summaryrefslogtreecommitdiffstats
path: root/adapters
diff options
context:
space:
mode:
Diffstat (limited to 'adapters')
-rw-r--r--adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/pom.xml5
-rw-r--r--adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/extclients/EtsiPackageProvider.java (renamed from adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/extclients/SdcPackageProvider.java)79
-rw-r--r--adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/extclients/vnfm/VnfmRestTemplateConfiguration.java56
-rw-r--r--adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/extclients/vnfm/VnfmServiceProviderConfiguration.java3
-rw-r--r--adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/lifecycle/LifecycleManager.java27
-rw-r--r--adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/test/java/org/onap/so/adapters/etsisol003adapter/lcm/rest/EtsiSol003AdapterControllerTest.java9
-rw-r--r--adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/test/java/org/onap/so/adapters/etsisol003adapter/lcm/rest/Sol003LcnControllerTest.java4
-rw-r--r--adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-api/src/main/resources/etsisol003adapter.yaml5
-rw-r--r--adapters/etsi-sol003-adapter/etsi-sol003-pkgm/etsi-sol003-pkgm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/pkgm/rest/exceptions/EtsiCatalogManagerRequestFailureException.java4
-rw-r--r--adapters/mso-adapter-utils/pom.xml5
-rw-r--r--adapters/mso-adapter-utils/src/main/java/org/onap/so/cloud/authentication/AuthenticationMethodFactory.java28
-rw-r--r--adapters/mso-adapter-utils/src/main/java/org/onap/so/cloud/authentication/KeystoneV3Authentication.java2
-rw-r--r--adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/beans/DeploymentInfo.java91
-rw-r--r--adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/beans/DeploymentInfoBuilder.java110
-rw-r--r--adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoCloudifyException.java88
-rw-r--r--adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoCloudifyTimeout.java66
-rw-r--r--adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoCloudifyWorkflowException.java54
-rw-r--r--adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/utils/MsoCloudifyUtils.java1356
-rw-r--r--adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MsoCommonUtils.java21
-rw-r--r--adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudCreateHeatResponse.java2
-rw-r--r--adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudCreateLinkResponse.java2
-rw-r--r--adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudCreateResponse.java2
-rw-r--r--adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudQueryResponse.java2
-rw-r--r--adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudRequest.java2
-rw-r--r--adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/NovaClient.java2
-rw-r--r--adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/beans/DeploymentInfoBuilderTest.java159
-rw-r--r--adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/exceptions/MsoCloudifyExceptionTest.java34
-rw-r--r--adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/exceptions/MsoCloudifyTest.java30
-rw-r--r--adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/exceptions/MsoCloudifyTimeoutTest.java33
-rw-r--r--adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/exceptions/MsoCloudifyWorkflowExceptionTest.java31
-rw-r--r--adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/utils/MsoCloudifyUtilsTest.java336
-rw-r--r--adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceMacroHolder.java10
-rw-r--r--adapters/mso-catalog-db-adapter/src/main/resources/db/migration/R__MacroData.sql15
-rw-r--r--adapters/mso-catalog-db-adapter/src/main/resources/db/migration/V1.1__Initial_Recipe_Setup.sql13
-rw-r--r--adapters/mso-cnf-adapter/pom.xml4
-rw-r--r--adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/MSOCnfApplication.java7
-rw-r--r--adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/exceptions/ApplicationException.java66
-rw-r--r--adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/BpmnInstanceRequest.java87
-rw-r--r--adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/ErrorResponse.java (renamed from adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/ErrorResponse.java)2
-rw-r--r--adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/GroupVersionKind.java66
-rw-r--r--adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceMiniResponse.java62
-rw-r--r--adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceMiniResponseList.java45
-rw-r--r--adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceResponse.java87
-rw-r--r--adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceStatusResponse.java84
-rw-r--r--adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/MulticloudInstanceRequest.java (renamed from adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceEntity.java)13
-rw-r--r--adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/PodStatus.java71
-rw-r--r--adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/Resource.java54
-rw-r--r--adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/Response.java39
-rw-r--r--adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/rest/CnfAdapterRest.java496
-rw-r--r--adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/service/CnfAdapterService.java269
-rw-r--r--adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/util/CNfAdapterUtil.java94
-rw-r--r--adapters/mso-cnf-adapter/src/main/resources/META-INF/services/org.onap.so.client.RestProperties2
-rw-r--r--adapters/mso-cnf-adapter/src/main/resources/application.yaml4
-rw-r--r--adapters/mso-cnf-adapter/src/test/java/org/onap/so/adapters/cnf/CnfAdapterRestTest.java63
-rw-r--r--adapters/mso-cnf-adapter/src/test/java/org/onap/so/adapters/cnf/rest/CnfAdapterRestTest.java161
-rw-r--r--adapters/mso-cnf-adapter/src/test/java/org/onap/so/adapters/cnf/service/CnfAdapterServiceTest.java139
-rw-r--r--adapters/mso-nssmf-adapter/pom.xml1
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/MSONssmfApplication.java1
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/annotation/ServiceLogger.java36
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/config/NssmfAdapterConfig.java36
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/config/RequestDbConfig.java (renamed from adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/RequestDbConfig.java)2
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/config/WebSecurityConfig.java (renamed from adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/WebSecurityConfig.java)2
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/consts/NssmfAdapterConsts.java187
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/controller/NssmfAdapterController.java57
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/ErrorResponse.java63
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/NssmfInfo.java (renamed from adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/beans/DeploymentStatus.java)32
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/NssmfUrlInfo.java17
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/RestResponse.java (renamed from adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/RestResponse.java)2
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/TokenRequest.java (renamed from adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/TokenRequest.java)29
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/TokenResponse.java (renamed from adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/TokenResponse.java)22
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/ActionType.java55
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/ExecutorType.java25
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/HttpMethod.java (renamed from adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/HttpMethod.java)2
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/JobStatus.java (renamed from adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/JobStatus.java)2
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/SelectionType.java27
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/exceptions/ApplicationException.java2
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiServiceProvider.java4
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiServiceProviderImpl.java10
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/interceptor/LoggerInterceptor.java92
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/NssmfManager.java44
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/NssmfManagerBuilder.java125
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/BaseNssmfManager.java267
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/ExternalNssmfManager.java187
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/InternalNssmfManager.java129
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/external/ExternalAnNssmfManager.java117
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/external/ExternalCnNssmfManager.java53
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/internal/InternalAnNssmfManager.java54
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/internal/InternalCnNssmfManager.java56
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/internal/InternalTnNssmfManager.java42
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfAdapterRest.java64
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfInfo.java94
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfManager.java34
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/TrustAllHostNameVerifier.java1
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/service/NssmfManagerService.java45
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/service/impl/NssmfManagerServiceImpl.java143
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/util/NssmfAdapterUtil.java29
-rw-r--r--adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/util/RestUtil.java (renamed from adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/RestUtil.java)64
-rw-r--r--adapters/mso-nssmf-adapter/src/main/resources/application-test.yaml60
-rw-r--r--adapters/mso-nssmf-adapter/src/main/resources/application.yaml3
-rw-r--r--adapters/mso-nssmf-adapter/src/test/java/org/onap/so/adapters/nssmf/NssmfAdapterRestTest.java335
-rw-r--r--adapters/mso-nssmf-adapter/src/test/java/org/onap/so/adapters/nssmf/service/impl/NssmfManagerServiceImplTest.java438
-rw-r--r--adapters/mso-nssmf-adapter/src/test/resources/application-test.yaml60
-rw-r--r--adapters/mso-oof-adapter/.gitignore33
-rw-r--r--adapters/mso-oof-adapter/pom.xml120
-rw-r--r--adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/MsoOofAdapterApplication.java (renamed from adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoDeploymentAlreadyExists.java)22
-rw-r--r--adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/OofAdapterClientConfig.java76
-rw-r--r--adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/WebSecurityConfig.java37
-rw-r--r--adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/constants/Constants.java (renamed from adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoBlueprintAlreadyExists.java)25
-rw-r--r--adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/exceptions/OofAdapterException.java (renamed from adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoCloudifyManagerNotFound.java)24
-rw-r--r--adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/model/OofRequest.java52
-rw-r--r--adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/rest/OofCallbackHandler.java71
-rw-r--r--adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/rest/OofClient.java67
-rw-r--r--adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/utils/OofUtils.java110
-rw-r--r--adapters/mso-oof-adapter/src/test/java/org/onap/so/adapters/oof/rest/OofCallbackHandlerTest.java85
-rw-r--r--adapters/mso-oof-adapter/src/test/java/org/onap/so/adapters/oof/rest/OofClientTest.java86
-rw-r--r--adapters/mso-oof-adapter/src/test/java/org/onap/so/adapters/oof/utils/OofUtilsTest.java76
-rw-r--r--adapters/mso-oof-adapter/src/test/resources/testInputs/NsiSelectionOofRequest.json84
-rw-r--r--adapters/mso-oof-adapter/src/test/resources/testInputs/NsiSelectionResponse.json20
-rw-r--r--adapters/mso-openstack-adapters/pom.xml2
-rw-r--r--adapters/mso-openstack-adapters/src/main/java/org/onap/so/adapters/inventory/delete/DeleteAAIInventory.java6
-rw-r--r--adapters/mso-openstack-adapters/src/main/java/org/onap/so/adapters/tasks/inventory/CreateAAIInventory.java10
-rw-r--r--adapters/mso-openstack-adapters/src/main/java/org/onap/so/heatbridge/HeatBridgeApi.java2
-rw-r--r--adapters/mso-openstack-adapters/src/main/java/org/onap/so/heatbridge/HeatBridgeImpl.java295
-rw-r--r--adapters/mso-openstack-adapters/src/main/java/org/onap/so/heatbridge/helpers/AaiHelper.java3
-rw-r--r--adapters/mso-openstack-adapters/src/test/java/org/onap/so/heatbridge/HeatBridgeImplTest.java172
-rw-r--r--adapters/pom.xml1
126 files changed, 6068 insertions, 3162 deletions
diff --git a/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/pom.xml b/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/pom.xml
index 8359fd3829..6ed9afcc75 100644
--- a/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/pom.xml
+++ b/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/pom.xml
@@ -105,5 +105,10 @@
<artifactId>junit</artifactId>
<scope>test</scope>
</dependency>
+ <dependency>
+ <groupId>org.onap.so.adapters</groupId>
+ <artifactId>etsi-sol003-pkgm-adapter</artifactId>
+ <version>${project.version}</version>
+ </dependency>
</dependencies>
</project>
diff --git a/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/extclients/SdcPackageProvider.java b/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/extclients/EtsiPackageProvider.java
index 497de2874c..c5164c1833 100644
--- a/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/extclients/SdcPackageProvider.java
+++ b/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/extclients/EtsiPackageProvider.java
@@ -24,38 +24,25 @@ package org.onap.so.adapters.etsisol003adapter.lcm.extclients;
import static com.google.common.base.Splitter.on;
import static com.google.common.collect.Iterables.filter;
-import static com.google.common.io.ByteStreams.toByteArray;
-import static java.lang.String.format;
-import static org.apache.http.HttpHeaders.ACCEPT;
-import static org.apache.http.HttpHeaders.AUTHORIZATION;
import static org.onap.so.adapters.etsisol003adapter.lcm.NvfmAdapterUtils.abortOperation;
import static org.onap.so.adapters.etsisol003adapter.lcm.NvfmAdapterUtils.child;
import static org.onap.so.adapters.etsisol003adapter.lcm.NvfmAdapterUtils.childElement;
import static org.onap.so.adapters.etsisol003adapter.lcm.NvfmAdapterUtils.children;
import static org.slf4j.LoggerFactory.getLogger;
-import static org.springframework.http.MediaType.APPLICATION_OCTET_STREAM_VALUE;
import java.io.ByteArrayInputStream;
import java.io.ByteArrayOutputStream;
import java.io.IOException;
import java.io.InputStream;
-import java.nio.charset.StandardCharsets;
import java.util.HashSet;
-import java.util.Iterator;
-import java.util.List;
import java.util.NoSuchElementException;
+import java.util.Optional;
import java.util.Set;
import java.util.zip.ZipEntry;
import java.util.zip.ZipInputStream;
-import javax.net.ssl.SSLContext;
-import org.apache.commons.codec.binary.Base64;
-import org.apache.http.HttpEntity;
-import org.apache.http.client.methods.CloseableHttpResponse;
-import org.apache.http.client.methods.HttpGet;
-import org.apache.http.impl.client.CloseableHttpClient;
-import org.apache.http.impl.client.HttpClients;
-import org.onap.so.utils.CryptoUtils;
+import org.onap.so.adapters.etsisol003adapter.pkgm.extclients.etsicatalog.EtsiCatalogServiceProviderImpl;
+import org.onap.so.adapters.etsisol003adapter.pkgm.rest.exceptions.EtsiCatalogManagerRequestFailureException;
import org.slf4j.Logger;
-import org.springframework.beans.factory.annotation.Value;
+import org.springframework.beans.factory.annotation.Autowired;
import org.springframework.stereotype.Component;
import org.yaml.snakeyaml.Yaml;
