndex = this.element[0].selectedIndex;
+
+ // Change native select element
+ this.element[0].selectedIndex = item.index;
+ this._setText(this.buttonText, item.label);
+ this._setAria(item);
+ this._trigger("select", event, {item: item});
+
+ if (item.index !== oldIndex) {
+ this._trigger("change", event, {item: item});
+ }
+
+ this.close(event);
+ },
+
+ _setAria: function (item) {
+ var id = this.menuItems.eq(item.index).attr("id");
+
+ this.button.attr({
+ "aria-labelledby": id,
+ "aria-activedescendant": id
+ });
+ this.menu.attr("aria-activedescendant", id);
+ },
+
+ _setOption: function (key, value) {
+ if (key === "icons") {
+ this.button.find("span.ui-icon")
+ .removeClass(this.options.icons.button)
+ .addClass(value.button);
+ }
+
+ this._super(key, value);
+
+ if (key === "appendTo") {
+ this.menuWrap.appendTo(this._appendTo());
+ }
+
+ if (key === "disabled") {
+ this.menuInstance.option("disabled", value);
+ this.button
+ .toggleClass("ui-state-disabled", value)
+ .attr("aria-disabled", value);
+
+ this.element.prop("disabled", value);
+ if (value) {
+ this.button.attr("tabindex", -1);
+ this.close();
+ } else {
+ this.button.attr("tabindex", 0);
+ }
+ }
+
+ if (key === "width") {
+ this._resizeButton();
+ }
+ },
+
+ _appendTo: function () {
+ var element = this.options.appendTo;
+
+ if (element) {
+ element = element.jquery || element.nodeType ?
+ $(element) :
+ this.document.find(element).eq(0);
+ }
+
+ if (!element || !element[0]) {
+ element = this.element.closest(".ui-front");
+ }
+
+ if (!element.length) {
+ element = this.document[0].body;
+ }
+
+ return element;
+ },
+
+ _toggleAttr: function () {
+ this.button
+ .toggleClass("ui-corner-top", this.isOpen)
+ .toggleClass("ui-corner-all", !this.isOpen)
+ .attr("aria-expanded", this.isOpen);
+ this.menuWrap.toggleClass("ui-selectmenu-open", this.isOpen);
+ this.menu.attr("aria-hidden", !this.isOpen);
+ },
+
+ _resizeButton: function () {
+ var width = this.options.width;
+
+ if (!width) {
+ width = this.element.show().outerWidth();
+ this.element.hide();
+ }
+
+ this.button.outerWidth(width);
+ },
+
+ _resizeMenu: function () {
+ this.menu.outerWidth(Math.max(
+ this.button.outerWidth(),
+
+ // support: IE10
+ // IE10 wraps long text (possibly a rounding bug)
+ // so we add 1px to avoid the wrapping
+ this.menu.width("").outerWidth() + 1
+ ));
+ },
+
+ _getCreateOptions: function () {
+ return {disabled: this.element.prop("disabled")};
+ },
+
+ _parseOptions: function (options) {
+ var data = [];
+ options.each(function (index, item) {
+ var option = $(item),
+ optgroup = option.parent("optgroup");
+ data.push({
+ element: option,
+ index: index,
+ value: option.val(),
+ label: option.text(),
+ optgroup: optgroup.attr("label") || "",
+ disabled: optgroup.prop("disabled") || option.prop("disabled")
+ });
+ });
+ this.items = data;
+ },
+
+ _destroy: function () {
+ this.menuWrap.remove();
+ this.button.remove();
+ this.element.show();
+ this.element.removeUniqueId();
+ this.label.attr("for", this.ids.element);
+ }
+ });
+
+
+ /*!
+ * jQuery UI Slider 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/slider/
+ */
+
+
+ var slider = $.widget("ui.slider", $.ui.mouse, {
+ version: "1.11.4",
+ widgetEventPrefix: "slide",
+
+ options: {
+ animate: false,
+ distance: 0,
+ max: 100,
+ min: 0,
+ orientation: "horizontal",
+ range: false,
+ step: 1,
+ value: 0,
+ values: null,
+
+ // callbacks
+ change: null,
+ slide: null,
+ start: null,
+ stop: null
+ },
+
+ // number of pages in a slider
+ // (how many times can you page up/down to go through the whole range)
+ numPages: 5,
+
+ _create: function () {
+ this._keySliding = false;
+ this._mouseSliding = false;
+ this._animateOff = true;
+ this._handleIndex = null;
+ this._detectOrientation();
+ this._mouseInit();
+ this._calculateNewMax();
+
+ this.element
+ .addClass("ui-slider" +
+ " ui-slider-" + this.orientation +
+ " ui-widget" +
+ " ui-widget-content" +
+ " ui-corner-all");
+
+ this._refresh();
+ this._setOption("disabled", this.options.disabled);
+
+ this._animateOff = false;
+ },
+
+ _refresh: function () {
+ this._createRange();
+ this._createHandles();
+ this._setupEvents();
+ this._refreshValue();
+ },
+
+ _createHandles: function () {
+ var i, handleCount,
+ options = this.options,
+ existingHandles = this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),
+ handle = "<span class='ui-slider-handle ui-state-default ui-corner-all' tabindex='0'></span>",
+ handles = [];
+
+ handleCount = ( options.values && options.values.length ) || 1;
+
+ if (existingHandles.length > handleCount) {
+ existingHandles.slice(handleCount).remove();
+ existingHandles = existingHandles.slice(0, handleCount);
+ }
+
+ for (i = existingHandles.length; i < handleCount; i++) {
+ handles.push(handle);
+ }
+
+ this.handles = existingHandles.add($(handles.join("")).appendTo(this.element));
+
+ this.handle = this.handles.eq(0);
+
+ this.handles.each(function (i) {
+ $(this).data("ui-slider-handle-index", i);
+ });
+ },
+
+ _createRange: function () {
+ var options = this.options,
+ classes = "";
+
+ if (options.range) {
+ if (options.range === true) {
+ if (!options.values) {
+ options.values = [this._valueMin(), this._valueMin()];
+ } else if (options.values.length && options.values.length !== 2) {
+ options.values = [options.values[0], options.values[0]];
+ } else if ($.isArray(options.values)) {
+ options.values = options.values.slice(0);
+ }
+ }
+
+ if (!this.range || !this.range.length) {
+ this.range = $("<div></div>")
+ .appendTo(this.element);
+
+ classes = "ui-slider-range" +
+ // note: this isn't the most fittingly semantic framework class for this element,
+ // but worked best visually with a variety of themes
+ " ui-widget-header ui-corner-all";
+ } else {
+ this.range.removeClass("ui-slider-range-min ui-slider-range-max")
+ // Handle range switching from true to min/max
+ .css({
+ "left": "",
+ "bottom": ""
+ });
+ }
+
+ this.range.addClass(classes +
+ ( ( options.range === "min" || options.range === "max" ) ? " ui-slider-range-" + options.range : "" ));
+ } else {
+ if (this.range) {
+ this.range.remove();
+ }
+ this.range = null;
+ }
+ },
+
+ _setupEvents: function () {
+ this._off(this.handles);
+ this._on(this.handles, this._handleEvents);
+ this._hoverable(this.handles);
+ this._focusable(this.handles);
+ },
+
+ _destroy: function () {
+ this.handles.remove();
+ if (this.range) {
+ this.range.remove();
+ }
+
+ this.element
+ .removeClass("ui-slider" +
+ " ui-slider-horizontal" +
+ " ui-slider-vertical" +
+ " ui-widget" +
+ " ui-widget-content" +
+ " ui-corner-all");
+
+ this._mouseDestroy();
+ },
+
+ _mouseCapture: function (event) {
+ var position, normValue, distance, closestHandle, index, allowed, offset, mouseOverHandle,
+ that = this,
+ o = this.options;
+
+ if (o.disabled) {
+ return false;
+ }
+
+ this.elementSize = {
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight()
+ };
+ this.elementOffset = this.element.offset();
+
+ position = {x: event.pageX, y: event.pageY};
+ normValue = this._normValueFromMouse(position);
+ distance = this._valueMax() - this._valueMin() + 1;
+ this.handles.each(function (i) {
+ var thisDistance = Math.abs(normValue - that.values(i));
+ if (( distance > thisDistance ) ||
+ ( distance === thisDistance &&
+ (i === that._lastChangedValue || that.values(i) === o.min ))) {
+ distance = thisDistance;
+ closestHandle = $(this);
+ index = i;
+ }
+ });
+
+ allowed = this._start(event, index);
+ if (allowed === false) {
+ return false;
+ }
+ this._mouseSliding = true;
+
+ this._handleIndex = index;
+
+ closestHandle
+ .addClass("ui-state-active")
+ .focus();
+
+ offset = closestHandle.offset();
+ mouseOverHandle = !$(event.target).parents().addBack().is(".ui-slider-handle");
+ this._clickOffset = mouseOverHandle ? {left: 0, top: 0} : {
+ left: event.pageX - offset.left - ( closestHandle.width() / 2 ),
+ top: event.pageY - offset.top -
+ ( closestHandle.height() / 2 ) -
+ ( parseInt(closestHandle.css("borderTopWidth"), 10) || 0 ) -
+ ( parseInt(closestHandle.css("borderBottomWidth"), 10) || 0) +
+ ( parseInt(closestHandle.css("marginTop"), 10) || 0)
+ };
+
+ if (!this.handles.hasClass("ui-state-hover")) {
+ this._slide(event, index, normValue);
+ }
+ this._animateOff = true;
+ return true;
+ },
+
+ _mouseStart: function () {
+ return true;
+ },
+
+ _mouseDrag: function (event) {
+ var position = {x: event.pageX, y: event.pageY},
+ normValue = this._normValueFromMouse(position);
+
+ this._slide(event, this._handleIndex, normValue);
+
+ return false;
+ },
+
+ _mouseStop: function (event) {
+ this.handles.removeClass("ui-state-active");
+ this._mouseSliding = false;
+
+ this._stop(event, this._handleIndex);
+ this._change(event, this._handleIndex);
+
+ this._handleIndex = null;
+ this._clickOffset = null;
+ this._animateOff = false;
+
+ return false;
+ },
+
+ _detectOrientation: function () {
+ this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
+ },
+
+ _normValueFromMouse: function (position) {
+ var pixelTotal,
+ pixelMouse,
+ percentMouse,
+ valueTotal,
+ valueMouse;
+
+ if (this.orientation === "horizontal") {
+ pixelTotal = this.elementSize.width;
+ pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 );
+ } else {
+ pixelTotal = this.elementSize.height;
+ pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 );
+ }
+
+ percentMouse = ( pixelMouse / pixelTotal );
+ if (percentMouse > 1) {
+ percentMouse = 1;
+ }
+ if (percentMouse < 0) {
+ percentMouse = 0;
+ }
+ if (this.orientation === "vertical") {
+ percentMouse = 1 - percentMouse;
+ }
+
+ valueTotal = this._valueMax() - this._valueMin();
+ valueMouse = this._valueMin() + percentMouse * valueTotal;
+
+ return this._trimAlignValue(valueMouse);
+ },
+
+ _start: function (event, index) {
+ var uiHash = {
+ handle: this.handles[index],
+ value: this.value()
+ };
+ if (this.options.values && this.options.values.length) {
+ uiHash.value = this.values(index);
+ uiHash.values = this.values();
+ }
+ return this._trigger("start", event, uiHash);
+ },
+
+ _slide: function (event, index, newVal) {
+ var otherVal,
+ newValues,
+ allowed;
+
+ if (this.options.values && this.options.values.length) {
+ otherVal = this.values(index ? 0 : 1);
+
+ if (( this.options.values.length === 2 && this.options.range === true ) &&
+ ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) )
+ ) {
+ newVal = otherVal;
+ }
+
+ if (newVal !== this.values(index)) {
+ newValues = this.values();
+ newValues[index] = newVal;
+ // A slide can be canceled by returning false from the slide callback
+ allowed = this._trigger("slide", event, {
+ handle: this.handles[index],
+ value: newVal,
+ values: newValues
+ });
+ otherVal = this.values(index ? 0 : 1);
+ if (allowed !== false) {
+ this.values(index, newVal);
+ }
+ }
+ } else {
+ if (newVal !== this.value()) {
+ // A slide can be canceled by returning false from the slide callback
+ allowed = this._trigger("slide", event, {
+ handle: this.handles[index],
+ value: newVal
+ });
+ if (allowed !== false) {
+ this.value(newVal);
+ }
+ }
+ }
+ },
+
+ _stop: function (event, index) {
+ var uiHash = {
+ handle: this.handles[index],
+ value: this.value()
+ };
+ if (this.options.values && this.options.values.length) {
+ uiHash.value = this.values(index);
+ uiHash.values = this.values();
+ }
+
+ this._trigger("stop", event, uiHash);
+ },
+
+ _change: function (event, index) {
+ if (!this._keySliding && !this._mouseSliding) {
+ var uiHash = {
+ handle: this.handles[index],
+ value: this.value()
+ };
+ if (this.options.values && this.options.values.length) {
+ uiHash.value = this.values(index);
+ uiHash.values = this.values();
+ }
+
+ //store the last changed value index for reference when handles overlap
+ this._lastChangedValue = index;
+
+ this._trigger("change", event, uiHash);
+ }
+ },
+
+ value: function (newValue) {
+ if (arguments.length) {
+ this.options.value = this._trimAlignValue(newValue);
+ this._refreshValue();
+ this._change(null, 0);
+ return;
+ }
+
+ return this._value();
+ },
+
+ values: function (index, newValue) {
+ var vals,
+ newValues,
+ i;
+
+ if (arguments.length > 1) {
+ this.options.values[index] = this._trimAlignValue(newValue);
+ this._refreshValue();
+ this._change(null, index);
+ return;
+ }
+
+ if (arguments.length) {
+ if ($.isArray(arguments[0])) {
+ vals = this.options.values;
+ newValues = arguments[0];
+ for (i = 0; i < vals.length; i += 1) {
+ vals[i] = this._trimAlignValue(newValues[i]);
+ this._change(null, i);
+ }
+ this._refreshValue();
+ } else {
+ if (this.options.values && this.options.values.length) {
+ return this._values(index);
+ } else {
+ return this.value();
+ }
+ }
+ } else {
+ return this._values();
+ }
+ },
+
+ _setOption: function (key, value) {
+ var i,
+ valsLength = 0;
+
+ if (key === "range" && this.options.range === true) {
+ if (value === "min") {
+ this.options.value = this._values(0);
+ this.options.values = null;
+ } else if (value === "max") {
+ this.options.value = this._values(this.options.values.length - 1);
+ this.options.values = null;
+ }
+ }
+
+ if ($.isArray(this.options.values)) {
+ valsLength = this.options.values.length;
+ }
+
+ if (key === "disabled") {
+ this.element.toggleClass("ui-state-disabled", !!value);
+ }
+
+ this._super(key, value);
+
+ switch (key) {
+ case "orientation":
+ this._detectOrientation();
+ this.element
+ .removeClass("ui-slider-horizontal ui-slider-vertical")
+ .addClass("ui-slider-" + this.orientation);
+ this._refreshValue();
+
+ // Reset positioning from previous orientation
+ this.handles.css(value === "horizontal" ? "bottom" : "left", "");
+ break;
+ case "value":
+ this._animateOff = true;
+ this._refreshValue();
+ this._change(null, 0);
+ this._animateOff = false;
+ break;
+ case "values":
+ this._animateOff = true;
+ this._refreshValue();
+ for (i = 0; i < valsLength; i += 1) {
+ this._change(null, i);
+ }
+ this._animateOff = false;
+ break;
+ case "step":
+ case "min":
+ case "max":
+ this._animateOff = true;
+ this._calculateNewMax();
+ this._refreshValue();
+ this._animateOff = false;
+ break;
+ case "range":
+ this._animateOff = true;
+ this._refresh();
+ this._animateOff = false;
+ break;
+ }
+ },
+
+ //internal value getter
+ // _value() returns value trimmed by min and max, aligned by step
+ _value: function () {
+ var val = this.options.value;
+ val = this._trimAlignValue(val);
+
+ return val;
+ },
+
+ //internal values getter
+ // _values() returns array of values trimmed by min and max, aligned by step
+ // _values( index ) returns single value trimmed by min and max, aligned by step
+ _values: function (index) {
+ var val,
+ vals,
+ i;
+
+ if (arguments.length) {
+ val = this.options.values[index];
+ val = this._trimAlignValue(val);
+
+ return val;
+ } else if (this.options.values && this.options.values.length) {
+ // .slice() creates a copy of the array
+ // this copy gets trimmed by min and max and then returned
+ vals = this.options.values.slice();
+ for (i = 0; i < vals.length; i += 1) {
+ vals[i] = this._trimAlignValue(vals[i]);
+ }
+
+ return vals;
+ } else {
+ return [];
+ }
+ },
+
+ // returns the step-aligned value that val is closest to, between (inclusive) min and max
+ _trimAlignValue: function (val) {
+ if (val <= this._valueMin()) {
+ return this._valueMin();
+ }
+ if (val >= this._valueMax()) {
+ return this._valueMax();
+ }
+ var step = ( this.options.step > 0 ) ? this.options.step : 1,
+ valModStep = (val - this._valueMin()) % step,
+ alignValue = val - valModStep;
+
+ if (Math.abs(valModStep) * 2 >= step) {
+ alignValue += ( valModStep > 0 ) ? step : ( -step );
+ }
+
+ // Since JavaScript has problems with large floats, round
+ // the final value to 5 digits after the decimal point (see #4124)
+ return parseFloat(alignValue.toFixed(5));
+ },
+
+ _calculateNewMax: function () {
+ var max = this.options.max,
+ min = this._valueMin(),
+ step = this.options.step,
+ aboveMin = Math.floor(( +( max - min ).toFixed(this._precision()) ) / step) * step;
+ max = aboveMin + min;
+ this.max = parseFloat(max.toFixed(this._precision()));
+ },
+
+ _precision: function () {
+ var precision = this._precisionOf(this.options.step);
+ if (this.options.min !== null) {
+ precision = Math.max(precision, this._precisionOf(this.options.min));
+ }
+ return precision;
+ },
+
+ _precisionOf: function (num) {
+ var str = num.toString(),
+ decimal = str.indexOf(".");
+ return decimal === -1 ? 0 : str.length - decimal - 1;
+ },
+
+ _valueMin: function () {
+ return this.options.min;
+ },
+
+ _valueMax: function () {
+ return this.max;
+ },
+
+ _refreshValue: function () {
+ var lastValPercent, valPercent, value, valueMin, valueMax,
+ oRange = this.options.range,
+ o = this.options,
+ that = this,
+ animate = ( !this._animateOff ) ? o.animate : false,
+ _set = {};
+
+ if (this.options.values && this.options.values.length) {
+ this.handles.each(function (i) {
+ valPercent = ( that.values(i) - that._valueMin() ) / ( that._valueMax() - that._valueMin() ) * 100;
+ _set[that.orientation === "horizontal" ? "left" : "bottom"] = valPercent + "%";
+ $(this).stop(1, 1)[animate ? "animate" : "css"](_set, o.animate);
+ if (that.options.range === true) {
+ if (that.orientation === "horizontal") {
+ if (i === 0) {
+ that.range.stop(1, 1)[animate ? "animate" : "css"]({left: valPercent + "%"}, o.animate);
+ }
+ if (i === 1) {
+ that.range[animate ? "animate" : "css"]({width: ( valPercent - lastValPercent ) + "%"}, {
+ queue: false,
+ duration: o.animate
+ });
+ }
+ } else {
+ if (i === 0) {
+ that.range.stop(1, 1)[animate ? "animate" : "css"]({bottom: ( valPercent ) + "%"}, o.animate);
+ }
+ if (i === 1) {
+ that.range[animate ? "animate" : "css"]({height: ( valPercent - lastValPercent ) + "%"}, {
+ queue: false,
+ duration: o.animate
+ });
+ }
+ }
+ }
+ lastValPercent = valPercent;
+ });
+ } else {
+ value = this.value();
+ valueMin = this._valueMin();
+ valueMax = this._valueMax();
+ valPercent = ( valueMax !== valueMin ) ?
+ ( value - valueMin ) / ( valueMax - valueMin ) * 100 :
+ 0;
+ _set[this.orientation === "horizontal" ? "left" : "bottom"] = valPercent + "%";
+ this.handle.stop(1, 1)[animate ? "animate" : "css"](_set, o.animate);
+
+ if (oRange === "min" && this.orientation === "horizontal") {
+ this.range.stop(1, 1)[animate ? "animate" : "css"]({width: valPercent + "%"}, o.animate);
+ }
+ if (oRange === "max" && this.orientation === "horizontal") {
+ this.range[animate ? "animate" : "css"]({width: ( 100 - valPercent ) + "%"}, {
+ queue: false,
+ duration: o.animate
+ });
+ }
+ if (oRange === "min" && this.orientation === "vertical") {
+ this.range.stop(1, 1)[animate ? "animate" : "css"]({height: valPercent + "%"}, o.animate);
+ }
+ if (oRange === "max" && this.orientation === "vertical") {
+ this.range[animate ? "animate" : "css"]({height: ( 100 - valPercent ) + "%"}, {
+ queue: false,
+ duration: o.animate
+ });
+ }
+ }
+ },
+
+ _handleEvents: {
+ keydown: function (event) {
+ var allowed, curVal, newVal, step,
+ index = $(event.target).data("ui-slider-handle-index");
+
+ switch (event.keyCode) {
+ case $.ui.keyCode.HOME:
+ case $.ui.keyCode.END:
+ case $.ui.keyCode.PAGE_UP:
+ case $.ui.keyCode.PAGE_DOWN:
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ event.preventDefault();
+ if (!this._keySliding) {
+ this._keySliding = true;
+ $(event.target).addClass("ui-state-active");
+ allowed = this._start(event, index);
+ if (allowed === false) {
+ return;
+ }
+ }
+ break;
+ }
+
+ step = this.options.step;
+ if (this.options.values && this.options.values.length) {
+ curVal = newVal = this.values(index);
+ } else {
+ curVal = newVal = this.value();
+ }
+
+ switch (event.keyCode) {
+ case $.ui.keyCode.HOME:
+ newVal = this._valueMin();
+ break;
+ case $.ui.keyCode.END:
+ newVal = this._valueMax();
+ break;
+ case $.ui.keyCode.PAGE_UP:
+ newVal = this._trimAlignValue(
+ curVal + ( ( this._valueMax() - this._valueMin() ) / this.numPages )
+ );
+ break;
+ case $.ui.keyCode.PAGE_DOWN:
+ newVal = this._trimAlignValue(
+ curVal - ( (this._valueMax() - this._valueMin()) / this.numPages ));
+ break;
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ if (curVal === this._valueMax()) {
+ return;
+ }
+ newVal = this._trimAlignValue(curVal + step);
+ break;
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ if (curVal === this._valueMin()) {
+ return;
+ }
+ newVal = this._trimAlignValue(curVal - step);
+ break;
+ }
+
+ this._slide(event, index, newVal);
+ },
+ keyup: function (event) {
+ var index = $(event.target).data("ui-slider-handle-index");
+
+ if (this._keySliding) {
+ this._keySliding = false;
+ this._stop(event, index);
+ this._change(event, index);
+ $(event.target).removeClass("ui-state-active");
+ }
+ }
+ }
+ });
+
+
+ /*!
+ * jQuery UI Spinner 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/spinner/
+ */
+
+
+ function spinner_modifier(fn) {
+ return function () {
+ var previous = this.element.val();
+ fn.apply(this, arguments);
+ this._refresh();
+ if (previous !== this.element.val()) {
+ this._trigger("change");
+ }
+ };
+ }
+
+ var spinner = $.widget("ui.spinner", {
+ version: "1.11.4",
+ defaultElement: "<input>",
+ widgetEventPrefix: "spin",
+ options: {
+ culture: null,
+ icons: {
+ down: "ui-icon-triangle-1-s",
+ up: "ui-icon-triangle-1-n"
+ },
+ incremental: true,
+ max: null,
+ min: null,
+ numberFormat: null,
+ page: 10,
+ step: 1,
+
+ change: null,
+ spin: null,
+ start: null,
+ stop: null
+ },
+
+ _create: function () {
+ // handle string values that need to be parsed
+ this._setOption("max", this.options.max);
+ this._setOption("min", this.options.min);
+ this._setOption("step", this.options.step);
+
+ // Only format if there is a value, prevents the field from being marked
+ // as invalid in Firefox, see #9573.
+ if (this.value() !== "") {
+ // Format the value, but don't constrain.
+ this._value(this.element.val(), true);
+ }
+
+ this._draw();
+ this._on(this._events);
+ this._refresh();
+
+ // turning off autocomplete prevents the browser from remembering the
+ // value when navigating through history, so we re-enable autocomplete
+ // if the page is unloaded before the widget is destroyed. #7790
+ this._on(this.window, {
+ beforeunload: function () {
+ this.element.removeAttr("autocomplete");
+ }
+ });
+ },
+
+ _getCreateOptions: function () {
+ var options = {},
+ element = this.element;
+
+ $.each(["min", "max", "step"], function (i, option) {
+ var value = element.attr(option);
+ if (value !== undefined && value.length) {
+ options[option] = value;
+ }
+ });
+
+ return options;
+ },
+
+ _events: {
+ keydown: function (event) {
+ if (this._start(event) && this._keydown(event)) {
+ event.preventDefault();
+ }
+ },
+ keyup: "_stop",
+ focus: function () {
+ this.previous = this.element.val();
+ },
+ blur: function (event) {
+ if (this.cancelBlur) {
+ delete this.cancelBlur;
+ return;
+ }
+
+ this._stop();
+ this._refresh();
+ if (this.previous !== this.element.val()) {
+ this._trigger("change", event);
+ }
+ },
+ mousewheel: function (event, delta) {
+ if (!delta) {
+ return;
+ }
+ if (!this.spinning && !this._start(event)) {
+ return false;
+ }
+
+ this._spin((delta > 0 ? 1 : -1) * this.options.step, event);
+ clearTimeout(this.mousewheelTimer);
+ this.mousewheelTimer = this._delay(function () {
+ if (this.spinning) {
+ this._stop(event);
+ }
+ }, 100);
+ event.preventDefault();
+ },
+ "mousedown .ui-spinner-button": function (event) {
+ var previous;
+
+ // We never want the buttons to have focus; whenever the user is
+ // interacting with the spinner, the focus should be on the input.
+ // If the input is focused then this.previous is properly set from
+ // when the input first received focus. If the input is not focused
+ // then we need to set this.previous based on the value before spinning.
+ previous = this.element[0] === this.document[0].activeElement ?
+ this.previous : this.element.val();
+ function checkFocus() {
+ var isActive = this.element[0] === this.document[0].activeElement;
+ if (!isActive) {
+ this.element.focus();
+ this.previous = previous;
+ // support: IE
+ // IE sets focus asynchronously, so we need to check if focus
+ // moved off of the input because the user clicked on the button.
+ this._delay(function () {
+ this.previous = previous;
+ });
+ }
+ }
+
+ // ensure focus is on (or stays on) the text field
+ event.preventDefault();
+ checkFocus.call(this);
+
+ // support: IE
+ // IE doesn't prevent moving focus even with event.preventDefault()
+ // so we set a flag to know when we should ignore the blur event
+ // and check (again) if focus moved off of the input.
+ this.cancelBlur = true;
+ this._delay(function () {
+ delete this.cancelBlur;
+ checkFocus.call(this);
+ });
+
+ if (this._start(event) === false) {
+ return;
+ }
+
+ this._repeat(null, $(event.currentTarget).hasClass("ui-spinner-up") ? 1 : -1, event);
+ },
+ "mouseup .ui-spinner-button": "_stop",
+ "mouseenter .ui-spinner-button": function (event) {
+ // button will add ui-state-active if mouse was down while mouseleave and kept down
+ if (!$(event.currentTarget).hasClass("ui-state-active")) {
+ return;
+ }
+
+ if (this._start(event) === false) {
+ return false;
+ }
+ this._repeat(null, $(event.currentTarget).hasClass("ui-spinner-up") ? 1 : -1, event);
+ },
+ // TODO: do we really want to consider this a stop?
+ // shouldn't we just stop the repeater and wait until mouseup before
+ // we trigger the stop event?
+ "mouseleave .ui-spinner-button": "_stop"
+ },
+
+ _draw: function () {
+ var uiSpinner = this.uiSpinner = this.element
+ .addClass("ui-spinner-input")
+ .attr("autocomplete", "off")
+ .wrap(this._uiSpinnerHtml())
+ .parent()
+ // add buttons
+ .append(this._buttonHtml());
+
+ this.element.attr("role", "spinbutton");
+
+ // button bindings
+ this.buttons = uiSpinner.find(".ui-spinner-button")
+ .attr("tabIndex", -1)
+ .button()
+ .removeClass("ui-corner-all");
+
+ // IE 6 doesn't understand height: 50% for the buttons
+ // unless the wrapper has an explicit height
+ if (this.buttons.height() > Math.ceil(uiSpinner.height() * 0.5) &&
+ uiSpinner.height() > 0) {
+ uiSpinner.height(uiSpinner.height());
+ }
+
+ // disable spinner if element was already disabled
+ if (this.options.disabled) {
+ this.disable();
+ }
+ },
+
+ _keydown: function (event) {
+ var options = this.options,
+ keyCode = $.ui.keyCode;
+
+ switch (event.keyCode) {
+ case keyCode.UP:
+ this._repeat(null, 1, event);
+ return true;
+ case keyCode.DOWN:
+ this._repeat(null, -1, event);
+ return true;
+ case keyCode.PAGE_UP:
+ this._repeat(null, options.page, event);
+ return true;
+ case keyCode.PAGE_DOWN:
+ this._repeat(null, -options.page, event);
+ return true;
+ }
+
+ return false;
+ },
+
+ _uiSpinnerHtml: function () {
+ return "<span class='ui-spinner ui-widget ui-widget-content ui-corner-all'></span>";
+ },
+
+ _buttonHtml: function () {
+ return "" +
+ "<a class='ui-spinner-button ui-spinner-up ui-corner-tr'>" +
+ "<span class='ui-icon " + this.options.icons.up + "'>▲</span>" +
+ "</a>" +
+ "<a class='ui-spinner-button ui-spinner-down ui-corner-br'>" +
+ "<span class='ui-icon " + this.options.icons.down + "'>▼</span>" +
+ "</a>";
+ },
+
+ _start: function (event) {
+ if (!this.spinning && this._trigger("start", event) === false) {
+ return false;
+ }
+
+ if (!this.counter) {
+ this.counter = 1;
+ }
+ this.spinning = true;
+ return true;
+ },
+
+ _repeat: function (i, steps, event) {
+ i = i || 500;
+
+ clearTimeout(this.timer);
+ this.timer = this._delay(function () {
+ this._repeat(40, steps, event);
+ }, i);
+
+ this._spin(steps * this.options.step, event);
+ },
+
+ _spin: function (step, event) {
+ var value = this.value() || 0;
+
+ if (!this.counter) {
+ this.counter = 1;
+ }
+
+ value = this._adjustValue(value + step * this._increment(this.counter));
+
+ if (!this.spinning || this._trigger("spin", event, {value: value}) !== false) {
+ this._value(value);
+ this.counter++;
+ }
+ },
+
+ _increment: function (i) {
+ var incremental = this.options.incremental;
+
+ if (incremental) {
+ return $.isFunction(incremental) ?
+ incremental(i) :
+ Math.floor(i * i * i / 50000 - i * i / 500 + 17 * i / 200 + 1);
+ }
+
+ return 1;
+ },
+
+ _precision: function () {
+ var precision = this._precisionOf(this.options.step);
+ if (this.options.min !== null) {
+ precision = Math.max(precision, this._precisionOf(this.options.min));
+ }
+ return precision;
+ },
+
+ _precisionOf: function (num) {
+ var str = num.toString(),
+ decimal = str.indexOf(".");
+ return decimal === -1 ? 0 : str.length - decimal - 1;
+ },
+
+ _adjustValue: function (value) {
+ var base, aboveMin,
+ options = this.options;
+
+ // make sure we're at a valid step
+ // - find out where we are relative to the base (min or 0)
+ base = options.min !== null ? options.min : 0;
+ aboveMin = value - base;
+ // - round to the nearest step
+ aboveMin = Math.round(aboveMin / options.step) * options.step;
+ // - rounding is based on 0, so adjust back to our base
+ value = base + aboveMin;
+
+ // fix precision from bad JS floating point math
+ value = parseFloat(value.toFixed(this._precision()));
+
+ // clamp the value
+ if (options.max !== null && value > options.max) {
+ return options.max;
+ }
+ if (options.min !== null && value < options.min) {
+ return options.min;
+ }
+
+ return value;
+ },
+
+ _stop: function (event) {
+ if (!this.spinning) {
+ return;
+ }
+
+ clearTimeout(this.timer);
+ clearTimeout(this.mousewheelTimer);
+ this.counter = 0;
+ this.spinning = false;
+ this._trigger("stop", event);
+ },
+
+ _setOption: function (key, value) {
+ if (key === "culture" || key === "numberFormat") {
+ var prevValue = this._parse(this.element.val());
+ this.options[key] = value;
+ this.element.val(this._format(prevValue));
+ return;
+ }
+
+ if (key === "max" || key === "min" || key === "step") {
+ if (typeof value === "string") {
+ value = this._parse(value);
+ }
+ }
+ if (key === "icons") {
+ this.buttons.first().find(".ui-icon")
+ .removeClass(this.options.icons.up)
+ .addClass(value.up);
+ this.buttons.last().find(".ui-icon")
+ .removeClass(this.options.icons.down)
+ .addClass(value.down);
+ }
+
+ this._super(key, value);
+
+ if (key === "disabled") {
+ this.widget().toggleClass("ui-state-disabled", !!value);
+ this.element.prop("disabled", !!value);
+ this.buttons.button(value ? "disable" : "enable");
+ }
+ },
+
+ _setOptions: spinner_modifier(function (options) {
+ this._super(options);
+ }),
+
+ _parse: function (val) {
+ if (typeof val === "string" && val !== "") {
+ val = window.Globalize && this.options.numberFormat ?
+ Globalize.parseFloat(val, 10, this.options.culture) : +val;
+ }
+ return val === "" || isNaN(val) ? null : val;
+ },
+
+ _format: function (value) {
+ if (value === "") {
+ return "";
+ }
+ return window.Globalize && this.options.numberFormat ?
+ Globalize.format(value, this.options.numberFormat, this.options.culture) :
+ value;
+ },
+
+ _refresh: function () {
+ this.element.attr({
+ "aria-valuemin": this.options.min,
+ "aria-valuemax": this.options.max,
+ // TODO: what should we do with values that can't be parsed?
+ "aria-valuenow": this._parse(this.element.val())
+ });
+ },
+
+ isValid: function () {
+ var value = this.value();
+
+ // null is invalid
+ if (value === null) {
+ return false;
+ }
+
+ // if value gets adjusted, it's invalid
+ return value === this._adjustValue(value);
+ },
+
+ // update the value without triggering change
+ _value: function (value, allowAny) {
+ var parsed;
+ if (value !== "") {
+ parsed = this._parse(value);
+ if (parsed !== null) {
+ if (!allowAny) {
+ parsed = this._adjustValue(parsed);
+ }
+ value = this._format(parsed);
+ }
+ }
+ this.element.val(value);
+ this._refresh();
+ },
+
+ _destroy: function () {
+ this.element
+ .removeClass("ui-spinner-input")
+ .prop("disabled", false)
+ .removeAttr("autocomplete")
+ .removeAttr("role")
+ .removeAttr("aria-valuemin")
+ .removeAttr("aria-valuemax")
+ .removeAttr("aria-valuenow");
+ this.uiSpinner.replaceWith(this.element);
+ },
+
+ stepUp: spinner_modifier(function (steps) {
+ this._stepUp(steps);
+ }),
+ _stepUp: function (steps) {
+ if (this._start()) {
+ this._spin((steps || 1) * this.options.step);
+ this._stop();
+ }
+ },
+
+ stepDown: spinner_modifier(function (steps) {
+ this._stepDown(steps);
+ }),
+ _stepDown: function (steps) {
+ if (this._start()) {
+ this._spin((steps || 1) * -this.options.step);
+ this._stop();
+ }
+ },
+
+ pageUp: spinner_modifier(function (pages) {
+ this._stepUp((pages || 1) * this.options.page);
+ }),
+
+ pageDown: spinner_modifier(function (pages) {
+ this._stepDown((pages || 1) * this.options.page);
+ }),
+
+ value: function (newVal) {
+ if (!arguments.length) {
+ return this._parse(this.element.val());
+ }
+ spinner_modifier(this._value).call(this, newVal);
+ },
+
+ widget: function () {
+ return this.uiSpinner;
+ }
+ });
+
+
+ /*!
+ * jQuery UI Tabs 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/tabs/
+ */
+
+
+ var tabs = $.widget("ui.tabs", {
+ version: "1.11.4",
+ delay: 300,
+ options: {
+ active: null,
+ collapsible: false,
+ event: "click",
+ heightStyle: "content",
+ hide: null,
+ show: null,
+
+ // callbacks
+ activate: null,
+ beforeActivate: null,
+ beforeLoad: null,
+ load: null
+ },
+
+ _isLocal: (function () {
+ var rhash = /#.*$/;
+
+ return function (anchor) {
+ var anchorUrl, locationUrl;
+
+ // support: IE7
+ // IE7 doesn't normalize the href property when set via script (#9317)
+ anchor = anchor.cloneNode(false);
+
+ anchorUrl = anchor.href.replace(rhash, "");
+ locationUrl = location.href.replace(rhash, "");
+
+ // decoding may throw an error if the URL isn't UTF-8 (#9518)
+ try {
+ anchorUrl = decodeURIComponent(anchorUrl);
+ } catch (error) {
+ }
+ try {
+ locationUrl = decodeURIComponent(locationUrl);
+ } catch (error) {
+ }
+
+ return anchor.hash.length > 1 && anchorUrl === locationUrl;
+ };
+ })(),
+
+ _create: function () {
+ var that = this,
+ options = this.options;
+
+ this.running = false;
+
+ this.element
+ .addClass("ui-tabs ui-widget ui-widget-content ui-corner-all")
+ .toggleClass("ui-tabs-collapsible", options.collapsible);
+
+ this._processTabs();
+ options.active = this._initialActive();
+
+ // Take disabling tabs via class attribute from HTML
+ // into account and update option properly.
+ if ($.isArray(options.disabled)) {
+ options.disabled = $.unique(options.disabled.concat(
+ $.map(this.tabs.filter(".ui-state-disabled"), function (li) {
+ return that.tabs.index(li);
+ })
+ )).sort();
+ }
+
+ // check for length avoids error when initializing empty list
+ if (this.options.active !== false && this.anchors.length) {
+ this.active = this._findActive(options.active);
+ } else {
+ this.active = $();
+ }
+
+ this._refresh();
+
+ if (this.active.length) {
+ this.load(options.active);
+ }
+ },
+
+ _initialActive: function () {
+ var active = this.options.active,
+ collapsible = this.options.collapsible,
+ locationHash = location.hash.substring(1);
+
+ if (active === null) {
+ // check the fragment identifier in the URL
+ if (locationHash) {
+ this.tabs.each(function (i, tab) {
+ if ($(tab).attr("aria-controls") === locationHash) {
+ active = i;
+ return false;
+ }
+ });
+ }
+
+ // check for a tab marked active via a class
+ if (active === null) {
+ active = this.tabs.index(this.tabs.filter(".ui-tabs-active"));
+ }
+
+ // no active tab, set to false
+ if (active === null || active === -1) {
+ active = this.tabs.length ? 0 : false;
+ }
+ }
+
+ // handle numbers: negative, out of range
+ if (active !== false) {
+ active = this.tabs.index(this.tabs.eq(active));
+ if (active === -1) {
+ active = collapsible ? false : 0;
+ }
+ }
+
+ // don't allow collapsible: false and active: false
+ if (!collapsible && active === false && this.anchors.length) {
+ active = 0;
+ }
+
+ return active;
+ },
+
+ _getCreateEventData: function () {
+ return {
+ tab: this.active,
+ panel: !this.active.length ? $() : this._getPanelForTab(this.active)
+ };
+ },
+
+ _tabKeydown: function (event) {
+ var focusedTab = $(this.document[0].activeElement).closest("li"),
+ selectedIndex = this.tabs.index(focusedTab),
+ goingForward = true;
+
+ if (this._handlePageNav(event)) {
+ return;
+ }
+
+ switch (event.keyCode) {
+ case $.ui.keyCode.RIGHT:
+ case $.ui.keyCode.DOWN:
+ selectedIndex++;
+ break;
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.LEFT:
+ goingForward = false;
+ selectedIndex--;
+ break;
+ case $.ui.keyCode.END:
+ selectedIndex = this.anchors.length - 1;
+ break;
+ case $.ui.keyCode.HOME:
+ selectedIndex = 0;
+ break;
+ case $.ui.keyCode.SPACE:
+ // Activate only, no collapsing
+ event.preventDefault();
+ clearTimeout(this.activating);
+ this._activate(selectedIndex);
+ return;
+ case $.ui.keyCode.ENTER:
+ // Toggle (cancel delayed activation, allow collapsing)
+ event.preventDefault();
+ clearTimeout(this.activating);
+ // Determine if we should collapse or activate
+ this._activate(selectedIndex === this.options.active ? false : selectedIndex);
+ return;
+ default:
+ return;
+ }
+
+ // Focus the appropriate tab, based on which key was pressed
+ event.preventDefault();
+ clearTimeout(this.activating);
+ selectedIndex = this._focusNextTab(selectedIndex, goingForward);
+
+ // Navigating with control/command key will prevent automatic activation
+ if (!event.ctrlKey && !event.metaKey) {
+
+ // Update aria-selected immediately so that AT think the tab is already selected.
+ // Otherwise AT may confuse the user by stating that they need to activate the tab,
+ // but the tab will already be activated by the time the announcement finishes.
+ focusedTab.attr("aria-selected", "false");
+ this.tabs.eq(selectedIndex).attr("aria-selected", "true");
+
+ this.activating = this._delay(function () {
+ this.option("active", selectedIndex);
+ }, this.delay);
+ }
+ },
+
+ _panelKeydown: function (event) {
+ if (this._handlePageNav(event)) {
+ return;
+ }
+
+ // Ctrl+up moves focus to the current tab
+ if (event.ctrlKey && event.keyCode === $.ui.keyCode.UP) {
+ event.preventDefault();
+ this.active.focus();
+ }
+ },
+
+ // Alt+page up/down moves focus to the previous/next tab (and activates)
+ _handlePageNav: function (event) {
+ if (event.altKey && event.keyCode === $.ui.keyCode.PAGE_UP) {
+ this._activate(this._focusNextTab(this.options.active - 1, false));
+ return true;
+ }
+ if (event.altKey && event.keyCode === $.ui.keyCode.PAGE_DOWN) {
+ this._activate(this._focusNextTab(this.options.active + 1, true));
+ return true;
+ }
+ },
+
+ _findNextTab: function (index, goingForward) {
+ var lastTabIndex = this.tabs.length - 1;
+
+ function constrain() {
+ if (index > lastTabIndex) {
+ index = 0;
+ }
+ if (index < 0) {
+ index = lastTabIndex;
+ }
+ return index;
+ }
+
+ while ($.inArray(constrain(), this.options.disabled) !== -1) {
+ index = goingForward ? index + 1 : index - 1;
+ }
+
+ return index;
+ },
+
+ _focusNextTab: function (index, goingForward) {
+ index = this._findNextTab(index, goingForward);
+ this.tabs.eq(index).focus();
+ return index;
+ },
+
+ _setOption: function (key, value) {
+ if (key === "active") {
+ // _activate() will handle invalid values and update this.options
+ this._activate(value);
+ return;
+ }
+
+ if (key === "disabled") {
+ // don't use the widget factory's disabled handling
+ this._setupDisabled(value);
+ return;
+ }
+
+ this._super(key, value);
+
+ if (key === "collapsible") {
+ this.element.toggleClass("ui-tabs-collapsible", value);
+ // Setting collapsible: false while collapsed; open first panel
+ if (!value && this.options.active === false) {
+ this._activate(0);
+ }
+ }
+
+ if (key === "event") {
+ this._setupEvents(value);
+ }
+
+ if (key === "heightStyle") {
+ this._setupHeightStyle(value);
+ }
+ },
+
+ _sanitizeSelector: function (hash) {
+ return hash ? hash.replace(/[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, "\\$&") : "";
+ },
+
+ refresh: function () {
+ var options = this.options,
+ lis = this.tablist.children(":has(a[href])");
+
+ // get disabled tabs from class attribute from HTML
+ // this will get converted to a boolean if needed in _refresh()
+ options.disabled = $.map(lis.filter(".ui-state-disabled"), function (tab) {
+ return lis.index(tab);
+ });
+
+ this._processTabs();
+
+ // was collapsed or no tabs
+ if (options.active === false || !this.anchors.length) {
+ options.active = false;
+ this.active = $();
+ // was active, but active tab is gone
+ } else if (this.active.length && !$.contains(this.tablist[0], this.active[0])) {
+ // all remaining tabs are disabled
+ if (this.tabs.length === options.disabled.length) {
+ options.active = false;
+ this.active = $();
+ // activate previous tab
+ } else {
+ this._activate(this._findNextTab(Math.max(0, options.active - 1), false));
+ }
+ // was active, active tab still exists
+ } else {
+ // make sure active index is correct
+ options.active = this.tabs.index(this.active);
+ }
+
+ this._refresh();
+ },
+
+ _refresh: function () {
+ this._setupDisabled(this.options.disabled);
+ this._setupEvents(this.options.event);
+ this._setupHeightStyle(this.options.heightStyle);
+
+ this.tabs.not(this.active).attr({
+ "aria-selected": "false",
+ "aria-expanded": "false",
+ tabIndex: -1
+ });
+ this.panels.not(this._getPanelForTab(this.active))
+ .hide()
+ .attr({
+ "aria-hidden": "true"
+ });
+
+ // Make sure one tab is in the tab order
+ if (!this.active.length) {
+ this.tabs.eq(0).attr("tabIndex", 0);
+ } else {
+ this.active
+ .addClass("ui-tabs-active ui-state-active")
+ .attr({
+ "aria-selected": "true",
+ "aria-expanded": "true",
+ tabIndex: 0
+ });
+ this._getPanelForTab(this.active)
+ .show()
+ .attr({
+ "aria-hidden": "false"
+ });
+ }
+ },
+
+ _processTabs: function () {
+ var that = this,
+ prevTabs = this.tabs,
+ prevAnchors = this.anchors,
+ prevPanels = this.panels;
+
+ this.tablist = this._getList()
+ .addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all")
+ .attr("role", "tablist")
+
+ // Prevent users from focusing disabled tabs via click
+ .delegate("> li", "mousedown" + this.eventNamespace, function (event) {
+ if ($(this).is(".ui-state-disabled")) {
+ event.preventDefault();
+ }
+ })
+
+ // support: IE <9
+ // Preventing the default action in mousedown doesn't prevent IE
+ // from focusing the element, so if the anchor gets focused, blur.
+ // We don't have to worry about focusing the previously focused
+ // element since clicking on a non-focusable element should focus
+ // the body anyway.
+ .delegate(".ui-tabs-anchor", "focus" + this.eventNamespace, function () {
+ if ($(this).closest("li").is(".ui-state-disabled")) {
+ this.blur();
+ }
+ });
+
+ this.tabs = this.tablist.find("> li:has(a[href])")
+ .addClass("ui-state-default ui-corner-top")
+ .attr({
+ role: "tab",
+ tabIndex: -1
+ });
+
+ this.anchors = this.tabs.map(function () {
+ return $("a", this)[0];
+ })
+ .addClass("ui-tabs-anchor")
+ .attr({
+ role: "presentation",
+ tabIndex: -1
+ });
+
+ this.panels = $();
+
+ this.anchors.each(function (i, anchor) {
+ var selector, panel, panelId,
+ anchorId = $(anchor).uniqueId().attr("id"),
+ tab = $(anchor).closest("li"),
+ originalAriaControls = tab.attr("aria-controls");
+
+ // inline tab
+ if (that._isLocal(anchor)) {
+ selector = anchor.hash;
+ panelId = selector.substring(1);
+ panel = that.element.find(that._sanitizeSelector(selector));
+ // remote tab
+ } else {
+ // If the tab doesn't already have aria-controls,
+ // generate an id by using a throw-away element
+ panelId = tab.attr("aria-controls") || $({}).uniqueId()[0].id;
+ selector = "#" + panelId;
+ panel = that.element.find(selector);
+ if (!panel.length) {
+ panel = that._createPanel(panelId);
+ panel.insertAfter(that.panels[i - 1] || that.tablist);
+ }
+ panel.attr("aria-live", "polite");
+ }
+
+ if (panel.length) {
+ that.panels = that.panels.add(panel);
+ }
+ if (originalAriaControls) {
+ tab.data("ui-tabs-aria-controls", originalAriaControls);
+ }
+ tab.attr({
+ "aria-controls": panelId,
+ "aria-labelledby": anchorId
+ });
+ panel.attr("aria-labelledby", anchorId);
+ });
+
+ this.panels
+ .addClass("ui-tabs-panel ui-widget-content ui-corner-bottom")
+ .attr("role", "tabpanel");
+
+ // Avoid memory leaks (#10056)
+ if (prevTabs) {
+ this._off(prevTabs.not(this.tabs));
+ this._off(prevAnchors.not(this.anchors));
+ this._off(prevPanels.not(this.panels));
+ }
+ },
+
+ // allow overriding how to find the list for rare usage scenarios (#7715)
+ _getList: function () {
+ return this.tablist || this.element.find("ol,ul").eq(0);
+ },
+
+ _createPanel: function (id) {
+ return $("<div>")
+ .attr("id", id)
+ .addClass("ui-tabs-panel ui-widget-content ui-corner-bottom")
+ .data("ui-tabs-destroy", true);
+ },
+
+ _setupDisabled: function (disabled) {
+ if ($.isArray(disabled)) {
+ if (!disabled.length) {
+ disabled = false;
+ } else if (disabled.length === this.anchors.length) {
+ disabled = true;
+ }
+ }
+
+ // disable tabs
+ for (var i = 0, li; ( li = this.tabs[i] ); i++) {
+ if (disabled === true || $.inArray(i, disabled) !== -1) {
+ $(li)
+ .addClass("ui-state-disabled")
+ .attr("aria-disabled", "true");
+ } else {
+ $(li)
+ .removeClass("ui-state-disabled")
+ .removeAttr("aria-disabled");
+ }
+ }
+
+ this.options.disabled = disabled;
+ },
+
+ _setupEvents: function (event) {
+ var events = {};
+ if (event) {
+ $.each(event.split(" "), function (index, eventName) {
+ events[eventName] = "_eventHandler";
+ });
+ }
+
+ this._off(this.anchors.add(this.tabs).add(this.panels));
+ // Always prevent the default action, even when disabled
+ this._on(true, this.anchors, {
+ click: function (event) {
+ event.preventDefault();
+ }
+ });
+ this._on(this.anchors, events);
+ this._on(this.tabs, {keydown: "_tabKeydown"});
+ this._on(this.panels, {keydown: "_panelKeydown"});
+
+ this._focusable(this.tabs);
+ this._hoverable(this.tabs);
+ },
+
+ _setupHeightStyle: function (heightStyle) {
+ var maxHeight,
+ parent = this.element.parent();
+
+ if (heightStyle === "fill") {
+ maxHeight = parent.height();
+ maxHeight -= this.element.outerHeight() - this.element.height();
+
+ this.element.siblings(":visible").each(function () {
+ var elem = $(this),
+ position = elem.css("position");
+
+ if (position === "absolute" || position === "fixed") {
+ return;
+ }
+ maxHeight -= elem.outerHeight(true);
+ });
+
+ this.element.children().not(this.panels).each(function () {
+ maxHeight -= $(this).outerHeight(true);
+ });
+
+ this.panels.each(function () {
+ $(this).height(Math.max(0, maxHeight -
+ $(this).innerHeight() + $(this).height()));
+ })
+ .css("overflow", "auto");
+ } else if (heightStyle === "auto") {
+ maxHeight = 0;
+ this.panels.each(function () {
+ maxHeight = Math.max(maxHeight, $(this).height("").height());
+ }).height(maxHeight);
+ }
+ },
+
+ _eventHandler: function (event) {
+ var options = this.options,
+ active = this.active,
+ anchor = $(event.currentTarget),
+ tab = anchor.closest("li"),
+ clickedIsActive = tab[0] === active[0],
+ collapsing = clickedIsActive && options.collapsible,
+ toShow = collapsing ? $() : this._getPanelForTab(tab),
+ toHide = !active.length ? $() : this._getPanelForTab(active),
+ eventData = {
+ oldTab: active,
+ oldPanel: toHide,
+ newTab: collapsing ? $() : tab,
+ newPanel: toShow
+ };
+
+ event.preventDefault();
+
+ if (tab.hasClass("ui-state-disabled") ||
+ // tab is already loading
+ tab.hasClass("ui-tabs-loading") ||
+ // can't switch durning an animation
+ this.running ||
+ // click on active header, but not collapsible
+ ( clickedIsActive && !options.collapsible ) ||
+ // allow canceling activation
+ ( this._trigger("beforeActivate", event, eventData) === false )) {
+ return;
+ }
+
+ options.active = collapsing ? false : this.tabs.index(tab);
+
+ this.active = clickedIsActive ? $() : tab;
+ if (this.xhr) {
+ this.xhr.abort();
+ }
+
+ if (!toHide.length && !toShow.length) {
+ $.error("jQuery UI Tabs: Mismatching fragment identifier.");
+ }
+
+ if (toShow.length) {
+ this.load(this.tabs.index(tab), event);
+ }
+ this._toggle(event, eventData);
+ },
+
+ // handles show/hide for selecting tabs
+ _toggle: function (event, eventData) {
+ var that = this,
+ toShow = eventData.newPanel,
+ toHide = eventData.oldPanel;
+
+ this.running = true;
+
+ function complete() {
+ that.running = false;
+ that._trigger("activate", event, eventData);
+ }
+
+ function show() {
+ eventData.newTab.closest("li").addClass("ui-tabs-active ui-state-active");
+
+ if (toShow.length && that.options.show) {
+ that._show(toShow, that.options.show, complete);
+ } else {
+ toShow.show();
+ complete();
+ }
+ }
+
+ // start out by hiding, then showing, then completing
+ if (toHide.length && this.options.hide) {
+ this._hide(toHide, this.options.hide, function () {
+ eventData.oldTab.closest("li").removeClass("ui-tabs-active ui-state-active");
+ show();
+ });
+ } else {
+ eventData.oldTab.closest("li").removeClass("ui-tabs-active ui-state-active");
+ toHide.hide();
+ show();
+ }
+
+ toHide.attr("aria-hidden", "true");
+ eventData.oldTab.attr({
+ "aria-selected": "false",
+ "aria-expanded": "false"
+ });
+ // If we're switching tabs, remove the old tab from the tab order.
+ // If we're opening from collapsed state, remove the previous tab from the tab order.
+ // If we're collapsing, then keep the collapsing tab in the tab order.
+ if (toShow.length && toHide.length) {
+ eventData.oldTab.attr("tabIndex", -1);
+ } else if (toShow.length) {
+ this.tabs.filter(function () {
+ return $(this).attr("tabIndex") === 0;
+ })
+ .attr("tabIndex", -1);
+ }
+
+ toShow.attr("aria-hidden", "false");
+ eventData.newTab.attr({
+ "aria-selected": "true",
+ "aria-expanded": "true",
+ tabIndex: 0
+ });
+ },
+
+ _activate: function (index) {
+ var anchor,
+ active = this._findActive(index);
+
+ // trying to activate the already active panel
+ if (active[0] === this.active[0]) {
+ return;
+ }
+
+ // trying to collapse, simulate a click on the current active header
+ if (!active.length) {
+ active = this.active;
+ }
+
+ anchor = active.find(".ui-tabs-anchor")[0];
+ this._eventHandler({
+ target: anchor,
+ currentTarget: anchor,
+ preventDefault: $.noop
+ });
+ },
+
+ _findActive: function (index) {
+ return index === false ? $() : this.tabs.eq(index);
+ },
+
+ _getIndex: function (index) {
+ // meta-function to give users option to provide a href string instead of a numerical index.
+ if (typeof index === "string") {
+ index = this.anchors.index(this.anchors.filter("[href$='" + index + "']"));
+ }
+
+ return index;
+ },
+
+ _destroy: function () {
+ if (this.xhr) {
+ this.xhr.abort();
+ }
+
+ this.element.removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible");
+
+ this.tablist
+ .removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all")
+ .removeAttr("role");
+
+ this.anchors
+ .removeClass("ui-tabs-anchor")
+ .removeAttr("role")
+ .removeAttr("tabIndex")
+ .removeUniqueId();
+
+ this.tablist.unbind(this.eventNamespace);
+
+ this.tabs.add(this.panels).each(function () {
+ if ($.data(this, "ui-tabs-destroy")) {
+ $(this).remove();
+ } else {
+ $(this)
+ .removeClass("ui-state-default ui-state-active ui-state-disabled " +
+ "ui-corner-top ui-corner-bottom ui-widget-content ui-tabs-active ui-tabs-panel")
+ .removeAttr("tabIndex")
+ .removeAttr("aria-live")
+ .removeAttr("aria-busy")
+ .removeAttr("aria-selected")
+ .removeAttr("aria-labelledby")
+ .removeAttr("aria-hidden")
+ .removeAttr("aria-expanded")
+ .removeAttr("role");
+ }
+ });
+
+ this.tabs.each(function () {
+ var li = $(this),
+ prev = li.data("ui-tabs-aria-controls");
+ if (prev) {
+ li
+ .attr("aria-controls", prev)
+ .removeData("ui-tabs-aria-controls");
+ } else {
+ li.removeAttr("aria-controls");
+ }
+ });
+
+ this.panels.show();
+
+ if (this.options.heightStyle !== "content") {
+ this.panels.css("height", "");
+ }
+ },
+
+ enable: function (index) {
+ var disabled = this.options.disabled;
+ if (disabled === false) {
+ return;
+ }
+
+ if (index === undefined) {
+ disabled = false;
+ } else {
+ index = this._getIndex(index);
+ if ($.isArray(disabled)) {
+ disabled = $.map(disabled, function (num) {
+ return num !== index ? num : null;
+ });
+ } else {
+ disabled = $.map(this.tabs, function (li, num) {
+ return num !== index ? num : null;
+ });
+ }
+ }
+ this._setupDisabled(disabled);
+ },
+
+ disable: function (index) {
+ var disabled = this.options.disabled;
+ if (disabled === true) {
+ return;
+ }
+
+ if (index === undefined) {
+ disabled = true;
+ } else {
+ index = this._getIndex(index);
+ if ($.inArray(index, disabled) !== -1) {
+ return;
+ }
+ if ($.isArray(disabled)) {
+ disabled = $.merge([index], disabled).sort();
+ } else {
+ disabled = [index];
+ }
+ }
+ this._setupDisabled(disabled);
+ },
+
+ load: function (index, event) {
+ index = this._getIndex(index);
+ var that = this,
+ tab = this.tabs.eq(index),
+ anchor = tab.find(".ui-tabs-anchor"),
+ panel = this._getPanelForTab(tab),
+ eventData = {
+ tab: tab,
+ panel: panel
+ },
+ complete = function (jqXHR, status) {
+ if (status === "abort") {
+ that.panels.stop(false, true);
+ }
+
+ tab.removeClass("ui-tabs-loading");
+ panel.removeAttr("aria-busy");
+
+ if (jqXHR === that.xhr) {
+ delete that.xhr;
+ }
+ };
+
+ // not remote
+ if (this._isLocal(anchor[0])) {
+ return;
+ }
+
+ this.xhr = $.ajax(this._ajaxSettings(anchor, event, eventData));
+
+ // support: jQuery <1.8
+ // jQuery <1.8 returns false if the request is canceled in beforeSend,
+ // but as of 1.8, $.ajax() always returns a jqXHR object.
+ if (this.xhr && this.xhr.statusText !== "canceled") {
+ tab.addClass("ui-tabs-loading");
+ panel.attr("aria-busy", "true");
+
+ this.xhr
+ .done(function (response, status, jqXHR) {
+ // support: jQuery <1.8
+ // http://bugs.jquery.com/ticket/11778
+ setTimeout(function () {
+ panel.html(response);
+ that._trigger("load", event, eventData);
+
+ complete(jqXHR, status);
+ }, 1);
+ })
+ .fail(function (jqXHR, status) {
+ // support: jQuery <1.8
+ // http://bugs.jquery.com/ticket/11778
+ setTimeout(function () {
+ complete(jqXHR, status);
+ }, 1);
+ });
+ }
+ },
+
+ _ajaxSettings: function (anchor, event, eventData) {
+ var that = this;
+ return {
+ url: anchor.attr("href"),
+ beforeSend: function (jqXHR, settings) {
+ return that._trigger("beforeLoad", event,
+ $.extend({jqXHR: jqXHR, ajaxSettings: settings}, eventData));
+ }
+ };
+ },
+
+ _getPanelForTab: function (tab) {
+ var id = $(tab).attr("aria-controls");
+ return this.element.find(this._sanitizeSelector("#" + id));
+ }
+ });
+
+
+ /*!
+ * jQuery UI Tooltip 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/tooltip/
+ */
+
+
+ var tooltip = $.widget("ui.tooltip", {
+ version: "1.11.4",
+ options: {
+ content: function () {
+ // support: IE<9, Opera in jQuery <1.7
+ // .text() can't accept undefined, so coerce to a string
+ var title = $(this).attr("title") || "";
+ // Escape title, since we're going from an attribute to raw HTML
+ return $("<a>").text(title).html();
+ },
+ hide: true,
+ // Disabled elements have inconsistent behavior across browsers (#8661)
+ items: "[title]:not([disabled])",
+ position: {
+ my: "left top+15",
+ at: "left bottom",
+ collision: "flipfit flip"
+ },
+ show: true,
+ tooltipClass: null,
+ track: false,
+
+ // callbacks
+ close: null,
+ open: null
+ },
+
+ _addDescribedBy: function (elem, id) {
+ var describedby = (elem.attr("aria-describedby") || "").split(/\s+/);
+ describedby.push(id);
+ elem
+ .data("ui-tooltip-id", id)
+ .attr("aria-describedby", $.trim(describedby.join(" ")));
+ },
+
+ _removeDescribedBy: function (elem) {
+ var id = elem.data("ui-tooltip-id"),
+ describedby = (elem.attr("aria-describedby") || "").split(/\s+/),
+ index = $.inArray(id, describedby);
+
+ if (index !== -1) {
+ describedby.splice(index, 1);
+ }
+
+ elem.removeData("ui-tooltip-id");
+ describedby = $.trim(describedby.join(" "));
+ if (describedby) {
+ elem.attr("aria-describedby", describedby);
+ } else {
+ elem.removeAttr("aria-describedby");
+ }
+ },
+
+ _create: function () {
+ this._on({
+ mouseover: "open",
+ focusin: "open"
+ });
+
+ // IDs of generated tooltips, needed for destroy
+ this.tooltips = {};
+
+ // IDs of parent tooltips where we removed the title attribute
+ this.parents = {};
+
+ if (this.options.disabled) {
+ this._disable();
+ }
+
+ // Append the aria-live region so tooltips announce correctly
+ this.liveRegion = $("<div>")
+ .attr({
+ role: "log",
+ "aria-live": "assertive",
+ "aria-relevant": "additions"
+ })
+ .addClass("ui-helper-hidden-accessible")
+ .appendTo(this.document[0].body);
+ },
+
+ _setOption: function (key, value) {
+ var that = this;
+
+ if (key === "disabled") {
+ this[value ? "_disable" : "_enable"]();
+ this.options[key] = value;
+ // disable element style changes
+ return;
+ }
+
+ this._super(key, value);
+
+ if (key === "content") {
+ $.each(this.tooltips, function (id, tooltipData) {
+ that._updateContent(tooltipData.element);
+ });
+ }
+ },
+
+ _disable: function () {
+ var that = this;
+
+ // close open tooltips
+ $.each(this.tooltips, function (id, tooltipData) {
+ var event = $.Event("blur");
+ event.target = event.currentTarget = tooltipData.element[0];
+ that.close(event, true);
+ });
+
+ // remove title attributes to prevent native tooltips
+ this.element.find(this.options.items).addBack().each(function () {
+ var element = $(this);
+ if (element.is("[title]")) {
+ element
+ .data("ui-tooltip-title", element.attr("title"))
+ .removeAttr("title");
+ }
+ });
+ },
+
+ _enable: function () {
+ // restore title attributes
+ this.element.find(this.options.items).addBack().each(function () {
+ var element = $(this);
+ if (element.data("ui-tooltip-title")) {
+ element.attr("title", element.data("ui-tooltip-title"));
+ }
+ });
+ },
+
+ open: function (event) {
+ var that = this,
+ target = $(event ? event.target : this.element)
+ // we need closest here due to mouseover bubbling,
+ // but always pointing at the same event target
+ .closest(this.options.items);
+
+ // No element to show a tooltip for or the tooltip is already open
+ if (!target.length || target.data("ui-tooltip-id")) {
+ return;
+ }
+
+ if (target.attr("title")) {
+ target.data("ui-tooltip-title", target.attr("title"));
+ }
+
+ target.data("ui-tooltip-open", true);
+
+ // kill parent tooltips, custom or native, for hover
+ if (event && event.type === "mouseover") {
+ target.parents().each(function () {
+ var parent = $(this),
+ blurEvent;
+ if (parent.data("ui-tooltip-open")) {
+ blurEvent = $.Event("blur");
+ blurEvent.target = blurEvent.currentTarget = this;
+ that.close(blurEvent, true);
+ }
+ if (parent.attr("title")) {
+ parent.uniqueId();
+ that.parents[this.id] = {
+ element: this,
+ title: parent.attr("title")
+ };
+ parent.attr("title", "");
+ }
+ });
+ }
+
+ this._registerCloseHandlers(event, target);
+ this._updateContent(target, event);
+ },
+
+ _updateContent: function (target, event) {
+ var content,
+ contentOption = this.options.content,
+ that = this,
+ eventType = event ? event.type : null;
+
+ if (typeof contentOption === "string") {
+ return this._open(event, target, contentOption);
+ }
+
+ content = contentOption.call(target[0], function (response) {
+
+ // IE may instantly serve a cached response for ajax requests
+ // delay this call to _open so the other call to _open runs first
+ that._delay(function () {
+
+ // Ignore async response if tooltip was closed already
+ if (!target.data("ui-tooltip-open")) {
+ return;
+ }
+
+ // jQuery creates a special event for focusin when it doesn't
+ // exist natively. To improve performance, the native event
+ // object is reused and the type is changed. Therefore, we can't
+ // rely on the type being correct after the event finished
+ // bubbling, so we set it back to the previous value. (#8740)
+ if (event) {
+ event.type = eventType;
+ }
+ this._open(event, target, response);
+ });
+ });
+ if (content) {
+ this._open(event, target, content);
+ }
+ },
+
+ _open: function (event, target, content) {
+ var tooltipData, tooltip, delayedShow, a11yContent,
+ positionOption = $.extend({}, this.options.position);
+
+ if (!content) {
+ return;
+ }
+
+ // Content can be updated multiple times. If the tooltip already
+ // exists, then just update the content and bail.
+ tooltipData = this._find(target);
+ if (tooltipData) {
+ tooltipData.tooltip.find(".ui-tooltip-content").html(content);
+ return;
+ }
+
+ // if we have a title, clear it to prevent the native tooltip
+ // we have to check first to avoid defining a title if none exists
+ // (we don't want to cause an element to start matching [title])
+ //
+ // We use removeAttr only for key events, to allow IE to export the correct
+ // accessible attributes. For mouse events, set to empty string to avoid
+ // native tooltip showing up (happens only when removing inside mouseover).
+ if (target.is("[title]")) {
+ if (event && event.type === "mouseover") {
+ target.attr("title", "");
+ } else {
+ target.removeAttr("title");
+ }
+ }
+
+ tooltipData = this._tooltip(target);
+ tooltip = tooltipData.tooltip;
+ this._addDescribedBy(target, tooltip.attr("id"));
+ tooltip.find(".ui-tooltip-content").html(content);
+
+ // Support: Voiceover on OS X, JAWS on IE <= 9
+ // JAWS announces deletions even when aria-relevant="additions"
+ // Voiceover will sometimes re-read the entire log region's contents from the beginning
+ this.liveRegion.children().hide();
+ if (content.clone) {
+ a11yContent = content.clone();
+ a11yContent.removeAttr("id").find("[id]").removeAttr("id");
+ } else {
+ a11yContent = content;
+ }
+ $("<div>").html(a11yContent).appendTo(this.liveRegion);
+
+ function position(event) {
+ positionOption.of = event;
+ if (tooltip.is(":hidden")) {
+ return;
+ }
+ tooltip.position(positionOption);
+ }
+
+ if (this.options.track && event && /^mouse/.test(event.type)) {
+ this._on(this.document, {
+ mousemove: position
+ });
+ // trigger once to override element-relative positioning
+ position(event);
+ } else {
+ tooltip.position($.extend({
+ of: target
+ }, this.options.position));
+ }
+
+ tooltip.hide();
+
+ this._show(tooltip, this.options.show);
+ // Handle tracking tooltips that are shown with a delay (#8644). As soon
+ // as the tooltip is visible, position the tooltip using the most recent
+ // event.
+ if (this.options.show && this.options.show.delay) {
+ delayedShow = this.delayedShow = setInterval(function () {
+ if (tooltip.is(":visible")) {
+ position(positionOption.of);
+ clearInterval(delayedShow);
+ }
+ }, $.fx.interval);
+ }
+
+ this._trigger("open", event, {tooltip: tooltip});
+ },
+
+ _registerCloseHandlers: function (event, target) {
+ var events = {
+ keyup: function (event) {
+ if (event.keyCode === $.ui.keyCode.ESCAPE) {
+ var fakeEvent = $.Event(event);
+ fakeEvent.currentTarget = target[0];
+ this.close(fakeEvent, true);
+ }
+ }
+ };
+
+ // Only bind remove handler for delegated targets. Non-delegated
+ // tooltips will handle this in destroy.
+ if (target[0] !== this.element[0]) {
+ events.remove = function () {
+ this._removeTooltip(this._find(target).tooltip);
+ };
+ }
+
+ if (!event || event.type === "mouseover") {
+ events.mouseleave = "close";
+ }
+ if (!event || event.type === "focusin") {
+ events.focusout = "close";
+ }
+ this._on(true, target, events);
+ },
+
+ close: function (event) {
+ var tooltip,
+ that = this,
+ target = $(event ? event.currentTarget : this.element),
+ tooltipData = this._find(target);
+
+ // The tooltip may already be closed
+ if (!tooltipData) {
+
+ // We set ui-tooltip-open immediately upon open (in open()), but only set the
+ // additional data once there's actually content to show (in _open()). So even if the
+ // tooltip doesn't have full data, we always remove ui-tooltip-open in case we're in
+ // the period between open() and _open().
+ target.removeData("ui-tooltip-open");
+ return;
+ }
+
+ tooltip = tooltipData.tooltip;
+
+ // disabling closes the tooltip, so we need to track when we're closing
+ // to avoid an infinite loop in case the tooltip becomes disabled on close
+ if (tooltipData.closing) {
+ return;
+ }
+
+ // Clear the interval for delayed tracking tooltips
+ clearInterval(this.delayedShow);
+
+ // only set title if we had one before (see comment in _open())
+ // If the title attribute has changed since open(), don't restore
+ if (target.data("ui-tooltip-title") && !target.attr("title")) {
+ target.attr("title", target.data("ui-tooltip-title"));
+ }
+
+ this._removeDescribedBy(target);
+
+ tooltipData.hiding = true;
+ tooltip.stop(true);
+ this._hide(tooltip, this.options.hide, function () {
+ that._removeTooltip($(this));
+ });
+
+ target.removeData("ui-tooltip-open");
+ this._off(target, "mouseleave focusout keyup");
+
+ // Remove 'remove' binding only on delegated targets
+ if (target[0] !== this.element[0]) {
+ this._off(target, "remove");
+ }
+ this._off(this.document, "mousemove");
+
+ if (event && event.type === "mouseleave") {
+ $.each(this.parents, function (id, parent) {
+ $(parent.element).attr("title", parent.title);
+ delete that.parents[id];
+ });
+ }
+
+ tooltipData.closing = true;
+ this._trigger("close", event, {tooltip: tooltip});
+ if (!tooltipData.hiding) {
+ tooltipData.closing = false;
+ }
+ },
+
+ _tooltip: function (element) {
+ var tooltip = $("<div>")
+ .attr("role", "tooltip")
+ .addClass("ui-tooltip ui-widget ui-corner-all ui-widget-content " +
+ ( this.options.tooltipClass || "" )),
+ id = tooltip.uniqueId().attr("id");
+
+ $("<div>")
+ .addClass("ui-tooltip-content")
+ .appendTo(tooltip);
+
+ tooltip.appendTo(this.document[0].body);
+
+ return this.tooltips[id] = {
+ element: element,
+ tooltip: tooltip
+ };
+ },
+
+ _find: function (target) {
+ var id = target.data("ui-tooltip-id");
+ return id ? this.tooltips[id] : null;
+ },
+
+ _removeTooltip: function (tooltip) {
+ tooltip.remove();
+ delete this.tooltips[tooltip.attr("id")];
+ },
+
+ _destroy: function () {
+ var that = this;
+
+ // close open tooltips
+ $.each(this.tooltips, function (id, tooltipData) {
+ // Delegate to close method to handle common cleanup
+ var event = $.Event("blur"),
+ element = tooltipData.element;
+ event.target = event.currentTarget = element[0];
+ that.close(event, true);
+
+ // Remove immediately; destroying an open tooltip doesn't use the
+ // hide animation
+ $("#" + id).remove();
+
+ // Restore the title
+ if (element.data("ui-tooltip-title")) {
+ // If the title attribute has changed since open(), don't restore
+ if (!element.attr("title")) {
+ element.attr("title", element.data("ui-tooltip-title"));
+ }
+ element.removeData("ui-tooltip-title");
+ }
+ });
+ this.liveRegion.remove();
+ }
+ });
+
+
+ /*!
+ * jQuery UI Effects 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/category/effects-core/
+ */
+
+
+ var dataSpace = "ui-effects-",
+
+ // Create a local jQuery because jQuery Color relies on it and the
+ // global may not exist with AMD and a custom build (#10199)
+ jQuery = $;
+
+ $.effects = {
+ effect: {}
+ };
+
+ /*!
+ * jQuery Color Animations v2.1.2
+ * https://github.com/jquery/jquery-color
+ *
+ * Copyright 2014 jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * Date: Wed Jan 16 08:47:09 2013 -0600
+ */
+ (function (jQuery, undefined) {
+
+ var stepHooks = "backgroundColor borderBottomColor borderLeftColor borderRightColor borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor",
+
+ // plusequals test for += 100 -= 100
+ rplusequals = /^([\-+])=\s*(\d+\.?\d*)/,
+ // a set of RE's that can match strings and generate color tuples.
+ stringParsers = [{
+ re: /rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+ parse: function (execResult) {
+ return [
+ execResult[1],
+ execResult[2],
+ execResult[3],
+ execResult[4]
+ ];
+ }
+ }, {
+ re: /rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+ parse: function (execResult) {
+ return [
+ execResult[1] * 2.55,
+ execResult[2] * 2.55,
+ execResult[3] * 2.55,
+ execResult[4]
+ ];
+ }
+ }, {
+ // this regex ignores A-F because it's compared against an already lowercased string
+ re: /#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/,
+ parse: function (execResult) {
+ return [
+ parseInt(execResult[1], 16),
+ parseInt(execResult[2], 16),
+ parseInt(execResult[3], 16)
+ ];
+ }
+ }, {
+ // this regex ignores A-F because it's compared against an already lowercased string
+ re: /#([a-f0-9])([a-f0-9])([a-f0-9])/,
+ parse: function (execResult) {
+ return [
+ parseInt(execResult[1] + execResult[1], 16),
+ parseInt(execResult[2] + execResult[2], 16),
+ parseInt(execResult[3] + execResult[3], 16)
+ ];
+ }
+ }, {
+ re: /hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+ space: "hsla",
+ parse: function (execResult) {
+ return [
+ execResult[1],
+ execResult[2] / 100,
+ execResult[3] / 100,
+ execResult[4]
+ ];
+ }
+ }],
+
+ // jQuery.Color( )
+ color = jQuery.Color = function (color, green, blue, alpha) {
+ return new jQuery.Color.fn.parse(color, green, blue, alpha);
+ },
+ spaces = {
+ rgba: {
+ props: {
+ red: {
+ idx: 0,
+ type: "byte"
+ },
+ green: {
+ idx: 1,
+ type: "byte"
+ },
+ blue: {
+ idx: 2,
+ type: "byte"
+ }
+ }
+ },
+
+ hsla: {
+ props: {
+ hue: {
+ idx: 0,
+ type: "degrees"
+ },
+ saturation: {
+ idx: 1,
+ type: "percent"
+ },
+ lightness: {
+ idx: 2,
+ type: "percent"
+ }
+ }
+ }
+ },
+ propTypes = {
+ "byte": {
+ floor: true,
+ max: 255
+ },
+ "percent": {
+ max: 1
+ },
+ "degrees": {
+ mod: 360,
+ floor: true
+ }
+ },
+ support = color.support = {},
+
+ // element for support tests
+ supportElem = jQuery("<p>")[0],
+
+ // colors = jQuery.Color.names
+ colors,
+
+ // local aliases of functions called often
+ each = jQuery.each;
+
+// determine rgba support immediately
+ supportElem.style.cssText = "background-color:rgba(1,1,1,.5)";
+ support.rgba = supportElem.style.backgroundColor.indexOf("rgba") > -1;
+
+// define cache name and alpha properties
+// for rgba and hsla spaces
+ each(spaces, function (spaceName, space) {
+ space.cache = "_" + spaceName;
+ space.props.alpha = {
+ idx: 3,
+ type: "percent",
+ def: 1
+ };
+ });
+
+ function clamp(value, prop, allowEmpty) {
+ var type = propTypes[prop.type] || {};
+
+ if (value == null) {
+ return (allowEmpty || !prop.def) ? null : prop.def;
+ }
+
+ // ~~ is an short way of doing floor for positive numbers
+ value = type.floor ? ~~value : parseFloat(value);
+
+ // IE will pass in empty strings as value for alpha,
+ // which will hit this case
+ if (isNaN(value)) {
+ return prop.def;
+ }
+
+ if (type.mod) {
+ // we add mod before modding to make sure that negatives values
+ // get converted properly: -10 -> 350
+ return (value + type.mod) % type.mod;
+ }
+
+ // for now all property types without mod have min and max
+ return 0 > value ? 0 : type.max < value ? type.max : value;
+ }
+
+ function stringParse(string) {
+ var inst = color(),
+ rgba = inst._rgba = [];
+
+ string = string.toLowerCase();
+
+ each(stringParsers, function (i, parser) {
+ var parsed,
+ match = parser.re.exec(string),
+ values = match && parser.parse(match),
+ spaceName = parser.space || "rgba";
+
+ if (values) {
+ parsed = inst[spaceName](values);
+
+ // if this was an rgba parse the assignment might happen twice
+ // oh well....
+ inst[spaces[spaceName].cache] = parsed[spaces[spaceName].cache];
+ rgba = inst._rgba = parsed._rgba;
+
+ // exit each( stringParsers ) here because we matched
+ return false;
+ }
+ });
+
+ // Found a stringParser that handled it
+ if (rgba.length) {
+
+ // if this came from a parsed string, force "transparent" when alpha is 0
+ // chrome, (and maybe others) return "transparent" as rgba(0,0,0,0)
+ if (rgba.join() === "0,0,0,0") {
+ jQuery.extend(rgba, colors.transparent);
+ }
+ return inst;
+ }
+
+ // named colors
+ return colors[string];
+ }
+
+ color.fn = jQuery.extend(color.prototype, {
+ parse: function (red, green, blue, alpha) {
+ if (red === undefined) {
+ this._rgba = [null, null, null, null];
+ return this;
+ }
+ if (red.jquery || red.nodeType) {
+ red = jQuery(red).css(green);
+ green = undefined;
+ }
+
+ var inst = this,
+ type = jQuery.type(red),
+ rgba = this._rgba = [];
+
+ // more than 1 argument specified - assume ( red, green, blue, alpha )
+ if (green !== undefined) {
+ red = [red, green, blue, alpha];
+ type = "array";
+ }
+
+ if (type === "string") {
+ return this.parse(stringParse(red) || colors._default);
+ }
+
+ if (type === "array") {
+ each(spaces.rgba.props, function (key, prop) {
+ rgba[prop.idx] = clamp(red[prop.idx], prop);
+ });
+ return this;
+ }
+
+ if (type === "object") {
+ if (red instanceof color) {
+ each(spaces, function (spaceName, space) {
+ if (red[space.cache]) {
+ inst[space.cache] = red[space.cache].slice();
+ }
+ });
+ } else {
+ each(spaces, function (spaceName, space) {
+ var cache = space.cache;
+ each(space.props, function (key, prop) {
+
+ // if the cache doesn't exist, and we know how to convert
+ if (!inst[cache] && space.to) {
+
+ // if the value was null, we don't need to copy it
+ // if the key was alpha, we don't need to copy it either
+ if (key === "alpha" || red[key] == null) {
+ return;
+ }
+ inst[cache] = space.to(inst._rgba);
+ }
+
+ // this is the only case where we allow nulls for ALL properties.
+ // call clamp with alwaysAllowEmpty
+ inst[cache][prop.idx] = clamp(red[key], prop, true);
+ });
+
+ // everything defined but alpha?
+ if (inst[cache] && jQuery.inArray(null, inst[cache].slice(0, 3)) < 0) {
+ // use the default of 1
+ inst[cache][3] = 1;
+ if (space.from) {
+ inst._rgba = space.from(inst[cache]);
+ }
+ }
+ });
+ }
+ return this;
+ }
+ },
+ is: function (compare) {
+ var is = color(compare),
+ same = true,
+ inst = this;
+
+ each(spaces, function (_, space) {
+ var localCache,
+ isCache = is[space.cache];
+ if (isCache) {
+ localCache = inst[space.cache] || space.to && space.to(inst._rgba) || [];
+ each(space.props, function (_, prop) {
+ if (isCache[prop.idx] != null) {
+ same = ( isCache[prop.idx] === localCache[prop.idx] );
+ return same;
+ }
+ });
+ }
+ return same;
+ });
+ return same;
+ },
+ _space: function () {
+ var used = [],
+ inst = this;
+ each(spaces, function (spaceName, space) {
+ if (inst[space.cache]) {
+ used.push(spaceName);
+ }
+ });
+ return used.pop();
+ },
+ transition: function (other, distance) {
+ var end = color(other),
+ spaceName = end._space(),
+ space = spaces[spaceName],
+ startColor = this.alpha() === 0 ? color("transparent") : this,
+ start = startColor[space.cache] || space.to(startColor._rgba),
+ result = start.slice();
+
+ end = end[space.cache];
+ each(space.props, function (key, prop) {
+ var index = prop.idx,
+ startValue = start[index],
+ endValue = end[index],
+ type = propTypes[prop.type] || {};
+
+ // if null, don't override start value
+ if (endValue === null) {
+ return;
+ }
+ // if null - use end
+ if (startValue === null) {
+ result[index] = endValue;
+ } else {
+ if (type.mod) {
+ if (endValue - startValue > type.mod / 2) {
+ startValue += type.mod;
+ } else if (startValue - endValue > type.mod / 2) {
+ startValue -= type.mod;
+ }
+ }
+ result[index] = clamp(( endValue - startValue ) * distance + startValue, prop);
+ }
+ });
+ return this[spaceName](result);
+ },
+ blend: function (opaque) {
+ // if we are already opaque - return ourself
+ if (this._rgba[3] === 1) {
+ return this;
+ }
+
+ var rgb = this._rgba.slice(),
+ a = rgb.pop(),
+ blend = color(opaque)._rgba;
+
+ return color(jQuery.map(rgb, function (v, i) {
+ return ( 1 - a ) * blend[i] + a * v;
+ }));
+ },
+ toRgbaString: function () {
+ var prefix = "rgba(",
+ rgba = jQuery.map(this._rgba, function (v, i) {
+ return v == null ? ( i > 2 ? 1 : 0 ) : v;
+ });
+
+ if (rgba[3] === 1) {
+ rgba.pop();
+ prefix = "rgb(";
+ }
+
+ return prefix + rgba.join() + ")";
+ },
+ toHslaString: function () {
+ var prefix = "hsla(",
+ hsla = jQuery.map(this.hsla(), function (v, i) {
+ if (v == null) {
+ v = i > 2 ? 1 : 0;
+ }
+
+ // catch 1 and 2
+ if (i && i < 3) {
+ v = Math.round(v * 100) + "%";
+ }
+ return v;
+ });
+
+ if (hsla[3] === 1) {
+ hsla.pop();
+ prefix = "hsl(";
+ }
+ return prefix + hsla.join() + ")";
+ },
+ toHexString: function (includeAlpha) {
+ var rgba = this._rgba.slice(),
+ alpha = rgba.pop();
+
+ if (includeAlpha) {
+ rgba.push(~~( alpha * 255 ));
+ }
+
+ return "#" + jQuery.map(rgba, function (v) {
+
+ // default to 0 when nulls exist
+ v = ( v || 0 ).toString(16);
+ return v.length === 1 ? "0" + v : v;
+ }).join("");
+ },
+ toString: function () {
+ return this._rgba[3] === 0 ? "transparent" : this.toRgbaString();
+ }
+ });
+ color.fn.parse.prototype = color.fn;
+
+// hsla conversions adapted from:
+// https://code.google.com/p/maashaack/source/browse/packages/graphics/trunk/src/graphics/colors/HUE2RGB.as?r=5021
+
+ function hue2rgb(p, q, h) {
+ h = ( h + 1 ) % 1;
+ if (h * 6 < 1) {
+ return p + ( q - p ) * h * 6;
+ }
+ if (h * 2 < 1) {
+ return q;
+ }
+ if (h * 3 < 2) {
+ return p + ( q - p ) * ( ( 2 / 3 ) - h ) * 6;
+ }
+ return p;
+ }
+
+ spaces.hsla.to = function (rgba) {
+ if (rgba[0] == null || rgba[1] == null || rgba[2] == null) {
+ return [null, null, null, rgba[3]];
+ }
+ var r = rgba[0] / 255,
+ g = rgba[1] / 255,
+ b = rgba[2] / 255,
+ a = rgba[3],
+ max = Math.max(r, g, b),
+ min = Math.min(r, g, b),
+ diff = max - min,
+ add = max + min,
+ l = add * 0.5,
+ h, s;
+
+ if (min === max) {
+ h = 0;
+ } else if (r === max) {
+ h = ( 60 * ( g - b ) / diff ) + 360;
+ } else if (g === max) {
+ h = ( 60 * ( b - r ) / diff ) + 120;
+ } else {
+ h = ( 60 * ( r - g ) / diff ) + 240;
+ }
+
+ // chroma (diff) == 0 means greyscale which, by definition, saturation = 0%
+ // otherwise, saturation is based on the ratio of chroma (diff) to lightness (add)
+ if (diff === 0) {
+ s = 0;
+ } else if (l <= 0.5) {
+ s = diff / add;
+ } else {
+ s = diff / ( 2 - add );
+ }
+ return [Math.round(h) % 360, s, l, a == null ? 1 : a];
+ };
+
+ spaces.hsla.from = function (hsla) {
+ if (hsla[0] == null || hsla[1] == null || hsla[2] == null) {
+ return [null, null, null, hsla[3]];
+ }
+ var h = hsla[0] / 360,
+ s = hsla[1],
+ l = hsla[2],
+ a = hsla[3],
+ q = l <= 0.5 ? l * ( 1 + s ) : l + s - l * s,
+ p = 2 * l - q;
+
+ return [
+ Math.round(hue2rgb(p, q, h + ( 1 / 3 )) * 255),
+ Math.round(hue2rgb(p, q, h) * 255),
+ Math.round(hue2rgb(p, q, h - ( 1 / 3 )) * 255),
+ a
+ ];
+ };
+
+ each(spaces, function (spaceName, space) {
+ var props = space.props,
+ cache = space.cache,
+ to = space.to,
+ from = space.from;
+
+ // makes rgba() and hsla()
+ color.fn[spaceName] = function (value) {
+
+ // generate a cache for this space if it doesn't exist
+ if (to && !this[cache]) {
+ this[cache] = to(this._rgba);
+ }
+ if (value === undefined) {
+ return this[cache].slice();
+ }
+
+ var ret,
+ type = jQuery.type(value),
+ arr = ( type === "array" || type === "object" ) ? value : arguments,
+ local = this[cache].slice();
+
+ each(props, function (key, prop) {
+ var val = arr[type === "object" ? key : prop.idx];
+ if (val == null) {
+ val = local[prop.idx];
+ }
+ local[prop.idx] = clamp(val, prop);
+ });
+
+ if (from) {
+ ret = color(from(local));
+ ret[cache] = local;
+ return ret;
+ } else {
+ return color(local);
+ }
+ };
+
+ // makes red() green() blue() alpha() hue() saturation() lightness()
+ each(props, function (key, prop) {
+ // alpha is included in more than one space
+ if (color.fn[key]) {
+ return;
+ }
+ color.fn[key] = function (value) {
+ var vtype = jQuery.type(value),
+ fn = ( key === "alpha" ? ( this._hsla ? "hsla" : "rgba" ) : spaceName ),
+ local = this[fn](),
+ cur = local[prop.idx],
+ match;
+
+ if (vtype === "undefined") {
+ return cur;
+ }
+
+ if (vtype === "function") {
+ value = value.call(this, cur);
+ vtype = jQuery.type(value);
+ }
+ if (value == null && prop.empty) {
+ return this;
+ }
+ if (vtype === "string") {
+ match = rplusequals.exec(value);
+ if (match) {
+ value = cur + parseFloat(match[2]) * ( match[1] === "+" ? 1 : -1 );
+ }
+ }
+ local[prop.idx] = value;
+ return this[fn](local);
+ };
+ });
+ });
+
+// add cssHook and .fx.step function for each named hook.
+// accept a space separated string of properties
+ color.hook = function (hook) {
+ var hooks = hook.split(" ");
+ each(hooks, function (i, hook) {
+ jQuery.cssHooks[hook] = {
+ set: function (elem, value) {
+ var parsed, curElem,
+ backgroundColor = "";
+
+ if (value !== "transparent" && ( jQuery.type(value) !== "string" || ( parsed = stringParse(value) ) )) {
+ value = color(parsed || value);
+ if (!support.rgba && value._rgba[3] !== 1) {
+ curElem = hook === "backgroundColor" ? elem.parentNode : elem;
+ while (
+ (backgroundColor === "" || backgroundColor === "transparent") &&
+ curElem && curElem.style
+ ) {
+ try {
+ backgroundColor = jQuery.css(curElem, "backgroundColor");
+ curElem = curElem.parentNode;
+ } catch (e) {
+ }
+ }
+
+ value = value.blend(backgroundColor && backgroundColor !== "transparent" ?
+ backgroundColor :
+ "_default");
+ }
+
+ value = value.toRgbaString();
+ }
+ try {
+ elem.style[hook] = value;
+ } catch (e) {
+ // wrapped to prevent IE from throwing errors on "invalid" values like 'auto' or 'inherit'
+ }
+ }
+ };
+ jQuery.fx.step[hook] = function (fx) {
+ if (!fx.colorInit) {
+ fx.start = color(fx.elem, hook);
+ fx.end = color(fx.end);
+ fx.colorInit = true;
+ }
+ jQuery.cssHooks[hook].set(fx.elem, fx.start.transition(fx.end, fx.pos));
+ };
+ });
+
+ };
+
+ color.hook(stepHooks);
+
+ jQuery.cssHooks.borderColor = {
+ expand: function (value) {
+ var expanded = {};
+
+ each(["Top", "Right", "Bottom", "Left"], function (i, part) {
+ expanded["border" + part + "Color"] = value;
+ });
+ return expanded;
+ }
+ };
+
+// Basic color names only.
+// Usage of any of the other color names requires adding yourself or including
+// jquery.color.svg-names.js.
+ colors = jQuery.Color.names = {
+ // 4.1. Basic color keywords
+ aqua: "#00ffff",
+ black: "#000000",
+ blue: "#0000ff",
+ fuchsia: "#ff00ff",
+ gray: "#808080",
+ green: "#008000",
+ lime: "#00ff00",
+ maroon: "#800000",
+ navy: "#000080",
+ olive: "#808000",
+ purple: "#800080",
+ red: "#ff0000",
+ silver: "#c0c0c0",
+ teal: "#008080",
+ white: "#ffffff",
+ yellow: "#ffff00",
+
+ // 4.2.3. "transparent" color keyword
+ transparent: [null, null, null, 0],
+
+ _default: "#ffffff"
+ };
+
+ })(jQuery);
+
+ /******************************************************************************/
+ /****************************** CLASS ANIMATIONS ******************************/
+ /******************************************************************************/
+ (function () {
+
+ var classAnimationActions = ["add", "remove", "toggle"],
+ shorthandStyles = {
+ border: 1,
+ borderBottom: 1,
+ borderColor: 1,
+ borderLeft: 1,
+ borderRight: 1,
+ borderTop: 1,
+ borderWidth: 1,
+ margin: 1,
+ padding: 1
+ };
+
+ $.each(["borderLeftStyle", "borderRightStyle", "borderBottomStyle", "borderTopStyle"], function (_, prop) {
+ $.fx.step[prop] = function (fx) {
+ if (fx.end !== "none" && !fx.setAttr || fx.pos === 1 && !fx.setAttr) {
+ jQuery.style(fx.elem, prop, fx.end);
+ fx.setAttr = true;
+ }
+ };
+ });
+
+ function getElementStyles(elem) {
+ var key, len,
+ style = elem.ownerDocument.defaultView ?
+ elem.ownerDocument.defaultView.getComputedStyle(elem, null) :
+ elem.currentStyle,
+ styles = {};
+
+ if (style && style.length && style[0] && style[style[0]]) {
+ len = style.length;
+ while (len--) {
+ key = style[len];
+ if (typeof style[key] === "string") {
+ styles[$.camelCase(key)] = style[key];
+ }
+ }
+ // support: Opera, IE <9
+ } else {
+ for (key in style) {
+ if (typeof style[key] === "string") {
+ styles[key] = style[key];
+ }
+ }
+ }
+
+ return styles;
+ }
+
+ function styleDifference(oldStyle, newStyle) {
+ var diff = {},
+ name, value;
+
+ for (name in newStyle) {
+ value = newStyle[name];
+ if (oldStyle[name] !== value) {
+ if (!shorthandStyles[name]) {
+ if ($.fx.step[name] || !isNaN(parseFloat(value))) {
+ diff[name] = value;
+ }
+ }
+ }
+ }
+
+ return diff;
+ }
+
+// support: jQuery <1.8
+ if (!$.fn.addBack) {
+ $.fn.addBack = function (selector) {
+ return this.add(selector == null ?
+ this.prevObject : this.prevObject.filter(selector)
+ );
+ };
+ }
+
+ $.effects.animateClass = function (value, duration, easing, callback) {
+ var o = $.speed(duration, easing, callback);
+
+ return this.queue(function () {
+ var animated = $(this),
+ baseClass = animated.attr("class") || "",
+ applyClassChange,
+ allAnimations = o.children ? animated.find("*").addBack() : animated;
+
+ // map the animated objects to store the original styles.
+ allAnimations = allAnimations.map(function () {
+ var el = $(this);
+ return {
+ el: el,
+ start: getElementStyles(this)
+ };
+ });
+
+ // apply class change
+ applyClassChange = function () {
+ $.each(classAnimationActions, function (i, action) {
+ if (value[action]) {
+ animated[action + "Class"](value[action]);
+ }
+ });
+ };
+ applyClassChange();
+
+ // map all animated objects again - calculate new styles and diff
+ allAnimations = allAnimations.map(function () {
+ this.end = getElementStyles(this.el[0]);
+ this.diff = styleDifference(this.start, this.end);
+ return this;
+ });
+
+ // apply original class
+ animated.attr("class", baseClass);
+
+ // map all animated objects again - this time collecting a promise
+ allAnimations = allAnimations.map(function () {
+ var styleInfo = this,
+ dfd = $.Deferred(),
+ opts = $.extend({}, o, {
+ queue: false,
+ complete: function () {
+ dfd.resolve(styleInfo);
+ }
+ });
+
+ this.el.animate(this.diff, opts);
+ return dfd.promise();
+ });
+
+ // once all animations have completed:
+ $.when.apply($, allAnimations.get()).done(function () {
+
+ // set the final class
+ applyClassChange();
+
+ // for each animated element,
+ // clear all css properties that were animated
+ $.each(arguments, function () {
+ var el = this.el;
+ $.each(this.diff, function (key) {
+ el.css(key, "");
+ });
+ });
+
+ // this is guarnteed to be there if you use jQuery.speed()
+ // it also handles dequeuing the next anim...
+ o.complete.call(animated[0]);
+ });
+ });
+ };
+
+ $.fn.extend({
+ addClass: (function (orig) {
+ return function (classNames, speed, easing, callback) {
+ return speed ?
+ $.effects.animateClass.call(this,
+ {add: classNames}, speed, easing, callback) :
+ orig.apply(this, arguments);
+ };
+ })($.fn.addClass),
+
+ removeClass: (function (orig) {
+ return function (classNames, speed, easing, callback) {
+ return arguments.length > 1 ?
+ $.effects.animateClass.call(this,
+ {remove: classNames}, speed, easing, callback) :
+ orig.apply(this, arguments);
+ };
+ })($.fn.removeClass),
+
+ toggleClass: (function (orig) {
+ return function (classNames, force, speed, easing, callback) {
+ if (typeof force === "boolean" || force === undefined) {
+ if (!speed) {
+ // without speed parameter
+ return orig.apply(this, arguments);
+ } else {
+ return $.effects.animateClass.call(this,
+ (force ? {add: classNames} : {remove: classNames}),
+ speed, easing, callback);
+ }
+ } else {
+ // without force parameter
+ return $.effects.animateClass.call(this,
+ {toggle: classNames}, force, speed, easing);
+ }
+ };
+ })($.fn.toggleClass),
+
+ switchClass: function (remove, add, speed, easing, callback) {
+ return $.effects.animateClass.call(this, {
+ add: add,
+ remove: remove
+ }, speed, easing, callback);
+ }
+ });
+
+ })();
+
+ /******************************************************************************/
+ /*********************************** EFFECTS **********************************/
+ /******************************************************************************/
+
+ (function () {
+
+ $.extend($.effects, {
+ version: "1.11.4",
+
+ // Saves a set of properties in a data storage
+ save: function (element, set) {
+ for (var i = 0; i < set.length; i++) {
+ if (set[i] !== null) {
+ element.data(dataSpace + set[i], element[0].style[set[i]]);
+ }
+ }
+ },
+
+ // Restores a set of previously saved properties from a data storage
+ restore: function (element, set) {
+ var val, i;
+ for (i = 0; i < set.length; i++) {
+ if (set[i] !== null) {
+ val = element.data(dataSpace + set[i]);
+ // support: jQuery 1.6.2
+ // http://bugs.jquery.com/ticket/9917
+ // jQuery 1.6.2 incorrectly returns undefined for any falsy value.
+ // We can't differentiate between "" and 0 here, so we just assume
+ // empty string since it's likely to be a more common value...
+ if (val === undefined) {
+ val = "";
+ }
+ element.css(set[i], val);
+ }
+ }
+ },
+
+ setMode: function (el, mode) {
+ if (mode === "toggle") {
+ mode = el.is(":hidden") ? "show" : "hide";
+ }
+ return mode;
+ },
+
+ // Translates a [top,left] array into a baseline value
+ // this should be a little more flexible in the future to handle a string & hash
+ getBaseline: function (origin, original) {
+ var y, x;
+ switch (origin[0]) {
+ case "top":
+ y = 0;
+ break;
+ case "middle":
+ y = 0.5;
+ break;
+ case "bottom":
+ y = 1;
+ break;
+ default:
+ y = origin[0] / original.height;
+ }
+ switch (origin[1]) {
+ case "left":
+ x = 0;
+ break;
+ case "center":
+ x = 0.5;
+ break;
+ case "right":
+ x = 1;
+ break;
+ default:
+ x = origin[1] / original.width;
+ }
+ return {
+ x: x,
+ y: y
+ };
+ },
+
+ // Wraps the element around a wrapper that copies position properties
+ createWrapper: function (element) {
+
+ // if the element is already wrapped, return it
+ if (element.parent().is(".ui-effects-wrapper")) {
+ return element.parent();
+ }
+
+ // wrap the element
+ var props = {
+ width: element.outerWidth(true),
+ height: element.outerHeight(true),
+ "float": element.css("float")
+ },
+ wrapper = $("<div></div>")
+ .addClass("ui-effects-wrapper")
+ .css({
+ fontSize: "100%",
+ background: "transparent",
+ border: "none",
+ margin: 0,
+ padding: 0
+ }),
+ // Store the size in case width/height are defined in % - Fixes #5245
+ size = {
+ width: element.width(),
+ height: element.height()
+ },
+ active = document.activeElement;
+
+ // support: Firefox
+ // Firefox incorrectly exposes anonymous content
+ // https://bugzilla.mozilla.org/show_bug.cgi?id=561664
+ try {
+ active.id;
+ } catch (e) {
+ active = document.body;
+ }
+
+ element.wrap(wrapper);
+
+ // Fixes #7595 - Elements lose focus when wrapped.
+ if (element[0] === active || $.contains(element[0], active)) {
+ $(active).focus();
+ }
+
+ wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually lose the reference to the wrapped element
+
+ // transfer positioning properties to the wrapper
+ if (element.css("position") === "static") {
+ wrapper.css({position: "relative"});
+ element.css({position: "relative"});
+ } else {
+ $.extend(props, {
+ position: element.css("position"),
+ zIndex: element.css("z-index")
+ });
+ $.each(["top", "left", "bottom", "right"], function (i, pos) {
+ props[pos] = element.css(pos);
+ if (isNaN(parseInt(props[pos], 10))) {
+ props[pos] = "auto";
+ }
+ });
+ element.css({
+ position: "relative",
+ top: 0,
+ left: 0,
+ right: "auto",
+ bottom: "auto"
+ });
+ }
+ element.css(size);
+
+ return wrapper.css(props).show();
+ },
+
+ removeWrapper: function (element) {
+ var active = document.activeElement;
+
+ if (element.parent().is(".ui-effects-wrapper")) {
+ element.parent().replaceWith(element);
+
+ // Fixes #7595 - Elements lose focus when wrapped.
+ if (element[0] === active || $.contains(element[0], active)) {
+ $(active).focus();
+ }
+ }
+
+ return element;
+ },
+
+ setTransition: function (element, list, factor, value) {
+ value = value || {};
+ $.each(list, function (i, x) {
+ var unit = element.cssUnit(x);
+ if (unit[0] > 0) {
+ value[x] = unit[0] * factor + unit[1];
+ }
+ });
+ return value;
+ }
+ });
+
+// return an effect options object for the given parameters:
+ function _normalizeArguments(effect, options, speed, callback) {
+
+ // allow passing all options as the first parameter
+ if ($.isPlainObject(effect)) {
+ options = effect;
+ effect = effect.effect;
+ }
+
+ // convert to an object
+ effect = {effect: effect};
+
+ // catch (effect, null, ...)
+ if (options == null) {
+ options = {};
+ }
+
+ // catch (effect, callback)
+ if ($.isFunction(options)) {
+ callback = options;
+ speed = null;
+ options = {};
+ }
+
+ // catch (effect, speed, ?)
+ if (typeof options === "number" || $.fx.speeds[options]) {
+ callback = speed;
+ speed = options;
+ options = {};
+ }
+
+ // catch (effect, options, callback)
+ if ($.isFunction(speed)) {
+ callback = speed;
+ speed = null;
+ }
+
+ // add options to effect
+ if (options) {
+ $.extend(effect, options);
+ }
+
+ speed = speed || options.duration;
+ effect.duration = $.fx.off ? 0 :
+ typeof speed === "number" ? speed :
+ speed in $.fx.speeds ? $.fx.speeds[speed] :
+ $.fx.speeds._default;
+
+ effect.complete = callback || options.complete;
+
+ return effect;
+ }
+
+ function standardAnimationOption(option) {
+ // Valid standard speeds (nothing, number, named speed)
+ if (!option || typeof option === "number" || $.fx.speeds[option]) {
+ return true;
+ }
+
+ // Invalid strings - treat as "normal" speed
+ if (typeof option === "string" && !$.effects.effect[option]) {
+ return true;
+ }
+
+ // Complete callback
+ if ($.isFunction(option)) {
+ return true;
+ }
+
+ // Options hash (but not naming an effect)
+ if (typeof option === "object" && !option.effect) {
+ return true;
+ }
+
+ // Didn't match any standard API
+ return false;
+ }
+
+ $.fn.extend({
+ effect: function (/* effect, options, speed, callback */) {
+ var args = _normalizeArguments.apply(this, arguments),
+ mode = args.mode,
+ queue = args.queue,
+ effectMethod = $.effects.effect[args.effect];
+
+ if ($.fx.off || !effectMethod) {
+ // delegate to the original method (e.g., .show()) if possible
+ if (mode) {
+ return this[mode](args.duration, args.complete);
+ } else {
+ return this.each(function () {
+ if (args.complete) {
+ args.complete.call(this);
+ }
+ });
+ }
+ }
+
+ function run(next) {
+ var elem = $(this),
+ complete = args.complete,
+ mode = args.mode;
+
+ function done() {
+ if ($.isFunction(complete)) {
+ complete.call(elem[0]);
+ }
+ if ($.isFunction(next)) {
+ next();
+ }
+ }
+
+ // If the element already has the correct final state, delegate to
+ // the core methods so the internal tracking of "olddisplay" works.
+ if (elem.is(":hidden") ? mode === "hide" : mode === "show") {
+ elem[mode]();
+ done();
+ } else {
+ effectMethod.call(elem[0], args, done);
+ }
+ }
+
+ return queue === false ? this.each(run) : this.queue(queue || "fx", run);
+ },
+
+ show: (function (orig) {
+ return function (option) {
+ if (standardAnimationOption(option)) {
+ return orig.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args.mode = "show";
+ return this.effect.call(this, args);
+ }
+ };
+ })($.fn.show),
+
+ hide: (function (orig) {
+ return function (option) {
+ if (standardAnimationOption(option)) {
+ return orig.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args.mode = "hide";
+ return this.effect.call(this, args);
+ }
+ };
+ })($.fn.hide),
+
+ toggle: (function (orig) {
+ return function (option) {
+ if (standardAnimationOption(option) || typeof option === "boolean") {
+ return orig.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args.mode = "toggle";
+ return this.effect.call(this, args);
+ }
+ };
+ })($.fn.toggle),
+
+ // helper functions
+ cssUnit: function (key) {
+ var style = this.css(key),
+ val = [];
+
+ $.each(["em", "px", "%", "pt"], function (i, unit) {
+ if (style.indexOf(unit) > 0) {
+ val = [parseFloat(style), unit];
+ }
+ });
+ return val;
+ }
+ });
+
+ })();
+
+ /******************************************************************************/
+ /*********************************** EASING ***********************************/
+ /******************************************************************************/
+
+ (function () {
+
+// based on easing equations from Robert Penner (http://www.robertpenner.com/easing)
+
+ var baseEasings = {};
+
+ $.each(["Quad", "Cubic", "Quart", "Quint", "Expo"], function (i, name) {
+ baseEasings[name] = function (p) {
+ return Math.pow(p, i + 2);
+ };
+ });
+
+ $.extend(baseEasings, {
+ Sine: function (p) {
+ return 1 - Math.cos(p * Math.PI / 2);
+ },
+ Circ: function (p) {
+ return 1 - Math.sqrt(1 - p * p);
+ },
+ Elastic: function (p) {
+ return p === 0 || p === 1 ? p :
+ -Math.pow(2, 8 * (p - 1)) * Math.sin(( (p - 1) * 80 - 7.5 ) * Math.PI / 15);
+ },
+ Back: function (p) {
+ return p * p * ( 3 * p - 2 );
+ },
+ Bounce: function (p) {
+ var pow2,
+ bounce = 4;
+
+ while (p < ( ( pow2 = Math.pow(2, --bounce) ) - 1 ) / 11) {
+ }
+ return 1 / Math.pow(4, 3 - bounce) - 7.5625 * Math.pow(( pow2 * 3 - 2 ) / 22 - p, 2);
+ }
+ });
+
+ $.each(baseEasings, function (name, easeIn) {
+ $.easing["easeIn" + name] = easeIn;
+ $.easing["easeOut" + name] = function (p) {
+ return 1 - easeIn(1 - p);
+ };
+ $.easing["easeInOut" + name] = function (p) {
+ return p < 0.5 ?
+ easeIn(p * 2) / 2 :
+ 1 - easeIn(p * -2 + 2) / 2;
+ };
+ });
+
+ })();
+
+ var effect = $.effects;
+
+
+ /*!
+ * jQuery UI Effects Blind 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/blind-effect/
+ */
+
+
+ var effectBlind = $.effects.effect.blind = function (o, done) {
+ // Create element
+ var el = $(this),
+ rvertical = /up|down|vertical/,
+ rpositivemotion = /up|left|vertical|horizontal/,
+ props = ["position", "top", "bottom", "left", "right", "height", "width"],
+ mode = $.effects.setMode(el, o.mode || "hide"),
+ direction = o.direction || "up",
+ vertical = rvertical.test(direction),
+ ref = vertical ? "height" : "width",
+ ref2 = vertical ? "top" : "left",
+ motion = rpositivemotion.test(direction),
+ animation = {},
+ show = mode === "show",
+ wrapper, distance, margin;
+
+ // if already wrapped, the wrapper's properties are my property. #6245
+ if (el.parent().is(".ui-effects-wrapper")) {
+ $.effects.save(el.parent(), props);
+ } else {
+ $.effects.save(el, props);
+ }
+ el.show();
+ wrapper = $.effects.createWrapper(el).css({
+ overflow: "hidden"
+ });
+
+ distance = wrapper[ref]();
+ margin = parseFloat(wrapper.css(ref2)) || 0;
+
+ animation[ref] = show ? distance : 0;
+ if (!motion) {
+ el
+ .css(vertical ? "bottom" : "right", 0)
+ .css(vertical ? "top" : "left", "auto")
+ .css({position: "absolute"});
+
+ animation[ref2] = show ? margin : distance + margin;
+ }
+
+ // start at 0 if we are showing
+ if (show) {
+ wrapper.css(ref, 0);
+ if (!motion) {
+ wrapper.css(ref2, margin + distance);
+ }
+ }
+
+ // Animate
+ wrapper.animate(animation, {
+ duration: o.duration,
+ easing: o.easing,
+ queue: false,
+ complete: function () {
+ if (mode === "hide") {
+ el.hide();
+ }
+ $.effects.restore(el, props);
+ $.effects.removeWrapper(el);
+ done();
+ }
+ });
+ };
+
+
+ /*!
+ * jQuery UI Effects Bounce 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/bounce-effect/
+ */
+
+
+ var effectBounce = $.effects.effect.bounce = function (o, done) {
+ var el = $(this),
+ props = ["position", "top", "bottom", "left", "right", "height", "width"],
+
+ // defaults:
+ mode = $.effects.setMode(el, o.mode || "effect"),
+ hide = mode === "hide",
+ show = mode === "show",
+ direction = o.direction || "up",
+ distance = o.distance,
+ times = o.times || 5,
+
+ // number of internal animations
+ anims = times * 2 + ( show || hide ? 1 : 0 ),
+ speed = o.duration / anims,
+ easing = o.easing,
+
+ // utility:
+ ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+ motion = ( direction === "up" || direction === "left" ),
+ i,
+ upAnim,
+ downAnim,
+
+ // we will need to re-assemble the queue to stack our animations in place
+ queue = el.queue(),
+ queuelen = queue.length;
+
+ // Avoid touching opacity to prevent clearType and PNG issues in IE
+ if (show || hide) {
+ props.push("opacity");
+ }
+
+ $.effects.save(el, props);
+ el.show();
+ $.effects.createWrapper(el); // Create Wrapper
+
+ // default distance for the BIGGEST bounce is the outer Distance / 3
+ if (!distance) {
+ distance = el[ref === "top" ? "outerHeight" : "outerWidth"]() / 3;
+ }
+
+ if (show) {
+ downAnim = {opacity: 1};
+ downAnim[ref] = 0;
+
+ // if we are showing, force opacity 0 and set the initial position
+ // then do the "first" animation
+ el.css("opacity", 0)
+ .css(ref, motion ? -distance * 2 : distance * 2)
+ .animate(downAnim, speed, easing);
+ }
+
+ // start at the smallest distance if we are hiding
+ if (hide) {
+ distance = distance / Math.pow(2, times - 1);
+ }
+
+ downAnim = {};
+ downAnim[ref] = 0;
+ // Bounces up/down/left/right then back to 0 -- times * 2 animations happen here
+ for (i = 0; i < times; i++) {
+ upAnim = {};
+ upAnim[ref] = ( motion ? "-=" : "+=" ) + distance;
+
+ el.animate(upAnim, speed, easing)
+ .animate(downAnim, speed, easing);
+
+ distance = hide ? distance * 2 : distance / 2;
+ }
+
+ // Last Bounce when Hiding
+ if (hide) {
+ upAnim = {opacity: 0};
+ upAnim[ref] = ( motion ? "-=" : "+=" ) + distance;
+
+ el.animate(upAnim, speed, easing);
+ }
+
+ el.queue(function () {
+ if (hide) {
+ el.hide();
+ }
+ $.effects.restore(el, props);
+ $.effects.removeWrapper(el);
+ done();
+ });
+
+ // inject all the animations we just queued to be first in line (after "inprogress")
+ if (queuelen > 1) {
+ queue.splice.apply(queue,
+ [1, 0].concat(queue.splice(queuelen, anims + 1)));
+ }
+ el.dequeue();
+
+ };
+
+
+ /*!
+ * jQuery UI Effects Clip 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/clip-effect/
+ */
+
+
+ var effectClip = $.effects.effect.clip = function (o, done) {
+ // Create element
+ var el = $(this),
+ props = ["position", "top", "bottom", "left", "right", "height", "width"],
+ mode = $.effects.setMode(el, o.mode || "hide"),
+ show = mode === "show",
+ direction = o.direction || "vertical",
+ vert = direction === "vertical",
+ size = vert ? "height" : "width",
+ position = vert ? "top" : "left",
+ animation = {},
+ wrapper, animate, distance;
+
+ // Save & Show
+ $.effects.save(el, props);
+ el.show();
+
+ // Create Wrapper
+ wrapper = $.effects.createWrapper(el).css({
+ overflow: "hidden"
+ });
+ animate = ( el[0].tagName === "IMG" ) ? wrapper : el;
+ distance = animate[size]();
+
+ // Shift
+ if (show) {
+ animate.css(size, 0);
+ animate.css(position, distance / 2);
+ }
+
+ // Create Animation Object:
+ animation[size] = show ? distance : 0;
+ animation[position] = show ? 0 : distance / 2;
+
+ // Animate
+ animate.animate(animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: function () {
+ if (!show) {
+ el.hide();
+ }
+ $.effects.restore(el, props);
+ $.effects.removeWrapper(el);
+ done();
+ }
+ });
+
+ };
+
+
+ /*!
+ * jQuery UI Effects Drop 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/drop-effect/
+ */
+
+
+ var effectDrop = $.effects.effect.drop = function (o, done) {
+
+ var el = $(this),
+ props = ["position", "top", "bottom", "left", "right", "opacity", "height", "width"],
+ mode = $.effects.setMode(el, o.mode || "hide"),
+ show = mode === "show",
+ direction = o.direction || "left",
+ ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+ motion = ( direction === "up" || direction === "left" ) ? "pos" : "neg",
+ animation = {
+ opacity: show ? 1 : 0
+ },
+ distance;
+
+ // Adjust
+ $.effects.save(el, props);
+ el.show();
+ $.effects.createWrapper(el);
+
+ distance = o.distance || el[ref === "top" ? "outerHeight" : "outerWidth"](true) / 2;
+
+ if (show) {
+ el
+ .css("opacity", 0)
+ .css(ref, motion === "pos" ? -distance : distance);
+ }
+
+ // Animation
+ animation[ref] = ( show ?
+ ( motion === "pos" ? "+=" : "-=" ) :
+ ( motion === "pos" ? "-=" : "+=" ) ) +
+ distance;
+
+ // Animate
+ el.animate(animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: function () {
+ if (mode === "hide") {
+ el.hide();
+ }
+ $.effects.restore(el, props);
+ $.effects.removeWrapper(el);
+ done();
+ }
+ });
+ };
+
+
+ /*!
+ * jQuery UI Effects Explode 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/explode-effect/
+ */
+
+
+ var effectExplode = $.effects.effect.explode = function (o, done) {
+
+ var rows = o.pieces ? Math.round(Math.sqrt(o.pieces)) : 3,
+ cells = rows,
+ el = $(this),
+ mode = $.effects.setMode(el, o.mode || "hide"),
+ show = mode === "show",
+
+ // show and then visibility:hidden the element before calculating offset
+ offset = el.show().css("visibility", "hidden").offset(),
+
+ // width and height of a piece
+ width = Math.ceil(el.outerWidth() / cells),
+ height = Math.ceil(el.outerHeight() / rows),
+ pieces = [],
+
+ // loop
+ i, j, left, top, mx, my;
+
+ // children animate complete:
+ function childComplete() {
+ pieces.push(this);
+ if (pieces.length === rows * cells) {
+ animComplete();
+ }
+ }
+
+ // clone the element for each row and cell.
+ for (i = 0; i < rows; i++) { // ===>
+ top = offset.top + i * height;
+ my = i - ( rows - 1 ) / 2;
+
+ for (j = 0; j < cells; j++) { // |||
+ left = offset.left + j * width;
+ mx = j - ( cells - 1 ) / 2;
+
+ // Create a clone of the now hidden main element that will be absolute positioned
+ // within a wrapper div off the -left and -top equal to size of our pieces
+ el
+ .clone()
+ .appendTo("body")
+ .wrap("<div></div>")
+ .css({
+ position: "absolute",
+ visibility: "visible",
+ left: -j * width,
+ top: -i * height
+ })
+
+ // select the wrapper - make it overflow: hidden and absolute positioned based on
+ // where the original was located +left and +top equal to the size of pieces
+ .parent()
+ .addClass("ui-effects-explode")
+ .css({
+ position: "absolute",
+ overflow: "hidden",
+ width: width,
+ height: height,
+ left: left + ( show ? mx * width : 0 ),
+ top: top + ( show ? my * height : 0 ),
+ opacity: show ? 0 : 1
+ }).animate({
+ left: left + ( show ? 0 : mx * width ),
+ top: top + ( show ? 0 : my * height ),
+ opacity: show ? 1 : 0
+ }, o.duration || 500, o.easing, childComplete);
+ }
+ }
+
+ function animComplete() {
+ el.css({
+ visibility: "visible"
+ });
+ $(pieces).remove();
+ if (!show) {
+ el.hide();
+ }
+ done();
+ }
+ };
+
+
+ /*!
+ * jQuery UI Effects Fade 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/fade-effect/
+ */
+
+
+ var effectFade = $.effects.effect.fade = function (o, done) {
+ var el = $(this),
+ mode = $.effects.setMode(el, o.mode || "toggle");
+
+ el.animate({
+ opacity: mode
+ }, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: done
+ });
+ };
+
+
+ /*!
+ * jQuery UI Effects Fold 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/fold-effect/
+ */
+
+
+ var effectFold = $.effects.effect.fold = function (o, done) {
+
+ // Create element
+ var el = $(this),
+ props = ["position", "top", "bottom", "left", "right", "height", "width"],
+ mode = $.effects.setMode(el, o.mode || "hide"),
+ show = mode === "show",
+ hide = mode === "hide",
+ size = o.size || 15,
+ percent = /([0-9]+)%/.exec(size),
+ horizFirst = !!o.horizFirst,
+ widthFirst = show !== horizFirst,
+ ref = widthFirst ? ["width", "height"] : ["height", "width"],
+ duration = o.duration / 2,
+ wrapper, distance,
+ animation1 = {},
+ animation2 = {};
+
+ $.effects.save(el, props);
+ el.show();
+
+ // Create Wrapper
+ wrapper = $.effects.createWrapper(el).css({
+ overflow: "hidden"
+ });
+ distance = widthFirst ?
+ [wrapper.width(), wrapper.height()] :
+ [wrapper.height(), wrapper.width()];
+
+ if (percent) {
+ size = parseInt(percent[1], 10) / 100 * distance[hide ? 0 : 1];
+ }
+ if (show) {
+ wrapper.css(horizFirst ? {
+ height: 0,
+ width: size
+ } : {
+ height: size,
+ width: 0
+ });
+ }
+
+ // Animation
+ animation1[ref[0]] = show ? distance[0] : size;
+ animation2[ref[1]] = show ? distance[1] : 0;
+
+ // Animate
+ wrapper
+ .animate(animation1, duration, o.easing)
+ .animate(animation2, duration, o.easing, function () {
+ if (hide) {
+ el.hide();
+ }
+ $.effects.restore(el, props);
+ $.effects.removeWrapper(el);
+ done();
+ });
+
+ };
+
+
+ /*!
+ * jQuery UI Effects Highlight 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/highlight-effect/
+ */
+
+
+ var effectHighlight = $.effects.effect.highlight = function (o, done) {
+ var elem = $(this),
+ props = ["backgroundImage", "backgroundColor", "opacity"],
+ mode = $.effects.setMode(elem, o.mode || "show"),
+ animation = {
+ backgroundColor: elem.css("backgroundColor")
+ };
+
+ if (mode === "hide") {
+ animation.opacity = 0;
+ }
+
+ $.effects.save(elem, props);
+
+ elem
+ .show()
+ .css({
+ backgroundImage: "none",
+ backgroundColor: o.color || "#ffff99"
+ })
+ .animate(animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: function () {
+ if (mode === "hide") {
+ elem.hide();
+ }
+ $.effects.restore(elem, props);
+ done();
+ }
+ });
+ };
+
+
+ /*!
+ * jQuery UI Effects Size 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/size-effect/
+ */
+
+
+ var effectSize = $.effects.effect.size = function (o, done) {
+
+ // Create element
+ var original, baseline, factor,
+ el = $(this),
+ props0 = ["position", "top", "bottom", "left", "right", "width", "height", "overflow", "opacity"],
+
+ // Always restore
+ props1 = ["position", "top", "bottom", "left", "right", "overflow", "opacity"],
+
+ // Copy for children
+ props2 = ["width", "height", "overflow"],
+ cProps = ["fontSize"],
+ vProps = ["borderTopWidth", "borderBottomWidth", "paddingTop", "paddingBottom"],
+ hProps = ["borderLeftWidth", "borderRightWidth", "paddingLeft", "paddingRight"],
+
+ // Set options
+ mode = $.effects.setMode(el, o.mode || "effect"),
+ restore = o.restore || mode !== "effect",
+ scale = o.scale || "both",
+ origin = o.origin || ["middle", "center"],
+ position = el.css("position"),
+ props = restore ? props0 : props1,
+ zero = {
+ height: 0,
+ width: 0,
+ outerHeight: 0,
+ outerWidth: 0
+ };
+
+ if (mode === "show") {
+ el.show();
+ }
+ original = {
+ height: el.height(),
+ width: el.width(),
+ outerHeight: el.outerHeight(),
+ outerWidth: el.outerWidth()
+ };
+
+ if (o.mode === "toggle" && mode === "show") {
+ el.from = o.to || zero;
+ el.to = o.from || original;
+ } else {
+ el.from = o.from || ( mode === "show" ? zero : original );
+ el.to = o.to || ( mode === "hide" ? zero : original );
+ }
+
+ // Set scaling factor
+ factor = {
+ from: {
+ y: el.from.height / original.height,
+ x: el.from.width / original.width
+ },
+ to: {
+ y: el.to.height / original.height,
+ x: el.to.width / original.width
+ }
+ };
+
+ // Scale the css box
+ if (scale === "box" || scale === "both") {
+
+ // Vertical props scaling
+ if (factor.from.y !== factor.to.y) {
+ props = props.concat(vProps);
+ el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
+ }
+
+ // Horizontal props scaling
+ if (factor.from.x !== factor.to.x) {
+ props = props.concat(hProps);
+ el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
+ el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
+ }
+ }
+
+ // Scale the content
+ if (scale === "content" || scale === "both") {
+
+ // Vertical props scaling
+ if (factor.from.y !== factor.to.y) {
+ props = props.concat(cProps).concat(props2);
+ el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
+ }
+ }
+
+ $.effects.save(el, props);
+ el.show();
+ $.effects.createWrapper(el);
+ el.css("overflow", "hidden").css(el.from);
+
+ // Adjust
+ if (origin) { // Calculate baseline shifts
+ baseline = $.effects.getBaseline(origin, original);
+ el.from.top = ( original.outerHeight - el.outerHeight() ) * baseline.y;
+ el.from.left = ( original.outerWidth - el.outerWidth() ) * baseline.x;
+ el.to.top = ( original.outerHeight - el.to.outerHeight ) * baseline.y;
+ el.to.left = ( original.outerWidth - el.to.outerWidth ) * baseline.x;
+ }
+ el.css(el.from); // set top & left
+
+ // Animate
+ if (scale === "content" || scale === "both") { // Scale the children
+
+ // Add margins/font-size
+ vProps = vProps.concat(["marginTop", "marginBottom"]).concat(cProps);
+ hProps = hProps.concat(["marginLeft", "marginRight"]);
+ props2 = props0.concat(vProps).concat(hProps);
+
+ el.find("*[width]").each(function () {
+ var child = $(this),
+ c_original = {
+ height: child.height(),
+ width: child.width(),
+ outerHeight: child.outerHeight(),
+ outerWidth: child.outerWidth()
+ };
+ if (restore) {
+ $.effects.save(child, props2);
+ }
+
+ child.from = {
+ height: c_original.height * factor.from.y,
+ width: c_original.width * factor.from.x,
+ outerHeight: c_original.outerHeight * factor.from.y,
+ outerWidth: c_original.outerWidth * factor.from.x
+ };
+ child.to = {
+ height: c_original.height * factor.to.y,
+ width: c_original.width * factor.to.x,
+ outerHeight: c_original.height * factor.to.y,
+ outerWidth: c_original.width * factor.to.x
+ };
+
+ // Vertical props scaling
+ if (factor.from.y !== factor.to.y) {
+ child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
+ child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
+ }
+
+ // Horizontal props scaling
+ if (factor.from.x !== factor.to.x) {
+ child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
+ child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
+ }
+
+ // Animate children
+ child.css(child.from);
+ child.animate(child.to, o.duration, o.easing, function () {
+
+ // Restore children
+ if (restore) {
+ $.effects.restore(child, props2);
+ }
+ });
+ });
+ }
+
+ // Animate
+ el.animate(el.to, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: function () {
+ if (el.to.opacity === 0) {
+ el.css("opacity", el.from.opacity);
+ }
+ if (mode === "hide") {
+ el.hide();
+ }
+ $.effects.restore(el, props);
+ if (!restore) {
+
+ // we need to calculate our new positioning based on the scaling
+ if (position === "static") {
+ el.css({
+ position: "relative",
+ top: el.to.top,
+ left: el.to.left
+ });
+ } else {
+ $.each(["top", "left"], function (idx, pos) {
+ el.css(pos, function (_, str) {
+ var val = parseInt(str, 10),
+ toRef = idx ? el.to.left : el.to.top;
+
+ // if original was "auto", recalculate the new value from wrapper
+ if (str === "auto") {
+ return toRef + "px";
+ }
+
+ return val + toRef + "px";
+ });
+ });
+ }
+ }
+
+ $.effects.removeWrapper(el);
+ done();
+ }
+ });
+
+ };
+
+
+ /*!
+ * jQuery UI Effects Scale 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/scale-effect/
+ */
+
+
+ var effectScale = $.effects.effect.scale = function (o, done) {
+
+ // Create element
+ var el = $(this),
+ options = $.extend(true, {}, o),
+ mode = $.effects.setMode(el, o.mode || "effect"),
+ percent = parseInt(o.percent, 10) ||
+ ( parseInt(o.percent, 10) === 0 ? 0 : ( mode === "hide" ? 0 : 100 ) ),
+ direction = o.direction || "both",
+ origin = o.origin,
+ original = {
+ height: el.height(),
+ width: el.width(),
+ outerHeight: el.outerHeight(),
+ outerWidth: el.outerWidth()
+ },
+ factor = {
+ y: direction !== "horizontal" ? (percent / 100) : 1,
+ x: direction !== "vertical" ? (percent / 100) : 1
+ };
+
+ // We are going to pass this effect to the size effect:
+ options.effect = "size";
+ options.queue = false;
+ options.complete = done;
+
+ // Set default origin and restore for show/hide
+ if (mode !== "effect") {
+ options.origin = origin || ["middle", "center"];
+ options.restore = true;
+ }
+
+ options.from = o.from || ( mode === "show" ? {
+ height: 0,
+ width: 0,
+ outerHeight: 0,
+ outerWidth: 0
+ } : original );
+ options.to = {
+ height: original.height * factor.y,
+ width: original.width * factor.x,
+ outerHeight: original.outerHeight * factor.y,
+ outerWidth: original.outerWidth * factor.x
+ };
+
+ // Fade option to support puff
+ if (options.fade) {
+ if (mode === "show") {
+ options.from.opacity = 0;
+ options.to.opacity = 1;
+ }
+ if (mode === "hide") {
+ options.from.opacity = 1;
+ options.to.opacity = 0;
+ }
+ }
+
+ // Animate
+ el.effect(options);
+
+ };
+
+
+ /*!
+ * jQuery UI Effects Puff 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/puff-effect/
+ */
+
+
+ var effectPuff = $.effects.effect.puff = function (o, done) {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.mode || "hide"),
+ hide = mode === "hide",
+ percent = parseInt(o.percent, 10) || 150,
+ factor = percent / 100,
+ original = {
+ height: elem.height(),
+ width: elem.width(),
+ outerHeight: elem.outerHeight(),
+ outerWidth: elem.outerWidth()
+ };
+
+ $.extend(o, {
+ effect: "scale",
+ queue: false,
+ fade: true,
+ mode: mode,
+ complete: done,
+ percent: hide ? percent : 100,
+ from: hide ?
+ original :
+ {
+ height: original.height * factor,
+ width: original.width * factor,
+ outerHeight: original.outerHeight * factor,
+ outerWidth: original.outerWidth * factor
+ }
+ });
+
+ elem.effect(o);
+ };
+
+
+ /*!
+ * jQuery UI Effects Pulsate 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/pulsate-effect/
+ */
+
+
+ var effectPulsate = $.effects.effect.pulsate = function (o, done) {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.mode || "show"),
+ show = mode === "show",
+ hide = mode === "hide",
+ showhide = ( show || mode === "hide" ),
+
+ // showing or hiding leaves of the "last" animation
+ anims = ( ( o.times || 5 ) * 2 ) + ( showhide ? 1 : 0 ),
+ duration = o.duration / anims,
+ animateTo = 0,
+ queue = elem.queue(),
+ queuelen = queue.length,
+ i;
+
+ if (show || !elem.is(":visible")) {
+ elem.css("opacity", 0).show();
+ animateTo = 1;
+ }
+
+ // anims - 1 opacity "toggles"
+ for (i = 1; i < anims; i++) {
+ elem.animate({
+ opacity: animateTo
+ }, duration, o.easing);
+ animateTo = 1 - animateTo;
+ }
+
+ elem.animate({
+ opacity: animateTo
+ }, duration, o.easing);
+
+ elem.queue(function () {
+ if (hide) {
+ elem.hide();
+ }
+ done();
+ });
+
+ // We just queued up "anims" animations, we need to put them next in the queue
+ if (queuelen > 1) {
+ queue.splice.apply(queue,
+ [1, 0].concat(queue.splice(queuelen, anims + 1)));
+ }
+ elem.dequeue();
+ };
+
+
+ /*!
+ * jQuery UI Effects Shake 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/shake-effect/
+ */
+
+
+ var effectShake = $.effects.effect.shake = function (o, done) {
+
+ var el = $(this),
+ props = ["position", "top", "bottom", "left", "right", "height", "width"],
+ mode = $.effects.setMode(el, o.mode || "effect"),
+ direction = o.direction || "left",
+ distance = o.distance || 20,
+ times = o.times || 3,
+ anims = times * 2 + 1,
+ speed = Math.round(o.duration / anims),
+ ref = (direction === "up" || direction === "down") ? "top" : "left",
+ positiveMotion = (direction === "up" || direction === "left"),
+ animation = {},
+ animation1 = {},
+ animation2 = {},
+ i,
+
+ // we will need to re-assemble the queue to stack our animations in place
+ queue = el.queue(),
+ queuelen = queue.length;
+
+ $.effects.save(el, props);
+ el.show();
+ $.effects.createWrapper(el);
+
+ // Animation
+ animation[ref] = ( positiveMotion ? "-=" : "+=" ) + distance;
+ animation1[ref] = ( positiveMotion ? "+=" : "-=" ) + distance * 2;
+ animation2[ref] = ( positiveMotion ? "-=" : "+=" ) + distance * 2;
+
+ // Animate
+ el.animate(animation, speed, o.easing);
+
+ // Shakes
+ for (i = 1; i < times; i++) {
+ el.animate(animation1, speed, o.easing).animate(animation2, speed, o.easing);
+ }
+ el
+ .animate(animation1, speed, o.easing)
+ .animate(animation, speed / 2, o.easing)
+ .queue(function () {
+ if (mode === "hide") {
+ el.hide();
+ }
+ $.effects.restore(el, props);
+ $.effects.removeWrapper(el);
+ done();
+ });
+
+ // inject all the animations we just queued to be first in line (after "inprogress")
+ if (queuelen > 1) {
+ queue.splice.apply(queue,
+ [1, 0].concat(queue.splice(queuelen, anims + 1)));
+ }
+ el.dequeue();
+
+ };
+
+
+ /*!
+ * jQuery UI Effects Slide 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/slide-effect/
+ */
+
+
+ var effectSlide = $.effects.effect.slide = function (o, done) {
+
+ // Create element
+ var el = $(this),
+ props = ["position", "top", "bottom", "left", "right", "width", "height"],
+ mode = $.effects.setMode(el, o.mode || "show"),
+ show = mode === "show",
+ direction = o.direction || "left",
+ ref = (direction === "up" || direction === "down") ? "top" : "left",
+ positiveMotion = (direction === "up" || direction === "left"),
+ distance,
+ animation = {};
+
+ // Adjust
+ $.effects.save(el, props);
+ el.show();
+ distance = o.distance || el[ref === "top" ? "outerHeight" : "outerWidth"](true);
+
+ $.effects.createWrapper(el).css({
+ overflow: "hidden"
+ });
+
+ if (show) {
+ el.css(ref, positiveMotion ? (isNaN(distance) ? "-" + distance : -distance) : distance);
+ }
+
+ // Animation
+ animation[ref] = ( show ?
+ ( positiveMotion ? "+=" : "-=") :
+ ( positiveMotion ? "-=" : "+=")) +
+ distance;
+
+ // Animate
+ el.animate(animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: function () {
+ if (mode === "hide") {
+ el.hide();
+ }
+ $.effects.restore(el, props);
+ $.effects.removeWrapper(el);
+ done();
+ }
+ });
+ };
+
+
+ /*!