import com.google.common.io.ByteStreams;
@@ -63,21 +50,13 @@ import com.google.gson.Gson;
import com.google.gson.JsonObject;
@Component
-public class SdcPackageProvider {
- private static final String GET_PACKAGE_URL = "%s/sdc/v1/catalog/resources/%s/toscaModel";
- @Value("${sdc.toscametapath:TOSCA-Metadata/TOSCA.meta}")
- private List<String> toscaMetaPaths;
+public class EtsiPackageProvider {
+ private static final String TOCSA_METADATA_FILE_PATH = "TOSCA-Metadata/TOSCA.meta";
private static final String TOSCA_VNFD_KEY = "Entry-Definitions";
- private static Logger logger = getLogger(SdcPackageProvider.class);
+ private static Logger logger = getLogger(EtsiPackageProvider.class);
- @Value("${sdc.username}")
- private String sdcUsername;
- @Value("${sdc.password}")
- private String sdcPassword;
- @Value("${sdc.key}")
- private String sdcKey;
- @Value("${sdc.endpoint}")
- private String baseUrl;
+ @Autowired
+ private EtsiCatalogServiceProviderImpl etsiCatalogServiceProviderImpl;
public String getVnfdId(final String csarId) {
return getVnfNodeProperty(csarId, "descriptor_id");
@@ -133,35 +112,25 @@ public class SdcPackageProvider {
}
private byte[] getPackage(final String csarId) {
- final String SERVICE_NAME = "vnfm-adapter";
- try (CloseableHttpClient client = HttpClients.custom().setSSLContext(SSLContext.getDefault()).build()) {
- final HttpGet httpget = new HttpGet(format(GET_PACKAGE_URL, baseUrl, csarId));
- httpget.setHeader(ACCEPT, APPLICATION_OCTET_STREAM_VALUE);
- httpget.setHeader("X-ECOMP-InstanceID", SERVICE_NAME);
- httpget.setHeader("X-FromAppId", SERVICE_NAME);
- final String auth = sdcUsername + ":" + CryptoUtils.decrypt(sdcPassword, sdcKey);
- final byte[] encodedAuth = Base64.encodeBase64(auth.getBytes(StandardCharsets.ISO_8859_1));
- final String authHeader = "Basic " + new String(encodedAuth);
- httpget.setHeader(AUTHORIZATION, authHeader);
- logger.debug("Fetching from SDC: " + httpget);
- final CloseableHttpResponse response = client.execute(httpget);
- final HttpEntity entity = response.getEntity();
- final InputStream is = entity.getContent();
- return toByteArray(is);
- } catch (final Exception e) {
- throw abortOperation("Unable to download " + csarId + " package from SDC", e);
+ try {
+ final Optional<byte[]> optional = etsiCatalogServiceProviderImpl.getVnfPackageContent(csarId);
+ if (optional.isPresent()) {
+ return optional.get();
+ }
+ } catch (final Exception exception) {
+ logger.error("Unable to retrieve package from ETSI Catalog Manager using pkgId: {}", csarId);
+ throw new EtsiCatalogManagerRequestFailureException("Value is not present", exception);
}
+ logger.error("Unable to retrieve package from ETSI Catalog Manager using pkgId: {}", csarId);
+ throw new EtsiCatalogManagerRequestFailureException("Value is not present");
}
private String getVnfdLocation(final InputStream stream) throws IOException {
- final Iterator<String> pathIterator = toscaMetaPaths.iterator();
- while (pathIterator.hasNext()) {
- final String toscaMetadata = new String(getFileInZip(stream, pathIterator.next()).toByteArray());
- if (!toscaMetadata.isEmpty()) {
- final String toscaVnfdLine =
- filter(on("\n").split(toscaMetadata), line -> line.contains(TOSCA_VNFD_KEY)).iterator().next();
- return toscaVnfdLine.replace(TOSCA_VNFD_KEY + ":", "").trim();
- }
+ final String toscaMetadata = new String(getFileInZip(stream, TOCSA_METADATA_FILE_PATH).toByteArray());
+ if (!toscaMetadata.isEmpty()) {
+ final String toscaVnfdLine =
+ filter(on("\n").split(toscaMetadata), line -> line.contains(TOSCA_VNFD_KEY)).iterator().next();
+ return toscaVnfdLine.replace(TOSCA_VNFD_KEY + ":", "").trim();
}
throw abortOperation("Unable to find valid Tosca Path");
}
diff --git a/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/extclients/vnfm/VnfmRestTemplateConfiguration.java b/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/extclients/vnfm/VnfmRestTemplateConfiguration.java
new file mode 100644
index 0000000000..2c7ddd1d49
--- /dev/null
+++ b/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/extclients/vnfm/VnfmRestTemplateConfiguration.java
@@ -0,0 +1,56 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * Copyright (C) 2020 Nordix Foundation.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *
+ * SPDX-License-Identifier: Apache-2.0
+ * ============LICENSE_END=========================================================
+ */
+package org.onap.so.adapters.etsisol003adapter.lcm.extclients.vnfm;
+
+import org.onap.logging.filter.spring.SpringClientPayloadFilter;
+import org.onap.so.configuration.rest.HttpComponentsClientConfiguration;
+import org.onap.so.logging.jaxrs.filter.SOSpringClientFilter;
+import org.springframework.beans.factory.annotation.Autowired;
+import org.springframework.beans.factory.annotation.Qualifier;
+import org.springframework.context.annotation.Bean;
+import org.springframework.context.annotation.Configuration;
+import org.springframework.http.client.BufferingClientHttpRequestFactory;
+import org.springframework.http.client.HttpComponentsClientHttpRequestFactory;
+import org.springframework.web.client.RestTemplate;
+
+/**
+ * @author Waqas Ikram (waqas.ikram@est.tech)
+ *
+ */
+@Configuration
+public class VnfmRestTemplateConfiguration {
+
+ public static final String SOL003_LCM_REST_TEMPLATE = "Sol003LcmRestTemplate";
+
+ @Autowired
+ private HttpComponentsClientConfiguration httpComponentsClientConfiguration;
+
+ @Bean
+ @Qualifier(SOL003_LCM_REST_TEMPLATE)
+ public RestTemplate sol003LcmRestTemplate() {
+ final HttpComponentsClientHttpRequestFactory clientHttpRequestFactory =
+ httpComponentsClientConfiguration.httpComponentsClientHttpRequestFactory();
+ final RestTemplate restTemplate =
+ new RestTemplate(new BufferingClientHttpRequestFactory(clientHttpRequestFactory));
+ restTemplate.getInterceptors().add(new SOSpringClientFilter());
+ restTemplate.getInterceptors().add((new SpringClientPayloadFilter()));
+ return restTemplate;
+ }
+}
diff --git a/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/extclients/vnfm/VnfmServiceProviderConfiguration.java b/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/extclients/vnfm/VnfmServiceProviderConfiguration.java
index da727b395a..1ed3ec9ff2 100644
--- a/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/extclients/vnfm/VnfmServiceProviderConfiguration.java
+++ b/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/extclients/vnfm/VnfmServiceProviderConfiguration.java
@@ -20,7 +20,6 @@
package org.onap.so.adapters.etsisol003adapter.lcm.extclients.vnfm;
-import static org.onap.so.client.RestTemplateConfig.CONFIGURABLE_REST_TEMPLATE;
import java.io.IOException;
import java.security.KeyManagementException;
import java.security.KeyStore;
@@ -83,7 +82,7 @@ public class VnfmServiceProviderConfiguration extends AbstractServiceProviderCon
@Value("${vnfmadapter.temp.vnfm.oauth.endpoint:#{null}}")
private String oauthEndpoint;
- @Qualifier(CONFIGURABLE_REST_TEMPLATE)
+ @Qualifier(VnfmRestTemplateConfiguration.SOL003_LCM_REST_TEMPLATE)
@Autowired
private RestTemplate defaultRestTemplate;
diff --git a/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/lifecycle/LifecycleManager.java b/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/lifecycle/LifecycleManager.java
index 8ba56c5051..a2af1a4580 100644
--- a/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/lifecycle/LifecycleManager.java
+++ b/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/lcm/lifecycle/LifecycleManager.java
@@ -24,7 +24,7 @@ import java.util.Map;
import org.onap.aai.domain.yang.EsrVnfm;
import org.onap.aai.domain.yang.GenericVnf;
import org.onap.aai.domain.yang.Relationship;
-import org.onap.so.adapters.etsisol003adapter.lcm.extclients.SdcPackageProvider;
+import org.onap.so.adapters.etsisol003adapter.lcm.extclients.EtsiPackageProvider;
import org.onap.so.adapters.etsisol003adapter.lcm.extclients.aai.AaiHelper;
import org.onap.so.adapters.etsisol003adapter.lcm.extclients.aai.AaiServiceProvider;
import org.onap.so.adapters.etsisol003adapter.lcm.extclients.aai.OamIpAddressSource;
@@ -48,6 +48,7 @@ import org.slf4j.LoggerFactory;
import org.springframework.beans.factory.annotation.Autowired;
import org.springframework.stereotype.Component;
import com.google.common.base.Optional;
+import static org.apache.commons.lang3.StringUtils.isNotBlank;
/**
* Manages lifecycle operations towards the VNFMs.
@@ -60,12 +61,12 @@ public class LifecycleManager {
private final AaiHelper aaiHelper;
private final VnfmHelper vnfmHelper;
private final JobManager jobManager;
- private final SdcPackageProvider packageProvider;
+ private final EtsiPackageProvider packageProvider;
@Autowired
LifecycleManager(final AaiServiceProvider aaiServiceProvider, final AaiHelper aaiHelper,
final VnfmHelper vnfmHelper, final VnfmServiceProvider vnfmServiceProvider, final JobManager jobManager,
- final SdcPackageProvider packageProvider) {
+ final EtsiPackageProvider packageProvider) {
this.aaiServiceProvider = aaiServiceProvider;
this.vnfmServiceProvider = vnfmServiceProvider;
this.aaiHelper = aaiHelper;
@@ -152,15 +153,16 @@ public class LifecycleManager {
}
}
- private InlineResponse201 sendCreateRequestToVnfm(final CreateVnfRequest aaiRequest, final GenericVnf genericVnf,
- final String vnfIdInAai, final EsrVnfm vnfm) {
- logger.debug("Sending a create request to SVNFM " + aaiRequest);
+ private InlineResponse201 sendCreateRequestToVnfm(final CreateVnfRequest createVnfRequest,
+ final GenericVnf genericVnf, final String vnfIdInAai, final EsrVnfm vnfm) {
+ logger.debug("Sending a create request to SVNFM {}", createVnfRequest);
final org.onap.so.adapters.etsisol003adapter.lcm.extclients.vnfm.model.CreateVnfRequest vnfmRequest =
new org.onap.so.adapters.etsisol003adapter.lcm.extclients.vnfm.model.CreateVnfRequest();
- final String vnfdId = packageProvider.getVnfdId(genericVnf.getModelVersionId());
+ final String pkgId = getPackageId(createVnfRequest, genericVnf);
+ final String vnfdId = packageProvider.getVnfdId(pkgId);
vnfmRequest.setVnfdId(vnfdId);
- vnfmRequest.setVnfInstanceName(aaiRequest.getName().replaceAll(" ", "_"));
+ vnfmRequest.setVnfInstanceName(createVnfRequest.getName().replaceAll(" ", "_"));
vnfmRequest.setVnfInstanceDescription(vnfIdInAai);
final Optional<InlineResponse201> optionalResponse = vnfmServiceProvider.createVnf(vnfm, vnfmRequest);
@@ -174,6 +176,15 @@ public class LifecycleManager {
}
}
+ private String getPackageId(final CreateVnfRequest createVnfRequest, final GenericVnf genericVnf) {
+ if (isNotBlank(createVnfRequest.getPkgId())) {
+ logger.info("Found createVnfRequest pkgId: {}", createVnfRequest.getPkgId());
+ return createVnfRequest.getPkgId();
+ }
+ logger.info("Found genericVnf modelVersionId: {}", genericVnf.getModelVersionId());
+ return genericVnf.getModelVersionId();
+ }
+
private void createNotificationSubscription(final EsrVnfm vnfm, final String vnfId) {
try {
final LccnSubscriptionRequest subscriptionRequest = vnfmHelper.createNotificationSubscriptionRequest(vnfId);
diff --git a/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/test/java/org/onap/so/adapters/etsisol003adapter/lcm/rest/EtsiSol003AdapterControllerTest.java b/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/test/java/org/onap/so/adapters/etsisol003adapter/lcm/rest/EtsiSol003AdapterControllerTest.java
index eaf40b546f..9aed675324 100644
--- a/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/test/java/org/onap/so/adapters/etsisol003adapter/lcm/rest/EtsiSol003AdapterControllerTest.java
+++ b/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/test/java/org/onap/so/adapters/etsisol003adapter/lcm/rest/EtsiSol003AdapterControllerTest.java
@@ -27,7 +27,7 @@ import static org.mockito.ArgumentMatchers.eq;
import static org.mockito.Mockito.doReturn;
import static org.mockito.Mockito.timeout;
import static org.mockito.Mockito.verify;
-import static org.onap.so.client.RestTemplateConfig.CONFIGURABLE_REST_TEMPLATE;
+import org.onap.so.adapters.etsisol003adapter.lcm.extclients.vnfm.VnfmRestTemplateConfiguration;
import static org.springframework.test.web.client.match.MockRestRequestMatchers.content;
import static org.springframework.test.web.client.match.MockRestRequestMatchers.requestTo;
import static org.springframework.test.web.client.response.MockRestResponseCreators.withBadRequest;
@@ -54,7 +54,8 @@ import org.onap.aai.domain.yang.RelationshipList;
import org.onap.aaiclient.client.aai.AAIResourcesClient;
import org.onap.aaiclient.client.aai.AAIVersion;
import org.onap.aaiclient.client.aai.entities.uri.AAIResourceUri;
-import org.onap.so.adapters.etsisol003adapter.lcm.extclients.SdcPackageProvider;
+import org.onap.so.adapters.etsisol003adapter.lcm.extclients.EtsiPackageProvider;
+import org.onap.so.adapters.etsisol003adapter.lcm.extclients.vnfm.VnfmRestTemplateConfiguration;
import org.onap.so.adapters.etsisol003adapter.lcm.extclients.vnfm.model.InlineResponse200;
import org.onap.so.adapters.etsisol003adapter.lcm.extclients.vnfm.model.InlineResponse2001;
import org.onap.so.adapters.etsisol003adapter.lcm.extclients.vnfm.model.InlineResponse201;
@@ -106,7 +107,7 @@ public class EtsiSol003AdapterControllerTest {
@LocalServerPort
private int port;
@Autowired
- @Qualifier(CONFIGURABLE_REST_TEMPLATE)
+ @Qualifier(VnfmRestTemplateConfiguration.SOL003_LCM_REST_TEMPLATE)
private RestTemplate testRestTemplate;
private MockRestServiceServer mockRestServer;
@@ -114,7 +115,7 @@ public class EtsiSol003AdapterControllerTest {
AAIResourcesClient aaiResourcesClient;
@MockBean
- SdcPackageProvider sdcPackageProvider;
+ EtsiPackageProvider etsiPackageProvider;
@Autowired
EtsiSol003AdapterController controller;
diff --git a/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/test/java/org/onap/so/adapters/etsisol003adapter/lcm/rest/Sol003LcnControllerTest.java b/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/test/java/org/onap/so/adapters/etsisol003adapter/lcm/rest/Sol003LcnControllerTest.java
index ab6ae83896..86eda0abfa 100644
--- a/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/test/java/org/onap/so/adapters/etsisol003adapter/lcm/rest/Sol003LcnControllerTest.java
+++ b/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-adapter/src/test/java/org/onap/so/adapters/etsisol003adapter/lcm/rest/Sol003LcnControllerTest.java
@@ -26,7 +26,7 @@ import static org.mockito.Mockito.doReturn;
import static org.mockito.Mockito.timeout;
import static org.mockito.Mockito.verify;
import static org.mockito.Mockito.verifyZeroInteractions;
-import static org.onap.so.client.RestTemplateConfig.CONFIGURABLE_REST_TEMPLATE;
+import org.onap.so.adapters.etsisol003adapter.lcm.extclients.vnfm.VnfmRestTemplateConfiguration;
import static org.springframework.test.web.client.match.MockRestRequestMatchers.requestTo;
import static org.springframework.test.web.client.response.MockRestResponseCreators.withStatus;
import static org.springframework.test.web.client.response.MockRestResponseCreators.withSuccess;
@@ -99,7 +99,7 @@ public class Sol003LcnControllerTest {
@LocalServerPort
private int port;
@Autowired
- @Qualifier(CONFIGURABLE_REST_TEMPLATE)
+ @Qualifier(VnfmRestTemplateConfiguration.SOL003_LCM_REST_TEMPLATE)
private RestTemplate testRestTemplate;
private MockRestServiceServer mockRestServer;
diff --git a/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-api/src/main/resources/etsisol003adapter.yaml b/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-api/src/main/resources/etsisol003adapter.yaml
index 9d0a5283af..578708ded8 100644
--- a/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-api/src/main/resources/etsisol003adapter.yaml
+++ b/adapters/etsi-sol003-adapter/etsi-sol003-lcm/etsi-sol003-lcm-api/src/main/resources/etsisol003adapter.yaml
@@ -168,6 +168,9 @@ definitions:
description: The name to be applied to the VNF.
tenant:
$ref: '#/definitions/Tenant'
+ pkgId:
+ type: string
+ description: An identifier for the vnf package.
additionalParams:
type: object
description: >-
@@ -519,4 +522,4 @@ definitions:
description: >
Type of the resource in the scope of the VIM or the resource
provider.