+ * jQuery UI Effects Transfer 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/transfer-effect/
+ */
+
+
+ var effectTransfer = $.effects.effect.transfer = function (o, done) {
+ var elem = $(this),
+ target = $(o.to),
+ targetFixed = target.css("position") === "fixed",
+ body = $("body"),
+ fixTop = targetFixed ? body.scrollTop() : 0,
+ fixLeft = targetFixed ? body.scrollLeft() : 0,
+ endPosition = target.offset(),
+ animation = {
+ top: endPosition.top - fixTop,
+ left: endPosition.left - fixLeft,
+ height: target.innerHeight(),
+ width: target.innerWidth()
+ },
+ startPosition = elem.offset(),
+ transfer = $("<div class='ui-effects-transfer'></div>")
+ .appendTo(document.body)
+ .addClass(o.className)
+ .css({
+ top: startPosition.top - fixTop,
+ left: startPosition.left - fixLeft,
+ height: elem.innerHeight(),
+ width: elem.innerWidth(),
+ position: targetFixed ? "fixed" : "absolute"
+ })
+ .animate(animation, o.duration, o.easing, function () {
+ transfer.remove();
+ done();
+ });
+ };
+
+
+}));
\ No newline at end of file diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.min.css b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.min.css new file mode 100644 index 00000000..fb2025ff --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.min.css @@ -0,0 +1,1775 @@ +/*! jQuery UI - v1.11.4 - 2015-04-16
+* http://jqueryui.com
+* Includes: core.css, draggable.css, resizable.css, selectable.css, sortable.css, accordion.css, autocomplete.css, button.css, datepicker.css, dialog.css, menu.css, progressbar.css, selectmenu.css, slider.css, spinner.css, tabs.css, tooltip.css, theme.css
+* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS%2CTahoma%2CVerdana%2CArial%2Csans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=gloss_wave&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=highlight_soft&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=glass&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=glass&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=glass&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=highlight_soft&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=diagonals_thick&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=diagonals_thick&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=flat&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px
+* Copyright 2015 jQuery Foundation and other contributors; Licensed MIT */
+
+.ui-helper-hidden {
+ display: none
+}
+
+.ui-helper-hidden-accessible {
+ border: 0;
+ clip: rect(0 0 0 0);
+ height: 1px;
+ margin: -1px;
+ overflow: hidden;
+ padding: 0;
+ position: absolute;
+ width: 1px
+}
+
+.ui-helper-reset {
+ margin: 0;
+ padding: 0;
+ border: 0;
+ outline: 0;
+ line-height: 1.3;
+ text-decoration: none;
+ font-size: 100%;
+ list-style: none
+}
+
+.ui-helper-clearfix:before, .ui-helper-clearfix:after {
+ content: "";
+ display: table;
+ border-collapse: collapse
+}
+
+.ui-helper-clearfix:after {
+ clear: both
+}
+
+.ui-helper-clearfix {
+ min-height: 0
+}
+
+.ui-helper-zfix {
+ width: 100%;
+ height: 100%;
+ top: 0;
+ left: 0;
+ position: absolute;
+ opacity: 0;
+ filter: Alpha(Opacity=0)
+}
+
+.ui-front {
+ z-index: 100
+}
+
+.ui-state-disabled {
+ cursor: default !important
+}
+
+.ui-icon {
+ display: block;
+ text-indent: -99999px;
+ overflow: hidden;
+ background-repeat: no-repeat
+}
+
+.ui-widget-overlay {
+ position: fixed;
+ top: 0;
+ left: 0;
+ width: 100%;
+ height: 100%
+}
+
+.ui-draggable-handle {
+ -ms-touch-action: none;
+ touch-action: none
+}
+
+.ui-resizable {
+ position: relative
+}
+
+.ui-resizable-handle {
+ position: absolute;
+ font-size: 0.1px;
+ display: block;
+ -ms-touch-action: none;
+ touch-action: none
+}
+
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle {
+ display: none
+}
+
+.ui-resizable-n {
+ cursor: n-resize;
+ height: 7px;
+ width: 100%;
+ top: -5px;
+ left: 0
+}
+
+.ui-resizable-s {
+ cursor: s-resize;
+ height: 7px;
+ width: 100%;
+ bottom: -5px;
+ left: 0
+}
+
+.ui-resizable-e {
+ cursor: e-resize;
+ width: 7px;
+ right: -5px;
+ top: 0;
+ height: 100%
+}
+
+.ui-resizable-w {
+ cursor: w-resize;
+ width: 7px;
+ left: -5px;
+ top: 0;
+ height: 100%
+}
+
+.ui-resizable-se {
+ cursor: se-resize;
+ width: 12px;
+ height: 12px;
+ right: 1px;
+ bottom: 1px
+}
+
+.ui-resizable-sw {
+ cursor: sw-resize;
+ width: 9px;
+ height: 9px;
+ left: -5px;
+ bottom: -5px
+}
+
+.ui-resizable-nw {
+ cursor: nw-resize;
+ width: 9px;
+ height: 9px;
+ left: -5px;
+ top: -5px
+}
+
+.ui-resizable-ne {
+ cursor: ne-resize;
+ width: 9px;
+ height: 9px;
+ right: -5px;
+ top: -5px
+}
+
+.ui-selectable {
+ -ms-touch-action: none;
+ touch-action: none
+}
+
+.ui-selectable-helper {
+ position: absolute;
+ z-index: 100;
+ border: 1px dotted black
+}
+
+.ui-sortable-handle {
+ -ms-touch-action: none;
+ touch-action: none
+}
+
+.ui-accordion .ui-accordion-header {
+ display: block;
+ cursor: pointer;
+ position: relative;
+ margin: 2px 0 0 0;
+ padding: .5em .5em .5em .7em;
+ min-height: 0;
+ font-size: 100%
+}
+
+.ui-accordion .ui-accordion-icons {
+ padding-left: 2.2em
+}
+
+.ui-accordion .ui-accordion-icons .ui-accordion-icons {
+ padding-left: 2.2em
+}
+
+.ui-accordion .ui-accordion-header .ui-accordion-header-icon {
+ position: absolute;
+ left: .5em;
+ top: 50%;
+ margin-top: -8px
+}
+
+.ui-accordion .ui-accordion-content {
+ padding: 1em 2.2em;
+ border-top: 0;
+ overflow: auto
+}
+
+.ui-autocomplete {
+ position: absolute;
+ top: 0;
+ left: 0;
+ cursor: default
+}
+
+.ui-button {
+ display: inline-block;
+ position: relative;
+ padding: 0;
+ line-height: normal;
+ margin-right: .1em;
+ cursor: pointer;
+ vertical-align: middle;
+ text-align: center;
+ overflow: visible
+}
+
+.ui-button, .ui-button:link, .ui-button:visited, .ui-button:hover, .ui-button:active {
+ text-decoration: none
+}
+
+.ui-button-icon-only {
+ width: 2.2em
+}
+
+button.ui-button-icon-only {
+ width: 2.4em
+}
+
+.ui-button-icons-only {
+ width: 3.4em
+}
+
+button.ui-button-icons-only {
+ width: 3.7em
+}
+
+.ui-button .ui-button-text {
+ display: block;
+ line-height: normal
+}
+
+.ui-button-text-only .ui-button-text {
+ padding: .4em 1em
+}
+
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text {
+ padding: .4em;
+ text-indent: -9999999px
+}
+
+.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text {
+ padding: .4em 1em .4em 2.1em
+}
+
+.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text {
+ padding: .4em 2.1em .4em 1em
+}
+
+.ui-button-text-icons .ui-button-text {
+ padding-left: 2.1em;
+ padding-right: 2.1em
+}
+
+input.ui-button {
+ padding: .4em 1em
+}
+
+.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon {
+ position: absolute;
+ top: 50%;
+ margin-top: -8px
+}
+
+.ui-button-icon-only .ui-icon {
+ left: 50%;
+ margin-left: -8px
+}
+
+.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary {
+ left: .5em
+}
+
+.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary {
+ right: .5em
+}
+
+.ui-buttonset {
+ margin-right: 7px
+}
+
+.ui-buttonset .ui-button {
+ margin-left: 0;
+ margin-right: -.3em
+}
+
+input.ui-button::-moz-focus-inner, button.ui-button::-moz-focus-inner {
+ border: 0;
+ padding: 0
+}
+
+.ui-datepicker {
+ width: 17em;
+ padding: .2em .2em 0;
+ display: none
+}
+
+.ui-datepicker .ui-datepicker-header {
+ position: relative;
+ padding: .2em 0
+}
+
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next {
+ position: absolute;
+ top: 2px;
+ width: 1.8em;
+ height: 1.8em
+}
+
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover {
+ top: 1px
+}
+
+.ui-datepicker .ui-datepicker-prev {
+ left: 2px
+}
+
+.ui-datepicker .ui-datepicker-next {
+ right: 2px
+}
+
+.ui-datepicker .ui-datepicker-prev-hover {
+ left: 1px
+}
+
+.ui-datepicker .ui-datepicker-next-hover {
+ right: 1px
+}
+
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span {
+ display: block;
+ position: absolute;
+ left: 50%;
+ margin-left: -8px;
+ top: 50%;
+ margin-top: -8px
+}
+
+.ui-datepicker .ui-datepicker-title {
+ margin: 0 2.3em;
+ line-height: 1.8em;
+ text-align: center
+}
+
+.ui-datepicker .ui-datepicker-title select {
+ font-size: 1em;
+ margin: 1px 0
+}
+
+.ui-datepicker select.ui-datepicker-month, .ui-datepicker select.ui-datepicker-year {
+ width: 45%
+}
+
+.ui-datepicker table {
+ width: 100%;
+ font-size: .9em;
+ border-collapse: collapse;
+ margin: 0 0 .4em
+}
+
+.ui-datepicker th {
+ padding: .7em .3em;
+ text-align: center;
+ font-weight: bold;
+ border: 0
+}
+
+.ui-datepicker td {
+ border: 0;
+ padding: 1px
+}
+
+.ui-datepicker td span, .ui-datepicker td a {
+ display: block;
+ padding: .2em;
+ text-align: right;
+ text-decoration: none
+}
+
+.ui-datepicker .ui-datepicker-buttonpane {
+ background-image: none;
+ margin: .7em 0 0 0;
+ padding: 0 .2em;
+ border-left: 0;
+ border-right: 0;
+ border-bottom: 0
+}
+
+.ui-datepicker .ui-datepicker-buttonpane button {
+ float: right;
+ margin: .5em .2em .4em;
+ cursor: pointer;
+ padding: .2em .6em .3em .6em;
+ width: auto;
+ overflow: visible
+}
+
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current {
+ float: left
+}
+
+.ui-datepicker.ui-datepicker-multi {
+ width: auto
+}
+
+.ui-datepicker-multi .ui-datepicker-group {
+ float: left
+}
+
+.ui-datepicker-multi .ui-datepicker-group table {
+ width: 95%;
+ margin: 0 auto .4em
+}
+
+.ui-datepicker-multi-2 .ui-datepicker-group {
+ width: 50%
+}
+
+.ui-datepicker-multi-3 .ui-datepicker-group {
+ width: 33.3%
+}
+
+.ui-datepicker-multi-4 .ui-datepicker-group {
+ width: 25%
+}
+
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header, .ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header {
+ border-left-width: 0
+}
+
+.ui-datepicker-multi .ui-datepicker-buttonpane {
+ clear: left
+}
+
+.ui-datepicker-row-break {
+ clear: both;
+ width: 100%;
+ font-size: 0
+}
+
+.ui-datepicker-rtl {
+ direction: rtl
+}
+
+.ui-datepicker-rtl .ui-datepicker-prev {
+ right: 2px;
+ left: auto
+}
+
+.ui-datepicker-rtl .ui-datepicker-next {
+ left: 2px;
+ right: auto
+}
+
+.ui-datepicker-rtl .ui-datepicker-prev:hover {
+ right: 1px;
+ left: auto
+}
+
+.ui-datepicker-rtl .ui-datepicker-next:hover {
+ left: 1px;
+ right: auto
+}
+
+.ui-datepicker-rtl .ui-datepicker-buttonpane {
+ clear: right
+}
+
+.ui-datepicker-rtl .ui-datepicker-buttonpane button {
+ float: left
+}
+
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current, .ui-datepicker-rtl .ui-datepicker-group {
+ float: right
+}
+
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header, .ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header {
+ border-right-width: 0;
+ border-left-width: 1px
+}
+
+.ui-dialog {
+ overflow: hidden;
+ position: absolute;
+ top: 0;
+ left: 0;
+ padding: .2em;
+ outline: 0
+}
+
+.ui-dialog .ui-dialog-titlebar {
+ padding: .4em 1em;
+ position: relative
+}
+
+.ui-dialog .ui-dialog-title {
+ float: left;
+ margin: .1em 0;
+ white-space: nowrap;
+ width: 90%;
+ overflow: hidden;
+ text-overflow: ellipsis
+}
+
+.ui-dialog .ui-dialog-titlebar-close {
+ position: absolute;
+ right: .3em;
+ top: 50%;
+ width: 20px;
+ margin: -10px 0 0 0;
+ padding: 1px;
+ height: 20px
+}
+
+.ui-dialog .ui-dialog-content {
+ position: relative;
+ border: 0;
+ padding: .5em 1em;
+ background: none;
+ overflow: auto
+}
+
+.ui-dialog .ui-dialog-buttonpane {
+ text-align: left;
+ border-width: 1px 0 0 0;
+ background-image: none;
+ margin-top: .5em;
+ padding: .3em 1em .5em .4em
+}
+
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset {
+ float: right
+}
+
+.ui-dialog .ui-dialog-buttonpane button {
+ margin: .5em .4em .5em 0;
+ cursor: pointer
+}
+
+.ui-dialog .ui-resizable-se {
+ width: 12px;
+ height: 12px;
+ right: -5px;
+ bottom: -5px;
+ background-position: 16px 16px
+}
+
+.ui-draggable .ui-dialog-titlebar {
+ cursor: move
+}
+
+.ui-menu {
+ list-style: none;
+ padding: 0;
+ margin: 0;
+ display: block;
+ outline: none
+}
+
+.ui-menu .ui-menu {
+ position: absolute
+}
+
+.ui-menu .ui-menu-item {
+ position: relative;
+ margin: 0;
+ padding: 3px 1em 3px .4em;
+ cursor: pointer;
+ min-height: 0;
+ list-style-image: url("data:image/gif;base64,R0lGODlhAQABAIAAAAAAAP///yH5BAEAAAAALAAAAAABAAEAAAIBRAA7")
+}
+
+.ui-menu .ui-menu-divider {
+ margin: 5px 0;
+ height: 0;
+ font-size: 0;
+ line-height: 0;
+ border-width: 1px 0 0 0
+}
+
+.ui-menu .ui-state-focus, .ui-menu .ui-state-active {
+ margin: -1px
+}
+
+.ui-menu-icons {
+ position: relative
+}
+
+.ui-menu-icons .ui-menu-item {
+ padding-left: 2em
+}
+
+.ui-menu .ui-icon {
+ position: absolute;
+ top: 0;
+ bottom: 0;
+ left: .2em;
+ margin: auto 0
+}
+
+.ui-menu .ui-menu-icon {
+ left: auto;
+ right: 0
+}
+
+.ui-progressbar {
+ height: 2em;
+ text-align: left;
+ overflow: hidden
+}
+
+.ui-progressbar .ui-progressbar-value {
+ margin: -1px;
+ height: 100%
+}
+
+.ui-progressbar .ui-progressbar-overlay {
+ background: url("data:image/gif;base64,R0lGODlhKAAoAIABAAAAAP///yH/C05FVFNDQVBFMi4wAwEAAAAh+QQJAQABACwAAAAAKAAoAAACkYwNqXrdC52DS06a7MFZI+4FHBCKoDeWKXqymPqGqxvJrXZbMx7Ttc+w9XgU2FB3lOyQRWET2IFGiU9m1frDVpxZZc6bfHwv4c1YXP6k1Vdy292Fb6UkuvFtXpvWSzA+HycXJHUXiGYIiMg2R6W459gnWGfHNdjIqDWVqemH2ekpObkpOlppWUqZiqr6edqqWQAAIfkECQEAAQAsAAAAACgAKAAAApSMgZnGfaqcg1E2uuzDmmHUBR8Qil95hiPKqWn3aqtLsS18y7G1SzNeowWBENtQd+T1JktP05nzPTdJZlR6vUxNWWjV+vUWhWNkWFwxl9VpZRedYcflIOLafaa28XdsH/ynlcc1uPVDZxQIR0K25+cICCmoqCe5mGhZOfeYSUh5yJcJyrkZWWpaR8doJ2o4NYq62lAAACH5BAkBAAEALAAAAAAoACgAAAKVDI4Yy22ZnINRNqosw0Bv7i1gyHUkFj7oSaWlu3ovC8GxNso5fluz3qLVhBVeT/Lz7ZTHyxL5dDalQWPVOsQWtRnuwXaFTj9jVVh8pma9JjZ4zYSj5ZOyma7uuolffh+IR5aW97cHuBUXKGKXlKjn+DiHWMcYJah4N0lYCMlJOXipGRr5qdgoSTrqWSq6WFl2ypoaUAAAIfkECQEAAQAsAAAAACgAKAAAApaEb6HLgd/iO7FNWtcFWe+ufODGjRfoiJ2akShbueb0wtI50zm02pbvwfWEMWBQ1zKGlLIhskiEPm9R6vRXxV4ZzWT2yHOGpWMyorblKlNp8HmHEb/lCXjcW7bmtXP8Xt229OVWR1fod2eWqNfHuMjXCPkIGNileOiImVmCOEmoSfn3yXlJWmoHGhqp6ilYuWYpmTqKUgAAIfkECQEAAQAsAAAAACgAKAAAApiEH6kb58biQ3FNWtMFWW3eNVcojuFGfqnZqSebuS06w5V80/X02pKe8zFwP6EFWOT1lDFk8rGERh1TTNOocQ61Hm4Xm2VexUHpzjymViHrFbiELsefVrn6XKfnt2Q9G/+Xdie499XHd2g4h7ioOGhXGJboGAnXSBnoBwKYyfioubZJ2Hn0RuRZaflZOil56Zp6iioKSXpUAAAh+QQJAQABACwAAAAAKAAoAAACkoQRqRvnxuI7kU1a1UU5bd5tnSeOZXhmn5lWK3qNTWvRdQxP8qvaC+/yaYQzXO7BMvaUEmJRd3TsiMAgswmNYrSgZdYrTX6tSHGZO73ezuAw2uxuQ+BbeZfMxsexY35+/Qe4J1inV0g4x3WHuMhIl2jXOKT2Q+VU5fgoSUI52VfZyfkJGkha6jmY+aaYdirq+lQAACH5BAkBAAEALAAAAAAoACgAAAKWBIKpYe0L3YNKToqswUlvznigd4wiR4KhZrKt9Upqip61i9E3vMvxRdHlbEFiEXfk9YARYxOZZD6VQ2pUunBmtRXo1Lf8hMVVcNl8JafV38aM2/Fu5V16Bn63r6xt97j09+MXSFi4BniGFae3hzbH9+hYBzkpuUh5aZmHuanZOZgIuvbGiNeomCnaxxap2upaCZsq+1kAACH5BAkBAAEALAAAAAAoACgAAAKXjI8By5zf4kOxTVrXNVlv1X0d8IGZGKLnNpYtm8Lr9cqVeuOSvfOW79D9aDHizNhDJidFZhNydEahOaDH6nomtJjp1tutKoNWkvA6JqfRVLHU/QUfau9l2x7G54d1fl995xcIGAdXqMfBNadoYrhH+Mg2KBlpVpbluCiXmMnZ2Sh4GBqJ+ckIOqqJ6LmKSllZmsoq6wpQAAAh+QQJAQABACwAAAAAKAAoAAAClYx/oLvoxuJDkU1a1YUZbJ59nSd2ZXhWqbRa2/gF8Gu2DY3iqs7yrq+xBYEkYvFSM8aSSObE+ZgRl1BHFZNr7pRCavZ5BW2142hY3AN/zWtsmf12p9XxxFl2lpLn1rseztfXZjdIWIf2s5dItwjYKBgo9yg5pHgzJXTEeGlZuenpyPmpGQoKOWkYmSpaSnqKileI2FAAACH5BAkBAAEALAAAAAAoACgAAAKVjB+gu+jG4kORTVrVhRlsnn2dJ3ZleFaptFrb+CXmO9OozeL5VfP99HvAWhpiUdcwkpBH3825AwYdU8xTqlLGhtCosArKMpvfa1mMRae9VvWZfeB2XfPkeLmm18lUcBj+p5dnN8jXZ3YIGEhYuOUn45aoCDkp16hl5IjYJvjWKcnoGQpqyPlpOhr3aElaqrq56Bq7VAAAOw==");
+ height: 100%;
+ filter: alpha(opacity=25);
+ opacity: 0.25
+}
+
+.ui-progressbar-indeterminate .ui-progressbar-value {
+ background-image: none
+}
+
+.ui-selectmenu-menu {
+ padding: 0;
+ margin: 0;
+ position: absolute;
+ top: 0;
+ left: 0;
+ display: none
+}
+
+.ui-selectmenu-menu .ui-menu {
+ overflow: auto;
+ overflow-x: hidden;
+ padding-bottom: 1px
+}
+
+.ui-selectmenu-menu .ui-menu .ui-selectmenu-optgroup {
+ font-size: 1em;
+ font-weight: bold;
+ line-height: 1.5;
+ padding: 2px 0.4em;
+ margin: 0.5em 0 0 0;
+ height: auto;
+ border: 0
+}
+
+.ui-selectmenu-open {
+ display: block
+}
+
+.ui-selectmenu-button {
+ display: inline-block;
+ overflow: hidden;
+ position: relative;
+ text-decoration: none;
+ cursor: pointer
+}
+
+.ui-selectmenu-button span.ui-icon {
+ right: 0.5em;
+ left: auto;
+ margin-top: -8px;
+ position: absolute;
+ top: 50%
+}
+
+.ui-selectmenu-button span.ui-selectmenu-text {
+ text-align: left;
+ padding: 0.4em 2.1em 0.4em 1em;
+ display: block;
+ line-height: 1.4;
+ overflow: hidden;
+ text-overflow: ellipsis;
+ white-space: nowrap
+}
+
+.ui-slider {
+ position: relative;
+ text-align: left
+}
+
+.ui-slider .ui-slider-handle {
+ position: absolute;
+ z-index: 2;
+ width: 1.2em;
+ height: 1.2em;
+ cursor: default;
+ -ms-touch-action: none;
+ touch-action: none
+}
+
+.ui-slider .ui-slider-range {
+ position: absolute;
+ z-index: 1;
+ font-size: .7em;
+ display: block;
+ border: 0;
+ background-position: 0 0
+}
+
+.ui-slider.ui-state-disabled .ui-slider-handle, .ui-slider.ui-state-disabled .ui-slider-range {
+ filter: inherit
+}
+
+.ui-slider-horizontal {
+ height: .8em
+}
+
+.ui-slider-horizontal .ui-slider-handle {
+ top: -.3em;
+ margin-left: -.6em
+}
+
+.ui-slider-horizontal .ui-slider-range {
+ top: 0;
+ height: 100%
+}
+
+.ui-slider-horizontal .ui-slider-range-min {
+ left: 0
+}
+
+.ui-slider-horizontal .ui-slider-range-max {
+ right: 0
+}
+
+.ui-slider-vertical {
+ width: .8em;
+ height: 100px
+}
+
+.ui-slider-vertical .ui-slider-handle {
+ left: -.3em;
+ margin-left: 0;
+ margin-bottom: -.6em
+}
+
+.ui-slider-vertical .ui-slider-range {
+ left: 0;
+ width: 100%
+}
+
+.ui-slider-vertical .ui-slider-range-min {
+ bottom: 0
+}
+
+.ui-slider-vertical .ui-slider-range-max {
+ top: 0
+}
+
+.ui-spinner {
+ position: relative;
+ display: inline-block;
+ overflow: hidden;
+ padding: 0;
+ vertical-align: middle
+}
+
+.ui-spinner-input {
+ border: none;
+ background: none;
+ color: inherit;
+ padding: 0;
+ margin: .2em 0;
+ vertical-align: middle;
+ margin-left: .4em;
+ margin-right: 22px
+}
+
+.ui-spinner-button {
+ width: 16px;
+ height: 50%;
+ font-size: .5em;
+ padding: 0;
+ margin: 0;
+ text-align: center;
+ position: absolute;
+ cursor: default;
+ display: block;
+ overflow: hidden;
+ right: 0
+}
+
+.ui-spinner a.ui-spinner-button {
+ border-top: none;
+ border-bottom: none;
+ border-right: none
+}
+
+.ui-spinner .ui-icon {
+ position: absolute;
+ margin-top: -8px;
+ top: 50%;
+ left: 0
+}
+
+.ui-spinner-up {
+ top: 0
+}
+
+.ui-spinner-down {
+ bottom: 0
+}
+
+.ui-spinner .ui-icon-triangle-1-s {
+ background-position: -65px -16px
+}
+
+.ui-tabs {
+ position: relative;
+ padding: .2em
+}
+
+.ui-tabs .ui-tabs-nav {
+ margin: 0;
+ padding: .2em .2em 0
+}
+
+.ui-tabs .ui-tabs-nav li {
+ list-style: none;
+ float: left;
+ position: relative;
+ top: 0;
+ margin: 1px .2em 0 0;
+ border-bottom-width: 0;
+ padding: 0;
+ white-space: nowrap
+}
+
+.ui-tabs .ui-tabs-nav .ui-tabs-anchor {
+ float: left;
+ padding: .5em 1em;
+ text-decoration: none
+}
+
+.ui-tabs .ui-tabs-nav li.ui-tabs-active {
+ margin-bottom: -1px;
+ padding-bottom: 1px
+}
+
+.ui-tabs .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor, .ui-tabs .ui-tabs-nav li.ui-state-disabled .ui-tabs-anchor, .ui-tabs .ui-tabs-nav li.ui-tabs-loading .ui-tabs-anchor {
+ cursor: text
+}
+
+.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor {
+ cursor: pointer
+}
+
+.ui-tabs .ui-tabs-panel {
+ display: block;
+ border-width: 0;
+ padding: 1em 1.4em;
+ background: none
+}
+
+.ui-tooltip {
+ padding: 8px;
+ position: absolute;
+ z-index: 9999;
+ max-width: 300px;
+ -webkit-box-shadow: 0 0 5px #aaa;
+ box-shadow: 0 0 5px #aaa
+}
+
+body .ui-tooltip {
+ border-width: 2px
+}
+
+.ui-widget {
+ font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif;
+ font-size: 1.1em
+}
+
+.ui-widget .ui-widget {
+ font-size: 1em
+}
+
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button {
+ font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif;
+ font-size: 1em
+}
+
+.ui-widget-content {
+ border: 1px solid #ddd;
+ background: #eee url("images/ui-bg_highlight-soft_100_eeeeee_1x100.png") 50% top repeat-x;
+ color: #333
+}
+
+.ui-widget-content a {
+ color: #333
+}
+
+.ui-widget-header {
+ border: 1px solid #e78f08;
+ background: #f6a828 url("images/ui-bg_gloss-wave_35_f6a828_500x100.png") 50% 50% repeat-x;
+ color: #fff;
+ font-weight: bold
+}
+
+.ui-widget-header a {
+ color: #fff
+}
+
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default {
+ border: 1px solid #ccc;
+ background: #f6f6f6 url("images/ui-bg_glass_100_f6f6f6_1x400.png") 50% 50% repeat-x;
+ font-weight: bold;
+ color: #1c94c4
+}
+
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited {
+ color: #1c94c4;
+ text-decoration: none
+}
+
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus {
+ border: 1px solid #fbcb09;
+ background: #fdf5ce url("images/ui-bg_glass_100_fdf5ce_1x400.png") 50% 50% repeat-x;
+ font-weight: bold;
+ color: #c77405
+}
+
+.ui-state-hover a, .ui-state-hover a:hover, .ui-state-hover a:link, .ui-state-hover a:visited, .ui-state-focus a, .ui-state-focus a:hover, .ui-state-focus a:link, .ui-state-focus a:visited {
+ color: #c77405;
+ text-decoration: none
+}
+
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active {
+ border: 1px solid #fbd850;
+ background: #fff url("images/ui-bg_glass_65_ffffff_1x400.png") 50% 50% repeat-x;
+ font-weight: bold;
+ color: #eb8f00
+}
+
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited {
+ color: #eb8f00;
+ text-decoration: none
+}
+
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {
+ border: 1px solid #fed22f;
+ background: #ffe45c url("images/ui-bg_highlight-soft_75_ffe45c_1x100.png") 50% top repeat-x;
+ color: #363636
+}
+
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a, .ui-widget-header .ui-state-highlight a {
+ color: #363636
+}
+
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {
+ border: 1px solid #cd0a0a;
+ background: #b81900 url("images/ui-bg_diagonals-thick_18_b81900_40x40.png") 50% 50% repeat;
+ color: #fff
+}
+
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a {
+ color: #fff
+}
+
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text {
+ color: #fff
+}
+
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary {
+ font-weight: bold
+}
+
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary {
+ opacity: .7;
+ filter: Alpha(Opacity=70);
+ font-weight: normal
+}
+
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled {
+ opacity: .35;
+ filter: Alpha(Opacity=35);
+ background-image: none
+}
+
+.ui-state-disabled .ui-icon {
+ filter: Alpha(Opacity=35)
+}
+
+.ui-icon {
+ width: 16px;
+ height: 16px
+}
+
+.ui-icon, .ui-widget-content .ui-icon {
+ background-image: url("images/ui-icons_222222_256x240.png")
+}
+
+.ui-widget-header .ui-icon {
+ background-image: url("images/ui-icons_ffffff_256x240.png")
+}
+
+.ui-state-default .ui-icon {
+ background-image: url("images/ui-icons_ef8c08_256x240.png")
+}
+
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {
+ background-image: url("images/ui-icons_ef8c08_256x240.png")
+}
+
+.ui-state-active .ui-icon {
+ background-image: url("images/ui-icons_ef8c08_256x240.png")
+}
+
+.ui-state-highlight .ui-icon {
+ background-image: url("images/ui-icons_228ef1_256x240.png")
+}
+
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {
+ background-image: url("images/ui-icons_ffd27a_256x240.png")
+}
+
+.ui-icon-blank {
+ background-position: 16px 16px
+}
+
+.ui-icon-carat-1-n {
+ background-position: 0 0
+}
+
+.ui-icon-carat-1-ne {
+ background-position: -16px 0
+}
+
+.ui-icon-carat-1-e {
+ background-position: -32px 0
+}
+
+.ui-icon-carat-1-se {
+ background-position: -48px 0
+}
+
+.ui-icon-carat-1-s {
+ background-position: -64px 0
+}
+
+.ui-icon-carat-1-sw {
+ background-position: -80px 0
+}
+
+.ui-icon-carat-1-w {
+ background-position: -96px 0
+}
+
+.ui-icon-carat-1-nw {
+ background-position: -112px 0
+}
+
+.ui-icon-carat-2-n-s {
+ background-position: -128px 0
+}
+
+.ui-icon-carat-2-e-w {
+ background-position: -144px 0
+}
+
+.ui-icon-triangle-1-n {
+ background-position: 0 -16px
+}
+
+.ui-icon-triangle-1-ne {
+ background-position: -16px -16px
+}
+
+.ui-icon-triangle-1-e {
+ background-position: -32px -16px
+}
+
+.ui-icon-triangle-1-se {
+ background-position: -48px -16px
+}
+
+.ui-icon-triangle-1-s {
+ background-position: -64px -16px
+}
+
+.ui-icon-triangle-1-sw {
+ background-position: -80px -16px
+}
+
+.ui-icon-triangle-1-w {
+ background-position: -96px -16px
+}
+
+.ui-icon-triangle-1-nw {
+ background-position: -112px -16px
+}
+
+.ui-icon-triangle-2-n-s {
+ background-position: -128px -16px
+}
+
+.ui-icon-triangle-2-e-w {
+ background-position: -144px -16px
+}
+
+.ui-icon-arrow-1-n {
+ background-position: 0 -32px
+}
+
+.ui-icon-arrow-1-ne {
+ background-position: -16px -32px
+}
+
+.ui-icon-arrow-1-e {
+ background-position: -32px -32px
+}
+
+.ui-icon-arrow-1-se {
+ background-position: -48px -32px
+}
+
+.ui-icon-arrow-1-s {
+ background-position: -64px -32px
+}
+
+.ui-icon-arrow-1-sw {
+ background-position: -80px -32px
+}
+
+.ui-icon-arrow-1-w {
+ background-position: -96px -32px
+}
+
+.ui-icon-arrow-1-nw {
+ background-position: -112px -32px
+}
+
+.ui-icon-arrow-2-n-s {
+ background-position: -128px -32px
+}
+
+.ui-icon-arrow-2-ne-sw {
+ background-position: -144px -32px
+}
+
+.ui-icon-arrow-2-e-w {
+ background-position: -160px -32px
+}
+
+.ui-icon-arrow-2-se-nw {
+ background-position: -176px -32px
+}
+
+.ui-icon-arrowstop-1-n {
+ background-position: -192px -32px
+}
+
+.ui-icon-arrowstop-1-e {
+ background-position: -208px -32px
+}
+
+.ui-icon-arrowstop-1-s {
+ background-position: -224px -32px
+}
+
+.ui-icon-arrowstop-1-w {
+ background-position: -240px -32px
+}
+
+.ui-icon-arrowthick-1-n {
+ background-position: 0 -48px
+}
+
+.ui-icon-arrowthick-1-ne {
+ background-position: -16px -48px
+}
+
+.ui-icon-arrowthick-1-e {
+ background-position: -32px -48px
+}
+
+.ui-icon-arrowthick-1-se {
+ background-position: -48px -48px
+}
+
+.ui-icon-arrowthick-1-s {
+ background-position: -64px -48px
+}
+
+.ui-icon-arrowthick-1-sw {
+ background-position: -80px -48px
+}
+
+.ui-icon-arrowthick-1-w {
+ background-position: -96px -48px
+}
+
+.ui-icon-arrowthick-1-nw {
+ background-position: -112px -48px
+}
+
+.ui-icon-arrowthick-2-n-s {
+ background-position: -128px -48px
+}
+
+.ui-icon-arrowthick-2-ne-sw {
+ background-position: -144px -48px
+}
+
+.ui-icon-arrowthick-2-e-w {
+ background-position: -160px -48px
+}
+
+.ui-icon-arrowthick-2-se-nw {
+ background-position: -176px -48px
+}
+
+.ui-icon-arrowthickstop-1-n {
+ background-position: -192px -48px
+}
+
+.ui-icon-arrowthickstop-1-e {
+ background-position: -208px -48px
+}
+
+.ui-icon-arrowthickstop-1-s {
+ background-position: -224px -48px
+}
+
+.ui-icon-arrowthickstop-1-w {
+ background-position: -240px -48px
+}
+
+.ui-icon-arrowreturnthick-1-w {
+ background-position: 0 -64px
+}
+
+.ui-icon-arrowreturnthick-1-n {
+ background-position: -16px -64px
+}
+
+.ui-icon-arrowreturnthick-1-e {
+ background-position: -32px -64px
+}
+
+.ui-icon-arrowreturnthick-1-s {
+ background-position: -48px -64px
+}
+
+.ui-icon-arrowreturn-1-w {
+ background-position: -64px -64px
+}
+
+.ui-icon-arrowreturn-1-n {
+ background-position: -80px -64px
+}
+
+.ui-icon-arrowreturn-1-e {
+ background-position: -96px -64px
+}
+
+.ui-icon-arrowreturn-1-s {
+ background-position: -112px -64px
+}
+
+.ui-icon-arrowrefresh-1-w {
+ background-position: -128px -64px
+}
+
+.ui-icon-arrowrefresh-1-n {
+ background-position: -144px -64px
+}
+
+.ui-icon-arrowrefresh-1-e {
+ background-position: -160px -64px
+}
+
+.ui-icon-arrowrefresh-1-s {
+ background-position: -176px -64px
+}
+
+.ui-icon-arrow-4 {
+ background-position: 0 -80px
+}
+
+.ui-icon-arrow-4-diag {
+ background-position: -16px -80px
+}
+
+.ui-icon-extlink {
+ background-position: -32px -80px
+}
+
+.ui-icon-newwin {
+ background-position: -48px -80px
+}
+
+.ui-icon-refresh {
+ background-position: -64px -80px
+}
+
+.ui-icon-shuffle {
+ background-position: -80px -80px
+}
+
+.ui-icon-transfer-e-w {
+ background-position: -96px -80px
+}
+
+.ui-icon-transferthick-e-w {
+ background-position: -112px -80px
+}
+
+.ui-icon-folder-collapsed {
+ background-position: 0 -96px
+}
+
+.ui-icon-folder-open {
+ background-position: -16px -96px
+}
+
+.ui-icon-document {
+ background-position: -32px -96px
+}
+
+.ui-icon-document-b {
+ background-position: -48px -96px
+}
+
+.ui-icon-note {
+ background-position: -64px -96px
+}
+
+.ui-icon-mail-closed {
+ background-position: -80px -96px
+}
+
+.ui-icon-mail-open {
+ background-position: -96px -96px
+}
+
+.ui-icon-suitcase {
+ background-position: -112px -96px
+}
+
+.ui-icon-comment {
+ background-position: -128px -96px
+}
+
+.ui-icon-person {
+ background-position: -144px -96px
+}
+
+.ui-icon-print {
+ background-position: -160px -96px
+}
+
+.ui-icon-trash {
+ background-position: -176px -96px
+}
+
+.ui-icon-locked {
+ background-position: -192px -96px
+}
+
+.ui-icon-unlocked {
+ background-position: -208px -96px
+}
+
+.ui-icon-bookmark {
+ background-position: -224px -96px
+}
+
+.ui-icon-tag {
+ background-position: -240px -96px
+}
+
+.ui-icon-home {
+ background-position: 0 -112px
+}
+
+.ui-icon-flag {
+ background-position: -16px -112px
+}
+
+.ui-icon-calendar {
+ background-position: -32px -112px
+}
+
+.ui-icon-cart {
+ background-position: -48px -112px
+}
+
+.ui-icon-pencil {
+ background-position: -64px -112px
+}
+
+.ui-icon-clock {
+ background-position: -80px -112px
+}
+
+.ui-icon-disk {
+ background-position: -96px -112px
+}
+
+.ui-icon-calculator {
+ background-position: -112px -112px
+}
+
+.ui-icon-zoomin {
+ background-position: -128px -112px
+}
+
+.ui-icon-zoomout {
+ background-position: -144px -112px
+}
+
+.ui-icon-search {
+ background-position: -160px -112px
+}
+
+.ui-icon-wrench {
+ background-position: -176px -112px
+}
+
+.ui-icon-gear {
+ background-position: -192px -112px
+}
+
+.ui-icon-heart {
+ background-position: -208px -112px
+}
+
+.ui-icon-star {
+ background-position: -224px -112px
+}
+
+.ui-icon-link {
+ background-position: -240px -112px
+}
+
+.ui-icon-cancel {
+ background-position: 0 -128px
+}
+
+.ui-icon-plus {
+ background-position: -16px -128px
+}
+
+.ui-icon-plusthick {
+ background-position: -32px -128px
+}
+
+.ui-icon-minus {
+ background-position: -48px -128px
+}
+
+.ui-icon-minusthick {
+ background-position: -64px -128px
+}
+
+.ui-icon-close {
+ background-position: -80px -128px
+}
+
+.ui-icon-closethick {
+ background-position: -96px -128px
+}
+
+.ui-icon-key {
+ background-position: -112px -128px
+}
+
+.ui-icon-lightbulb {
+ background-position: -128px -128px
+}
+
+.ui-icon-scissors {
+ background-position: -144px -128px
+}
+
+.ui-icon-clipboard {
+ background-position: -160px -128px
+}
+
+.ui-icon-copy {
+ background-position: -176px -128px
+}
+
+.ui-icon-contact {
+ background-position: -192px -128px
+}
+
+.ui-icon-image {
+ background-position: -208px -128px
+}
+
+.ui-icon-video {
+ background-position: -224px -128px
+}
+
+.ui-icon-script {
+ background-position: -240px -128px
+}
+
+.ui-icon-alert {
+ background-position: 0 -144px
+}
+
+.ui-icon-info {
+ background-position: -16px -144px
+}
+
+.ui-icon-notice {
+ background-position: -32px -144px
+}
+
+.ui-icon-help {
+ background-position: -48px -144px
+}
+
+.ui-icon-check {
+ background-position: -64px -144px
+}
+
+.ui-icon-bullet {
+ background-position: -80px -144px
+}
+
+.ui-icon-radio-on {
+ background-position: -96px -144px
+}
+
+.ui-icon-radio-off {
+ background-position: -112px -144px
+}
+
+.ui-icon-pin-w {
+ background-position: -128px -144px
+}
+
+.ui-icon-pin-s {
+ background-position: -144px -144px
+}
+
+.ui-icon-play {
+ background-position: 0 -160px
+}
+
+.ui-icon-pause {
+ background-position: -16px -160px
+}
+
+.ui-icon-seek-next {
+ background-position: -32px -160px
+}
+
+.ui-icon-seek-prev {
+ background-position: -48px -160px
+}
+
+.ui-icon-seek-end {
+ background-position: -64px -160px
+}
+
+.ui-icon-seek-start {
+ background-position: -80px -160px
+}
+
+.ui-icon-seek-first {
+ background-position: -80px -160px
+}
+
+.ui-icon-stop {
+ background-position: -96px -160px
+}
+
+.ui-icon-eject {
+ background-position: -112px -160px
+}
+
+.ui-icon-volume-off {
+ background-position: -128px -160px
+}
+
+.ui-icon-volume-on {
+ background-position: -144px -160px
+}
+
+.ui-icon-power {
+ background-position: 0 -176px
+}
+
+.ui-icon-signal-diag {
+ background-position: -16px -176px
+}
+
+.ui-icon-signal {
+ background-position: -32px -176px
+}
+
+.ui-icon-battery-0 {
+ background-position: -48px -176px
+}
+
+.ui-icon-battery-1 {
+ background-position: -64px -176px
+}
+
+.ui-icon-battery-2 {
+ background-position: -80px -176px
+}
+
+.ui-icon-battery-3 {
+ background-position: -96px -176px
+}
+
+.ui-icon-circle-plus {
+ background-position: 0 -192px
+}
+
+.ui-icon-circle-minus {
+ background-position: -16px -192px
+}
+
+.ui-icon-circle-close {
+ background-position: -32px -192px
+}
+
+.ui-icon-circle-triangle-e {
+ background-position: -48px -192px
+}
+
+.ui-icon-circle-triangle-s {
+ background-position: -64px -192px
+}
+
+.ui-icon-circle-triangle-w {
+ background-position: -80px -192px
+}
+
+.ui-icon-circle-triangle-n {
+ background-position: -96px -192px
+}
+
+.ui-icon-circle-arrow-e {
+ background-position: -112px -192px
+}
+
+.ui-icon-circle-arrow-s {
+ background-position: -128px -192px
+}
+
+.ui-icon-circle-arrow-w {
+ background-position: -144px -192px
+}
+
+.ui-icon-circle-arrow-n {
+ background-position: -160px -192px
+}
+
+.ui-icon-circle-zoomin {
+ background-position: -176px -192px
+}
+
+.ui-icon-circle-zoomout {
+ background-position: -192px -192px
+}
+
+.ui-icon-circle-check {
+ background-position: -208px -192px
+}
+
+.ui-icon-circlesmall-plus {
+ background-position: 0 -208px
+}
+
+.ui-icon-circlesmall-minus {
+ background-position: -16px -208px
+}
+
+.ui-icon-circlesmall-close {
+ background-position: -32px -208px
+}
+
+.ui-icon-squaresmall-plus {
+ background-position: -48px -208px
+}
+
+.ui-icon-squaresmall-minus {
+ background-position: -64px -208px
+}
+
+.ui-icon-squaresmall-close {
+ background-position: -80px -208px
+}
+
+.ui-icon-grip-dotted-vertical {
+ background-position: 0 -224px
+}
+
+.ui-icon-grip-dotted-horizontal {
+ background-position: -16px -224px
+}
+
+.ui-icon-grip-solid-vertical {
+ background-position: -32px -224px
+}
+
+.ui-icon-grip-solid-horizontal {
+ background-position: -48px -224px
+}
+
+.ui-icon-gripsmall-diagonal-se {
+ background-position: -64px -224px
+}
+
+.ui-icon-grip-diagonal-se {
+ background-position: -80px -224px
+}
+
+.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl {
+ border-top-left-radius: 4px
+}
+
+.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr {
+ border-top-right-radius: 4px
+}
+
+.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl {
+ border-bottom-left-radius: 4px
+}
+
+.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br {
+ border-bottom-right-radius: 4px
+}
+
+.ui-widget-overlay {
+ background: #666 url("images/ui-bg_diagonals-thick_20_666666_40x40.png") 50% 50% repeat;
+ opacity: .5;
+ filter: Alpha(Opacity=50)
+}
+
+.ui-widget-shadow {
+ margin: -5px 0 0 -5px;
+ padding: 5px;
+ background: #000 url("images/ui-bg_flat_10_000000_40x100.png") 50% 50% repeat-x;
+ opacity: .2;
+ filter: Alpha(Opacity=20);
+ border-radius: 5px
+}
\ No newline at end of file diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.min.js b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.min.js new file mode 100644 index 00000000..242fcb5b --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.min.js @@ -0,0 +1,5102 @@ +/*! jQuery UI - v1.11.4 - 2015-04-12
+ * http://jqueryui.com
+ * Includes: core.js, widget.js, mouse.js, position.js, draggable.js, droppable.js, resizable.js, selectable.js, sortable.js, accordion.js, autocomplete.js, button.js, datepicker.js, dialog.js, menu.js, progressbar.js, selectmenu.js, slider.js, spinner.js, tabs.js, tooltip.js, effect.js, effect-blind.js, effect-bounce.js, effect-clip.js, effect-drop.js, effect-explode.js, effect-fade.js, effect-fold.js, effect-highlight.js, effect-puff.js, effect-pulsate.js, effect-scale.js, effect-shake.js, effect-size.js, effect-slide.js, effect-transfer.js
+ * Copyright 2015 jQuery Foundation and other contributors; Licensed MIT */
+
+(function (e) {
+ "function" == typeof define && define.amd ? define(["jquery"], e) : e(jQuery)
+})(function (e) {
+ function t(t, s) {
+ var n, a, o, r = t.nodeName.toLowerCase();
+ return "area" === r ? (n = t.parentNode, a = n.name, t.href && a && "map" === n.nodeName.toLowerCase() ? (o = e("img[usemap='#" + a + "']")[0], !!o && i(o)) : !1) : (/^(input|select|textarea|button|object)$/.test(r) ? !t.disabled : "a" === r ? t.href || s : s) && i(t)
+ }
+
+ function i(t) {
+ return e.expr.filters.visible(t) && !e(t).parents().addBack().filter(function () {
+ return "hidden" === e.css(this, "visibility")
+ }).length
+ }
+
+ function s(e) {
+ for (var t, i; e.length && e[0] !== document;) {
+ if (t = e.css("position"), ("absolute" === t || "relative" === t || "fixed" === t) && (i = parseInt(e.css("zIndex"), 10), !isNaN(i) && 0 !== i))return i;
+ e = e.parent()
+ }
+ return 0
+ }
+
+ function n() {
+ this._curInst = null, this._keyEvent = !1, this._disabledInputs = [], this._datepickerShowing = !1, this._inDialog = !1, this._mainDivId = "ui-datepicker-div", this._inlineClass = "ui-datepicker-inline", this._appendClass = "ui-datepicker-append", this._triggerClass = "ui-datepicker-trigger", this._dialogClass = "ui-datepicker-dialog", this._disableClass = "ui-datepicker-disabled", this._unselectableClass = "ui-datepicker-unselectable", this._currentClass = "ui-datepicker-current-day", this._dayOverClass = "ui-datepicker-days-cell-over", this.regional = [], this.regional[""] = {
+ closeText: "Done",
+ prevText: "Prev",
+ nextText: "Next",
+ currentText: "Today",
+ monthNames: ["January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December"],
+ monthNamesShort: ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"],
+ dayNames: ["Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"],
+ dayNamesShort: ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"],
+ dayNamesMin: ["Su", "Mo", "Tu", "We", "Th", "Fr", "Sa"],
+ weekHeader: "Wk",
+ dateFormat: "mm/dd/yy",
+ firstDay: 0,
+ isRTL: !1,
+ showMonthAfterYear: !1,
+ yearSuffix: ""
+ }, this._defaults = {
+ showOn: "focus",
+ showAnim: "fadeIn",
+ showOptions: {},
+ defaultDate: null,
+ appendText: "",
+ buttonText: "...",
+ buttonImage: "",
+ buttonImageOnly: !1,
+ hideIfNoPrevNext: !1,
+ navigationAsDateFormat: !1,
+ gotoCurrent: !1,
+ changeMonth: !1,
+ changeYear: !1,
+ yearRange: "c-10:c+10",
+ showOtherMonths: !1,
+ selectOtherMonths: !1,
+ showWeek: !1,
+ calculateWeek: this.iso8601Week,
+ shortYearCutoff: "+10",
+ minDate: null,
+ maxDate: null,
+ duration: "fast",
+ beforeShowDay: null,
+ beforeShow: null,
+ onSelect: null,
+ onChangeMonthYear: null,
+ onClose: null,
+ numberOfMonths: 1,
+ showCurrentAtPos: 0,
+ stepMonths: 1,
+ stepBigMonths: 12,
+ altField: "",
+ altFormat: "",
+ constrainInput: !0,
+ showButtonPanel: !1,
+ autoSize: !1,
+ disabled: !1
+ }, e.extend(this._defaults, this.regional[""]), this.regional.en = e.extend(!0, {}, this.regional[""]), this.regional["en-US"] = e.extend(!0, {}, this.regional.en), this.dpDiv = a(e("<div id='" + this._mainDivId + "' class='ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>"))
+ }
+
+ function a(t) {
+ var i = "button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";
+ return t.delegate(i, "mouseout", function () {
+ e(this).removeClass("ui-state-hover"), -1 !== this.className.indexOf("ui-datepicker-prev") && e(this).removeClass("ui-datepicker-prev-hover"), -1 !== this.className.indexOf("ui-datepicker-next") && e(this).removeClass("ui-datepicker-next-hover")
+ }).delegate(i, "mouseover", o)
+ }
+
+ function o() {
+ e.datepicker._isDisabledDatepicker(v.inline ? v.dpDiv.parent()[0] : v.input[0]) || (e(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"), e(this).addClass("ui-state-hover"), -1 !== this.className.indexOf("ui-datepicker-prev") && e(this).addClass("ui-datepicker-prev-hover"), -1 !== this.className.indexOf("ui-datepicker-next") && e(this).addClass("ui-datepicker-next-hover"))
+ }
+
+ function r(t, i) {
+ e.extend(t, i);
+ for (var s in i)null == i[s] && (t[s] = i[s]);
+ return t
+ }
+
+ function h(e) {
+ return function () {
+ var t = this.element.val();
+ e.apply(this, arguments), this._refresh(), t !== this.element.val() && this._trigger("change")
+ }
+ }
+
+ e.ui = e.ui || {}, e.extend(e.ui, {
+ version: "1.11.4",
+ keyCode: {
+ BACKSPACE: 8,
+ COMMA: 188,
+ DELETE: 46,
+ DOWN: 40,
+ END: 35,
+ ENTER: 13,
+ ESCAPE: 27,
+ HOME: 36,
+ LEFT: 37,
+ PAGE_DOWN: 34,
+ PAGE_UP: 33,
+ PERIOD: 190,
+ RIGHT: 39,
+ SPACE: 32,
+ TAB: 9,
+ UP: 38
+ }
+ }), e.fn.extend({
+ scrollParent: function (t) {
+ var i = this.css("position"), s = "absolute" === i, n = t ? /(auto|scroll|hidden)/ : /(auto|scroll)/, a = this.parents().filter(function () {
+ var t = e(this);
+ return s && "static" === t.css("position") ? !1 : n.test(t.css("overflow") + t.css("overflow-y") + t.css("overflow-x"))
+ }).eq(0);
+ return "fixed" !== i && a.length ? a : e(this[0].ownerDocument || document)
+ }, uniqueId: function () {
+ var e = 0;
+ return function () {
+ return this.each(function () {
+ this.id || (this.id = "ui-id-" + ++e)
+ })
+ }
+ }(), removeUniqueId: function () {
+ return this.each(function () {
+ /^ui-id-\d+$/.test(this.id) && e(this).removeAttr("id")
+ })
+ }
+ }), e.extend(e.expr[":"], {
+ data: e.expr.createPseudo ? e.expr.createPseudo(function (t) {
+ return function (i) {
+ return !!e.data(i, t)
+ }
+ }) : function (t, i, s) {
+ return !!e.data(t, s[3])
+ }, focusable: function (i) {
+ return t(i, !isNaN(e.attr(i, "tabindex")))
+ }, tabbable: function (i) {
+ var s = e.attr(i, "tabindex"), n = isNaN(s);
+ return (n || s >= 0) && t(i, !n)
+ }
+ }), e("<a>").outerWidth(1).jquery || e.each(["Width", "Height"], function (t, i) {
+ function s(t, i, s, a) {
+ return e.each(n, function () {
+ i -= parseFloat(e.css(t, "padding" + this)) || 0, s && (i -= parseFloat(e.css(t, "border" + this + "Width")) || 0), a && (i -= parseFloat(e.css(t, "margin" + this)) || 0)
+ }), i
+ }
+
+ var n = "Width" === i ? ["Left", "Right"] : ["Top", "Bottom"], a = i.toLowerCase(), o = {
+ innerWidth: e.fn.innerWidth,
+ innerHeight: e.fn.innerHeight,
+ outerWidth: e.fn.outerWidth,
+ outerHeight: e.fn.outerHeight
+ };
+ e.fn["inner" + i] = function (t) {
+ return void 0 === t ? o["inner" + i].call(this) : this.each(function () {
+ e(this).css(a, s(this, t) + "px")
+ })
+ }, e.fn["outer" + i] = function (t, n) {
+ return "number" != typeof t ? o["outer" + i].call(this, t) : this.each(function () {
+ e(this).css(a, s(this, t, !0, n) + "px")
+ })
+ }
+ }), e.fn.addBack || (e.fn.addBack = function (e) {
+ return this.add(null == e ? this.prevObject : this.prevObject.filter(e))
+ }), e("<a>").data("a-b", "a").removeData("a-b").data("a-b") && (e.fn.removeData = function (t) {
+ return function (i) {
+ return arguments.length ? t.call(this, e.camelCase(i)) : t.call(this)
+ }
+ }(e.fn.removeData)), e.ui.ie = !!/msie [\w.]+/.exec(navigator.userAgent.toLowerCase()), e.fn.extend({
+ focus: function (t) {
+ return function (i, s) {
+ return "number" == typeof i ? this.each(function () {
+ var t = this;
+ setTimeout(function () {
+ e(t).focus(), s && s.call(t)
+ }, i)
+ }) : t.apply(this, arguments)
+ }
+ }(e.fn.focus), disableSelection: function () {
+ var e = "onselectstart"in document.createElement("div") ? "selectstart" : "mousedown";
+ return function () {
+ return this.bind(e + ".ui-disableSelection", function (e) {
+ e.preventDefault()
+ })
+ }
+ }(), enableSelection: function () {
+ return this.unbind(".ui-disableSelection")
+ }, zIndex: function (t) {
+ if (void 0 !== t)return this.css("zIndex", t);
+ if (this.length)for (var i, s, n = e(this[0]); n.length && n[0] !== document;) {
+ if (i = n.css("position"), ("absolute" === i || "relative" === i || "fixed" === i) && (s = parseInt(n.css("zIndex"), 10), !isNaN(s) && 0 !== s))return s;
+ n = n.parent()
+ }
+ return 0
+ }
+ }), e.ui.plugin = {
+ add: function (t, i, s) {
+ var n, a = e.ui[t].prototype;
+ for (n in s)a.plugins[n] = a.plugins[n] || [], a.plugins[n].push([i, s[n]])
+ }, call: function (e, t, i, s) {
+ var n, a = e.plugins[t];
+ if (a && (s || e.element[0].parentNode && 11 !== e.element[0].parentNode.nodeType))for (n = 0; a.length > n; n++)e.options[a[n][0]] && a[n][1].apply(e.element, i)
+ }
+ };
+ var l = 0, u = Array.prototype.slice;
+ e.cleanData = function (t) {
+ return function (i) {
+ var s, n, a;
+ for (a = 0; null != (n = i[a]); a++)try {
+ s = e._data(n, "events"), s && s.remove && e(n).triggerHandler("remove")
+ } catch (o) {
+ }
+ t(i)
+ }
+ }(e.cleanData), e.widget = function (t, i, s) {
+ var n, a, o, r, h = {}, l = t.split(".")[0];
+ return t = t.split(".")[1], n = l + "-" + t, s || (s = i, i = e.Widget), e.expr[":"][n.toLowerCase()] = function (t) {
+ return !!e.data(t, n)
+ }, e[l] = e[l] || {}, a = e[l][t], o = e[l][t] = function (e, t) {
+ return this._createWidget ? (arguments.length && this._createWidget(e, t), void 0) : new o(e, t)
+ }, e.extend(o, a, {
+ version: s.version,
+ _proto: e.extend({}, s),
+ _childConstructors: []
+ }), r = new i, r.options = e.widget.extend({}, r.options), e.each(s, function (t, s) {
+ return e.isFunction(s) ? (h[t] = function () {
+ var e = function () {
+ return i.prototype[t].apply(this, arguments)
+ }, n = function (e) {
+ return i.prototype[t].apply(this, e)
+ };
+ return function () {
+ var t, i = this._super, a = this._superApply;
+ return this._super = e, this._superApply = n, t = s.apply(this, arguments), this._super = i, this._superApply = a, t
+ }
+ }(), void 0) : (h[t] = s, void 0)
+ }), o.prototype = e.widget.extend(r, {widgetEventPrefix: a ? r.widgetEventPrefix || t : t}, h, {
+ constructor: o,
+ namespace: l,
+ widgetName: t,
+ widgetFullName: n
+ }), a ? (e.each(a._childConstructors, function (t, i) {
+ var s = i.prototype;
+ e.widget(s.namespace + "." + s.widgetName, o, i._proto)
+ }), delete a._childConstructors) : i._childConstructors.push(o), e.widget.bridge(t, o), o
+ }, e.widget.extend = function (t) {
+ for (var i, s, n = u.call(arguments, 1), a = 0, o = n.length; o > a; a++)for (i in n[a])s = n[a][i], n[a].hasOwnProperty(i) && void 0 !== s && (t[i] = e.isPlainObject(s) ? e.isPlainObject(t[i]) ? e.widget.extend({}, t[i], s) : e.widget.extend({}, s) : s);
+ return t
+ }, e.widget.bridge = function (t, i) {
+ var s = i.prototype.widgetFullName || t;
+ e.fn[t] = function (n) {
+ var a = "string" == typeof n, o = u.call(arguments, 1), r = this;
+ return a ? this.each(function () {
+ var i, a = e.data(this, s);
+ return "instance" === n ? (r = a, !1) : a ? e.isFunction(a[n]) && "_" !== n.charAt(0) ? (i = a[n].apply(a, o), i !== a && void 0 !== i ? (r = i && i.jquery ? r.pushStack(i.get()) : i, !1) : void 0) : e.error("no such method '" + n + "' for " + t + " widget instance") : e.error("cannot call methods on " + t + " prior to initialization; " + "attempted to call method '" + n + "'")
+ }) : (o.length && (n = e.widget.extend.apply(null, [n].concat(o))), this.each(function () {
+ var t = e.data(this, s);
+ t ? (t.option(n || {}), t._init && t._init()) : e.data(this, s, new i(n, this))
+ })), r
+ }
+ }, e.Widget = function () {
+ }, e.Widget._childConstructors = [], e.Widget.prototype = {
+ widgetName: "widget",
+ widgetEventPrefix: "",
+ defaultElement: "<div>",
+ options: {disabled: !1, create: null},
+ _createWidget: function (t, i) {
+ i = e(i || this.defaultElement || this)[0], this.element = e(i), this.uuid = l++, this.eventNamespace = "." + this.widgetName + this.uuid, this.bindings = e(), this.hoverable = e(), this.focusable = e(), i !== this && (e.data(i, this.widgetFullName, this), this._on(!0, this.element, {
+ remove: function (e) {
+ e.target === i && this.destroy()
+ }
+ }), this.document = e(i.style ? i.ownerDocument : i.document || i), this.window = e(this.document[0].defaultView || this.document[0].parentWindow)), this.options = e.widget.extend({}, this.options, this._getCreateOptions(), t), this._create(), this._trigger("create", null, this._getCreateEventData()), this._init()
+ },
+ _getCreateOptions: e.noop,
+ _getCreateEventData: e.noop,
+ _create: e.noop,
+ _init: e.noop,
+ destroy: function () {
+ this._destroy(), this.element.unbind(this.eventNamespace).removeData(this.widgetFullName).removeData(e.camelCase(this.widgetFullName)), this.widget().unbind(this.eventNamespace).removeAttr("aria-disabled").removeClass(this.widgetFullName + "-disabled " + "ui-state-disabled"), this.bindings.unbind(this.eventNamespace), this.hoverable.removeClass("ui-state-hover"), this.focusable.removeClass("ui-state-focus")
+ },
+ _destroy: e.noop,
+ widget: function () {
+ return this.element
+ },
+ option: function (t, i) {
+ var s, n, a, o = t;
+ if (0 === arguments.length)return e.widget.extend({}, this.options);
+ if ("string" == typeof t)if (o = {}, s = t.split("."), t = s.shift(), s.length) {
+ for (n = o[t] = e.widget.extend({}, this.options[t]), a = 0; s.length - 1 > a; a++)n[s[a]] = n[s[a]] || {}, n = n[s[a]];
+ if (t = s.pop(), 1 === arguments.length)return void 0 === n[t] ? null : n[t];
+ n[t] = i
+ } else {
+ if (1 === arguments.length)return void 0 === this.options[t] ? null : this.options[t];
+ o[t] = i
+ }
+ return this._setOptions(o), this
+ },
+ _setOptions: function (e) {
+ var t;
+ for (t in e)this._setOption(t, e[t]);
+ return this
+ },
+ _setOption: function (e, t) {
+ return this.options[e] = t, "disabled" === e && (this.widget().toggleClass(this.widgetFullName + "-disabled", !!t), t && (this.hoverable.removeClass("ui-state-hover"), this.focusable.removeClass("ui-state-focus"))), this
+ },
+ enable: function () {
+ return this._setOptions({disabled: !1})
+ },
+ disable: function () {
+ return this._setOptions({disabled: !0})
+ },
+ _on: function (t, i, s) {
+ var n, a = this;
+ "boolean" != typeof t && (s = i, i = t, t = !1), s ? (i = n = e(i), this.bindings = this.bindings.add(i)) : (s = i, i = this.element, n = this.widget()), e.each(s, function (s, o) {
+ function r() {
+ return t || a.options.disabled !== !0 && !e(this).hasClass("ui-state-disabled") ? ("string" == typeof o ? a[o] : o).apply(a, arguments) : void 0
+ }
+
+ "string" != typeof o && (r.guid = o.guid = o.guid || r.guid || e.guid++);
+ var h = s.match(/^([\w:-]*)\s*(.*)$/), l = h[1] + a.eventNamespace, u = h[2];
+ u ? n.delegate(u, l, r) : i.bind(l, r)
+ })
+ },
+ _off: function (t, i) {
+ i = (i || "").split(" ").join(this.eventNamespace + " ") + this.eventNamespace, t.unbind(i).undelegate(i), this.bindings = e(this.bindings.not(t).get()), this.focusable = e(this.focusable.not(t).get()), this.hoverable = e(this.hoverable.not(t).get())
+ },
+ _delay: function (e, t) {
+ function i() {
+ return ("string" == typeof e ? s[e] : e).apply(s, arguments)
+ }
+
+ var s = this;
+ return setTimeout(i, t || 0)
+ },
+ _hoverable: function (t) {
+ this.hoverable = this.hoverable.add(t), this._on(t, {
+ mouseenter: function (t) {
+ e(t.currentTarget).addClass("ui-state-hover")
+ }, mouseleave: function (t) {
+ e(t.currentTarget).removeClass("ui-state-hover")
+ }
+ })
+ },
+ _focusable: function (t) {
+ this.focusable = this.focusable.add(t), this._on(t, {
+ focusin: function (t) {
+ e(t.currentTarget).addClass("ui-state-focus")
+ }, focusout: function (t) {
+ e(t.currentTarget).removeClass("ui-state-focus")
+ }
+ })
+ },
+ _trigger: function (t, i, s) {
+ var n, a, o = this.options[t];
+ if (s = s || {}, i = e.Event(i), i.type = (t === this.widgetEventPrefix ? t : this.widgetEventPrefix + t).toLowerCase(), i.target = this.element[0], a = i.originalEvent)for (n in a)n in i || (i[n] = a[n]);
+ return this.element.trigger(i, s), !(e.isFunction(o) && o.apply(this.element[0], [i].concat(s)) === !1 || i.isDefaultPrevented())
+ }
+ }, e.each({show: "fadeIn", hide: "fadeOut"}, function (t, i) {
+ e.Widget.prototype["_" + t] = function (s, n, a) {
+ "string" == typeof n && (n = {effect: n});
+ var o, r = n ? n === !0 || "number" == typeof n ? i : n.effect || i : t;
+ n = n || {}, "number" == typeof n && (n = {duration: n}), o = !e.isEmptyObject(n), n.complete = a, n.delay && s.delay(n.delay), o && e.effects && e.effects.effect[r] ? s[t](n) : r !== t && s[r] ? s[r](n.duration, n.easing, a) : s.queue(function (i) {
+ e(this)[t](), a && a.call(s[0]), i()
+ })
+ }
+ }), e.widget;
+ var d = !1;
+ e(document).mouseup(function () {
+ d = !1
+ }), e.widget("ui.mouse", {
+ version: "1.11.4",
+ options: {cancel: "input,textarea,button,select,option", distance: 1, delay: 0},
+ _mouseInit: function () {
+ var t = this;
+ this.element.bind("mousedown." + this.widgetName, function (e) {
+ return t._mouseDown(e)
+ }).bind("click." + this.widgetName, function (i) {
+ return !0 === e.data(i.target, t.widgetName + ".preventClickEvent") ? (e.removeData(i.target, t.widgetName + ".preventClickEvent"), i.stopImmediatePropagation(), !1) : void 0
+ }), this.started = !1
+ },
+ _mouseDestroy: function () {
+ this.element.unbind("." + this.widgetName), this._mouseMoveDelegate && this.document.unbind("mousemove." + this.widgetName, this._mouseMoveDelegate).unbind("mouseup." + this.widgetName, this._mouseUpDelegate)
+ },
+ _mouseDown: function (t) {
+ if (!d) {
+ this._mouseMoved = !1, this._mouseStarted && this._mouseUp(t), this._mouseDownEvent = t;
+ var i = this, s = 1 === t.which, n = "string" == typeof this.options.cancel && t.target.nodeName ? e(t.target).closest(this.options.cancel).length : !1;
+ return s && !n && this._mouseCapture(t) ? (this.mouseDelayMet = !this.options.delay, this.mouseDelayMet || (this._mouseDelayTimer = setTimeout(function () {
+ i.mouseDelayMet = !0
+ }, this.options.delay)), this._mouseDistanceMet(t) && this._mouseDelayMet(t) && (this._mouseStarted = this._mouseStart(t) !== !1, !this._mouseStarted) ? (t.preventDefault(), !0) : (!0 === e.data(t.target, this.widgetName + ".preventClickEvent") && e.removeData(t.target, this.widgetName + ".preventClickEvent"), this._mouseMoveDelegate = function (e) {
+ return i._mouseMove(e)
+ }, this._mouseUpDelegate = function (e) {
+ return i._mouseUp(e)
+ }, this.document.bind("mousemove." + this.widgetName, this._mouseMoveDelegate).bind("mouseup." + this.widgetName, this._mouseUpDelegate), t.preventDefault(), d = !0, !0)) : !0
+ }
+ },
+ _mouseMove: function (t) {
+ if (this._mouseMoved) {
+ if (e.ui.ie && (!document.documentMode || 9 > document.documentMode) && !t.button)return this._mouseUp(t);
+ if (!t.which)return this._mouseUp(t)
+ }
+ return (t.which || t.button) && (this._mouseMoved = !0), this._mouseStarted ? (this._mouseDrag(t), t.preventDefault()) : (this._mouseDistanceMet(t) && this._mouseDelayMet(t) && (this._mouseStarted = this._mouseStart(this._mouseDownEvent, t) !== !1, this._mouseStarted ? this._mouseDrag(t) : this._mouseUp(t)), !this._mouseStarted)
+ },
+ _mouseUp: function (t) {
+ return this.document.unbind("mousemove." + this.widgetName, this._mouseMoveDelegate).unbind("mouseup." + this.widgetName, this._mouseUpDelegate), this._mouseStarted && (this._mouseStarted = !1, t.target === this._mouseDownEvent.target && e.data(t.target, this.widgetName + ".preventClickEvent", !0), this._mouseStop(t)), d = !1, !1
+ },
+ _mouseDistanceMet: function (e) {
+ return Math.max(Math.abs(this._mouseDownEvent.pageX - e.pageX), Math.abs(this._mouseDownEvent.pageY - e.pageY)) >= this.options.distance
+ },
+ _mouseDelayMet: function () {
+ return this.mouseDelayMet
+ },
+ _mouseStart: function () {
+ },
+ _mouseDrag: function () {
+ },
+ _mouseStop: function () {
+ },
+ _mouseCapture: function () {
+ return !0
+ }
+ }), function () {
+ function t(e, t, i) {
+ return [parseFloat(e[0]) * (p.test(e[0]) ? t / 100 : 1), parseFloat(e[1]) * (p.test(e[1]) ? i / 100 : 1)]
+ }
+
+ function i(t, i) {
+ return parseInt(e.css(t, i), 10) || 0
+ }
+
+ function s(t) {
+ var i = t[0];
+ return 9 === i.nodeType ? {
+ width: t.width(),
+ height: t.height(),
+ offset: {top: 0, left: 0}
+ } : e.isWindow(i) ? {
+ width: t.width(),
+ height: t.height(),
+ offset: {top: t.scrollTop(), left: t.scrollLeft()}
+ } : i.preventDefault ? {
+ width: 0,
+ height: 0,
+ offset: {top: i.pageY, left: i.pageX}
+ } : {width: t.outerWidth(), height: t.outerHeight(), offset: t.offset()}
+ }
+
+ e.ui = e.ui || {};
+ var n, a, o = Math.max, r = Math.abs, h = Math.round, l = /left|center|right/, u = /top|center|bottom/, d = /[\+\-]\d+(\.[\d]+)?%?/, c = /^\w+/, p = /%$/, f = e.fn.position;
+ e.position = {
+ scrollbarWidth: function () {
+ if (void 0 !== n)return n;
+ var t, i, s = e("<div style='display:block;position:absolute;width:50px;height:50px;overflow:hidden;'><div style='height:100px;width:auto;'></div></div>"), a = s.children()[0];
+ return e("body").append(s), t = a.offsetWidth, s.css("overflow", "scroll"), i = a.offsetWidth, t === i && (i = s[0].clientWidth), s.remove(), n = t - i
+ }, getScrollInfo: function (t) {
+ var i = t.isWindow || t.isDocument ? "" : t.element.css("overflow-x"), s = t.isWindow || t.isDocument ? "" : t.element.css("overflow-y"), n = "scroll" === i || "auto" === i && t.width < t.element[0].scrollWidth, a = "scroll" === s || "auto" === s && t.height < t.element[0].scrollHeight;
+ return {width: a ? e.position.scrollbarWidth() : 0, height: n ? e.position.scrollbarWidth() : 0}
+ }, getWithinInfo: function (t) {
+ var i = e(t || window), s = e.isWindow(i[0]), n = !!i[0] && 9 === i[0].nodeType;
+ return {
+ element: i,
+ isWindow: s,
+ isDocument: n,
+ offset: i.offset() || {left: 0, top: 0},
+ scrollLeft: i.scrollLeft(),
+ scrollTop: i.scrollTop(),
+ width: s || n ? i.width() : i.outerWidth(),
+ height: s || n ? i.height() : i.outerHeight()
+ }
+ }
+ }, e.fn.position = function (n) {
+ if (!n || !n.of)return f.apply(this, arguments);
+ n = e.extend({}, n);
+ var p, m, g, v, y, b, _ = e(n.of), x = e.position.getWithinInfo(n.within), w = e.position.getScrollInfo(x), k = (n.collision || "flip").split(" "), T = {};
+ return b = s(_), _[0].preventDefault && (n.at = "left top"), m = b.width, g = b.height, v = b.offset, y = e.extend({}, v), e.each(["my", "at"], function () {
+ var e, t, i = (n[this] || "").split(" ");
+ 1 === i.length && (i = l.test(i[0]) ? i.concat(["center"]) : u.test(i[0]) ? ["center"].concat(i) : ["center", "center"]), i[0] = l.test(i[0]) ? i[0] : "center", i[1] = u.test(i[1]) ? i[1] : "center", e = d.exec(i[0]), t = d.exec(i[1]), T[this] = [e ? e[0] : 0, t ? t[0] : 0], n[this] = [c.exec(i[0])[0], c.exec(i[1])[0]]
+ }), 1 === k.length && (k[1] = k[0]), "right" === n.at[0] ? y.left += m : "center" === n.at[0] && (y.left += m / 2), "bottom" === n.at[1] ? y.top += g : "center" === n.at[1] && (y.top += g / 2), p = t(T.at, m, g), y.left += p[0], y.top += p[1], this.each(function () {
+ var s, l, u = e(this), d = u.outerWidth(), c = u.outerHeight(), f = i(this, "marginLeft"), b = i(this, "marginTop"), D = d + f + i(this, "marginRight") + w.width, S = c + b + i(this, "marginBottom") + w.height, M = e.extend({}, y), C = t(T.my, u.outerWidth(), u.outerHeight());
+ "right" === n.my[0] ? M.left -= d : "center" === n.my[0] && (M.left -= d / 2), "bottom" === n.my[1] ? M.top -= c : "center" === n.my[1] && (M.top -= c / 2), M.left += C[0], M.top += C[1], a || (M.left = h(M.left), M.top = h(M.top)), s = {
+ marginLeft: f,
+ marginTop: b
+ }, e.each(["left", "top"], function (t, i) {
+ e.ui.position[k[t]] && e.ui.position[k[t]][i](M, {
+ targetWidth: m,
+ targetHeight: g,
+ elemWidth: d,
+ elemHeight: c,
+ collisionPosition: s,
+ collisionWidth: D,
+ collisionHeight: S,
+ offset: [p[0] + C[0], p[1] + C[1]],
+ my: n.my,
+ at: n.at,
+ within: x,
+ elem: u
+ })
+ }), n.using && (l = function (e) {
+ var t = v.left - M.left, i = t + m - d, s = v.top - M.top, a = s + g - c, h = {
+ target: {
+ element: _,
+ left: v.left,
+ top: v.top,
+ width: m,
+ height: g
+ },
+ element: {element: u, left: M.left, top: M.top, width: d, height: c},
+ horizontal: 0 > i ? "left" : t > 0 ? "right" : "center",
+ vertical: 0 > a ? "top" : s > 0 ? "bottom" : "middle"
+ };
+ d > m && m > r(t + i) && (h.horizontal = "center"), c > g && g > r(s + a) && (h.vertical = "middle"), h.important = o(r(t), r(i)) > o(r(s), r(a)) ? "horizontal" : "vertical", n.using.call(this, e, h)
+ }), u.offset(e.extend(M, {using: l}))
+ })
+ }, e.ui.position = {
+ fit: {
+ left: function (e, t) {
+ var i, s = t.within, n = s.isWindow ? s.scrollLeft : s.offset.left, a = s.width, r = e.left - t.collisionPosition.marginLeft, h = n - r, l = r + t.collisionWidth - a - n;
+ t.collisionWidth > a ? h > 0 && 0 >= l ? (i = e.left + h + t.collisionWidth - a - n, e.left += h - i) : e.left = l > 0 && 0 >= h ? n : h > l ? n + a - t.collisionWidth : n : h > 0 ? e.left += h : l > 0 ? e.left -= l : e.left = o(e.left - r, e.left)
+ }, top: function (e, t) {
+ var i, s = t.within, n = s.isWindow ? s.scrollTop : s.offset.top, a = t.within.height, r = e.top - t.collisionPosition.marginTop, h = n - r, l = r + t.collisionHeight - a - n;
+ t.collisionHeight > a ? h > 0 && 0 >= l ? (i = e.top + h + t.collisionHeight - a - n, e.top += h - i) : e.top = l > 0 && 0 >= h ? n : h > l ? n + a - t.collisionHeight : n : h > 0 ? e.top += h : l > 0 ? e.top -= l : e.top = o(e.top - r, e.top)
+ }
+ }, flip: {
+ left: function (e, t) {
+ var i, s, n = t.within, a = n.offset.left + n.scrollLeft, o = n.width, h = n.isWindow ? n.scrollLeft : n.offset.left, l = e.left - t.collisionPosition.marginLeft, u = l - h, d = l + t.collisionWidth - o - h, c = "left" === t.my[0] ? -t.elemWidth : "right" === t.my[0] ? t.elemWidth : 0, p = "left" === t.at[0] ? t.targetWidth : "right" === t.at[0] ? -t.targetWidth : 0, f = -2 * t.offset[0];
+ 0 > u ? (i = e.left + c + p + f + t.collisionWidth - o - a, (0 > i || r(u) > i) && (e.left += c + p + f)) : d > 0 && (s = e.left - t.collisionPosition.marginLeft + c + p + f - h, (s > 0 || d > r(s)) && (e.left += c + p + f))
+ }, top: function (e, t) {
+ var i, s, n = t.within, a = n.offset.top + n.scrollTop, o = n.height, h = n.isWindow ? n.scrollTop : n.offset.top, l = e.top - t.collisionPosition.marginTop, u = l - h, d = l + t.collisionHeight - o - h, c = "top" === t.my[1], p = c ? -t.elemHeight : "bottom" === t.my[1] ? t.elemHeight : 0, f = "top" === t.at[1] ? t.targetHeight : "bottom" === t.at[1] ? -t.targetHeight : 0, m = -2 * t.offset[1];
+ 0 > u ? (s = e.top + p + f + m + t.collisionHeight - o - a, (0 > s || r(u) > s) && (e.top += p + f + m)) : d > 0 && (i = e.top - t.collisionPosition.marginTop + p + f + m - h, (i > 0 || d > r(i)) && (e.top += p + f + m))
+ }
+ }, flipfit: {
+ left: function () {
+ e.ui.position.flip.left.apply(this, arguments), e.ui.position.fit.left.apply(this, arguments)
+ }, top: function () {
+ e.ui.position.flip.top.apply(this, arguments), e.ui.position.fit.top.apply(this, arguments)
+ }
+ }
+ }, function () {
+ var t, i, s, n, o, r = document.getElementsByTagName("body")[0], h = document.createElement("div");
+ t = document.createElement(r ? "div" : "body"), s = {
+ visibility: "hidden",
+ width: 0,
+ height: 0,
+ border: 0,
+ margin: 0,
+ background: "none"
+ }, r && e.extend(s, {position: "absolute", left: "-1000px", top: "-1000px"});
+ for (o in s)t.style[o] = s[o];
+ t.appendChild(h), i = r || document.documentElement, i.insertBefore(t, i.firstChild), h.style.cssText = "position: absolute; left: 10.7432222px;", n = e(h).offset().left, a = n > 10 && 11 > n, t.innerHTML = "", i.removeChild(t)
+ }()
+ }(), e.ui.position, e.widget("ui.draggable", e.ui.mouse, {
+ version: "1.11.4",
+ widgetEventPrefix: "drag",
+ options: {
+ addClasses: !0,
+ appendTo: "parent",
+ axis: !1,
+ connectToSortable: !1,
+ containment: !1,
+ cursor: "auto",