- type: string \ No newline at end of file
+ type: string
diff --git a/adapters/etsi-sol003-adapter/etsi-sol003-pkgm/etsi-sol003-pkgm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/pkgm/rest/exceptions/EtsiCatalogManagerRequestFailureException.java b/adapters/etsi-sol003-adapter/etsi-sol003-pkgm/etsi-sol003-pkgm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/pkgm/rest/exceptions/EtsiCatalogManagerRequestFailureException.java
index a07732f3fa..110826a6d3 100644
--- a/adapters/etsi-sol003-adapter/etsi-sol003-pkgm/etsi-sol003-pkgm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/pkgm/rest/exceptions/EtsiCatalogManagerRequestFailureException.java
+++ b/adapters/etsi-sol003-adapter/etsi-sol003-pkgm/etsi-sol003-pkgm-adapter/src/main/java/org/onap/so/adapters/etsisol003adapter/pkgm/rest/exceptions/EtsiCatalogManagerRequestFailureException.java
@@ -36,6 +36,10 @@ public class EtsiCatalogManagerRequestFailureException extends RuntimeException
super(message);
}
+ public EtsiCatalogManagerRequestFailureException(final String message, final Throwable cause) {
+ super(message, cause);
+ }
+
@Override
public synchronized Throwable fillInStackTrace() {
return this;
diff --git a/adapters/mso-adapter-utils/pom.xml b/adapters/mso-adapter-utils/pom.xml
index 6346983f96..2453c18f1a 100644
--- a/adapters/mso-adapter-utils/pom.xml
+++ b/adapters/mso-adapter-utils/pom.xml
@@ -103,11 +103,6 @@
<version>${project.version}</version>
</dependency>
<dependency>
- <groupId>org.onap.so</groupId>
- <artifactId>cloudify-client</artifactId>
- <version>${project.version}</version>
- </dependency>
- <dependency>
<groupId>javax.servlet</groupId>
<artifactId>javax.servlet-api</artifactId>
<scope>provided</scope>
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloud/authentication/AuthenticationMethodFactory.java b/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloud/authentication/AuthenticationMethodFactory.java
index 59c6becfbd..ab0239057a 100644
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloud/authentication/AuthenticationMethodFactory.java
+++ b/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloud/authentication/AuthenticationMethodFactory.java
@@ -89,4 +89,32 @@ public final class AuthenticationMethodFactory {
v3Auth.setScope(scope);
return v3Auth;
}
+
+ public final com.woorea.openstack.keystone.v3.model.Authentication getAuthenticationForV3ByName(
+ CloudIdentity cloudIdentity, String name) {
+ Identity identity = new Identity();
+ Password password = new Password();
+ User user = new User();
+ Domain userDomain = new Domain();
+ Scope scope = new Scope();
+ Project project = new Project();
+ Project.Domain projectDomain = new Project.Domain();
+ userDomain.setName(cloudIdentity.getUserDomainName());
+ projectDomain.setName(cloudIdentity.getProjectDomainName());
+ user.setName(cloudIdentity.getMsoId());
+ user.setPassword(CryptoUtils.decryptCloudConfigPassword(cloudIdentity.getMsoPass()));
+ user.setDomain(userDomain);
+ password.setUser(user);
+ project.setDomain(projectDomain);
+ project.setName(name);
+ scope.setProject(project);
+ identity.setPassword(password);
+ identity.setMethods(Collections.singletonList("password"));
+ com.woorea.openstack.keystone.v3.model.Authentication v3Auth =
+ new com.woorea.openstack.keystone.v3.model.Authentication();
+ v3Auth.setIdentity(identity);
+ v3Auth.setScope(scope);
+ return v3Auth;
+ }
+
}
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloud/authentication/KeystoneV3Authentication.java b/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloud/authentication/KeystoneV3Authentication.java
index 16906957a7..3564b8f0a7 100644
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloud/authentication/KeystoneV3Authentication.java
+++ b/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloud/authentication/KeystoneV3Authentication.java
@@ -107,7 +107,7 @@ public class KeystoneV3Authentication {
return policy;
}
- protected String findEndpointURL(List<Service> serviceCatalog, String type, String region, String facing) {
+ public String findEndpointURL(List<Service> serviceCatalog, String type, String region, String facing) {
for (Service service : serviceCatalog) {
if (type.equals(service.getType())) {
for (Service.Endpoint endpoint : service.getEndpoints()) {
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/beans/DeploymentInfo.java b/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/beans/DeploymentInfo.java
deleted file mode 100644
index 42b77baeeb..0000000000
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/beans/DeploymentInfo.java
+++ /dev/null
@@ -1,91 +0,0 @@
-/*-
- * ============LICENSE_START=======================================================
- * ONAP - SO
- * ================================================================================
- * Copyright (C) 2017 AT&T Intellectual Property. All rights reserved.
- * ================================================================================
- * Copyright (C) 2018 Nokia.
- * ================================================================================
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- * ============LICENSE_END=========================================================
- */
-
-package org.onap.so.cloudify.beans;
-
-import java.util.Map;
-
-/*
- * This Java bean class relays Heat stack status information to ActiveVOS processes.
- *
- * This bean is returned by all Heat-specific adapter operations (create, query, delete)
- */
-
-public final class DeploymentInfo {
-
- private final String id;
- private final DeploymentStatus status;
- private final Map<String, Object> outputs;
- private final Map<String, Object> inputs;
- private final String lastAction;
- private final String actionStatus;
- private final String errorMessage;
-
- DeploymentInfo(String id, DeploymentStatus deploymentStatus, Map<String, Object> deploymentOutputs,
- Map<String, Object> deploymentInputs, String lastAction, String actionStatus, String errorMessage) {
-
- this.id = id;
- this.status = deploymentStatus;
- this.outputs = deploymentOutputs;
- this.inputs = deploymentInputs;
- this.lastAction = lastAction;
- this.actionStatus = actionStatus;
- this.errorMessage = errorMessage;
- }
-
- public String getId() {
- return id;
- }
-
- public DeploymentStatus getStatus() {
- return status;
- }
-
- public Map<String, Object> getOutputs() {
- return outputs;
- }
-
- public Map<String, Object> getInputs() {
- return inputs;
- }
-
- public String getLastAction() {
- return lastAction;
- }
-
- public String getActionStatus() {
- return actionStatus;
- }
-
- public String getErrorMessage() {
- return errorMessage;
- }
-
- @Override
- public String toString() {
- return "DeploymentInfo {" + "id='" + id + '\'' + ", inputs='" + inputs + '\'' + ", outputs='" + outputs + '\''
- + ", lastAction='" + lastAction + '\'' + ", status='" + status + '\'' + ", errorMessage='"
- + errorMessage + '\'' + '}';
- }
-
-}
-
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/beans/DeploymentInfoBuilder.java b/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/beans/DeploymentInfoBuilder.java
deleted file mode 100644
index 072bf404e7..0000000000
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/beans/DeploymentInfoBuilder.java
+++ /dev/null
@@ -1,110 +0,0 @@
-/*
- * ============LICENSE_START======================================================= ONAP : SO
- * ================================================================================ Copyright (C) 2018 Nokia.
- * ============================================================================= Licensed under the Apache License,
- * Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy
- * of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on
- * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the
- * specific language governing permissions and limitations under the License.
- * ============LICENSE_END=========================================================
- */
-package org.onap.so.cloudify.beans;
-
-import java.util.HashMap;
-import java.util.Map;
-import org.onap.so.cloudify.v3.model.Execution;
-
-public final class DeploymentInfoBuilder {
-
- private String id = "";
- private DeploymentStatus deploymentStatus = DeploymentStatus.NOTFOUND;
- private Map<String, Object> deploymentOutputs = new HashMap<>();
- private Map<String, Object> deploymentInputs = new HashMap<>();
- private String lastAction;
- private String actionStatus;
- private String errorMessage;
-
- public DeploymentInfoBuilder withId(String id) {
- this.id = id;
- return this;
- }
-
- public DeploymentInfoBuilder withStatus(DeploymentStatus deploymentStatus) {
- this.deploymentStatus = deploymentStatus;
- return this;
- }
-
- public DeploymentInfoBuilder withDeploymentOutputs(Map<String, Object> deploymentOutputs) {
- if (deploymentOutputs != null) {
- this.deploymentOutputs = deploymentOutputs;
- }
- return this;
- }
-
- public DeploymentInfoBuilder withDeploymentInputs(Map<String, Object> deploymentInputs) {
- this.deploymentInputs = deploymentInputs;
- return this;
- }
-
- public DeploymentInfoBuilder withLastAction(String lastAction) {
- this.lastAction = lastAction;
- return this;
- }
-
- public DeploymentInfoBuilder withActionStatus(String actionStatus) {
- this.actionStatus = actionStatus;
- return this;
- }
-
- public DeploymentInfoBuilder withErrorMessage(String errorMessage) {
- this.errorMessage = errorMessage;
- return this;
- }
-
- public DeploymentInfoBuilder fromExecution(Execution execution) {
- if (execution != null) {
- this.lastAction = execution.getWorkflowId();
- this.actionStatus = execution.getStatus();
- this.errorMessage = execution.getError();
-
- // Compute the status based on the last workflow
- if (("install").equals(lastAction)) {
- if (("terminated").equals(actionStatus)) {
- this.deploymentStatus = DeploymentStatus.INSTALLED;
- } else if (("failed").equals(actionStatus)) {
- this.deploymentStatus = DeploymentStatus.FAILED;
- } else if (("started").equals(actionStatus) || ("pending").equals(actionStatus)) {
- this.deploymentStatus = DeploymentStatus.INSTALLING;
- } else {
- this.deploymentStatus = DeploymentStatus.UNKNOWN;
- }
- } else if (("uninstall").equals(lastAction)) {
- if (("terminated").equals(actionStatus)) {
- this.deploymentStatus = DeploymentStatus.CREATED;
- } else if (("failed").equals(actionStatus)) {
- this.deploymentStatus = DeploymentStatus.FAILED;
- } else if (("started").equals(actionStatus) || ("pending").equals(actionStatus)) {
- this.deploymentStatus = DeploymentStatus.UNINSTALLING;
- } else {
- this.deploymentStatus = DeploymentStatus.UNKNOWN;
- }
- } else {
- // Could have more cases in the future for different actions.
- this.deploymentStatus = DeploymentStatus.UNKNOWN;
- }
- } else {
- this.deploymentStatus = DeploymentStatus.CREATED;
- }
-
- return this;
- }
-
- public DeploymentInfo build() {
- return new DeploymentInfo(id, deploymentStatus, deploymentOutputs, deploymentInputs, lastAction, actionStatus,
- errorMessage);
- }
-}
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoCloudifyException.java b/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoCloudifyException.java
deleted file mode 100644
index 441bd4dc07..0000000000
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoCloudifyException.java
+++ /dev/null
@@ -1,88 +0,0 @@
-/*-
- * ============LICENSE_START=======================================================
- * ONAP - SO
- * ================================================================================
- * Copyright (C) 2017 AT&T Intellectual Property. All rights reserved.
- * ================================================================================
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- * ============LICENSE_END=========================================================
- */
-
-package org.onap.so.cloudify.exceptions;
-
-import org.onap.so.openstack.exceptions.MsoException;
-import org.onap.so.openstack.exceptions.MsoExceptionCategory;
-
-/**
- * OpenStack exception.
- */
-public class MsoCloudifyException extends MsoException {
-
- /**
- * Serialization id.
- */
- private static final long serialVersionUID = 3313636124141766495L;
-
- private int statusCode;
- private String statusMessage;
- private String errorDetail;
- private boolean pendingWorkflow;
-
- /**
- * Constructor to create a new MsoOpenstackException instance
- *
- * @param code the error code
- * @param message the error message
- * @param detail error details
- */
- public MsoCloudifyException(int code, String message, String detail) {
- // Set the detailed error as the Exception 'message'
- super(detail);
- super.category = MsoExceptionCategory.OPENSTACK;
-
- this.statusCode = code;
- this.statusMessage = message;
- this.errorDetail = detail;
- this.pendingWorkflow = false;
- }
-
- /**
- * Constructor to propagate the caught exception (mostly for stack trace)
- *
- * @param code the error code
- * @param message the error message
- * @param detail error details
- * @param e the cause
- */
- public MsoCloudifyException(int code, String message, String detail, Exception e) {
- // Set the detailed error as the Exception 'message'
- super(detail, e);
- super.category = MsoExceptionCategory.OPENSTACK;
-
- this.statusCode = code;
- this.statusMessage = message;
- this.errorDetail = detail;
- this.pendingWorkflow = false;
- }
-
- public void setPendingWorkflow(boolean pendingWorkflow) {
- this.pendingWorkflow = pendingWorkflow;
- }
-
- @Override
- public String toString() {
- String error = "" + statusCode + " " + statusMessage + ": " + errorDetail
- + (pendingWorkflow ? " [workflow pending]" : "");
- return error;
- }
-}
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoCloudifyTimeout.java b/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoCloudifyTimeout.java
deleted file mode 100644
index 99b6ade326..0000000000
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoCloudifyTimeout.java
+++ /dev/null
@@ -1,66 +0,0 @@
-/*-
- * ============LICENSE_START=======================================================
- * ONAP - SO
- * ================================================================================
- * Copyright (C) 2017 AT&T Intellectual Property. All rights reserved.
- * ================================================================================
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- * ============LICENSE_END=========================================================
- */
-
-package org.onap.so.cloudify.exceptions;
-
-import org.onap.so.cloudify.v3.model.Execution;
-import org.onap.so.openstack.exceptions.MsoException;
-import org.onap.so.openstack.exceptions.MsoExceptionCategory;
-
-/**
- * MSO Exception when a Cloudify workflow execution times out waiting for completion. Exception includes the last known
- * state of the workflow execution.
- */
-public class MsoCloudifyTimeout extends MsoException {
-
- /**
- * Serialization id.
- */
- private static final long serialVersionUID = 3313636124141766495L;
-
- private Execution execution;
-
- /**
- * Constructor to create a new MsoOpenstackException instance
- *
- * @param code the error code
- * @param message the error message
- * @param detail error details
- */
- public MsoCloudifyTimeout(Execution execution) {
- // Set the detailed error as the Exception 'message'
- super("Cloudify Workflow Timeout for workflow " + execution.getWorkflowId() + " on deployment "
- + execution.getDeploymentId());
- super.category = MsoExceptionCategory.OPENSTACK;
-
- this.execution = execution;
- }
-
- public Execution getExecution() {
- return this.execution;
- }
-
- @Override
- public String toString() {
- String error = "Workflow timeout: workflow=" + execution.getWorkflowId() + ",deployment="
- + execution.getDeploymentId();
- return error;
- }
-}
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoCloudifyWorkflowException.java b/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoCloudifyWorkflowException.java
deleted file mode 100644
index 2251575671..0000000000
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoCloudifyWorkflowException.java
+++ /dev/null
@@ -1,54 +0,0 @@
-/*-
- * ============LICENSE_START=======================================================
- * ONAP - SO
- * ================================================================================
- * Copyright (C) 2017 AT&T Intellectual Property. All rights reserved.
- * ================================================================================
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- * ============LICENSE_END=========================================================
- */
-
-package org.onap.so.cloudify.exceptions;
-
-/**
- * Reports an error with a Cloudify Workflow execution.
- *
- * @author JC1348
- *
- */
-public class MsoCloudifyWorkflowException extends MsoCloudifyException {
-
- private static final long serialVersionUID = 1L;
-
- private String workflowStatus;
- private boolean workflowStillRunning = false;
-
- // Constructor to create a new MsoCloudifyException instance
- public MsoCloudifyWorkflowException(String message, String deploymentId, String workflowId, String workflowStatus) {
- super(0, "Workflow Exception",
- "Workflow " + workflowId + " failed on deployment " + deploymentId + ": " + message);
- this.workflowStatus = workflowStatus;
- if (("pending").equals(workflowStatus) || ("started").equals(workflowStatus)
- || ("cancelling").equals(workflowStatus) || ("force_cancelling").equals(workflowStatus)) {
- workflowStillRunning = true;
- }
- }
-
- public String getWorkflowStatus() {
- return workflowStatus;
- }
-
- public boolean isWorkflowStillRunning() {
- return workflowStillRunning;
- }
-}
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/utils/MsoCloudifyUtils.java b/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/utils/MsoCloudifyUtils.java
deleted file mode 100644
index 446c725e48..0000000000
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/utils/MsoCloudifyUtils.java
+++ /dev/null
@@ -1,1356 +0,0 @@
-/*-
- * ============LICENSE_START=======================================================
- * ONAP - SO
- * ================================================================================
- * Copyright (C) 2017 AT&T Intellectual Property. All rights reserved.
- * ================================================================================
- * Copyright (C) 2018 Nokia.
- * ================================================================================
- * Modifications Copyright (c) 2019 Samsung
- * ================================================================================
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- * ============LICENSE_END=========================================================
- */
-
-package org.onap.so.cloudify.utils;
-
-import com.fasterxml.jackson.core.JsonParseException;
-import com.fasterxml.jackson.databind.JsonNode;
-import com.fasterxml.jackson.databind.ObjectMapper;
-import java.io.ByteArrayInputStream;
-import java.io.ByteArrayOutputStream;
-import java.io.IOException;
-import java.io.InputStream;
-import java.util.HashMap;
-import java.util.List;
-import java.util.Map;
-import java.util.Optional;
-import java.util.zip.ZipEntry;
-import java.util.zip.ZipOutputStream;
-import org.onap.so.adapters.vdu.CloudInfo;
-import org.onap.so.adapters.vdu.PluginAction;
-import org.onap.so.adapters.vdu.VduArtifact;
-import org.onap.so.adapters.vdu.VduArtifact.ArtifactType;
-import org.onap.so.adapters.vdu.VduException;
-import org.onap.so.adapters.vdu.VduInstance;
-import org.onap.so.adapters.vdu.VduModelInfo;
-import org.onap.so.adapters.vdu.VduPlugin;
-import org.onap.so.adapters.vdu.VduStateType;
-import org.onap.so.adapters.vdu.VduStatus;
-import org.onap.so.cloud.CloudConfig;
-import org.onap.so.cloudify.base.client.CloudifyBaseException;
-import org.onap.so.cloudify.base.client.CloudifyClientTokenProvider;
-import org.onap.so.cloudify.base.client.CloudifyConnectException;
-import org.onap.so.cloudify.base.client.CloudifyRequest;
-import org.onap.so.cloudify.base.client.CloudifyResponseException;
-import org.onap.so.cloudify.beans.DeploymentInfo;
-import org.onap.so.cloudify.beans.DeploymentInfoBuilder;
-import org.onap.so.cloudify.beans.DeploymentStatus;
-import org.onap.so.cloudify.exceptions.MsoCloudifyException;
-import org.onap.so.cloudify.exceptions.MsoCloudifyManagerNotFound;
-import org.onap.so.cloudify.exceptions.MsoDeploymentAlreadyExists;
-import org.onap.so.cloudify.v3.client.BlueprintsResource.GetBlueprint;
-import org.onap.so.cloudify.v3.client.BlueprintsResource.UploadBlueprint;
-import org.onap.so.cloudify.v3.client.Cloudify;
-import org.onap.so.cloudify.v3.client.DeploymentsResource.CreateDeployment;
-import org.onap.so.cloudify.v3.client.DeploymentsResource.DeleteDeployment;
-import org.onap.so.cloudify.v3.client.DeploymentsResource.GetDeployment;
-import org.onap.so.cloudify.v3.client.DeploymentsResource.GetDeploymentOutputs;
-import org.onap.so.cloudify.v3.client.ExecutionsResource.CancelExecution;
-import org.onap.so.cloudify.v3.client.ExecutionsResource.GetExecution;
-import org.onap.so.cloudify.v3.client.ExecutionsResource.ListExecutions;
-import org.onap.so.cloudify.v3.client.ExecutionsResource.StartExecution;
-import org.onap.so.cloudify.v3.model.AzureConfig;
-import org.onap.so.cloudify.v3.model.Blueprint;
-import org.onap.so.cloudify.v3.model.CancelExecutionParams;
-import org.onap.so.cloudify.v3.model.CloudifyError;
-import org.onap.so.cloudify.v3.model.CreateDeploymentParams;
-import org.onap.so.cloudify.v3.model.Deployment;
-import org.onap.so.cloudify.v3.model.DeploymentOutputs;
-import org.onap.so.cloudify.v3.model.Execution;
-import org.onap.so.cloudify.v3.model.Executions;
-import org.onap.so.cloudify.v3.model.OpenstackConfig;
-import org.onap.so.cloudify.v3.model.StartExecutionParams;
-import org.onap.so.config.beans.PoConfig;
-import org.onap.so.db.catalog.beans.CloudSite;
-import org.onap.so.db.catalog.beans.CloudifyManager;
-import org.onap.so.db.catalog.beans.HeatTemplateParam;
-import org.onap.logging.filter.base.ErrorCode;
-import org.onap.so.logger.MessageEnum;
-import org.onap.so.openstack.exceptions.MsoAdapterException;
-import org.onap.so.openstack.exceptions.MsoCloudSiteNotFound;
-import org.onap.so.openstack.exceptions.MsoException;
-import org.onap.so.openstack.exceptions.MsoExceptionCategory;
-import org.onap.so.openstack.exceptions.MsoIOException;
-import org.onap.so.openstack.exceptions.MsoOpenstackException;
-import org.onap.so.openstack.utils.MsoCommonUtils;
-import org.onap.so.utils.CryptoUtils;
-import org.slf4j.Logger;
-import org.slf4j.LoggerFactory;
-import org.springframework.beans.factory.annotation.Autowired;
-import org.springframework.core.env.Environment;
-import org.springframework.stereotype.Component;
-
-@Component
-public class MsoCloudifyUtils extends MsoCommonUtils implements VduPlugin {
-
- private static final String CLOUDIFY = "Cloudify";
- private static final String CREATE_DEPLOYMENT = "CreateDeployment";
- private static final String DELETE_DEPLOYMENT = "DeleteDeployment";
- private static final String TERMINATED = "terminated";
- private static final String CANCELLED = "cancelled";
- private static final String UNINSTALL = "uninstall";
- private static final String UPLOAD_BLUEPRINT = "UPLOAD_BLUEPRINT";
-
- // Fetch cloud configuration each time (may be cached in CloudConfig class)
- @Autowired
- protected CloudConfig cloudConfig;
-
- @Autowired
- private Environment environment;
-
- @Autowired
- private PoConfig poConfig;
-
- private static final Logger logger = LoggerFactory.getLogger(MsoCloudifyUtils.class);
-
- // Properties names and variables (with default values)
- protected String createPollIntervalProp = "org.onap.so.adapters.po.pollInterval";
- private String deletePollIntervalProp = "org.onap.so.adapters.po.pollInterval";
-
- protected String createPollIntervalDefault = "15";
- private String deletePollIntervalDefault = "15";
-
- private static final ObjectMapper JSON_MAPPER = new ObjectMapper();
-
- /**
- * Create a new Deployment from a specified blueprint, and install it in the specified cloud location and tenant.
- * The blueprint identifier and parameter map are passed in as arguments, along with the cloud access credentials.
- * The blueprint should have been previously uploaded to Cloudify.
- *
- * It is expected that parameters have been validated and contain at minimum the required parameters for the given
- * template with no extra (undefined) parameters..
- *
- * The deployment ID supplied by the caller must be unique in the scope of the Cloudify tenant (not the Openstack
- * tenant). However, it should also be globally unique, as it will be the identifier for the resource going forward
- * in Inventory. This latter is managed by the higher levels invoking this function.
- *
- * This function executes the "install" workflow on the newly created workflow. Cloudify will be polled for
- * completion unless the client requests otherwise.
- *
- * An error will be thrown if the requested Deployment already exists in the specified Cloudify instance.
- *
- * @param cloudSiteId The cloud (may be a region) in which to create the stack.
- * @param tenantId The Openstack ID of the tenant in which to create the Stack
- * @param deploymentId The identifier (name) of the deployment to create
- * @param blueprintId The blueprint from which to create the deployment.
- * @param inputs A map of key/value inputs
- * @param pollForCompletion Indicator that polling should be handled in Java vs. in the client
- * @param timeoutMinutes Timeout after which the "install" will be cancelled
- * @param backout Flag to delete deployment on install Failure - defaulted to True
- * @return A DeploymentInfo object
- * @throws MsoCloudifyException Thrown if the Cloudify API call returns an exception.
- * @throws MsoIOException Thrown on Cloudify connection errors.
- */
-
- public DeploymentInfo createAndInstallDeployment(String cloudSiteId, String tenantId, String deploymentId,
- String blueprintId, Map<String, ? extends Object> inputs, boolean pollForCompletion, int timeoutMinutes,
- boolean backout) throws MsoException {
- // Obtain the cloud site information where we will create the stack
- Optional<CloudSite> cloudSite = cloudConfig.getCloudSite(cloudSiteId);
- if (!cloudSite.isPresent()) {
- throw new MsoCloudSiteNotFound(cloudSiteId);
- }
-
- Cloudify cloudify = getCloudifyClient(cloudSite.get());
-
- logger.debug("Ready to Create Deployment ({}) with input params: {}", deploymentId, inputs);
-
- // Build up the inputs, including:
- // - from provided "environment" file
- // - passed in by caller
- // - special input for cloud-specific Credentials
- Map<String, Object> expandedInputs = new HashMap<>(inputs);
-
- String platform = cloudSite.get().getPlatform();
- if (platform == null || platform.isEmpty() || ("OPENSTACK").equalsIgnoreCase(platform)) {
- // Create the Cloudify OpenstackConfig with the credentials
- OpenstackConfig openstackConfig = getOpenstackConfig(cloudSite.get(), tenantId);
- expandedInputs.put("openstack_config", openstackConfig);
- } else if (("AZURE").equalsIgnoreCase(platform)) {
- // Create Cloudify AzureConfig with the credentials
- AzureConfig azureConfig = getAzureConfig(cloudSite.get(), tenantId);
- expandedInputs.put("azure_config", azureConfig);
- }
-
- // Build up the parameters to create a new deployment
- CreateDeploymentParams deploymentParams = new CreateDeploymentParams();
- deploymentParams.setBlueprintId(blueprintId);
- deploymentParams.setInputs(expandedInputs);
-
- Deployment deployment = null;
- try {
- CreateDeployment createDeploymentRequest = cloudify.deployments().create(deploymentId, deploymentParams);
- logger.debug(createDeploymentRequest.toString());
-
- deployment = executeAndRecordCloudifyRequest(createDeploymentRequest);
- } catch (CloudifyResponseException e) {
- // Since this came on the 'Create Deployment' command, nothing was changed
- // in the cloud. Return the error as an exception.
- if (e.getStatus() == 409) {
- // Deployment already exists. Return a specific error for this case
- MsoException me = new MsoDeploymentAlreadyExists(deploymentId, cloudSiteId);
- me.addContext(CREATE_DEPLOYMENT);
- throw me;
- } else {
- // Convert the CloudifyResponseException to an MsoException
- logger.debug("ERROR STATUS = {},\n{}\n{}", e.getStatus(), e.getMessage(), e.getLocalizedMessage());
- MsoException me = cloudifyExceptionToMsoException(e, CREATE_DEPLOYMENT);
- me.setCategory(MsoExceptionCategory.OPENSTACK);
- throw me;
- }
- } catch (CloudifyConnectException e) {
- // Error connecting to Cloudify instance. Convert to an MsoException
- throw cloudifyExceptionToMsoException(e, CREATE_DEPLOYMENT);
- } catch (RuntimeException e) {
- // Catch-all
- throw runtimeExceptionToMsoException(e, CREATE_DEPLOYMENT);
- }
-
- /*
- * It can take some time for Cloudify to be ready to execute a workflow on the deployment. Sleep 30 seconds
- * based on observation of behavior in a Cloudify VM instance (delay due to "create_deployment_environment").
- */
- sleep(30000);
-
- /*
- * Next execute the "install" workflow. Note - this assumes there are no additional parameters required for the
- * workflow.
- */
- int createPollInterval =
- Integer.parseInt(this.environment.getProperty(createPollIntervalProp, createPollIntervalDefault));
- int pollTimeout = (timeoutMinutes * 60) + createPollInterval;
-
- Execution installWorkflow = null;
-
- try {
- installWorkflow = executeWorkflow(cloudify, deploymentId, "install", null, pollForCompletion, pollTimeout,
- createPollInterval);
-
- if (installWorkflow.getStatus().equals(TERMINATED)) {
- // Success!
- // Create and return a DeploymentInfo structure. Include the Runtime outputs
- return new DeploymentInfoBuilder().withId(deployment.getId())
- .withDeploymentInputs(deployment.getInputs())
- .withDeploymentOutputs(getDeploymentOutputs(cloudify, deploymentId).get())
- .fromExecution(installWorkflow).build();
- } else {
- // The workflow completed with errors. Must try to back it out.
- if (!backout) {
- logger.warn("{} Deployment installation failed, backout deletion suppressed {} {}",
- MessageEnum.RA_CREATE_STACK_ERR, ErrorCode.BusinessProcessError.getValue(),
- "Exception in Deployment Installation, backout suppressed");
- } else {
- // Poll on delete if we rollback - use same values for now
- int deletePollInterval = createPollInterval;
- int deletePollTimeout = pollTimeout;
-
- try {
- // Run the uninstall to undo the install
- Execution uninstallWorkflow = executeWorkflow(cloudify, deploymentId, UNINSTALL, null,
- pollForCompletion, deletePollTimeout, deletePollInterval);
-
- if (uninstallWorkflow.getStatus().equals(TERMINATED)) {
- // The uninstall completed. Delete the deployment itself
- DeleteDeployment deleteRequest = cloudify.deployments().deleteByName(deploymentId);
- executeAndRecordCloudifyRequest(deleteRequest);
- } else {
- // Didn't uninstall successfully. Log this error
- logger.error("{} Create Deployment: Cloudify error rolling back deployment install: {} {}",
- MessageEnum.RA_CREATE_STACK_ERR, installWorkflow.getError(),
- ErrorCode.BusinessProcessError.getValue());
- }
- } catch (Exception e) {
- // Catch-all for backout errors trying to uninstall/delete
- // Log this error, and return the original exception
- logger.error("{} Create Stack: Nested exception rolling back deployment install: {}",
- MessageEnum.RA_CREATE_STACK_ERR, ErrorCode.BusinessProcessError.getValue(), e);
- }
- }
-
- MsoCloudifyException me =
- new MsoCloudifyException(0, "Workflow Execution Failed", installWorkflow.getError());
- me.addContext(CREATE_DEPLOYMENT);
-
- throw me;
- }
- } catch (MsoException me) {
- // Install failed. Unless requested otherwise, back out the deployment
-
- if (!backout) {
- logger.warn("{} Deployment installation failed, backout deletion suppressed {}",
- MessageEnum.RA_CREATE_STACK_ERR, ErrorCode.BusinessProcessError.getValue());
- } else {
- // Poll on delete if we rollback - use same values for now
- int deletePollInterval = createPollInterval;
- int deletePollTimeout = pollTimeout;
-
- try {
- // Run the uninstall to undo the install.
- // Always try to run it, as it should be idempotent
- executeWorkflow(cloudify, deploymentId, UNINSTALL, null, pollForCompletion, deletePollTimeout,
- deletePollInterval);
-
- // Delete the deployment itself
- DeleteDeployment deleteRequest = cloudify.deployments().deleteByName(deploymentId);
- executeAndRecordCloudifyRequest(deleteRequest);
- } catch (Exception e) {
- // Catch-all for backout errors trying to uninstall/delete
- // Log this error, and return the original exception
- logger.error("{} Create Stack: Nested exception rolling back deployment install: {} ",
- MessageEnum.RA_CREATE_STACK_ERR, ErrorCode.BusinessProcessError.getValue(), e);
- }
- }
-
- // Propagate the original exception from Stack Query.
- me.addContext(CREATE_DEPLOYMENT);
-
- throw me;
- }
- }
-
-
- /*
- * Get the runtime Outputs of a deployment. Return the Map of tag/value outputs.
- */
- private Optional<Map<String, Object>> getDeploymentOutputs(Cloudify cloudify, String deploymentId)
- throws MsoException {
- // Build and send the Cloudify request
- DeploymentOutputs deploymentOutputs;
- try {
- GetDeploymentOutputs queryDeploymentOutputs = cloudify.deployments().outputsById(deploymentId);
- logger.debug(queryDeploymentOutputs.toString());
-
- deploymentOutputs = executeAndRecordCloudifyRequest(queryDeploymentOutputs);
- if (deploymentOutputs != null) {
- return Optional.ofNullable(deploymentOutputs.getOutputs());
- } else {
- return Optional.empty();
- }
- } catch (CloudifyConnectException ce) {
- // Couldn't connect to Cloudify
- logger.error("{} QueryDeploymentOutputs: Cloudify connection failure: {} ", MessageEnum.RA_CREATE_STACK_ERR,
- ErrorCode.BusinessProcessError.getValue(), ce);
- throw new MsoIOException(ce.getMessage(), ce);
- } catch (CloudifyResponseException re) {
- if (re.getStatus() == 404) {
- // No Outputs
- return Optional.empty();
- }
- throw new MsoCloudifyException(re.getStatus(), re.getMessage(), re.getLocalizedMessage(), re);
- } catch (Exception e) {
- // Catch-all
- throw new MsoAdapterException(e.getMessage(), e);
- }
- }
-
- /*
- * Execute a workflow on a deployment. Handle polling for completion with timeout. Return the final Execution object
- * with status. Throw an exception on Errors. Question - how does the client know whether rollback needs to be done?