+ cursorAt: !1,
+ grid: !1,
+ handle: !1,
+ helper: "original",
+ iframeFix: !1,
+ opacity: !1,
+ refreshPositions: !1,
+ revert: !1,
+ revertDuration: 500,
+ scope: "default",
+ scroll: !0,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ snap: !1,
+ snapMode: "both",
+ snapTolerance: 20,
+ stack: !1,
+ zIndex: !1,
+ drag: null,
+ start: null,
+ stop: null
+ },
+ _create: function () {
+ "original" === this.options.helper && this._setPositionRelative(), this.options.addClasses && this.element.addClass("ui-draggable"), this.options.disabled && this.element.addClass("ui-draggable-disabled"), this._setHandleClassName(), this._mouseInit()
+ },
+ _setOption: function (e, t) {
+ this._super(e, t), "handle" === e && (this._removeHandleClassName(), this._setHandleClassName())
+ },
+ _destroy: function () {
+ return (this.helper || this.element).is(".ui-draggable-dragging") ? (this.destroyOnClear = !0, void 0) : (this.element.removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled"), this._removeHandleClassName(), this._mouseDestroy(), void 0)
+ },
+ _mouseCapture: function (t) {
+ var i = this.options;
+ return this._blurActiveElement(t), this.helper || i.disabled || e(t.target).closest(".ui-resizable-handle").length > 0 ? !1 : (this.handle = this._getHandle(t), this.handle ? (this._blockFrames(i.iframeFix === !0 ? "iframe" : i.iframeFix), !0) : !1)
+ },
+ _blockFrames: function (t) {
+ this.iframeBlocks = this.document.find(t).map(function () {
+ var t = e(this);
+ return e("<div>").css("position", "absolute").appendTo(t.parent()).outerWidth(t.outerWidth()).outerHeight(t.outerHeight()).offset(t.offset())[0]
+ })
+ },
+ _unblockFrames: function () {
+ this.iframeBlocks && (this.iframeBlocks.remove(), delete this.iframeBlocks)
+ },
+ _blurActiveElement: function (t) {
+ var i = this.document[0];
+ if (this.handleElement.is(t.target))try {
+ i.activeElement && "body" !== i.activeElement.nodeName.toLowerCase() && e(i.activeElement).blur()
+ } catch (s) {
+ }
+ },
+ _mouseStart: function (t) {
+ var i = this.options;
+ return this.helper = this._createHelper(t), this.helper.addClass("ui-draggable-dragging"), this._cacheHelperProportions(), e.ui.ddmanager && (e.ui.ddmanager.current = this), this._cacheMargins(), this.cssPosition = this.helper.css("position"), this.scrollParent = this.helper.scrollParent(!0), this.offsetParent = this.helper.offsetParent(), this.hasFixedAncestor = this.helper.parents().filter(function () {
+ return "fixed" === e(this).css("position")
+ }).length > 0, this.positionAbs = this.element.offset(), this._refreshOffsets(t), this.originalPosition = this.position = this._generatePosition(t, !1), this.originalPageX = t.pageX, this.originalPageY = t.pageY, i.cursorAt && this._adjustOffsetFromHelper(i.cursorAt), this._setContainment(), this._trigger("start", t) === !1 ? (this._clear(), !1) : (this._cacheHelperProportions(), e.ui.ddmanager && !i.dropBehaviour && e.ui.ddmanager.prepareOffsets(this, t), this._normalizeRightBottom(), this._mouseDrag(t, !0), e.ui.ddmanager && e.ui.ddmanager.dragStart(this, t), !0)
+ },
+ _refreshOffsets: function (e) {
+ this.offset = {
+ top: this.positionAbs.top - this.margins.top,
+ left: this.positionAbs.left - this.margins.left,
+ scroll: !1,
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset()
+ }, this.offset.click = {left: e.pageX - this.offset.left, top: e.pageY - this.offset.top}
+ },
+ _mouseDrag: function (t, i) {
+ if (this.hasFixedAncestor && (this.offset.parent = this._getParentOffset()), this.position = this._generatePosition(t, !0), this.positionAbs = this._convertPositionTo("absolute"), !i) {
+ var s = this._uiHash();
+ if (this._trigger("drag", t, s) === !1)return this._mouseUp({}), !1;
+ this.position = s.position
+ }
+ return this.helper[0].style.left = this.position.left + "px", this.helper[0].style.top = this.position.top + "px", e.ui.ddmanager && e.ui.ddmanager.drag(this, t), !1
+ },
+ _mouseStop: function (t) {
+ var i = this, s = !1;
+ return e.ui.ddmanager && !this.options.dropBehaviour && (s = e.ui.ddmanager.drop(this, t)), this.dropped && (s = this.dropped, this.dropped = !1), "invalid" === this.options.revert && !s || "valid" === this.options.revert && s || this.options.revert === !0 || e.isFunction(this.options.revert) && this.options.revert.call(this.element, s) ? e(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function () {
+ i._trigger("stop", t) !== !1 && i._clear()
+ }) : this._trigger("stop", t) !== !1 && this._clear(), !1
+ },
+ _mouseUp: function (t) {
+ return this._unblockFrames(), e.ui.ddmanager && e.ui.ddmanager.dragStop(this, t), this.handleElement.is(t.target) && this.element.focus(), e.ui.mouse.prototype._mouseUp.call(this, t)
+ },
+ cancel: function () {
+ return this.helper.is(".ui-draggable-dragging") ? this._mouseUp({}) : this._clear(), this
+ },
+ _getHandle: function (t) {
+ return this.options.handle ? !!e(t.target).closest(this.element.find(this.options.handle)).length : !0
+ },
+ _setHandleClassName: function () {
+ this.handleElement = this.options.handle ? this.element.find(this.options.handle) : this.element, this.handleElement.addClass("ui-draggable-handle")
+ },
+ _removeHandleClassName: function () {
+ this.handleElement.removeClass("ui-draggable-handle")
+ },
+ _createHelper: function (t) {
+ var i = this.options, s = e.isFunction(i.helper), n = s ? e(i.helper.apply(this.element[0], [t])) : "clone" === i.helper ? this.element.clone().removeAttr("id") : this.element;
+ return n.parents("body").length || n.appendTo("parent" === i.appendTo ? this.element[0].parentNode : i.appendTo), s && n[0] === this.element[0] && this._setPositionRelative(), n[0] === this.element[0] || /(fixed|absolute)/.test(n.css("position")) || n.css("position", "absolute"), n
+ },
+ _setPositionRelative: function () {
+ /^(?:r|a|f)/.test(this.element.css("position")) || (this.element[0].style.position = "relative")
+ },
+ _adjustOffsetFromHelper: function (t) {
+ "string" == typeof t && (t = t.split(" ")), e.isArray(t) && (t = {
+ left: +t[0],
+ top: +t[1] || 0
+ }), "left"in t && (this.offset.click.left = t.left + this.margins.left), "right"in t && (this.offset.click.left = this.helperProportions.width - t.right + this.margins.left), "top"in t && (this.offset.click.top = t.top + this.margins.top), "bottom"in t && (this.offset.click.top = this.helperProportions.height - t.bottom + this.margins.top)
+ },
+ _isRootNode: function (e) {
+ return /(html|body)/i.test(e.tagName) || e === this.document[0]
+ },
+ _getParentOffset: function () {
+ var t = this.offsetParent.offset(), i = this.document[0];
+ return "absolute" === this.cssPosition && this.scrollParent[0] !== i && e.contains(this.scrollParent[0], this.offsetParent[0]) && (t.left += this.scrollParent.scrollLeft(), t.top += this.scrollParent.scrollTop()), this._isRootNode(this.offsetParent[0]) && (t = {
+ top: 0,
+ left: 0
+ }), {
+ top: t.top + (parseInt(this.offsetParent.css("borderTopWidth"), 10) || 0),
+ left: t.left + (parseInt(this.offsetParent.css("borderLeftWidth"), 10) || 0)
+ }
+ },
+ _getRelativeOffset: function () {
+ if ("relative" !== this.cssPosition)return {top: 0, left: 0};
+ var e = this.element.position(), t = this._isRootNode(this.scrollParent[0]);
+ return {
+ top: e.top - (parseInt(this.helper.css("top"), 10) || 0) + (t ? 0 : this.scrollParent.scrollTop()),
+ left: e.left - (parseInt(this.helper.css("left"), 10) || 0) + (t ? 0 : this.scrollParent.scrollLeft())
+ }
+ },
+ _cacheMargins: function () {
+ this.margins = {
+ left: parseInt(this.element.css("marginLeft"), 10) || 0,
+ top: parseInt(this.element.css("marginTop"), 10) || 0,
+ right: parseInt(this.element.css("marginRight"), 10) || 0,
+ bottom: parseInt(this.element.css("marginBottom"), 10) || 0
+ }
+ },
+ _cacheHelperProportions: function () {
+ this.helperProportions = {width: this.helper.outerWidth(), height: this.helper.outerHeight()}
+ },
+ _setContainment: function () {
+ var t, i, s, n = this.options, a = this.document[0];
+ return this.relativeContainer = null, n.containment ? "window" === n.containment ? (this.containment = [e(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, e(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, e(window).scrollLeft() + e(window).width() - this.helperProportions.width - this.margins.left, e(window).scrollTop() + (e(window).height() || a.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top], void 0) : "document" === n.containment ? (this.containment = [0, 0, e(a).width() - this.helperProportions.width - this.margins.left, (e(a).height() || a.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top], void 0) : n.containment.constructor === Array ? (this.containment = n.containment, void 0) : ("parent" === n.containment && (n.containment = this.helper[0].parentNode), i = e(n.containment), s = i[0], s && (t = /(scroll|auto)/.test(i.css("overflow")), this.containment = [(parseInt(i.css("borderLeftWidth"), 10) || 0) + (parseInt(i.css("paddingLeft"), 10) || 0), (parseInt(i.css("borderTopWidth"), 10) || 0) + (parseInt(i.css("paddingTop"), 10) || 0), (t ? Math.max(s.scrollWidth, s.offsetWidth) : s.offsetWidth) - (parseInt(i.css("borderRightWidth"), 10) || 0) - (parseInt(i.css("paddingRight"), 10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, (t ? Math.max(s.scrollHeight, s.offsetHeight) : s.offsetHeight) - (parseInt(i.css("borderBottomWidth"), 10) || 0) - (parseInt(i.css("paddingBottom"), 10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom], this.relativeContainer = i), void 0) : (this.containment = null, void 0)
+ },
+ _convertPositionTo: function (e, t) {
+ t || (t = this.position);
+ var i = "absolute" === e ? 1 : -1, s = this._isRootNode(this.scrollParent[0]);
+ return {
+ top: t.top + this.offset.relative.top * i + this.offset.parent.top * i - ("fixed" === this.cssPosition ? -this.offset.scroll.top : s ? 0 : this.offset.scroll.top) * i,
+ left: t.left + this.offset.relative.left * i + this.offset.parent.left * i - ("fixed" === this.cssPosition ? -this.offset.scroll.left : s ? 0 : this.offset.scroll.left) * i
+ }
+ },
+ _generatePosition: function (e, t) {
+ var i, s, n, a, o = this.options, r = this._isRootNode(this.scrollParent[0]), h = e.pageX, l = e.pageY;
+ return r && this.offset.scroll || (this.offset.scroll = {
+ top: this.scrollParent.scrollTop(),
+ left: this.scrollParent.scrollLeft()
+ }), t && (this.containment && (this.relativeContainer ? (s = this.relativeContainer.offset(), i = [this.containment[0] + s.left, this.containment[1] + s.top, this.containment[2] + s.left, this.containment[3] + s.top]) : i = this.containment, e.pageX - this.offset.click.left < i[0] && (h = i[0] + this.offset.click.left), e.pageY - this.offset.click.top < i[1] && (l = i[1] + this.offset.click.top), e.pageX - this.offset.click.left > i[2] && (h = i[2] + this.offset.click.left), e.pageY - this.offset.click.top > i[3] && (l = i[3] + this.offset.click.top)), o.grid && (n = o.grid[1] ? this.originalPageY + Math.round((l - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY, l = i ? n - this.offset.click.top >= i[1] || n - this.offset.click.top > i[3] ? n : n - this.offset.click.top >= i[1] ? n - o.grid[1] : n + o.grid[1] : n, a = o.grid[0] ? this.originalPageX + Math.round((h - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX, h = i ? a - this.offset.click.left >= i[0] || a - this.offset.click.left > i[2] ? a : a - this.offset.click.left >= i[0] ? a - o.grid[0] : a + o.grid[0] : a), "y" === o.axis && (h = this.originalPageX), "x" === o.axis && (l = this.originalPageY)), {
+ top: l - this.offset.click.top - this.offset.relative.top - this.offset.parent.top + ("fixed" === this.cssPosition ? -this.offset.scroll.top : r ? 0 : this.offset.scroll.top),
+ left: h - this.offset.click.left - this.offset.relative.left - this.offset.parent.left + ("fixed" === this.cssPosition ? -this.offset.scroll.left : r ? 0 : this.offset.scroll.left)
+ }
+ },
+ _clear: function () {
+ this.helper.removeClass("ui-draggable-dragging"), this.helper[0] === this.element[0] || this.cancelHelperRemoval || this.helper.remove(), this.helper = null, this.cancelHelperRemoval = !1, this.destroyOnClear && this.destroy()
+ },
+ _normalizeRightBottom: function () {
+ "y" !== this.options.axis && "auto" !== this.helper.css("right") && (this.helper.width(this.helper.width()), this.helper.css("right", "auto")), "x" !== this.options.axis && "auto" !== this.helper.css("bottom") && (this.helper.height(this.helper.height()), this.helper.css("bottom", "auto"))
+ },
+ _trigger: function (t, i, s) {
+ return s = s || this._uiHash(), e.ui.plugin.call(this, t, [i, s, this], !0), /^(drag|start|stop)/.test(t) && (this.positionAbs = this._convertPositionTo("absolute"), s.offset = this.positionAbs), e.Widget.prototype._trigger.call(this, t, i, s)
+ },
+ plugins: {},
+ _uiHash: function () {
+ return {
+ helper: this.helper,
+ position: this.position,
+ originalPosition: this.originalPosition,
+ offset: this.positionAbs
+ }
+ }
+ }), e.ui.plugin.add("draggable", "connectToSortable", {
+ start: function (t, i, s) {
+ var n = e.extend({}, i, {item: s.element});
+ s.sortables = [], e(s.options.connectToSortable).each(function () {
+ var i = e(this).sortable("instance");
+ i && !i.options.disabled && (s.sortables.push(i), i.refreshPositions(), i._trigger("activate", t, n))
+ })
+ }, stop: function (t, i, s) {
+ var n = e.extend({}, i, {item: s.element});
+ s.cancelHelperRemoval = !1, e.each(s.sortables, function () {
+ var e = this;
+ e.isOver ? (e.isOver = 0, s.cancelHelperRemoval = !0, e.cancelHelperRemoval = !1, e._storedCSS = {
+ position: e.placeholder.css("position"),
+ top: e.placeholder.css("top"),
+ left: e.placeholder.css("left")
+ }, e._mouseStop(t), e.options.helper = e.options._helper) : (e.cancelHelperRemoval = !0, e._trigger("deactivate", t, n))
+ })
+ }, drag: function (t, i, s) {
+ e.each(s.sortables, function () {
+ var n = !1, a = this;
+ a.positionAbs = s.positionAbs, a.helperProportions = s.helperProportions, a.offset.click = s.offset.click, a._intersectsWith(a.containerCache) && (n = !0, e.each(s.sortables, function () {
+ return this.positionAbs = s.positionAbs, this.helperProportions = s.helperProportions, this.offset.click = s.offset.click, this !== a && this._intersectsWith(this.containerCache) && e.contains(a.element[0], this.element[0]) && (n = !1), n
+ })), n ? (a.isOver || (a.isOver = 1, s._parent = i.helper.parent(), a.currentItem = i.helper.appendTo(a.element).data("ui-sortable-item", !0), a.options._helper = a.options.helper, a.options.helper = function () {
+ return i.helper[0]
+ }, t.target = a.currentItem[0], a._mouseCapture(t, !0), a._mouseStart(t, !0, !0), a.offset.click.top = s.offset.click.top, a.offset.click.left = s.offset.click.left, a.offset.parent.left -= s.offset.parent.left - a.offset.parent.left, a.offset.parent.top -= s.offset.parent.top - a.offset.parent.top, s._trigger("toSortable", t), s.dropped = a.element, e.each(s.sortables, function () {
+ this.refreshPositions()
+ }), s.currentItem = s.element, a.fromOutside = s), a.currentItem && (a._mouseDrag(t), i.position = a.position)) : a.isOver && (a.isOver = 0, a.cancelHelperRemoval = !0, a.options._revert = a.options.revert, a.options.revert = !1, a._trigger("out", t, a._uiHash(a)), a._mouseStop(t, !0), a.options.revert = a.options._revert, a.options.helper = a.options._helper, a.placeholder && a.placeholder.remove(), i.helper.appendTo(s._parent), s._refreshOffsets(t), i.position = s._generatePosition(t, !0), s._trigger("fromSortable", t), s.dropped = !1, e.each(s.sortables, function () {
+ this.refreshPositions()
+ }))
+ })
+ }
+ }), e.ui.plugin.add("draggable", "cursor", {
+ start: function (t, i, s) {
+ var n = e("body"), a = s.options;
+ n.css("cursor") && (a._cursor = n.css("cursor")), n.css("cursor", a.cursor)
+ }, stop: function (t, i, s) {
+ var n = s.options;
+ n._cursor && e("body").css("cursor", n._cursor)
+ }
+ }), e.ui.plugin.add("draggable", "opacity", {
+ start: function (t, i, s) {
+ var n = e(i.helper), a = s.options;
+ n.css("opacity") && (a._opacity = n.css("opacity")), n.css("opacity", a.opacity)
+ }, stop: function (t, i, s) {
+ var n = s.options;
+ n._opacity && e(i.helper).css("opacity", n._opacity)
+ }
+ }), e.ui.plugin.add("draggable", "scroll", {
+ start: function (e, t, i) {
+ i.scrollParentNotHidden || (i.scrollParentNotHidden = i.helper.scrollParent(!1)), i.scrollParentNotHidden[0] !== i.document[0] && "HTML" !== i.scrollParentNotHidden[0].tagName && (i.overflowOffset = i.scrollParentNotHidden.offset())
+ }, drag: function (t, i, s) {
+ var n = s.options, a = !1, o = s.scrollParentNotHidden[0], r = s.document[0];
+ o !== r && "HTML" !== o.tagName ? (n.axis && "x" === n.axis || (s.overflowOffset.top + o.offsetHeight - t.pageY < n.scrollSensitivity ? o.scrollTop = a = o.scrollTop + n.scrollSpeed : t.pageY - s.overflowOffset.top < n.scrollSensitivity && (o.scrollTop = a = o.scrollTop - n.scrollSpeed)), n.axis && "y" === n.axis || (s.overflowOffset.left + o.offsetWidth - t.pageX < n.scrollSensitivity ? o.scrollLeft = a = o.scrollLeft + n.scrollSpeed : t.pageX - s.overflowOffset.left < n.scrollSensitivity && (o.scrollLeft = a = o.scrollLeft - n.scrollSpeed))) : (n.axis && "x" === n.axis || (t.pageY - e(r).scrollTop() < n.scrollSensitivity ? a = e(r).scrollTop(e(r).scrollTop() - n.scrollSpeed) : e(window).height() - (t.pageY - e(r).scrollTop()) < n.scrollSensitivity && (a = e(r).scrollTop(e(r).scrollTop() + n.scrollSpeed))), n.axis && "y" === n.axis || (t.pageX - e(r).scrollLeft() < n.scrollSensitivity ? a = e(r).scrollLeft(e(r).scrollLeft() - n.scrollSpeed) : e(window).width() - (t.pageX - e(r).scrollLeft()) < n.scrollSensitivity && (a = e(r).scrollLeft(e(r).scrollLeft() + n.scrollSpeed)))), a !== !1 && e.ui.ddmanager && !n.dropBehaviour && e.ui.ddmanager.prepareOffsets(s, t)
+ }
+ }), e.ui.plugin.add("draggable", "snap", {
+ start: function (t, i, s) {
+ var n = s.options;
+ s.snapElements = [], e(n.snap.constructor !== String ? n.snap.items || ":data(ui-draggable)" : n.snap).each(function () {
+ var t = e(this), i = t.offset();
+ this !== s.element[0] && s.snapElements.push({
+ item: this,
+ width: t.outerWidth(),
+ height: t.outerHeight(),
+ top: i.top,
+ left: i.left
+ })
+ })
+ }, drag: function (t, i, s) {
+ var n, a, o, r, h, l, u, d, c, p, f = s.options, m = f.snapTolerance, g = i.offset.left, v = g + s.helperProportions.width, y = i.offset.top, b = y + s.helperProportions.height;
+ for (c = s.snapElements.length - 1; c >= 0; c--)h = s.snapElements[c].left - s.margins.left, l = h + s.snapElements[c].width, u = s.snapElements[c].top - s.margins.top, d = u + s.snapElements[c].height, h - m > v || g > l + m || u - m > b || y > d + m || !e.contains(s.snapElements[c].item.ownerDocument, s.snapElements[c].item) ? (s.snapElements[c].snapping && s.options.snap.release && s.options.snap.release.call(s.element, t, e.extend(s._uiHash(), {snapItem: s.snapElements[c].item})), s.snapElements[c].snapping = !1) : ("inner" !== f.snapMode && (n = m >= Math.abs(u - b), a = m >= Math.abs(d - y), o = m >= Math.abs(h - v), r = m >= Math.abs(l - g), n && (i.position.top = s._convertPositionTo("relative", {
+ top: u - s.helperProportions.height,
+ left: 0
+ }).top), a && (i.position.top = s._convertPositionTo("relative", {
+ top: d,
+ left: 0
+ }).top), o && (i.position.left = s._convertPositionTo("relative", {
+ top: 0,
+ left: h - s.helperProportions.width
+ }).left), r && (i.position.left = s._convertPositionTo("relative", {
+ top: 0,
+ left: l
+ }).left)), p = n || a || o || r, "outer" !== f.snapMode && (n = m >= Math.abs(u - y), a = m >= Math.abs(d - b), o = m >= Math.abs(h - g), r = m >= Math.abs(l - v), n && (i.position.top = s._convertPositionTo("relative", {
+ top: u,
+ left: 0
+ }).top), a && (i.position.top = s._convertPositionTo("relative", {
+ top: d - s.helperProportions.height,
+ left: 0
+ }).top), o && (i.position.left = s._convertPositionTo("relative", {
+ top: 0,
+ left: h
+ }).left), r && (i.position.left = s._convertPositionTo("relative", {
+ top: 0,
+ left: l - s.helperProportions.width
+ }).left)), !s.snapElements[c].snapping && (n || a || o || r || p) && s.options.snap.snap && s.options.snap.snap.call(s.element, t, e.extend(s._uiHash(), {snapItem: s.snapElements[c].item})), s.snapElements[c].snapping = n || a || o || r || p)
+ }
+ }), e.ui.plugin.add("draggable", "stack", {
+ start: function (t, i, s) {
+ var n, a = s.options, o = e.makeArray(e(a.stack)).sort(function (t, i) {
+ return (parseInt(e(t).css("zIndex"), 10) || 0) - (parseInt(e(i).css("zIndex"), 10) || 0)
+ });
+ o.length && (n = parseInt(e(o[0]).css("zIndex"), 10) || 0, e(o).each(function (t) {
+ e(this).css("zIndex", n + t)
+ }), this.css("zIndex", n + o.length))
+ }
+ }), e.ui.plugin.add("draggable", "zIndex", {
+ start: function (t, i, s) {
+ var n = e(i.helper), a = s.options;
+ n.css("zIndex") && (a._zIndex = n.css("zIndex")), n.css("zIndex", a.zIndex)
+ }, stop: function (t, i, s) {
+ var n = s.options;
+ n._zIndex && e(i.helper).css("zIndex", n._zIndex)
+ }
+ }), e.ui.draggable, e.widget("ui.droppable", {
+ version: "1.11.4",
+ widgetEventPrefix: "drop",
+ options: {
+ accept: "*",
+ activeClass: !1,
+ addClasses: !0,
+ greedy: !1,
+ hoverClass: !1,
+ scope: "default",
+ tolerance: "intersect",
+ activate: null,
+ deactivate: null,
+ drop: null,
+ out: null,
+ over: null
+ },
+ _create: function () {
+ var t, i = this.options, s = i.accept;
+ this.isover = !1, this.isout = !0, this.accept = e.isFunction(s) ? s : function (e) {
+ return e.is(s)
+ }, this.proportions = function () {
+ return arguments.length ? (t = arguments[0], void 0) : t ? t : t = {
+ width: this.element[0].offsetWidth,
+ height: this.element[0].offsetHeight
+ }
+ }, this._addToManager(i.scope), i.addClasses && this.element.addClass("ui-droppable")
+ },
+ _addToManager: function (t) {
+ e.ui.ddmanager.droppables[t] = e.ui.ddmanager.droppables[t] || [], e.ui.ddmanager.droppables[t].push(this)
+ },
+ _splice: function (e) {
+ for (var t = 0; e.length > t; t++)e[t] === this && e.splice(t, 1)
+ },
+ _destroy: function () {
+ var t = e.ui.ddmanager.droppables[this.options.scope];
+ this._splice(t), this.element.removeClass("ui-droppable ui-droppable-disabled")
+ },
+ _setOption: function (t, i) {
+ if ("accept" === t)this.accept = e.isFunction(i) ? i : function (e) {
+ return e.is(i)
+ }; else if ("scope" === t) {
+ var s = e.ui.ddmanager.droppables[this.options.scope];
+ this._splice(s), this._addToManager(i)
+ }
+ this._super(t, i)
+ },
+ _activate: function (t) {
+ var i = e.ui.ddmanager.current;
+ this.options.activeClass && this.element.addClass(this.options.activeClass), i && this._trigger("activate", t, this.ui(i))
+ },
+ _deactivate: function (t) {
+ var i = e.ui.ddmanager.current;
+ this.options.activeClass && this.element.removeClass(this.options.activeClass), i && this._trigger("deactivate", t, this.ui(i))
+ },
+ _over: function (t) {
+ var i = e.ui.ddmanager.current;
+ i && (i.currentItem || i.element)[0] !== this.element[0] && this.accept.call(this.element[0], i.currentItem || i.element) && (this.options.hoverClass && this.element.addClass(this.options.hoverClass), this._trigger("over", t, this.ui(i)))
+ },
+ _out: function (t) {
+ var i = e.ui.ddmanager.current;
+ i && (i.currentItem || i.element)[0] !== this.element[0] && this.accept.call(this.element[0], i.currentItem || i.element) && (this.options.hoverClass && this.element.removeClass(this.options.hoverClass), this._trigger("out", t, this.ui(i)))
+ },
+ _drop: function (t, i) {
+ var s = i || e.ui.ddmanager.current, n = !1;
+ return s && (s.currentItem || s.element)[0] !== this.element[0] ? (this.element.find(":data(ui-droppable)").not(".ui-draggable-dragging").each(function () {
+ var i = e(this).droppable("instance");
+ return i.options.greedy && !i.options.disabled && i.options.scope === s.options.scope && i.accept.call(i.element[0], s.currentItem || s.element) && e.ui.intersect(s, e.extend(i, {offset: i.element.offset()}), i.options.tolerance, t) ? (n = !0, !1) : void 0
+ }), n ? !1 : this.accept.call(this.element[0], s.currentItem || s.element) ? (this.options.activeClass && this.element.removeClass(this.options.activeClass), this.options.hoverClass && this.element.removeClass(this.options.hoverClass), this._trigger("drop", t, this.ui(s)), this.element) : !1) : !1
+ },
+ ui: function (e) {
+ return {
+ draggable: e.currentItem || e.element,
+ helper: e.helper,
+ position: e.position,
+ offset: e.positionAbs
+ }
+ }
+ }), e.ui.intersect = function () {
+ function e(e, t, i) {
+ return e >= t && t + i > e
+ }
+
+ return function (t, i, s, n) {
+ if (!i.offset)return !1;
+ var a = (t.positionAbs || t.position.absolute).left + t.margins.left, o = (t.positionAbs || t.position.absolute).top + t.margins.top, r = a + t.helperProportions.width, h = o + t.helperProportions.height, l = i.offset.left, u = i.offset.top, d = l + i.proportions().width, c = u + i.proportions().height;
+ switch (s) {
+ case"fit":
+ return a >= l && d >= r && o >= u && c >= h;
+ case"intersect":
+ return a + t.helperProportions.width / 2 > l && d > r - t.helperProportions.width / 2 && o + t.helperProportions.height / 2 > u && c > h - t.helperProportions.height / 2;
+ case"pointer":
+ return e(n.pageY, u, i.proportions().height) && e(n.pageX, l, i.proportions().width);
+ case"touch":
+ return (o >= u && c >= o || h >= u && c >= h || u > o && h > c) && (a >= l && d >= a || r >= l && d >= r || l > a && r > d);
+ default:
+ return !1
+ }
+ }
+ }(), e.ui.ddmanager = {
+ current: null, droppables: {"default": []}, prepareOffsets: function (t, i) {
+ var s, n, a = e.ui.ddmanager.droppables[t.options.scope] || [], o = i ? i.type : null, r = (t.currentItem || t.element).find(":data(ui-droppable)").addBack();
+ e:for (s = 0; a.length > s; s++)if (!(a[s].options.disabled || t && !a[s].accept.call(a[s].element[0], t.currentItem || t.element))) {
+ for (n = 0; r.length > n; n++)if (r[n] === a[s].element[0]) {
+ a[s].proportions().height = 0;
+ continue e
+ }
+ a[s].visible = "none" !== a[s].element.css("display"), a[s].visible && ("mousedown" === o && a[s]._activate.call(a[s], i), a[s].offset = a[s].element.offset(), a[s].proportions({
+ width: a[s].element[0].offsetWidth,
+ height: a[s].element[0].offsetHeight
+ }))
+ }
+ }, drop: function (t, i) {
+ var s = !1;
+ return e.each((e.ui.ddmanager.droppables[t.options.scope] || []).slice(), function () {
+ this.options && (!this.options.disabled && this.visible && e.ui.intersect(t, this, this.options.tolerance, i) && (s = this._drop.call(this, i) || s), !this.options.disabled && this.visible && this.accept.call(this.element[0], t.currentItem || t.element) && (this.isout = !0, this.isover = !1, this._deactivate.call(this, i)))
+ }), s
+ }, dragStart: function (t, i) {
+ t.element.parentsUntil("body").bind("scroll.droppable", function () {
+ t.options.refreshPositions || e.ui.ddmanager.prepareOffsets(t, i)
+ })
+ }, drag: function (t, i) {
+ t.options.refreshPositions && e.ui.ddmanager.prepareOffsets(t, i), e.each(e.ui.ddmanager.droppables[t.options.scope] || [], function () {
+ if (!this.options.disabled && !this.greedyChild && this.visible) {
+ var s, n, a, o = e.ui.intersect(t, this, this.options.tolerance, i), r = !o && this.isover ? "isout" : o && !this.isover ? "isover" : null;
+ r && (this.options.greedy && (n = this.options.scope, a = this.element.parents(":data(ui-droppable)").filter(function () {
+ return e(this).droppable("instance").options.scope === n
+ }), a.length && (s = e(a[0]).droppable("instance"), s.greedyChild = "isover" === r)), s && "isover" === r && (s.isover = !1, s.isout = !0, s._out.call(s, i)), this[r] = !0, this["isout" === r ? "isover" : "isout"] = !1, this["isover" === r ? "_over" : "_out"].call(this, i), s && "isout" === r && (s.isout = !1, s.isover = !0, s._over.call(s, i)))
+ }
+ })
+ }, dragStop: function (t, i) {
+ t.element.parentsUntil("body").unbind("scroll.droppable"), t.options.refreshPositions || e.ui.ddmanager.prepareOffsets(t, i)
+ }
+ }, e.ui.droppable, e.widget("ui.resizable", e.ui.mouse, {
+ version: "1.11.4",
+ widgetEventPrefix: "resize",
+ options: {
+ alsoResize: !1,
+ animate: !1,
+ animateDuration: "slow",
+ animateEasing: "swing",
+ aspectRatio: !1,
+ autoHide: !1,
+ containment: !1,
+ ghost: !1,
+ grid: !1,
+ handles: "e,s,se",
+ helper: !1,
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 10,
+ minWidth: 10,
+ zIndex: 90,
+ resize: null,
+ start: null,
+ stop: null
+ },
+ _num: function (e) {
+ return parseInt(e, 10) || 0
+ },
+ _isNumber: function (e) {
+ return !isNaN(parseInt(e, 10))
+ },
+ _hasScroll: function (t, i) {
+ if ("hidden" === e(t).css("overflow"))return !1;
+ var s = i && "left" === i ? "scrollLeft" : "scrollTop", n = !1;
+ return t[s] > 0 ? !0 : (t[s] = 1, n = t[s] > 0, t[s] = 0, n)
+ },
+ _create: function () {
+ var t, i, s, n, a, o = this, r = this.options;
+ if (this.element.addClass("ui-resizable"), e.extend(this, {
+ _aspectRatio: !!r.aspectRatio,
+ aspectRatio: r.aspectRatio,
+ originalElement: this.element,
+ _proportionallyResizeElements: [],
+ _helper: r.helper || r.ghost || r.animate ? r.helper || "ui-resizable-helper" : null
+ }), this.element[0].nodeName.match(/^(canvas|textarea|input|select|button|img)$/i) && (this.element.wrap(e("<div class='ui-wrapper' style='overflow: hidden;'></div>").css({
+ position: this.element.css("position"),
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight(),
+ top: this.element.css("top"),
+ left: this.element.css("left")
+ })), this.element = this.element.parent().data("ui-resizable", this.element.resizable("instance")), this.elementIsWrapper = !0, this.element.css({
+ marginLeft: this.originalElement.css("marginLeft"),
+ marginTop: this.originalElement.css("marginTop"),
+ marginRight: this.originalElement.css("marginRight"),
+ marginBottom: this.originalElement.css("marginBottom")
+ }), this.originalElement.css({
+ marginLeft: 0,
+ marginTop: 0,
+ marginRight: 0,
+ marginBottom: 0
+ }), this.originalResizeStyle = this.originalElement.css("resize"), this.originalElement.css("resize", "none"), this._proportionallyResizeElements.push(this.originalElement.css({
+ position: "static",
+ zoom: 1,
+ display: "block"
+ })), this.originalElement.css({margin: this.originalElement.css("margin")}), this._proportionallyResize()), this.handles = r.handles || (e(".ui-resizable-handle", this.element).length ? {
+ n: ".ui-resizable-n",
+ e: ".ui-resizable-e",
+ s: ".ui-resizable-s",
+ w: ".ui-resizable-w",
+ se: ".ui-resizable-se",
+ sw: ".ui-resizable-sw",
+ ne: ".ui-resizable-ne",
+ nw: ".ui-resizable-nw"
+ } : "e,s,se"), this._handles = e(), this.handles.constructor === String)for ("all" === this.handles && (this.handles = "n,e,s,w,se,sw,ne,nw"), t = this.handles.split(","), this.handles = {}, i = 0; t.length > i; i++)s = e.trim(t[i]), a = "ui-resizable-" + s, n = e("<div class='ui-resizable-handle " + a + "'></div>"), n.css({zIndex: r.zIndex}), "se" === s && n.addClass("ui-icon ui-icon-gripsmall-diagonal-se"), this.handles[s] = ".ui-resizable-" + s, this.element.append(n);
+ this._renderAxis = function (t) {
+ var i, s, n, a;
+ t = t || this.element;
+ for (i in this.handles)this.handles[i].constructor === String ? this.handles[i] = this.element.children(this.handles[i]).first().show() : (this.handles[i].jquery || this.handles[i].nodeType) && (this.handles[i] = e(this.handles[i]), this._on(this.handles[i], {mousedown: o._mouseDown})), this.elementIsWrapper && this.originalElement[0].nodeName.match(/^(textarea|input|select|button)$/i) && (s = e(this.handles[i], this.element), a = /sw|ne|nw|se|n|s/.test(i) ? s.outerHeight() : s.outerWidth(), n = ["padding", /ne|nw|n/.test(i) ? "Top" : /se|sw|s/.test(i) ? "Bottom" : /^e$/.test(i) ? "Right" : "Left"].join(""), t.css(n, a), this._proportionallyResize()), this._handles = this._handles.add(this.handles[i])
+ }, this._renderAxis(this.element), this._handles = this._handles.add(this.element.find(".ui-resizable-handle")), this._handles.disableSelection(), this._handles.mouseover(function () {
+ o.resizing || (this.className && (n = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)), o.axis = n && n[1] ? n[1] : "se")
+ }), r.autoHide && (this._handles.hide(), e(this.element).addClass("ui-resizable-autohide").mouseenter(function () {
+ r.disabled || (e(this).removeClass("ui-resizable-autohide"), o._handles.show())
+ }).mouseleave(function () {
+ r.disabled || o.resizing || (e(this).addClass("ui-resizable-autohide"), o._handles.hide())
+ })), this._mouseInit()
+ },
+ _destroy: function () {
+ this._mouseDestroy();
+ var t, i = function (t) {
+ e(t).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").removeData("ui-resizable").unbind(".resizable").find(".ui-resizable-handle").remove()
+ };
+ return this.elementIsWrapper && (i(this.element), t = this.element, this.originalElement.css({
+ position: t.css("position"),
+ width: t.outerWidth(),
+ height: t.outerHeight(),
+ top: t.css("top"),
+ left: t.css("left")
+ }).insertAfter(t), t.remove()), this.originalElement.css("resize", this.originalResizeStyle), i(this.originalElement), this
+ },
+ _mouseCapture: function (t) {
+ var i, s, n = !1;
+ for (i in this.handles)s = e(this.handles[i])[0], (s === t.target || e.contains(s, t.target)) && (n = !0);
+ return !this.options.disabled && n
+ },
+ _mouseStart: function (t) {
+ var i, s, n, a = this.options, o = this.element;
+ return this.resizing = !0, this._renderProxy(), i = this._num(this.helper.css("left")), s = this._num(this.helper.css("top")), a.containment && (i += e(a.containment).scrollLeft() || 0, s += e(a.containment).scrollTop() || 0), this.offset = this.helper.offset(), this.position = {
+ left: i,
+ top: s
+ }, this.size = this._helper ? {
+ width: this.helper.width(),
+ height: this.helper.height()
+ } : {width: o.width(), height: o.height()}, this.originalSize = this._helper ? {
+ width: o.outerWidth(),
+ height: o.outerHeight()
+ } : {width: o.width(), height: o.height()}, this.sizeDiff = {
+ width: o.outerWidth() - o.width(),
+ height: o.outerHeight() - o.height()
+ }, this.originalPosition = {left: i, top: s}, this.originalMousePosition = {
+ left: t.pageX,
+ top: t.pageY
+ }, this.aspectRatio = "number" == typeof a.aspectRatio ? a.aspectRatio : this.originalSize.width / this.originalSize.height || 1, n = e(".ui-resizable-" + this.axis).css("cursor"), e("body").css("cursor", "auto" === n ? this.axis + "-resize" : n), o.addClass("ui-resizable-resizing"), this._propagate("start", t), !0
+ },
+ _mouseDrag: function (t) {
+ var i, s, n = this.originalMousePosition, a = this.axis, o = t.pageX - n.left || 0, r = t.pageY - n.top || 0, h = this._change[a];
+ return this._updatePrevProperties(), h ? (i = h.apply(this, [t, o, r]), this._updateVirtualBoundaries(t.shiftKey), (this._aspectRatio || t.shiftKey) && (i = this._updateRatio(i, t)), i = this._respectSize(i, t), this._updateCache(i), this._propagate("resize", t), s = this._applyChanges(), !this._helper && this._proportionallyResizeElements.length && this._proportionallyResize(), e.isEmptyObject(s) || (this._updatePrevProperties(), this._trigger("resize", t, this.ui()), this._applyChanges()), !1) : !1
+ },
+ _mouseStop: function (t) {
+ this.resizing = !1;
+ var i, s, n, a, o, r, h, l = this.options, u = this;
+ return this._helper && (i = this._proportionallyResizeElements, s = i.length && /textarea/i.test(i[0].nodeName), n = s && this._hasScroll(i[0], "left") ? 0 : u.sizeDiff.height, a = s ? 0 : u.sizeDiff.width, o = {
+ width: u.helper.width() - a,
+ height: u.helper.height() - n
+ }, r = parseInt(u.element.css("left"), 10) + (u.position.left - u.originalPosition.left) || null, h = parseInt(u.element.css("top"), 10) + (u.position.top - u.originalPosition.top) || null, l.animate || this.element.css(e.extend(o, {
+ top: h,
+ left: r
+ })), u.helper.height(u.size.height), u.helper.width(u.size.width), this._helper && !l.animate && this._proportionallyResize()), e("body").css("cursor", "auto"), this.element.removeClass("ui-resizable-resizing"), this._propagate("stop", t), this._helper && this.helper.remove(), !1
+ },
+ _updatePrevProperties: function () {
+ this.prevPosition = {
+ top: this.position.top,
+ left: this.position.left
+ }, this.prevSize = {width: this.size.width, height: this.size.height}
+ },
+ _applyChanges: function () {
+ var e = {};
+ return this.position.top !== this.prevPosition.top && (e.top = this.position.top + "px"), this.position.left !== this.prevPosition.left && (e.left = this.position.left + "px"), this.size.width !== this.prevSize.width && (e.width = this.size.width + "px"), this.size.height !== this.prevSize.height && (e.height = this.size.height + "px"), this.helper.css(e), e
+ },
+ _updateVirtualBoundaries: function (e) {
+ var t, i, s, n, a, o = this.options;
+ a = {
+ minWidth: this._isNumber(o.minWidth) ? o.minWidth : 0,
+ maxWidth: this._isNumber(o.maxWidth) ? o.maxWidth : 1 / 0,
+ minHeight: this._isNumber(o.minHeight) ? o.minHeight : 0,
+ maxHeight: this._isNumber(o.maxHeight) ? o.maxHeight : 1 / 0
+ }, (this._aspectRatio || e) && (t = a.minHeight * this.aspectRatio, s = a.minWidth / this.aspectRatio, i = a.maxHeight * this.aspectRatio, n = a.maxWidth / this.aspectRatio, t > a.minWidth && (a.minWidth = t), s > a.minHeight && (a.minHeight = s), a.maxWidth > i && (a.maxWidth = i), a.maxHeight > n && (a.maxHeight = n)), this._vBoundaries = a
+ },
+ _updateCache: function (e) {
+ this.offset = this.helper.offset(), this._isNumber(e.left) && (this.position.left = e.left), this._isNumber(e.top) && (this.position.top = e.top), this._isNumber(e.height) && (this.size.height = e.height), this._isNumber(e.width) && (this.size.width = e.width)
+ },
+ _updateRatio: function (e) {
+ var t = this.position, i = this.size, s = this.axis;
+ return this._isNumber(e.height) ? e.width = e.height * this.aspectRatio : this._isNumber(e.width) && (e.height = e.width / this.aspectRatio), "sw" === s && (e.left = t.left + (i.width - e.width), e.top = null), "nw" === s && (e.top = t.top + (i.height - e.height), e.left = t.left + (i.width - e.width)), e
+ },
+ _respectSize: function (e) {
+ var t = this._vBoundaries, i = this.axis, s = this._isNumber(e.width) && t.maxWidth && t.maxWidth < e.width, n = this._isNumber(e.height) && t.maxHeight && t.maxHeight < e.height, a = this._isNumber(e.width) && t.minWidth && t.minWidth > e.width, o = this._isNumber(e.height) && t.minHeight && t.minHeight > e.height, r = this.originalPosition.left + this.originalSize.width, h = this.position.top + this.size.height, l = /sw|nw|w/.test(i), u = /nw|ne|n/.test(i);
+ return a && (e.width = t.minWidth), o && (e.height = t.minHeight), s && (e.width = t.maxWidth), n && (e.height = t.maxHeight), a && l && (e.left = r - t.minWidth), s && l && (e.left = r - t.maxWidth), o && u && (e.top = h - t.minHeight), n && u && (e.top = h - t.maxHeight), e.width || e.height || e.left || !e.top ? e.width || e.height || e.top || !e.left || (e.left = null) : e.top = null, e
+ },
+ _getPaddingPlusBorderDimensions: function (e) {
+ for (var t = 0, i = [], s = [e.css("borderTopWidth"), e.css("borderRightWidth"), e.css("borderBottomWidth"), e.css("borderLeftWidth")], n = [e.css("paddingTop"), e.css("paddingRight"), e.css("paddingBottom"), e.css("paddingLeft")]; 4 > t; t++)i[t] = parseInt(s[t], 10) || 0, i[t] += parseInt(n[t], 10) || 0;
+ return {height: i[0] + i[2], width: i[1] + i[3]}
+ },
+ _proportionallyResize: function () {
+ if (this._proportionallyResizeElements.length)for (var e, t = 0, i = this.helper || this.element; this._proportionallyResizeElements.length > t; t++)e = this._proportionallyResizeElements[t], this.outerDimensions || (this.outerDimensions = this._getPaddingPlusBorderDimensions(e)), e.css({
+ height: i.height() - this.outerDimensions.height || 0,
+ width: i.width() - this.outerDimensions.width || 0
+ })
+ },
+ _renderProxy: function () {
+ var t = this.element, i = this.options;
+ this.elementOffset = t.offset(), this._helper ? (this.helper = this.helper || e("<div style='overflow:hidden;'></div>"), this.helper.addClass(this._helper).css({
+ width: this.element.outerWidth() - 1,
+ height: this.element.outerHeight() - 1,
+ position: "absolute",
+ left: this.elementOffset.left + "px",
+ top: this.elementOffset.top + "px",
+ zIndex: ++i.zIndex
+ }), this.helper.appendTo("body").disableSelection()) : this.helper = this.element
+ },
+ _change: {
+ e: function (e, t) {
+ return {width: this.originalSize.width + t}
+ }, w: function (e, t) {
+ var i = this.originalSize, s = this.originalPosition;
+ return {left: s.left + t, width: i.width - t}
+ }, n: function (e, t, i) {
+ var s = this.originalSize, n = this.originalPosition;
+ return {top: n.top + i, height: s.height - i}
+ }, s: function (e, t, i) {
+ return {height: this.originalSize.height + i}
+ }, se: function (t, i, s) {
+ return e.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [t, i, s]))
+ }, sw: function (t, i, s) {
+ return e.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [t, i, s]))
+ }, ne: function (t, i, s) {
+ return e.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [t, i, s]))
+ }, nw: function (t, i, s) {
+ return e.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [t, i, s]))
+ }
+ },
+ _propagate: function (t, i) {
+ e.ui.plugin.call(this, t, [i, this.ui()]), "resize" !== t && this._trigger(t, i, this.ui())
+ },
+ plugins: {},
+ ui: function () {
+ return {
+ originalElement: this.originalElement,
+ element: this.element,
+ helper: this.helper,
+ position: this.position,
+ size: this.size,
+ originalSize: this.originalSize,
+ originalPosition: this.originalPosition
+ }
+ }
+ }), e.ui.plugin.add("resizable", "animate", {
+ stop: function (t) {
+ var i = e(this).resizable("instance"), s = i.options, n = i._proportionallyResizeElements, a = n.length && /textarea/i.test(n[0].nodeName), o = a && i._hasScroll(n[0], "left") ? 0 : i.sizeDiff.height, r = a ? 0 : i.sizeDiff.width, h = {
+ width: i.size.width - r,
+ height: i.size.height - o
+ }, l = parseInt(i.element.css("left"), 10) + (i.position.left - i.originalPosition.left) || null, u = parseInt(i.element.css("top"), 10) + (i.position.top - i.originalPosition.top) || null;
+ i.element.animate(e.extend(h, u && l ? {top: u, left: l} : {}), {
+ duration: s.animateDuration,
+ easing: s.animateEasing,
+ step: function () {
+ var s = {
+ width: parseInt(i.element.css("width"), 10),
+ height: parseInt(i.element.css("height"), 10),
+ top: parseInt(i.element.css("top"), 10),
+ left: parseInt(i.element.css("left"), 10)
+ };
+ n && n.length && e(n[0]).css({
+ width: s.width,
+ height: s.height
+ }), i._updateCache(s), i._propagate("resize", t)
+ }
+ })
+ }
+ }), e.ui.plugin.add("resizable", "containment", {
+ start: function () {
+ var t, i, s, n, a, o, r, h = e(this).resizable("instance"), l = h.options, u = h.element, d = l.containment, c = d instanceof e ? d.get(0) : /parent/.test(d) ? u.parent().get(0) : d;
+ c && (h.containerElement = e(c), /document/.test(d) || d === document ? (h.containerOffset = {
+ left: 0,
+ top: 0
+ }, h.containerPosition = {left: 0, top: 0}, h.parentData = {
+ element: e(document),
+ left: 0,
+ top: 0,
+ width: e(document).width(),
+ height: e(document).height() || document.body.parentNode.scrollHeight
+ }) : (t = e(c), i = [], e(["Top", "Right", "Left", "Bottom"]).each(function (e, s) {
+ i[e] = h._num(t.css("padding" + s))
+ }), h.containerOffset = t.offset(), h.containerPosition = t.position(), h.containerSize = {
+ height: t.innerHeight() - i[3],
+ width: t.innerWidth() - i[1]
+ }, s = h.containerOffset, n = h.containerSize.height, a = h.containerSize.width, o = h._hasScroll(c, "left") ? c.scrollWidth : a, r = h._hasScroll(c) ? c.scrollHeight : n, h.parentData = {
+ element: c,
+ left: s.left,
+ top: s.top,
+ width: o,
+ height: r
+ }))
+ }, resize: function (t) {
+ var i, s, n, a, o = e(this).resizable("instance"), r = o.options, h = o.containerOffset, l = o.position, u = o._aspectRatio || t.shiftKey, d = {
+ top: 0,
+ left: 0
+ }, c = o.containerElement, p = !0;
+ c[0] !== document && /static/.test(c.css("position")) && (d = h), l.left < (o._helper ? h.left : 0) && (o.size.width = o.size.width + (o._helper ? o.position.left - h.left : o.position.left - d.left), u && (o.size.height = o.size.width / o.aspectRatio, p = !1), o.position.left = r.helper ? h.left : 0), l.top < (o._helper ? h.top : 0) && (o.size.height = o.size.height + (o._helper ? o.position.top - h.top : o.position.top), u && (o.size.width = o.size.height * o.aspectRatio, p = !1), o.position.top = o._helper ? h.top : 0), n = o.containerElement.get(0) === o.element.parent().get(0), a = /relative|absolute/.test(o.containerElement.css("position")), n && a ? (o.offset.left = o.parentData.left + o.position.left, o.offset.top = o.parentData.top + o.position.top) : (o.offset.left = o.element.offset().left, o.offset.top = o.element.offset().top), i = Math.abs(o.sizeDiff.width + (o._helper ? o.offset.left - d.left : o.offset.left - h.left)), s = Math.abs(o.sizeDiff.height + (o._helper ? o.offset.top - d.top : o.offset.top - h.top)), i + o.size.width >= o.parentData.width && (o.size.width = o.parentData.width - i, u && (o.size.height = o.size.width / o.aspectRatio, p = !1)), s + o.size.height >= o.parentData.height && (o.size.height = o.parentData.height - s, u && (o.size.width = o.size.height * o.aspectRatio, p = !1)), p || (o.position.left = o.prevPosition.left, o.position.top = o.prevPosition.top, o.size.width = o.prevSize.width, o.size.height = o.prevSize.height)
+ }, stop: function () {
+ var t = e(this).resizable("instance"), i = t.options, s = t.containerOffset, n = t.containerPosition, a = t.containerElement, o = e(t.helper), r = o.offset(), h = o.outerWidth() - t.sizeDiff.width, l = o.outerHeight() - t.sizeDiff.height;
+ t._helper && !i.animate && /relative/.test(a.css("position")) && e(this).css({
+ left: r.left - n.left - s.left,
+ width: h,
+ height: l
+ }), t._helper && !i.animate && /static/.test(a.css("position")) && e(this).css({
+ left: r.left - n.left - s.left,
+ width: h,
+ height: l
+ })
+ }
+ }), e.ui.plugin.add("resizable", "alsoResize", {
+ start: function () {
+ var t = e(this).resizable("instance"), i = t.options;
+ e(i.alsoResize).each(function () {
+ var t = e(this);
+ t.data("ui-resizable-alsoresize", {
+ width: parseInt(t.width(), 10),
+ height: parseInt(t.height(), 10),
+ left: parseInt(t.css("left"), 10),
+ top: parseInt(t.css("top"), 10)
+ })
+ })
+ }, resize: function (t, i) {
+ var s = e(this).resizable("instance"), n = s.options, a = s.originalSize, o = s.originalPosition, r = {
+ height: s.size.height - a.height || 0,
+ width: s.size.width - a.width || 0,
+ top: s.position.top - o.top || 0,
+ left: s.position.left - o.left || 0
+ };
+ e(n.alsoResize).each(function () {
+ var t = e(this), s = e(this).data("ui-resizable-alsoresize"), n = {}, a = t.parents(i.originalElement[0]).length ? ["width", "height"] : ["width", "height", "top", "left"];
+ e.each(a, function (e, t) {
+ var i = (s[t] || 0) + (r[t] || 0);
+ i && i >= 0 && (n[t] = i || null)
+ }), t.css(n)
+ })
+ }, stop: function () {
+ e(this).removeData("resizable-alsoresize")
+ }
+ }), e.ui.plugin.add("resizable", "ghost", {
+ start: function () {
+ var t = e(this).resizable("instance"), i = t.options, s = t.size;
+ t.ghost = t.originalElement.clone(), t.ghost.css({
+ opacity: .25,
+ display: "block",
+ position: "relative",
+ height: s.height,
+ width: s.width,
+ margin: 0,
+ left: 0,
+ top: 0
+ }).addClass("ui-resizable-ghost").addClass("string" == typeof i.ghost ? i.ghost : ""), t.ghost.appendTo(t.helper)
+ }, resize: function () {
+ var t = e(this).resizable("instance");
+ t.ghost && t.ghost.css({position: "relative", height: t.size.height, width: t.size.width})
+ }, stop: function () {
+ var t = e(this).resizable("instance");
+ t.ghost && t.helper && t.helper.get(0).removeChild(t.ghost.get(0))
+ }
+ }), e.ui.plugin.add("resizable", "grid", {
+ resize: function () {
+ var t, i = e(this).resizable("instance"), s = i.options, n = i.size, a = i.originalSize, o = i.originalPosition, r = i.axis, h = "number" == typeof s.grid ? [s.grid, s.grid] : s.grid, l = h[0] || 1, u = h[1] || 1, d = Math.round((n.width - a.width) / l) * l, c = Math.round((n.height - a.height) / u) * u, p = a.width + d, f = a.height + c, m = s.maxWidth && p > s.maxWidth, g = s.maxHeight && f > s.maxHeight, v = s.minWidth && s.minWidth > p, y = s.minHeight && s.minHeight > f;
+ s.grid = h, v && (p += l), y && (f += u), m && (p -= l), g && (f -= u), /^(se|s|e)$/.test(r) ? (i.size.width = p, i.size.height = f) : /^(ne)$/.test(r) ? (i.size.width = p, i.size.height = f, i.position.top = o.top - c) : /^(sw)$/.test(r) ? (i.size.width = p, i.size.height = f, i.position.left = o.left - d) : ((0 >= f - u || 0 >= p - l) && (t = i._getPaddingPlusBorderDimensions(this)), f - u > 0 ? (i.size.height = f, i.position.top = o.top - c) : (f = u - t.height, i.size.height = f, i.position.top = o.top + a.height - f), p - l > 0 ? (i.size.width = p, i.position.left = o.left - d) : (p = l - t.width, i.size.width = p, i.position.left = o.left + a.width - p))
+ }
+ }), e.ui.resizable, e.widget("ui.selectable", e.ui.mouse, {
+ version: "1.11.4",
+ options: {
+ appendTo: "body",
+ autoRefresh: !0,
+ distance: 0,
+ filter: "*",
+ tolerance: "touch",
+ selected: null,
+ selecting: null,
+ start: null,
+ stop: null,
+ unselected: null,
+ unselecting: null
+ },
+ _create: function () {
+ var t, i = this;
+ this.element.addClass("ui-selectable"), this.dragged = !1, this.refresh = function () {
+ t = e(i.options.filter, i.element[0]), t.addClass("ui-selectee"), t.each(function () {
+ var t = e(this), i = t.offset();
+ e.data(this, "selectable-item", {
+ element: this,
+ $element: t,
+ left: i.left,
+ top: i.top,
+ right: i.left + t.outerWidth(),
+ bottom: i.top + t.outerHeight(),
+ startselected: !1,
+ selected: t.hasClass("ui-selected"),
+ selecting: t.hasClass("ui-selecting"),
+ unselecting: t.hasClass("ui-unselecting")
+ })
+ })
+ }, this.refresh(), this.selectees = t.addClass("ui-selectee"), this._mouseInit(), this.helper = e("<div class='ui-selectable-helper'></div>")
+ },
+ _destroy: function () {
+ this.selectees.removeClass("ui-selectee").removeData("selectable-item"), this.element.removeClass("ui-selectable ui-selectable-disabled"), this._mouseDestroy()
+ },
+ _mouseStart: function (t) {
+ var i = this, s = this.options;
+ this.opos = [t.pageX, t.pageY], this.options.disabled || (this.selectees = e(s.filter, this.element[0]), this._trigger("start", t), e(s.appendTo).append(this.helper), this.helper.css({
+ left: t.pageX,
+ top: t.pageY,
+ width: 0,
+ height: 0
+ }), s.autoRefresh && this.refresh(), this.selectees.filter(".ui-selected").each(function () {
+ var s = e.data(this, "selectable-item");
+ s.startselected = !0, t.metaKey || t.ctrlKey || (s.$element.removeClass("ui-selected"), s.selected = !1, s.$element.addClass("ui-unselecting"), s.unselecting = !0, i._trigger("unselecting", t, {unselecting: s.element}))
+ }), e(t.target).parents().addBack().each(function () {
+ var s, n = e.data(this, "selectable-item");
+ return n ? (s = !t.metaKey && !t.ctrlKey || !n.$element.hasClass("ui-selected"), n.$element.removeClass(s ? "ui-unselecting" : "ui-selected").addClass(s ? "ui-selecting" : "ui-unselecting"), n.unselecting = !s, n.selecting = s, n.selected = s, s ? i._trigger("selecting", t, {selecting: n.element}) : i._trigger("unselecting", t, {unselecting: n.element}), !1) : void 0
+ }))
+ },
+ _mouseDrag: function (t) {
+ if (this.dragged = !0, !this.options.disabled) {
+ var i, s = this, n = this.options, a = this.opos[0], o = this.opos[1], r = t.pageX, h = t.pageY;
+ return a > r && (i = r, r = a, a = i), o > h && (i = h, h = o, o = i), this.helper.css({
+ left: a,
+ top: o,
+ width: r - a,
+ height: h - o
+ }), this.selectees.each(function () {
+ var i = e.data(this, "selectable-item"), l = !1;
+ i && i.element !== s.element[0] && ("touch" === n.tolerance ? l = !(i.left > r || a > i.right || i.top > h || o > i.bottom) : "fit" === n.tolerance && (l = i.left > a && r > i.right && i.top > o && h > i.bottom), l ? (i.selected && (i.$element.removeClass("ui-selected"), i.selected = !1), i.unselecting && (i.$element.removeClass("ui-unselecting"), i.unselecting = !1), i.selecting || (i.$element.addClass("ui-selecting"), i.selecting = !0, s._trigger("selecting", t, {selecting: i.element}))) : (i.selecting && ((t.metaKey || t.ctrlKey) && i.startselected ? (i.$element.removeClass("ui-selecting"), i.selecting = !1, i.$element.addClass("ui-selected"), i.selected = !0) : (i.$element.removeClass("ui-selecting"), i.selecting = !1, i.startselected && (i.$element.addClass("ui-unselecting"), i.unselecting = !0), s._trigger("unselecting", t, {unselecting: i.element}))), i.selected && (t.metaKey || t.ctrlKey || i.startselected || (i.$element.removeClass("ui-selected"), i.selected = !1, i.$element.addClass("ui-unselecting"), i.unselecting = !0, s._trigger("unselecting", t, {unselecting: i.element})))))
+ }), !1
+ }
+ },
+ _mouseStop: function (t) {
+ var i = this;
+ return this.dragged = !1, e(".ui-unselecting", this.element[0]).each(function () {
+ var s = e.data(this, "selectable-item");
+ s.$element.removeClass("ui-unselecting"), s.unselecting = !1, s.startselected = !1, i._trigger("unselected", t, {unselected: s.element})
+ }), e(".ui-selecting", this.element[0]).each(function () {
+ var s = e.data(this, "selectable-item");
+ s.$element.removeClass("ui-selecting").addClass("ui-selected"), s.selecting = !1, s.selected = !0, s.startselected = !0, i._trigger("selected", t, {selected: s.element})
+ }), this._trigger("stop", t), this.helper.remove(), !1
+ }
+ }), e.widget("ui.sortable", e.ui.mouse, {
+ version: "1.11.4",
+ widgetEventPrefix: "sort",
+ ready: !1,
+ options: {
+ appendTo: "parent",
+ axis: !1,
+ connectWith: !1,
+ containment: !1,
+ cursor: "auto",
+ cursorAt: !1,
+ dropOnEmpty: !0,
+ forcePlaceholderSize: !1,
+ forceHelperSize: !1,
+ grid: !1,
+ handle: !1,
+ helper: "original",
+ items: "> *",
+ opacity: !1,
+ placeholder: !1,
+ revert: !1,
+ scroll: !0,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ scope: "default",
+ tolerance: "intersect",
+ zIndex: 1e3,
+ activate: null,
+ beforeStop: null,
+ change: null,
+ deactivate: null,
+ out: null,
+ over: null,
+ receive: null,
+ remove: null,
+ sort: null,
+ start: null,
+ stop: null,
+ update: null
+ },
+ _isOverAxis: function (e, t, i) {
+ return e >= t && t + i > e
+ },
+ _isFloating: function (e) {
+ return /left|right/.test(e.css("float")) || /inline|table-cell/.test(e.css("display"))
+ },
+ _create: function () {
+ this.containerCache = {}, this.element.addClass("ui-sortable"), this.refresh(), this.offset = this.element.offset(), this._mouseInit(), this._setHandleClassName(), this.ready = !0
+ },
+ _setOption: function (e, t) {
+ this._super(e, t), "handle" === e && this._setHandleClassName()
+ },
+ _setHandleClassName: function () {
+ this.element.find(".ui-sortable-handle").removeClass("ui-sortable-handle"), e.each(this.items, function () {
+ (this.instance.options.handle ? this.item.find(this.instance.options.handle) : this.item).addClass("ui-sortable-handle")
+ })
+ },
+ _destroy: function () {
+ this.element.removeClass("ui-sortable ui-sortable-disabled").find(".ui-sortable-handle").removeClass("ui-sortable-handle"), this._mouseDestroy();
+ for (var e = this.items.length - 1; e >= 0; e--)this.items[e].item.removeData(this.widgetName + "-item");
+ return this
+ },
+ _mouseCapture: function (t, i) {
+ var s = null, n = !1, a = this;
+ return this.reverting ? !1 : this.options.disabled || "static" === this.options.type ? !1 : (this._refreshItems(t), e(t.target).parents().each(function () {
+ return e.data(this, a.widgetName + "-item") === a ? (s = e(this), !1) : void 0
+ }), e.data(t.target, a.widgetName + "-item") === a && (s = e(t.target)), s ? !this.options.handle || i || (e(this.options.handle, s).find("*").addBack().each(function () {
+ this === t.target && (n = !0)
+ }), n) ? (this.currentItem = s, this._removeCurrentsFromItems(), !0) : !1 : !1)
+ },
+ _mouseStart: function (t, i, s) {
+ var n, a, o = this.options;
+ if (this.currentContainer = this, this.refreshPositions(), this.helper = this._createHelper(t), this._cacheHelperProportions(), this._cacheMargins(), this.scrollParent = this.helper.scrollParent(), this.offset = this.currentItem.offset(), this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ }, e.extend(this.offset, {
+ click: {left: t.pageX - this.offset.left, top: t.pageY - this.offset.top},
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset()
+ }), this.helper.css("position", "absolute"), this.cssPosition = this.helper.css("position"), this.originalPosition = this._generatePosition(t), this.originalPageX = t.pageX, this.originalPageY = t.pageY, o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt), this.domPosition = {
+ prev: this.currentItem.prev()[0],
+ parent: this.currentItem.parent()[0]
+ }, this.helper[0] !== this.currentItem[0] && this.currentItem.hide(), this._createPlaceholder(), o.containment && this._setContainment(), o.cursor && "auto" !== o.cursor && (a = this.document.find("body"), this.storedCursor = a.css("cursor"), a.css("cursor", o.cursor), this.storedStylesheet = e("<style>*{ cursor: " + o.cursor + " !important; }</style>").appendTo(a)), o.opacity && (this.helper.css("opacity") && (this._storedOpacity = this.helper.css("opacity")), this.helper.css("opacity", o.opacity)), o.zIndex && (this.helper.css("zIndex") && (this._storedZIndex = this.helper.css("zIndex")), this.helper.css("zIndex", o.zIndex)), this.scrollParent[0] !== this.document[0] && "HTML" !== this.scrollParent[0].tagName && (this.overflowOffset = this.scrollParent.offset()), this._trigger("start", t, this._uiHash()), this._preserveHelperProportions || this._cacheHelperProportions(), !s)for (n = this.containers.length - 1; n >= 0; n--)this.containers[n]._trigger("activate", t, this._uiHash(this));
+ return e.ui.ddmanager && (e.ui.ddmanager.current = this), e.ui.ddmanager && !o.dropBehaviour && e.ui.ddmanager.prepareOffsets(this, t), this.dragging = !0, this.helper.addClass("ui-sortable-helper"), this._mouseDrag(t), !0
+ },
+ _mouseDrag: function (t) {
+ var i, s, n, a, o = this.options, r = !1;
+ for (this.position = this._generatePosition(t), this.positionAbs = this._convertPositionTo("absolute"), this.lastPositionAbs || (this.lastPositionAbs = this.positionAbs), this.options.scroll && (this.scrollParent[0] !== this.document[0] && "HTML" !== this.scrollParent[0].tagName ? (this.overflowOffset.top + this.scrollParent[0].offsetHeight - t.pageY < o.scrollSensitivity ? this.scrollParent[0].scrollTop = r = this.scrollParent[0].scrollTop + o.scrollSpeed : t.pageY - this.overflowOffset.top < o.scrollSensitivity && (this.scrollParent[0].scrollTop = r = this.scrollParent[0].scrollTop - o.scrollSpeed), this.overflowOffset.left + this.scrollParent[0].offsetWidth - t.pageX < o.scrollSensitivity ? this.scrollParent[0].scrollLeft = r = this.scrollParent[0].scrollLeft + o.scrollSpeed : t.pageX - this.overflowOffset.left < o.scrollSensitivity && (this.scrollParent[0].scrollLeft = r = this.scrollParent[0].scrollLeft - o.scrollSpeed)) : (t.pageY - this.document.scrollTop() < o.scrollSensitivity ? r = this.document.scrollTop(this.document.scrollTop() - o.scrollSpeed) : this.window.height() - (t.pageY - this.document.scrollTop()) < o.scrollSensitivity && (r = this.document.scrollTop(this.document.scrollTop() + o.scrollSpeed)), t.pageX - this.document.scrollLeft() < o.scrollSensitivity ? r = this.document.scrollLeft(this.document.scrollLeft() - o.scrollSpeed) : this.window.width() - (t.pageX - this.document.scrollLeft()) < o.scrollSensitivity && (r = this.document.scrollLeft(this.document.scrollLeft() + o.scrollSpeed))), r !== !1 && e.ui.ddmanager && !o.dropBehaviour && e.ui.ddmanager.prepareOffsets(this, t)), this.positionAbs = this._convertPositionTo("absolute"), this.options.axis && "y" === this.options.axis || (this.helper[0].style.left = this.position.left + "px"), this.options.axis && "x" === this.options.axis || (this.helper[0].style.top = this.position.top + "px"), i = this.items.length - 1; i >= 0; i--)if (s = this.items[i], n = s.item[0], a = this._intersectsWithPointer(s), a && s.instance === this.currentContainer && n !== this.currentItem[0] && this.placeholder[1 === a ? "next" : "prev"]()[0] !== n && !e.contains(this.placeholder[0], n) && ("semi-dynamic" === this.options.type ? !e.contains(this.element[0], n) : !0)) {
+ if (this.direction = 1 === a ? "down" : "up", "pointer" !== this.options.tolerance && !this._intersectsWithSides(s))break;
+ this._rearrange(t, s), this._trigger("change", t, this._uiHash());
+ break
+ }
+ return this._contactContainers(t), e.ui.ddmanager && e.ui.ddmanager.drag(this, t), this._trigger("sort", t, this._uiHash()), this.lastPositionAbs = this.positionAbs, !1
+ },
+ _mouseStop: function (t, i) {
+ if (t) {
+ if (e.ui.ddmanager && !this.options.dropBehaviour && e.ui.ddmanager.drop(this, t), this.options.revert) {
+ var s = this, n = this.placeholder.offset(), a = this.options.axis, o = {};
+ a && "x" !== a || (o.left = n.left - this.offset.parent.left - this.margins.left + (this.offsetParent[0] === this.document[0].body ? 0 : this.offsetParent[0].scrollLeft)), a && "y" !== a || (o.top = n.top - this.offset.parent.top - this.margins.top + (this.offsetParent[0] === this.document[0].body ? 0 : this.offsetParent[0].scrollTop)), this.reverting = !0, e(this.helper).animate(o, parseInt(this.options.revert, 10) || 500, function () {
+ s._clear(t)
+ })
+ } else this._clear(t, i);
+ return !1
+ }
+ },
+ cancel: function () {
+ if (this.dragging) {
+ this._mouseUp({target: null}), "original" === this.options.helper ? this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper") : this.currentItem.show();
+ for (var t = this.containers.length - 1; t >= 0; t--)this.containers[t]._trigger("deactivate", null, this._uiHash(this)), this.containers[t].containerCache.over && (this.containers[t]._trigger("out", null, this._uiHash(this)), this.containers[t].containerCache.over = 0)
+ }
+ return this.placeholder && (this.placeholder[0].parentNode && this.placeholder[0].parentNode.removeChild(this.placeholder[0]), "original" !== this.options.helper && this.helper && this.helper[0].parentNode && this.helper.remove(), e.extend(this, {
+ helper: null,
+ dragging: !1,
+ reverting: !1,
+ _noFinalSort: null
+ }), this.domPosition.prev ? e(this.domPosition.prev).after(this.currentItem) : e(this.domPosition.parent).prepend(this.currentItem)), this
+ },
+ serialize: function (t) {
+ var i = this._getItemsAsjQuery(t && t.connected), s = [];
+ return t = t || {}, e(i).each(function () {
+ var i = (e(t.item || this).attr(t.attribute || "id") || "").match(t.expression || /(.+)[\-=_](.+)/);
+ i && s.push((t.key || i[1] + "[]") + "=" + (t.key && t.expression ? i[1] : i[2]))
+ }), !s.length && t.key && s.push(t.key + "="), s.join("&")
+ },
+ toArray: function (t) {
+ var i = this._getItemsAsjQuery(t && t.connected), s = [];
+ return t = t || {}, i.each(function () {
+ s.push(e(t.item || this).attr(t.attribute || "id") || "")
+ }), s
+ },
+ _intersectsWith: function (e) {
+ var t = this.positionAbs.left, i = t + this.helperProportions.width, s = this.positionAbs.top, n = s + this.helperProportions.height, a = e.left, o = a + e.width, r = e.top, h = r + e.height, l = this.offset.click.top, u = this.offset.click.left, d = "x" === this.options.axis || s + l > r && h > s + l, c = "y" === this.options.axis || t + u > a && o > t + u, p = d && c;