- */
- private Execution executeWorkflow(Cloudify cloudify, String deploymentId, String workflowId,
- Map<String, Object> workflowParams, boolean pollForCompletion, int timeout, int pollInterval)
- throws MsoCloudifyException {
- logger.debug("Executing '{}' workflow on deployment '{}'", workflowId, deploymentId);
-
- StartExecutionParams executeParams = new StartExecutionParams();
- executeParams.setWorkflowId(workflowId);
- executeParams.setDeploymentId(deploymentId);
- executeParams.setParameters(workflowParams);
-
- Execution execution = null;
- String executionId = null;
- String command = "start";
- Exception savedException = null;
-
- try {
- StartExecution executionRequest = cloudify.executions().start(executeParams);
- logger.debug(executionRequest.toString());
- execution = executeAndRecordCloudifyRequest(executionRequest);
- executionId = execution.getId();
-
- if (!pollForCompletion) {
- // Client did not request polling, so just return the Execution object
- return execution;
- }
-
- // Enter polling loop
- boolean timedOut = false;
- int pollTimeout = timeout;
-
- String status = execution.getStatus();
-
- // Create a reusable cloudify query request
- GetExecution queryExecution = cloudify.executions().byId(executionId);
- command = "query";
-
- while (!timedOut && !(status.equals(TERMINATED) || ("failed").equals(status) || status.equals(CANCELLED))) {
- // workflow is still running; check for timeout
- if (pollTimeout <= 0) {
- logger.debug("workflow {} timed out on deployment {}", execution.getWorkflowId(),
- execution.getDeploymentId());
- timedOut = true;
- continue;
- }
-
- sleep(pollInterval * 1000L);
-
- pollTimeout -= pollInterval;
- logger.debug("pollTimeout remaining: " + pollTimeout);
-
- execution = queryExecution.execute();
- if (execution != null) {
- status = execution.getStatus();
- } else {
- status = TERMINATED;
- }
- }
-
- // Broke the loop. Check again for a terminal state
- if (status.equals(TERMINATED)) {
- // Success!
- logger.debug("Workflow '{}' completed successfully on deployment '{}'", workflowId, deploymentId);
- return execution;
- } else if (("failed").equals(status)) {
- // Workflow failed. Log it and return the execution object (don't throw exception here)
- logger.error("{} Cloudify workflow failure: {} {} Execute Workflow: Failed: {}",
- MessageEnum.RA_CREATE_STACK_ERR, execution.getError(),
- ErrorCode.BusinessProcessError.getValue(), execution.getError());
- return execution;
- } else if (status.equals(CANCELLED)) {
- // Workflow was cancelled, leaving the deployment in an indeterminate state. Log it and return the
- // execution object (don't throw exception here)
- logger.error("{} Cloudify workflow cancelled. Deployment is in an indeterminate state {} {} {}",
- MessageEnum.RA_CREATE_STACK_ERR, ErrorCode.BusinessProcessError.getValue(),
- "Execute Workflow cancelled: ", workflowId);
- return execution;
- } else {
- // Can only get here after a timeout
- logger.error("{} Cloudify workflow timeout {} Execute Workflow: Timed Out",
- MessageEnum.RA_CREATE_STACK_ERR, ErrorCode.BusinessProcessError.getValue());
- }
- } catch (CloudifyConnectException ce) {
- logger.error("{} {} Execute Workflow ({} {}): Cloudify connection failure {} ",
- MessageEnum.RA_CREATE_STACK_ERR, ErrorCode.BusinessProcessError.getValue(), command, ce);
- savedException = ce;
- } catch (CloudifyResponseException re) {
- logger.error("{} {} Execute Workflow ({}): Cloudify response error {} ", MessageEnum.RA_CREATE_STACK_ERR,
- ErrorCode.BusinessProcessError.getValue(), command, re.getMessage(), re);
- savedException = re;
- } catch (RuntimeException e) {
- // Catch-all
- logger.error("{} {} Execute Workflow ({}): Internal error {}", MessageEnum.RA_CREATE_STACK_ERR,
- ErrorCode.BusinessProcessError.getValue(), command, e.getMessage(), e);
- savedException = e;
- }
-
- // Get to this point ONLY on an error or timeout
- // The cloudify execution is still running (we've not received a terminal status),
- // so try to Cancel it.
- CancelExecutionParams cancelParams = new CancelExecutionParams();
- cancelParams.setAction("cancel");
- // TODO: Use force_cancel?
-
- Execution cancelExecution = null;
-
- try {
- CancelExecution cancelRequest = cloudify.executions().cancel(executionId, cancelParams);
- logger.debug(cancelRequest.toString());
- cancelExecution = cancelRequest.execute();
-
- // Enter polling loop
- boolean timedOut = false;
- int cancelTimeout = timeout; // TODO: For now, just use same timeout
-
- String status = null;
- if (cancelExecution != null) {
- status = cancelExecution.getStatus();
- }
- // Poll for completion. Create a reusable cloudify query request
- GetExecution queryExecution = cloudify.executions().byId(executionId);
-
- while (!timedOut && !CANCELLED.equals(status)) {
- // workflow is still running; check for timeout
- if (cancelTimeout <= 0) {
- logger.debug("Cancel timeout for workflow {} on deployment {}", workflowId, deploymentId);
- timedOut = true;
- continue;
- }
-
- sleep(pollInterval * 1000L);
-
- cancelTimeout -= pollInterval;
- logger.debug("pollTimeout remaining: {}", cancelTimeout);
-
- execution = queryExecution.execute();
- if (execution != null) {
- status = execution.getStatus();
- }
- }
-
- // Broke the loop. Check again for a terminal state
- if (CANCELLED.equals(status)) {
- // Finished cancelling. Return the original exception
- logger.debug("Cancel workflow {} completed on deployment {}", workflowId, deploymentId);
- throw new MsoCloudifyException(-1, "", "", savedException);
- } else {
- // Can only get here after a timeout
- logger.debug("Cancel workflow {} timeout out on deployment {}", workflowId, deploymentId);
- MsoCloudifyException exception = new MsoCloudifyException(-1, "", "", savedException);
- exception.setPendingWorkflow(true);
- throw exception;
- }
- } catch (Exception e) {
- // Catch-all. Log the message and throw the original exception
- logger.debug("Cancel workflow {} failed for deployment {} :", workflowId, deploymentId, e);
- MsoCloudifyException exception = new MsoCloudifyException(-1, "", "", savedException);
- exception.setPendingWorkflow(true);
- throw exception;
- }
- }
-
-
-
- /**
- * Query for a Cloudify Deployment (by Name). This call will always return a DeploymentInfo object. If the
- * deployment does not exist, an "empty" DeploymentInfo will be returned - containing only the deployment ID and a
- * special status of NOTFOUND.
- *
- * @param tenantId The Openstack ID of the tenant in which to query
- * @param cloudSiteId The cloud identifier (may be a region) in which to query
- * @return A StackInfo object
- * @throws MsoOpenstackException Thrown if the Openstack API call returns an exception.
- */
- public DeploymentInfo queryDeployment(String cloudSiteId, String tenantId, String deploymentId)
- throws MsoException {
- logger.debug("Query Cloudify Deployment: {} in tenant {}", deploymentId, tenantId);
-
- // Obtain the cloud site information where we will create the stack
- Optional<CloudSite> cloudSite = cloudConfig.getCloudSite(cloudSiteId);
- if (!cloudSite.isPresent()) {
- throw new MsoCloudSiteNotFound(cloudSiteId);
- }
-
- Cloudify cloudify = getCloudifyClient(cloudSite.get());
-
- // Build and send the Cloudify request
- Deployment deployment = new Deployment();
- try {
- GetDeployment queryDeployment = cloudify.deployments().byId(deploymentId);
- logger.debug(queryDeployment.toString());
- deployment = executeAndRecordCloudifyRequest(queryDeployment);
-
- // Next look for the latest execution
- ListExecutions listExecutions =
- cloudify.executions().listFiltered("deployment_id=" + deploymentId, "-created_at");
- Executions executions = listExecutions.execute();
-
- // If no executions, does this give NOT_FOUND or empty set?
- if (executions == null || executions.getItems().isEmpty()) {
- return new DeploymentInfoBuilder().withId(deployment.getId())
- .withDeploymentInputs(deployment.getInputs()).build();
- } else {
- return new DeploymentInfoBuilder().withId(deployment.getId())
- .withDeploymentInputs(deployment.getInputs())
- .withDeploymentOutputs(getDeploymentOutputs(cloudify, deploymentId).get())
- .fromExecution(executions.getItems().get(0)).build();
- }
- } catch (CloudifyConnectException ce) {
- // Couldn't connect to Cloudify
- logger.error("{} QueryDeployment: Cloudify connection failure: {} ", MessageEnum.RA_CREATE_STACK_ERR,
- ErrorCode.BusinessProcessError.getValue(), ce);
- throw new MsoIOException(ce.getMessage(), ce);
- } catch (CloudifyResponseException re) {
- if (re.getStatus() == 404) {
- // Got a NOT FOUND error. React differently based on deployment vs. execution
- if (deployment != null) {
- // Got NOT_FOUND on the executions. Assume this is a valid "empty" set
- return new DeploymentInfoBuilder().withId(deployment.getId())
- .withDeploymentInputs(deployment.getInputs())
- .withDeploymentOutputs(getDeploymentOutputs(cloudify, deploymentId).get()).build();
- } else {
- // Deployment not found. Default status of a DeploymentInfo object is NOTFOUND
- return new DeploymentInfoBuilder().withId(deploymentId).build();
- }
- }
- throw new MsoCloudifyException(re.getStatus(), re.getMessage(), re.getLocalizedMessage(), re);
- } catch (Exception e) {
- // Catch-all
- throw new MsoAdapterException(e.getMessage(), e);
- }
- }
-
-
- /**
- * Delete a Cloudify deployment (by ID). If the deployment is not found, it will be considered a successful
- * deletion. The return value is a DeploymentInfo object which contains the last deployment status.
- *
- * There is no rollback from a successful deletion. A deletion failure will also result in an undefined deployment
- * state - the components may or may not have been all or partially deleted, so the resulting deployment must be
- * considered invalid.
- *
- * @param tenantId The Openstack ID of the tenant in which to perform the delete
- * @param cloudSiteId The cloud identifier (may be a region) from which to delete the stack.
- * @return A StackInfo object
- * @throws MsoOpenstackException Thrown if the Openstack API call returns an exception.
- * @throws MsoCloudSiteNotFound
- */
- public DeploymentInfo uninstallAndDeleteDeployment(String cloudSiteId, String tenantId, String deploymentId,
- int timeoutMinutes) throws MsoException {
- // Obtain the cloud site information where we will create the stack
- Optional<CloudSite> cloudSite = cloudConfig.getCloudSite(cloudSiteId);
- if (!cloudSite.isPresent()) {
- throw new MsoCloudSiteNotFound(cloudSiteId);
- }
-
- Cloudify cloudify = getCloudifyClient(cloudSite.get());
-
- logger.debug("Ready to Uninstall/Delete Deployment ({})", deploymentId);
-
- // Query first to save the trouble if deployment not found
- try {
- GetDeployment queryDeploymentRequest = cloudify.deployments().byId(deploymentId);
- logger.debug(queryDeploymentRequest.toString());
-
- // deployment = executeAndRecordCloudifyRequest (queryDeploymentRequest);
- } catch (CloudifyResponseException e) {
- // Since this came on the 'Create Deployment' command, nothing was changed
- // in the cloud. Return the error as an exception.
- if (e.getStatus() == 404) {
- // Deployment doesn't exist. Return a "NOTFOUND" DeploymentInfo object
- // TODO: Should return NULL?
- logger.debug("Deployment requested for deletion does not exist: {}", deploymentId);
- return new DeploymentInfoBuilder().withId(deploymentId).withStatus(DeploymentStatus.NOTFOUND).build();
- } else {
- // Convert the CloudifyResponseException to an MsoOpenstackException
- logger.debug("ERROR STATUS = {}, \n {}\n {}\n {}", e.getStatus(), e.getMessage(),
- e.getLocalizedMessage(), e);
- MsoException me = cloudifyExceptionToMsoException(e, DELETE_DEPLOYMENT);
- me.setCategory(MsoExceptionCategory.INTERNAL);
- throw me;
- }
- } catch (CloudifyConnectException e) {
- // Error connecting to Cloudify instance. Convert to an MsoException
- throw cloudifyExceptionToMsoException(e, DELETE_DEPLOYMENT);
- } catch (RuntimeException e) {
- // Catch-all
- throw runtimeExceptionToMsoException(e, DELETE_DEPLOYMENT);
- }
-
- /*
- * Query the outputs before deleting so they can be returned as well
- */
- // DeploymentOutputs outputs = getDeploymentOutputs (cloudify, deploymentId);
-
- /*
- * Next execute the "uninstall" workflow. Note - this assumes there are no additional parameters required for
- * the workflow.
- */
- // TODO: No deletePollInterval that I'm aware of. Use the create interval
- int deletePollInterval =
- Integer.parseInt(this.environment.getProperty(deletePollIntervalProp, deletePollIntervalDefault));
- int pollTimeout = (timeoutMinutes * 60) + deletePollInterval;
-
- Execution uninstallWorkflow = null;
-
- try {
- uninstallWorkflow =
- executeWorkflow(cloudify, deploymentId, UNINSTALL, null, true, pollTimeout, deletePollInterval);
-
- if (uninstallWorkflow.getStatus().equals(TERMINATED)) {
- // Successful uninstall.
- logger.debug("Uninstall successful for deployment {}", deploymentId);
- } else {
- // The uninstall workflow completed with an error. Must fail the request, but will
- // leave the deployment in an indeterminate state, as cloud resources may still exist.
- MsoCloudifyException me =
- new MsoCloudifyException(0, "Uninstall Workflow Failed", uninstallWorkflow.getError());
- me.addContext(DELETE_DEPLOYMENT);
-
- throw me;
- }
- } catch (MsoException me) {
- // Uninstall workflow has failed.
- // Must fail the deletion... may leave the deployment in an inconclusive state
- me.addContext(DELETE_DEPLOYMENT);
-
- throw me;
- }
-
- // At this point, the deployment has been successfully uninstalled.
- // Next step is to delete the deployment itself
- Deployment deployment;
- try {
- DeleteDeployment deleteRequest = cloudify.deployments().deleteByName(deploymentId);
- logger.debug(deleteRequest.toString());
-
- // The delete request returns the deleted deployment
- deployment = deleteRequest.execute();
-
- } catch (CloudifyConnectException ce) {
- // Failed to delete. Must fail the request, but will leave the (uninstalled)
- // deployment in Cloudify DB.
- MsoCloudifyException me = new MsoCloudifyException(0, "Deployment Delete Failed", ce.getMessage(), ce);
- me.addContext(DELETE_DEPLOYMENT);
-
- throw me;
- } catch (CloudifyResponseException re) {
- // Failed to delete. Must fail the request, but will leave the (uninstalled)
- // deployment in the Cloudify DB.
- MsoCloudifyException me = new MsoCloudifyException(re.getStatus(), re.getMessage(), re.getMessage(), re);
- me.addContext(DELETE_DEPLOYMENT);
-
- throw me;
- } catch (Exception e) {
- // Catch-all
- MsoAdapterException ae = new MsoAdapterException(e.getMessage(), e);
- ae.addContext(DELETE_DEPLOYMENT);
-
- throw ae;
- }
-
- // Return the deleted deployment info (with runtime outputs) along with the completed uninstall workflow status
- return new DeploymentInfoBuilder().withId(deployment.getId()).withDeploymentInputs(deployment.getInputs())
- .withDeploymentOutputs(getDeploymentOutputs(cloudify, deploymentId).get())
- .fromExecution(uninstallWorkflow).build();
- }
-
-
- /**
- * Check if a blueprint is available for use at a targeted cloud site. This requires checking the Cloudify Manager
- * which is servicing that cloud site to see if the specified blueprint has been loaded.
- *
- * @param cloudSiteId The cloud site where the blueprint is needed
- * @param blueprintId The ID for the blueprint in Cloudify
- */
- public boolean isBlueprintLoaded(String cloudSiteId, String blueprintId) throws MsoException {
- // Obtain the cloud site information where we will load the blueprint
- Optional<CloudSite> cloudSite = cloudConfig.getCloudSite(cloudSiteId);
- if (!cloudSite.isPresent()) {
- throw new MsoCloudSiteNotFound(cloudSiteId);
- }
-
- Cloudify cloudify = getCloudifyClient(cloudSite.get());
-
- GetBlueprint getRequest = cloudify.blueprints().getMetadataById(blueprintId);
- try {
- Blueprint bp = getRequest.execute();
- if (bp != null) {
- logger.debug("Blueprint exists: {}", bp.getId());
- return true;
- } else {
- logger.debug("Null blueprint!");
- return false;
- }
- } catch (CloudifyResponseException ce) {
- if (ce.getStatus() == 404) {
- return false;
- } else {
- throw ce;
- }
- }
- }
-
- /**
- * Upload a blueprint to the Cloudify Manager that is servicing a Cloud Site. The blueprint currently must be
- * structured as a single directory with all of the required files. One of those files is designated the "main file"
- * for the blueprint. Files are provided as byte arrays, though expect only text files will be distributed from ASDC
- * and stored by MSO.