+ return "pointer" === this.options.tolerance || this.options.forcePointerForContainers || "pointer" !== this.options.tolerance && this.helperProportions[this.floating ? "width" : "height"] > e[this.floating ? "width" : "height"] ? p : t + this.helperProportions.width / 2 > a && o > i - this.helperProportions.width / 2 && s + this.helperProportions.height / 2 > r && h > n - this.helperProportions.height / 2
+ },
+ _intersectsWithPointer: function (e) {
+ var t = "x" === this.options.axis || this._isOverAxis(this.positionAbs.top + this.offset.click.top, e.top, e.height), i = "y" === this.options.axis || this._isOverAxis(this.positionAbs.left + this.offset.click.left, e.left, e.width), s = t && i, n = this._getDragVerticalDirection(), a = this._getDragHorizontalDirection();
+ return s ? this.floating ? a && "right" === a || "down" === n ? 2 : 1 : n && ("down" === n ? 2 : 1) : !1
+ },
+ _intersectsWithSides: function (e) {
+ var t = this._isOverAxis(this.positionAbs.top + this.offset.click.top, e.top + e.height / 2, e.height), i = this._isOverAxis(this.positionAbs.left + this.offset.click.left, e.left + e.width / 2, e.width), s = this._getDragVerticalDirection(), n = this._getDragHorizontalDirection();
+ return this.floating && n ? "right" === n && i || "left" === n && !i : s && ("down" === s && t || "up" === s && !t)
+ },
+ _getDragVerticalDirection: function () {
+ var e = this.positionAbs.top - this.lastPositionAbs.top;
+ return 0 !== e && (e > 0 ? "down" : "up")
+ },
+ _getDragHorizontalDirection: function () {
+ var e = this.positionAbs.left - this.lastPositionAbs.left;
+ return 0 !== e && (e > 0 ? "right" : "left")
+ },
+ refresh: function (e) {
+ return this._refreshItems(e), this._setHandleClassName(), this.refreshPositions(), this
+ },
+ _connectWith: function () {
+ var e = this.options;
+ return e.connectWith.constructor === String ? [e.connectWith] : e.connectWith
+ },
+ _getItemsAsjQuery: function (t) {
+ function i() {
+ r.push(this)
+ }
+
+ var s, n, a, o, r = [], h = [], l = this._connectWith();
+ if (l && t)for (s = l.length - 1; s >= 0; s--)for (a = e(l[s], this.document[0]), n = a.length - 1; n >= 0; n--)o = e.data(a[n], this.widgetFullName), o && o !== this && !o.options.disabled && h.push([e.isFunction(o.options.items) ? o.options.items.call(o.element) : e(o.options.items, o.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), o]);
+ for (h.push([e.isFunction(this.options.items) ? this.options.items.call(this.element, null, {
+ options: this.options,
+ item: this.currentItem
+ }) : e(this.options.items, this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), this]), s = h.length - 1; s >= 0; s--)h[s][0].each(i);
+ return e(r)
+ },
+ _removeCurrentsFromItems: function () {
+ var t = this.currentItem.find(":data(" + this.widgetName + "-item)");
+ this.items = e.grep(this.items, function (e) {
+ for (var i = 0; t.length > i; i++)if (t[i] === e.item[0])return !1;
+ return !0
+ })
+ },
+ _refreshItems: function (t) {
+ this.items = [], this.containers = [this];
+ var i, s, n, a, o, r, h, l, u = this.items, d = [[e.isFunction(this.options.items) ? this.options.items.call(this.element[0], t, {item: this.currentItem}) : e(this.options.items, this.element), this]], c = this._connectWith();
+ if (c && this.ready)for (i = c.length - 1; i >= 0; i--)for (n = e(c[i], this.document[0]), s = n.length - 1; s >= 0; s--)a = e.data(n[s], this.widgetFullName), a && a !== this && !a.options.disabled && (d.push([e.isFunction(a.options.items) ? a.options.items.call(a.element[0], t, {item: this.currentItem}) : e(a.options.items, a.element), a]), this.containers.push(a));
+ for (i = d.length - 1; i >= 0; i--)for (o = d[i][1], r = d[i][0], s = 0, l = r.length; l > s; s++)h = e(r[s]), h.data(this.widgetName + "-item", o), u.push({
+ item: h,
+ instance: o,
+ width: 0,
+ height: 0,
+ left: 0,
+ top: 0
+ })
+ },
+ refreshPositions: function (t) {
+ this.floating = this.items.length ? "x" === this.options.axis || this._isFloating(this.items[0].item) : !1, this.offsetParent && this.helper && (this.offset.parent = this._getParentOffset());
+ var i, s, n, a;
+ for (i = this.items.length - 1; i >= 0; i--)s = this.items[i], s.instance !== this.currentContainer && this.currentContainer && s.item[0] !== this.currentItem[0] || (n = this.options.toleranceElement ? e(this.options.toleranceElement, s.item) : s.item, t || (s.width = n.outerWidth(), s.height = n.outerHeight()), a = n.offset(), s.left = a.left, s.top = a.top);
+ if (this.options.custom && this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this); else for (i = this.containers.length - 1; i >= 0; i--)a = this.containers[i].element.offset(), this.containers[i].containerCache.left = a.left, this.containers[i].containerCache.top = a.top, this.containers[i].containerCache.width = this.containers[i].element.outerWidth(), this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
+ return this
+ },
+ _createPlaceholder: function (t) {
+ t = t || this;
+ var i, s = t.options;
+ s.placeholder && s.placeholder.constructor !== String || (i = s.placeholder, s.placeholder = {
+ element: function () {
+ var s = t.currentItem[0].nodeName.toLowerCase(), n = e("<" + s + ">", t.document[0]).addClass(i || t.currentItem[0].className + " ui-sortable-placeholder").removeClass("ui-sortable-helper");
+ return "tbody" === s ? t._createTrPlaceholder(t.currentItem.find("tr").eq(0), e("<tr>", t.document[0]).appendTo(n)) : "tr" === s ? t._createTrPlaceholder(t.currentItem, n) : "img" === s && n.attr("src", t.currentItem.attr("src")), i || n.css("visibility", "hidden"), n
+ }, update: function (e, n) {
+ (!i || s.forcePlaceholderSize) && (n.height() || n.height(t.currentItem.innerHeight() - parseInt(t.currentItem.css("paddingTop") || 0, 10) - parseInt(t.currentItem.css("paddingBottom") || 0, 10)), n.width() || n.width(t.currentItem.innerWidth() - parseInt(t.currentItem.css("paddingLeft") || 0, 10) - parseInt(t.currentItem.css("paddingRight") || 0, 10)))
+ }
+ }), t.placeholder = e(s.placeholder.element.call(t.element, t.currentItem)), t.currentItem.after(t.placeholder), s.placeholder.update(t, t.placeholder)
+ },
+ _createTrPlaceholder: function (t, i) {
+ var s = this;
+ t.children().each(function () {
+ e("<td> </td>", s.document[0]).attr("colspan", e(this).attr("colspan") || 1).appendTo(i)
+ })
+ },
+ _contactContainers: function (t) {
+ var i, s, n, a, o, r, h, l, u, d, c = null, p = null;
+ for (i = this.containers.length - 1; i >= 0; i--)if (!e.contains(this.currentItem[0], this.containers[i].element[0]))if (this._intersectsWith(this.containers[i].containerCache)) {
+ if (c && e.contains(this.containers[i].element[0], c.element[0]))continue;
+ c = this.containers[i], p = i
+ } else this.containers[i].containerCache.over && (this.containers[i]._trigger("out", t, this._uiHash(this)), this.containers[i].containerCache.over = 0);
+ if (c)if (1 === this.containers.length)this.containers[p].containerCache.over || (this.containers[p]._trigger("over", t, this._uiHash(this)), this.containers[p].containerCache.over = 1); else {
+ for (n = 1e4, a = null, u = c.floating || this._isFloating(this.currentItem), o = u ? "left" : "top", r = u ? "width" : "height", d = u ? "clientX" : "clientY", s = this.items.length - 1; s >= 0; s--)e.contains(this.containers[p].element[0], this.items[s].item[0]) && this.items[s].item[0] !== this.currentItem[0] && (h = this.items[s].item.offset()[o], l = !1, t[d] - h > this.items[s][r] / 2 && (l = !0), n > Math.abs(t[d] - h) && (n = Math.abs(t[d] - h), a = this.items[s], this.direction = l ? "up" : "down"));
+ if (!a && !this.options.dropOnEmpty)return;
+ if (this.currentContainer === this.containers[p])return this.currentContainer.containerCache.over || (this.containers[p]._trigger("over", t, this._uiHash()), this.currentContainer.containerCache.over = 1), void 0;
+ a ? this._rearrange(t, a, null, !0) : this._rearrange(t, null, this.containers[p].element, !0), this._trigger("change", t, this._uiHash()), this.containers[p]._trigger("change", t, this._uiHash(this)), this.currentContainer = this.containers[p], this.options.placeholder.update(this.currentContainer, this.placeholder), this.containers[p]._trigger("over", t, this._uiHash(this)), this.containers[p].containerCache.over = 1
+ }
+ },
+ _createHelper: function (t) {
+ var i = this.options, s = e.isFunction(i.helper) ? e(i.helper.apply(this.element[0], [t, this.currentItem])) : "clone" === i.helper ? this.currentItem.clone() : this.currentItem;
+ return s.parents("body").length || e("parent" !== i.appendTo ? i.appendTo : this.currentItem[0].parentNode)[0].appendChild(s[0]), s[0] === this.currentItem[0] && (this._storedCSS = {
+ width: this.currentItem[0].style.width,
+ height: this.currentItem[0].style.height,
+ position: this.currentItem.css("position"),
+ top: this.currentItem.css("top"),
+ left: this.currentItem.css("left")
+ }), (!s[0].style.width || i.forceHelperSize) && s.width(this.currentItem.width()), (!s[0].style.height || i.forceHelperSize) && s.height(this.currentItem.height()), s
+ },
+ _adjustOffsetFromHelper: function (t) {
+ "string" == typeof t && (t = t.split(" ")), e.isArray(t) && (t = {
+ left: +t[0],
+ top: +t[1] || 0
+ }), "left"in t && (this.offset.click.left = t.left + this.margins.left), "right"in t && (this.offset.click.left = this.helperProportions.width - t.right + this.margins.left), "top"in t && (this.offset.click.top = t.top + this.margins.top), "bottom"in t && (this.offset.click.top = this.helperProportions.height - t.bottom + this.margins.top)
+ },
+ _getParentOffset: function () {
+ this.offsetParent = this.helper.offsetParent();
+ var t = this.offsetParent.offset();
+ return "absolute" === this.cssPosition && this.scrollParent[0] !== this.document[0] && e.contains(this.scrollParent[0], this.offsetParent[0]) && (t.left += this.scrollParent.scrollLeft(), t.top += this.scrollParent.scrollTop()), (this.offsetParent[0] === this.document[0].body || this.offsetParent[0].tagName && "html" === this.offsetParent[0].tagName.toLowerCase() && e.ui.ie) && (t = {
+ top: 0,
+ left: 0
+ }), {
+ top: t.top + (parseInt(this.offsetParent.css("borderTopWidth"), 10) || 0),
+ left: t.left + (parseInt(this.offsetParent.css("borderLeftWidth"), 10) || 0)
+ }
+ },
+ _getRelativeOffset: function () {
+ if ("relative" === this.cssPosition) {
+ var e = this.currentItem.position();
+ return {
+ top: e.top - (parseInt(this.helper.css("top"), 10) || 0) + this.scrollParent.scrollTop(),
+ left: e.left - (parseInt(this.helper.css("left"), 10) || 0) + this.scrollParent.scrollLeft()
+ }
+ }
+ return {top: 0, left: 0}
+ },
+ _cacheMargins: function () {
+ this.margins = {
+ left: parseInt(this.currentItem.css("marginLeft"), 10) || 0,
+ top: parseInt(this.currentItem.css("marginTop"), 10) || 0
+ }
+ },
+ _cacheHelperProportions: function () {
+ this.helperProportions = {width: this.helper.outerWidth(), height: this.helper.outerHeight()}
+ },
+ _setContainment: function () {
+ var t, i, s, n = this.options;
+ "parent" === n.containment && (n.containment = this.helper[0].parentNode), ("document" === n.containment || "window" === n.containment) && (this.containment = [0 - this.offset.relative.left - this.offset.parent.left, 0 - this.offset.relative.top - this.offset.parent.top, "document" === n.containment ? this.document.width() : this.window.width() - this.helperProportions.width - this.margins.left, ("document" === n.containment ? this.document.width() : this.window.height() || this.document[0].body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top]), /^(document|window|parent)$/.test(n.containment) || (t = e(n.containment)[0], i = e(n.containment).offset(), s = "hidden" !== e(t).css("overflow"), this.containment = [i.left + (parseInt(e(t).css("borderLeftWidth"), 10) || 0) + (parseInt(e(t).css("paddingLeft"), 10) || 0) - this.margins.left, i.top + (parseInt(e(t).css("borderTopWidth"), 10) || 0) + (parseInt(e(t).css("paddingTop"), 10) || 0) - this.margins.top, i.left + (s ? Math.max(t.scrollWidth, t.offsetWidth) : t.offsetWidth) - (parseInt(e(t).css("borderLeftWidth"), 10) || 0) - (parseInt(e(t).css("paddingRight"), 10) || 0) - this.helperProportions.width - this.margins.left, i.top + (s ? Math.max(t.scrollHeight, t.offsetHeight) : t.offsetHeight) - (parseInt(e(t).css("borderTopWidth"), 10) || 0) - (parseInt(e(t).css("paddingBottom"), 10) || 0) - this.helperProportions.height - this.margins.top])
+ },
+ _convertPositionTo: function (t, i) {
+ i || (i = this.position);
+ var s = "absolute" === t ? 1 : -1, n = "absolute" !== this.cssPosition || this.scrollParent[0] !== this.document[0] && e.contains(this.scrollParent[0], this.offsetParent[0]) ? this.scrollParent : this.offsetParent, a = /(html|body)/i.test(n[0].tagName);
+ return {
+ top: i.top + this.offset.relative.top * s + this.offset.parent.top * s - ("fixed" === this.cssPosition ? -this.scrollParent.scrollTop() : a ? 0 : n.scrollTop()) * s,
+ left: i.left + this.offset.relative.left * s + this.offset.parent.left * s - ("fixed" === this.cssPosition ? -this.scrollParent.scrollLeft() : a ? 0 : n.scrollLeft()) * s
+ }
+ },
+ _generatePosition: function (t) {
+ var i, s, n = this.options, a = t.pageX, o = t.pageY, r = "absolute" !== this.cssPosition || this.scrollParent[0] !== this.document[0] && e.contains(this.scrollParent[0], this.offsetParent[0]) ? this.scrollParent : this.offsetParent, h = /(html|body)/i.test(r[0].tagName);
+ return "relative" !== this.cssPosition || this.scrollParent[0] !== this.document[0] && this.scrollParent[0] !== this.offsetParent[0] || (this.offset.relative = this._getRelativeOffset()), this.originalPosition && (this.containment && (t.pageX - this.offset.click.left < this.containment[0] && (a = this.containment[0] + this.offset.click.left), t.pageY - this.offset.click.top < this.containment[1] && (o = this.containment[1] + this.offset.click.top), t.pageX - this.offset.click.left > this.containment[2] && (a = this.containment[2] + this.offset.click.left), t.pageY - this.offset.click.top > this.containment[3] && (o = this.containment[3] + this.offset.click.top)), n.grid && (i = this.originalPageY + Math.round((o - this.originalPageY) / n.grid[1]) * n.grid[1], o = this.containment ? i - this.offset.click.top >= this.containment[1] && i - this.offset.click.top <= this.containment[3] ? i : i - this.offset.click.top >= this.containment[1] ? i - n.grid[1] : i + n.grid[1] : i, s = this.originalPageX + Math.round((a - this.originalPageX) / n.grid[0]) * n.grid[0], a = this.containment ? s - this.offset.click.left >= this.containment[0] && s - this.offset.click.left <= this.containment[2] ? s : s - this.offset.click.left >= this.containment[0] ? s - n.grid[0] : s + n.grid[0] : s)), {
+ top: o - this.offset.click.top - this.offset.relative.top - this.offset.parent.top + ("fixed" === this.cssPosition ? -this.scrollParent.scrollTop() : h ? 0 : r.scrollTop()),
+ left: a - this.offset.click.left - this.offset.relative.left - this.offset.parent.left + ("fixed" === this.cssPosition ? -this.scrollParent.scrollLeft() : h ? 0 : r.scrollLeft())
+ }
+ },
+ _rearrange: function (e, t, i, s) {
+ i ? i[0].appendChild(this.placeholder[0]) : t.item[0].parentNode.insertBefore(this.placeholder[0], "down" === this.direction ? t.item[0] : t.item[0].nextSibling), this.counter = this.counter ? ++this.counter : 1;
+ var n = this.counter;
+ this._delay(function () {
+ n === this.counter && this.refreshPositions(!s)
+ })
+ },
+ _clear: function (e, t) {
+ function i(e, t, i) {
+ return function (s) {
+ i._trigger(e, s, t._uiHash(t))
+ }
+ }
+
+ this.reverting = !1;
+ var s, n = [];
+ if (!this._noFinalSort && this.currentItem.parent().length && this.placeholder.before(this.currentItem), this._noFinalSort = null, this.helper[0] === this.currentItem[0]) {
+ for (s in this._storedCSS)("auto" === this._storedCSS[s] || "static" === this._storedCSS[s]) && (this._storedCSS[s] = "");
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")
+ } else this.currentItem.show();
+ for (this.fromOutside && !t && n.push(function (e) {
+ this._trigger("receive", e, this._uiHash(this.fromOutside))
+ }), !this.fromOutside && this.domPosition.prev === this.currentItem.prev().not(".ui-sortable-helper")[0] && this.domPosition.parent === this.currentItem.parent()[0] || t || n.push(function (e) {
+ this._trigger("update", e, this._uiHash())
+ }), this !== this.currentContainer && (t || (n.push(function (e) {
+ this._trigger("remove", e, this._uiHash())
+ }), n.push(function (e) {
+ return function (t) {
+ e._trigger("receive", t, this._uiHash(this))
+ }
+ }.call(this, this.currentContainer)), n.push(function (e) {
+ return function (t) {
+ e._trigger("update", t, this._uiHash(this))
+ }
+ }.call(this, this.currentContainer)))), s = this.containers.length - 1; s >= 0; s--)t || n.push(i("deactivate", this, this.containers[s])), this.containers[s].containerCache.over && (n.push(i("out", this, this.containers[s])), this.containers[s].containerCache.over = 0);
+ if (this.storedCursor && (this.document.find("body").css("cursor", this.storedCursor), this.storedStylesheet.remove()), this._storedOpacity && this.helper.css("opacity", this._storedOpacity), this._storedZIndex && this.helper.css("zIndex", "auto" === this._storedZIndex ? "" : this._storedZIndex), this.dragging = !1, t || this._trigger("beforeStop", e, this._uiHash()), this.placeholder[0].parentNode.removeChild(this.placeholder[0]), this.cancelHelperRemoval || (this.helper[0] !== this.currentItem[0] && this.helper.remove(), this.helper = null), !t) {
+ for (s = 0; n.length > s; s++)n[s].call(this, e);
+ this._trigger("stop", e, this._uiHash())
+ }
+ return this.fromOutside = !1, !this.cancelHelperRemoval
+ },
+ _trigger: function () {
+ e.Widget.prototype._trigger.apply(this, arguments) === !1 && this.cancel()
+ },
+ _uiHash: function (t) {
+ var i = t || this;
+ return {
+ helper: i.helper,
+ placeholder: i.placeholder || e([]),
+ position: i.position,
+ originalPosition: i.originalPosition,
+ offset: i.positionAbs,
+ item: i.currentItem,
+ sender: t ? t.element : null
+ }
+ }
+ }), e.widget("ui.accordion", {
+ version: "1.11.4",
+ options: {
+ active: 0,
+ animate: {},
+ collapsible: !1,
+ event: "click",
+ header: "> li > :first-child,> :not(li):even",
+ heightStyle: "auto",
+ icons: {activeHeader: "ui-icon-triangle-1-s", header: "ui-icon-triangle-1-e"},
+ activate: null,
+ beforeActivate: null
+ },
+ hideProps: {
+ borderTopWidth: "hide",
+ borderBottomWidth: "hide",
+ paddingTop: "hide",
+ paddingBottom: "hide",
+ height: "hide"
+ },
+ showProps: {
+ borderTopWidth: "show",
+ borderBottomWidth: "show",
+ paddingTop: "show",
+ paddingBottom: "show",
+ height: "show"
+ },
+ _create: function () {
+ var t = this.options;
+ this.prevShow = this.prevHide = e(), this.element.addClass("ui-accordion ui-widget ui-helper-reset").attr("role", "tablist"), t.collapsible || t.active !== !1 && null != t.active || (t.active = 0), this._processPanels(), 0 > t.active && (t.active += this.headers.length), this._refresh()
+ },
+ _getCreateEventData: function () {
+ return {header: this.active, panel: this.active.length ? this.active.next() : e()}
+ },
+ _createIcons: function () {
+ var t = this.options.icons;
+ t && (e("<span>").addClass("ui-accordion-header-icon ui-icon " + t.header).prependTo(this.headers), this.active.children(".ui-accordion-header-icon").removeClass(t.header).addClass(t.activeHeader), this.headers.addClass("ui-accordion-icons"))
+ },
+ _destroyIcons: function () {
+ this.headers.removeClass("ui-accordion-icons").children(".ui-accordion-header-icon").remove()
+ },
+ _destroy: function () {
+ var e;
+ this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role"), this.headers.removeClass("ui-accordion-header ui-accordion-header-active ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("aria-controls").removeAttr("tabIndex").removeUniqueId(), this._destroyIcons(), e = this.headers.next().removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-state-disabled").css("display", "").removeAttr("role").removeAttr("aria-hidden").removeAttr("aria-labelledby").removeUniqueId(), "content" !== this.options.heightStyle && e.css("height", "")
+ },
+ _setOption: function (e, t) {
+ return "active" === e ? (this._activate(t), void 0) : ("event" === e && (this.options.event && this._off(this.headers, this.options.event), this._setupEvents(t)), this._super(e, t), "collapsible" !== e || t || this.options.active !== !1 || this._activate(0), "icons" === e && (this._destroyIcons(), t && this._createIcons()), "disabled" === e && (this.element.toggleClass("ui-state-disabled", !!t).attr("aria-disabled", t), this.headers.add(this.headers.next()).toggleClass("ui-state-disabled", !!t)), void 0)
+ },
+ _keydown: function (t) {
+ if (!t.altKey && !t.ctrlKey) {
+ var i = e.ui.keyCode, s = this.headers.length, n = this.headers.index(t.target), a = !1;
+ switch (t.keyCode) {
+ case i.RIGHT:
+ case i.DOWN:
+ a = this.headers[(n + 1) % s];
+ break;
+ case i.LEFT:
+ case i.UP:
+ a = this.headers[(n - 1 + s) % s];
+ break;
+ case i.SPACE:
+ case i.ENTER:
+ this._eventHandler(t);
+ break;
+ case i.HOME:
+ a = this.headers[0];
+ break;
+ case i.END:
+ a = this.headers[s - 1]
+ }
+ a && (e(t.target).attr("tabIndex", -1), e(a).attr("tabIndex", 0), a.focus(), t.preventDefault())
+ }
+ },
+ _panelKeyDown: function (t) {
+ t.keyCode === e.ui.keyCode.UP && t.ctrlKey && e(t.currentTarget).prev().focus()
+ },
+ refresh: function () {
+ var t = this.options;
+ this._processPanels(), t.active === !1 && t.collapsible === !0 || !this.headers.length ? (t.active = !1, this.active = e()) : t.active === !1 ? this._activate(0) : this.active.length && !e.contains(this.element[0], this.active[0]) ? this.headers.length === this.headers.find(".ui-state-disabled").length ? (t.active = !1, this.active = e()) : this._activate(Math.max(0, t.active - 1)) : t.active = this.headers.index(this.active), this._destroyIcons(), this._refresh()
+ },
+ _processPanels: function () {
+ var e = this.headers, t = this.panels;
+ this.headers = this.element.find(this.options.header).addClass("ui-accordion-header ui-state-default ui-corner-all"), this.panels = this.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom").filter(":not(.ui-accordion-content-active)").hide(), t && (this._off(e.not(this.headers)), this._off(t.not(this.panels)))
+ },
+ _refresh: function () {
+ var t, i = this.options, s = i.heightStyle, n = this.element.parent();
+ this.active = this._findActive(i.active).addClass("ui-accordion-header-active ui-state-active ui-corner-top").removeClass("ui-corner-all"), this.active.next().addClass("ui-accordion-content-active").show(), this.headers.attr("role", "tab").each(function () {
+ var t = e(this), i = t.uniqueId().attr("id"), s = t.next(), n = s.uniqueId().attr("id");
+ t.attr("aria-controls", n), s.attr("aria-labelledby", i)
+ }).next().attr("role", "tabpanel"), this.headers.not(this.active).attr({
+ "aria-selected": "false",
+ "aria-expanded": "false",
+ tabIndex: -1
+ }).next().attr({"aria-hidden": "true"}).hide(), this.active.length ? this.active.attr({
+ "aria-selected": "true",
+ "aria-expanded": "true",
+ tabIndex: 0
+ }).next().attr({"aria-hidden": "false"}) : this.headers.eq(0).attr("tabIndex", 0), this._createIcons(), this._setupEvents(i.event), "fill" === s ? (t = n.height(), this.element.siblings(":visible").each(function () {
+ var i = e(this), s = i.css("position");
+ "absolute" !== s && "fixed" !== s && (t -= i.outerHeight(!0))
+ }), this.headers.each(function () {
+ t -= e(this).outerHeight(!0)
+ }), this.headers.next().each(function () {
+ e(this).height(Math.max(0, t - e(this).innerHeight() + e(this).height()))
+ }).css("overflow", "auto")) : "auto" === s && (t = 0, this.headers.next().each(function () {
+ t = Math.max(t, e(this).css("height", "").height())
+ }).height(t))
+ },
+ _activate: function (t) {
+ var i = this._findActive(t)[0];
+ i !== this.active[0] && (i = i || this.active[0], this._eventHandler({
+ target: i,
+ currentTarget: i,
+ preventDefault: e.noop
+ }))
+ },
+ _findActive: function (t) {
+ return "number" == typeof t ? this.headers.eq(t) : e()
+ },
+ _setupEvents: function (t) {
+ var i = {keydown: "_keydown"};
+ t && e.each(t.split(" "), function (e, t) {
+ i[t] = "_eventHandler"
+ }), this._off(this.headers.add(this.headers.next())), this._on(this.headers, i), this._on(this.headers.next(), {keydown: "_panelKeyDown"}), this._hoverable(this.headers), this._focusable(this.headers)
+ },
+ _eventHandler: function (t) {
+ var i = this.options, s = this.active, n = e(t.currentTarget), a = n[0] === s[0], o = a && i.collapsible, r = o ? e() : n.next(), h = s.next(), l = {
+ oldHeader: s,
+ oldPanel: h,
+ newHeader: o ? e() : n,
+ newPanel: r
+ };
+ t.preventDefault(), a && !i.collapsible || this._trigger("beforeActivate", t, l) === !1 || (i.active = o ? !1 : this.headers.index(n), this.active = a ? e() : n, this._toggle(l), s.removeClass("ui-accordion-header-active ui-state-active"), i.icons && s.children(".ui-accordion-header-icon").removeClass(i.icons.activeHeader).addClass(i.icons.header), a || (n.removeClass("ui-corner-all").addClass("ui-accordion-header-active ui-state-active ui-corner-top"), i.icons && n.children(".ui-accordion-header-icon").removeClass(i.icons.header).addClass(i.icons.activeHeader), n.next().addClass("ui-accordion-content-active")))
+ },
+ _toggle: function (t) {
+ var i = t.newPanel, s = this.prevShow.length ? this.prevShow : t.oldPanel;
+ this.prevShow.add(this.prevHide).stop(!0, !0), this.prevShow = i, this.prevHide = s, this.options.animate ? this._animate(i, s, t) : (s.hide(), i.show(), this._toggleComplete(t)), s.attr({"aria-hidden": "true"}), s.prev().attr({
+ "aria-selected": "false",
+ "aria-expanded": "false"
+ }), i.length && s.length ? s.prev().attr({
+ tabIndex: -1,
+ "aria-expanded": "false"
+ }) : i.length && this.headers.filter(function () {
+ return 0 === parseInt(e(this).attr("tabIndex"), 10)
+ }).attr("tabIndex", -1), i.attr("aria-hidden", "false").prev().attr({
+ "aria-selected": "true",
+ "aria-expanded": "true",
+ tabIndex: 0
+ })
+ },
+ _animate: function (e, t, i) {
+ var s, n, a, o = this, r = 0, h = e.css("box-sizing"), l = e.length && (!t.length || e.index() < t.index()), u = this.options.animate || {}, d = l && u.down || u, c = function () {
+ o._toggleComplete(i)
+ };
+ return "number" == typeof d && (a = d), "string" == typeof d && (n = d), n = n || d.easing || u.easing, a = a || d.duration || u.duration, t.length ? e.length ? (s = e.show().outerHeight(), t.animate(this.hideProps, {
+ duration: a,
+ easing: n,
+ step: function (e, t) {
+ t.now = Math.round(e)
+ }
+ }), e.hide().animate(this.showProps, {
+ duration: a, easing: n, complete: c, step: function (e, i) {
+ i.now = Math.round(e), "height" !== i.prop ? "content-box" === h && (r += i.now) : "content" !== o.options.heightStyle && (i.now = Math.round(s - t.outerHeight() - r), r = 0)
+ }
+ }), void 0) : t.animate(this.hideProps, a, n, c) : e.animate(this.showProps, a, n, c)
+ },
+ _toggleComplete: function (e) {
+ var t = e.oldPanel;
+ t.removeClass("ui-accordion-content-active").prev().removeClass("ui-corner-top").addClass("ui-corner-all"), t.length && (t.parent()[0].className = t.parent()[0].className), this._trigger("activate", null, e)
+ }
+ }), e.widget("ui.menu", {
+ version: "1.11.4",
+ defaultElement: "<ul>",
+ delay: 300,
+ options: {
+ icons: {submenu: "ui-icon-carat-1-e"},
+ items: "> *",
+ menus: "ul",
+ position: {my: "left-1 top", at: "right top"},
+ role: "menu",
+ blur: null,
+ focus: null,
+ select: null
+ },
+ _create: function () {
+ this.activeMenu = this.element, this.mouseHandled = !1, this.element.uniqueId().addClass("ui-menu ui-widget ui-widget-content").toggleClass("ui-menu-icons", !!this.element.find(".ui-icon").length).attr({
+ role: this.options.role,
+ tabIndex: 0
+ }), this.options.disabled && this.element.addClass("ui-state-disabled").attr("aria-disabled", "true"), this._on({
+ "mousedown .ui-menu-item": function (e) {
+ e.preventDefault()
+ }, "click .ui-menu-item": function (t) {
+ var i = e(t.target);
+ !this.mouseHandled && i.not(".ui-state-disabled").length && (this.select(t), t.isPropagationStopped() || (this.mouseHandled = !0), i.has(".ui-menu").length ? this.expand(t) : !this.element.is(":focus") && e(this.document[0].activeElement).closest(".ui-menu").length && (this.element.trigger("focus", [!0]), this.active && 1 === this.active.parents(".ui-menu").length && clearTimeout(this.timer)))
+ }, "mouseenter .ui-menu-item": function (t) {
+ if (!this.previousFilter) {
+ var i = e(t.currentTarget);
+ i.siblings(".ui-state-active").removeClass("ui-state-active"), this.focus(t, i)
+ }
+ }, mouseleave: "collapseAll", "mouseleave .ui-menu": "collapseAll", focus: function (e, t) {
+ var i = this.active || this.element.find(this.options.items).eq(0);
+ t || this.focus(e, i)
+ }, blur: function (t) {
+ this._delay(function () {
+ e.contains(this.element[0], this.document[0].activeElement) || this.collapseAll(t)
+ })
+ }, keydown: "_keydown"
+ }), this.refresh(), this._on(this.document, {
+ click: function (e) {
+ this._closeOnDocumentClick(e) && this.collapseAll(e), this.mouseHandled = !1
+ }
+ })
+ },
+ _destroy: function () {
+ this.element.removeAttr("aria-activedescendant").find(".ui-menu").addBack().removeClass("ui-menu ui-widget ui-widget-content ui-menu-icons ui-front").removeAttr("role").removeAttr("tabIndex").removeAttr("aria-labelledby").removeAttr("aria-expanded").removeAttr("aria-hidden").removeAttr("aria-disabled").removeUniqueId().show(), this.element.find(".ui-menu-item").removeClass("ui-menu-item").removeAttr("role").removeAttr("aria-disabled").removeUniqueId().removeClass("ui-state-hover").removeAttr("tabIndex").removeAttr("role").removeAttr("aria-haspopup").children().each(function () {
+ var t = e(this);
+ t.data("ui-menu-submenu-carat") && t.remove()
+ }), this.element.find(".ui-menu-divider").removeClass("ui-menu-divider ui-widget-content")
+ },
+ _keydown: function (t) {
+ var i, s, n, a, o = !0;
+ switch (t.keyCode) {
+ case e.ui.keyCode.PAGE_UP:
+ this.previousPage(t);
+ break;
+ case e.ui.keyCode.PAGE_DOWN:
+ this.nextPage(t);
+ break;
+ case e.ui.keyCode.HOME:
+ this._move("first", "first", t);
+ break;
+ case e.ui.keyCode.END:
+ this._move("last", "last", t);
+ break;
+ case e.ui.keyCode.UP:
+ this.previous(t);
+ break;
+ case e.ui.keyCode.DOWN:
+ this.next(t);
+ break;
+ case e.ui.keyCode.LEFT:
+ this.collapse(t);
+ break;
+ case e.ui.keyCode.RIGHT:
+ this.active && !this.active.is(".ui-state-disabled") && this.expand(t);
+ break;
+ case e.ui.keyCode.ENTER:
+ case e.ui.keyCode.SPACE:
+ this._activate(t);
+ break;
+ case e.ui.keyCode.ESCAPE:
+ this.collapse(t);
+ break;
+ default:
+ o = !1, s = this.previousFilter || "", n = String.fromCharCode(t.keyCode), a = !1, clearTimeout(this.filterTimer), n === s ? a = !0 : n = s + n, i = this._filterMenuItems(n), i = a && -1 !== i.index(this.active.next()) ? this.active.nextAll(".ui-menu-item") : i, i.length || (n = String.fromCharCode(t.keyCode), i = this._filterMenuItems(n)), i.length ? (this.focus(t, i), this.previousFilter = n, this.filterTimer = this._delay(function () {
+ delete this.previousFilter
+ }, 1e3)) : delete this.previousFilter
+ }
+ o && t.preventDefault()
+ },
+ _activate: function (e) {
+ this.active.is(".ui-state-disabled") || (this.active.is("[aria-haspopup='true']") ? this.expand(e) : this.select(e))
+ },
+ refresh: function () {
+ var t, i, s = this, n = this.options.icons.submenu, a = this.element.find(this.options.menus);
+ this.element.toggleClass("ui-menu-icons", !!this.element.find(".ui-icon").length), a.filter(":not(.ui-menu)").addClass("ui-menu ui-widget ui-widget-content ui-front").hide().attr({
+ role: this.options.role,
+ "aria-hidden": "true",
+ "aria-expanded": "false"
+ }).each(function () {
+ var t = e(this), i = t.parent(), s = e("<span>").addClass("ui-menu-icon ui-icon " + n).data("ui-menu-submenu-carat", !0);
+ i.attr("aria-haspopup", "true").prepend(s), t.attr("aria-labelledby", i.attr("id"))
+ }), t = a.add(this.element), i = t.find(this.options.items), i.not(".ui-menu-item").each(function () {
+ var t = e(this);
+ s._isDivider(t) && t.addClass("ui-widget-content ui-menu-divider")
+ }), i.not(".ui-menu-item, .ui-menu-divider").addClass("ui-menu-item").uniqueId().attr({
+ tabIndex: -1,
+ role: this._itemRole()
+ }), i.filter(".ui-state-disabled").attr("aria-disabled", "true"), this.active && !e.contains(this.element[0], this.active[0]) && this.blur()
+ },
+ _itemRole: function () {
+ return {menu: "menuitem", listbox: "option"}[this.options.role]
+ },
+ _setOption: function (e, t) {
+ "icons" === e && this.element.find(".ui-menu-icon").removeClass(this.options.icons.submenu).addClass(t.submenu), "disabled" === e && this.element.toggleClass("ui-state-disabled", !!t).attr("aria-disabled", t), this._super(e, t)
+ },
+ focus: function (e, t) {
+ var i, s;
+ this.blur(e, e && "focus" === e.type), this._scrollIntoView(t), this.active = t.first(), s = this.active.addClass("ui-state-focus").removeClass("ui-state-active"), this.options.role && this.element.attr("aria-activedescendant", s.attr("id")), this.active.parent().closest(".ui-menu-item").addClass("ui-state-active"), e && "keydown" === e.type ? this._close() : this.timer = this._delay(function () {
+ this._close()
+ }, this.delay), i = t.children(".ui-menu"), i.length && e && /^mouse/.test(e.type) && this._startOpening(i), this.activeMenu = t.parent(), this._trigger("focus", e, {item: t})
+ },
+ _scrollIntoView: function (t) {
+ var i, s, n, a, o, r;
+ this._hasScroll() && (i = parseFloat(e.css(this.activeMenu[0], "borderTopWidth")) || 0, s = parseFloat(e.css(this.activeMenu[0], "paddingTop")) || 0, n = t.offset().top - this.activeMenu.offset().top - i - s, a = this.activeMenu.scrollTop(), o = this.activeMenu.height(), r = t.outerHeight(), 0 > n ? this.activeMenu.scrollTop(a + n) : n + r > o && this.activeMenu.scrollTop(a + n - o + r))
+ },
+ blur: function (e, t) {
+ t || clearTimeout(this.timer), this.active && (this.active.removeClass("ui-state-focus"), this.active = null, this._trigger("blur", e, {item: this.active}))
+ },
+ _startOpening: function (e) {
+ clearTimeout(this.timer), "true" === e.attr("aria-hidden") && (this.timer = this._delay(function () {
+ this._close(), this._open(e)
+ }, this.delay))
+ },
+ _open: function (t) {
+ var i = e.extend({of: this.active}, this.options.position);
+ clearTimeout(this.timer), this.element.find(".ui-menu").not(t.parents(".ui-menu")).hide().attr("aria-hidden", "true"), t.show().removeAttr("aria-hidden").attr("aria-expanded", "true").position(i)
+ },
+ collapseAll: function (t, i) {
+ clearTimeout(this.timer), this.timer = this._delay(function () {
+ var s = i ? this.element : e(t && t.target).closest(this.element.find(".ui-menu"));
+ s.length || (s = this.element), this._close(s), this.blur(t), this.activeMenu = s
+ }, this.delay)
+ },
+ _close: function (e) {
+ e || (e = this.active ? this.active.parent() : this.element), e.find(".ui-menu").hide().attr("aria-hidden", "true").attr("aria-expanded", "false").end().find(".ui-state-active").not(".ui-state-focus").removeClass("ui-state-active")
+ },
+ _closeOnDocumentClick: function (t) {
+ return !e(t.target).closest(".ui-menu").length
+ },
+ _isDivider: function (e) {
+ return !/[^\-\u2014\u2013\s]/.test(e.text())
+ },
+ collapse: function (e) {
+ var t = this.active && this.active.parent().closest(".ui-menu-item", this.element);
+ t && t.length && (this._close(), this.focus(e, t))
+ },
+ expand: function (e) {
+ var t = this.active && this.active.children(".ui-menu ").find(this.options.items).first();
+ t && t.length && (this._open(t.parent()), this._delay(function () {
+ this.focus(e, t)
+ }))
+ },
+ next: function (e) {
+ this._move("next", "first", e)
+ },
+ previous: function (e) {
+ this._move("prev", "last", e)
+ },
+ isFirstItem: function () {
+ return this.active && !this.active.prevAll(".ui-menu-item").length
+ },
+ isLastItem: function () {
+ return this.active && !this.active.nextAll(".ui-menu-item").length
+ },
+ _move: function (e, t, i) {
+ var s;
+ this.active && (s = "first" === e || "last" === e ? this.active["first" === e ? "prevAll" : "nextAll"](".ui-menu-item").eq(-1) : this.active[e + "All"](".ui-menu-item").eq(0)), s && s.length && this.active || (s = this.activeMenu.find(this.options.items)[t]()), this.focus(i, s)
+ },
+ nextPage: function (t) {
+ var i, s, n;
+ return this.active ? (this.isLastItem() || (this._hasScroll() ? (s = this.active.offset().top, n = this.element.height(), this.active.nextAll(".ui-menu-item").each(function () {
+ return i = e(this), 0 > i.offset().top - s - n
+ }), this.focus(t, i)) : this.focus(t, this.activeMenu.find(this.options.items)[this.active ? "last" : "first"]())), void 0) : (this.next(t), void 0)
+ },
+ previousPage: function (t) {
+ var i, s, n;
+ return this.active ? (this.isFirstItem() || (this._hasScroll() ? (s = this.active.offset().top, n = this.element.height(), this.active.prevAll(".ui-menu-item").each(function () {
+ return i = e(this), i.offset().top - s + n > 0
+ }), this.focus(t, i)) : this.focus(t, this.activeMenu.find(this.options.items).first())), void 0) : (this.next(t), void 0)
+ },
+ _hasScroll: function () {
+ return this.element.outerHeight() < this.element.prop("scrollHeight")
+ },
+ select: function (t) {
+ this.active = this.active || e(t.target).closest(".ui-menu-item");
+ var i = {item: this.active};
+ this.active.has(".ui-menu").length || this.collapseAll(t, !0), this._trigger("select", t, i)
+ },
+ _filterMenuItems: function (t) {
+ var i = t.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&"), s = RegExp("^" + i, "i");
+ return this.activeMenu.find(this.options.items).filter(".ui-menu-item").filter(function () {
+ return s.test(e.trim(e(this).text()))
+ })
+ }
+ }), e.widget("ui.autocomplete", {
+ version: "1.11.4",
+ defaultElement: "<input>",
+ options: {
+ appendTo: null,
+ autoFocus: !1,
+ delay: 300,
+ minLength: 1,
+ position: {my: "left top", at: "left bottom", collision: "none"},
+ source: null,
+ change: null,
+ close: null,
+ focus: null,
+ open: null,
+ response: null,
+ search: null,
+ select: null
+ },
+ requestIndex: 0,
+ pending: 0,
+ _create: function () {
+ var t, i, s, n = this.element[0].nodeName.toLowerCase(), a = "textarea" === n, o = "input" === n;
+ this.isMultiLine = a ? !0 : o ? !1 : this.element.prop("isContentEditable"), this.valueMethod = this.element[a || o ? "val" : "text"], this.isNewMenu = !0, this.element.addClass("ui-autocomplete-input").attr("autocomplete", "off"), this._on(this.element, {
+ keydown: function (n) {
+ if (this.element.prop("readOnly"))return t = !0, s = !0, i = !0, void 0;
+ t = !1, s = !1, i = !1;
+ var a = e.ui.keyCode;
+ switch (n.keyCode) {
+ case a.PAGE_UP:
+ t = !0, this._move("previousPage", n);
+ break;
+ case a.PAGE_DOWN:
+ t = !0, this._move("nextPage", n);
+ break;
+ case a.UP:
+ t = !0, this._keyEvent("previous", n);
+ break;
+ case a.DOWN:
+ t = !0, this._keyEvent("next", n);
+ break;
+ case a.ENTER:
+ this.menu.active && (t = !0, n.preventDefault(), this.menu.select(n));
+ break;
+ case a.TAB:
+ this.menu.active && this.menu.select(n);
+ break;
+ case a.ESCAPE:
+ this.menu.element.is(":visible") && (this.isMultiLine || this._value(this.term), this.close(n), n.preventDefault());
+ break;
+ default:
+ i = !0, this._searchTimeout(n)
+ }
+ }, keypress: function (s) {
+ if (t)return t = !1, (!this.isMultiLine || this.menu.element.is(":visible")) && s.preventDefault(), void 0;
+ if (!i) {
+ var n = e.ui.keyCode;
+ switch (s.keyCode) {
+ case n.PAGE_UP:
+ this._move("previousPage", s);
+ break;
+ case n.PAGE_DOWN:
+ this._move("nextPage", s);
+ break;
+ case n.UP:
+ this._keyEvent("previous", s);
+ break;
+ case n.DOWN:
+ this._keyEvent("next", s)
+ }
+ }
+ }, input: function (e) {
+ return s ? (s = !1, e.preventDefault(), void 0) : (this._searchTimeout(e), void 0)
+ }, focus: function () {
+ this.selectedItem = null, this.previous = this._value()
+ }, blur: function (e) {
+ return this.cancelBlur ? (delete this.cancelBlur, void 0) : (clearTimeout(this.searching), this.close(e), this._change(e), void 0)
+ }
+ }), this._initSource(), this.menu = e("<ul>").addClass("ui-autocomplete ui-front").appendTo(this._appendTo()).menu({role: null}).hide().menu("instance"), this._on(this.menu.element, {
+ mousedown: function (t) {
+ t.preventDefault(), this.cancelBlur = !0, this._delay(function () {
+ delete this.cancelBlur
+ });
+ var i = this.menu.element[0];
+ e(t.target).closest(".ui-menu-item").length || this._delay(function () {
+ var t = this;
+ this.document.one("mousedown", function (s) {
+ s.target === t.element[0] || s.target === i || e.contains(i, s.target) || t.close()
+ })
+ })
+ }, menufocus: function (t, i) {
+ var s, n;
+ return this.isNewMenu && (this.isNewMenu = !1, t.originalEvent && /^mouse/.test(t.originalEvent.type)) ? (this.menu.blur(), this.document.one("mousemove", function () {
+ e(t.target).trigger(t.originalEvent)
+ }), void 0) : (n = i.item.data("ui-autocomplete-item"), !1 !== this._trigger("focus", t, {item: n}) && t.originalEvent && /^key/.test(t.originalEvent.type) && this._value(n.value), s = i.item.attr("aria-label") || n.value, s && e.trim(s).length && (this.liveRegion.children().hide(), e("<div>").text(s).appendTo(this.liveRegion)), void 0)
+ }, menuselect: function (e, t) {
+ var i = t.item.data("ui-autocomplete-item"), s = this.previous;
+ this.element[0] !== this.document[0].activeElement && (this.element.focus(), this.previous = s, this._delay(function () {
+ this.previous = s, this.selectedItem = i
+ })), !1 !== this._trigger("select", e, {item: i}) && this._value(i.value), this.term = this._value(), this.close(e), this.selectedItem = i
+ }
+ }), this.liveRegion = e("<span>", {
+ role: "status",
+ "aria-live": "assertive",
+ "aria-relevant": "additions"
+ }).addClass("ui-helper-hidden-accessible").appendTo(this.document[0].body), this._on(this.window, {
+ beforeunload: function () {
+ this.element.removeAttr("autocomplete")
+ }
+ })
+ },
+ _destroy: function () {
+ clearTimeout(this.searching), this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete"), this.menu.element.remove(), this.liveRegion.remove()
+ },
+ _setOption: function (e, t) {
+ this._super(e, t), "source" === e && this._initSource(), "appendTo" === e && this.menu.element.appendTo(this._appendTo()), "disabled" === e && t && this.xhr && this.xhr.abort()
+ },
+ _appendTo: function () {
+ var t = this.options.appendTo;
+ return t && (t = t.jquery || t.nodeType ? e(t) : this.document.find(t).eq(0)), t && t[0] || (t = this.element.closest(".ui-front")), t.length || (t = this.document[0].body), t
+ },
+ _initSource: function () {
+ var t, i, s = this;
+ e.isArray(this.options.source) ? (t = this.options.source, this.source = function (i, s) {
+ s(e.ui.autocomplete.filter(t, i.term))
+ }) : "string" == typeof this.options.source ? (i = this.options.source, this.source = function (t, n) {
+ s.xhr && s.xhr.abort(), s.xhr = e.ajax({
+ url: i, data: t, dataType: "json", success: function (e) {
+ n(e)
+ }, error: function () {
+ n([])
+ }
+ })
+ }) : this.source = this.options.source
+ },
+ _searchTimeout: function (e) {
+ clearTimeout(this.searching), this.searching = this._delay(function () {
+ var t = this.term === this._value(), i = this.menu.element.is(":visible"), s = e.altKey || e.ctrlKey || e.metaKey || e.shiftKey;
+ (!t || t && !i && !s) && (this.selectedItem = null, this.search(null, e))
+ }, this.options.delay)
+ },
+ search: function (e, t) {
+ return e = null != e ? e : this._value(), this.term = this._value(), e.length < this.options.minLength ? this.close(t) : this._trigger("search", t) !== !1 ? this._search(e) : void 0
+ },
+ _search: function (e) {
+ this.pending++, this.element.addClass("ui-autocomplete-loading"), this.cancelSearch = !1, this.source({term: e}, this._response())
+ },
+ _response: function () {
+ var t = ++this.requestIndex;
+ return e.proxy(function (e) {
+ t === this.requestIndex && this.__response(e), this.pending--, this.pending || this.element.removeClass("ui-autocomplete-loading")
+ }, this)
+ },
+ __response: function (e) {
+ e && (e = this._normalize(e)), this._trigger("response", null, {content: e}), !this.options.disabled && e && e.length && !this.cancelSearch ? (this._suggest(e), this._trigger("open")) : this._close()
+ },
+ close: function (e) {
+ this.cancelSearch = !0, this._close(e)
+ },
+ _close: function (e) {
+ this.menu.element.is(":visible") && (this.menu.element.hide(), this.menu.blur(), this.isNewMenu = !0, this._trigger("close", e))
+ },
+ _change: function (e) {
+ this.previous !== this._value() && this._trigger("change", e, {item: this.selectedItem})
+ },
+ _normalize: function (t) {
+ return t.length && t[0].label && t[0].value ? t : e.map(t, function (t) {
+ return "string" == typeof t ? {label: t, value: t} : e.extend({}, t, {
+ label: t.label || t.value,
+ value: t.value || t.label
+ })
+ })
+ },
+ _suggest: function (t) {
+ var i = this.menu.element.empty();
+ this._renderMenu(i, t), this.isNewMenu = !0, this.menu.refresh(), i.show(), this._resizeMenu(), i.position(e.extend({of: this.element}, this.options.position)), this.options.autoFocus && this.menu.next()
+ },
+ _resizeMenu: function () {
+ var e = this.menu.element;
+ e.outerWidth(Math.max(e.width("").outerWidth() + 1, this.element.outerWidth()))
+ },
+ _renderMenu: function (t, i) {
+ var s = this;
+ e.each(i, function (e, i) {
+ s._renderItemData(t, i)
+ })
+ },
+ _renderItemData: function (e, t) {
+ return this._renderItem(e, t).data("ui-autocomplete-item", t)
+ },
+ _renderItem: function (t, i) {
+ return e("<li>").text(i.label).appendTo(t)
+ },
+ _move: function (e, t) {
+ return this.menu.element.is(":visible") ? this.menu.isFirstItem() && /^previous/.test(e) || this.menu.isLastItem() && /^next/.test(e) ? (this.isMultiLine || this._value(this.term), this.menu.blur(), void 0) : (this.menu[e](t), void 0) : (this.search(null, t), void 0)
+ },
+ widget: function () {
+ return this.menu.element
+ },
+ _value: function () {
+ return this.valueMethod.apply(this.element, arguments)
+ },
+ _keyEvent: function (e, t) {
+ (!this.isMultiLine || this.menu.element.is(":visible")) && (this._move(e, t), t.preventDefault())
+ }
+ }), e.extend(e.ui.autocomplete, {
+ escapeRegex: function (e) {
+ return e.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&")
+ }, filter: function (t, i) {
+ var s = RegExp(e.ui.autocomplete.escapeRegex(i), "i");
+ return e.grep(t, function (e) {
+ return s.test(e.label || e.value || e)
+ })
+ }
+ }), e.widget("ui.autocomplete", e.ui.autocomplete, {
+ options: {
+ messages: {
+ noResults: "No search results.",
+ results: function (e) {
+ return e + (e > 1 ? " results are" : " result is") + " available, use up and down arrow keys to navigate."
+ }
+ }
+ }, __response: function (t) {
+ var i;
+ this._superApply(arguments), this.options.disabled || this.cancelSearch || (i = t && t.length ? this.options.messages.results(t.length) : this.options.messages.noResults, this.liveRegion.children().hide(), e("<div>").text(i).appendTo(this.liveRegion))
+ }
+ }), e.ui.autocomplete;
+ var c, p = "ui-button ui-widget ui-state-default ui-corner-all", f = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", m = function () {
+ var t = e(this);
+ setTimeout(function () {
+ t.find(":ui-button").button("refresh")
+ }, 1)
+ }, g = function (t) {
+ var i = t.name, s = t.form, n = e([]);
+ return i && (i = i.replace(/'/g, "\\'"), n = s ? e(s).find("[name='" + i + "'][type=radio]") : e("[name='" + i + "'][type=radio]", t.ownerDocument).filter(function () {
+ return !this.form
+ })), n
+ };
+ e.widget("ui.button", {
+ version: "1.11.4",
+ defaultElement: "<button>",
+ options: {disabled: null, text: !0, label: null, icons: {primary: null, secondary: null}},
+ _create: function () {
+ this.element.closest("form").unbind("reset" + this.eventNamespace).bind("reset" + this.eventNamespace, m), "boolean" != typeof this.options.disabled ? this.options.disabled = !!this.element.prop("disabled") : this.element.prop("disabled", this.options.disabled), this._determineButtonType(), this.hasTitle = !!this.buttonElement.attr("title");
+ var t = this, i = this.options, s = "checkbox" === this.type || "radio" === this.type, n = s ? "" : "ui-state-active";
+ null === i.label && (i.label = "input" === this.type ? this.buttonElement.val() : this.buttonElement.html()), this._hoverable(this.buttonElement), this.buttonElement.addClass(p).attr("role", "button").bind("mouseenter" + this.eventNamespace, function () {
+ i.disabled || this === c && e(this).addClass("ui-state-active")
+ }).bind("mouseleave" + this.eventNamespace, function () {
+ i.disabled || e(this).removeClass(n)
+ }).bind("click" + this.eventNamespace, function (e) {
+ i.disabled && (e.preventDefault(), e.stopImmediatePropagation())
+ }), this._on({
+ focus: function () {
+ this.buttonElement.addClass("ui-state-focus")
+ }, blur: function () {
+ this.buttonElement.removeClass("ui-state-focus")
+ }
+ }), s && this.element.bind("change" + this.eventNamespace, function () {
+ t.refresh()
+ }), "checkbox" === this.type ? this.buttonElement.bind("click" + this.eventNamespace, function () {
+ return i.disabled ? !1 : void 0
+ }) : "radio" === this.type ? this.buttonElement.bind("click" + this.eventNamespace, function () {
+ if (i.disabled)return !1;
+ e(this).addClass("ui-state-active"), t.buttonElement.attr("aria-pressed", "true");
+ var s = t.element[0];
+ g(s).not(s).map(function () {
+ return e(this).button("widget")[0]
+ }).removeClass("ui-state-active").attr("aria-pressed", "false")
+ }) : (this.buttonElement.bind("mousedown" + this.eventNamespace, function () {
+ return i.disabled ? !1 : (e(this).addClass("ui-state-active"), c = this, t.document.one("mouseup", function () {
+ c = null
+ }), void 0)
+ }).bind("mouseup" + this.eventNamespace, function () {
+ return i.disabled ? !1 : (e(this).removeClass("ui-state-active"), void 0)
+ }).bind("keydown" + this.eventNamespace, function (t) {
+ return i.disabled ? !1 : ((t.keyCode === e.ui.keyCode.SPACE || t.keyCode === e.ui.keyCode.ENTER) && e(this).addClass("ui-state-active"), void 0)
+ }).bind("keyup" + this.eventNamespace + " blur" + this.eventNamespace, function () {
+ e(this).removeClass("ui-state-active")
+ }), this.buttonElement.is("a") && this.buttonElement.keyup(function (t) {
+ t.keyCode === e.ui.keyCode.SPACE && e(this).click()
+ })), this._setOption("disabled", i.disabled), this._resetButton()
+ },
+ _determineButtonType: function () {
+ var e, t, i;
+ this.type = this.element.is("[type=checkbox]") ? "checkbox" : this.element.is("[type=radio]") ? "radio" : this.element.is("input") ? "input" : "button", "checkbox" === this.type || "radio" === this.type ? (e = this.element.parents().last(), t = "label[for='" + this.element.attr("id") + "']", this.buttonElement = e.find(t), this.buttonElement.length || (e = e.length ? e.siblings() : this.element.siblings(), this.buttonElement = e.filter(t), this.buttonElement.length || (this.buttonElement = e.find(t))), this.element.addClass("ui-helper-hidden-accessible"), i = this.element.is(":checked"), i && this.buttonElement.addClass("ui-state-active"), this.buttonElement.prop("aria-pressed", i)) : this.buttonElement = this.element
+ },
+ widget: function () {
+ return this.buttonElement
+ },
+ _destroy: function () {
+ this.element.removeClass("ui-helper-hidden-accessible"), this.buttonElement.removeClass(p + " ui-state-active " + f).removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html()), this.hasTitle || this.buttonElement.removeAttr("title")
+ },
+ _setOption: function (e, t) {
+ return this._super(e, t), "disabled" === e ? (this.widget().toggleClass("ui-state-disabled", !!t), this.element.prop("disabled", !!t), t && ("checkbox" === this.type || "radio" === this.type ? this.buttonElement.removeClass("ui-state-focus") : this.buttonElement.removeClass("ui-state-focus ui-state-active")), void 0) : (this._resetButton(), void 0)
+ },
+ refresh: function () {
+ var t = this.element.is("input, button") ? this.element.is(":disabled") : this.element.hasClass("ui-button-disabled");
+ t !== this.options.disabled && this._setOption("disabled", t), "radio" === this.type ? g(this.element[0]).each(function () {
+ e(this).is(":checked") ? e(this).button("widget").addClass("ui-state-active").attr("aria-pressed", "true") : e(this).button("widget").removeClass("ui-state-active").attr("aria-pressed", "false")
+ }) : "checkbox" === this.type && (this.element.is(":checked") ? this.buttonElement.addClass("ui-state-active").attr("aria-pressed", "true") : this.buttonElement.removeClass("ui-state-active").attr("aria-pressed", "false"))
+ },
+ _resetButton: function () {
+ if ("input" === this.type)return this.options.label && this.element.val(this.options.label), void 0;
+ var t = this.buttonElement.removeClass(f), i = e("<span></span>", this.document[0]).addClass("ui-button-text").html(this.options.label).appendTo(t.empty()).text(), s = this.options.icons, n = s.primary && s.secondary, a = [];
+ s.primary || s.secondary ? (this.options.text && a.push("ui-button-text-icon" + (n ? "s" : s.primary ? "-primary" : "-secondary")), s.primary && t.prepend("<span class='ui-button-icon-primary ui-icon " + s.primary + "'></span>"), s.secondary && t.append("<span class='ui-button-icon-secondary ui-icon " + s.secondary + "'></span>"), this.options.text || (a.push(n ? "ui-button-icons-only" : "ui-button-icon-only"), this.hasTitle || t.attr("title", e.trim(i)))) : a.push("ui-button-text-only"), t.addClass(a.join(" "))
+ }
+ }), e.widget("ui.buttonset", {
+ version: "1.11.4",
+ options: {items: "button, input[type=button], input[type=submit], input[type=reset], input[type=checkbox], input[type=radio], a, :data(ui-button)"},
+ _create: function () {
+ this.element.addClass("ui-buttonset")
+ },
+ _init: function () {
+ this.refresh()
+ },
+ _setOption: function (e, t) {
+ "disabled" === e && this.buttons.button("option", e, t), this._super(e, t)
+ },
+ refresh: function () {
+ var t = "rtl" === this.element.css("direction"), i = this.element.find(this.options.items), s = i.filter(":ui-button");
+ i.not(":ui-button").button(), s.button("refresh"), this.buttons = i.map(function () {
+ return e(this).button("widget")[0]
+ }).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(t ? "ui-corner-right" : "ui-corner-left").end().filter(":last").addClass(t ? "ui-corner-left" : "ui-corner-right").end().end()
+ },
+ _destroy: function () {
+ this.element.removeClass("ui-buttonset"), this.buttons.map(function () {
+ return e(this).button("widget")[0]
+ }).removeClass("ui-corner-left ui-corner-right").end().button("destroy")
+ }
+ }), e.ui.button, e.extend(e.ui, {datepicker: {version: "1.11.4"}});
+ var v;
+ e.extend(n.prototype, {
+ markerClassName: "hasDatepicker",
+ maxRows: 4,
+ _widgetDatepicker: function () {
+ return this.dpDiv
+ },
+ setDefaults: function (e) {
+ return r(this._defaults, e || {}), this
+ },
+ _attachDatepicker: function (t, i) {
+ var s, n, a;
+ s = t.nodeName.toLowerCase(), n = "div" === s || "span" === s, t.id || (this.uuid += 1, t.id = "dp" + this.uuid), a = this._newInst(e(t), n), a.settings = e.extend({}, i || {}), "input" === s ? this._connectDatepicker(t, a) : n && this._inlineDatepicker(t, a)
+ },
+ _newInst: function (t, i) {
+ var s = t[0].id.replace(/([^A-Za-z0-9_\-])/g, "\\\\$1");
+ return {
+ id: s,
+ input: t,
+ selectedDay: 0,
+ selectedMonth: 0,
+ selectedYear: 0,
+ drawMonth: 0,
+ drawYear: 0,
+ inline: i,
+ dpDiv: i ? a(e("<div class='" + this._inlineClass + " ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>")) : this.dpDiv
+ }
+ },
+ _connectDatepicker: function (t, i) {
+ var s = e(t);
+ i.append = e([]), i.trigger = e([]), s.hasClass(this.markerClassName) || (this._attachments(s, i), s.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp), this._autoSize(i), e.data(t, "datepicker", i), i.settings.disabled && this._disableDatepicker(t))
+ },
+ _attachments: function (t, i) {
+ var s, n, a, o = this._get(i, "appendText"), r = this._get(i, "isRTL");
+ i.append && i.append.remove(), o && (i.append = e("<span class='" + this._appendClass + "'>" + o + "</span>"), t[r ? "before" : "after"](i.append)), t.unbind("focus", this._showDatepicker), i.trigger && i.trigger.remove(), s = this._get(i, "showOn"), ("focus" === s || "both" === s) && t.focus(this._showDatepicker), ("button" === s || "both" === s) && (n = this._get(i, "buttonText"), a = this._get(i, "buttonImage"), i.trigger = e(this._get(i, "buttonImageOnly") ? e("<img/>").addClass(this._triggerClass).attr({
+ src: a,
+ alt: n,
+ title: n
+ }) : e("<button type='button'></button>").addClass(this._triggerClass).html(a ? e("<img/>").attr({
+ src: a,
+ alt: n,
+ title: n
+ }) : n)), t[r ? "before" : "after"](i.trigger), i.trigger.click(function () {
+ return e.datepicker._datepickerShowing && e.datepicker._lastInput === t[0] ? e.datepicker._hideDatepicker() : e.datepicker._datepickerShowing && e.datepicker._lastInput !== t[0] ? (e.datepicker._hideDatepicker(), e.datepicker._showDatepicker(t[0])) : e.datepicker._showDatepicker(t[0]), !1
+ }))
+ },
+ _autoSize: function (e) {
+ if (this._get(e, "autoSize") && !e.inline) {
+ var t, i, s, n, a = new Date(2009, 11, 20), o = this._get(e, "dateFormat");
+ o.match(/[DM]/) && (t = function (e) {
+ for (i = 0, s = 0, n = 0; e.length > n; n++)e[n].length > i && (i = e[n].length, s = n);
+ return s
+ }, a.setMonth(t(this._get(e, o.match(/MM/) ? "monthNames" : "monthNamesShort"))), a.setDate(t(this._get(e, o.match(/DD/) ? "dayNames" : "dayNamesShort")) + 20 - a.getDay())), e.input.attr("size", this._formatDate(e, a).length)
+ }
+ },
+ _inlineDatepicker: function (t, i) {
+ var s = e(t);
+ s.hasClass(this.markerClassName) || (s.addClass(this.markerClassName).append(i.dpDiv), e.data(t, "datepicker", i), this._setDate(i, this._getDefaultDate(i), !0), this._updateDatepicker(i), this._updateAlternate(i), i.settings.disabled && this._disableDatepicker(t), i.dpDiv.css("display", "block"))
+ },
+ _dialogDatepicker: function (t, i, s, n, a) {
+ var o, h, l, u, d, c = this._dialogInst;
+ return c || (this.uuid += 1, o = "dp" + this.uuid, this._dialogInput = e("<input type='text' id='" + o + "' style='position: absolute; top: -100px; width: 0px;'/>"), this._dialogInput.keydown(this._doKeyDown), e("body").append(this._dialogInput), c = this._dialogInst = this._newInst(this._dialogInput, !1), c.settings = {}, e.data(this._dialogInput[0], "datepicker", c)), r(c.settings, n || {}), i = i && i.constructor === Date ? this._formatDate(c, i) : i, this._dialogInput.val(i), this._pos = a ? a.length ? a : [a.pageX, a.pageY] : null, this._pos || (h = document.documentElement.clientWidth, l = document.documentElement.clientHeight, u = document.documentElement.scrollLeft || document.body.scrollLeft, d = document.documentElement.scrollTop || document.body.scrollTop, this._pos = [h / 2 - 100 + u, l / 2 - 150 + d]), this._dialogInput.css("left", this._pos[0] + 20 + "px").css("top", this._pos[1] + "px"), c.settings.onSelect = s, this._inDialog = !0, this.dpDiv.addClass(this._dialogClass), this._showDatepicker(this._dialogInput[0]), e.blockUI && e.blockUI(this.dpDiv), e.data(this._dialogInput[0], "datepicker", c), this
+ },
+ _destroyDatepicker: function (t) {
+ var i, s = e(t), n = e.data(t, "datepicker");
+ s.hasClass(this.markerClassName) && (i = t.nodeName.toLowerCase(), e.removeData(t, "datepicker"), "input" === i ? (n.append.remove(), n.trigger.remove(), s.removeClass(this.markerClassName).unbind("focus", this._showDatepicker).unbind("keydown", this._doKeyDown).unbind("keypress", this._doKeyPress).unbind("keyup", this._doKeyUp)) : ("div" === i || "span" === i) && s.removeClass(this.markerClassName).empty(), v === n && (v = null))
+ },
+ _enableDatepicker: function (t) {
+ var i, s, n = e(t), a = e.data(t, "datepicker");
+ n.hasClass(this.markerClassName) && (i = t.nodeName.toLowerCase(), "input" === i ? (t.disabled = !1, a.trigger.filter("button").each(function () {
+ this.disabled = !1
+ }).end().filter("img").css({
+ opacity: "1.0",
+ cursor: ""
+ })) : ("div" === i || "span" === i) && (s = n.children("." + this._inlineClass), s.children().removeClass("ui-state-disabled"), s.find("select.ui-datepicker-month, select.ui-datepicker-year").prop("disabled", !1)), this._disabledInputs = e.map(this._disabledInputs, function (e) {
+ return e === t ? null : e
+ }))
+ },
+ _disableDatepicker: function (t) {
+ var i, s, n = e(t), a = e.data(t, "datepicker");
+ n.hasClass(this.markerClassName) && (i = t.nodeName.toLowerCase(), "input" === i ? (t.disabled = !0, a.trigger.filter("button").each(function () {
+ this.disabled = !0
+ }).end().filter("img").css({
+ opacity: "0.5",
+ cursor: "default"
+ })) : ("div" === i || "span" === i) && (s = n.children("." + this._inlineClass), s.children().addClass("ui-state-disabled"), s.find("select.ui-datepicker-month, select.ui-datepicker-year").prop("disabled", !0)), this._disabledInputs = e.map(this._disabledInputs, function (e) {
+ return e === t ? null : e
+ }), this._disabledInputs[this._disabledInputs.length] = t)
+ },
+ _isDisabledDatepicker: function (e) {
+ if (!e)return !1;
+ for (var t = 0; this._disabledInputs.length > t; t++)if (this._disabledInputs[t] === e)return !0;
+ return !1
+ },
+ _getInst: function (t) {
+ try {
+ return e.data(t, "datepicker")
+ } catch (i) {
+ throw"Missing instance data for this datepicker"
+ }
+ },
+ _optionDatepicker: function (t, i, s) {
+ var n, a, o, h, l = this._getInst(t);
+ return 2 === arguments.length && "string" == typeof i ? "defaults" === i ? e.extend({}, e.datepicker._defaults) : l ? "all" === i ? e.extend({}, l.settings) : this._get(l, i) : null : (n = i || {}, "string" == typeof i && (n = {}, n[i] = s), l && (this._curInst === l && this._hideDatepicker(), a = this._getDateDatepicker(t, !0), o = this._getMinMaxDate(l, "min"), h = this._getMinMaxDate(l, "max"), r(l.settings, n), null !== o && void 0 !== n.dateFormat && void 0 === n.minDate && (l.settings.minDate = this._formatDate(l, o)), null !== h && void 0 !== n.dateFormat && void 0 === n.maxDate && (l.settings.maxDate = this._formatDate(l, h)), "disabled"in n && (n.disabled ? this._disableDatepicker(t) : this._enableDatepicker(t)), this._attachments(e(t), l), this._autoSize(l), this._setDate(l, a), this._updateAlternate(l), this._updateDatepicker(l)), void 0)
+ },
+ _changeDatepicker: function (e, t, i) {
+ this._optionDatepicker(e, t, i)
+ },
+ _refreshDatepicker: function (e) {
+ var t = this._getInst(e);
+ t && this._updateDatepicker(t)
+ },
+ _setDateDatepicker: function (e, t) {
+ var i = this._getInst(e);
+ i && (this._setDate(i, t), this._updateDatepicker(i), this._updateAlternate(i))
+ },
+ _getDateDatepicker: function (e, t) {
+ var i = this._getInst(e);
+ return i && !i.inline && this._setDateFromField(i, t), i ? this._getDate(i) : null
+ },
+ _doKeyDown: function (t) {
+ var i, s, n, a = e.datepicker._getInst(t.target), o = !0, r = a.dpDiv.is(".ui-datepicker-rtl");
+ if (a._keyEvent = !0, e.datepicker._datepickerShowing)switch (t.keyCode) {
+ case 9:
+ e.datepicker._hideDatepicker(), o = !1;