- *
- * Cloudify requires a single root directory in its blueprint zip files. The requested blueprint ID will also be
- * used as the directory. All of the files will be added to this directory in the zip file.
- */
- public void uploadBlueprint(String cloudSiteId, String blueprintId, String mainFileName,
- Map<String, byte[]> blueprintFiles, boolean failIfExists) throws MsoException {
- // Obtain the cloud site information where we will load the blueprint
- Optional<CloudSite> cloudSite = cloudConfig.getCloudSite(cloudSiteId);
- if (!cloudSite.isPresent()) {
- throw new MsoCloudSiteNotFound(cloudSiteId);
- }
-
- Cloudify cloudify = getCloudifyClient(cloudSite.get());
-
- boolean blueprintUploaded = uploadBlueprint(cloudify, blueprintId, mainFileName, blueprintFiles);
-
- if (!blueprintUploaded && failIfExists) {
- throw new MsoAdapterException("Blueprint already exists");
- }
- }
-
- /*
- * Common method to load a blueprint. May be called from
- */
- protected boolean uploadBlueprint(Cloudify cloudify, String blueprintId, String mainFileName,
- Map<String, byte[]> blueprintFiles) throws MsoException {
- // Check if it already exists. If so, return false.
- GetBlueprint getRequest = cloudify.blueprints().getMetadataById(blueprintId);
- try {
- Blueprint bp = getRequest.execute();
- if (bp != null) {
- logger.debug("Blueprint {} already exists.", bp.getId());
- return false;
- } else {
- logger.debug("Null blueprint!");
- }
- } catch (CloudifyResponseException ce) {
- if (ce.getStatus() == 404) {
- // This is the expected result.
- logger.debug("Verified that Blueprint doesn't exist yet");
- } else {
- throw ce;
- }
- }
-
- // Create a blueprint ZIP file in memory
- ByteArrayOutputStream zipBuffer = new ByteArrayOutputStream();
- ZipOutputStream zipOut = new ZipOutputStream(zipBuffer);
-
- try {
- // Put the root directory
- String rootDir = blueprintId + (blueprintId.endsWith("/") ? "" : "/");
- zipOut.putNextEntry(new ZipEntry(rootDir));
- zipOut.closeEntry();
-
- for (String fileName : blueprintFiles.keySet()) {
- ZipEntry ze = new ZipEntry(rootDir + fileName);
- zipOut.putNextEntry(ze);
- zipOut.write(blueprintFiles.get(fileName));
- zipOut.closeEntry();
- }
- zipOut.close();
- } catch (IOException e) {
- // Since we're writing to a byte array, this should never happen
- }
- logger.debug("Blueprint zip file size: {}", zipBuffer.size());
-
- // Ready to upload the blueprint zip
-
- try (InputStream blueprintStream = new ByteArrayInputStream(zipBuffer.toByteArray())) {
- UploadBlueprint uploadRequest =
- cloudify.blueprints().uploadFromStream(blueprintId, mainFileName, blueprintStream);
- Blueprint blueprint = uploadRequest.execute();
- logger.debug("Successfully uploaded blueprint {}", blueprint.getId());
- } catch (CloudifyResponseException | CloudifyConnectException e) {
- throw cloudifyExceptionToMsoException(e, UPLOAD_BLUEPRINT);
- } catch (RuntimeException e) {
- // Catch-all
- throw runtimeExceptionToMsoException(e, UPLOAD_BLUEPRINT);
- } catch (IOException e) {
- // for try-with-resources
- throw ioExceptionToMsoException(e, UPLOAD_BLUEPRINT);
- }
-
- return true;
- }
-
-
-
- // ---------------------------------------------------------------
- // PRIVATE FUNCTIONS FOR USE WITHIN THIS CLASS
-
- /**
- * Get a Cloudify client for the specified cloud site. Everything that is required can be found in the Cloud Config.
- *
- * @param cloudSite
- * @return a Cloudify object
- */
- public Cloudify getCloudifyClient(CloudSite cloudSite) throws MsoException {
- CloudifyManager cloudifyConfig = cloudConfig.getCloudifyManager(cloudSite.getCloudifyId());
- if (cloudifyConfig == null) {
- throw new MsoCloudifyManagerNotFound(cloudSite.getId());
- }
-
- // Get a Cloudify client
- // Set a Token Provider to fetch tokens from Cloudify itself.
- String cloudifyUrl = cloudifyConfig.getCloudifyUrl();
- Cloudify cloudify = new Cloudify(cloudifyUrl);
- cloudify.setTokenProvider(new CloudifyClientTokenProvider(cloudifyUrl, cloudifyConfig.getUsername(),
- CryptoUtils.decryptCloudConfigPassword(cloudifyConfig.getPassword())));
-
- return cloudify;
- }
-
-
- /*
- * Query for a Cloudify Deployment. This function is needed in several places, so a common method is useful. This
- * method takes an authenticated CloudifyClient (which internally identifies the cloud & tenant to search), and
- * returns a Deployment object if found, Null if not found, or an MsoCloudifyException if the Cloudify API call
- * fails.
- *
- * @param cloudifyClient an authenticated Cloudify client
- *
- * @param deploymentId the deployment to query
- *
- * @return a Deployment object or null if the requested deployment doesn't exist.
- *
- * @throws MsoCloudifyException Thrown if the Cloudify API call returns an exception
- */
- protected Deployment queryDeployment(Cloudify cloudify, String deploymentId) throws MsoException {
- if (deploymentId == null) {
- return null;
- }
- try {
- GetDeployment request = cloudify.deployments().byId(deploymentId);
- return executeAndRecordCloudifyRequest(request);
- } catch (CloudifyResponseException e) {
- if (e.getStatus() == 404) {
- logger.debug("queryDeployment - not found: {}", deploymentId);
- return null;
- } else {
- // Convert the CloudifyResponseException to an MsoCloudifyException
- throw cloudifyExceptionToMsoException(e, "QueryDeployment");
- }
- } catch (CloudifyConnectException e) {
- // Connection to Openstack failed
- throw cloudifyExceptionToMsoException(e, "QueryDeployment");
- }
- }
-
-
- public void copyStringOutputsToInputs(Map<String, String> inputs, Map<String, Object> otherStackOutputs,
- boolean overWrite) {
- if (inputs == null || otherStackOutputs == null)
- return;
-
- for (Map.Entry<String, Object> entry : otherStackOutputs.entrySet()) {
- String key = entry.getKey();
- Object value = entry.getValue();
-
- if (value instanceof JsonNode) {
- // This is a bit of mess - but I think it's the least impacting
- // let's convert it BACK to a string - then it will get converted back later
- try {
- inputs.put(key, this.convertNode((JsonNode) value));
- } catch (Exception e) {
- logger.debug("WARNING: unable to convert JsonNode output value for {}", key);
- // effect here is this value will not have been copied to the inputs - and therefore will error out
- // downstream
- }
- } else if (value instanceof java.util.LinkedHashMap) {
- logger.debug("LinkedHashMap - this is showing up as a LinkedHashMap instead of JsonNode");
- try {
- inputs.put(key, JSON_MAPPER.writeValueAsString(value));
- } catch (Exception e) {
- logger.debug("WARNING: unable to convert LinkedHashMap output value for {}", key);
- }
- } else {
- // just try to cast it - could be an integer or some such
- try {
- inputs.put(key, (String) value);
- } catch (Exception e) {
- logger.debug("WARNING: unable to convert output value for {}", key);
- // effect here is this value will not have been copied to the inputs - and therefore will error out
- // downstream
- }
- }
- }
- return;
- }
-
- /*
- * Normalize an input value to an Object, based on the target parameter type. If the type is not recognized, it will
- * just be returned unchanged (as a string).
- */
- public Object convertInputValue(Object inputValue, HeatTemplateParam templateParam) {
- String type = templateParam.getParamType();
- logger.debug("Parameter: {} is of type {}", templateParam.getParamName(), type);
-
- if (("number").equalsIgnoreCase(type)) {
- try {
- return Integer.valueOf(inputValue.toString());
- } catch (Exception e) {
- logger.debug("Unable to convert {} to an integer!", inputValue);
- return null;
- }
- } else if (("json").equalsIgnoreCase(type)) {
- try {
- if (inputValue instanceof String) {
- return JSON_MAPPER.readTree(inputValue.toString());
- }
- // will already marshal to json without intervention
- return inputValue;
- } catch (Exception e) {
- logger.debug("Unable to convert {} to a JsonNode!", inputValue);
- return null;
- }
- } else if (("boolean").equalsIgnoreCase(type)) {
- return Boolean.valueOf(inputValue.toString());
- }
-
- // Nothing else matched. Return the original string
- return inputValue;
- }
-
-
- private String convertNode(final JsonNode node) {
- try {
- final Object obj = JSON_MAPPER.treeToValue(node, Object.class);
- return JSON_MAPPER.writeValueAsString(obj);
- } catch (JsonParseException jpe) {
- logger.debug("Error converting json to string {}", jpe);
- } catch (Exception e) {
- logger.debug("Error converting json to string {}", e);
- }
- return "[Error converting json to string]";
- }
-
-
- /*
- * Method to execute a Cloudify command and track its execution time. For the metrics log, a category of "Cloudify"
- * is used along with a sub-category that identifies the specific call (using the real cloudify-client classname of
- * the CloudifyRequest<T> parameter).
- */
-
-
- protected <T> T executeAndRecordCloudifyRequest(CloudifyRequest<T> request) {
-
- String requestType;
- if (request.getClass().getEnclosingClass() != null) {
- requestType =
- request.getClass().getEnclosingClass().getSimpleName() + "." + request.getClass().getSimpleName();
- } else {
- requestType = request.getClass().getSimpleName();
- }
-
- int retryDelay = poConfig.getRetryDelay();
- int retryCount = poConfig.getRetryCount();
- String retryCodes = poConfig.getRetryCodes();
-
- // Run the actual command. All exceptions will be propagated
- while (true) {
- try {
- return request.execute();
- } catch (CloudifyResponseException e) {
- boolean retry = false;
- if (retryCodes != null) {
- int code = e.getStatus();
- logger.debug("Config values RetryDelay: {} RetryCount:{} RetryCodes:{} ResponseCode:{}", retryDelay,
- retryCount, retryCodes, code);
- for (String rCode : retryCodes.split(",")) {
- try {
- if (retryCount > 0 && code == Integer.parseInt(rCode)) {
- retryCount--;
- retry = true;
- logger.debug(
- "CloudifyResponseException ResponseCode:{} request:{} Retry indicated. Attempts remaining:{}",
- code, requestType, retryCount);
- break;
- }
- } catch (NumberFormatException e1) {
- logger.error("{} No retries. Exception in parsing retry code in config:{} {}",
- MessageEnum.RA_CONFIG_EXC, rCode, ErrorCode.SchemaError.getValue());
- throw e;
- }
- }
- }
- if (retry) {
- sleep(retryDelay * 1000L);
- } else
- throw e; // exceeded retryCount or code is not retryable
- } catch (CloudifyConnectException e) {
- // Connection to Cloudify failed
- if (retryCount > 0) {
- retryCount--;
- logger.debug(" request: {} Retry indicated. Attempts remaining:{}", requestType, retryCount);
- sleep(retryDelay * 1000L);
- } else
- throw e;
-
- }
- }
- }
-
- /*
- * Convert an Exception on a Cloudify call to an MsoCloudifyException. This method supports
- * CloudifyResponseException and CloudifyConnectException.
- */
- protected MsoException cloudifyExceptionToMsoException(CloudifyBaseException e, String context) {
- MsoException me = null;
-
- if (e instanceof CloudifyResponseException) {
- CloudifyResponseException re = (CloudifyResponseException) e;
-
- try {
- // Failed Cloudify calls return an error entity body.
- CloudifyError error = re.getResponse().getErrorEntity(CloudifyError.class);
- logger.error("{} {} {} Exception - Cloudify Error on {}: {}", MessageEnum.RA_CONNECTION_EXCEPTION,
- CLOUDIFY, ErrorCode.DataError.getValue(), context, error.getErrorCode());
- String fullError = error.getErrorCode() + ": " + error.getMessage();
- logger.debug(fullError);
- me = new MsoCloudifyException(re.getStatus(), re.getMessage(), fullError);
- } catch (Exception e2) {
- // Couldn't parse the body as a "CloudifyError". Report the original HTTP error.
- logger.error("{} {} {} Exception - HTTP Error on {}: {}, {} ", MessageEnum.RA_CONNECTION_EXCEPTION,
- CLOUDIFY, ErrorCode.DataError.getValue(), context, re.getStatus(), e.getMessage(), e2);
- me = new MsoCloudifyException(re.getStatus(), re.getMessage(), "");
- }
-
- // Add the context of the error
- me.addContext(context);
-
- // Generate an alarm for 5XX and higher errors.
- if (re.getStatus() >= 500) {
-
- }
- } else if (e instanceof CloudifyConnectException) {
- CloudifyConnectException ce = (CloudifyConnectException) e;
-
- me = new MsoIOException(ce.getMessage());
- me.addContext(context);
-
- // Generate an alarm for all connection errors.
-
- logger.error("{} {} {} Cloudify connection error on {}: ", MessageEnum.RA_CONNECTION_EXCEPTION, CLOUDIFY,
- ErrorCode.DataError.getValue(), context, e);
- }
-
- return me;
- }
-
-
-
- /*******************************************************************************
- *
- * Methods (and associated utilities) to implement the VduPlugin interface
- *
- *******************************************************************************/
-
- /**
- * VduPlugin interface for instantiate function.
- *
- * This one is a bit more complex, in that it will first upload the blueprint if needed, then create the Cloudify
- * deployment and execute the install workflow.
- *
- * This implementation also merges any parameters defined in the ENV file with the other other input parameters for
- * any undefined parameters). The basic MsoCloudifyUtils separates blueprint management from deploument actions, but
- * the VduPlugin does not declare blueprint management operations.
- */
- @Override
- public VduInstance instantiateVdu(CloudInfo cloudInfo, String instanceName, Map<String, Object> inputs,
- VduModelInfo vduModel, boolean rollbackOnFailure) throws VduException {
- String cloudSiteId = cloudInfo.getCloudSiteId();
- String tenantId = cloudInfo.getTenantId();
-
- // Translate the VDU ModelInformation structure to that which is needed for
- // creating and uploading a blueprint. Use the model customization UUID as
- // the blueprint identifier.
-
- String blueprintId = vduModel.getModelCustomizationUUID();
-
- try {
-
- if (!isBlueprintLoaded(cloudSiteId, blueprintId)) {
- logger.debug("Blueprint {} is not loaded. Will upload it now.", blueprintId);
-
- // Prepare the blueprint inputs. Need the set of blueprint templates and files,
- // plus the main blueprint name.
- Map<String, byte[]> blueprintFiles = new HashMap<>();
- String mainTemplate = "";
-
- // Add all of the blueprint artifacts from the VDU model
- List<VduArtifact> vduArtifacts = vduModel.getArtifacts();
- for (VduArtifact vduArtifact : vduArtifacts) {
- // Add all artifacts to the blueprint, with one exception.
- // ENVIRONMENT files will be processed later as additional parameters.
-
- ArtifactType artifactType = vduArtifact.getType();
- if (artifactType != ArtifactType.ENVIRONMENT) {
- blueprintFiles.put(vduArtifact.getName(), vduArtifact.getContent());
-
- if (artifactType == ArtifactType.MAIN_TEMPLATE) {
- mainTemplate = vduArtifact.getName();
- }
- }
- }
-
- // Upload the blueprint package
- uploadBlueprint(cloudSiteId, blueprintId, mainTemplate, blueprintFiles, false);
- }
- } catch (Exception e) {
- throw new VduException("CloudifyUtils (instantiateVDU): blueprint Exception", e);
- }
-
-
- // Next, create and install a new deployment based on the blueprint.
- // For Cloudify, the deploymentId is specified by the client. Just use the instance name
- // as the ID.
-
- try {
- // Query the Cloudify Deployment object and populate a VduInstance
- DeploymentInfo deployment =
- createAndInstallDeployment(cloudSiteId, tenantId, instanceName, blueprintId, inputs, true, // (poll
- // for
- // completion)
- vduModel.getTimeoutMinutes(), rollbackOnFailure);
-
- return deploymentInfoToVduInstance(deployment);
- } catch (Exception e) {
- throw new VduException("CloudifyUtils (instantiateVDU): Create-and-install-deployment Exception", e);
- }
- }
-
-
- /**
- * VduPlugin interface for query function.