+ break;
+ case 13:
+ return n = e("td." + e.datepicker._dayOverClass + ":not(." + e.datepicker._currentClass + ")", a.dpDiv), n[0] && e.datepicker._selectDay(t.target, a.selectedMonth, a.selectedYear, n[0]), i = e.datepicker._get(a, "onSelect"), i ? (s = e.datepicker._formatDate(a), i.apply(a.input ? a.input[0] : null, [s, a])) : e.datepicker._hideDatepicker(), !1;
+ case 27:
+ e.datepicker._hideDatepicker();
+ break;
+ case 33:
+ e.datepicker._adjustDate(t.target, t.ctrlKey ? -e.datepicker._get(a, "stepBigMonths") : -e.datepicker._get(a, "stepMonths"), "M");
+ break;
+ case 34:
+ e.datepicker._adjustDate(t.target, t.ctrlKey ? +e.datepicker._get(a, "stepBigMonths") : +e.datepicker._get(a, "stepMonths"), "M");
+ break;
+ case 35:
+ (t.ctrlKey || t.metaKey) && e.datepicker._clearDate(t.target), o = t.ctrlKey || t.metaKey;
+ break;
+ case 36:
+ (t.ctrlKey || t.metaKey) && e.datepicker._gotoToday(t.target), o = t.ctrlKey || t.metaKey;
+ break;
+ case 37:
+ (t.ctrlKey || t.metaKey) && e.datepicker._adjustDate(t.target, r ? 1 : -1, "D"), o = t.ctrlKey || t.metaKey, t.originalEvent.altKey && e.datepicker._adjustDate(t.target, t.ctrlKey ? -e.datepicker._get(a, "stepBigMonths") : -e.datepicker._get(a, "stepMonths"), "M");
+ break;
+ case 38:
+ (t.ctrlKey || t.metaKey) && e.datepicker._adjustDate(t.target, -7, "D"), o = t.ctrlKey || t.metaKey;
+ break;
+ case 39:
+ (t.ctrlKey || t.metaKey) && e.datepicker._adjustDate(t.target, r ? -1 : 1, "D"), o = t.ctrlKey || t.metaKey, t.originalEvent.altKey && e.datepicker._adjustDate(t.target, t.ctrlKey ? +e.datepicker._get(a, "stepBigMonths") : +e.datepicker._get(a, "stepMonths"), "M");
+ break;
+ case 40:
+ (t.ctrlKey || t.metaKey) && e.datepicker._adjustDate(t.target, 7, "D"), o = t.ctrlKey || t.metaKey;
+ break;
+ default:
+ o = !1
+ } else 36 === t.keyCode && t.ctrlKey ? e.datepicker._showDatepicker(this) : o = !1;
+ o && (t.preventDefault(), t.stopPropagation())
+ },
+ _doKeyPress: function (t) {
+ var i, s, n = e.datepicker._getInst(t.target);
+ return e.datepicker._get(n, "constrainInput") ? (i = e.datepicker._possibleChars(e.datepicker._get(n, "dateFormat")), s = String.fromCharCode(null == t.charCode ? t.keyCode : t.charCode), t.ctrlKey || t.metaKey || " " > s || !i || i.indexOf(s) > -1) : void 0
+ },
+ _doKeyUp: function (t) {
+ var i, s = e.datepicker._getInst(t.target);
+ if (s.input.val() !== s.lastVal)try {
+ i = e.datepicker.parseDate(e.datepicker._get(s, "dateFormat"), s.input ? s.input.val() : null, e.datepicker._getFormatConfig(s)), i && (e.datepicker._setDateFromField(s), e.datepicker._updateAlternate(s), e.datepicker._updateDatepicker(s))
+ } catch (n) {
+ }
+ return !0
+ },
+ _showDatepicker: function (t) {
+ if (t = t.target || t, "input" !== t.nodeName.toLowerCase() && (t = e("input", t.parentNode)[0]), !e.datepicker._isDisabledDatepicker(t) && e.datepicker._lastInput !== t) {
+ var i, n, a, o, h, l, u;
+ i = e.datepicker._getInst(t), e.datepicker._curInst && e.datepicker._curInst !== i && (e.datepicker._curInst.dpDiv.stop(!0, !0), i && e.datepicker._datepickerShowing && e.datepicker._hideDatepicker(e.datepicker._curInst.input[0])), n = e.datepicker._get(i, "beforeShow"), a = n ? n.apply(t, [t, i]) : {}, a !== !1 && (r(i.settings, a), i.lastVal = null, e.datepicker._lastInput = t, e.datepicker._setDateFromField(i), e.datepicker._inDialog && (t.value = ""), e.datepicker._pos || (e.datepicker._pos = e.datepicker._findPos(t), e.datepicker._pos[1] += t.offsetHeight), o = !1, e(t).parents().each(function () {
+ return o |= "fixed" === e(this).css("position"), !o
+ }), h = {
+ left: e.datepicker._pos[0],
+ top: e.datepicker._pos[1]
+ }, e.datepicker._pos = null, i.dpDiv.empty(), i.dpDiv.css({
+ position: "absolute",
+ display: "block",
+ top: "-1000px"
+ }), e.datepicker._updateDatepicker(i), h = e.datepicker._checkOffset(i, h, o), i.dpDiv.css({
+ position: e.datepicker._inDialog && e.blockUI ? "static" : o ? "fixed" : "absolute",
+ display: "none",
+ left: h.left + "px",
+ top: h.top + "px"
+ }), i.inline || (l = e.datepicker._get(i, "showAnim"), u = e.datepicker._get(i, "duration"), i.dpDiv.css("z-index", s(e(t)) + 1), e.datepicker._datepickerShowing = !0, e.effects && e.effects.effect[l] ? i.dpDiv.show(l, e.datepicker._get(i, "showOptions"), u) : i.dpDiv[l || "show"](l ? u : null), e.datepicker._shouldFocusInput(i) && i.input.focus(), e.datepicker._curInst = i))
+ }
+ },
+ _updateDatepicker: function (t) {
+ this.maxRows = 4, v = t, t.dpDiv.empty().append(this._generateHTML(t)), this._attachHandlers(t);
+ var i, s = this._getNumberOfMonths(t), n = s[1], a = 17, r = t.dpDiv.find("." + this._dayOverClass + " a");
+ r.length > 0 && o.apply(r.get(0)), t.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width(""), n > 1 && t.dpDiv.addClass("ui-datepicker-multi-" + n).css("width", a * n + "em"), t.dpDiv[(1 !== s[0] || 1 !== s[1] ? "add" : "remove") + "Class"]("ui-datepicker-multi"), t.dpDiv[(this._get(t, "isRTL") ? "add" : "remove") + "Class"]("ui-datepicker-rtl"), t === e.datepicker._curInst && e.datepicker._datepickerShowing && e.datepicker._shouldFocusInput(t) && t.input.focus(), t.yearshtml && (i = t.yearshtml, setTimeout(function () {
+ i === t.yearshtml && t.yearshtml && t.dpDiv.find("select.ui-datepicker-year:first").replaceWith(t.yearshtml), i = t.yearshtml = null
+ }, 0))
+ },
+ _shouldFocusInput: function (e) {
+ return e.input && e.input.is(":visible") && !e.input.is(":disabled") && !e.input.is(":focus")
+ },
+ _checkOffset: function (t, i, s) {
+ var n = t.dpDiv.outerWidth(), a = t.dpDiv.outerHeight(), o = t.input ? t.input.outerWidth() : 0, r = t.input ? t.input.outerHeight() : 0, h = document.documentElement.clientWidth + (s ? 0 : e(document).scrollLeft()), l = document.documentElement.clientHeight + (s ? 0 : e(document).scrollTop());
+ return i.left -= this._get(t, "isRTL") ? n - o : 0, i.left -= s && i.left === t.input.offset().left ? e(document).scrollLeft() : 0, i.top -= s && i.top === t.input.offset().top + r ? e(document).scrollTop() : 0, i.left -= Math.min(i.left, i.left + n > h && h > n ? Math.abs(i.left + n - h) : 0), i.top -= Math.min(i.top, i.top + a > l && l > a ? Math.abs(a + r) : 0), i
+ },
+ _findPos: function (t) {
+ for (var i, s = this._getInst(t), n = this._get(s, "isRTL"); t && ("hidden" === t.type || 1 !== t.nodeType || e.expr.filters.hidden(t));)t = t[n ? "previousSibling" : "nextSibling"];
+ return i = e(t).offset(), [i.left, i.top]
+ },
+ _hideDatepicker: function (t) {
+ var i, s, n, a, o = this._curInst;
+ !o || t && o !== e.data(t, "datepicker") || this._datepickerShowing && (i = this._get(o, "showAnim"), s = this._get(o, "duration"), n = function () {
+ e.datepicker._tidyDialog(o)
+ }, e.effects && (e.effects.effect[i] || e.effects[i]) ? o.dpDiv.hide(i, e.datepicker._get(o, "showOptions"), s, n) : o.dpDiv["slideDown" === i ? "slideUp" : "fadeIn" === i ? "fadeOut" : "hide"](i ? s : null, n), i || n(), this._datepickerShowing = !1, a = this._get(o, "onClose"), a && a.apply(o.input ? o.input[0] : null, [o.input ? o.input.val() : "", o]), this._lastInput = null, this._inDialog && (this._dialogInput.css({
+ position: "absolute",
+ left: "0",
+ top: "-100px"
+ }), e.blockUI && (e.unblockUI(), e("body").append(this.dpDiv))), this._inDialog = !1)
+ },
+ _tidyDialog: function (e) {
+ e.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")
+ },
+ _checkExternalClick: function (t) {
+ if (e.datepicker._curInst) {
+ var i = e(t.target), s = e.datepicker._getInst(i[0]);
+ (i[0].id !== e.datepicker._mainDivId && 0 === i.parents("#" + e.datepicker._mainDivId).length && !i.hasClass(e.datepicker.markerClassName) && !i.closest("." + e.datepicker._triggerClass).length && e.datepicker._datepickerShowing && (!e.datepicker._inDialog || !e.blockUI) || i.hasClass(e.datepicker.markerClassName) && e.datepicker._curInst !== s) && e.datepicker._hideDatepicker()
+ }
+ },
+ _adjustDate: function (t, i, s) {
+ var n = e(t), a = this._getInst(n[0]);
+ this._isDisabledDatepicker(n[0]) || (this._adjustInstDate(a, i + ("M" === s ? this._get(a, "showCurrentAtPos") : 0), s), this._updateDatepicker(a))
+ },
+ _gotoToday: function (t) {
+ var i, s = e(t), n = this._getInst(s[0]);
+ this._get(n, "gotoCurrent") && n.currentDay ? (n.selectedDay = n.currentDay, n.drawMonth = n.selectedMonth = n.currentMonth, n.drawYear = n.selectedYear = n.currentYear) : (i = new Date, n.selectedDay = i.getDate(), n.drawMonth = n.selectedMonth = i.getMonth(), n.drawYear = n.selectedYear = i.getFullYear()), this._notifyChange(n), this._adjustDate(s)
+ },
+ _selectMonthYear: function (t, i, s) {
+ var n = e(t), a = this._getInst(n[0]);
+ a["selected" + ("M" === s ? "Month" : "Year")] = a["draw" + ("M" === s ? "Month" : "Year")] = parseInt(i.options[i.selectedIndex].value, 10), this._notifyChange(a), this._adjustDate(n)
+ },
+ _selectDay: function (t, i, s, n) {
+ var a, o = e(t);
+ e(n).hasClass(this._unselectableClass) || this._isDisabledDatepicker(o[0]) || (a = this._getInst(o[0]), a.selectedDay = a.currentDay = e("a", n).html(), a.selectedMonth = a.currentMonth = i, a.selectedYear = a.currentYear = s, this._selectDate(t, this._formatDate(a, a.currentDay, a.currentMonth, a.currentYear)))
+ },
+ _clearDate: function (t) {
+ var i = e(t);
+ this._selectDate(i, "")
+ },
+ _selectDate: function (t, i) {
+ var s, n = e(t), a = this._getInst(n[0]);
+ i = null != i ? i : this._formatDate(a), a.input && a.input.val(i), this._updateAlternate(a), s = this._get(a, "onSelect"), s ? s.apply(a.input ? a.input[0] : null, [i, a]) : a.input && a.input.trigger("change"), a.inline ? this._updateDatepicker(a) : (this._hideDatepicker(), this._lastInput = a.input[0], "object" != typeof a.input[0] && a.input.focus(), this._lastInput = null)
+ },
+ _updateAlternate: function (t) {
+ var i, s, n, a = this._get(t, "altField");
+ a && (i = this._get(t, "altFormat") || this._get(t, "dateFormat"), s = this._getDate(t), n = this.formatDate(i, s, this._getFormatConfig(t)), e(a).each(function () {
+ e(this).val(n)
+ }))
+ },
+ noWeekends: function (e) {
+ var t = e.getDay();
+ return [t > 0 && 6 > t, ""]
+ },
+ iso8601Week: function (e) {
+ var t, i = new Date(e.getTime());
+ return i.setDate(i.getDate() + 4 - (i.getDay() || 7)), t = i.getTime(), i.setMonth(0), i.setDate(1), Math.floor(Math.round((t - i) / 864e5) / 7) + 1
+ },
+ parseDate: function (t, i, s) {
+ if (null == t || null == i)throw"Invalid arguments";
+ if (i = "object" == typeof i ? "" + i : i + "", "" === i)return null;
+ var n, a, o, r, h = 0, l = (s ? s.shortYearCutoff : null) || this._defaults.shortYearCutoff, u = "string" != typeof l ? l : (new Date).getFullYear() % 100 + parseInt(l, 10), d = (s ? s.dayNamesShort : null) || this._defaults.dayNamesShort, c = (s ? s.dayNames : null) || this._defaults.dayNames, p = (s ? s.monthNamesShort : null) || this._defaults.monthNamesShort, f = (s ? s.monthNames : null) || this._defaults.monthNames, m = -1, g = -1, v = -1, y = -1, b = !1, _ = function (e) {
+ var i = t.length > n + 1 && t.charAt(n + 1) === e;
+ return i && n++, i
+ }, x = function (e) {
+ var t = _(e), s = "@" === e ? 14 : "!" === e ? 20 : "y" === e && t ? 4 : "o" === e ? 3 : 2, n = "y" === e ? s : 1, a = RegExp("^\\d{" + n + "," + s + "}"), o = i.substring(h).match(a);
+ if (!o)throw"Missing number at position " + h;
+ return h += o[0].length, parseInt(o[0], 10)
+ }, w = function (t, s, n) {
+ var a = -1, o = e.map(_(t) ? n : s, function (e, t) {
+ return [[t, e]]
+ }).sort(function (e, t) {
+ return -(e[1].length - t[1].length)
+ });
+ if (e.each(o, function (e, t) {
+ var s = t[1];
+ return i.substr(h, s.length).toLowerCase() === s.toLowerCase() ? (a = t[0], h += s.length, !1) : void 0
+ }), -1 !== a)return a + 1;
+ throw"Unknown name at position " + h
+ }, k = function () {
+ if (i.charAt(h) !== t.charAt(n))throw"Unexpected literal at position " + h;
+ h++
+ };
+ for (n = 0; t.length > n; n++)if (b)"'" !== t.charAt(n) || _("'") ? k() : b = !1; else switch (t.charAt(n)) {
+ case"d":
+ v = x("d");
+ break;
+ case"D":
+ w("D", d, c);
+ break;
+ case"o":
+ y = x("o");
+ break;
+ case"m":
+ g = x("m");
+ break;
+ case"M":
+ g = w("M", p, f);
+ break;
+ case"y":
+ m = x("y");
+ break;
+ case"@":
+ r = new Date(x("@")), m = r.getFullYear(), g = r.getMonth() + 1, v = r.getDate();
+ break;
+ case"!":
+ r = new Date((x("!") - this._ticksTo1970) / 1e4), m = r.getFullYear(), g = r.getMonth() + 1, v = r.getDate();
+ break;
+ case"'":
+ _("'") ? k() : b = !0;
+ break;
+ default:
+ k()
+ }
+ if (i.length > h && (o = i.substr(h), !/^\s+/.test(o)))throw"Extra/unparsed characters found in date: " + o;
+ if (-1 === m ? m = (new Date).getFullYear() : 100 > m && (m += (new Date).getFullYear() - (new Date).getFullYear() % 100 + (u >= m ? 0 : -100)), y > -1)for (g = 1, v = y; ;) {
+ if (a = this._getDaysInMonth(m, g - 1), a >= v)break;
+ g++, v -= a
+ }
+ if (r = this._daylightSavingAdjust(new Date(m, g - 1, v)), r.getFullYear() !== m || r.getMonth() + 1 !== g || r.getDate() !== v)throw"Invalid date";
+ return r
+ },
+ ATOM: "yy-mm-dd",
+ COOKIE: "D, dd M yy",
+ ISO_8601: "yy-mm-dd",
+ RFC_822: "D, d M y",
+ RFC_850: "DD, dd-M-y",
+ RFC_1036: "D, d M y",
+ RFC_1123: "D, d M yy",
+ RFC_2822: "D, d M yy",
+ RSS: "D, d M y",
+ TICKS: "!",
+ TIMESTAMP: "@",
+ W3C: "yy-mm-dd",
+ _ticksTo1970: 1e7 * 60 * 60 * 24 * (718685 + Math.floor(492.5) - Math.floor(19.7) + Math.floor(4.925)),
+ formatDate: function (e, t, i) {
+ if (!t)return "";
+ var s, n = (i ? i.dayNamesShort : null) || this._defaults.dayNamesShort, a = (i ? i.dayNames : null) || this._defaults.dayNames, o = (i ? i.monthNamesShort : null) || this._defaults.monthNamesShort, r = (i ? i.monthNames : null) || this._defaults.monthNames, h = function (t) {
+ var i = e.length > s + 1 && e.charAt(s + 1) === t;
+ return i && s++, i
+ }, l = function (e, t, i) {
+ var s = "" + t;
+ if (h(e))for (; i > s.length;)s = "0" + s;
+ return s
+ }, u = function (e, t, i, s) {
+ return h(e) ? s[t] : i[t]
+ }, d = "", c = !1;
+ if (t)for (s = 0; e.length > s; s++)if (c)"'" !== e.charAt(s) || h("'") ? d += e.charAt(s) : c = !1; else switch (e.charAt(s)) {
+ case"d":
+ d += l("d", t.getDate(), 2);
+ break;
+ case"D":
+ d += u("D", t.getDay(), n, a);
+ break;
+ case"o":
+ d += l("o", Math.round((new Date(t.getFullYear(), t.getMonth(), t.getDate()).getTime() - new Date(t.getFullYear(), 0, 0).getTime()) / 864e5), 3);
+ break;
+ case"m":
+ d += l("m", t.getMonth() + 1, 2);
+ break;
+ case"M":
+ d += u("M", t.getMonth(), o, r);
+ break;
+ case"y":
+ d += h("y") ? t.getFullYear() : (10 > t.getYear() % 100 ? "0" : "") + t.getYear() % 100;
+ break;
+ case"@":
+ d += t.getTime();
+ break;
+ case"!":
+ d += 1e4 * t.getTime() + this._ticksTo1970;
+ break;
+ case"'":
+ h("'") ? d += "'" : c = !0;
+ break;
+ default:
+ d += e.charAt(s)
+ }
+ return d
+ },
+ _possibleChars: function (e) {
+ var t, i = "", s = !1, n = function (i) {
+ var s = e.length > t + 1 && e.charAt(t + 1) === i;
+ return s && t++, s
+ };
+ for (t = 0; e.length > t; t++)if (s)"'" !== e.charAt(t) || n("'") ? i += e.charAt(t) : s = !1; else switch (e.charAt(t)) {
+ case"d":
+ case"m":
+ case"y":
+ case"@":
+ i += "0123456789";
+ break;
+ case"D":
+ case"M":
+ return null;
+ case"'":
+ n("'") ? i += "'" : s = !0;
+ break;
+ default:
+ i += e.charAt(t)
+ }
+ return i
+ },
+ _get: function (e, t) {
+ return void 0 !== e.settings[t] ? e.settings[t] : this._defaults[t]
+ },
+ _setDateFromField: function (e, t) {
+ if (e.input.val() !== e.lastVal) {
+ var i = this._get(e, "dateFormat"), s = e.lastVal = e.input ? e.input.val() : null, n = this._getDefaultDate(e), a = n, o = this._getFormatConfig(e);
+ try {
+ a = this.parseDate(i, s, o) || n
+ } catch (r) {
+ s = t ? "" : s
+ }
+ e.selectedDay = a.getDate(), e.drawMonth = e.selectedMonth = a.getMonth(), e.drawYear = e.selectedYear = a.getFullYear(), e.currentDay = s ? a.getDate() : 0, e.currentMonth = s ? a.getMonth() : 0, e.currentYear = s ? a.getFullYear() : 0, this._adjustInstDate(e)
+ }
+ },
+ _getDefaultDate: function (e) {
+ return this._restrictMinMax(e, this._determineDate(e, this._get(e, "defaultDate"), new Date))
+ },
+ _determineDate: function (t, i, s) {
+ var n = function (e) {
+ var t = new Date;
+ return t.setDate(t.getDate() + e), t
+ }, a = function (i) {
+ try {
+ return e.datepicker.parseDate(e.datepicker._get(t, "dateFormat"), i, e.datepicker._getFormatConfig(t))
+ } catch (s) {
+ }
+ for (var n = (i.toLowerCase().match(/^c/) ? e.datepicker._getDate(t) : null) || new Date, a = n.getFullYear(), o = n.getMonth(), r = n.getDate(), h = /([+\-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g, l = h.exec(i); l;) {
+ switch (l[2] || "d") {
+ case"d":
+ case"D":
+ r += parseInt(l[1], 10);
+ break;
+ case"w":
+ case"W":
+ r += 7 * parseInt(l[1], 10);
+ break;
+ case"m":
+ case"M":
+ o += parseInt(l[1], 10), r = Math.min(r, e.datepicker._getDaysInMonth(a, o));
+ break;
+ case"y":
+ case"Y":
+ a += parseInt(l[1], 10), r = Math.min(r, e.datepicker._getDaysInMonth(a, o))
+ }
+ l = h.exec(i)
+ }
+ return new Date(a, o, r)
+ }, o = null == i || "" === i ? s : "string" == typeof i ? a(i) : "number" == typeof i ? isNaN(i) ? s : n(i) : new Date(i.getTime());
+ return o = o && "Invalid Date" == "" + o ? s : o, o && (o.setHours(0), o.setMinutes(0), o.setSeconds(0), o.setMilliseconds(0)), this._daylightSavingAdjust(o)
+ },
+ _daylightSavingAdjust: function (e) {
+ return e ? (e.setHours(e.getHours() > 12 ? e.getHours() + 2 : 0), e) : null
+ },
+ _setDate: function (e, t, i) {
+ var s = !t, n = e.selectedMonth, a = e.selectedYear, o = this._restrictMinMax(e, this._determineDate(e, t, new Date));
+ e.selectedDay = e.currentDay = o.getDate(), e.drawMonth = e.selectedMonth = e.currentMonth = o.getMonth(), e.drawYear = e.selectedYear = e.currentYear = o.getFullYear(), n === e.selectedMonth && a === e.selectedYear || i || this._notifyChange(e), this._adjustInstDate(e), e.input && e.input.val(s ? "" : this._formatDate(e))
+ },
+ _getDate: function (e) {
+ var t = !e.currentYear || e.input && "" === e.input.val() ? null : this._daylightSavingAdjust(new Date(e.currentYear, e.currentMonth, e.currentDay));
+ return t
+ },
+ _attachHandlers: function (t) {
+ var i = this._get(t, "stepMonths"), s = "#" + t.id.replace(/\\\\/g, "\\");
+ t.dpDiv.find("[data-handler]").map(function () {
+ var t = {
+ prev: function () {
+ e.datepicker._adjustDate(s, -i, "M")
+ }, next: function () {
+ e.datepicker._adjustDate(s, +i, "M")
+ }, hide: function () {
+ e.datepicker._hideDatepicker()
+ }, today: function () {
+ e.datepicker._gotoToday(s)
+ }, selectDay: function () {
+ return e.datepicker._selectDay(s, +this.getAttribute("data-month"), +this.getAttribute("data-year"), this), !1
+ }, selectMonth: function () {
+ return e.datepicker._selectMonthYear(s, this, "M"), !1
+ }, selectYear: function () {
+ return e.datepicker._selectMonthYear(s, this, "Y"), !1
+ }
+ };
+ e(this).bind(this.getAttribute("data-event"), t[this.getAttribute("data-handler")])
+ })
+ },
+ _generateHTML: function (e) {
+ var t, i, s, n, a, o, r, h, l, u, d, c, p, f, m, g, v, y, b, _, x, w, k, T, D, S, M, C, N, A, P, I, H, z, F, E, O, j, W, L = new Date, R = this._daylightSavingAdjust(new Date(L.getFullYear(), L.getMonth(), L.getDate())), Y = this._get(e, "isRTL"), B = this._get(e, "showButtonPanel"), J = this._get(e, "hideIfNoPrevNext"), q = this._get(e, "navigationAsDateFormat"), K = this._getNumberOfMonths(e), V = this._get(e, "showCurrentAtPos"), U = this._get(e, "stepMonths"), Q = 1 !== K[0] || 1 !== K[1], G = this._daylightSavingAdjust(e.currentDay ? new Date(e.currentYear, e.currentMonth, e.currentDay) : new Date(9999, 9, 9)), X = this._getMinMaxDate(e, "min"), $ = this._getMinMaxDate(e, "max"), Z = e.drawMonth - V, et = e.drawYear;
+ if (0 > Z && (Z += 12, et--), $)for (t = this._daylightSavingAdjust(new Date($.getFullYear(), $.getMonth() - K[0] * K[1] + 1, $.getDate())), t = X && X > t ? X : t; this._daylightSavingAdjust(new Date(et, Z, 1)) > t;)Z--, 0 > Z && (Z = 11, et--);
+ for (e.drawMonth = Z, e.drawYear = et, i = this._get(e, "prevText"), i = q ? this.formatDate(i, this._daylightSavingAdjust(new Date(et, Z - U, 1)), this._getFormatConfig(e)) : i, s = this._canAdjustMonth(e, -1, et, Z) ? "<a class='ui-datepicker-prev ui-corner-all' data-handler='prev' data-event='click' title='" + i + "'><span class='ui-icon ui-icon-circle-triangle-" + (Y ? "e" : "w") + "'>" + i + "</span></a>" : J ? "" : "<a class='ui-datepicker-prev ui-corner-all ui-state-disabled' title='" + i + "'><span class='ui-icon ui-icon-circle-triangle-" + (Y ? "e" : "w") + "'>" + i + "</span></a>", n = this._get(e, "nextText"), n = q ? this.formatDate(n, this._daylightSavingAdjust(new Date(et, Z + U, 1)), this._getFormatConfig(e)) : n, a = this._canAdjustMonth(e, 1, et, Z) ? "<a class='ui-datepicker-next ui-corner-all' data-handler='next' data-event='click' title='" + n + "'><span class='ui-icon ui-icon-circle-triangle-" + (Y ? "w" : "e") + "'>" + n + "</span></a>" : J ? "" : "<a class='ui-datepicker-next ui-corner-all ui-state-disabled' title='" + n + "'><span class='ui-icon ui-icon-circle-triangle-" + (Y ? "w" : "e") + "'>" + n + "</span></a>", o = this._get(e, "currentText"), r = this._get(e, "gotoCurrent") && e.currentDay ? G : R, o = q ? this.formatDate(o, r, this._getFormatConfig(e)) : o, h = e.inline ? "" : "<button type='button' class='ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all' data-handler='hide' data-event='click'>" + this._get(e, "closeText") + "</button>", l = B ? "<div class='ui-datepicker-buttonpane ui-widget-content'>" + (Y ? h : "") + (this._isInRange(e, r) ? "<button type='button' class='ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all' data-handler='today' data-event='click'>" + o + "</button>" : "") + (Y ? "" : h) + "</div>" : "", u = parseInt(this._get(e, "firstDay"), 10), u = isNaN(u) ? 0 : u, d = this._get(e, "showWeek"), c = this._get(e, "dayNames"), p = this._get(e, "dayNamesMin"), f = this._get(e, "monthNames"), m = this._get(e, "monthNamesShort"), g = this._get(e, "beforeShowDay"), v = this._get(e, "showOtherMonths"), y = this._get(e, "selectOtherMonths"), b = this._getDefaultDate(e), _ = "", w = 0; K[0] > w; w++) {
+ for (k = "", this.maxRows = 4, T = 0; K[1] > T; T++) {
+ if (D = this._daylightSavingAdjust(new Date(et, Z, e.selectedDay)), S = " ui-corner-all", M = "", Q) {
+ if (M += "<div class='ui-datepicker-group", K[1] > 1)switch (T) {
+ case 0:
+ M += " ui-datepicker-group-first", S = " ui-corner-" + (Y ? "right" : "left");
+ break;
+ case K[1] - 1:
+ M += " ui-datepicker-group-last", S = " ui-corner-" + (Y ? "left" : "right");
+ break;
+ default:
+ M += " ui-datepicker-group-middle", S = ""
+ }
+ M += "'>"
+ }
+ for (M += "<div class='ui-datepicker-header ui-widget-header ui-helper-clearfix" + S + "'>" + (/all|left/.test(S) && 0 === w ? Y ? a : s : "") + (/all|right/.test(S) && 0 === w ? Y ? s : a : "") + this._generateMonthYearHeader(e, Z, et, X, $, w > 0 || T > 0, f, m) + "</div><table class='ui-datepicker-calendar'><thead>" + "<tr>", C = d ? "<th class='ui-datepicker-week-col'>" + this._get(e, "weekHeader") + "</th>" : "", x = 0; 7 > x; x++)N = (x + u) % 7, C += "<th scope='col'" + ((x + u + 6) % 7 >= 5 ? " class='ui-datepicker-week-end'" : "") + ">" + "<span title='" + c[N] + "'>" + p[N] + "</span></th>";
+ for (M += C + "</tr></thead><tbody>", A = this._getDaysInMonth(et, Z), et === e.selectedYear && Z === e.selectedMonth && (e.selectedDay = Math.min(e.selectedDay, A)), P = (this._getFirstDayOfMonth(et, Z) - u + 7) % 7, I = Math.ceil((P + A) / 7), H = Q ? this.maxRows > I ? this.maxRows : I : I, this.maxRows = H, z = this._daylightSavingAdjust(new Date(et, Z, 1 - P)), F = 0; H > F; F++) {
+ for (M += "<tr>", E = d ? "<td class='ui-datepicker-week-col'>" + this._get(e, "calculateWeek")(z) + "</td>" : "", x = 0; 7 > x; x++)O = g ? g.apply(e.input ? e.input[0] : null, [z]) : [!0, ""], j = z.getMonth() !== Z, W = j && !y || !O[0] || X && X > z || $ && z > $, E += "<td class='" + ((x + u + 6) % 7 >= 5 ? " ui-datepicker-week-end" : "") + (j ? " ui-datepicker-other-month" : "") + (z.getTime() === D.getTime() && Z === e.selectedMonth && e._keyEvent || b.getTime() === z.getTime() && b.getTime() === D.getTime() ? " " + this._dayOverClass : "") + (W ? " " + this._unselectableClass + " ui-state-disabled" : "") + (j && !v ? "" : " " + O[1] + (z.getTime() === G.getTime() ? " " + this._currentClass : "") + (z.getTime() === R.getTime() ? " ui-datepicker-today" : "")) + "'" + (j && !v || !O[2] ? "" : " title='" + O[2].replace(/'/g, "'") + "'") + (W ? "" : " data-handler='selectDay' data-event='click' data-month='" + z.getMonth() + "' data-year='" + z.getFullYear() + "'") + ">" + (j && !v ? " " : W ? "<span class='ui-state-default'>" + z.getDate() + "</span>" : "<a class='ui-state-default" + (z.getTime() === R.getTime() ? " ui-state-highlight" : "") + (z.getTime() === G.getTime() ? " ui-state-active" : "") + (j ? " ui-priority-secondary" : "") + "' href='#'>" + z.getDate() + "</a>") + "</td>", z.setDate(z.getDate() + 1), z = this._daylightSavingAdjust(z);
+ M += E + "</tr>"
+ }
+ Z++, Z > 11 && (Z = 0, et++), M += "</tbody></table>" + (Q ? "</div>" + (K[0] > 0 && T === K[1] - 1 ? "<div class='ui-datepicker-row-break'></div>" : "") : ""), k += M
+ }
+ _ += k
+ }
+ return _ += l, e._keyEvent = !1, _
+ },
+ _generateMonthYearHeader: function (e, t, i, s, n, a, o, r) {
+ var h, l, u, d, c, p, f, m, g = this._get(e, "changeMonth"), v = this._get(e, "changeYear"), y = this._get(e, "showMonthAfterYear"), b = "<div class='ui-datepicker-title'>", _ = "";
+ if (a || !g)_ += "<span class='ui-datepicker-month'>" + o[t] + "</span>"; else {
+ for (h = s && s.getFullYear() === i, l = n && n.getFullYear() === i, _ += "<select class='ui-datepicker-month' data-handler='selectMonth' data-event='change'>", u = 0; 12 > u; u++)(!h || u >= s.getMonth()) && (!l || n.getMonth() >= u) && (_ += "<option value='" + u + "'" + (u === t ? " selected='selected'" : "") + ">" + r[u] + "</option>");
+ _ += "</select>"
+ }
+ if (y || (b += _ + (!a && g && v ? "" : " ")), !e.yearshtml)if (e.yearshtml = "", a || !v)b += "<span class='ui-datepicker-year'>" + i + "</span>"; else {
+ for (d = this._get(e, "yearRange").split(":"), c = (new Date).getFullYear(), p = function (e) {
+ var t = e.match(/c[+\-].*/) ? i + parseInt(e.substring(1), 10) : e.match(/[+\-].*/) ? c + parseInt(e, 10) : parseInt(e, 10);
+ return isNaN(t) ? c : t
+ }, f = p(d[0]), m = Math.max(f, p(d[1] || "")), f = s ? Math.max(f, s.getFullYear()) : f, m = n ? Math.min(m, n.getFullYear()) : m, e.yearshtml += "<select class='ui-datepicker-year' data-handler='selectYear' data-event='change'>"; m >= f; f++)e.yearshtml += "<option value='" + f + "'" + (f === i ? " selected='selected'" : "") + ">" + f + "</option>";
+ e.yearshtml += "</select>", b += e.yearshtml, e.yearshtml = null
+ }
+ return b += this._get(e, "yearSuffix"), y && (b += (!a && g && v ? "" : " ") + _), b += "</div>"
+ },
+ _adjustInstDate: function (e, t, i) {
+ var s = e.drawYear + ("Y" === i ? t : 0), n = e.drawMonth + ("M" === i ? t : 0), a = Math.min(e.selectedDay, this._getDaysInMonth(s, n)) + ("D" === i ? t : 0), o = this._restrictMinMax(e, this._daylightSavingAdjust(new Date(s, n, a)));
+ e.selectedDay = o.getDate(), e.drawMonth = e.selectedMonth = o.getMonth(), e.drawYear = e.selectedYear = o.getFullYear(), ("M" === i || "Y" === i) && this._notifyChange(e)
+ },
+ _restrictMinMax: function (e, t) {
+ var i = this._getMinMaxDate(e, "min"), s = this._getMinMaxDate(e, "max"), n = i && i > t ? i : t;
+ return s && n > s ? s : n
+ },
+ _notifyChange: function (e) {
+ var t = this._get(e, "onChangeMonthYear");
+ t && t.apply(e.input ? e.input[0] : null, [e.selectedYear, e.selectedMonth + 1, e])
+ },
+ _getNumberOfMonths: function (e) {
+ var t = this._get(e, "numberOfMonths");
+ return null == t ? [1, 1] : "number" == typeof t ? [1, t] : t
+ },
+ _getMinMaxDate: function (e, t) {
+ return this._determineDate(e, this._get(e, t + "Date"), null)
+ },
+ _getDaysInMonth: function (e, t) {
+ return 32 - this._daylightSavingAdjust(new Date(e, t, 32)).getDate()
+ },
+ _getFirstDayOfMonth: function (e, t) {
+ return new Date(e, t, 1).getDay()
+ },
+ _canAdjustMonth: function (e, t, i, s) {
+ var n = this._getNumberOfMonths(e), a = this._daylightSavingAdjust(new Date(i, s + (0 > t ? t : n[0] * n[1]), 1));
+ return 0 > t && a.setDate(this._getDaysInMonth(a.getFullYear(), a.getMonth())), this._isInRange(e, a)
+ },
+ _isInRange: function (e, t) {
+ var i, s, n = this._getMinMaxDate(e, "min"), a = this._getMinMaxDate(e, "max"), o = null, r = null, h = this._get(e, "yearRange");
+ return h && (i = h.split(":"), s = (new Date).getFullYear(), o = parseInt(i[0], 10), r = parseInt(i[1], 10), i[0].match(/[+\-].*/) && (o += s), i[1].match(/[+\-].*/) && (r += s)), (!n || t.getTime() >= n.getTime()) && (!a || t.getTime() <= a.getTime()) && (!o || t.getFullYear() >= o) && (!r || r >= t.getFullYear())
+ },
+ _getFormatConfig: function (e) {
+ var t = this._get(e, "shortYearCutoff");
+ return t = "string" != typeof t ? t : (new Date).getFullYear() % 100 + parseInt(t, 10), {
+ shortYearCutoff: t,
+ dayNamesShort: this._get(e, "dayNamesShort"),
+ dayNames: this._get(e, "dayNames"),
+ monthNamesShort: this._get(e, "monthNamesShort"),
+ monthNames: this._get(e, "monthNames")
+ }
+ },
+ _formatDate: function (e, t, i, s) {
+ t || (e.currentDay = e.selectedDay, e.currentMonth = e.selectedMonth, e.currentYear = e.selectedYear);
+ var n = t ? "object" == typeof t ? t : this._daylightSavingAdjust(new Date(s, i, t)) : this._daylightSavingAdjust(new Date(e.currentYear, e.currentMonth, e.currentDay));
+ return this.formatDate(this._get(e, "dateFormat"), n, this._getFormatConfig(e))
+ }
+ }), e.fn.datepicker = function (t) {
+ if (!this.length)return this;
+ e.datepicker.initialized || (e(document).mousedown(e.datepicker._checkExternalClick), e.datepicker.initialized = !0), 0 === e("#" + e.datepicker._mainDivId).length && e("body").append(e.datepicker.dpDiv);
+ var i = Array.prototype.slice.call(arguments, 1);
+ return "string" != typeof t || "isDisabled" !== t && "getDate" !== t && "widget" !== t ? "option" === t && 2 === arguments.length && "string" == typeof arguments[1] ? e.datepicker["_" + t + "Datepicker"].apply(e.datepicker, [this[0]].concat(i)) : this.each(function () {
+ "string" == typeof t ? e.datepicker["_" + t + "Datepicker"].apply(e.datepicker, [this].concat(i)) : e.datepicker._attachDatepicker(this, t)
+ }) : e.datepicker["_" + t + "Datepicker"].apply(e.datepicker, [this[0]].concat(i))
+ }, e.datepicker = new n, e.datepicker.initialized = !1, e.datepicker.uuid = (new Date).getTime(), e.datepicker.version = "1.11.4", e.datepicker, e.widget("ui.dialog", {
+ version: "1.11.4",
+ options: {
+ appendTo: "body",
+ autoOpen: !0,
+ buttons: [],
+ closeOnEscape: !0,
+ closeText: "Close",
+ dialogClass: "",
+ draggable: !0,
+ hide: null,
+ height: "auto",
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 150,
+ minWidth: 150,
+ modal: !1,
+ position: {
+ my: "center", at: "center", of: window, collision: "fit", using: function (t) {
+ var i = e(this).css(t).offset().top;
+ 0 > i && e(this).css("top", t.top - i)
+ }
+ },
+ resizable: !0,
+ show: null,
+ title: null,
+ width: 300,
+ beforeClose: null,
+ close: null,
+ drag: null,
+ dragStart: null,
+ dragStop: null,
+ focus: null,
+ open: null,
+ resize: null,
+ resizeStart: null,
+ resizeStop: null
+ },
+ sizeRelatedOptions: {
+ buttons: !0,
+ height: !0,
+ maxHeight: !0,
+ maxWidth: !0,
+ minHeight: !0,
+ minWidth: !0,
+ width: !0
+ },
+ resizableRelatedOptions: {maxHeight: !0, maxWidth: !0, minHeight: !0, minWidth: !0},
+ _create: function () {
+ this.originalCss = {
+ display: this.element[0].style.display,
+ width: this.element[0].style.width,
+ minHeight: this.element[0].style.minHeight,
+ maxHeight: this.element[0].style.maxHeight,
+ height: this.element[0].style.height
+ }, this.originalPosition = {
+ parent: this.element.parent(),
+ index: this.element.parent().children().index(this.element)
+ }, this.originalTitle = this.element.attr("title"), this.options.title = this.options.title || this.originalTitle, this._createWrapper(), this.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(this.uiDialog), this._createTitlebar(), this._createButtonPane(), this.options.draggable && e.fn.draggable && this._makeDraggable(), this.options.resizable && e.fn.resizable && this._makeResizable(), this._isOpen = !1, this._trackFocus()
+ },
+ _init: function () {
+ this.options.autoOpen && this.open()
+ },
+ _appendTo: function () {
+ var t = this.options.appendTo;
+ return t && (t.jquery || t.nodeType) ? e(t) : this.document.find(t || "body").eq(0)
+ },
+ _destroy: function () {
+ var e, t = this.originalPosition;
+ this._untrackInstance(), this._destroyOverlay(), this.element.removeUniqueId().removeClass("ui-dialog-content ui-widget-content").css(this.originalCss).detach(), this.uiDialog.stop(!0, !0).remove(), this.originalTitle && this.element.attr("title", this.originalTitle), e = t.parent.children().eq(t.index), e.length && e[0] !== this.element[0] ? e.before(this.element) : t.parent.append(this.element)
+ },
+ widget: function () {
+ return this.uiDialog
+ },
+ disable: e.noop,
+ enable: e.noop,
+ close: function (t) {
+ var i, s = this;
+ if (this._isOpen && this._trigger("beforeClose", t) !== !1) {
+ if (this._isOpen = !1, this._focusedElement = null, this._destroyOverlay(), this._untrackInstance(), !this.opener.filter(":focusable").focus().length)try {
+ i = this.document[0].activeElement, i && "body" !== i.nodeName.toLowerCase() && e(i).blur()
+ } catch (n) {
+ }
+ this._hide(this.uiDialog, this.options.hide, function () {
+ s._trigger("close", t)
+ })
+ }
+ },
+ isOpen: function () {
+ return this._isOpen
+ },
+ moveToTop: function () {
+ this._moveToTop()
+ },
+ _moveToTop: function (t, i) {
+ var s = !1, n = this.uiDialog.siblings(".ui-front:visible").map(function () {
+ return +e(this).css("z-index")
+ }).get(), a = Math.max.apply(null, n);
+ return a >= +this.uiDialog.css("z-index") && (this.uiDialog.css("z-index", a + 1), s = !0), s && !i && this._trigger("focus", t), s
+ },
+ open: function () {
+ var t = this;
+ return this._isOpen ? (this._moveToTop() && this._focusTabbable(), void 0) : (this._isOpen = !0, this.opener = e(this.document[0].activeElement), this._size(), this._position(), this._createOverlay(), this._moveToTop(null, !0), this.overlay && this.overlay.css("z-index", this.uiDialog.css("z-index") - 1), this._show(this.uiDialog, this.options.show, function () {
+ t._focusTabbable(), t._trigger("focus")
+ }), this._makeFocusTarget(), this._trigger("open"), void 0)
+ },
+ _focusTabbable: function () {
+ var e = this._focusedElement;
+ e || (e = this.element.find("[autofocus]")), e.length || (e = this.element.find(":tabbable")), e.length || (e = this.uiDialogButtonPane.find(":tabbable")), e.length || (e = this.uiDialogTitlebarClose.filter(":tabbable")), e.length || (e = this.uiDialog), e.eq(0).focus()
+ },
+ _keepFocus: function (t) {
+ function i() {
+ var t = this.document[0].activeElement, i = this.uiDialog[0] === t || e.contains(this.uiDialog[0], t);
+ i || this._focusTabbable()
+ }
+
+ t.preventDefault(), i.call(this), this._delay(i)
+ },
+ _createWrapper: function () {
+ this.uiDialog = e("<div>").addClass("ui-dialog ui-widget ui-widget-content ui-corner-all ui-front " + this.options.dialogClass).hide().attr({
+ tabIndex: -1,
+ role: "dialog"
+ }).appendTo(this._appendTo()), this._on(this.uiDialog, {
+ keydown: function (t) {
+ if (this.options.closeOnEscape && !t.isDefaultPrevented() && t.keyCode && t.keyCode === e.ui.keyCode.ESCAPE)return t.preventDefault(), this.close(t), void 0;
+ if (t.keyCode === e.ui.keyCode.TAB && !t.isDefaultPrevented()) {
+ var i = this.uiDialog.find(":tabbable"), s = i.filter(":first"), n = i.filter(":last");
+ t.target !== n[0] && t.target !== this.uiDialog[0] || t.shiftKey ? t.target !== s[0] && t.target !== this.uiDialog[0] || !t.shiftKey || (this._delay(function () {
+ n.focus()
+ }), t.preventDefault()) : (this._delay(function () {
+ s.focus()
+ }), t.preventDefault())
+ }
+ }, mousedown: function (e) {
+ this._moveToTop(e) && this._focusTabbable()
+ }
+ }), this.element.find("[aria-describedby]").length || this.uiDialog.attr({"aria-describedby": this.element.uniqueId().attr("id")})
+ },
+ _createTitlebar: function () {
+ var t;
+ this.uiDialogTitlebar = e("<div>").addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(this.uiDialog), this._on(this.uiDialogTitlebar, {
+ mousedown: function (t) {
+ e(t.target).closest(".ui-dialog-titlebar-close") || this.uiDialog.focus()
+ }
+ }), this.uiDialogTitlebarClose = e("<button type='button'></button>").button({
+ label: this.options.closeText,
+ icons: {primary: "ui-icon-closethick"},
+ text: !1
+ }).addClass("ui-dialog-titlebar-close").appendTo(this.uiDialogTitlebar), this._on(this.uiDialogTitlebarClose, {
+ click: function (e) {
+ e.preventDefault(), this.close(e)
+ }
+ }), t = e("<span>").uniqueId().addClass("ui-dialog-title").prependTo(this.uiDialogTitlebar), this._title(t), this.uiDialog.attr({"aria-labelledby": t.attr("id")})
+ },
+ _title: function (e) {
+ this.options.title || e.html(" "), e.text(this.options.title)
+ },
+ _createButtonPane: function () {
+ this.uiDialogButtonPane = e("<div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"), this.uiButtonSet = e("<div>").addClass("ui-dialog-buttonset").appendTo(this.uiDialogButtonPane), this._createButtons()
+ },
+ _createButtons: function () {
+ var t = this, i = this.options.buttons;
+ return this.uiDialogButtonPane.remove(), this.uiButtonSet.empty(), e.isEmptyObject(i) || e.isArray(i) && !i.length ? (this.uiDialog.removeClass("ui-dialog-buttons"), void 0) : (e.each(i, function (i, s) {
+ var n, a;
+ s = e.isFunction(s) ? {
+ click: s,
+ text: i
+ } : s, s = e.extend({type: "button"}, s), n = s.click, s.click = function () {
+ n.apply(t.element[0], arguments)
+ }, a = {
+ icons: s.icons,
+ text: s.showText
+ }, delete s.icons, delete s.showText, e("<button></button>", s).button(a).appendTo(t.uiButtonSet)
+ }), this.uiDialog.addClass("ui-dialog-buttons"), this.uiDialogButtonPane.appendTo(this.uiDialog), void 0)
+ },
+ _makeDraggable: function () {
+ function t(e) {
+ return {position: e.position, offset: e.offset}
+ }
+
+ var i = this, s = this.options;
+ this.uiDialog.draggable({
+ cancel: ".ui-dialog-content, .ui-dialog-titlebar-close",
+ handle: ".ui-dialog-titlebar",
+ containment: "document",
+ start: function (s, n) {
+ e(this).addClass("ui-dialog-dragging"), i._blockFrames(), i._trigger("dragStart", s, t(n))
+ },
+ drag: function (e, s) {
+ i._trigger("drag", e, t(s))
+ },
+ stop: function (n, a) {
+ var o = a.offset.left - i.document.scrollLeft(), r = a.offset.top - i.document.scrollTop();
+ s.position = {
+ my: "left top",
+ at: "left" + (o >= 0 ? "+" : "") + o + " " + "top" + (r >= 0 ? "+" : "") + r,
+ of: i.window
+ }, e(this).removeClass("ui-dialog-dragging"), i._unblockFrames(), i._trigger("dragStop", n, t(a))
+ }
+ })
+ },
+ _makeResizable: function () {
+ function t(e) {
+ return {
+ originalPosition: e.originalPosition,
+ originalSize: e.originalSize,
+ position: e.position,
+ size: e.size
+ }
+ }
+
+ var i = this, s = this.options, n = s.resizable, a = this.uiDialog.css("position"), o = "string" == typeof n ? n : "n,e,s,w,se,sw,ne,nw";
+ this.uiDialog.resizable({
+ cancel: ".ui-dialog-content",
+ containment: "document",
+ alsoResize: this.element,
+ maxWidth: s.maxWidth,
+ maxHeight: s.maxHeight,
+ minWidth: s.minWidth,
+ minHeight: this._minHeight(),
+ handles: o,
+ start: function (s, n) {
+ e(this).addClass("ui-dialog-resizing"), i._blockFrames(), i._trigger("resizeStart", s, t(n))
+ },
+ resize: function (e, s) {
+ i._trigger("resize", e, t(s))
+ },
+ stop: function (n, a) {
+ var o = i.uiDialog.offset(), r = o.left - i.document.scrollLeft(), h = o.top - i.document.scrollTop();
+ s.height = i.uiDialog.height(), s.width = i.uiDialog.width(), s.position = {
+ my: "left top",
+ at: "left" + (r >= 0 ? "+" : "") + r + " " + "top" + (h >= 0 ? "+" : "") + h,
+ of: i.window
+ }, e(this).removeClass("ui-dialog-resizing"), i._unblockFrames(), i._trigger("resizeStop", n, t(a))
+ }
+ }).css("position", a)
+ },
+ _trackFocus: function () {
+ this._on(this.widget(), {
+ focusin: function (t) {
+ this._makeFocusTarget(), this._focusedElement = e(t.target)
+ }
+ })
+ },
+ _makeFocusTarget: function () {
+ this._untrackInstance(), this._trackingInstances().unshift(this)
+ },
+ _untrackInstance: function () {
+ var t = this._trackingInstances(), i = e.inArray(this, t);
+ -1 !== i && t.splice(i, 1)
+ },
+ _trackingInstances: function () {
+ var e = this.document.data("ui-dialog-instances");
+ return e || (e = [], this.document.data("ui-dialog-instances", e)), e
+ },
+ _minHeight: function () {
+ var e = this.options;
+ return "auto" === e.height ? e.minHeight : Math.min(e.minHeight, e.height)
+ },
+ _position: function () {
+ var e = this.uiDialog.is(":visible");
+ e || this.uiDialog.show(), this.uiDialog.position(this.options.position), e || this.uiDialog.hide()
+ },
+ _setOptions: function (t) {
+ var i = this, s = !1, n = {};
+ e.each(t, function (e, t) {
+ i._setOption(e, t), e in i.sizeRelatedOptions && (s = !0), e in i.resizableRelatedOptions && (n[e] = t)
+ }), s && (this._size(), this._position()), this.uiDialog.is(":data(ui-resizable)") && this.uiDialog.resizable("option", n)
+ },
+ _setOption: function (e, t) {
+ var i, s, n = this.uiDialog;
+ "dialogClass" === e && n.removeClass(this.options.dialogClass).addClass(t), "disabled" !== e && (this._super(e, t), "appendTo" === e && this.uiDialog.appendTo(this._appendTo()), "buttons" === e && this._createButtons(), "closeText" === e && this.uiDialogTitlebarClose.button({label: "" + t}), "draggable" === e && (i = n.is(":data(ui-draggable)"), i && !t && n.draggable("destroy"), !i && t && this._makeDraggable()), "position" === e && this._position(), "resizable" === e && (s = n.is(":data(ui-resizable)"), s && !t && n.resizable("destroy"), s && "string" == typeof t && n.resizable("option", "handles", t), s || t === !1 || this._makeResizable()), "title" === e && this._title(this.uiDialogTitlebar.find(".ui-dialog-title")))
+ },
+ _size: function () {
+ var e, t, i, s = this.options;
+ this.element.show().css({
+ width: "auto",
+ minHeight: 0,
+ maxHeight: "none",
+ height: 0
+ }), s.minWidth > s.width && (s.width = s.minWidth), e = this.uiDialog.css({
+ height: "auto",
+ width: s.width
+ }).outerHeight(), t = Math.max(0, s.minHeight - e), i = "number" == typeof s.maxHeight ? Math.max(0, s.maxHeight - e) : "none", "auto" === s.height ? this.element.css({
+ minHeight: t,
+ maxHeight: i,
+ height: "auto"
+ }) : this.element.height(Math.max(0, s.height - e)), this.uiDialog.is(":data(ui-resizable)") && this.uiDialog.resizable("option", "minHeight", this._minHeight())
+ },
+ _blockFrames: function () {
+ this.iframeBlocks = this.document.find("iframe").map(function () {
+ var t = e(this);
+ return e("<div>").css({
+ position: "absolute",
+ width: t.outerWidth(),
+ height: t.outerHeight()
+ }).appendTo(t.parent()).offset(t.offset())[0]
+ })
+ },
+ _unblockFrames: function () {
+ this.iframeBlocks && (this.iframeBlocks.remove(), delete this.iframeBlocks)
+ },
+ _allowInteraction: function (t) {
+ return e(t.target).closest(".ui-dialog").length ? !0 : !!e(t.target).closest(".ui-datepicker").length
+ },
+ _createOverlay: function () {
+ if (this.options.modal) {
+ var t = !0;
+ this._delay(function () {
+ t = !1
+ }), this.document.data("ui-dialog-overlays") || this._on(this.document, {
+ focusin: function (e) {
+ t || this._allowInteraction(e) || (e.preventDefault(), this._trackingInstances()[0]._focusTabbable())
+ }
+ }), this.overlay = e("<div>").addClass("ui-widget-overlay ui-front").appendTo(this._appendTo()), this._on(this.overlay, {mousedown: "_keepFocus"}), this.document.data("ui-dialog-overlays", (this.document.data("ui-dialog-overlays") || 0) + 1)
+ }
+ },
+ _destroyOverlay: function () {
+ if (this.options.modal && this.overlay) {
+ var e = this.document.data("ui-dialog-overlays") - 1;
+ e ? this.document.data("ui-dialog-overlays", e) : this.document.unbind("focusin").removeData("ui-dialog-overlays"), this.overlay.remove(), this.overlay = null
+ }
+ }
+ }), e.widget("ui.progressbar", {
+ version: "1.11.4",
+ options: {max: 100, value: 0, change: null, complete: null},
+ min: 0,
+ _create: function () {
+ this.oldValue = this.options.value = this._constrainedValue(), this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({
+ role: "progressbar",
+ "aria-valuemin": this.min
+ }), this.valueDiv = e("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element), this._refreshValue()
+ },
+ _destroy: function () {
+ this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"), this.valueDiv.remove()
+ },
+ value: function (e) {
+ return void 0 === e ? this.options.value : (this.options.value = this._constrainedValue(e), this._refreshValue(), void 0)
+ },
+ _constrainedValue: function (e) {
+ return void 0 === e && (e = this.options.value), this.indeterminate = e === !1, "number" != typeof e && (e = 0), this.indeterminate ? !1 : Math.min(this.options.max, Math.max(this.min, e))
+ },
+ _setOptions: function (e) {
+ var t = e.value;
+ delete e.value, this._super(e), this.options.value = this._constrainedValue(t), this._refreshValue()
+ },
+ _setOption: function (e, t) {
+ "max" === e && (t = Math.max(this.min, t)), "disabled" === e && this.element.toggleClass("ui-state-disabled", !!t).attr("aria-disabled", t), this._super(e, t)
+ },
+ _percentage: function () {
+ return this.indeterminate ? 100 : 100 * (this.options.value - this.min) / (this.options.max - this.min)
+ },
+ _refreshValue: function () {
+ var t = this.options.value, i = this._percentage();
+ this.valueDiv.toggle(this.indeterminate || t > this.min).toggleClass("ui-corner-right", t === this.options.max).width(i.toFixed(0) + "%"), this.element.toggleClass("ui-progressbar-indeterminate", this.indeterminate), this.indeterminate ? (this.element.removeAttr("aria-valuenow"), this.overlayDiv || (this.overlayDiv = e("<div class='ui-progressbar-overlay'></div>").appendTo(this.valueDiv))) : (this.element.attr({
+ "aria-valuemax": this.options.max,
+ "aria-valuenow": t
+ }), this.overlayDiv && (this.overlayDiv.remove(), this.overlayDiv = null)), this.oldValue !== t && (this.oldValue = t, this._trigger("change")), t === this.options.max && this._trigger("complete")
+ }
+ }), e.widget("ui.selectmenu", {
+ version: "1.11.4",
+ defaultElement: "<select>",
+ options: {
+ appendTo: null,
+ disabled: null,
+ icons: {button: "ui-icon-triangle-1-s"},
+ position: {my: "left top", at: "left bottom", collision: "none"},
+ width: null,
+ change: null,
+ close: null,
+ focus: null,
+ open: null,
+ select: null
+ },
+ _create: function () {
+ var e = this.element.uniqueId().attr("id");
+ this.ids = {
+ element: e,
+ button: e + "-button",
+ menu: e + "-menu"
+ }, this._drawButton(), this._drawMenu(), this.options.disabled && this.disable()
+ },
+ _drawButton: function () {
+ var t = this;
+ this.label = e("label[for='" + this.ids.element + "']").attr("for", this.ids.button), this._on(this.label, {
+ click: function (e) {
+ this.button.focus(), e.preventDefault()
+ }
+ }), this.element.hide(), this.button = e("<span>", {
+ "class": "ui-selectmenu-button ui-widget ui-state-default ui-corner-all",
+ tabindex: this.options.disabled ? -1 : 0,
+ id: this.ids.button,
+ role: "combobox",
+ "aria-expanded": "false",
+ "aria-autocomplete": "list",
+ "aria-owns": this.ids.menu,
+ "aria-haspopup": "true"
+ }).insertAfter(this.element), e("<span>", {"class": "ui-icon " + this.options.icons.button}).prependTo(this.button), this.buttonText = e("<span>", {"class": "ui-selectmenu-text"}).appendTo(this.button), this._setText(this.buttonText, this.element.find("option:selected").text()), this._resizeButton(), this._on(this.button, this._buttonEvents), this.button.one("focusin", function () {
+ t.menuItems || t._refreshMenu()
+ }), this._hoverable(this.button), this._focusable(this.button)
+ },
+ _drawMenu: function () {
+ var t = this;
+ this.menu = e("<ul>", {
+ "aria-hidden": "true",
+ "aria-labelledby": this.ids.button,
+ id: this.ids.menu
+ }), this.menuWrap = e("<div>", {"class": "ui-selectmenu-menu ui-front"}).append(this.menu).appendTo(this._appendTo()), this.menuInstance = this.menu.menu({
+ role: "listbox",
+ select: function (e, i) {
+ e.preventDefault(), t._setSelection(), t._select(i.item.data("ui-selectmenu-item"), e)
+ },
+ focus: function (e, i) {
+ var s = i.item.data("ui-selectmenu-item");
+ null != t.focusIndex && s.index !== t.focusIndex && (t._trigger("focus", e, {item: s}), t.isOpen || t._select(s, e)), t.focusIndex = s.index, t.button.attr("aria-activedescendant", t.menuItems.eq(s.index).attr("id"))
+ }
+ }).menu("instance"), this.menu.addClass("ui-corner-bottom").removeClass("ui-corner-all"), this.menuInstance._off(this.menu, "mouseleave"), this.menuInstance._closeOnDocumentClick = function () {
+ return !1
+ }, this.menuInstance._isDivider = function () {
+ return !1
+ }
+ },
+ refresh: function () {
+ this._refreshMenu(), this._setText(this.buttonText, this._getSelectedItem().text()), this.options.width || this._resizeButton()
+ },
+ _refreshMenu: function () {
+ this.menu.empty();
+ var e, t = this.element.find("option");
+ t.length && (this._parseOptions(t), this._renderMenu(this.menu, this.items), this.menuInstance.refresh(), this.menuItems = this.menu.find("li").not(".ui-selectmenu-optgroup"), e = this._getSelectedItem(), this.menuInstance.focus(null, e), this._setAria(e.data("ui-selectmenu-item")), this._setOption("disabled", this.element.prop("disabled")))
+ },
+ open: function (e) {
+ this.options.disabled || (this.menuItems ? (this.menu.find(".ui-state-focus").removeClass("ui-state-focus"), this.menuInstance.focus(null, this._getSelectedItem())) : this._refreshMenu(), this.isOpen = !0, this._toggleAttr(), this._resizeMenu(), this._position(), this._on(this.document, this._documentClick), this._trigger("open", e))
+ },
+ _position: function () {
+ this.menuWrap.position(e.extend({of: this.button}, this.options.position))
+ },
+ close: function (e) {
+ this.isOpen && (this.isOpen = !1, this._toggleAttr(), this.range = null, this._off(this.document), this._trigger("close", e))
+ },
+ widget: function () {
+ return this.button
+ },
+ menuWidget: function () {
+ return this.menu
+ },
+ _renderMenu: function (t, i) {
+ var s = this, n = "";
+ e.each(i, function (i, a) {
+ a.optgroup !== n && (e("<li>", {
+ "class": "ui-selectmenu-optgroup ui-menu-divider" + (a.element.parent("optgroup").prop("disabled") ? " ui-state-disabled" : ""),
+ text: a.optgroup
+ }).appendTo(t), n = a.optgroup), s._renderItemData(t, a)
+ })
+ },
+ _renderItemData: function (e, t) {
+ return this._renderItem(e, t).data("ui-selectmenu-item", t)
+ },
+ _renderItem: function (t, i) {
+ var s = e("<li>");
+ return i.disabled && s.addClass("ui-state-disabled"), this._setText(s, i.label), s.appendTo(t)
+ },
+ _setText: function (e, t) {
+ t ? e.text(t) : e.html(" ")
+ },
+ _move: function (e, t) {
+ var i, s, n = ".ui-menu-item";
+ this.isOpen ? i = this.menuItems.eq(this.focusIndex) : (i = this.menuItems.eq(this.element[0].selectedIndex), n += ":not(.ui-state-disabled)"), s = "first" === e || "last" === e ? i["first" === e ? "prevAll" : "nextAll"](n).eq(-1) : i[e + "All"](n).eq(0), s.length && this.menuInstance.focus(t, s)
+ },
+ _getSelectedItem: function () {
+ return this.menuItems.eq(this.element[0].selectedIndex)
+ },
+ _toggle: function (e) {
+ this[this.isOpen ? "close" : "open"](e)
+ },
+ _setSelection: function () {
+ var e;
+ this.range && (window.getSelection ? (e = window.getSelection(), e.removeAllRanges(), e.addRange(this.range)) : this.range.select(), this.button.focus())
+ },
+ _documentClick: {
+ mousedown: function (t) {
+ this.isOpen && (e(t.target).closest(".ui-selectmenu-menu, #" + this.ids.button).length || this.close(t))
+ }
+ },
+ _buttonEvents: {
+ mousedown: function () {
+ var e;
+ window.getSelection ? (e = window.getSelection(), e.rangeCount && (this.range = e.getRangeAt(0))) : this.range = document.selection.createRange()
+ }, click: function (e) {
+ this._setSelection(), this._toggle(e)
+ }, keydown: function (t) {
+ var i = !0;
+ switch (t.keyCode) {
+ case e.ui.keyCode.TAB:
+ case e.ui.keyCode.ESCAPE:
+ this.close(t), i = !1;
+ break;
+ case e.ui.keyCode.ENTER:
+ this.isOpen && this._selectFocusedItem(t);
+ break;
+ case e.ui.keyCode.UP:
+ t.altKey ? this._toggle(t) : this._move("prev", t);
+ break;
+ case e.ui.keyCode.DOWN:
+ t.altKey ? this._toggle(t) : this._move("next", t);
+ break;
+ case e.ui.keyCode.SPACE:
+ this.isOpen ? this._selectFocusedItem(t) : this._toggle(t);
+ break;
+ case e.ui.keyCode.LEFT:
+ this._move("prev", t);
+ break;
+ case e.ui.keyCode.RIGHT:
+ this._move("next", t);
+ break;
+ case e.ui.keyCode.HOME:
+ case e.ui.keyCode.PAGE_UP:
+ this._move("first", t);
+ break;
+ case e.ui.keyCode.END:
+ case e.ui.keyCode.PAGE_DOWN:
+ this._move("last", t);
+ break;
+ default:
+ this.menu.trigger(t), i = !1
+ }
+ i && t.preventDefault()
+ }
+ },
+ _selectFocusedItem: function (e) {
+ var t = this.menuItems.eq(this.focusIndex);
+ t.hasClass("ui-state-disabled") || this._select(t.data("ui-selectmenu-item"), e)
+ },
+ _select: function (e, t) {
+ var i = this.element[0].selectedIndex;
+ this.element[0].selectedIndex = e.index, this._setText(this.buttonText, e.label), this._setAria(e), this._trigger("select", t, {item: e}), e.index !== i && this._trigger("change", t, {item: e}), this.close(t)
+ },
+ _setAria: function (e) {
+ var t = this.menuItems.eq(e.index).attr("id");
+ this.button.attr({
+ "aria-labelledby": t,
+ "aria-activedescendant": t
+ }), this.menu.attr("aria-activedescendant", t)
+ },
+ _setOption: function (e, t) {
+ "icons" === e && this.button.find("span.ui-icon").removeClass(this.options.icons.button).addClass(t.button), this._super(e, t), "appendTo" === e && this.menuWrap.appendTo(this._appendTo()), "disabled" === e && (this.menuInstance.option("disabled", t), this.button.toggleClass("ui-state-disabled", t).attr("aria-disabled", t), this.element.prop("disabled", t), t ? (this.button.attr("tabindex", -1), this.close()) : this.button.attr("tabindex", 0)), "width" === e && this._resizeButton()
+ },
+ _appendTo: function () {
+ var t = this.options.appendTo;
+ return t && (t = t.jquery || t.nodeType ? e(t) : this.document.find(t).eq(0)), t && t[0] || (t = this.element.closest(".ui-front")), t.length || (t = this.document[0].body), t
+ },
+ _toggleAttr: function () {
+ this.button.toggleClass("ui-corner-top", this.isOpen).toggleClass("ui-corner-all", !this.isOpen).attr("aria-expanded", this.isOpen), this.menuWrap.toggleClass("ui-selectmenu-open", this.isOpen), this.menu.attr("aria-hidden", !this.isOpen)
+ },
+ _resizeButton: function () {
+ var e = this.options.width;
+ e || (e = this.element.show().outerWidth(), this.element.hide()), this.button.outerWidth(e)
+ },
+ _resizeMenu: function () {
+ this.menu.outerWidth(Math.max(this.button.outerWidth(), this.menu.width("").outerWidth() + 1))
+ },
+ _getCreateOptions: function () {
+ return {disabled: this.element.prop("disabled")}
+ },
+ _parseOptions: function (t) {
+ var i = [];
+ t.each(function (t, s) {
+ var n = e(s), a = n.parent("optgroup");
+ i.push({
+ element: n,
+ index: t,
+ value: n.val(),
+ label: n.text(),
+ optgroup: a.attr("label") || "",
+ disabled: a.prop("disabled") || n.prop("disabled")
+ })
+ }), this.items = i
+ },
+ _destroy: function () {
+ this.menuWrap.remove(), this.button.remove(), this.element.show(), this.element.removeUniqueId(), this.label.attr("for", this.ids.element)
+ }
+ }), e.widget("ui.slider", e.ui.mouse, {
+ version: "1.11.4",
+ widgetEventPrefix: "slide",
+ options: {
+ animate: !1,
+ distance: 0,
+ max: 100,
+ min: 0,
+ orientation: "horizontal",
+ range: !1,
+ step: 1,
+ value: 0,
+ values: null,
+ change: null,
+ slide: null,
+ start: null,
+ stop: null
+ },
+ numPages: 5,
+ _create: function () {
+ this._keySliding = !1, this._mouseSliding = !1, this._animateOff = !0, this._handleIndex = null, this._detectOrientation(), this._mouseInit(), this._calculateNewMax(), this.element.addClass("ui-slider ui-slider-" + this.orientation + " ui-widget" + " ui-widget-content" + " ui-corner-all"), this._refresh(), this._setOption("disabled", this.options.disabled), this._animateOff = !1
+ },
+ _refresh: function () {
+ this._createRange(), this._createHandles(), this._setupEvents(), this._refreshValue()
+ },
+ _createHandles: function () {
+ var t, i, s = this.options, n = this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"), a = "<span class='ui-slider-handle ui-state-default ui-corner-all' tabindex='0'></span>", o = [];
+ for (i = s.values && s.values.length || 1, n.length > i && (n.slice(i).remove(), n = n.slice(0, i)), t = n.length; i > t; t++)o.push(a);
+ this.handles = n.add(e(o.join("")).appendTo(this.element)), this.handle = this.handles.eq(0), this.handles.each(function (t) {
+ e(this).data("ui-slider-handle-index", t)
+ })
+ },
+ _createRange: function () {
+ var t = this.options, i = "";
+ t.range ? (t.range === !0 && (t.values ? t.values.length && 2 !== t.values.length ? t.values = [t.values[0], t.values[0]] : e.isArray(t.values) && (t.values = t.values.slice(0)) : t.values = [this._valueMin(), this._valueMin()]), this.range && this.range.length ? this.range.removeClass("ui-slider-range-min ui-slider-range-max").css({
+ left: "",
+ bottom: ""
+ }) : (this.range = e("<div></div>").appendTo(this.element), i = "ui-slider-range ui-widget-header ui-corner-all"), this.range.addClass(i + ("min" === t.range || "max" === t.range ? " ui-slider-range-" + t.range : ""))) : (this.range && this.range.remove(), this.range = null)
+ },
+ _setupEvents: function () {
+ this._off(this.handles), this._on(this.handles, this._handleEvents), this._hoverable(this.handles), this._focusable(this.handles)
+ },
+ _destroy: function () {
+ this.handles.remove(), this.range && this.range.remove(), this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-widget ui-widget-content ui-corner-all"), this._mouseDestroy()
+ },
+ _mouseCapture: function (t) {
+ var i, s, n, a, o, r, h, l, u = this, d = this.options;
+ return d.disabled ? !1 : (this.elementSize = {
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight()
+ }, this.elementOffset = this.element.offset(), i = {
+ x: t.pageX,
+ y: t.pageY
+ }, s = this._normValueFromMouse(i), n = this._valueMax() - this._valueMin() + 1, this.handles.each(function (t) {
+ var i = Math.abs(s - u.values(t));
+ (n > i || n === i && (t === u._lastChangedValue || u.values(t) === d.min)) && (n = i, a = e(this), o = t)
+ }), r = this._start(t, o), r === !1 ? !1 : (this._mouseSliding = !0, this._handleIndex = o, a.addClass("ui-state-active").focus(), h = a.offset(), l = !e(t.target).parents().addBack().is(".ui-slider-handle"), this._clickOffset = l ? {
+ left: 0,
+ top: 0
+ } : {
+ left: t.pageX - h.left - a.width() / 2,
+ top: t.pageY - h.top - a.height() / 2 - (parseInt(a.css("borderTopWidth"), 10) || 0) - (parseInt(a.css("borderBottomWidth"), 10) || 0) + (parseInt(a.css("marginTop"), 10) || 0)
+ }, this.handles.hasClass("ui-state-hover") || this._slide(t, o, s), this._animateOff = !0, !0))
+ },
+ _mouseStart: function () {
+ return !0
+ },
+ _mouseDrag: function (e) {
+ var t = {x: e.pageX, y: e.pageY}, i = this._normValueFromMouse(t);
+ return this._slide(e, this._handleIndex, i), !1
+ },
+ _mouseStop: function (e) {
+ return this.handles.removeClass("ui-state-active"), this._mouseSliding = !1, this._stop(e, this._handleIndex), this._change(e, this._handleIndex), this._handleIndex = null, this._clickOffset = null, this._animateOff = !1, !1
+ },
+ _detectOrientation: function () {
+ this.orientation = "vertical" === this.options.orientation ? "vertical" : "horizontal"
+ },
+ _normValueFromMouse: function (e) {
+ var t, i, s, n, a;
+ return "horizontal" === this.orientation ? (t = this.elementSize.width, i = e.x - this.elementOffset.left - (this._clickOffset ? this._clickOffset.left : 0)) : (t = this.elementSize.height, i = e.y - this.elementOffset.top - (this._clickOffset ? this._clickOffset.top : 0)), s = i / t, s > 1 && (s = 1), 0 > s && (s = 0), "vertical" === this.orientation && (s = 1 - s), n = this._valueMax() - this._valueMin(), a = this._valueMin() + s * n, this._trimAlignValue(a)
+ },
+ _start: function (e, t) {
+ var i = {handle: this.handles[t], value: this.value()};
+ return this.options.values && this.options.values.length && (i.value = this.values(t), i.values = this.values()), this._trigger("start", e, i)
+ },
+ _slide: function (e, t, i) {
+ var s, n, a;
+ this.options.values && this.options.values.length ? (s = this.values(t ? 0 : 1), 2 === this.options.values.length && this.options.range === !0 && (0 === t && i > s || 1 === t && s > i) && (i = s), i !== this.values(t) && (n = this.values(), n[t] = i, a = this._trigger("slide", e, {
+ handle: this.handles[t],
+ value: i,
+ values: n
+ }), s = this.values(t ? 0 : 1), a !== !1 && this.values(t, i))) : i !== this.value() && (a = this._trigger("slide", e, {
+ handle: this.handles[t],
+ value: i
+ }), a !== !1 && this.value(i))
+ },
+ _stop: function (e, t) {
+ var i = {handle: this.handles[t], value: this.value()};
+ this.options.values && this.options.values.length && (i.value = this.values(t), i.values = this.values()), this._trigger("stop", e, i)
+ },
+ _change: function (e, t) {
+ if (!this._keySliding && !this._mouseSliding) {
+ var i = {handle: this.handles[t], value: this.value()};
+ this.options.values && this.options.values.length && (i.value = this.values(t), i.values = this.values()), this._lastChangedValue = t, this._trigger("change", e, i)
+ }
+ },
+ value: function (e) {
+ return arguments.length ? (this.options.value = this._trimAlignValue(e), this._refreshValue(), this._change(null, 0), void 0) : this._value()
+ },
+ values: function (t, i) {
+ var s, n, a;
+ if (arguments.length > 1)return this.options.values[t] = this._trimAlignValue(i), this._refreshValue(), this._change(null, t), void 0;
+ if (!arguments.length)return this._values();
+ if (!e.isArray(arguments[0]))return this.options.values && this.options.values.length ? this._values(t) : this.value();
+ for (s = this.options.values, n = arguments[0], a = 0; s.length > a; a += 1)s[a] = this._trimAlignValue(n[a]), this._change(null, a);
+ this._refreshValue()
+ },
+ _setOption: function (t, i) {
+ var s, n = 0;
+ switch ("range" === t && this.options.range === !0 && ("min" === i ? (this.options.value = this._values(0), this.options.values = null) : "max" === i && (this.options.value = this._values(this.options.values.length - 1), this.options.values = null)), e.isArray(this.options.values) && (n = this.options.values.length), "disabled" === t && this.element.toggleClass("ui-state-disabled", !!i), this._super(t, i), t) {
+ case"orientation":
+ this._detectOrientation(), this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-" + this.orientation), this._refreshValue(), this.handles.css("horizontal" === i ? "bottom" : "left", "");
+ break;
+ case"value":
+ this._animateOff = !0, this._refreshValue(), this._change(null, 0), this._animateOff = !1;
+ break;
+ case"values":
+ for (this._animateOff = !0, this._refreshValue(), s = 0; n > s; s += 1)this._change(null, s);