- */
- @Override
- public VduInstance queryVdu(CloudInfo cloudInfo, String instanceId) throws VduException {
- String cloudSiteId = cloudInfo.getCloudSiteId();
- String tenantId = cloudInfo.getTenantId();
-
- try {
- // Query the Cloudify Deployment object and populate a VduInstance
- DeploymentInfo deployment = queryDeployment(cloudSiteId, tenantId, instanceId);
-
- return deploymentInfoToVduInstance(deployment);
- } catch (Exception e) {
- throw new VduException("Query VDU Exception", e);
- }
- }
-
-
- /**
- * VduPlugin interface for delete function.
- */
- @Override
- public VduInstance deleteVdu(CloudInfo cloudInfo, String instanceId, int timeoutMinutes) throws VduException {
- String cloudSiteId = cloudInfo.getCloudSiteId();
- String tenantId = cloudInfo.getTenantId();
-
- try {
- // Uninstall and delete the Cloudify Deployment
- DeploymentInfo deployment = uninstallAndDeleteDeployment(cloudSiteId, tenantId, instanceId, timeoutMinutes);
-
- // Populate a VduInstance based on the deleted Cloudify Deployment object
- return deploymentInfoToVduInstance(deployment);
- } catch (Exception e) {
- throw new VduException("Delete VDU Exception", e);
- }
- }
-
-
- /**
- * VduPlugin interface for update function.
- *
- * Update is currently not supported in the MsoCloudifyUtils implementation. Just return a VduException.
- *
- */
- @Override
- public VduInstance updateVdu(CloudInfo cloudInfo, String instanceId, Map<String, Object> inputs,
- VduModelInfo vduModel, boolean rollbackOnFailure) throws VduException {
- throw new VduException("CloudifyUtils: updateVDU interface not supported");
- }
-
-
- /*
- * Convert the local DeploymentInfo object (Cloudify-specific) to a generic VduInstance object
- */
- protected VduInstance deploymentInfoToVduInstance(DeploymentInfo deployment) {
- VduInstance vduInstance = new VduInstance();
-
- // only one ID in Cloudify, use for both VDU name and ID
- vduInstance.setVduInstanceId(deployment.getId());
- vduInstance.setVduInstanceName(deployment.getId());
-
- // Copy inputs and outputs
- vduInstance.setInputs(deployment.getInputs());
- vduInstance.setOutputs(deployment.getOutputs());
-
- // Translate the status elements
- vduInstance.setStatus(deploymentStatusToVduStatus(deployment));
-
- return vduInstance;
- }
-
- protected VduStatus deploymentStatusToVduStatus(DeploymentInfo deployment) {
- VduStatus vduStatus = new VduStatus();
-
- // Determine the status based on last action & status
- // DeploymentInfo object should be enhanced to report a better status internally.
- DeploymentStatus status = deployment.getStatus();
-
- if (status == null) {
- vduStatus.setState(VduStateType.UNKNOWN);
- } else if (status == DeploymentStatus.NOTFOUND) {
- vduStatus.setState(VduStateType.NOTFOUND);
- } else if (status == DeploymentStatus.INSTALLED) {
- vduStatus.setState(VduStateType.INSTANTIATED);
- } else if (status == DeploymentStatus.CREATED) {
- // Deployment exists but is not installed. This shouldn't really happen,
- // since create + install or uninstall + delete are always done together.
- // But account for it anyway, assuming the operation is still in progress.
- String lastAction = deployment.getLastAction();
- if (lastAction == null)
- vduStatus.setState(VduStateType.INSTANTIATING);
- else
- vduStatus.setState(VduStateType.DELETING);
- } else if (status == DeploymentStatus.FAILED) {
- vduStatus.setState(VduStateType.FAILED);
- } else {
- vduStatus.setState(VduStateType.UNKNOWN);
- }
-
- vduStatus.setErrorMessage(deployment.getErrorMessage());
- vduStatus.setLastAction(new PluginAction(deployment.getLastAction(), deployment.getActionStatus(),
- deployment.getErrorMessage()));
-
- return vduStatus;
- }
-
- /*
- * Return an OpenstackConfig object as expected by Cloudify Openstack Plug-in. Base the values on the CloudSite
- * definition.
- */
- protected OpenstackConfig getOpenstackConfig(CloudSite cloudSite, String tenantId) {
- OpenstackConfig openstackConfig = new OpenstackConfig();
- openstackConfig.setRegion(cloudSite.getRegionId());
- openstackConfig.setAuthUrl(cloudSite.getIdentityService().getIdentityUrl());
- openstackConfig.setUsername(cloudSite.getIdentityService().getMsoId());
- openstackConfig
- .setPassword(CryptoUtils.decryptCloudConfigPassword(cloudSite.getIdentityService().getMsoPass()));
- openstackConfig.setTenantName(tenantId);
- return openstackConfig;
- }
-
- /*
- * Return an Azure object as expected by Cloudify Azure Plug-in. Base the values on the CloudSite definition.
- */
- protected AzureConfig getAzureConfig(CloudSite cloudSite, String tenantId) {
- AzureConfig azureConfig = new AzureConfig();
- // TODO: Use adminTenant for now, instead of adding another element
- azureConfig.setSubscriptionId(cloudSite.getIdentityService().getAdminTenant());
- azureConfig.setTenantId(tenantId);
- azureConfig.setClientId(cloudSite.getIdentityService().getMsoId());
- azureConfig.setClientSecret(cloudSite.getIdentityService().getMsoPass());
- return azureConfig;
- }
-
- private void sleep(long time) {
- try {
- Thread.sleep(time);
- } catch (InterruptedException e) {
- logger.debug("Thread interrupted while sleeping!", e);
- Thread.currentThread().interrupt();
- }
- }
-}
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MsoCommonUtils.java b/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MsoCommonUtils.java
index 50ebcc66ee..6800428a62 100644
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MsoCommonUtils.java
+++ b/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MsoCommonUtils.java
@@ -97,7 +97,7 @@ public class MsoCommonUtils {
* openstack-java-sdk classname of the OpenStackRequest<T> parameter).
*/
- protected <T> T executeAndRecordOpenstackRequest(OpenStackRequest<T> request) {
+ public <T> T executeAndRecordOpenstackRequest(OpenStackRequest<T> request) {
return executeAndRecordOpenstackRequest(request, true);
}
@@ -174,7 +174,7 @@ public class MsoCommonUtils {
* Convert an Openstack Exception on a Keystone call to an MsoException. This method supports both
* OpenstackResponseException and OpenStackConnectException.
*/
- protected MsoException keystoneErrorToMsoException(OpenStackBaseException e, String context) {
+ public MsoException keystoneErrorToMsoException(OpenStackBaseException e, String context) {
MsoException me = null;
if (e instanceof OpenStackResponseException) {
@@ -455,15 +455,16 @@ public class MsoCommonUtils {
*/
protected KeystoneAuthHolder getKeystoneAuthHolder(String cloudSiteId, String tenantId, String serviceName)
throws MsoException {
- CloudSite cloudSite =
- cloudConfig.getCloudSite(cloudSiteId).orElseThrow(() -> new MsoCloudSiteNotFound(cloudSiteId));
- String cloudId = cloudSite.getId();
- String region = cloudSite.getRegionId();
- CloudIdentity cloudIdentity = cloudSite.getIdentityService();
- MsoTenantUtils tenantUtils =
- tenantUtilsFactory.getTenantUtilsByServerType(cloudIdentity.getIdentityServerType());
- String keystoneUrl = tenantUtils.getKeystoneUrl(cloudId, cloudIdentity);
+ CloudIdentity cloudIdentity = null;
try {
+ CloudSite cloudSite =
+ cloudConfig.getCloudSite(cloudSiteId).orElseThrow(() -> new MsoCloudSiteNotFound(cloudSiteId));
+ String cloudId = cloudSite.getId();
+ String region = cloudSite.getRegionId();
+ cloudIdentity = cloudSite.getIdentityService();
+ MsoTenantUtils tenantUtils =
+ tenantUtilsFactory.getTenantUtilsByServerType(cloudIdentity.getIdentityServerType());
+ String keystoneUrl = tenantUtils.getKeystoneUrl(cloudId, cloudIdentity);
if (ServerType.KEYSTONE.equals(cloudIdentity.getIdentityServerType())) {
Access access = getKeystone(tenantId, cloudIdentity, keystoneUrl);
try {
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudCreateHeatResponse.java b/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudCreateHeatResponse.java
index 16671bbe50..6eb7e3d56d 100644
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudCreateHeatResponse.java
+++ b/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudCreateHeatResponse.java
@@ -22,11 +22,11 @@ package org.onap.so.openstack.utils;
import java.io.Serializable;
import java.util.List;
+import org.apache.commons.lang3.builder.ToStringBuilder;
import com.fasterxml.jackson.annotation.JsonCreator;
import com.fasterxml.jackson.annotation.JsonInclude;
import com.fasterxml.jackson.annotation.JsonProperty;
import com.fasterxml.jackson.annotation.JsonPropertyOrder;
-import org.apache.commons.lang.builder.ToStringBuilder;
@JsonInclude(JsonInclude.Include.NON_NULL)
@JsonPropertyOrder({"id", "links"})
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudCreateLinkResponse.java b/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudCreateLinkResponse.java
index 1f55aa92a2..f9a8093de6 100644
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudCreateLinkResponse.java
+++ b/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudCreateLinkResponse.java
@@ -21,11 +21,11 @@
package org.onap.so.openstack.utils;
import java.io.Serializable;
+import org.apache.commons.lang3.builder.ToStringBuilder;
import com.fasterxml.jackson.annotation.JsonCreator;
import com.fasterxml.jackson.annotation.JsonInclude;
import com.fasterxml.jackson.annotation.JsonProperty;
import com.fasterxml.jackson.annotation.JsonPropertyOrder;
-import org.apache.commons.lang.builder.ToStringBuilder;
@JsonInclude(JsonInclude.Include.NON_NULL)
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudCreateResponse.java b/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudCreateResponse.java
index 9fa4557a45..dcc4f50b45 100644
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudCreateResponse.java
+++ b/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudCreateResponse.java
@@ -21,13 +21,13 @@
package org.onap.so.openstack.utils;
import java.io.Serializable;
+import org.apache.commons.lang3.builder.ToStringBuilder;
import com.fasterxml.jackson.annotation.JsonCreator;
import com.fasterxml.jackson.annotation.JsonIgnoreProperties;
import com.fasterxml.jackson.annotation.JsonInclude;
import com.fasterxml.jackson.annotation.JsonProperty;
import com.fasterxml.jackson.annotation.JsonPropertyOrder;
import com.fasterxml.jackson.databind.JsonNode;
-import org.apache.commons.lang.builder.ToStringBuilder;
@JsonInclude(JsonInclude.Include.NON_NULL)
@JsonIgnoreProperties(ignoreUnknown = true)
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudQueryResponse.java b/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudQueryResponse.java
index c575304ade..ba5e449034 100644
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudQueryResponse.java
+++ b/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudQueryResponse.java
@@ -21,12 +21,12 @@
package org.onap.so.openstack.utils;
import java.io.Serializable;
+import org.apache.commons.lang3.builder.ToStringBuilder;
import com.fasterxml.jackson.annotation.JsonCreator;
import com.fasterxml.jackson.annotation.JsonInclude;
import com.fasterxml.jackson.annotation.JsonProperty;
import com.fasterxml.jackson.annotation.JsonPropertyOrder;
import com.fasterxml.jackson.databind.JsonNode;
-import org.apache.commons.lang.builder.ToStringBuilder;
@JsonInclude(JsonInclude.Include.NON_NULL)
@JsonPropertyOrder({"template_type", "workload_id", "workload_status", "workload_status_reason"})
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudRequest.java b/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudRequest.java
index 95dd48caa6..d679b0303e 100644
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudRequest.java
+++ b/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/MulticloudRequest.java
@@ -21,12 +21,12 @@
package org.onap.so.openstack.utils;
import java.io.Serializable;
+import org.apache.commons.lang3.builder.ToStringBuilder;
import com.fasterxml.jackson.annotation.JsonInclude;
import com.fasterxml.jackson.annotation.JsonProperty;
import com.fasterxml.jackson.annotation.JsonPropertyOrder;
import com.fasterxml.jackson.databind.JsonNode;
import com.woorea.openstack.heat.model.CreateStackParam;
-import org.apache.commons.lang.builder.ToStringBuilder;
@JsonInclude(JsonInclude.Include.NON_NULL)
@JsonPropertyOrder({"generic-vnf-id", "vf-module-id", "vf-module-model-invariant-id", "vf-module-model-version-id",
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/NovaClient.java b/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/NovaClient.java
index c5eeb34157..968e7864b3 100644
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/NovaClient.java
+++ b/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/NovaClient.java
@@ -49,4 +49,6 @@ public class NovaClient extends MsoCommonUtils {
novaClient.token(keystone.getId());
return novaClient;
}
+
+
}
diff --git a/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/beans/DeploymentInfoBuilderTest.java b/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/beans/DeploymentInfoBuilderTest.java
deleted file mode 100644
index 9fbb45a2c3..0000000000
--- a/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/beans/DeploymentInfoBuilderTest.java
+++ /dev/null
@@ -1,159 +0,0 @@
-/*
- * ============LICENSE_START======================================================= ONAP : SO
- * ================================================================================ Copyright (C) 2018 Nokia.
- * ============================================================================= Licensed under the Apache License,
- * Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy
- * of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on
- * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the
- * specific language governing permissions and limitations under the License.