+ this._animateOff = !1;
+ break;
+ case"step":
+ case"min":
+ case"max":
+ this._animateOff = !0, this._calculateNewMax(), this._refreshValue(), this._animateOff = !1;
+ break;
+ case"range":
+ this._animateOff = !0, this._refresh(), this._animateOff = !1
+ }
+ },
+ _value: function () {
+ var e = this.options.value;
+ return e = this._trimAlignValue(e)
+ },
+ _values: function (e) {
+ var t, i, s;
+ if (arguments.length)return t = this.options.values[e], t = this._trimAlignValue(t);
+ if (this.options.values && this.options.values.length) {
+ for (i = this.options.values.slice(), s = 0; i.length > s; s += 1)i[s] = this._trimAlignValue(i[s]);
+ return i
+ }
+ return []
+ },
+ _trimAlignValue: function (e) {
+ if (this._valueMin() >= e)return this._valueMin();
+ if (e >= this._valueMax())return this._valueMax();
+ var t = this.options.step > 0 ? this.options.step : 1, i = (e - this._valueMin()) % t, s = e - i;
+ return 2 * Math.abs(i) >= t && (s += i > 0 ? t : -t), parseFloat(s.toFixed(5))
+ },
+ _calculateNewMax: function () {
+ var e = this.options.max, t = this._valueMin(), i = this.options.step, s = Math.floor(+(e - t).toFixed(this._precision()) / i) * i;
+ e = s + t, this.max = parseFloat(e.toFixed(this._precision()))
+ },
+ _precision: function () {
+ var e = this._precisionOf(this.options.step);
+ return null !== this.options.min && (e = Math.max(e, this._precisionOf(this.options.min))), e
+ },
+ _precisionOf: function (e) {
+ var t = "" + e, i = t.indexOf(".");
+ return -1 === i ? 0 : t.length - i - 1
+ },
+ _valueMin: function () {
+ return this.options.min
+ },
+ _valueMax: function () {
+ return this.max
+ },
+ _refreshValue: function () {
+ var t, i, s, n, a, o = this.options.range, r = this.options, h = this, l = this._animateOff ? !1 : r.animate, u = {};
+ this.options.values && this.options.values.length ? this.handles.each(function (s) {
+ i = 100 * ((h.values(s) - h._valueMin()) / (h._valueMax() - h._valueMin())), u["horizontal" === h.orientation ? "left" : "bottom"] = i + "%", e(this).stop(1, 1)[l ? "animate" : "css"](u, r.animate), h.options.range === !0 && ("horizontal" === h.orientation ? (0 === s && h.range.stop(1, 1)[l ? "animate" : "css"]({left: i + "%"}, r.animate), 1 === s && h.range[l ? "animate" : "css"]({width: i - t + "%"}, {
+ queue: !1,
+ duration: r.animate
+ })) : (0 === s && h.range.stop(1, 1)[l ? "animate" : "css"]({bottom: i + "%"}, r.animate), 1 === s && h.range[l ? "animate" : "css"]({height: i - t + "%"}, {
+ queue: !1,
+ duration: r.animate
+ }))), t = i
+ }) : (s = this.value(), n = this._valueMin(), a = this._valueMax(), i = a !== n ? 100 * ((s - n) / (a - n)) : 0, u["horizontal" === this.orientation ? "left" : "bottom"] = i + "%", this.handle.stop(1, 1)[l ? "animate" : "css"](u, r.animate), "min" === o && "horizontal" === this.orientation && this.range.stop(1, 1)[l ? "animate" : "css"]({width: i + "%"}, r.animate), "max" === o && "horizontal" === this.orientation && this.range[l ? "animate" : "css"]({width: 100 - i + "%"}, {
+ queue: !1,
+ duration: r.animate
+ }), "min" === o && "vertical" === this.orientation && this.range.stop(1, 1)[l ? "animate" : "css"]({height: i + "%"}, r.animate), "max" === o && "vertical" === this.orientation && this.range[l ? "animate" : "css"]({height: 100 - i + "%"}, {
+ queue: !1,
+ duration: r.animate
+ }))
+ },
+ _handleEvents: {
+ keydown: function (t) {
+ var i, s, n, a, o = e(t.target).data("ui-slider-handle-index");
+ switch (t.keyCode) {
+ case e.ui.keyCode.HOME:
+ case e.ui.keyCode.END:
+ case e.ui.keyCode.PAGE_UP:
+ case e.ui.keyCode.PAGE_DOWN:
+ case e.ui.keyCode.UP:
+ case e.ui.keyCode.RIGHT:
+ case e.ui.keyCode.DOWN:
+ case e.ui.keyCode.LEFT:
+ if (t.preventDefault(), !this._keySliding && (this._keySliding = !0, e(t.target).addClass("ui-state-active"), i = this._start(t, o), i === !1))return
+ }
+ switch (a = this.options.step, s = n = this.options.values && this.options.values.length ? this.values(o) : this.value(), t.keyCode) {
+ case e.ui.keyCode.HOME:
+ n = this._valueMin();
+ break;
+ case e.ui.keyCode.END:
+ n = this._valueMax();
+ break;
+ case e.ui.keyCode.PAGE_UP:
+ n = this._trimAlignValue(s + (this._valueMax() - this._valueMin()) / this.numPages);
+ break;
+ case e.ui.keyCode.PAGE_DOWN:
+ n = this._trimAlignValue(s - (this._valueMax() - this._valueMin()) / this.numPages);
+ break;
+ case e.ui.keyCode.UP:
+ case e.ui.keyCode.RIGHT:
+ if (s === this._valueMax())return;
+ n = this._trimAlignValue(s + a);
+ break;
+ case e.ui.keyCode.DOWN:
+ case e.ui.keyCode.LEFT:
+ if (s === this._valueMin())return;
+ n = this._trimAlignValue(s - a)
+ }
+ this._slide(t, o, n)
+ }, keyup: function (t) {
+ var i = e(t.target).data("ui-slider-handle-index");
+ this._keySliding && (this._keySliding = !1, this._stop(t, i), this._change(t, i), e(t.target).removeClass("ui-state-active"))
+ }
+ }
+ }), e.widget("ui.spinner", {
+ version: "1.11.4",
+ defaultElement: "<input>",
+ widgetEventPrefix: "spin",
+ options: {
+ culture: null,
+ icons: {down: "ui-icon-triangle-1-s", up: "ui-icon-triangle-1-n"},
+ incremental: !0,
+ max: null,
+ min: null,
+ numberFormat: null,
+ page: 10,
+ step: 1,
+ change: null,
+ spin: null,
+ start: null,
+ stop: null
+ },
+ _create: function () {
+ this._setOption("max", this.options.max), this._setOption("min", this.options.min), this._setOption("step", this.options.step), "" !== this.value() && this._value(this.element.val(), !0), this._draw(), this._on(this._events), this._refresh(), this._on(this.window, {
+ beforeunload: function () {
+ this.element.removeAttr("autocomplete")
+ }
+ })
+ },
+ _getCreateOptions: function () {
+ var t = {}, i = this.element;
+ return e.each(["min", "max", "step"], function (e, s) {
+ var n = i.attr(s);
+ void 0 !== n && n.length && (t[s] = n)
+ }), t
+ },
+ _events: {
+ keydown: function (e) {
+ this._start(e) && this._keydown(e) && e.preventDefault()
+ }, keyup: "_stop", focus: function () {
+ this.previous = this.element.val()
+ }, blur: function (e) {
+ return this.cancelBlur ? (delete this.cancelBlur, void 0) : (this._stop(), this._refresh(), this.previous !== this.element.val() && this._trigger("change", e), void 0)
+ }, mousewheel: function (e, t) {
+ if (t) {
+ if (!this.spinning && !this._start(e))return !1;
+ this._spin((t > 0 ? 1 : -1) * this.options.step, e), clearTimeout(this.mousewheelTimer), this.mousewheelTimer = this._delay(function () {
+ this.spinning && this._stop(e)
+ }, 100), e.preventDefault()
+ }
+ }, "mousedown .ui-spinner-button": function (t) {
+ function i() {
+ var e = this.element[0] === this.document[0].activeElement;
+ e || (this.element.focus(), this.previous = s, this._delay(function () {
+ this.previous = s
+ }))
+ }
+
+ var s;
+ s = this.element[0] === this.document[0].activeElement ? this.previous : this.element.val(), t.preventDefault(), i.call(this), this.cancelBlur = !0, this._delay(function () {
+ delete this.cancelBlur, i.call(this)
+ }), this._start(t) !== !1 && this._repeat(null, e(t.currentTarget).hasClass("ui-spinner-up") ? 1 : -1, t)
+ }, "mouseup .ui-spinner-button": "_stop", "mouseenter .ui-spinner-button": function (t) {
+ return e(t.currentTarget).hasClass("ui-state-active") ? this._start(t) === !1 ? !1 : (this._repeat(null, e(t.currentTarget).hasClass("ui-spinner-up") ? 1 : -1, t), void 0) : void 0
+ }, "mouseleave .ui-spinner-button": "_stop"
+ },
+ _draw: function () {
+ var e = this.uiSpinner = this.element.addClass("ui-spinner-input").attr("autocomplete", "off").wrap(this._uiSpinnerHtml()).parent().append(this._buttonHtml());
+ this.element.attr("role", "spinbutton"), this.buttons = e.find(".ui-spinner-button").attr("tabIndex", -1).button().removeClass("ui-corner-all"), this.buttons.height() > Math.ceil(.5 * e.height()) && e.height() > 0 && e.height(e.height()), this.options.disabled && this.disable()
+ },
+ _keydown: function (t) {
+ var i = this.options, s = e.ui.keyCode;
+ switch (t.keyCode) {
+ case s.UP:
+ return this._repeat(null, 1, t), !0;
+ case s.DOWN:
+ return this._repeat(null, -1, t), !0;
+ case s.PAGE_UP:
+ return this._repeat(null, i.page, t), !0;
+ case s.PAGE_DOWN:
+ return this._repeat(null, -i.page, t), !0
+ }
+ return !1
+ },
+ _uiSpinnerHtml: function () {
+ return "<span class='ui-spinner ui-widget ui-widget-content ui-corner-all'></span>"
+ },
+ _buttonHtml: function () {
+ return "<a class='ui-spinner-button ui-spinner-up ui-corner-tr'><span class='ui-icon " + this.options.icons.up + "'>▲</span>" + "</a>" + "<a class='ui-spinner-button ui-spinner-down ui-corner-br'>" + "<span class='ui-icon " + this.options.icons.down + "'>▼</span>" + "</a>"
+ },
+ _start: function (e) {
+ return this.spinning || this._trigger("start", e) !== !1 ? (this.counter || (this.counter = 1), this.spinning = !0, !0) : !1
+ },
+ _repeat: function (e, t, i) {
+ e = e || 500, clearTimeout(this.timer), this.timer = this._delay(function () {
+ this._repeat(40, t, i)
+ }, e), this._spin(t * this.options.step, i)
+ },
+ _spin: function (e, t) {
+ var i = this.value() || 0;
+ this.counter || (this.counter = 1), i = this._adjustValue(i + e * this._increment(this.counter)), this.spinning && this._trigger("spin", t, {value: i}) === !1 || (this._value(i), this.counter++)
+ },
+ _increment: function (t) {
+ var i = this.options.incremental;
+ return i ? e.isFunction(i) ? i(t) : Math.floor(t * t * t / 5e4 - t * t / 500 + 17 * t / 200 + 1) : 1
+ },
+ _precision: function () {
+ var e = this._precisionOf(this.options.step);
+ return null !== this.options.min && (e = Math.max(e, this._precisionOf(this.options.min))), e
+ },
+ _precisionOf: function (e) {
+ var t = "" + e, i = t.indexOf(".");
+ return -1 === i ? 0 : t.length - i - 1
+ },
+ _adjustValue: function (e) {
+ var t, i, s = this.options;
+ return t = null !== s.min ? s.min : 0, i = e - t, i = Math.round(i / s.step) * s.step, e = t + i, e = parseFloat(e.toFixed(this._precision())), null !== s.max && e > s.max ? s.max : null !== s.min && s.min > e ? s.min : e
+ },
+ _stop: function (e) {
+ this.spinning && (clearTimeout(this.timer), clearTimeout(this.mousewheelTimer), this.counter = 0, this.spinning = !1, this._trigger("stop", e))
+ },
+ _setOption: function (e, t) {
+ if ("culture" === e || "numberFormat" === e) {
+ var i = this._parse(this.element.val());
+ return this.options[e] = t, this.element.val(this._format(i)), void 0
+ }
+ ("max" === e || "min" === e || "step" === e) && "string" == typeof t && (t = this._parse(t)), "icons" === e && (this.buttons.first().find(".ui-icon").removeClass(this.options.icons.up).addClass(t.up), this.buttons.last().find(".ui-icon").removeClass(this.options.icons.down).addClass(t.down)), this._super(e, t), "disabled" === e && (this.widget().toggleClass("ui-state-disabled", !!t), this.element.prop("disabled", !!t), this.buttons.button(t ? "disable" : "enable"))
+ },
+ _setOptions: h(function (e) {
+ this._super(e)
+ }),
+ _parse: function (e) {
+ return "string" == typeof e && "" !== e && (e = window.Globalize && this.options.numberFormat ? Globalize.parseFloat(e, 10, this.options.culture) : +e), "" === e || isNaN(e) ? null : e
+ },
+ _format: function (e) {
+ return "" === e ? "" : window.Globalize && this.options.numberFormat ? Globalize.format(e, this.options.numberFormat, this.options.culture) : e
+ },
+ _refresh: function () {
+ this.element.attr({
+ "aria-valuemin": this.options.min,
+ "aria-valuemax": this.options.max,
+ "aria-valuenow": this._parse(this.element.val())
+ })
+ },
+ isValid: function () {
+ var e = this.value();
+ return null === e ? !1 : e === this._adjustValue(e)
+ },
+ _value: function (e, t) {
+ var i;
+ "" !== e && (i = this._parse(e), null !== i && (t || (i = this._adjustValue(i)), e = this._format(i))), this.element.val(e), this._refresh()
+ },
+ _destroy: function () {
+ this.element.removeClass("ui-spinner-input").prop("disabled", !1).removeAttr("autocomplete").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"), this.uiSpinner.replaceWith(this.element)
+ },
+ stepUp: h(function (e) {
+ this._stepUp(e)
+ }),
+ _stepUp: function (e) {
+ this._start() && (this._spin((e || 1) * this.options.step), this._stop())
+ },
+ stepDown: h(function (e) {
+ this._stepDown(e)
+ }),
+ _stepDown: function (e) {
+ this._start() && (this._spin((e || 1) * -this.options.step), this._stop())
+ },
+ pageUp: h(function (e) {
+ this._stepUp((e || 1) * this.options.page)
+ }),
+ pageDown: h(function (e) {
+ this._stepDown((e || 1) * this.options.page)
+ }),
+ value: function (e) {
+ return arguments.length ? (h(this._value).call(this, e), void 0) : this._parse(this.element.val())
+ },
+ widget: function () {
+ return this.uiSpinner
+ }
+ }), e.widget("ui.tabs", {
+ version: "1.11.4",
+ delay: 300,
+ options: {
+ active: null,
+ collapsible: !1,
+ event: "click",
+ heightStyle: "content",
+ hide: null,
+ show: null,
+ activate: null,
+ beforeActivate: null,
+ beforeLoad: null,
+ load: null
+ },
+ _isLocal: function () {
+ var e = /#.*$/;
+ return function (t) {
+ var i, s;
+ t = t.cloneNode(!1), i = t.href.replace(e, ""), s = location.href.replace(e, "");
+ try {
+ i = decodeURIComponent(i)
+ } catch (n) {
+ }
+ try {
+ s = decodeURIComponent(s)
+ } catch (n) {
+ }
+ return t.hash.length > 1 && i === s
+ }
+ }(),
+ _create: function () {
+ var t = this, i = this.options;
+ this.running = !1, this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all").toggleClass("ui-tabs-collapsible", i.collapsible), this._processTabs(), i.active = this._initialActive(), e.isArray(i.disabled) && (i.disabled = e.unique(i.disabled.concat(e.map(this.tabs.filter(".ui-state-disabled"), function (e) {
+ return t.tabs.index(e)
+ }))).sort()), this.active = this.options.active !== !1 && this.anchors.length ? this._findActive(i.active) : e(), this._refresh(), this.active.length && this.load(i.active)
+ },
+ _initialActive: function () {
+ var t = this.options.active, i = this.options.collapsible, s = location.hash.substring(1);
+ return null === t && (s && this.tabs.each(function (i, n) {
+ return e(n).attr("aria-controls") === s ? (t = i, !1) : void 0
+ }), null === t && (t = this.tabs.index(this.tabs.filter(".ui-tabs-active"))), (null === t || -1 === t) && (t = this.tabs.length ? 0 : !1)), t !== !1 && (t = this.tabs.index(this.tabs.eq(t)), -1 === t && (t = i ? !1 : 0)), !i && t === !1 && this.anchors.length && (t = 0), t
+ },
+ _getCreateEventData: function () {
+ return {tab: this.active, panel: this.active.length ? this._getPanelForTab(this.active) : e()}
+ },
+ _tabKeydown: function (t) {
+ var i = e(this.document[0].activeElement).closest("li"), s = this.tabs.index(i), n = !0;
+ if (!this._handlePageNav(t)) {
+ switch (t.keyCode) {
+ case e.ui.keyCode.RIGHT:
+ case e.ui.keyCode.DOWN:
+ s++;
+ break;
+ case e.ui.keyCode.UP:
+ case e.ui.keyCode.LEFT:
+ n = !1, s--;
+ break;
+ case e.ui.keyCode.END:
+ s = this.anchors.length - 1;
+ break;
+ case e.ui.keyCode.HOME:
+ s = 0;
+ break;
+ case e.ui.keyCode.SPACE:
+ return t.preventDefault(), clearTimeout(this.activating), this._activate(s), void 0;
+ case e.ui.keyCode.ENTER:
+ return t.preventDefault(), clearTimeout(this.activating), this._activate(s === this.options.active ? !1 : s), void 0;
+ default:
+ return
+ }
+ t.preventDefault(), clearTimeout(this.activating), s = this._focusNextTab(s, n), t.ctrlKey || t.metaKey || (i.attr("aria-selected", "false"), this.tabs.eq(s).attr("aria-selected", "true"), this.activating = this._delay(function () {
+ this.option("active", s)
+ }, this.delay))
+ }
+ },
+ _panelKeydown: function (t) {
+ this._handlePageNav(t) || t.ctrlKey && t.keyCode === e.ui.keyCode.UP && (t.preventDefault(), this.active.focus())
+ },
+ _handlePageNav: function (t) {
+ return t.altKey && t.keyCode === e.ui.keyCode.PAGE_UP ? (this._activate(this._focusNextTab(this.options.active - 1, !1)), !0) : t.altKey && t.keyCode === e.ui.keyCode.PAGE_DOWN ? (this._activate(this._focusNextTab(this.options.active + 1, !0)), !0) : void 0
+ },
+ _findNextTab: function (t, i) {
+ function s() {
+ return t > n && (t = 0), 0 > t && (t = n), t
+ }
+
+ for (var n = this.tabs.length - 1; -1 !== e.inArray(s(), this.options.disabled);)t = i ? t + 1 : t - 1;
+ return t
+ },
+ _focusNextTab: function (e, t) {
+ return e = this._findNextTab(e, t), this.tabs.eq(e).focus(), e
+ },
+ _setOption: function (e, t) {
+ return "active" === e ? (this._activate(t), void 0) : "disabled" === e ? (this._setupDisabled(t), void 0) : (this._super(e, t), "collapsible" === e && (this.element.toggleClass("ui-tabs-collapsible", t), t || this.options.active !== !1 || this._activate(0)), "event" === e && this._setupEvents(t), "heightStyle" === e && this._setupHeightStyle(t), void 0)
+ },
+ _sanitizeSelector: function (e) {
+ return e ? e.replace(/[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, "\\$&") : ""
+ },
+ refresh: function () {
+ var t = this.options, i = this.tablist.children(":has(a[href])");
+ t.disabled = e.map(i.filter(".ui-state-disabled"), function (e) {
+ return i.index(e)
+ }), this._processTabs(), t.active !== !1 && this.anchors.length ? this.active.length && !e.contains(this.tablist[0], this.active[0]) ? this.tabs.length === t.disabled.length ? (t.active = !1, this.active = e()) : this._activate(this._findNextTab(Math.max(0, t.active - 1), !1)) : t.active = this.tabs.index(this.active) : (t.active = !1, this.active = e()), this._refresh()
+ },
+ _refresh: function () {
+ this._setupDisabled(this.options.disabled), this._setupEvents(this.options.event), this._setupHeightStyle(this.options.heightStyle), this.tabs.not(this.active).attr({
+ "aria-selected": "false",
+ "aria-expanded": "false",
+ tabIndex: -1
+ }), this.panels.not(this._getPanelForTab(this.active)).hide().attr({"aria-hidden": "true"}), this.active.length ? (this.active.addClass("ui-tabs-active ui-state-active").attr({
+ "aria-selected": "true",
+ "aria-expanded": "true",
+ tabIndex: 0
+ }), this._getPanelForTab(this.active).show().attr({"aria-hidden": "false"})) : this.tabs.eq(0).attr("tabIndex", 0)
+ },
+ _processTabs: function () {
+ var t = this, i = this.tabs, s = this.anchors, n = this.panels;
+ this.tablist = this._getList().addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all").attr("role", "tablist").delegate("> li", "mousedown" + this.eventNamespace, function (t) {
+ e(this).is(".ui-state-disabled") && t.preventDefault()
+ }).delegate(".ui-tabs-anchor", "focus" + this.eventNamespace, function () {
+ e(this).closest("li").is(".ui-state-disabled") && this.blur()
+ }), this.tabs = this.tablist.find("> li:has(a[href])").addClass("ui-state-default ui-corner-top").attr({
+ role: "tab",
+ tabIndex: -1
+ }), this.anchors = this.tabs.map(function () {
+ return e("a", this)[0]
+ }).addClass("ui-tabs-anchor").attr({
+ role: "presentation",
+ tabIndex: -1
+ }), this.panels = e(), this.anchors.each(function (i, s) {
+ var n, a, o, r = e(s).uniqueId().attr("id"), h = e(s).closest("li"), l = h.attr("aria-controls");
+ t._isLocal(s) ? (n = s.hash, o = n.substring(1), a = t.element.find(t._sanitizeSelector(n))) : (o = h.attr("aria-controls") || e({}).uniqueId()[0].id, n = "#" + o, a = t.element.find(n), a.length || (a = t._createPanel(o), a.insertAfter(t.panels[i - 1] || t.tablist)), a.attr("aria-live", "polite")), a.length && (t.panels = t.panels.add(a)), l && h.data("ui-tabs-aria-controls", l), h.attr({
+ "aria-controls": o,
+ "aria-labelledby": r
+ }), a.attr("aria-labelledby", r)
+ }), this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").attr("role", "tabpanel"), i && (this._off(i.not(this.tabs)), this._off(s.not(this.anchors)), this._off(n.not(this.panels)))
+ },
+ _getList: function () {
+ return this.tablist || this.element.find("ol,ul").eq(0)
+ },
+ _createPanel: function (t) {
+ return e("<div>").attr("id", t).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").data("ui-tabs-destroy", !0)
+ },
+ _setupDisabled: function (t) {
+ e.isArray(t) && (t.length ? t.length === this.anchors.length && (t = !0) : t = !1);
+ for (var i, s = 0; i = this.tabs[s]; s++)t === !0 || -1 !== e.inArray(s, t) ? e(i).addClass("ui-state-disabled").attr("aria-disabled", "true") : e(i).removeClass("ui-state-disabled").removeAttr("aria-disabled");
+ this.options.disabled = t
+ },
+ _setupEvents: function (t) {
+ var i = {};
+ t && e.each(t.split(" "), function (e, t) {
+ i[t] = "_eventHandler"
+ }), this._off(this.anchors.add(this.tabs).add(this.panels)), this._on(!0, this.anchors, {
+ click: function (e) {
+ e.preventDefault()
+ }
+ }), this._on(this.anchors, i), this._on(this.tabs, {keydown: "_tabKeydown"}), this._on(this.panels, {keydown: "_panelKeydown"}), this._focusable(this.tabs), this._hoverable(this.tabs)
+ },
+ _setupHeightStyle: function (t) {
+ var i, s = this.element.parent();
+ "fill" === t ? (i = s.height(), i -= this.element.outerHeight() - this.element.height(), this.element.siblings(":visible").each(function () {
+ var t = e(this), s = t.css("position");
+ "absolute" !== s && "fixed" !== s && (i -= t.outerHeight(!0))
+ }), this.element.children().not(this.panels).each(function () {
+ i -= e(this).outerHeight(!0)
+ }), this.panels.each(function () {
+ e(this).height(Math.max(0, i - e(this).innerHeight() + e(this).height()))
+ }).css("overflow", "auto")) : "auto" === t && (i = 0, this.panels.each(function () {
+ i = Math.max(i, e(this).height("").height())
+ }).height(i))
+ },
+ _eventHandler: function (t) {
+ var i = this.options, s = this.active, n = e(t.currentTarget), a = n.closest("li"), o = a[0] === s[0], r = o && i.collapsible, h = r ? e() : this._getPanelForTab(a), l = s.length ? this._getPanelForTab(s) : e(), u = {
+ oldTab: s,
+ oldPanel: l,
+ newTab: r ? e() : a,
+ newPanel: h
+ };
+ t.preventDefault(), a.hasClass("ui-state-disabled") || a.hasClass("ui-tabs-loading") || this.running || o && !i.collapsible || this._trigger("beforeActivate", t, u) === !1 || (i.active = r ? !1 : this.tabs.index(a), this.active = o ? e() : a, this.xhr && this.xhr.abort(), l.length || h.length || e.error("jQuery UI Tabs: Mismatching fragment identifier."), h.length && this.load(this.tabs.index(a), t), this._toggle(t, u))
+ },
+ _toggle: function (t, i) {
+ function s() {
+ a.running = !1, a._trigger("activate", t, i)
+ }
+
+ function n() {
+ i.newTab.closest("li").addClass("ui-tabs-active ui-state-active"), o.length && a.options.show ? a._show(o, a.options.show, s) : (o.show(), s())
+ }
+
+ var a = this, o = i.newPanel, r = i.oldPanel;
+ this.running = !0, r.length && this.options.hide ? this._hide(r, this.options.hide, function () {
+ i.oldTab.closest("li").removeClass("ui-tabs-active ui-state-active"), n()
+ }) : (i.oldTab.closest("li").removeClass("ui-tabs-active ui-state-active"), r.hide(), n()), r.attr("aria-hidden", "true"), i.oldTab.attr({
+ "aria-selected": "false",
+ "aria-expanded": "false"
+ }), o.length && r.length ? i.oldTab.attr("tabIndex", -1) : o.length && this.tabs.filter(function () {
+ return 0 === e(this).attr("tabIndex")
+ }).attr("tabIndex", -1), o.attr("aria-hidden", "false"), i.newTab.attr({
+ "aria-selected": "true",
+ "aria-expanded": "true",
+ tabIndex: 0
+ })
+ },
+ _activate: function (t) {
+ var i, s = this._findActive(t);
+ s[0] !== this.active[0] && (s.length || (s = this.active), i = s.find(".ui-tabs-anchor")[0], this._eventHandler({
+ target: i,
+ currentTarget: i,
+ preventDefault: e.noop
+ }))
+ },
+ _findActive: function (t) {
+ return t === !1 ? e() : this.tabs.eq(t)
+ },
+ _getIndex: function (e) {
+ return "string" == typeof e && (e = this.anchors.index(this.anchors.filter("[href$='" + e + "']"))), e
+ },
+ _destroy: function () {
+ this.xhr && this.xhr.abort(), this.element.removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible"), this.tablist.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all").removeAttr("role"), this.anchors.removeClass("ui-tabs-anchor").removeAttr("role").removeAttr("tabIndex").removeUniqueId(), this.tablist.unbind(this.eventNamespace), this.tabs.add(this.panels).each(function () {
+ e.data(this, "ui-tabs-destroy") ? e(this).remove() : e(this).removeClass("ui-state-default ui-state-active ui-state-disabled ui-corner-top ui-corner-bottom ui-widget-content ui-tabs-active ui-tabs-panel").removeAttr("tabIndex").removeAttr("aria-live").removeAttr("aria-busy").removeAttr("aria-selected").removeAttr("aria-labelledby").removeAttr("aria-hidden").removeAttr("aria-expanded").removeAttr("role")
+ }), this.tabs.each(function () {
+ var t = e(this), i = t.data("ui-tabs-aria-controls");
+ i ? t.attr("aria-controls", i).removeData("ui-tabs-aria-controls") : t.removeAttr("aria-controls")
+ }), this.panels.show(), "content" !== this.options.heightStyle && this.panels.css("height", "")
+ },
+ enable: function (t) {
+ var i = this.options.disabled;
+ i !== !1 && (void 0 === t ? i = !1 : (t = this._getIndex(t), i = e.isArray(i) ? e.map(i, function (e) {
+ return e !== t ? e : null
+ }) : e.map(this.tabs, function (e, i) {
+ return i !== t ? i : null
+ })), this._setupDisabled(i))
+ },
+ disable: function (t) {
+ var i = this.options.disabled;
+ if (i !== !0) {
+ if (void 0 === t)i = !0; else {
+ if (t = this._getIndex(t), -1 !== e.inArray(t, i))return;
+ i = e.isArray(i) ? e.merge([t], i).sort() : [t]
+ }
+ this._setupDisabled(i)
+ }
+ },
+ load: function (t, i) {
+ t = this._getIndex(t);
+ var s = this, n = this.tabs.eq(t), a = n.find(".ui-tabs-anchor"), o = this._getPanelForTab(n), r = {
+ tab: n,
+ panel: o
+ }, h = function (e, t) {
+ "abort" === t && s.panels.stop(!1, !0), n.removeClass("ui-tabs-loading"), o.removeAttr("aria-busy"), e === s.xhr && delete s.xhr
+ };
+ this._isLocal(a[0]) || (this.xhr = e.ajax(this._ajaxSettings(a, i, r)), this.xhr && "canceled" !== this.xhr.statusText && (n.addClass("ui-tabs-loading"), o.attr("aria-busy", "true"), this.xhr.done(function (e, t, n) {
+ setTimeout(function () {
+ o.html(e), s._trigger("load", i, r), h(n, t)
+ }, 1)
+ }).fail(function (e, t) {
+ setTimeout(function () {
+ h(e, t)
+ }, 1)
+ })))
+ },
+ _ajaxSettings: function (t, i, s) {
+ var n = this;
+ return {
+ url: t.attr("href"), beforeSend: function (t, a) {
+ return n._trigger("beforeLoad", i, e.extend({jqXHR: t, ajaxSettings: a}, s))
+ }
+ }
+ },
+ _getPanelForTab: function (t) {
+ var i = e(t).attr("aria-controls");
+ return this.element.find(this._sanitizeSelector("#" + i))
+ }
+ }), e.widget("ui.tooltip", {
+ version: "1.11.4", options: {
+ content: function () {
+ var t = e(this).attr("title") || "";
+ return e("<a>").text(t).html()
+ },
+ hide: !0,
+ items: "[title]:not([disabled])",
+ position: {my: "left top+15", at: "left bottom", collision: "flipfit flip"},
+ show: !0,
+ tooltipClass: null,
+ track: !1,
+ close: null,
+ open: null
+ }, _addDescribedBy: function (t, i) {
+ var s = (t.attr("aria-describedby") || "").split(/\s+/);
+ s.push(i), t.data("ui-tooltip-id", i).attr("aria-describedby", e.trim(s.join(" ")))
+ }, _removeDescribedBy: function (t) {
+ var i = t.data("ui-tooltip-id"), s = (t.attr("aria-describedby") || "").split(/\s+/), n = e.inArray(i, s);
+ -1 !== n && s.splice(n, 1), t.removeData("ui-tooltip-id"), s = e.trim(s.join(" ")), s ? t.attr("aria-describedby", s) : t.removeAttr("aria-describedby")
+ }, _create: function () {
+ this._on({
+ mouseover: "open",
+ focusin: "open"
+ }), this.tooltips = {}, this.parents = {}, this.options.disabled && this._disable(), this.liveRegion = e("<div>").attr({
+ role: "log",
+ "aria-live": "assertive",
+ "aria-relevant": "additions"
+ }).addClass("ui-helper-hidden-accessible").appendTo(this.document[0].body)
+ }, _setOption: function (t, i) {
+ var s = this;
+ return "disabled" === t ? (this[i ? "_disable" : "_enable"](), this.options[t] = i, void 0) : (this._super(t, i), "content" === t && e.each(this.tooltips, function (e, t) {
+ s._updateContent(t.element)
+ }), void 0)
+ }, _disable: function () {
+ var t = this;
+ e.each(this.tooltips, function (i, s) {
+ var n = e.Event("blur");
+ n.target = n.currentTarget = s.element[0], t.close(n, !0)
+ }), this.element.find(this.options.items).addBack().each(function () {
+ var t = e(this);
+ t.is("[title]") && t.data("ui-tooltip-title", t.attr("title")).removeAttr("title")
+ })
+ }, _enable: function () {
+ this.element.find(this.options.items).addBack().each(function () {
+ var t = e(this);
+ t.data("ui-tooltip-title") && t.attr("title", t.data("ui-tooltip-title"))
+ })
+ }, open: function (t) {
+ var i = this, s = e(t ? t.target : this.element).closest(this.options.items);
+ s.length && !s.data("ui-tooltip-id") && (s.attr("title") && s.data("ui-tooltip-title", s.attr("title")), s.data("ui-tooltip-open", !0), t && "mouseover" === t.type && s.parents().each(function () {
+ var t, s = e(this);
+ s.data("ui-tooltip-open") && (t = e.Event("blur"), t.target = t.currentTarget = this, i.close(t, !0)), s.attr("title") && (s.uniqueId(), i.parents[this.id] = {
+ element: this,
+ title: s.attr("title")
+ }, s.attr("title", ""))
+ }), this._registerCloseHandlers(t, s), this._updateContent(s, t))
+ }, _updateContent: function (e, t) {
+ var i, s = this.options.content, n = this, a = t ? t.type : null;
+ return "string" == typeof s ? this._open(t, e, s) : (i = s.call(e[0], function (i) {
+ n._delay(function () {
+ e.data("ui-tooltip-open") && (t && (t.type = a), this._open(t, e, i))
+ })
+ }), i && this._open(t, e, i), void 0)
+ }, _open: function (t, i, s) {
+ function n(e) {
+ l.of = e, o.is(":hidden") || o.position(l)
+ }
+
+ var a, o, r, h, l = e.extend({}, this.options.position);
+ if (s) {
+ if (a = this._find(i))return a.tooltip.find(".ui-tooltip-content").html(s), void 0;
+ i.is("[title]") && (t && "mouseover" === t.type ? i.attr("title", "") : i.removeAttr("title")), a = this._tooltip(i), o = a.tooltip, this._addDescribedBy(i, o.attr("id")), o.find(".ui-tooltip-content").html(s), this.liveRegion.children().hide(), s.clone ? (h = s.clone(), h.removeAttr("id").find("[id]").removeAttr("id")) : h = s, e("<div>").html(h).appendTo(this.liveRegion), this.options.track && t && /^mouse/.test(t.type) ? (this._on(this.document, {mousemove: n}), n(t)) : o.position(e.extend({of: i}, this.options.position)), o.hide(), this._show(o, this.options.show), this.options.show && this.options.show.delay && (r = this.delayedShow = setInterval(function () {
+ o.is(":visible") && (n(l.of), clearInterval(r))
+ }, e.fx.interval)), this._trigger("open", t, {tooltip: o})
+ }
+ }, _registerCloseHandlers: function (t, i) {
+ var s = {
+ keyup: function (t) {
+ if (t.keyCode === e.ui.keyCode.ESCAPE) {
+ var s = e.Event(t);
+ s.currentTarget = i[0], this.close(s, !0)
+ }
+ }
+ };
+ i[0] !== this.element[0] && (s.remove = function () {
+ this._removeTooltip(this._find(i).tooltip)
+ }), t && "mouseover" !== t.type || (s.mouseleave = "close"), t && "focusin" !== t.type || (s.focusout = "close"), this._on(!0, i, s)
+ }, close: function (t) {
+ var i, s = this, n = e(t ? t.currentTarget : this.element), a = this._find(n);
+ return a ? (i = a.tooltip, a.closing || (clearInterval(this.delayedShow), n.data("ui-tooltip-title") && !n.attr("title") && n.attr("title", n.data("ui-tooltip-title")), this._removeDescribedBy(n), a.hiding = !0, i.stop(!0), this._hide(i, this.options.hide, function () {
+ s._removeTooltip(e(this))
+ }), n.removeData("ui-tooltip-open"), this._off(n, "mouseleave focusout keyup"), n[0] !== this.element[0] && this._off(n, "remove"), this._off(this.document, "mousemove"), t && "mouseleave" === t.type && e.each(this.parents, function (t, i) {
+ e(i.element).attr("title", i.title), delete s.parents[t]
+ }), a.closing = !0, this._trigger("close", t, {tooltip: i}), a.hiding || (a.closing = !1)), void 0) : (n.removeData("ui-tooltip-open"), void 0)
+ }, _tooltip: function (t) {
+ var i = e("<div>").attr("role", "tooltip").addClass("ui-tooltip ui-widget ui-corner-all ui-widget-content " + (this.options.tooltipClass || "")), s = i.uniqueId().attr("id");
+ return e("<div>").addClass("ui-tooltip-content").appendTo(i), i.appendTo(this.document[0].body), this.tooltips[s] = {
+ element: t,
+ tooltip: i
+ }
+ }, _find: function (e) {
+ var t = e.data("ui-tooltip-id");
+ return t ? this.tooltips[t] : null
+ }, _removeTooltip: function (e) {
+ e.remove(), delete this.tooltips[e.attr("id")]
+ }, _destroy: function () {
+ var t = this;
+ e.each(this.tooltips, function (i, s) {
+ var n = e.Event("blur"), a = s.element;
+ n.target = n.currentTarget = a[0], t.close(n, !0), e("#" + i).remove(), a.data("ui-tooltip-title") && (a.attr("title") || a.attr("title", a.data("ui-tooltip-title")), a.removeData("ui-tooltip-title"))
+ }), this.liveRegion.remove()
+ }
+ });
+ var y = "ui-effects-", b = e;
+ e.effects = {effect: {}}, function (e, t) {
+ function i(e, t, i) {
+ var s = d[t.type] || {};
+ return null == e ? i || !t.def ? null : t.def : (e = s.floor ? ~~e : parseFloat(e), isNaN(e) ? t.def : s.mod ? (e + s.mod) % s.mod : 0 > e ? 0 : e > s.max ? s.max : e)
+ }
+
+ function s(i) {
+ var s = l(), n = s._rgba = [];
+ return i = i.toLowerCase(), f(h, function (e, a) {
+ var o, r = a.re.exec(i), h = r && a.parse(r), l = a.space || "rgba";
+ return h ? (o = s[l](h), s[u[l].cache] = o[u[l].cache], n = s._rgba = o._rgba, !1) : t
+ }), n.length ? ("0,0,0,0" === n.join() && e.extend(n, a.transparent), s) : a[i]
+ }
+
+ function n(e, t, i) {
+ return i = (i + 1) % 1, 1 > 6 * i ? e + 6 * (t - e) * i : 1 > 2 * i ? t : 2 > 3 * i ? e + 6 * (t - e) * (2 / 3 - i) : e
+ }
+
+ var a, o = "backgroundColor borderBottomColor borderLeftColor borderRightColor borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor", r = /^([\-+])=\s*(\d+\.?\d*)/, h = [{
+ re: /rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+ parse: function (e) {
+ return [e[1], e[2], e[3], e[4]]
+ }
+ }, {
+ re: /rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+ parse: function (e) {
+ return [2.55 * e[1], 2.55 * e[2], 2.55 * e[3], e[4]]
+ }
+ }, {
+ re: /#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/, parse: function (e) {
+ return [parseInt(e[1], 16), parseInt(e[2], 16), parseInt(e[3], 16)]
+ }
+ }, {
+ re: /#([a-f0-9])([a-f0-9])([a-f0-9])/, parse: function (e) {
+ return [parseInt(e[1] + e[1], 16), parseInt(e[2] + e[2], 16), parseInt(e[3] + e[3], 16)]
+ }
+ }, {
+ re: /hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+ space: "hsla",
+ parse: function (e) {
+ return [e[1], e[2] / 100, e[3] / 100, e[4]]
+ }
+ }], l = e.Color = function (t, i, s, n) {
+ return new e.Color.fn.parse(t, i, s, n)
+ }, u = {
+ rgba: {
+ props: {
+ red: {idx: 0, type: "byte"},
+ green: {idx: 1, type: "byte"},
+ blue: {idx: 2, type: "byte"}
+ }
+ },
+ hsla: {
+ props: {
+ hue: {idx: 0, type: "degrees"},
+ saturation: {idx: 1, type: "percent"},
+ lightness: {idx: 2, type: "percent"}
+ }
+ }
+ }, d = {
+ "byte": {floor: !0, max: 255},
+ percent: {max: 1},
+ degrees: {mod: 360, floor: !0}
+ }, c = l.support = {}, p = e("<p>")[0], f = e.each;
+ p.style.cssText = "background-color:rgba(1,1,1,.5)", c.rgba = p.style.backgroundColor.indexOf("rgba") > -1, f(u, function (e, t) {
+ t.cache = "_" + e, t.props.alpha = {idx: 3, type: "percent", def: 1}
+ }), l.fn = e.extend(l.prototype, {
+ parse: function (n, o, r, h) {
+ if (n === t)return this._rgba = [null, null, null, null], this;
+ (n.jquery || n.nodeType) && (n = e(n).css(o), o = t);
+ var d = this, c = e.type(n), p = this._rgba = [];
+ return o !== t && (n = [n, o, r, h], c = "array"), "string" === c ? this.parse(s(n) || a._default) : "array" === c ? (f(u.rgba.props, function (e, t) {
+ p[t.idx] = i(n[t.idx], t)
+ }), this) : "object" === c ? (n instanceof l ? f(u, function (e, t) {
+ n[t.cache] && (d[t.cache] = n[t.cache].slice())
+ }) : f(u, function (t, s) {
+ var a = s.cache;
+ f(s.props, function (e, t) {
+ if (!d[a] && s.to) {
+ if ("alpha" === e || null == n[e])return;
+ d[a] = s.to(d._rgba)
+ }
+ d[a][t.idx] = i(n[e], t, !0)
+ }), d[a] && 0 > e.inArray(null, d[a].slice(0, 3)) && (d[a][3] = 1, s.from && (d._rgba = s.from(d[a])))
+ }), this) : t
+ }, is: function (e) {
+ var i = l(e), s = !0, n = this;
+ return f(u, function (e, a) {
+ var o, r = i[a.cache];
+ return r && (o = n[a.cache] || a.to && a.to(n._rgba) || [], f(a.props, function (e, i) {
+ return null != r[i.idx] ? s = r[i.idx] === o[i.idx] : t
+ })), s
+ }), s
+ }, _space: function () {
+ var e = [], t = this;
+ return f(u, function (i, s) {
+ t[s.cache] && e.push(i)
+ }), e.pop()
+ }, transition: function (e, t) {
+ var s = l(e), n = s._space(), a = u[n], o = 0 === this.alpha() ? l("transparent") : this, r = o[a.cache] || a.to(o._rgba), h = r.slice();
+ return s = s[a.cache], f(a.props, function (e, n) {
+ var a = n.idx, o = r[a], l = s[a], u = d[n.type] || {};
+ null !== l && (null === o ? h[a] = l : (u.mod && (l - o > u.mod / 2 ? o += u.mod : o - l > u.mod / 2 && (o -= u.mod)), h[a] = i((l - o) * t + o, n)))
+ }), this[n](h)
+ }, blend: function (t) {
+ if (1 === this._rgba[3])return this;
+ var i = this._rgba.slice(), s = i.pop(), n = l(t)._rgba;
+ return l(e.map(i, function (e, t) {
+ return (1 - s) * n[t] + s * e
+ }))
+ }, toRgbaString: function () {
+ var t = "rgba(", i = e.map(this._rgba, function (e, t) {
+ return null == e ? t > 2 ? 1 : 0 : e
+ });
+ return 1 === i[3] && (i.pop(), t = "rgb("), t + i.join() + ")"
+ }, toHslaString: function () {
+ var t = "hsla(", i = e.map(this.hsla(), function (e, t) {
+ return null == e && (e = t > 2 ? 1 : 0), t && 3 > t && (e = Math.round(100 * e) + "%"), e
+ });
+ return 1 === i[3] && (i.pop(), t = "hsl("), t + i.join() + ")"
+ }, toHexString: function (t) {
+ var i = this._rgba.slice(), s = i.pop();
+ return t && i.push(~~(255 * s)), "#" + e.map(i, function (e) {
+ return e = (e || 0).toString(16), 1 === e.length ? "0" + e : e
+ }).join("")
+ }, toString: function () {
+ return 0 === this._rgba[3] ? "transparent" : this.toRgbaString()
+ }
+ }), l.fn.parse.prototype = l.fn, u.hsla.to = function (e) {
+ if (null == e[0] || null == e[1] || null == e[2])return [null, null, null, e[3]];
+ var t, i, s = e[0] / 255, n = e[1] / 255, a = e[2] / 255, o = e[3], r = Math.max(s, n, a), h = Math.min(s, n, a), l = r - h, u = r + h, d = .5 * u;
+ return t = h === r ? 0 : s === r ? 60 * (n - a) / l + 360 : n === r ? 60 * (a - s) / l + 120 : 60 * (s - n) / l + 240, i = 0 === l ? 0 : .5 >= d ? l / u : l / (2 - u), [Math.round(t) % 360, i, d, null == o ? 1 : o]
+ }, u.hsla.from = function (e) {
+ if (null == e[0] || null == e[1] || null == e[2])return [null, null, null, e[3]];
+ var t = e[0] / 360, i = e[1], s = e[2], a = e[3], o = .5 >= s ? s * (1 + i) : s + i - s * i, r = 2 * s - o;
+ return [Math.round(255 * n(r, o, t + 1 / 3)), Math.round(255 * n(r, o, t)), Math.round(255 * n(r, o, t - 1 / 3)), a]
+ }, f(u, function (s, n) {
+ var a = n.props, o = n.cache, h = n.to, u = n.from;
+ l.fn[s] = function (s) {
+ if (h && !this[o] && (this[o] = h(this._rgba)), s === t)return this[o].slice();
+ var n, r = e.type(s), d = "array" === r || "object" === r ? s : arguments, c = this[o].slice();
+ return f(a, function (e, t) {
+ var s = d["object" === r ? e : t.idx];
+ null == s && (s = c[t.idx]), c[t.idx] = i(s, t)
+ }), u ? (n = l(u(c)), n[o] = c, n) : l(c)
+ }, f(a, function (t, i) {
+ l.fn[t] || (l.fn[t] = function (n) {
+ var a, o = e.type(n), h = "alpha" === t ? this._hsla ? "hsla" : "rgba" : s, l = this[h](), u = l[i.idx];
+ return "undefined" === o ? u : ("function" === o && (n = n.call(this, u), o = e.type(n)), null == n && i.empty ? this : ("string" === o && (a = r.exec(n), a && (n = u + parseFloat(a[2]) * ("+" === a[1] ? 1 : -1))), l[i.idx] = n, this[h](l)))
+ })
+ })
+ }), l.hook = function (t) {
+ var i = t.split(" ");
+ f(i, function (t, i) {
+ e.cssHooks[i] = {
+ set: function (t, n) {
+ var a, o, r = "";
+ if ("transparent" !== n && ("string" !== e.type(n) || (a = s(n)))) {
+ if (n = l(a || n), !c.rgba && 1 !== n._rgba[3]) {
+ for (o = "backgroundColor" === i ? t.parentNode : t; ("" === r || "transparent" === r) && o && o.style;)try {
+ r = e.css(o, "backgroundColor"), o = o.parentNode
+ } catch (h) {
+ }
+ n = n.blend(r && "transparent" !== r ? r : "_default")
+ }
+ n = n.toRgbaString()
+ }
+ try {
+ t.style[i] = n
+ } catch (h) {
+ }
+ }
+ }, e.fx.step[i] = function (t) {
+ t.colorInit || (t.start = l(t.elem, i), t.end = l(t.end), t.colorInit = !0), e.cssHooks[i].set(t.elem, t.start.transition(t.end, t.pos))
+ }
+ })
+ }, l.hook(o), e.cssHooks.borderColor = {
+ expand: function (e) {
+ var t = {};
+ return f(["Top", "Right", "Bottom", "Left"], function (i, s) {
+ t["border" + s + "Color"] = e
+ }), t
+ }
+ }, a = e.Color.names = {
+ aqua: "#00ffff",
+ black: "#000000",
+ blue: "#0000ff",
+ fuchsia: "#ff00ff",
+ gray: "#808080",
+ green: "#008000",
+ lime: "#00ff00",
+ maroon: "#800000",
+ navy: "#000080",
+ olive: "#808000",
+ purple: "#800080",
+ red: "#ff0000",
+ silver: "#c0c0c0",
+ teal: "#008080",
+ white: "#ffffff",
+ yellow: "#ffff00",
+ transparent: [null, null, null, 0],
+ _default: "#ffffff"
+ }
+ }(b), function () {
+ function t(t) {
+ var i, s, n = t.ownerDocument.defaultView ? t.ownerDocument.defaultView.getComputedStyle(t, null) : t.currentStyle, a = {};
+ if (n && n.length && n[0] && n[n[0]])for (s = n.length; s--;)i = n[s], "string" == typeof n[i] && (a[e.camelCase(i)] = n[i]); else for (i in n)"string" == typeof n[i] && (a[i] = n[i]);
+ return a
+ }
+
+ function i(t, i) {
+ var s, a, o = {};
+ for (s in i)a = i[s], t[s] !== a && (n[s] || (e.fx.step[s] || !isNaN(parseFloat(a))) && (o[s] = a));
+ return o
+ }
+
+ var s = ["add", "remove", "toggle"], n = {
+ border: 1,
+ borderBottom: 1,
+ borderColor: 1,
+ borderLeft: 1,
+ borderRight: 1,
+ borderTop: 1,
+ borderWidth: 1,
+ margin: 1,
+ padding: 1
+ };
+ e.each(["borderLeftStyle", "borderRightStyle", "borderBottomStyle", "borderTopStyle"], function (t, i) {
+ e.fx.step[i] = function (e) {
+ ("none" !== e.end && !e.setAttr || 1 === e.pos && !e.setAttr) && (b.style(e.elem, i, e.end), e.setAttr = !0)
+ }
+ }), e.fn.addBack || (e.fn.addBack = function (e) {
+ return this.add(null == e ? this.prevObject : this.prevObject.filter(e))
+ }), e.effects.animateClass = function (n, a, o, r) {
+ var h = e.speed(a, o, r);
+ return this.queue(function () {
+ var a, o = e(this), r = o.attr("class") || "", l = h.children ? o.find("*").addBack() : o;
+ l = l.map(function () {
+ var i = e(this);
+ return {el: i, start: t(this)}
+ }), a = function () {
+ e.each(s, function (e, t) {
+ n[t] && o[t + "Class"](n[t])
+ })
+ }, a(), l = l.map(function () {
+ return this.end = t(this.el[0]), this.diff = i(this.start, this.end), this
+ }), o.attr("class", r), l = l.map(function () {
+ var t = this, i = e.Deferred(), s = e.extend({}, h, {
+ queue: !1, complete: function () {
+ i.resolve(t)
+ }
+ });
+ return this.el.animate(this.diff, s), i.promise()
+ }), e.when.apply(e, l.get()).done(function () {
+ a(), e.each(arguments, function () {
+ var t = this.el;
+ e.each(this.diff, function (e) {
+ t.css(e, "")
+ })
+ }), h.complete.call(o[0])
+ })
+ })
+ }, e.fn.extend({
+ addClass: function (t) {
+ return function (i, s, n, a) {
+ return s ? e.effects.animateClass.call(this, {add: i}, s, n, a) : t.apply(this, arguments)
+ }
+ }(e.fn.addClass), removeClass: function (t) {
+ return function (i, s, n, a) {
+ return arguments.length > 1 ? e.effects.animateClass.call(this, {remove: i}, s, n, a) : t.apply(this, arguments)
+ }
+ }(e.fn.removeClass), toggleClass: function (t) {
+ return function (i, s, n, a, o) {
+ return "boolean" == typeof s || void 0 === s ? n ? e.effects.animateClass.call(this, s ? {add: i} : {remove: i}, n, a, o) : t.apply(this, arguments) : e.effects.animateClass.call(this, {toggle: i}, s, n, a)
+ }
+ }(e.fn.toggleClass), switchClass: function (t, i, s, n, a) {
+ return e.effects.animateClass.call(this, {add: i, remove: t}, s, n, a)
+ }
+ })
+ }(), function () {
+ function t(t, i, s, n) {
+ return e.isPlainObject(t) && (i = t, t = t.effect), t = {effect: t}, null == i && (i = {}), e.isFunction(i) && (n = i, s = null, i = {}), ("number" == typeof i || e.fx.speeds[i]) && (n = s, s = i, i = {}), e.isFunction(s) && (n = s, s = null), i && e.extend(t, i), s = s || i.duration, t.duration = e.fx.off ? 0 : "number" == typeof s ? s : s in e.fx.speeds ? e.fx.speeds[s] : e.fx.speeds._default, t.complete = n || i.complete, t
+ }
+
+ function i(t) {
+ return !t || "number" == typeof t || e.fx.speeds[t] ? !0 : "string" != typeof t || e.effects.effect[t] ? e.isFunction(t) ? !0 : "object" != typeof t || t.effect ? !1 : !0 : !0
+ }
+
+ e.extend(e.effects, {
+ version: "1.11.4", save: function (e, t) {
+ for (var i = 0; t.length > i; i++)null !== t[i] && e.data(y + t[i], e[0].style[t[i]])
+ }, restore: function (e, t) {
+ var i, s;
+ for (s = 0; t.length > s; s++)null !== t[s] && (i = e.data(y + t[s]), void 0 === i && (i = ""), e.css(t[s], i))
+ }, setMode: function (e, t) {
+ return "toggle" === t && (t = e.is(":hidden") ? "show" : "hide"), t
+ }, getBaseline: function (e, t) {
+ var i, s;
+ switch (e[0]) {
+ case"top":
+ i = 0;
+ break;
+ case"middle":
+ i = .5;
+ break;
+ case"bottom":
+ i = 1;
+ break;
+ default:
+ i = e[0] / t.height
+ }
+ switch (e[1]) {
+ case"left":
+ s = 0;
+ break;
+ case"center":
+ s = .5;
+ break;
+ case"right":
+ s = 1;
+ break;
+ default:
+ s = e[1] / t.width
+ }
+ return {x: s, y: i}
+ }, createWrapper: function (t) {
+ if (t.parent().is(".ui-effects-wrapper"))return t.parent();
+ var i = {
+ width: t.outerWidth(!0),
+ height: t.outerHeight(!0),
+ "float": t.css("float")
+ }, s = e("<div></div>").addClass("ui-effects-wrapper").css({
+ fontSize: "100%",
+ background: "transparent",
+ border: "none",
+ margin: 0,
+ padding: 0
+ }), n = {width: t.width(), height: t.height()}, a = document.activeElement;
+ try {
+ a.id
+ } catch (o) {
+ a = document.body
+ }
+ return t.wrap(s), (t[0] === a || e.contains(t[0], a)) && e(a).focus(), s = t.parent(), "static" === t.css("position") ? (s.css({position: "relative"}), t.css({position: "relative"})) : (e.extend(i, {
+ position: t.css("position"),
+ zIndex: t.css("z-index")
+ }), e.each(["top", "left", "bottom", "right"], function (e, s) {
+ i[s] = t.css(s), isNaN(parseInt(i[s], 10)) && (i[s] = "auto")
+ }), t.css({
+ position: "relative",
+ top: 0,
+ left: 0,
+ right: "auto",
+ bottom: "auto"
+ })), t.css(n), s.css(i).show()
+ }, removeWrapper: function (t) {
+ var i = document.activeElement;
+ return t.parent().is(".ui-effects-wrapper") && (t.parent().replaceWith(t), (t[0] === i || e.contains(t[0], i)) && e(i).focus()), t
+ }, setTransition: function (t, i, s, n) {
+ return n = n || {}, e.each(i, function (e, i) {
+ var a = t.cssUnit(i);
+ a[0] > 0 && (n[i] = a[0] * s + a[1])
+ }), n
+ }
+ }), e.fn.extend({
+ effect: function () {
+ function i(t) {
+ function i() {
+ e.isFunction(a) && a.call(n[0]), e.isFunction(t) && t()
+ }
+
+ var n = e(this), a = s.complete, r = s.mode;
+ (n.is(":hidden") ? "hide" === r : "show" === r) ? (n[r](), i()) : o.call(n[0], s, i)
+ }
+
+ var s = t.apply(this, arguments), n = s.mode, a = s.queue, o = e.effects.effect[s.effect];
+ return e.fx.off || !o ? n ? this[n](s.duration, s.complete) : this.each(function () {
+ s.complete && s.complete.call(this)
+ }) : a === !1 ? this.each(i) : this.queue(a || "fx", i)
+ }, show: function (e) {
+ return function (s) {
+ if (i(s))return e.apply(this, arguments);
+ var n = t.apply(this, arguments);
+ return n.mode = "show", this.effect.call(this, n)
+ }
+ }(e.fn.show), hide: function (e) {
+ return function (s) {
+ if (i(s))return e.apply(this, arguments);
+ var n = t.apply(this, arguments);
+ return n.mode = "hide", this.effect.call(this, n)
+ }
+ }(e.fn.hide), toggle: function (e) {
+ return function (s) {
+ if (i(s) || "boolean" == typeof s)return e.apply(this, arguments);
+ var n = t.apply(this, arguments);
+ return n.mode = "toggle", this.effect.call(this, n)
+ }
+ }(e.fn.toggle), cssUnit: function (t) {
+ var i = this.css(t), s = [];
+ return e.each(["em", "px", "%", "pt"], function (e, t) {
+ i.indexOf(t) > 0 && (s = [parseFloat(i), t])
+ }), s
+ }
+ })
+ }(), function () {
+ var t = {};
+ e.each(["Quad", "Cubic", "Quart", "Quint", "Expo"], function (e, i) {
+ t[i] = function (t) {
+ return Math.pow(t, e + 2)
+ }
+ }), e.extend(t, {
+ Sine: function (e) {
+ return 1 - Math.cos(e * Math.PI / 2)
+ }, Circ: function (e) {
+ return 1 - Math.sqrt(1 - e * e)
+ }, Elastic: function (e) {
+ return 0 === e || 1 === e ? e : -Math.pow(2, 8 * (e - 1)) * Math.sin((80 * (e - 1) - 7.5) * Math.PI / 15)
+ }, Back: function (e) {
+ return e * e * (3 * e - 2)
+ }, Bounce: function (e) {
+ for (var t, i = 4; ((t = Math.pow(2, --i)) - 1) / 11 > e;);
+ return 1 / Math.pow(4, 3 - i) - 7.5625 * Math.pow((3 * t - 2) / 22 - e, 2)
+ }
+ }), e.each(t, function (t, i) {
+ e.easing["easeIn" + t] = i, e.easing["easeOut" + t] = function (e) {
+ return 1 - i(1 - e)
+ }, e.easing["easeInOut" + t] = function (e) {
+ return .5 > e ? i(2 * e) / 2 : 1 - i(-2 * e + 2) / 2
+ }
+ })
+ }(), e.effects, e.effects.effect.blind = function (t, i) {
+ var s, n, a, o = e(this), r = /up|down|vertical/, h = /up|left|vertical|horizontal/, l = ["position", "top", "bottom", "left", "right", "height", "width"], u = e.effects.setMode(o, t.mode || "hide"), d = t.direction || "up", c = r.test(d), p = c ? "height" : "width", f = c ? "top" : "left", m = h.test(d), g = {}, v = "show" === u;
+ o.parent().is(".ui-effects-wrapper") ? e.effects.save(o.parent(), l) : e.effects.save(o, l), o.show(), s = e.effects.createWrapper(o).css({overflow: "hidden"}), n = s[p](), a = parseFloat(s.css(f)) || 0, g[p] = v ? n : 0, m || (o.css(c ? "bottom" : "right", 0).css(c ? "top" : "left", "auto").css({position: "absolute"}), g[f] = v ? a : n + a), v && (s.css(p, 0), m || s.css(f, a + n)), s.animate(g, {
+ duration: t.duration,
+ easing: t.easing,
+ queue: !1,
+ complete: function () {
+ "hide" === u && o.hide(), e.effects.restore(o, l), e.effects.removeWrapper(o), i()
+ }
+ })
+ }, e.effects.effect.bounce = function (t, i) {
+ var s, n, a, o = e(this), r = ["position", "top", "bottom", "left", "right", "height", "width"], h = e.effects.setMode(o, t.mode || "effect"), l = "hide" === h, u = "show" === h, d = t.direction || "up", c = t.distance, p = t.times || 5, f = 2 * p + (u || l ? 1 : 0), m = t.duration / f, g = t.easing, v = "up" === d || "down" === d ? "top" : "left", y = "up" === d || "left" === d, b = o.queue(), _ = b.length;
+ for ((u || l) && r.push("opacity"), e.effects.save(o, r), o.show(), e.effects.createWrapper(o), c || (c = o["top" === v ? "outerHeight" : "outerWidth"]() / 3), u && (a = {opacity: 1}, a[v] = 0, o.css("opacity", 0).css(v, y ? 2 * -c : 2 * c).animate(a, m, g)), l && (c /= Math.pow(2, p - 1)), a = {}, a[v] = 0, s = 0; p > s; s++)n = {}, n[v] = (y ? "-=" : "+=") + c, o.animate(n, m, g).animate(a, m, g), c = l ? 2 * c : c / 2;
+ l && (n = {opacity: 0}, n[v] = (y ? "-=" : "+=") + c, o.animate(n, m, g)), o.queue(function () {
+ l && o.hide(), e.effects.restore(o, r), e.effects.removeWrapper(o), i()
+ }), _ > 1 && b.splice.apply(b, [1, 0].concat(b.splice(_, f + 1))), o.dequeue()
+ }, e.effects.effect.clip = function (t, i) {
+ var s, n, a, o = e(this), r = ["position", "top", "bottom", "left", "right", "height", "width"], h = e.effects.setMode(o, t.mode || "hide"), l = "show" === h, u = t.direction || "vertical", d = "vertical" === u, c = d ? "height" : "width", p = d ? "top" : "left", f = {};
+ e.effects.save(o, r), o.show(), s = e.effects.createWrapper(o).css({overflow: "hidden"}), n = "IMG" === o[0].tagName ? s : o, a = n[c](), l && (n.css(c, 0), n.css(p, a / 2)), f[c] = l ? a : 0, f[p] = l ? 0 : a / 2, n.animate(f, {
+ queue: !1,
+ duration: t.duration,
+ easing: t.easing,
+ complete: function () {
+ l || o.hide(), e.effects.restore(o, r), e.effects.removeWrapper(o), i()
+ }
+ })
+ }, e.effects.effect.drop = function (t, i) {
+ var s, n = e(this), a = ["position", "top", "bottom", "left", "right", "opacity", "height", "width"], o = e.effects.setMode(n, t.mode || "hide"), r = "show" === o, h = t.direction || "left", l = "up" === h || "down" === h ? "top" : "left", u = "up" === h || "left" === h ? "pos" : "neg", d = {opacity: r ? 1 : 0};
+ e.effects.save(n, a), n.show(), e.effects.createWrapper(n), s = t.distance || n["top" === l ? "outerHeight" : "outerWidth"](!0) / 2, r && n.css("opacity", 0).css(l, "pos" === u ? -s : s), d[l] = (r ? "pos" === u ? "+=" : "-=" : "pos" === u ? "-=" : "+=") + s, n.animate(d, {
+ queue: !1,
+ duration: t.duration,
+ easing: t.easing,
+ complete: function () {
+ "hide" === o && n.hide(), e.effects.restore(n, a), e.effects.removeWrapper(n), i()
+ }
+ })
+ }, e.effects.effect.explode = function (t, i) {
+ function s() {
+ b.push(this), b.length === d * c && n()
+ }
+
+ function n() {
+ p.css({visibility: "visible"}), e(b).remove(), m || p.hide(), i()
+ }
+
+ var a, o, r, h, l, u, d = t.pieces ? Math.round(Math.sqrt(t.pieces)) : 3, c = d, p = e(this), f = e.effects.setMode(p, t.mode || "hide"), m = "show" === f, g = p.show().css("visibility", "hidden").offset(), v = Math.ceil(p.outerWidth() / c), y = Math.ceil(p.outerHeight() / d), b = [];
+ for (a = 0; d > a; a++)for (h = g.top + a * y, u = a - (d - 1) / 2, o = 0; c > o; o++)r = g.left + o * v, l = o - (c - 1) / 2, p.clone().appendTo("body").wrap("<div></div>").css({
+ position: "absolute",
+ visibility: "visible",
+ left: -o * v,
+ top: -a * y
+ }).parent().addClass("ui-effects-explode").css({
+ position: "absolute",
+ overflow: "hidden",
+ width: v,
+ height: y,
+ left: r + (m ? l * v : 0),
+ top: h + (m ? u * y : 0),
+ opacity: m ? 0 : 1
+ }).animate({
+ left: r + (m ? 0 : l * v),
+ top: h + (m ? 0 : u * y),
+ opacity: m ? 1 : 0
+ }, t.duration || 500, t.easing, s)
+ }, e.effects.effect.fade = function (t, i) {
+ var s = e(this), n = e.effects.setMode(s, t.mode || "toggle");
+ s.animate({opacity: n}, {queue: !1, duration: t.duration, easing: t.easing, complete: i})
+ }, e.effects.effect.fold = function (t, i) {
+ var s, n, a = e(this), o = ["position", "top", "bottom", "left", "right", "height", "width"], r = e.effects.setMode(a, t.mode || "hide"), h = "show" === r, l = "hide" === r, u = t.size || 15, d = /([0-9]+)%/.exec(u), c = !!t.horizFirst, p = h !== c, f = p ? ["width", "height"] : ["height", "width"], m = t.duration / 2, g = {}, v = {};
+ e.effects.save(a, o), a.show(), s = e.effects.createWrapper(a).css({overflow: "hidden"}), n = p ? [s.width(), s.height()] : [s.height(), s.width()], d && (u = parseInt(d[1], 10) / 100 * n[l ? 0 : 1]), h && s.css(c ? {
+ height: 0,
+ width: u
+ } : {
+ height: u,
+ width: 0
+ }), g[f[0]] = h ? n[0] : u, v[f[1]] = h ? n[1] : 0, s.animate(g, m, t.easing).animate(v, m, t.easing, function () {
+ l && a.hide(), e.effects.restore(a, o), e.effects.removeWrapper(a), i()
+ })
+ }, e.effects.effect.highlight = function (t, i) {
+ var s = e(this), n = ["backgroundImage", "backgroundColor", "opacity"], a = e.effects.setMode(s, t.mode || "show"), o = {backgroundColor: s.css("backgroundColor")};
+ "hide" === a && (o.opacity = 0), e.effects.save(s, n), s.show().css({
+ backgroundImage: "none",
+ backgroundColor: t.color || "#ffff99"
+ }).animate(o, {
+ queue: !1, duration: t.duration, easing: t.easing, complete: function () {
+ "hide" === a && s.hide(), e.effects.restore(s, n), i()
+ }
+ })
+ }, e.effects.effect.size = function (t, i) {
+ var s, n, a, o = e(this), r = ["position", "top", "bottom", "left", "right", "width", "height", "overflow", "opacity"], h = ["position", "top", "bottom", "left", "right", "overflow", "opacity"], l = ["width", "height", "overflow"], u = ["fontSize"], d = ["borderTopWidth", "borderBottomWidth", "paddingTop", "paddingBottom"], c = ["borderLeftWidth", "borderRightWidth", "paddingLeft", "paddingRight"], p = e.effects.setMode(o, t.mode || "effect"), f = t.restore || "effect" !== p, m = t.scale || "both", g = t.origin || ["middle", "center"], v = o.css("position"), y = f ? r : h, b = {
+ height: 0,
+ width: 0,
+ outerHeight: 0,
+ outerWidth: 0
+ };
+ "show" === p && o.show(), s = {
+ height: o.height(),
+ width: o.width(),
+ outerHeight: o.outerHeight(),
+ outerWidth: o.outerWidth()
+ }, "toggle" === t.mode && "show" === p ? (o.from = t.to || b, o.to = t.from || s) : (o.from = t.from || ("show" === p ? b : s), o.to = t.to || ("hide" === p ? b : s)), a = {
+ from: {
+ y: o.from.height / s.height,
+ x: o.from.width / s.width
+ }, to: {y: o.to.height / s.height, x: o.to.width / s.width}
+ }, ("box" === m || "both" === m) && (a.from.y !== a.to.y && (y = y.concat(d), o.from = e.effects.setTransition(o, d, a.from.y, o.from), o.to = e.effects.setTransition(o, d, a.to.y, o.to)), a.from.x !== a.to.x && (y = y.concat(c), o.from = e.effects.setTransition(o, c, a.from.x, o.from), o.to = e.effects.setTransition(o, c, a.to.x, o.to))), ("content" === m || "both" === m) && a.from.y !== a.to.y && (y = y.concat(u).concat(l), o.from = e.effects.setTransition(o, u, a.from.y, o.from), o.to = e.effects.setTransition(o, u, a.to.y, o.to)), e.effects.save(o, y), o.show(), e.effects.createWrapper(o), o.css("overflow", "hidden").css(o.from), g && (n = e.effects.getBaseline(g, s), o.from.top = (s.outerHeight - o.outerHeight()) * n.y, o.from.left = (s.outerWidth - o.outerWidth()) * n.x, o.to.top = (s.outerHeight - o.to.outerHeight) * n.y, o.to.left = (s.outerWidth - o.to.outerWidth) * n.x), o.css(o.from), ("content" === m || "both" === m) && (d = d.concat(["marginTop", "marginBottom"]).concat(u), c = c.concat(["marginLeft", "marginRight"]), l = r.concat(d).concat(c), o.find("*[width]").each(function () {
+ var i = e(this), s = {
+ height: i.height(),
+ width: i.width(),
+ outerHeight: i.outerHeight(),
+ outerWidth: i.outerWidth()
+ };
+ f && e.effects.save(i, l), i.from = {
+ height: s.height * a.from.y,
+ width: s.width * a.from.x,
+ outerHeight: s.outerHeight * a.from.y,
+ outerWidth: s.outerWidth * a.from.x
+ }, i.to = {
+ height: s.height * a.to.y,
+ width: s.width * a.to.x,
+ outerHeight: s.height * a.to.y,
+ outerWidth: s.width * a.to.x
+ }, a.from.y !== a.to.y && (i.from = e.effects.setTransition(i, d, a.from.y, i.from), i.to = e.effects.setTransition(i, d, a.to.y, i.to)), a.from.x !== a.to.x && (i.from = e.effects.setTransition(i, c, a.from.x, i.from), i.to = e.effects.setTransition(i, c, a.to.x, i.to)), i.css(i.from), i.animate(i.to, t.duration, t.easing, function () {
+ f && e.effects.restore(i, l)
+ })
+ })), o.animate(o.to, {
+ queue: !1, duration: t.duration, easing: t.easing, complete: function () {
+ 0 === o.to.opacity && o.css("opacity", o.from.opacity), "hide" === p && o.hide(), e.effects.restore(o, y), f || ("static" === v ? o.css({
+ position: "relative",
+ top: o.to.top,
+ left: o.to.left
+ }) : e.each(["top", "left"], function (e, t) {
+ o.css(t, function (t, i) {
+ var s = parseInt(i, 10), n = e ? o.to.left : o.to.top;
+ return "auto" === i ? n + "px" : s + n + "px"
+ })
+ })), e.effects.removeWrapper(o), i()
+ }
+ })
+ }, e.effects.effect.scale = function (t, i) {
+ var s = e(this), n = e.extend(!0, {}, t), a = e.effects.setMode(s, t.mode || "effect"), o = parseInt(t.percent, 10) || (0 === parseInt(t.percent, 10) ? 0 : "hide" === a ? 0 : 100), r = t.direction || "both", h = t.origin, l = {
+ height: s.height(),
+ width: s.width(),
+ outerHeight: s.outerHeight(),
+ outerWidth: s.outerWidth()
+ }, u = {y: "horizontal" !== r ? o / 100 : 1, x: "vertical" !== r ? o / 100 : 1};
+ n.effect = "size", n.queue = !1, n.complete = i, "effect" !== a && (n.origin = h || ["middle", "center"], n.restore = !0), n.from = t.from || ("show" === a ? {
+ height: 0,
+ width: 0,
+ outerHeight: 0,
+ outerWidth: 0
+ } : l), n.to = {
+ height: l.height * u.y,
+ width: l.width * u.x,
+ outerHeight: l.outerHeight * u.y,
+ outerWidth: l.outerWidth * u.x
+ }, n.fade && ("show" === a && (n.from.opacity = 0, n.to.opacity = 1), "hide" === a && (n.from.opacity = 1, n.to.opacity = 0)), s.effect(n)
+ }, e.effects.effect.puff = function (t, i) {
+ var s = e(this), n = e.effects.setMode(s, t.mode || "hide"), a = "hide" === n, o = parseInt(t.percent, 10) || 150, r = o / 100, h = {
+ height: s.height(),
+ width: s.width(),
+ outerHeight: s.outerHeight(),
+ outerWidth: s.outerWidth()
+ };
+ e.extend(t, {
+ effect: "scale",
+ queue: !1,
+ fade: !0,
+ mode: n,
+ complete: i,
+ percent: a ? o : 100,
+ from: a ? h : {
+ height: h.height * r,
+ width: h.width * r,
+ outerHeight: h.outerHeight * r,
+ outerWidth: h.outerWidth * r
+ }
+ }), s.effect(t)
+ }, e.effects.effect.pulsate = function (t, i) {
+ var s, n = e(this), a = e.effects.setMode(n, t.mode || "show"), o = "show" === a, r = "hide" === a, h = o || "hide" === a, l = 2 * (t.times || 5) + (h ? 1 : 0), u = t.duration / l, d = 0, c = n.queue(), p = c.length;
+ for ((o || !n.is(":visible")) && (n.css("opacity", 0).show(), d = 1), s = 1; l > s; s++)n.animate({opacity: d}, u, t.easing), d = 1 - d;
+ n.animate({opacity: d}, u, t.easing), n.queue(function () {
+ r && n.hide(), i()
+ }), p > 1 && c.splice.apply(c, [1, 0].concat(c.splice(p, l + 1))), n.dequeue()
+ }, e.effects.effect.shake = function (t, i) {
+ var s, n = e(this), a = ["position", "top", "bottom", "left", "right", "height", "width"], o = e.effects.setMode(n, t.mode || "effect"), r = t.direction || "left", h = t.distance || 20, l = t.times || 3, u = 2 * l + 1, d = Math.round(t.duration / u), c = "up" === r || "down" === r ? "top" : "left", p = "up" === r || "left" === r, f = {}, m = {}, g = {}, v = n.queue(), y = v.length;
+ for (e.effects.save(n, a), n.show(), e.effects.createWrapper(n), f[c] = (p ? "-=" : "+=") + h, m[c] = (p ? "+=" : "-=") + 2 * h, g[c] = (p ? "-=" : "+=") + 2 * h, n.animate(f, d, t.easing), s = 1; l > s; s++)n.animate(m, d, t.easing).animate(g, d, t.easing);
+ n.animate(m, d, t.easing).animate(f, d / 2, t.easing).queue(function () {
+ "hide" === o && n.hide(), e.effects.restore(n, a), e.effects.removeWrapper(n), i()
+ }), y > 1 && v.splice.apply(v, [1, 0].concat(v.splice(y, u + 1))), n.dequeue()
+ }, e.effects.effect.slide = function (t, i) {
+ var s, n = e(this), a = ["position", "top", "bottom", "left", "right", "width", "height"], o = e.effects.setMode(n, t.mode || "show"), r = "show" === o, h = t.direction || "left", l = "up" === h || "down" === h ? "top" : "left", u = "up" === h || "left" === h, d = {};
+ e.effects.save(n, a), n.show(), s = t.distance || n["top" === l ? "outerHeight" : "outerWidth"](!0), e.effects.createWrapper(n).css({overflow: "hidden"}), r && n.css(l, u ? isNaN(s) ? "-" + s : -s : s), d[l] = (r ? u ? "+=" : "-=" : u ? "-=" : "+=") + s, n.animate(d, {
+ queue: !1,
+ duration: t.duration,
+ easing: t.easing,
+ complete: function () {
+ "hide" === o && n.hide(), e.effects.restore(n, a), e.effects.removeWrapper(n), i()
+ }
+ })
+ }, e.effects.effect.transfer = function (t, i) {
+ var s = e(this), n = e(t.to), a = "fixed" === n.css("position"), o = e("body"), r = a ? o.scrollTop() : 0, h = a ? o.scrollLeft() : 0, l = n.offset(), u = {
+ top: l.top - r,
+ left: l.left - h,
+ height: n.innerHeight(),
+ width: n.innerWidth()
+ }, d = s.offset(), c = e("<div class='ui-effects-transfer'></div>").appendTo(document.body).addClass(t.className).css({
+ top: d.top - r,
+ left: d.left - h,
+ height: s.innerHeight(),
+ width: s.innerWidth(),
+ position: a ? "fixed" : "absolute"
+ }).animate(u, t.duration, t.easing, function () {
+ c.remove(), i()
+ })
+ }
+});
\ No newline at end of file diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.structure.css b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.structure.css new file mode 100644 index 00000000..a58bc8c9 --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.structure.css @@ -0,0 +1,963 @@ +/*!
+ * jQuery UI CSS Framework 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/category/theming/
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden {
+ display: none;
+}
+
+.ui-helper-hidden-accessible {
+ border: 0;
+ clip: rect(0 0 0 0);
+ height: 1px;
+ margin: -1px;
+ overflow: hidden;
+ padding: 0;
+ position: absolute;
+ width: 1px;
+}
+
+.ui-helper-reset {
+ margin: 0;
+ padding: 0;
+ border: 0;
+ outline: 0;
+ line-height: 1.3;
+ text-decoration: none;
+ font-size: 100%;
+ list-style: none;
+}
+
+.ui-helper-clearfix:before,
+.ui-helper-clearfix:after {
+ content: "";
+ display: table;
+ border-collapse: collapse;
+}
+
+.ui-helper-clearfix:after {
+ clear: both;
+}
+
+.ui-helper-clearfix {
+ min-height: 0; /* support: IE7 */
+}
+
+.ui-helper-zfix {
+ width: 100%;
+ height: 100%;
+ top: 0;
+ left: 0;
+ position: absolute;
+ opacity: 0;
+ filter: Alpha(Opacity=0); /* support: IE8 */
+}
+
+.ui-front {
+ z-index: 100;
+}
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled {
+ cursor: default !important;
+}
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon {
+ display: block;
+ text-indent: -99999px;
+ overflow: hidden;
+ background-repeat: no-repeat;
+}
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay {
+ position: fixed;
+ top: 0;
+ left: 0;
+ width: 100%;
+ height: 100%;
+}
+
+.ui-draggable-handle {
+ -ms-touch-action: none;
+ touch-action: none;
+}
+
+.ui-resizable {
+ position: relative;
+}
+
+.ui-resizable-handle {
+ position: absolute;
+ font-size: 0.1px;
+ display: block;
+ -ms-touch-action: none;
+ touch-action: none;
+}
+
+.ui-resizable-disabled .ui-resizable-handle,
+.ui-resizable-autohide .ui-resizable-handle {
+ display: none;
+}
+
+.ui-resizable-n {
+ cursor: n-resize;
+ height: 7px;
+ width: 100%;
+ top: -5px;
+ left: 0;
+}
+
+.ui-resizable-s {
+ cursor: s-resize;
+ height: 7px;
+ width: 100%;
+ bottom: -5px;
+ left: 0;
+}
+
+.ui-resizable-e {
+ cursor: e-resize;
+ width: 7px;
+ right: -5px;
+ top: 0;
+ height: 100%;
+}
+
+.ui-resizable-w {
+ cursor: w-resize;
+ width: 7px;
+ left: -5px;
+ top: 0;
+ height: 100%;
+}
+
+.ui-resizable-se {
+ cursor: se-resize;
+ width: 12px;
+ height: 12px;
+ right: 1px;
+ bottom: 1px;
+}
+
+.ui-resizable-sw {
+ cursor: sw-resize;
+ width: 9px;
+ height: 9px;
+ left: -5px;
+ bottom: -5px;
+}
+
+.ui-resizable-nw {
+ cursor: nw-resize;
+ width: 9px;
+ height: 9px;
+ left: -5px;
+ top: -5px;
+}
+
+.ui-resizable-ne {
+ cursor: ne-resize;
+ width: 9px;
+ height: 9px;
+ right: -5px;
+ top: -5px;
+}
+
+.ui-selectable {
+ -ms-touch-action: none;
+ touch-action: none;
+}
+
+.ui-selectable-helper {
+ position: absolute;
+ z-index: 100;
+ border: 1px dotted black;
+}
+
+.ui-sortable-handle {
+ -ms-touch-action: none;
+ touch-action: none;
+}
+
+.ui-accordion .ui-accordion-header {
+ display: block;
+ cursor: pointer;
+ position: relative;
+ margin: 2px 0 0 0;
+ padding: .5em .5em .5em .7em;
+ min-height: 0; /* support: IE7 */
+ font-size: 100%;
+}
+
+.ui-accordion .ui-accordion-icons {
+ padding-left: 2.2em;
+}
+
+.ui-accordion .ui-accordion-icons .ui-accordion-icons {
+ padding-left: 2.2em;
+}
+
+.ui-accordion .ui-accordion-header .ui-accordion-header-icon {
+ position: absolute;
+ left: .5em;
+ top: 50%;
+ margin-top: -8px;
+}
+
+.ui-accordion .ui-accordion-content {
+ padding: 1em 2.2em;
+ border-top: 0;
+ overflow: auto;
+}
+
+.ui-autocomplete {
+ position: absolute;
+ top: 0;
+ left: 0;
+ cursor: default;
+}
+
+.ui-button {
+ display: inline-block;
+ position: relative;
+ padding: 0;
+ line-height: normal;
+ margin-right: .1em;
+ cursor: pointer;
+ vertical-align: middle;
+ text-align: center;
+ overflow: visible; /* removes extra width in IE */
+}
+
+.ui-button,
+.ui-button:link,
+.ui-button:visited,
+.ui-button:hover,
+.ui-button:active {
+ text-decoration: none;
+}
+
+/* to make room for the icon, a width needs to be set here */
+.ui-button-icon-only {
+ width: 2.2em;
+}
+
+/* button elements seem to need a little more width */
+button.ui-button-icon-only {
+ width: 2.4em;
+}
+
+.ui-button-icons-only {
+ width: 3.4em;
+}
+
+button.ui-button-icons-only {
+ width: 3.7em;
+}
+
+/* button text element */
+.ui-button .ui-button-text {
+ display: block;
+ line-height: normal;
+}
+
+.ui-button-text-only .ui-button-text {
+ padding: .4em 1em;
+}
+
+.ui-button-icon-only .ui-button-text,
+.ui-button-icons-only .ui-button-text {
+ padding: .4em;
+ text-indent: -9999999px;
+}
+
+.ui-button-text-icon-primary .ui-button-text,
+.ui-button-text-icons .ui-button-text {
+ padding: .4em 1em .4em 2.1em;
+}
+
+.ui-button-text-icon-secondary .ui-button-text,
+.ui-button-text-icons .ui-button-text {
+ padding: .4em 2.1em .4em 1em;
+}
+
+.ui-button-text-icons .ui-button-text {
+ padding-left: 2.1em;
+ padding-right: 2.1em;
+}
+
+/* no icon support for input elements, provide padding by default */
+input.ui-button {
+ padding: .4em 1em;
+}
+
+/* button icon element(s) */
+.ui-button-icon-only .ui-icon,
+.ui-button-text-icon-primary .ui-icon,
+.ui-button-text-icon-secondary .ui-icon,
+.ui-button-text-icons .ui-icon,
+.ui-button-icons-only .ui-icon {
+ position: absolute;
+ top: 50%;
+ margin-top: -8px;
+}
+
+.ui-button-icon-only .ui-icon {
+ left: 50%;
+ margin-left: -8px;
+}
+
+.ui-button-text-icon-primary .ui-button-icon-primary,
+.ui-button-text-icons .ui-button-icon-primary,
+.ui-button-icons-only .ui-button-icon-primary {
+ left: .5em;
+}
+
+.ui-button-text-icon-secondary .ui-button-icon-secondary,
+.ui-button-text-icons .ui-button-icon-secondary,
+.ui-button-icons-only .ui-button-icon-secondary {
+ right: .5em;
+}
+
+/* button sets */
+.ui-buttonset {
+ margin-right: 7px;
+}
+
+.ui-buttonset .ui-button {
+ margin-left: 0;
+ margin-right: -.3em;
+}
+
+/* workarounds */
+/* reset extra padding in Firefox, see h5bp.com/l */
+input.ui-button::-moz-focus-inner,
+button.ui-button::-moz-focus-inner {
+ border: 0;
+ padding: 0;
+}
+
+.ui-datepicker {
+ width: 17em;
+ padding: .2em .2em 0;
+ display: none;
+}
+
+.ui-datepicker .ui-datepicker-header {
+ position: relative;
+ padding: .2em 0;
+}
+
+.ui-datepicker .ui-datepicker-prev,
+.ui-datepicker .ui-datepicker-next {
+ position: absolute;
+ top: 2px;
+ width: 1.8em;
+ height: 1.8em;
+}
+
+.ui-datepicker .ui-datepicker-prev-hover,
+.ui-datepicker .ui-datepicker-next-hover {
+ top: 1px;
+}
+
+.ui-datepicker .ui-datepicker-prev {
+ left: 2px;
+}
+
+.ui-datepicker .ui-datepicker-next {
+ right: 2px;
+}
+
+.ui-datepicker .ui-datepicker-prev-hover {
+ left: 1px;
+}
+
+.ui-datepicker .ui-datepicker-next-hover {
+ right: 1px;
+}
+
+.ui-datepicker .ui-datepicker-prev span,
+.ui-datepicker .ui-datepicker-next span {
+ display: block;
+ position: absolute;
+ left: 50%;
+ margin-left: -8px;
+ top: 50%;
+ margin-top: -8px;
+}
+
+.ui-datepicker .ui-datepicker-title {
+ margin: 0 2.3em;
+ line-height: 1.8em;
+ text-align: center;
+}
+
+.ui-datepicker .ui-datepicker-title select {
+ font-size: 1em;
+ margin: 1px 0;
+}
+
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year {
+ width: 45%;
+}
+
+.ui-datepicker table {
+ width: 100%;
+ font-size: .9em;
+ border-collapse: collapse;
+ margin: 0 0 .4em;
+}
+
+.ui-datepicker th {
+ padding: .7em .3em;
+ text-align: center;
+ font-weight: bold;
+ border: 0;
+}
+
+.ui-datepicker td {
+ border: 0;
+ padding: 1px;
+}
+
+.ui-datepicker td span,
+.ui-datepicker td a {
+ display: block;
+ padding: .2em;
+ text-align: right;
+ text-decoration: none;
+}
+
+.ui-datepicker .ui-datepicker-buttonpane {
+ background-image: none;
+ margin: .7em 0 0 0;
+ padding: 0 .2em;
+ border-left: 0;
+ border-right: 0;
+ border-bottom: 0;
+}
+
+.ui-datepicker .ui-datepicker-buttonpane button {
+ float: right;
+ margin: .5em .2em .4em;
+ cursor: pointer;
+ padding: .2em .6em .3em .6em;
+ width: auto;
+ overflow: visible;
+}
+
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current {
+ float: left;
+}
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi {
+ width: auto;
+}
+
+.ui-datepicker-multi .ui-datepicker-group {
+ float: left;
+}
+
+.ui-datepicker-multi .ui-datepicker-group table {
+ width: 95%;
+ margin: 0 auto .4em;
+}
+
+.ui-datepicker-multi-2 .ui-datepicker-group {
+ width: 50%;
+}
+
+.ui-datepicker-multi-3 .ui-datepicker-group {
+ width: 33.3%;
+}
+
+.ui-datepicker-multi-4 .ui-datepicker-group {
+ width: 25%;
+}
+
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header,
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header {
+ border-left-width: 0;
+}
+
+.ui-datepicker-multi .ui-datepicker-buttonpane {
+ clear: left;
+}
+
+.ui-datepicker-row-break {
+ clear: both;
+ width: 100%;
+ font-size: 0;
+}
+
+/* RTL support */
+.ui-datepicker-rtl {
+ direction: rtl;
+}
+
+.ui-datepicker-rtl .ui-datepicker-prev {
+ right: 2px;
+ left: auto;
+}
+
+.ui-datepicker-rtl .ui-datepicker-next {
+ left: 2px;
+ right: auto;
+}
+
+.ui-datepicker-rtl .ui-datepicker-prev:hover {
+ right: 1px;
+ left: auto;
+}
+
+.ui-datepicker-rtl .ui-datepicker-next:hover {
+ left: 1px;
+ right: auto;
+}
+
+.ui-datepicker-rtl .ui-datepicker-buttonpane {
+ clear: right;
+}
+
+.ui-datepicker-rtl .ui-datepicker-buttonpane button {
+ float: left;
+}
+
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current,
+.ui-datepicker-rtl .ui-datepicker-group {
+ float: right;
+}
+
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header,
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header {
+ border-right-width: 0;
+ border-left-width: 1px;
+}
+
+.ui-dialog {
+ overflow: hidden;
+ position: absolute;
+ top: 0;
+ left: 0;
+ padding: .2em;
+ outline: 0;
+}
+
+.ui-dialog .ui-dialog-titlebar {
+ padding: .4em 1em;
+ position: relative;
+}
+
+.ui-dialog .ui-dialog-title {
+ float: left;
+ margin: .1em 0;
+ white-space: nowrap;
+ width: 90%;
+ overflow: hidden;
+ text-overflow: ellipsis;
+}
+
+.ui-dialog .ui-dialog-titlebar-close {
+ position: absolute;
+ right: .3em;
+ top: 50%;
+ width: 20px;
+ margin: -10px 0 0 0;
+ padding: 1px;
+ height: 20px;
+}
+
+.ui-dialog .ui-dialog-content {
+ position: relative;
+ border: 0;
+ padding: .5em 1em;
+ background: none;
+ overflow: auto;
+}
+
+.ui-dialog .ui-dialog-buttonpane {
+ text-align: left;
+ border-width: 1px 0 0 0;
+ background-image: none;
+ margin-top: .5em;
+ padding: .3em 1em .5em .4em;
+}
+
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset {
+ float: right;
+}
+
+.ui-dialog .ui-dialog-buttonpane button {
+ margin: .5em .4em .5em 0;
+ cursor: pointer;
+}
+
+.ui-dialog .ui-resizable-se {
+ width: 12px;
+ height: 12px;
+ right: -5px;
+ bottom: -5px;
+ background-position: 16px 16px;
+}
+
+.ui-draggable .ui-dialog-titlebar {
+ cursor: move;
+}
+
+.ui-menu {
+ list-style: none;
+ padding: 0;
+ margin: 0;
+ display: block;
+ outline: none;
+}
+
+.ui-menu .ui-menu {
+ position: absolute;
+}
+
+.ui-menu .ui-menu-item {
+ position: relative;
+ margin: 0;
+ padding: 3px 1em 3px .4em;
+ cursor: pointer;
+ min-height: 0; /* support: IE7 */
+ /* support: IE10, see #8844 */
+ list-style-image: url("data:image/gif;base64,R0lGODlhAQABAIAAAAAAAP///yH5BAEAAAAALAAAAAABAAEAAAIBRAA7");
+}
+
+.ui-menu .ui-menu-divider {
+ margin: 5px 0;
+ height: 0;
+ font-size: 0;
+ line-height: 0;
+ border-width: 1px 0 0 0;
+}
+
+.ui-menu .ui-state-focus,
+.ui-menu .ui-state-active {
+ margin: -1px;
+}
+
+/* icon support */
+.ui-menu-icons {
+ position: relative;
+}
+
+.ui-menu-icons .ui-menu-item {
+ padding-left: 2em;
+}
+
+/* left-aligned */
+.ui-menu .ui-icon {
+ position: absolute;
+ top: 0;
+ bottom: 0;
+ left: .2em;
+ margin: auto 0;
+}
+
+/* right-aligned */
+.ui-menu .ui-menu-icon {
+ left: auto;
+ right: 0;
+}
+
+.ui-progressbar {
+ height: 2em;
+ text-align: left;
+ overflow: hidden;
+}
+
+.ui-progressbar .ui-progressbar-value {
+ margin: -1px;
+ height: 100%;
+}
+
+.ui-progressbar .ui-progressbar-overlay {
+ background: url("data:image/gif;base64,R0lGODlhKAAoAIABAAAAAP///yH/C05FVFNDQVBFMi4wAwEAAAAh+QQJAQABACwAAAAAKAAoAAACkYwNqXrdC52DS06a7MFZI+4FHBCKoDeWKXqymPqGqxvJrXZbMx7Ttc+w9XgU2FB3lOyQRWET2IFGiU9m1frDVpxZZc6bfHwv4c1YXP6k1Vdy292Fb6UkuvFtXpvWSzA+HycXJHUXiGYIiMg2R6W459gnWGfHNdjIqDWVqemH2ekpObkpOlppWUqZiqr6edqqWQAAIfkECQEAAQAsAAAAACgAKAAAApSMgZnGfaqcg1E2uuzDmmHUBR8Qil95hiPKqWn3aqtLsS18y7G1SzNeowWBENtQd+T1JktP05nzPTdJZlR6vUxNWWjV+vUWhWNkWFwxl9VpZRedYcflIOLafaa28XdsH/ynlcc1uPVDZxQIR0K25+cICCmoqCe5mGhZOfeYSUh5yJcJyrkZWWpaR8doJ2o4NYq62lAAACH5BAkBAAEALAAAAAAoACgAAAKVDI4Yy22ZnINRNqosw0Bv7i1gyHUkFj7oSaWlu3ovC8GxNso5fluz3qLVhBVeT/Lz7ZTHyxL5dDalQWPVOsQWtRnuwXaFTj9jVVh8pma9JjZ4zYSj5ZOyma7uuolffh+IR5aW97cHuBUXKGKXlKjn+DiHWMcYJah4N0lYCMlJOXipGRr5qdgoSTrqWSq6WFl2ypoaUAAAIfkECQEAAQAsAAAAACgAKAAAApaEb6HLgd/iO7FNWtcFWe+ufODGjRfoiJ2akShbueb0wtI50zm02pbvwfWEMWBQ1zKGlLIhskiEPm9R6vRXxV4ZzWT2yHOGpWMyorblKlNp8HmHEb/lCXjcW7bmtXP8Xt229OVWR1fod2eWqNfHuMjXCPkIGNileOiImVmCOEmoSfn3yXlJWmoHGhqp6ilYuWYpmTqKUgAAIfkECQEAAQAsAAAAACgAKAAAApiEH6kb58biQ3FNWtMFWW3eNVcojuFGfqnZqSebuS06w5V80/X02pKe8zFwP6EFWOT1lDFk8rGERh1TTNOocQ61Hm4Xm2VexUHpzjymViHrFbiELsefVrn6XKfnt2Q9G/+Xdie499XHd2g4h7ioOGhXGJboGAnXSBnoBwKYyfioubZJ2Hn0RuRZaflZOil56Zp6iioKSXpUAAAh+QQJAQABACwAAAAAKAAoAAACkoQRqRvnxuI7kU1a1UU5bd5tnSeOZXhmn5lWK3qNTWvRdQxP8qvaC+/yaYQzXO7BMvaUEmJRd3TsiMAgswmNYrSgZdYrTX6tSHGZO73ezuAw2uxuQ+BbeZfMxsexY35+/Qe4J1inV0g4x3WHuMhIl2jXOKT2Q+VU5fgoSUI52VfZyfkJGkha6jmY+aaYdirq+lQAACH5BAkBAAEALAAAAAAoACgAAAKWBIKpYe0L3YNKToqswUlvznigd4wiR4KhZrKt9Upqip61i9E3vMvxRdHlbEFiEXfk9YARYxOZZD6VQ2pUunBmtRXo1Lf8hMVVcNl8JafV38aM2/Fu5V16Bn63r6xt97j09+MXSFi4BniGFae3hzbH9+hYBzkpuUh5aZmHuanZOZgIuvbGiNeomCnaxxap2upaCZsq+1kAACH5BAkBAAEALAAAAAAoACgAAAKXjI8By5zf4kOxTVrXNVlv1X0d8IGZGKLnNpYtm8Lr9cqVeuOSvfOW79D9aDHizNhDJidFZhNydEahOaDH6nomtJjp1tutKoNWkvA6JqfRVLHU/QUfau9l2x7G54d1fl995xcIGAdXqMfBNadoYrhH+Mg2KBlpVpbluCiXmMnZ2Sh4GBqJ+ckIOqqJ6LmKSllZmsoq6wpQAAAh+QQJAQABACwAAAAAKAAoAAAClYx/oLvoxuJDkU1a1YUZbJ59nSd2ZXhWqbRa2/gF8Gu2DY3iqs7yrq+xBYEkYvFSM8aSSObE+ZgRl1BHFZNr7pRCavZ5BW2142hY3AN/zWtsmf12p9XxxFl2lpLn1rseztfXZjdIWIf2s5dItwjYKBgo9yg5pHgzJXTEeGlZuenpyPmpGQoKOWkYmSpaSnqKileI2FAAACH5BAkBAAEALAAAAAAoACgAAAKVjB+gu+jG4kORTVrVhRlsnn2dJ3ZleFaptFrb+CXmO9OozeL5VfP99HvAWhpiUdcwkpBH3825AwYdU8xTqlLGhtCosArKMpvfa1mMRae9VvWZfeB2XfPkeLmm18lUcBj+p5dnN8jXZ3YIGEhYuOUn45aoCDkp16hl5IjYJvjWKcnoGQpqyPlpOhr3aElaqrq56Bq7VAAAOw==");
+ height: 100%;
+ filter: alpha(opacity=25); /* support: IE8 */
+ opacity: 0.25;
+}
+
+.ui-progressbar-indeterminate .ui-progressbar-value {
+ background-image: none;
+}
+
+.ui-selectmenu-menu {
+ padding: 0;
+ margin: 0;
+ position: absolute;
+ top: 0;
+ left: 0;
+ display: none;
+}
+
+.ui-selectmenu-menu .ui-menu {
+ overflow: auto;
+ /* Support: IE7 */
+ overflow-x: hidden;
+ padding-bottom: 1px;
+}
+
+.ui-selectmenu-menu .ui-menu .ui-selectmenu-optgroup {
+ font-size: 1em;
+ font-weight: bold;
+ line-height: 1.5;
+ padding: 2px 0.4em;
+ margin: 0.5em 0 0 0;
+ height: auto;
+ border: 0;
+}
+
+.ui-selectmenu-open {
+ display: block;
+}
+
+.ui-selectmenu-button {
+ display: inline-block;
+ overflow: hidden;
+ position: relative;
+ text-decoration: none;
+ cursor: pointer;
+}
+
+.ui-selectmenu-button span.ui-icon {
+ right: 0.5em;
+ left: auto;
+ margin-top: -8px;
+ position: absolute;
+ top: 50%;
+}
+
+.ui-selectmenu-button span.ui-selectmenu-text {
+ text-align: left;
+ padding: 0.4em 2.1em 0.4em 1em;
+ display: block;
+ line-height: 1.4;
+ overflow: hidden;
+ text-overflow: ellipsis;
+ white-space: nowrap;
+}
+
+.ui-slider {
+ position: relative;
+ text-align: left;
+}
+
+.ui-slider .ui-slider-handle {
+ position: absolute;
+ z-index: 2;
+ width: 1.2em;
+ height: 1.2em;
+ cursor: default;
+ -ms-touch-action: none;
+ touch-action: none;
+}
+
+.ui-slider .ui-slider-range {
+ position: absolute;
+ z-index: 1;
+ font-size: .7em;
+ display: block;
+ border: 0;
+ background-position: 0 0;
+}
+
+/* support: IE8 - See #6727 */
+.ui-slider.ui-state-disabled .ui-slider-handle,
+.ui-slider.ui-state-disabled .ui-slider-range {
+ filter: inherit;
+}
+
+.ui-slider-horizontal {
+ height: .8em;
+}
+
+.ui-slider-horizontal .ui-slider-handle {
+ top: -.3em;
+ margin-left: -.6em;
+}
+
+.ui-slider-horizontal .ui-slider-range {
+ top: 0;
+ height: 100%;
+}
+
+.ui-slider-horizontal .ui-slider-range-min {
+ left: 0;
+}
+
+.ui-slider-horizontal .ui-slider-range-max {
+ right: 0;
+}
+
+.ui-slider-vertical {
+ width: .8em;
+ height: 100px;
+}
+
+.ui-slider-vertical .ui-slider-handle {
+ left: -.3em;
+ margin-left: 0;
+ margin-bottom: -.6em;
+}
+
+.ui-slider-vertical .ui-slider-range {
+ left: 0;
+ width: 100%;
+}
+
+.ui-slider-vertical .ui-slider-range-min {
+ bottom: 0;
+}
+
+.ui-slider-vertical .ui-slider-range-max {
+ top: 0;
+}
+
+.ui-spinner {
+ position: relative;
+ display: inline-block;
+ overflow: hidden;
+ padding: 0;
+ vertical-align: middle;
+}
+
+.ui-spinner-input {
+ border: none;
+ background: none;
+ color: inherit;
+ padding: 0;
+ margin: .2em 0;
+ vertical-align: middle;
+ margin-left: .4em;
+ margin-right: 22px;
+}
+
+.ui-spinner-button {
+ width: 16px;
+ height: 50%;
+ font-size: .5em;
+ padding: 0;
+ margin: 0;
+ text-align: center;
+ position: absolute;
+ cursor: default;
+ display: block;
+ overflow: hidden;
+ right: 0;
+}
+
+/* more specificity required here to override default borders */
+.ui-spinner a.ui-spinner-button {
+ border-top: none;
+ border-bottom: none;
+ border-right: none;
+}
+
+/* vertically center icon */
+.ui-spinner .ui-icon {
+ position: absolute;
+ margin-top: -8px;
+ top: 50%;
+ left: 0;
+}
+
+.ui-spinner-up {
+ top: 0;
+}
+
+.ui-spinner-down {
+ bottom: 0;
+}
+
+/* TR overrides */
+.ui-spinner .ui-icon-triangle-1-s {
+ /* need to fix icons sprite */
+ background-position: -65px -16px;
+}
+
+.ui-tabs {
+ position: relative; /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+ padding: .2em;
+}
+
+.ui-tabs .ui-tabs-nav {
+ margin: 0;
+ padding: .2em .2em 0;
+}
+
+.ui-tabs .ui-tabs-nav li {
+ list-style: none;
+ float: left;
+ position: relative;
+ top: 0;
+ margin: 1px .2em 0 0;
+ border-bottom-width: 0;
+ padding: 0;
+ white-space: nowrap;
+}
+
+.ui-tabs .ui-tabs-nav .ui-tabs-anchor {
+ float: left;
+ padding: .5em 1em;
+ text-decoration: none;
+}
+
+.ui-tabs .ui-tabs-nav li.ui-tabs-active {
+ margin-bottom: -1px;
+ padding-bottom: 1px;
+}
+
+.ui-tabs .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor,
+.ui-tabs .ui-tabs-nav li.ui-state-disabled .ui-tabs-anchor,
+.ui-tabs .ui-tabs-nav li.ui-tabs-loading .ui-tabs-anchor {
+ cursor: text;
+}
+
+.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor {
+ cursor: pointer;
+}
+
+.ui-tabs .ui-tabs-panel {
+ display: block;
+ border-width: 0;
+ padding: 1em 1.4em;
+ background: none;
+}
+
+.ui-tooltip {
+ padding: 8px;
+ position: absolute;
+ z-index: 9999;
+ max-width: 300px;
+ -webkit-box-shadow: 0 0 5px #aaa;
+ box-shadow: 0 0 5px #aaa;
+}
+
+body .ui-tooltip {
+ border-width: 2px;
+}
diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.structure.min.css b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.structure.min.css new file mode 100644 index 00000000..c74dbd8e --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.structure.min.css @@ -0,0 +1,894 @@ +/*! jQuery UI - v1.11.4 - 2015-04-12
+* http://jqueryui.com
+* Copyright 2015 jQuery Foundation and other contributors; Licensed MIT */
+
+.ui-helper-hidden {
+ display: none
+}
+
+.ui-helper-hidden-accessible {
+ border: 0;
+ clip: rect(0 0 0 0);
+ height: 1px;
+ margin: -1px;
+ overflow: hidden;
+ padding: 0;
+ position: absolute;
+ width: 1px
+}
+
+.ui-helper-reset {
+ margin: 0;
+ padding: 0;
+ border: 0;
+ outline: 0;
+ line-height: 1.3;
+ text-decoration: none;
+ font-size: 100%;
+ list-style: none
+}
+
+.ui-helper-clearfix:before, .ui-helper-clearfix:after {
+ content: "";
+ display: table;
+ border-collapse: collapse
+}
+
+.ui-helper-clearfix:after {
+ clear: both
+}
+
+.ui-helper-clearfix {
+ min-height: 0
+}
+
+.ui-helper-zfix {
+ width: 100%;
+ height: 100%;
+ top: 0;
+ left: 0;
+ position: absolute;
+ opacity: 0;
+ filter: Alpha(Opacity=0)
+}
+
+.ui-front {
+ z-index: 100
+}
+
+.ui-state-disabled {
+ cursor: default !important
+}
+
+.ui-icon {
+ display: block;
+ text-indent: -99999px;
+ overflow: hidden;
+ background-repeat: no-repeat
+}
+
+.ui-widget-overlay {
+ position: fixed;
+ top: 0;
+ left: 0;
+ width: 100%;
+ height: 100%
+}
+
+.ui-draggable-handle {
+ -ms-touch-action: none;
+ touch-action: none
+}
+
+.ui-resizable {
+ position: relative
+}
+
+.ui-resizable-handle {
+ position: absolute;
+ font-size: 0.1px;
+ display: block;
+ -ms-touch-action: none;
+ touch-action: none
+}
+
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle {
+ display: none
+}
+
+.ui-resizable-n {
+ cursor: n-resize;
+ height: 7px;
+ width: 100%;
+ top: -5px;
+ left: 0
+}
+
+.ui-resizable-s {
+ cursor: s-resize;
+ height: 7px;
+ width: 100%;
+ bottom: -5px;
+ left: 0
+}
+
+.ui-resizable-e {
+ cursor: e-resize;
+ width: 7px;
+ right: -5px;
+ top: 0;
+ height: 100%
+}
+
+.ui-resizable-w {
+ cursor: w-resize;
+ width: 7px;
+ left: -5px;
+ top: 0;
+ height: 100%
+}
+
+.ui-resizable-se {
+ cursor: se-resize;
+ width: 12px;
+ height: 12px;
+ right: 1px;
+ bottom: 1px
+}
+
+.ui-resizable-sw {
+ cursor: sw-resize;
+ width: 9px;
+ height: 9px;
+ left: -5px;
+ bottom: -5px
+}
+
+.ui-resizable-nw {
+ cursor: nw-resize;
+ width: 9px;
+ height: 9px;
+ left: -5px;
+ top: -5px
+}
+
+.ui-resizable-ne {
+ cursor: ne-resize;
+ width: 9px;
+ height: 9px;
+ right: -5px;
+ top: -5px
+}
+
+.ui-selectable {
+ -ms-touch-action: none;
+ touch-action: none
+}
+
+.ui-selectable-helper {
+ position: absolute;
+ z-index: 100;
+ border: 1px dotted black
+}
+
+.ui-sortable-handle {
+ -ms-touch-action: none;
+ touch-action: none
+}
+
+.ui-accordion .ui-accordion-header {
+ display: block;
+ cursor: pointer;
+ position: relative;
+ margin: 2px 0 0 0;
+ padding: .5em .5em .5em .7em;
+ min-height: 0;
+ font-size: 100%
+}
+
+.ui-accordion .ui-accordion-icons {
+ padding-left: 2.2em
+}
+
+.ui-accordion .ui-accordion-icons .ui-accordion-icons {
+ padding-left: 2.2em
+}
+
+.ui-accordion .ui-accordion-header .ui-accordion-header-icon {
+ position: absolute;
+ left: .5em;
+ top: 50%;
+ margin-top: -8px
+}
+
+.ui-accordion .ui-accordion-content {
+ padding: 1em 2.2em;
+ border-top: 0;
+ overflow: auto
+}
+
+.ui-autocomplete {
+ position: absolute;
+ top: 0;
+ left: 0;
+ cursor: default
+}
+
+.ui-button {
+ display: inline-block;
+ position: relative;
+ padding: 0;
+ line-height: normal;
+ margin-right: .1em;
+ cursor: pointer;
+ vertical-align: middle;
+ text-align: center;
+ overflow: visible
+}
+
+.ui-button, .ui-button:link, .ui-button:visited, .ui-button:hover, .ui-button:active {
+ text-decoration: none
+}
+
+.ui-button-icon-only {
+ width: 2.2em
+}
+
+button.ui-button-icon-only {
+ width: 2.4em
+}
+
+.ui-button-icons-only {
+ width: 3.4em
+}
+
+button.ui-button-icons-only {
+ width: 3.7em
+}
+
+.ui-button .ui-button-text {
+ display: block;
+ line-height: normal
+}
+
+.ui-button-text-only .ui-button-text {
+ padding: .4em 1em
+}
+
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text {
+ padding: .4em;
+ text-indent: -9999999px
+}
+
+.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text {
+ padding: .4em 1em .4em 2.1em
+}
+
+.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text {
+ padding: .4em 2.1em .4em 1em
+}
+
+.ui-button-text-icons .ui-button-text {
+ padding-left: 2.1em;
+ padding-right: 2.1em
+}
+
+input.ui-button {
+ padding: .4em 1em
+}
+
+.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon {
+ position: absolute;
+ top: 50%;
+ margin-top: -8px
+}
+
+.ui-button-icon-only .ui-icon {
+ left: 50%;
+ margin-left: -8px
+}
+
+.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary {
+ left: .5em
+}
+
+.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary {
+ right: .5em
+}
+
+.ui-buttonset {
+ margin-right: 7px
+}
+
+.ui-buttonset .ui-button {
+ margin-left: 0;
+ margin-right: -.3em
+}
+
+input.ui-button::-moz-focus-inner, button.ui-button::-moz-focus-inner {
+ border: 0;
+ padding: 0
+}
+
+.ui-datepicker {
+ width: 17em;
+ padding: .2em .2em 0;
+ display: none
+}
+
+.ui-datepicker .ui-datepicker-header {
+ position: relative;
+ padding: .2em 0
+}
+
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next {
+ position: absolute;
+ top: 2px;
+ width: 1.8em;
+ height: 1.8em
+}
+
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover {
+ top: 1px
+}
+
+.ui-datepicker .ui-datepicker-prev {
+ left: 2px
+}
+
+.ui-datepicker .ui-datepicker-next {
+ right: 2px
+}
+
+.ui-datepicker .ui-datepicker-prev-hover {
+ left: 1px
+}
+
+.ui-datepicker .ui-datepicker-next-hover {
+ right: 1px
+}
+
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span {
+ display: block;
+ position: absolute;
+ left: 50%;
+ margin-left: -8px;
+ top: 50%;
+ margin-top: -8px
+}
+
+.ui-datepicker .ui-datepicker-title {
+ margin: 0 2.3em;
+ line-height: 1.8em;
+ text-align: center
+}
+
+.ui-datepicker .ui-datepicker-title select {
+ font-size: 1em;
+ margin: 1px 0
+}
+
+.ui-datepicker select.ui-datepicker-month, .ui-datepicker select.ui-datepicker-year {
+ width: 45%
+}
+
+.ui-datepicker table {
+ width: 100%;
+ font-size: .9em;
+ border-collapse: collapse;
+ margin: 0 0 .4em
+}
+
+.ui-datepicker th {
+ padding: .7em .3em;
+ text-align: center;
+ font-weight: bold;
+ border: 0
+}
+
+.ui-datepicker td {
+ border: 0;
+ padding: 1px
+}
+
+.ui-datepicker td span, .ui-datepicker td a {
+ display: block;
+ padding: .2em;
+ text-align: right;
+ text-decoration: none
+}
+
+.ui-datepicker .ui-datepicker-buttonpane {
+ background-image: none;
+ margin: .7em 0 0 0;
+ padding: 0 .2em;
+ border-left: 0;
+ border-right: 0;
+ border-bottom: 0
+}
+
+.ui-datepicker .ui-datepicker-buttonpane button {
+ float: right;
+ margin: .5em .2em .4em;
+ cursor: pointer;
+ padding: .2em .6em .3em .6em;
+ width: auto;
+ overflow: visible
+}
+
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current {
+ float: left
+}
+
+.ui-datepicker.ui-datepicker-multi {
+ width: auto
+}
+
+.ui-datepicker-multi .ui-datepicker-group {
+ float: left
+}
+
+.ui-datepicker-multi .ui-datepicker-group table {
+ width: 95%;
+ margin: 0 auto .4em
+}
+
+.ui-datepicker-multi-2 .ui-datepicker-group {
+ width: 50%
+}
+
+.ui-datepicker-multi-3 .ui-datepicker-group {
+ width: 33.3%
+}
+
+.ui-datepicker-multi-4 .ui-datepicker-group {
+ width: 25%
+}
+
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header, .ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header {
+ border-left-width: 0
+}
+
+.ui-datepicker-multi .ui-datepicker-buttonpane {
+ clear: left
+}
+
+.ui-datepicker-row-break {
+ clear: both;
+ width: 100%;
+ font-size: 0
+}
+
+.ui-datepicker-rtl {
+ direction: rtl
+}
+
+.ui-datepicker-rtl .ui-datepicker-prev {
+ right: 2px;
+ left: auto
+}
+
+.ui-datepicker-rtl .ui-datepicker-next {
+ left: 2px;
+ right: auto
+}
+
+.ui-datepicker-rtl .ui-datepicker-prev:hover {
+ right: 1px;
+ left: auto
+}
+
+.ui-datepicker-rtl .ui-datepicker-next:hover {
+ left: 1px;
+ right: auto
+}
+
+.ui-datepicker-rtl .ui-datepicker-buttonpane {
+ clear: right
+}
+
+.ui-datepicker-rtl .ui-datepicker-buttonpane button {
+ float: left
+}
+
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current, .ui-datepicker-rtl .ui-datepicker-group {
+ float: right
+}
+
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header, .ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header {
+ border-right-width: 0;
+ border-left-width: 1px
+}
+
+.ui-dialog {
+ overflow: hidden;
+ position: absolute;
+ top: 0;
+ left: 0;
+ padding: .2em;
+ outline: 0
+}
+
+.ui-dialog .ui-dialog-titlebar {
+ padding: .4em 1em;
+ position: relative
+}
+
+.ui-dialog .ui-dialog-title {
+ float: left;
+ margin: .1em 0;
+ white-space: nowrap;
+ width: 90%;
+ overflow: hidden;
+ text-overflow: ellipsis
+}
+
+.ui-dialog .ui-dialog-titlebar-close {
+ position: absolute;
+ right: .3em;
+ top: 50%;
+ width: 20px;
+ margin: -10px 0 0 0;
+ padding: 1px;
+ height: 20px
+}
+
+.ui-dialog .ui-dialog-content {
+ position: relative;
+ border: 0;
+ padding: .5em 1em;
+ background: none;
+ overflow: auto
+}
+
+.ui-dialog .ui-dialog-buttonpane {
+ text-align: left;
+ border-width: 1px 0 0 0;
+ background-image: none;
+ margin-top: .5em;
+ padding: .3em 1em .5em .4em
+}
+
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset {
+ float: right
+}
+
+.ui-dialog .ui-dialog-buttonpane button {
+ margin: .5em .4em .5em 0;
+ cursor: pointer
+}
+
+.ui-dialog .ui-resizable-se {
+ width: 12px;
+ height: 12px;
+ right: -5px;
+ bottom: -5px;
+ background-position: 16px 16px
+}
+
+.ui-draggable .ui-dialog-titlebar {
+ cursor: move
+}
+
+.ui-menu {
+ list-style: none;
+ padding: 0;
+ margin: 0;
+ display: block;
+ outline: none
+}
+
+.ui-menu .ui-menu {
+ position: absolute
+}
+
+.ui-menu .ui-menu-item {
+ position: relative;
+ margin: 0;
+ padding: 3px 1em 3px .4em;
+ cursor: pointer;
+ min-height: 0;
+ list-style-image: url("data:image/gif;base64,R0lGODlhAQABAIAAAAAAAP///yH5BAEAAAAALAAAAAABAAEAAAIBRAA7")
+}
+
+.ui-menu .ui-menu-divider {
+ margin: 5px 0;
+ height: 0;
+ font-size: 0;
+ line-height: 0;
+ border-width: 1px 0 0 0
+}
+
+.ui-menu .ui-state-focus, .ui-menu .ui-state-active {
+ margin: -1px
+}
+
+.ui-menu-icons {
+ position: relative
+}
+
+.ui-menu-icons .ui-menu-item {
+ padding-left: 2em
+}
+
+.ui-menu .ui-icon {
+ position: absolute;
+ top: 0;
+ bottom: 0;
+ left: .2em;
+ margin: auto 0
+}
+
+.ui-menu .ui-menu-icon {
+ left: auto;
+ right: 0
+}
+
+.ui-progressbar {
+ height: 2em;
+ text-align: left;
+ overflow: hidden
+}
+
+.ui-progressbar .ui-progressbar-value {
+ margin: -1px;
+ height: 100%
+}
+
+.ui-progressbar .ui-progressbar-overlay {
+ background: url("data:image/gif;base64,R0lGODlhKAAoAIABAAAAAP///yH/C05FVFNDQVBFMi4wAwEAAAAh+QQJAQABACwAAAAAKAAoAAACkYwNqXrdC52DS06a7MFZI+4FHBCKoDeWKXqymPqGqxvJrXZbMx7Ttc+w9XgU2FB3lOyQRWET2IFGiU9m1frDVpxZZc6bfHwv4c1YXP6k1Vdy292Fb6UkuvFtXpvWSzA+HycXJHUXiGYIiMg2R6W459gnWGfHNdjIqDWVqemH2ekpObkpOlppWUqZiqr6edqqWQAAIfkECQEAAQAsAAAAACgAKAAAApSMgZnGfaqcg1E2uuzDmmHUBR8Qil95hiPKqWn3aqtLsS18y7G1SzNeowWBENtQd+T1JktP05nzPTdJZlR6vUxNWWjV+vUWhWNkWFwxl9VpZRedYcflIOLafaa28XdsH/ynlcc1uPVDZxQIR0K25+cICCmoqCe5mGhZOfeYSUh5yJcJyrkZWWpaR8doJ2o4NYq62lAAACH5BAkBAAEALAAAAAAoACgAAAKVDI4Yy22ZnINRNqosw0Bv7i1gyHUkFj7oSaWlu3ovC8GxNso5fluz3qLVhBVeT/Lz7ZTHyxL5dDalQWPVOsQWtRnuwXaFTj9jVVh8pma9JjZ4zYSj5ZOyma7uuolffh+IR5aW97cHuBUXKGKXlKjn+DiHWMcYJah4N0lYCMlJOXipGRr5qdgoSTrqWSq6WFl2ypoaUAAAIfkECQEAAQAsAAAAACgAKAAAApaEb6HLgd/iO7FNWtcFWe+ufODGjRfoiJ2akShbueb0wtI50zm02pbvwfWEMWBQ1zKGlLIhskiEPm9R6vRXxV4ZzWT2yHOGpWMyorblKlNp8HmHEb/lCXjcW7bmtXP8Xt229OVWR1fod2eWqNfHuMjXCPkIGNileOiImVmCOEmoSfn3yXlJWmoHGhqp6ilYuWYpmTqKUgAAIfkECQEAAQAsAAAAACgAKAAAApiEH6kb58biQ3FNWtMFWW3eNVcojuFGfqnZqSebuS06w5V80/X02pKe8zFwP6EFWOT1lDFk8rGERh1TTNOocQ61Hm4Xm2VexUHpzjymViHrFbiELsefVrn6XKfnt2Q9G/+Xdie499XHd2g4h7ioOGhXGJboGAnXSBnoBwKYyfioubZJ2Hn0RuRZaflZOil56Zp6iioKSXpUAAAh+QQJAQABACwAAAAAKAAoAAACkoQRqRvnxuI7kU1a1UU5bd5tnSeOZXhmn5lWK3qNTWvRdQxP8qvaC+/yaYQzXO7BMvaUEmJRd3TsiMAgswmNYrSgZdYrTX6tSHGZO73ezuAw2uxuQ+BbeZfMxsexY35+/Qe4J1inV0g4x3WHuMhIl2jXOKT2Q+VU5fgoSUI52VfZyfkJGkha6jmY+aaYdirq+lQAACH5BAkBAAEALAAAAAAoACgAAAKWBIKpYe0L3YNKToqswUlvznigd4wiR4KhZrKt9Upqip61i9E3vMvxRdHlbEFiEXfk9YARYxOZZD6VQ2pUunBmtRXo1Lf8hMVVcNl8JafV38aM2/Fu5V16Bn63r6xt97j09+MXSFi4BniGFae3hzbH9+hYBzkpuUh5aZmHuanZOZgIuvbGiNeomCnaxxap2upaCZsq+1kAACH5BAkBAAEALAAAAAAoACgAAAKXjI8By5zf4kOxTVrXNVlv1X0d8IGZGKLnNpYtm8Lr9cqVeuOSvfOW79D9aDHizNhDJidFZhNydEahOaDH6nomtJjp1tutKoNWkvA6JqfRVLHU/QUfau9l2x7G54d1fl995xcIGAdXqMfBNadoYrhH+Mg2KBlpVpbluCiXmMnZ2Sh4GBqJ+ckIOqqJ6LmKSllZmsoq6wpQAAAh+QQJAQABACwAAAAAKAAoAAAClYx/oLvoxuJDkU1a1YUZbJ59nSd2ZXhWqbRa2/gF8Gu2DY3iqs7yrq+xBYEkYvFSM8aSSObE+ZgRl1BHFZNr7pRCavZ5BW2142hY3AN/zWtsmf12p9XxxFl2lpLn1rseztfXZjdIWIf2s5dItwjYKBgo9yg5pHgzJXTEeGlZuenpyPmpGQoKOWkYmSpaSnqKileI2FAAACH5BAkBAAEALAAAAAAoACgAAAKVjB+gu+jG4kORTVrVhRlsnn2dJ3ZleFaptFrb+CXmO9OozeL5VfP99HvAWhpiUdcwkpBH3825AwYdU8xTqlLGhtCosArKMpvfa1mMRae9VvWZfeB2XfPkeLmm18lUcBj+p5dnN8jXZ3YIGEhYuOUn45aoCDkp16hl5IjYJvjWKcnoGQpqyPlpOhr3aElaqrq56Bq7VAAAOw==");
+ height: 100%;
+ filter: alpha(opacity=25);
+ opacity: 0.25
+}
+
+.ui-progressbar-indeterminate .ui-progressbar-value {
+ background-image: none
+}
+
+.ui-selectmenu-menu {
+ padding: 0;
+ margin: 0;
+ position: absolute;
+ top: 0;
+ left: 0;
+ display: none
+}
+
+.ui-selectmenu-menu .ui-menu {
+ overflow: auto;
+ overflow-x: hidden;
+ padding-bottom: 1px
+}
+
+.ui-selectmenu-menu .ui-menu .ui-selectmenu-optgroup {
+ font-size: 1em;
+ font-weight: bold;
+ line-height: 1.5;
+ padding: 2px 0.4em;
+ margin: 0.5em 0 0 0;
+ height: auto;
+ border: 0
+}
+
+.ui-selectmenu-open {
+ display: block
+}
+
+.ui-selectmenu-button {
+ display: inline-block;
+ overflow: hidden;
+ position: relative;
+ text-decoration: none;
+ cursor: pointer
+}
+
+.ui-selectmenu-button span.ui-icon {
+ right: 0.5em;
+ left: auto;
+ margin-top: -8px;
+ position: absolute;
+ top: 50%
+}
+
+.ui-selectmenu-button span.ui-selectmenu-text {
+ text-align: left;
+ padding: 0.4em 2.1em 0.4em 1em;
+ display: block;
+ line-height: 1.4;
+ overflow: hidden;
+ text-overflow: ellipsis;
+ white-space: nowrap
+}
+
+.ui-slider {
+ position: relative;
+ text-align: left
+}
+
+.ui-slider .ui-slider-handle {
+ position: absolute;
+ z-index: 2;
+ width: 1.2em;
+ height: 1.2em;
+ cursor: default;
+ -ms-touch-action: none;
+ touch-action: none
+}
+
+.ui-slider .ui-slider-range {
+ position: absolute;
+ z-index: 1;
+ font-size: .7em;
+ display: block;
+ border: 0;
+ background-position: 0 0
+}
+
+.ui-slider.ui-state-disabled .ui-slider-handle, .ui-slider.ui-state-disabled .ui-slider-range {
+ filter: inherit
+}
+
+.ui-slider-horizontal {
+ height: .8em
+}
+
+.ui-slider-horizontal .ui-slider-handle {
+ top: -.3em;
+ margin-left: -.6em
+}
+
+.ui-slider-horizontal .ui-slider-range {
+ top: 0;
+ height: 100%
+}
+
+.ui-slider-horizontal .ui-slider-range-min {
+ left: 0
+}
+
+.ui-slider-horizontal .ui-slider-range-max {
+ right: 0
+}
+
+.ui-slider-vertical {
+ width: .8em;
+ height: 100px
+}
+
+.ui-slider-vertical .ui-slider-handle {
+ left: -.3em;
+ margin-left: 0;
+ margin-bottom: -.6em
+}
+
+.ui-slider-vertical .ui-slider-range {
+ left: 0;
+ width: 100%
+}
+
+.ui-slider-vertical .ui-slider-range-min {
+ bottom: 0
+}
+
+.ui-slider-vertical .ui-slider-range-max {
+ top: 0
+}
+
+.ui-spinner {
+ position: relative;
+ display: inline-block;
+ overflow: hidden;
+ padding: 0;
+ vertical-align: middle
+}
+
+.ui-spinner-input {
+ border: none;
+ background: none;
+ color: inherit;
+ padding: 0;
+ margin: .2em 0;
+ vertical-align: middle;
+ margin-left: .4em;
+ margin-right: 22px
+}
+
+.ui-spinner-button {
+ width: 16px;
+ height: 50%;
+ font-size: .5em;
+ padding: 0;
+ margin: 0;
+ text-align: center;
+ position: absolute;
+ cursor: default;
+ display: block;
+ overflow: hidden;
+ right: 0
+}
+
+.ui-spinner a.ui-spinner-button {
+ border-top: none;
+ border-bottom: none;
+ border-right: none
+}
+
+.ui-spinner .ui-icon {
+ position: absolute;
+ margin-top: -8px;
+ top: 50%;
+ left: 0
+}
+
+.ui-spinner-up {
+ top: 0
+}
+
+.ui-spinner-down {
+ bottom: 0
+}
+
+.ui-spinner .ui-icon-triangle-1-s {
+ background-position: -65px -16px
+}
+
+.ui-tabs {
+ position: relative;
+ padding: .2em
+}
+
+.ui-tabs .ui-tabs-nav {
+ margin: 0;
+ padding: .2em .2em 0
+}
+
+.ui-tabs .ui-tabs-nav li {
+ list-style: none;
+ float: left;
+ position: relative;
+ top: 0;
+ margin: 1px .2em 0 0;
+ border-bottom-width: 0;
+ padding: 0;
+ white-space: nowrap
+}
+
+.ui-tabs .ui-tabs-nav .ui-tabs-anchor {
+ float: left;
+ padding: .5em 1em;
+ text-decoration: none
+}
+
+.ui-tabs .ui-tabs-nav li.ui-tabs-active {
+ margin-bottom: -1px;
+ padding-bottom: 1px
+}
+
+.ui-tabs .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor, .ui-tabs .ui-tabs-nav li.ui-state-disabled .ui-tabs-anchor, .ui-tabs .ui-tabs-nav li.ui-tabs-loading .ui-tabs-anchor {
+ cursor: text
+}
+
+.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor {
+ cursor: pointer
+}
+
+.ui-tabs .ui-tabs-panel {
+ display: block;
+ border-width: 0;
+ padding: 1em 1.4em;
+ background: none
+}
+
+.ui-tooltip {
+ padding: 8px;
+ position: absolute;
+ z-index: 9999;
+ max-width: 300px;
+ -webkit-box-shadow: 0 0 5px #aaa;
+ box-shadow: 0 0 5px #aaa
+}
+
+body .ui-tooltip {
+ border-width: 2px
+}
\ No newline at end of file diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.theme.css b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.theme.css new file mode 100644 index 00000000..5f1de320 --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.theme.css @@ -0,0 +1,962 @@ +/*!
+ * jQuery UI CSS Framework 1.11.4
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/category/theming/
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS%2CTahoma%2CVerdana%2CArial%2Csans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=gloss_wave&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=highlight_soft&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=glass&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=glass&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=glass&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=highlight_soft&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=diagonals_thick&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=diagonals_thick&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=flat&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px
+ */
+
+/* Component containers
+----------------------------------*/
+.ui-widget {
+ font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif;
+ font-size: 1.1em;
+}
+
+.ui-widget .ui-widget {
+ font-size: 1em;
+}
+
+.ui-widget input,
+.ui-widget select,
+.ui-widget textarea,
+.ui-widget button {
+ font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif;
+ font-size: 1em;
+}
+
+.ui-widget-content {
+ border: 1px solid #dddddd;
+ background: #eeeeee url("images/ui-bg_highlight-soft_100_eeeeee_1x100.png") 50% top repeat-x;
+ color: #333333;
+}
+
+.ui-widget-content a {
+ color: #333333;
+}
+
+.ui-widget-header {
+ border: 1px solid #e78f08;
+ background: #f6a828 url("images/ui-bg_gloss-wave_35_f6a828_500x100.png") 50% 50% repeat-x;
+ color: #ffffff;
+ font-weight: bold;
+}
+
+.ui-widget-header a {
+ color: #ffffff;
+}
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default,
+.ui-widget-content .ui-state-default,
+.ui-widget-header .ui-state-default {
+ border: 1px solid #cccccc;
+ background: #f6f6f6 url("images/ui-bg_glass_100_f6f6f6_1x400.png") 50% 50% repeat-x;
+ font-weight: bold;
+ color: #1c94c4;
+}
+
+.ui-state-default a,
+.ui-state-default a:link,
+.ui-state-default a:visited {
+ color: #1c94c4;
+ text-decoration: none;
+}
+
+.ui-state-hover,
+.ui-widget-content .ui-state-hover,
+.ui-widget-header .ui-state-hover,
+.ui-state-focus,
+.ui-widget-content .ui-state-focus,
+.ui-widget-header .ui-state-focus {
+ border: 1px solid #fbcb09;
+ background: #fdf5ce url("images/ui-bg_glass_100_fdf5ce_1x400.png") 50% 50% repeat-x;
+ font-weight: bold;
+ color: #c77405;
+}
+
+.ui-state-hover a,
+.ui-state-hover a:hover,
+.ui-state-hover a:link,
+.ui-state-hover a:visited,
+.ui-state-focus a,
+.ui-state-focus a:hover,
+.ui-state-focus a:link,
+.ui-state-focus a:visited {
+ color: #c77405;
+ text-decoration: none;
+}
+
+.ui-state-active,
+.ui-widget-content .ui-state-active,
+.ui-widget-header .ui-state-active {
+ border: 1px solid #fbd850;
+ background: #ffffff url("images/ui-bg_glass_65_ffffff_1x400.png") 50% 50% repeat-x;
+ font-weight: bold;
+ color: #eb8f00;
+}
+
+.ui-state-active a,
+.ui-state-active a:link,
+.ui-state-active a:visited {
+ color: #eb8f00;
+ text-decoration: none;
+}
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight,
+.ui-widget-content .ui-state-highlight,
+.ui-widget-header .ui-state-highlight {
+ border: 1px solid #fed22f;
+ background: #ffe45c url("images/ui-bg_highlight-soft_75_ffe45c_1x100.png") 50% top repeat-x;
+ color: #363636;
+}
+
+.ui-state-highlight a,
+.ui-widget-content .ui-state-highlight a,
+.ui-widget-header .ui-state-highlight a {
+ color: #363636;
+}
+
+.ui-state-error,
+.ui-widget-content .ui-state-error,
+.ui-widget-header .ui-state-error {
+ border: 1px solid #cd0a0a;
+ background: #b81900 url("images/ui-bg_diagonals-thick_18_b81900_40x40.png") 50% 50% repeat;
+ color: #ffffff;
+}
+
+.ui-state-error a,
+.ui-widget-content .ui-state-error a,
+.ui-widget-header .ui-state-error a {
+ color: #ffffff;
+}
+
+.ui-state-error-text,
+.ui-widget-content .ui-state-error-text,
+.ui-widget-header .ui-state-error-text {
+ color: #ffffff;
+}
+
+.ui-priority-primary,
+.ui-widget-content .ui-priority-primary,
+.ui-widget-header .ui-priority-primary {
+ font-weight: bold;
+}
+
+.ui-priority-secondary,
+.ui-widget-content .ui-priority-secondary,
+.ui-widget-header .ui-priority-secondary {
+ opacity: .7;
+ filter: Alpha(Opacity=70); /* support: IE8 */
+ font-weight: normal;
+}
+
+.ui-state-disabled,
+.ui-widget-content .ui-state-disabled,
+.ui-widget-header .ui-state-disabled {
+ opacity: .35;
+ filter: Alpha(Opacity=35); /* support: IE8 */
+ background-image: none;
+}
+
+.ui-state-disabled .ui-icon {
+ filter: Alpha(Opacity=35); /* support: IE8 - See #6059 */
+}
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon {
+ width: 16px;
+ height: 16px;
+}
+
+.ui-icon,
+.ui-widget-content .ui-icon {
+ background-image: url("images/ui-icons_222222_256x240.png");
+}
+
+.ui-widget-header .ui-icon {
+ background-image: url("images/ui-icons_ffffff_256x240.png");
+}
+
+.ui-state-default .ui-icon {
+ background-image: url("images/ui-icons_ef8c08_256x240.png");
+}
+
+.ui-state-hover .ui-icon,
+.ui-state-focus .ui-icon {
+ background-image: url("images/ui-icons_ef8c08_256x240.png");
+}
+
+.ui-state-active .ui-icon {
+ background-image: url("images/ui-icons_ef8c08_256x240.png");
+}
+
+.ui-state-highlight .ui-icon {
+ background-image: url("images/ui-icons_228ef1_256x240.png");
+}
+
+.ui-state-error .ui-icon,
+.ui-state-error-text .ui-icon {
+ background-image: url("images/ui-icons_ffd27a_256x240.png");
+}
+
+/* positioning */
+.ui-icon-blank {
+ background-position: 16px 16px;
+}
+
+.ui-icon-carat-1-n {
+ background-position: 0 0;
+}
+
+.ui-icon-carat-1-ne {
+ background-position: -16px 0;
+}
+
+.ui-icon-carat-1-e {
+ background-position: -32px 0;
+}
+
+.ui-icon-carat-1-se {
+ background-position: -48px 0;
+}
+
+.ui-icon-carat-1-s {
+ background-position: -64px 0;
+}
+
+.ui-icon-carat-1-sw {
+ background-position: -80px 0;
+}
+
+.ui-icon-carat-1-w {
+ background-position: -96px 0;
+}
+
+.ui-icon-carat-1-nw {
+ background-position: -112px 0;
+}
+
+.ui-icon-carat-2-n-s {
+ background-position: -128px 0;
+}
+
+.ui-icon-carat-2-e-w {
+ background-position: -144px 0;
+}
+
+.ui-icon-triangle-1-n {
+ background-position: 0 -16px;
+}
+
+.ui-icon-triangle-1-ne {
+ background-position: -16px -16px;
+}
+
+.ui-icon-triangle-1-e {
+ background-position: -32px -16px;
+}
+
+.ui-icon-triangle-1-se {
+ background-position: -48px -16px;
+}
+
+.ui-icon-triangle-1-s {
+ background-position: -64px -16px;
+}
+
+.ui-icon-triangle-1-sw {
+ background-position: -80px -16px;
+}
+
+.ui-icon-triangle-1-w {
+ background-position: -96px -16px;
+}
+
+.ui-icon-triangle-1-nw {
+ background-position: -112px -16px;
+}
+
+.ui-icon-triangle-2-n-s {
+ background-position: -128px -16px;
+}
+
+.ui-icon-triangle-2-e-w {
+ background-position: -144px -16px;
+}
+
+.ui-icon-arrow-1-n {
+ background-position: 0 -32px;
+}
+
+.ui-icon-arrow-1-ne {
+ background-position: -16px -32px;
+}
+
+.ui-icon-arrow-1-e {
+ background-position: -32px -32px;
+}
+
+.ui-icon-arrow-1-se {
+ background-position: -48px -32px;
+}
+
+.ui-icon-arrow-1-s {
+ background-position: -64px -32px;
+}
+
+.ui-icon-arrow-1-sw {
+ background-position: -80px -32px;
+}
+
+.ui-icon-arrow-1-w {
+ background-position: -96px -32px;
+}
+
+.ui-icon-arrow-1-nw {
+ background-position: -112px -32px;
+}
+
+.ui-icon-arrow-2-n-s {
+ background-position: -128px -32px;
+}
+
+.ui-icon-arrow-2-ne-sw {
+ background-position: -144px -32px;
+}
+
+.ui-icon-arrow-2-e-w {
+ background-position: -160px -32px;
+}
+
+.ui-icon-arrow-2-se-nw {
+ background-position: -176px -32px;
+}
+
+.ui-icon-arrowstop-1-n {
+ background-position: -192px -32px;
+}
+
+.ui-icon-arrowstop-1-e {
+ background-position: -208px -32px;
+}
+
+.ui-icon-arrowstop-1-s {
+ background-position: -224px -32px;
+}
+
+.ui-icon-arrowstop-1-w {
+ background-position: -240px -32px;
+}
+
+.ui-icon-arrowthick-1-n {
+ background-position: 0 -48px;
+}
+
+.ui-icon-arrowthick-1-ne {
+ background-position: -16px -48px;
+}
+
+.ui-icon-arrowthick-1-e {
+ background-position: -32px -48px;
+}
+
+.ui-icon-arrowthick-1-se {
+ background-position: -48px -48px;
+}
+
+.ui-icon-arrowthick-1-s {
+ background-position: -64px -48px;
+}
+
+.ui-icon-arrowthick-1-sw {
+ background-position: -80px -48px;
+}
+
+.ui-icon-arrowthick-1-w {
+ background-position: -96px -48px;
+}
+
+.ui-icon-arrowthick-1-nw {
+ background-position: -112px -48px;
+}
+
+.ui-icon-arrowthick-2-n-s {
+ background-position: -128px -48px;
+}
+
+.ui-icon-arrowthick-2-ne-sw {
+ background-position: -144px -48px;
+}
+
+.ui-icon-arrowthick-2-e-w {
+ background-position: -160px -48px;
+}
+
+.ui-icon-arrowthick-2-se-nw {
+ background-position: -176px -48px;
+}
+
+.ui-icon-arrowthickstop-1-n {
+ background-position: -192px -48px;
+}
+
+.ui-icon-arrowthickstop-1-e {
+ background-position: -208px -48px;
+}
+
+.ui-icon-arrowthickstop-1-s {
+ background-position: -224px -48px;
+}
+
+.ui-icon-arrowthickstop-1-w {
+ background-position: -240px -48px;
+}
+
+.ui-icon-arrowreturnthick-1-w {
+ background-position: 0 -64px;
+}
+
+.ui-icon-arrowreturnthick-1-n {
+ background-position: -16px -64px;
+}
+
+.ui-icon-arrowreturnthick-1-e {
+ background-position: -32px -64px;
+}
+
+.ui-icon-arrowreturnthick-1-s {
+ background-position: -48px -64px;
+}
+
+.ui-icon-arrowreturn-1-w {
+ background-position: -64px -64px;
+}
+
+.ui-icon-arrowreturn-1-n {
+ background-position: -80px -64px;
+}
+
+.ui-icon-arrowreturn-1-e {
+ background-position: -96px -64px;
+}
+
+.ui-icon-arrowreturn-1-s {
+ background-position: -112px -64px;
+}
+
+.ui-icon-arrowrefresh-1-w {
+ background-position: -128px -64px;
+}
+
+.ui-icon-arrowrefresh-1-n {
+ background-position: -144px -64px;
+}
+
+.ui-icon-arrowrefresh-1-e {
+ background-position: -160px -64px;
+}
+
+.ui-icon-arrowrefresh-1-s {
+ background-position: -176px -64px;
+}
+
+.ui-icon-arrow-4 {
+ background-position: 0 -80px;
+}
+
+.ui-icon-arrow-4-diag {
+ background-position: -16px -80px;
+}
+
+.ui-icon-extlink {
+ background-position: -32px -80px;
+}
+
+.ui-icon-newwin {
+ background-position: -48px -80px;
+}
+
+.ui-icon-refresh {
+ background-position: -64px -80px;
+}
+
+.ui-icon-shuffle {
+ background-position: -80px -80px;
+}
+
+.ui-icon-transfer-e-w {
+ background-position: -96px -80px;
+}
+
+.ui-icon-transferthick-e-w {
+ background-position: -112px -80px;
+}
+
+.ui-icon-folder-collapsed {
+ background-position: 0 -96px;
+}
+
+.ui-icon-folder-open {
+ background-position: -16px -96px;
+}
+
+.ui-icon-document {
+ background-position: -32px -96px;
+}
+
+.ui-icon-document-b {
+ background-position: -48px -96px;
+}
+
+.ui-icon-note {
+ background-position: -64px -96px;
+}
+
+.ui-icon-mail-closed {
+ background-position: -80px -96px;
+}
+
+.ui-icon-mail-open {
+ background-position: -96px -96px;
+}
+
+.ui-icon-suitcase {
+ background-position: -112px -96px;
+}
+
+.ui-icon-comment {
+ background-position: -128px -96px;
+}
+
+.ui-icon-person {
+ background-position: -144px -96px;
+}
+
+.ui-icon-print {
+ background-position: -160px -96px;
+}
+
+.ui-icon-trash {
+ background-position: -176px -96px;
+}
+
+.ui-icon-locked {
+ background-position: -192px -96px;
+}
+
+.ui-icon-unlocked {
+ background-position: -208px -96px;
+}
+
+.ui-icon-bookmark {
+ background-position: -224px -96px;
+}
+
+.ui-icon-tag {
+ background-position: -240px -96px;
+}
+
+.ui-icon-home {
+ background-position: 0 -112px;
+}
+
+.ui-icon-flag {
+ background-position: -16px -112px;
+}
+
+.ui-icon-calendar {
+ background-position: -32px -112px;
+}
+
+.ui-icon-cart {
+ background-position: -48px -112px;
+}
+
+.ui-icon-pencil {
+ background-position: -64px -112px;
+}
+
+.ui-icon-clock {
+ background-position: -80px -112px;
+}
+
+.ui-icon-disk {
+ background-position: -96px -112px;
+}
+
+.ui-icon-calculator {
+ background-position: -112px -112px;
+}
+
+.ui-icon-zoomin {
+ background-position: -128px -112px;
+}
+
+.ui-icon-zoomout {
+ background-position: -144px -112px;
+}
+
+.ui-icon-search {
+ background-position: -160px -112px;
+}
+
+.ui-icon-wrench {
+ background-position: -176px -112px;
+}
+
+.ui-icon-gear {
+ background-position: -192px -112px;
+}
+
+.ui-icon-heart {
+ background-position: -208px -112px;
+}
+
+.ui-icon-star {
+ background-position: -224px -112px;
+}
+
+.ui-icon-link {
+ background-position: -240px -112px;
+}
+
+.ui-icon-cancel {
+ background-position: 0 -128px;
+}
+
+.ui-icon-plus {
+ background-position: -16px -128px;
+}
+
+.ui-icon-plusthick {
+ background-position: -32px -128px;
+}
+
+.ui-icon-minus {
+ background-position: -48px -128px;
+}
+
+.ui-icon-minusthick {
+ background-position: -64px -128px;
+}
+
+.ui-icon-close {
+ background-position: -80px -128px;
+}
+
+.ui-icon-closethick {
+ background-position: -96px -128px;
+}
+
+.ui-icon-key {
+ background-position: -112px -128px;
+}
+
+.ui-icon-lightbulb {
+ background-position: -128px -128px;
+}
+
+.ui-icon-scissors {
+ background-position: -144px -128px;
+}
+
+.ui-icon-clipboard {
+ background-position: -160px -128px;
+}
+
+.ui-icon-copy {
+ background-position: -176px -128px;
+}
+
+.ui-icon-contact {
+ background-position: -192px -128px;
+}
+
+.ui-icon-image {
+ background-position: -208px -128px;
+}
+
+.ui-icon-video {
+ background-position: -224px -128px;
+}
+
+.ui-icon-script {
+ background-position: -240px -128px;
+}
+
+.ui-icon-alert {
+ background-position: 0 -144px;
+}
+
+.ui-icon-info {
+ background-position: -16px -144px;
+}
+
+.ui-icon-notice {
+ background-position: -32px -144px;
+}
+
+.ui-icon-help {
+ background-position: -48px -144px;
+}
+
+.ui-icon-check {
+ background-position: -64px -144px;
+}
+
+.ui-icon-bullet {
+ background-position: -80px -144px;
+}
+
+.ui-icon-radio-on {
+ background-position: -96px -144px;
+}
+
+.ui-icon-radio-off {
+ background-position: -112px -144px;
+}
+
+.ui-icon-pin-w {
+ background-position: -128px -144px;
+}
+
+.ui-icon-pin-s {
+ background-position: -144px -144px;
+}
+
+.ui-icon-play {
+ background-position: 0 -160px;
+}
+
+.ui-icon-pause {
+ background-position: -16px -160px;
+}
+
+.ui-icon-seek-next {
+ background-position: -32px -160px;
+}
+
+.ui-icon-seek-prev {
+ background-position: -48px -160px;
+}
+
+.ui-icon-seek-end {
+ background-position: -64px -160px;
+}
+
+.ui-icon-seek-start {
+ background-position: -80px -160px;
+}
+
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first {
+ background-position: -80px -160px;
+}
+
+.ui-icon-stop {
+ background-position: -96px -160px;
+}
+
+.ui-icon-eject {
+ background-position: -112px -160px;
+}
+
+.ui-icon-volume-off {
+ background-position: -128px -160px;
+}
+
+.ui-icon-volume-on {
+ background-position: -144px -160px;
+}
+
+.ui-icon-power {
+ background-position: 0 -176px;
+}
+
+.ui-icon-signal-diag {
+ background-position: -16px -176px;
+}
+
+.ui-icon-signal {
+ background-position: -32px -176px;
+}
+
+.ui-icon-battery-0 {
+ background-position: -48px -176px;
+}
+
+.ui-icon-battery-1 {
+ background-position: -64px -176px;
+}
+
+.ui-icon-battery-2 {
+ background-position: -80px -176px;
+}
+
+.ui-icon-battery-3 {
+ background-position: -96px -176px;
+}
+
+.ui-icon-circle-plus {
+ background-position: 0 -192px;
+}
+
+.ui-icon-circle-minus {
+ background-position: -16px -192px;
+}
+
+.ui-icon-circle-close {
+ background-position: -32px -192px;
+}
+
+.ui-icon-circle-triangle-e {
+ background-position: -48px -192px;
+}
+
+.ui-icon-circle-triangle-s {
+ background-position: -64px -192px;
+}
+
+.ui-icon-circle-triangle-w {
+ background-position: -80px -192px;
+}
+
+.ui-icon-circle-triangle-n {
+ background-position: -96px -192px;
+}
+
+.ui-icon-circle-arrow-e {
+ background-position: -112px -192px;
+}
+
+.ui-icon-circle-arrow-s {
+ background-position: -128px -192px;
+}
+
+.ui-icon-circle-arrow-w {
+ background-position: -144px -192px;
+}
+
+.ui-icon-circle-arrow-n {
+ background-position: -160px -192px;
+}
+
+.ui-icon-circle-zoomin {
+ background-position: -176px -192px;
+}
+
+.ui-icon-circle-zoomout {
+ background-position: -192px -192px;
+}
+
+.ui-icon-circle-check {
+ background-position: -208px -192px;
+}
+
+.ui-icon-circlesmall-plus {
+ background-position: 0 -208px;
+}
+
+.ui-icon-circlesmall-minus {
+ background-position: -16px -208px;
+}
+
+.ui-icon-circlesmall-close {
+ background-position: -32px -208px;
+}
+
+.ui-icon-squaresmall-plus {
+ background-position: -48px -208px;
+}
+
+.ui-icon-squaresmall-minus {
+ background-position: -64px -208px;
+}
+
+.ui-icon-squaresmall-close {
+ background-position: -80px -208px;
+}
+
+.ui-icon-grip-dotted-vertical {
+ background-position: 0 -224px;
+}
+
+.ui-icon-grip-dotted-horizontal {
+ background-position: -16px -224px;
+}
+
+.ui-icon-grip-solid-vertical {
+ background-position: -32px -224px;
+}
+
+.ui-icon-grip-solid-horizontal {
+ background-position: -48px -224px;
+}
+
+.ui-icon-gripsmall-diagonal-se {
+ background-position: -64px -224px;
+}
+
+.ui-icon-grip-diagonal-se {
+ background-position: -80px -224px;
+}
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-all,
+.ui-corner-top,
+.ui-corner-left,
+.ui-corner-tl {
+ border-top-left-radius: 4px;
+}
+
+.ui-corner-all,
+.ui-corner-top,
+.ui-corner-right,
+.ui-corner-tr {
+ border-top-right-radius: 4px;
+}
+
+.ui-corner-all,
+.ui-corner-bottom,
+.ui-corner-left,
+.ui-corner-bl {
+ border-bottom-left-radius: 4px;
+}
+
+.ui-corner-all,
+.ui-corner-bottom,
+.ui-corner-right,
+.ui-corner-br {
+ border-bottom-right-radius: 4px;
+}
+
+/* Overlays */
+.ui-widget-overlay {
+ background: #666666 url("images/ui-bg_diagonals-thick_20_666666_40x40.png") 50% 50% repeat;
+ opacity: .5;
+ filter: Alpha(Opacity=50); /* support: IE8 */
+}
+
+.ui-widget-shadow {
+ margin: -5px 0 0 -5px;
+ padding: 5px;
+ background: #000000 url("images/ui-bg_flat_10_000000_40x100.png") 50% 50% repeat-x;
+ opacity: .2;
+ filter: Alpha(Opacity=20); /* support: IE8 */
+ border-radius: 5px;
+}
diff --git a/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.theme.min.css b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.theme.min.css new file mode 100644 index 00000000..e6654d08 --- /dev/null +++ b/uiframe-iui/src/main/resources/webroot/vendor/ict/ict-slider/jquery-ui-1.11.4.custom/jquery-ui.theme.min.css @@ -0,0 +1,882 @@ +/*! jQuery UI - v1.11.4 - 2015-04-16
+* http://jqueryui.com
+* Copyright 2015 jQuery Foundation and other contributors; Licensed MIT */
+
+.ui-widget {
+ font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif;
+ font-size: 1.1em
+}
+
+.ui-widget .ui-widget {
+ font-size: 1em
+}
+
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button {
+ font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif;
+ font-size: 1em
+}
+
+.ui-widget-content {
+ border: 1px solid #ddd;
+ background: #eee url("images/ui-bg_highlight-soft_100_eeeeee_1x100.png") 50% top repeat-x;
+ color: #333
+}
+
+.ui-widget-content a {
+ color: #333
+}
+
+.ui-widget-header {
+ border: 1px solid #e78f08;
+ background: #f6a828 url("images/ui-bg_gloss-wave_35_f6a828_500x100.png") 50% 50% repeat-x;
+ color: #fff;
+ font-weight: bold
+}
+
+.ui-widget-header a {
+ color: #fff
+}
+
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default {
+ border: 1px solid #ccc;
+ background: #f6f6f6 url("images/ui-bg_glass_100_f6f6f6_1x400.png") 50% 50% repeat-x;
+ font-weight: bold;
+ color: #1c94c4
+}
+
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited {
+ color: #1c94c4;
+ text-decoration: none
+}
+
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus {
+ border: 1px solid #fbcb09;
+ background: #fdf5ce url("images/ui-bg_glass_100_fdf5ce_1x400.png") 50% 50% repeat-x;
+ font-weight: bold;
+ color: #c77405
+}
+
+.ui-state-hover a, .ui-state-hover a:hover, .ui-state-hover a:link, .ui-state-hover a:visited, .ui-state-focus a, .ui-state-focus a:hover, .ui-state-focus a:link, .ui-state-focus a:visited {
+ color: #c77405;
+ text-decoration: none
+}
+
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active {
+ border: 1px solid #fbd850;
+ background: #fff url("images/ui-bg_glass_65_ffffff_1x400.png") 50% 50% repeat-x;
+ font-weight: bold;
+ color: #eb8f00
+}
+
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited {
+ color: #eb8f00;
+ text-decoration: none
+}
+
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {
+ border: 1px solid #fed22f;
+ background: #ffe45c url("images/ui-bg_highlight-soft_75_ffe45c_1x100.png") 50% top repeat-x;
+ color: #363636
+}
+
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a, .ui-widget-header .ui-state-highlight a {
+ color: #363636
+}
+
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {
+ border: 1px solid #cd0a0a;
+ background: #b81900 url("images/ui-bg_diagonals-thick_18_b81900_40x40.png") 50% 50% repeat;
+ color: #fff
+}
+
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a {
+ color: #fff
+}
+
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text {
+ color: #fff
+}
+
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary {
+ font-weight: bold
+}
+
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary {
+ opacity: .7;
+ filter: Alpha(Opacity=70);
+ font-weight: normal
+}
+
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled {
+ opacity: .35;
+ filter: Alpha(Opacity=35);
+ background-image: none
+}
+
+.ui-state-disabled .ui-icon {
+ filter: Alpha(Opacity=35)
+}
+
+.ui-icon {
+ width: 16px;
+ height: 16px
+}
+
+.ui-icon, .ui-widget-content .ui-icon {
+ background-image: url("images/ui-icons_222222_256x240.png")
+}
+
+.ui-widget-header .ui-icon {
+ background-image: url("images/ui-icons_ffffff_256x240.png")
+}
+
+.ui-state-default .ui-icon {
+ background-image: url("images/ui-icons_ef8c08_256x240.png")
+}
+
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {
+ background-image: url("images/ui-icons_ef8c08_256x240.png")
+}
+
+.ui-state-active .ui-icon {
+ background-image: url("images/ui-icons_ef8c08_256x240.png")
+}
+
+.ui-state-highlight .ui-icon {
+ background-image: url("images/ui-icons_228ef1_256x240.png")
+}
+
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {
+ background-image: url("images/ui-icons_ffd27a_256x240.png")
+}
+
+.ui-icon-blank {
+ background-position: 16px 16px
+}
+
+.ui-icon-carat-1-n {
+ background-position: 0 0
+}
+
+.ui-icon-carat-1-ne {
+ background-position: -16px 0
+}
+
+.ui-icon-carat-1-e {
+ background-position: -32px 0
+}
+
+.ui-icon-carat-1-se {
+ background-position: -48px 0
+}
+
+.ui-icon-carat-1-s {
+ background-position: -64px 0
+}
+
+.ui-icon-carat-1-sw {
+ background-position: -80px 0
+}
+
+.ui-icon-carat-1-w {
+ background-position: -96px 0
+}
+
+.ui-icon-carat-1-nw {
+ background-position: -112px 0
+}
+
+.ui-icon-carat-2-n-s {
+ background-position: -128px 0
+}
+
+.ui-icon-carat-2-e-w {
+ background-position: -144px 0
+}
+
+.ui-icon-triangle-1-n {
+ background-position: 0 -16px
+}
+
+.ui-icon-triangle-1-ne {
+ background-position: -16px -16px
+}
+
+.ui-icon-triangle-1-e {
+ background-position: -32px -16px
+}
+
+.ui-icon-triangle-1-se {
+ background-position: -48px -16px
+}
+
+.ui-icon-triangle-1-s {
+ background-position: -64px -16px
+}
+
+.ui-icon-triangle-1-sw {
+ background-position: -80px -16px
+}
+
+.ui-icon-triangle-1-w {
+ background-position: -96px -16px
+}
+
+.ui-icon-triangle-1-nw {
+ background-position: -112px -16px
+}
+
+.ui-icon-triangle-2-n-s {
+ background-position: -128px -16px
+}
+
+.ui-icon-triangle-2-e-w {
+ background-position: -144px -16px
+}
+
+.ui-icon-arrow-1-n {
+ background-position: 0 -32px
+}
+
+.ui-icon-arrow-1-ne {
+ background-position: -16px -32px
+}
+
+.ui-icon-arrow-1-e {
+ background-position: -32px -32px
+}
+
+.ui-icon-arrow-1-se {
+ background-position: -48px -32px
+}
+
+.ui-icon-arrow-1-s {
+ background-position: -64px -32px
+}
+
+.ui-icon-arrow-1-sw {
+ background-position: -80px -32px
+}
+
+.ui-icon-arrow-1-w {
+ background-position: -96px -32px
+}
+
+.ui-icon-arrow-1-nw {
+ background-position: -112px -32px
+}
+
+.ui-icon-arrow-2-n-s {
+ background-position: -128px -32px
+}
+
+.ui-icon-arrow-2-ne-sw {
+ background-position: -144px -32px
+}
+
+.ui-icon-arrow-2-e-w {
+ background-position: -160px -32px
+}
+
+.ui-icon-arrow-2-se-nw {
+ background-position: -176px -32px
+}
+
+.ui-icon-arrowstop-1-n {
+ background-position: -192px -32px
+}
+
+.ui-icon-arrowstop-1-e {
+ background-position: -208px -32px
+}
+
+.ui-icon-arrowstop-1-s {
+ background-position: -224px -32px
+}
+
+.ui-icon-arrowstop-1-w {
+ background-position: -240px -32px
+}
+
+.ui-icon-arrowthick-1-n {
+ background-position: 0 -48px
+}
+
+.ui-icon-arrowthick-1-ne {
+ background-position: -16px -48px
+}
+
+.ui-icon-arrowthick-1-e {
+ background-position: -32px -48px
+}
+
+.ui-icon-arrowthick-1-se {
+ background-position: -48px -48px
+}
+
+.ui-icon-arrowthick-1-s {
+ background-position: -64px -48px
+}
+
+.ui-icon-arrowthick-1-sw {
+ background-position: -80px -48px
+}
+
+.ui-icon-arrowthick-1-w {
+ background-position: -96px -48px
+}
+
+.ui-icon-arrowthick-1-nw {
+ background-position: -112px -48px
+}
+
+.ui-icon-arrowthick-2-n-s {
+ background-position: -128px -48px
+}
+
+.ui-icon-arrowthick-2-ne-sw {
+ background-position: -144px -48px
+}
+
+.ui-icon-arrowthick-2-e-w {
+ background-position: -160px -48px
+}
+
+.ui-icon-arrowthick-2-se-nw {
+ background-position: -176px -48px
+}
+
+.ui-icon-arrowthickstop-1-n {
+ background-position: -192px -48px
+}
+
+.ui-icon-arrowthickstop-1-e {
+ background-position: -208px -48px
+}
+
+.ui-icon-arrowthickstop-1-s {
+ background-position: -224px -48px
+}
+
+.ui-icon-arrowthickstop-1-w {
+ background-position: -240px -48px
+}
+
+.ui-icon-arrowreturnthick-1-w {
+ background-position: 0 -64px
+}
+
+.ui-icon-arrowreturnthick-1-n {
+ background-position: -16px -64px
+}
+
+.ui-icon-arrowreturnthick-1-e {
+ background-position: -32px -64px
+}
+
+.ui-icon-arrowreturnthick-1-s {
+ background-position: -48px -64px
+}
+
+.ui-icon-arrowreturn-1-w {
+ background-position: -64px -64px
+}
+
+.ui-icon-arrowreturn-1-n {
+ background-position: -80px -64px
+}
+
+.ui-icon-arrowreturn-1-e {
+ background-position: -96px -64px
+}
+
+.ui-icon-arrowreturn-1-s {
+ background-position: -112px -64px
+}
+
+.ui-icon-arrowrefresh-1-w {
+ background-position: -128px -64px
+}
+
+.ui-icon-arrowrefresh-1-n {
+ background-position: -144px -64px
+}
+
+.ui-icon-arrowrefresh-1-e {
+ background-position: -160px -64px
+}
+
+.ui-icon-arrowrefresh-1-s {
+ background-position: -176px -64px
+}
+
+.ui-icon-arrow-4 {
+ background-position: 0 -80px
+}
+
+.ui-icon-arrow-4-diag {
+ background-position: -16px -80px
+}
+
+.ui-icon-extlink {
+ background-position: -32px -80px
+}
+
+.ui-icon-newwin {
+ background-position: -48px -80px
+}
+
+.ui-icon-refresh {
+ background-position: -64px -80px
+}
+
+.ui-icon-shuffle {
+ background-position: -80px -80px
+}
+
+.ui-icon-transfer-e-w {
+ background-position: -96px -80px
+}
+
+.ui-icon-transferthick-e-w {
+ background-position: -112px -80px
+}
+
+.ui-icon-folder-collapsed {
+ background-position: 0 -96px
+}
+
+.ui-icon-folder-open {
+ background-position: -16px -96px
+}
+
+.ui-icon-document {
+ background-position: -32px -96px
+}
+
+.ui-icon-document-b {
+ background-position: -48px -96px
+}
+
+.ui-icon-note {
+ background-position: -64px -96px
+}
+
+.ui-icon-mail-closed {
+ background-position: -80px -96px
+}
+
+.ui-icon-mail-open {
+ background-position: -96px -96px
+}
+
+.ui-icon-suitcase {
+ background-position: -112px -96px
+}
+
+.ui-icon-comment {
+ background-position: -128px -96px
+}
+
+.ui-icon-person {
+ background-position: -144px -96px
+}
+
+.ui-icon-print {
+ background-position: -160px -96px
+}
+
+.ui-icon-trash {
+ background-position: -176px -96px
+}
+
+.ui-icon-locked {
+ background-position: -192px -96px
+}
+
+.ui-icon-unlocked {
+ background-position: -208px -96px
+}
+
+.ui-icon-bookmark {
+ background-position: -224px -96px
+}
+
+.ui-icon-tag {
+ background-position: -240px -96px
+}
+
+.ui-icon-home {
+ background-position: 0 -112px
+}
+
+.ui-icon-flag {
+ background-position: -16px -112px
+}
+
+.ui-icon-calendar {
+ background-position: -32px -112px
+}
+
+.ui-icon-cart {
+ background-position: -48px -112px
+}
+
+.ui-icon-pencil {
+ background-position: -64px -112px
+}
+
+.ui-icon-clock {
+ background-position: -80px -112px
+}
+
+.ui-icon-disk {
+ background-position: -96px -112px
+}
+
+.ui-icon-calculator {
+ background-position: -112px -112px
+}
+
+.ui-icon-zoomin {
+ background-position: -128px -112px
+}
+
+.ui-icon-zoomout {
+ background-position: -144px -112px
+}
+
+.ui-icon-search {
+ background-position: -160px -112px
+}
+
+.ui-icon-wrench {
+ background-position: -176px -112px
+}
+
+.ui-icon-gear {
+ background-position: -192px -112px
+}
+
+.ui-icon-heart {
+ background-position: -208px -112px
+}
+
+.ui-icon-star {
+ background-position: -224px -112px
+}
+
+.ui-icon-link {
+ background-position: -240px -112px
+}
+
+.ui-icon-cancel {
+ background-position: 0 -128px
+}
+
+.ui-icon-plus {
+ background-position: -16px -128px
+}
+
+.ui-icon-plusthick {
+ background-position: -32px -128px
+}
+
+.ui-icon-minus {
+ background-position: -48px -128px
+}
+
+.ui-icon-minusthick {
+ background-position: -64px -128px
+}
+
+.ui-icon-close {
+ background-position: -80px -128px
+}
+
+.ui-icon-closethick {
+ background-position: -96px -128px
+}
+
+.ui-icon-key {
+ background-position: -112px -128px
+}
+
+.ui-icon-lightbulb {
+ background-position: -128px -128px
+}
+
+.ui-icon-scissors {
+ background-position: -144px -128px
+}
+
+.ui-icon-clipboard {
+ background-position: -160px -128px
+}
+
+.ui-icon-copy {
+ background-position: -176px -128px
+}
+
+.ui-icon-contact {
+ background-position: -192px -128px
+}
+
+.ui-icon-image {
+ background-position: -208px -128px
+}
+
+.ui-icon-video {
+ background-position: -224px -128px
+}
+
+.ui-icon-script {
+ background-position: -240px -128px
+}
+
+.ui-icon-alert {
+ background-position: 0 -144px
+}
+
+.ui-icon-info {
+ background-position: -16px -144px
+}
+
+.ui-icon-notice {
+ background-position: -32px -144px
+}
+
+.ui-icon-help {
+ background-position: -48px -144px
+}
+
+.ui-icon-check {
+ background-position: -64px -144px
+}
+
+.ui-icon-bullet {
+ background-position: -80px -144px
+}
+
+.ui-icon-radio-on {
+ background-position: -96px -144px
+}
+
+.ui-icon-radio-off {
+ background-position: -112px -144px
+}
+
+.ui-icon-pin-w {
+ background-position: -128px -144px
+}
+
+.ui-icon-pin-s {
+ background-position: -144px -144px
+}
+
+.ui-icon-play {
+ background-position: 0 -160px
+}
+
+.ui-icon-pause {
+ background-position: -16px -160px
+}
+
+.ui-icon-seek-next {
+ background-position: -32px -160px
+}
+
+.ui-icon-seek-prev {
+ background-position: -48px -160px
+}
+
+.ui-icon-seek-end {
+ background-position: -64px -160px
+}
+
+.ui-icon-seek-start {
+ background-position: -80px -160px
+}
+
+.ui-icon-seek-first {
+ background-position: -80px -160px
+}
+
+.ui-icon-stop {
+ background-position: -96px -160px
+}
+
+.ui-icon-eject {
+ background-position: -112px -160px
+}
+
+.ui-icon-volume-off {
+ background-position: -128px -160px
+}
+
+.ui-icon-volume-on {
+ background-position: -144px -160px
+}
+
+.ui-icon-power {
+ background-position: 0 -176px
+}
+
+.ui-icon-signal-diag {
+ background-position: -16px -176px
+}
+
+.ui-icon-signal {
+ background-position: -32px -176px
+}
+
+.ui-icon-battery-0 {
+ background-position: -48px -176px
+}
+
+.ui-icon-battery-1 {
+ background-position: -64px -176px
+}
+
+.ui-icon-battery-2 {
+ background-position: -80px -176px
+}
+
+.ui-icon-battery-3 {
+ background-position: -96px -176px
+}
+
+.ui-icon-circle-plus {
+ background-position: 0 -192px
+}
+
+.ui-icon-circle-minus {
+ background-position: -16px -192px
+}
+
+.ui-icon-circle-close {
+ background-position: -32px -192px
+}
+
+.ui-icon-circle-triangle-e {
+ background-position: -48px -192px
+}
+
+.ui-icon-circle-triangle-s {
+ background-position: -64px -192px
+}
+
+.ui-icon-circle-triangle-w {
+ background-position: -80px -192px
+}
+
+.ui-icon-circle-triangle-n {
+ background-position: -96px -192px
+}
+
+.ui-icon-circle-arrow-e {
+ background-position: -112px -192px
+}
+
+.ui-icon-circle-arrow-s {
+ background-position: -128px -192px
+}
+
+.ui-icon-circle-arrow-w {
+ background-position: -144px -192px
+}
+
+.ui-icon-circle-arrow-n {
+ background-position: -160px -192px
+}
+
+.ui-icon-circle-zoomin {
+ background-position: -176px -192px
+}
+
+.ui-icon-circle-zoomout {
+ background-position: -192px -192px
+}
+
+.ui-icon-circle-check {
+ background-position: -208px -192px
+}
+
+.ui-icon-circlesmall-plus {
+ background-position: 0 -208px
+}
+
+.ui-icon-circlesmall-minus {
+ background-position: -16px -208px
+}
+
+.ui-icon-circlesmall-close {
+ background-position: -32px -208px
+}
+
+.ui-icon-squaresmall-plus {
+ background-position: -48px -208px
+}
+
+.ui-icon-squaresmall-minus {
+ background-position: -64px -208px
+}
+
+.ui-icon-squaresmall-close {
+ background-position: -80px -208px
+}
+
+.ui-icon-grip-dotted-vertical {
+ background-position: 0 -224px
+}
+
+.ui-icon-grip-dotted-horizontal {
+ background-position: -16px -224px
+}
+
+.ui-icon-grip-solid-vertical {
+ background-position: -32px -224px
+}
+
+.ui-icon-grip-solid-horizontal {
+ background-position: -48px -224px
+}
+
+.ui-icon-gripsmall-diagonal-se {
+ background-position: -64px -224px
+}
+
+.ui-icon-grip-diagonal-se {
+ background-position: -80px -224px
+}
+
+.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl {
+ border-top-left-radius: 4px
+}
+
+.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr {
+ border-top-right-radius: 4px
+}
+
+.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl {
+ border-bottom-left-radius: 4px
+}
+
+.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br {
+ border-bottom-right-radius: 4px
+}
+
+.ui-widget-overlay {
+ background: #666 url("images/ui-bg_diagonals-thick_20_666666_40x40.png") 50% 50% repeat;
+ opacity: .5;
+ filter: Alpha(Opacity=50)
+}
+
+.ui-widget-shadow {
+ margin: -5px 0 0 -5px;
+ padding: 5px;
+ background: #000 url("images/ui-bg_flat_10_000000_40x100.png") 50% 50% repeat-x;
+ opacity: .2;
+ filter: Alpha(Opacity=20);
+ border-radius: 5px
+}
\ No newline at end of file |