- * ============LICENSE_END=========================================================
- */
-package org.onap.so.cloudify.beans;
-
-import static org.assertj.core.api.Assertions.assertThat;
-import com.google.common.collect.ImmutableMap;
-import org.junit.Test;
-import org.onap.so.cloudify.v3.model.Execution;
-
-public class DeploymentInfoBuilderTest {
-
- private static final String ERROR_MESSAGE = "something went wrong";
- private static final String INSTALL_WORKFLOW_ID = "install";
- private static final String UNINSTALL_WORKFLOW_ID = "uninstall";
-
- @Test
- public void shouldConstructDeploymentInfo_withBasicValues() {
- DeploymentInfo deploymentInfo = new DeploymentInfoBuilder().withId("id").withStatus(DeploymentStatus.CREATED)
- .withDeploymentOutputs(ImmutableMap.of()).withDeploymentInputs(ImmutableMap.of())
- .withActionStatus("started").withLastAction(INSTALL_WORKFLOW_ID).withErrorMessage(ERROR_MESSAGE)
- .build();
-
- assertThat(deploymentInfo.getId()).isEqualTo("id");
- assertThat(deploymentInfo.getStatus()).isEqualTo(DeploymentStatus.CREATED);
- assertThat(deploymentInfo.getOutputs()).isEqualTo(ImmutableMap.of());
- assertThat(deploymentInfo.getInputs()).isEqualTo(ImmutableMap.of());
- assertThat(deploymentInfo.getActionStatus()).isEqualTo("started");
- assertThat(deploymentInfo.getLastAction()).isEqualTo(INSTALL_WORKFLOW_ID);
- assertThat(deploymentInfo.getErrorMessage()).isEqualTo(ERROR_MESSAGE);
- }
-
- @Test
- public void shouldConstructDeploymentInfo_withCreateDeploymentStatus_fromNullExecution() {
- DeploymentInfo deploymentInfo = new DeploymentInfoBuilder().fromExecution(null).build();
-
- assertThat(deploymentInfo.getStatus()).isEqualTo(DeploymentStatus.CREATED);
- }
-
- @Test
- public void shouldConstructDeploymentInfo_withInstalledDeploymentStatus_fromTerminatedExecution() {
- String workflowIdLastAction = INSTALL_WORKFLOW_ID;
- String status = "terminated";
- DeploymentStatus expectedDeploymentStatus = DeploymentStatus.INSTALLED;
- verifyDeploymentInfoConstruction(workflowIdLastAction, status, expectedDeploymentStatus);
- }
-
- @Test
- public void shouldConstructDeploymentInfo_withFailedDeploymentStatus_fromFailedInstallExecution() {
- String workflowIdLastAction = INSTALL_WORKFLOW_ID;
- String status = "failed";
- DeploymentStatus expectedDeploymentStatus = DeploymentStatus.FAILED;
- verifyDeploymentInfoConstruction(workflowIdLastAction, status, expectedDeploymentStatus);
- }
-
- @Test
- public void shouldConstructDeploymentInfo_withInstallingDeploymentStatus_fromStartedExecution() {
- String workflowIdLastAction = INSTALL_WORKFLOW_ID;
- String status = "started";
- DeploymentStatus expectedDeploymentStatus = DeploymentStatus.INSTALLING;
- verifyDeploymentInfoConstruction(workflowIdLastAction, status, expectedDeploymentStatus);
- }
-
- @Test
- public void shouldConstructDeploymentInfo_withInstallingDeploymentStatus_fromPendingExecution() {
- String workflowIdLastAction = INSTALL_WORKFLOW_ID;
- String status = "pending";
- DeploymentStatus expectedDeploymentStatus = DeploymentStatus.INSTALLING;
- verifyDeploymentInfoConstruction(workflowIdLastAction, status, expectedDeploymentStatus);
- }
-
- @Test
- public void shouldConstructDeploymentInfo_withUnknownDeploymentStatus_fromUnmappableExecution() {
- String workflowIdLastAction = INSTALL_WORKFLOW_ID;
- String status = "strangeStatus";
- DeploymentStatus expectedDeploymentStatus = DeploymentStatus.UNKNOWN;
- verifyDeploymentInfoConstruction(workflowIdLastAction, status, expectedDeploymentStatus);
- }
-
- @Test
- public void shouldConstructDeploymentInfo_withCreatedDeploymentStatus_fromTerminatedExecution() {
- String workflowIdLastAction = UNINSTALL_WORKFLOW_ID;
- String status = "terminated";
- DeploymentStatus expectedDeploymentStatus = DeploymentStatus.CREATED;
- verifyDeploymentInfoConstruction(workflowIdLastAction, status, expectedDeploymentStatus);
- }
-
- @Test
- public void shouldConstructDeploymentInfo_withFailedDeploymentStatus_fromFailedUninstallExecution() {
- String workflowIdLastAction = UNINSTALL_WORKFLOW_ID;
- String status = "failed";
- DeploymentStatus expectedDeploymentStatus = DeploymentStatus.FAILED;
- verifyDeploymentInfoConstruction(workflowIdLastAction, status, expectedDeploymentStatus);
- }
-
- @Test
- public void shouldConstructDeploymentInfo_withUninstallingDeploymentStatus_fromStartedUninstallExecution() {
- String workflowIdLastAction = UNINSTALL_WORKFLOW_ID;
- String status = "started";
- DeploymentStatus expectedDeploymentStatus = DeploymentStatus.UNINSTALLING;
- verifyDeploymentInfoConstruction(workflowIdLastAction, status, expectedDeploymentStatus);
- }
-
- @Test
- public void shouldConstructDeploymentInfo_withUninstallingDeploymentStatus_fromPendingUninstallExecution() {
- String workflowIdLastAction = UNINSTALL_WORKFLOW_ID;
- String status = "pending";
- DeploymentStatus expectedDeploymentStatus = DeploymentStatus.UNINSTALLING;
- verifyDeploymentInfoConstruction(workflowIdLastAction, status, expectedDeploymentStatus);
- }
-
- @Test
- public void shouldConstructDeploymentInfo_withUnknownDeploymentStatus_fromUnmappableUninstallExecution() {
- String workflowIdLastAction = UNINSTALL_WORKFLOW_ID;
- String status = "strangeStatus";
- DeploymentStatus expectedDeploymentStatus = DeploymentStatus.UNKNOWN;
- verifyDeploymentInfoConstruction(workflowIdLastAction, status, expectedDeploymentStatus);
- }
-
- @Test
- public void shouldConstructDeploymentInfo_withUnknownDeploymentStatus_forUnknownExecutionWorkflowId() {
- String workflowIdLastAction = "strangeWorkflowIdLastAction";
- String status = "strangeStatus";
- DeploymentStatus expectedDeploymentStatus = DeploymentStatus.UNKNOWN;
- verifyDeploymentInfoConstruction(workflowIdLastAction, status, expectedDeploymentStatus);
- }
-
- @Test
- public void shouldSetEmptyOutputsMapWhenInputIsNull() {
- DeploymentInfo deploymentInfo = new DeploymentInfoBuilder().withDeploymentOutputs(null).build();
- assertThat(deploymentInfo.getOutputs()).isEmpty();
- }
-
- private void verifyDeploymentInfoConstruction(String workflowIdLastAction, String actionStatus,
- DeploymentStatus expectedDeploymentStatus) {
-
- Execution execution = new Execution();
- execution.setWorkflowId(workflowIdLastAction);
- execution.setStatus(actionStatus);
- execution.setError(ERROR_MESSAGE);
- DeploymentInfo deploymentInfo = new DeploymentInfoBuilder().fromExecution(execution).build();
-
- assertThat(deploymentInfo.getLastAction()).isEqualTo(workflowIdLastAction);
- assertThat(deploymentInfo.getActionStatus()).isEqualTo(actionStatus);
- assertThat(deploymentInfo.getErrorMessage()).isEqualTo(ERROR_MESSAGE);
- assertThat(deploymentInfo.getStatus()).isEqualTo(expectedDeploymentStatus);
- }
-}
diff --git a/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/exceptions/MsoCloudifyExceptionTest.java b/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/exceptions/MsoCloudifyExceptionTest.java
deleted file mode 100644
index 1506fda817..0000000000
--- a/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/exceptions/MsoCloudifyExceptionTest.java
+++ /dev/null
@@ -1,34 +0,0 @@
-/*
- * ============LICENSE_START======================================================= ONAP : SO
- * ================================================================================ Copyright (C) 2018 TechMahindra
- * ================================================================================ Licensed under the Apache License,
- * Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy
- * of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on
- * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the
- * specific language governing permissions and limitations under the License.
- * ============LICENSE_END=========================================================
- */
-
-package org.onap.so.cloudify.exceptions;
-
-import static org.junit.Assert.*;
-import org.junit.Test;
-
-public class MsoCloudifyExceptionTest {
-
- @Test
- public void test() {
- Exception e = null;
- boolean pendingWorkflow = true;
- MsoCloudifyException mce = new MsoCloudifyException(200, "message", "detail");
- MsoCloudifyException mcl = new MsoCloudifyException(200, "message", "detail", e);
- mce.setPendingWorkflow(pendingWorkflow);
- assert (mcl.toString() != null);
- assertNotNull(mce);
- }
-
-}
diff --git a/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/exceptions/MsoCloudifyTest.java b/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/exceptions/MsoCloudifyTest.java
deleted file mode 100644
index 25dcae3c2c..0000000000
--- a/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/exceptions/MsoCloudifyTest.java
+++ /dev/null
@@ -1,30 +0,0 @@
-/*
- * ============LICENSE_START======================================================= ONAP : SO
- * ================================================================================ Copyright (C) 2018 TechMahindra
- * ================================================================================ Licensed under the Apache License,
- * Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy
- * of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on
- * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the
- * specific language governing permissions and limitations under the License.
- * ============LICENSE_END=========================================================
- */
-package org.onap.so.cloudify.exceptions;
-
-import static org.junit.Assert.*;
-import org.junit.Test;
-
-public class MsoCloudifyTest {
-
- @Test
- public void test() {
- MsoBlueprintAlreadyExists mbae = new MsoBlueprintAlreadyExists("blueprintId", "cloud");
- MsoCloudifyManagerNotFound mcm = new MsoCloudifyManagerNotFound("cloudSiteId");
- MsoDeploymentAlreadyExists mdae = new MsoDeploymentAlreadyExists("deploymentId", "cloud");
- assertNotNull((mbae));
- }
-
-}
diff --git a/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/exceptions/MsoCloudifyTimeoutTest.java b/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/exceptions/MsoCloudifyTimeoutTest.java
deleted file mode 100644
index dc74d83d04..0000000000
--- a/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/exceptions/MsoCloudifyTimeoutTest.java
+++ /dev/null
@@ -1,33 +0,0 @@
-/*
- * ============LICENSE_START======================================================= ONAP : SO
- * ================================================================================ Copyright (C) 2018 TechMahindra
- * ================================================================================ Licensed under the Apache License,
- * Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy
- * of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on
- * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the
- * specific language governing permissions and limitations under the License.
- * ============LICENSE_END=========================================================
- */
-package org.onap.so.cloudify.exceptions;
-
-import static org.junit.Assert.*;
-import static org.mockito.Mockito.mock;
-import org.junit.Test;
-import org.onap.so.cloudify.v3.model.Execution;
-
-public class MsoCloudifyTimeoutTest {
-
- @Test
- public void test() {
- Execution execution = mock(Execution.class);
- MsoCloudifyTimeout mct = new MsoCloudifyTimeout(execution);
- mct.getExecution();
- assert (mct.toString() != null);
- assertNotNull(mct);
- }
-
-}
diff --git a/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/exceptions/MsoCloudifyWorkflowExceptionTest.java b/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/exceptions/MsoCloudifyWorkflowExceptionTest.java
deleted file mode 100644
index b8b2c97a65..0000000000
--- a/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/exceptions/MsoCloudifyWorkflowExceptionTest.java
+++ /dev/null
@@ -1,31 +0,0 @@
-/*
- * ============LICENSE_START======================================================= ONAP : SO
- * ================================================================================ Copyright (C) 2018 TechMahindra
- * ================================================================================ Licensed under the Apache License,
- * Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy
- * of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on
- * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the
- * specific language governing permissions and limitations under the License.
- * ============LICENSE_END=========================================================
- */
-package org.onap.so.cloudify.exceptions;
-
-import static org.junit.Assert.*;
-import org.junit.Test;
-
-public class MsoCloudifyWorkflowExceptionTest {
-
- @Test
- public void test() {
- MsoCloudifyWorkflowException mcw =
- new MsoCloudifyWorkflowException("message", "id", "workflowId", "workflowStatus");
- mcw.getWorkflowStatus();
- assertFalse(mcw.isWorkflowStillRunning());
-
- }
-
-}
diff --git a/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/utils/MsoCloudifyUtilsTest.java b/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/utils/MsoCloudifyUtilsTest.java
deleted file mode 100644
index d14115971c..0000000000
--- a/adapters/mso-adapter-utils/src/test/java/org/onap/so/cloudify/utils/MsoCloudifyUtilsTest.java
+++ /dev/null
@@ -1,336 +0,0 @@
-/*-
- * ============LICENSE_START=======================================================
- * ONAP - SO
- * ================================================================================
- * Copyright (C) 2017 AT&T Intellectual Property. All rights reserved.
- * ================================================================================
- * Copyright (C) 2018 Nokia.
- * ================================================================================
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- * ============LICENSE_END=========================================================
- */
-package org.onap.so.cloudify.utils;
-
-import static com.shazam.shazamcrest.MatcherAssert.assertThat;
-import static com.shazam.shazamcrest.matcher.Matchers.sameBeanAs;
-import static org.junit.Assert.assertEquals;
-import static org.junit.Assert.assertTrue;
-import static org.junit.Assert.fail;
-import static org.mockito.ArgumentMatchers.any;
-import static org.mockito.ArgumentMatchers.eq;
-import static org.mockito.Mockito.doReturn;
-import static org.mockito.Mockito.mock;
-import static org.mockito.Mockito.spy;
-import static org.mockito.Mockito.verify;
-import static org.mockito.Mockito.when;
-import java.io.IOException;
-import java.nio.file.Files;
-import java.nio.file.Paths;
-import java.util.ArrayList;
-import java.util.HashMap;
-import java.util.List;
-import java.util.Map;
-import java.util.Optional;
-import org.junit.Assert;
-import org.junit.Test;
-import org.mockito.Mockito;
-import org.onap.so.adapters.vdu.CloudInfo;
-import org.onap.so.adapters.vdu.PluginAction;
-import org.onap.so.adapters.vdu.VduArtifact;
-import org.onap.so.adapters.vdu.VduArtifact.ArtifactType;
-import org.onap.so.adapters.vdu.VduInstance;
-import org.onap.so.adapters.vdu.VduModelInfo;
-import org.onap.so.adapters.vdu.VduStateType;
-import org.onap.so.adapters.vdu.VduStatus;
-import org.onap.so.cloud.CloudConfig;
-import org.onap.so.cloudify.beans.DeploymentInfo;
-import org.onap.so.cloudify.beans.DeploymentInfoBuilder;
-import org.onap.so.cloudify.beans.DeploymentStatus;
-import org.onap.so.cloudify.v3.client.Cloudify;
-import org.onap.so.cloudify.v3.model.AzureConfig;
-import org.onap.so.db.catalog.beans.CloudIdentity;
-import org.onap.so.db.catalog.beans.CloudSite;
-import org.onap.so.db.catalog.beans.CloudifyManager;
-import org.onap.so.db.catalog.beans.HeatTemplateParam;
-import org.onap.so.openstack.exceptions.MsoAdapterException;
-import org.onap.so.openstack.exceptions.MsoException;
-import org.skyscreamer.jsonassert.JSONAssert;
-import com.fasterxml.jackson.core.JsonParseException;
-import com.fasterxml.jackson.core.type.TypeReference;
-import com.fasterxml.jackson.databind.JsonMappingException;
-import com.fasterxml.jackson.databind.JsonNode;
-import com.fasterxml.jackson.databind.ObjectMapper;
-
-public class MsoCloudifyUtilsTest {
-
- private static final String CLOUD_SITE_ID = "cloudSiteIdTest";
- private static final String BLUEPRINT_ID = "bluePrintIdTest";
- private static final String FILE_NAME = "fileName";
-
- @Test
- public void instantiateVduTest() throws MsoException {
- VduInstance expected = new VduInstance();
- expected.setVduInstanceId("id");
- expected.setVduInstanceName("id");
- VduStatus status = new VduStatus();
- status.setState(VduStateType.INSTANTIATED);
- status.setLastAction(new PluginAction(null, null, null));
- expected.setStatus(status);
-
- MsoCloudifyUtils cloudify = Mockito.spy(MsoCloudifyUtils.class);
- CloudSite site = new CloudSite();
- Optional<CloudSite> opSite = Optional.ofNullable(site);
- CloudConfig config = Mockito.mock(CloudConfig.class);
- cloudify.cloudConfig = config;
- Cloudify cloudifyClient = new Cloudify("cloudSite");
- CloudInfo cloudInfo = new CloudInfo();
- cloudInfo.setCloudSiteId("cloudSiteId");
- cloudInfo.setTenantId("tenantId");
- VduModelInfo vduModel = new VduModelInfo();
- vduModel.setModelCustomizationUUID("blueprintId");
- vduModel.setTimeoutMinutes(1);
- VduArtifact artifact = new VduArtifact();
- artifact.setName("name");
- artifact.setType(ArtifactType.MAIN_TEMPLATE);
- byte[] content = new byte[1];
- artifact.setContent(content);
- List<VduArtifact> artifacts = new ArrayList<>();
- artifacts.add(artifact);
- vduModel.setArtifacts(artifacts);
- DeploymentInfo deployment =
- new DeploymentInfoBuilder().withId("id").withStatus(DeploymentStatus.INSTALLED).build();
- Map<String, byte[]> blueprintFiles = new HashMap<>();
- blueprintFiles.put(artifact.getName(), artifact.getContent());
- String instanceName = "instanceName";
- Map<String, Object> inputs = new HashMap<>();
- boolean rollbackOnFailure = true;
-
- when(config.getCloudSite(cloudInfo.getCloudSiteId())).thenReturn(opSite);
- doReturn(false).when(cloudify).isBlueprintLoaded(cloudInfo.getCloudSiteId(),
- vduModel.getModelCustomizationUUID());
- doReturn(cloudifyClient).when(cloudify).getCloudifyClient(site);
- doReturn(true).when(cloudify).uploadBlueprint(cloudifyClient, vduModel.getModelCustomizationUUID(),
- artifact.getName(), blueprintFiles);
- doReturn(deployment).when(cloudify).createAndInstallDeployment(cloudInfo.getCloudSiteId(),
- cloudInfo.getTenantId(), instanceName, vduModel.getModelCustomizationUUID(), inputs, true,
- vduModel.getTimeoutMinutes(), rollbackOnFailure);
-
- VduInstance actual = cloudify.instantiateVdu(cloudInfo, instanceName, inputs, vduModel, rollbackOnFailure);
- assertThat(actual, sameBeanAs(expected));
- }
-
- @Test
- public void queryVduTest() throws MsoException {
- VduInstance expected = new VduInstance();
- expected.setVduInstanceId("id");
- expected.setVduInstanceName("id");
- VduStatus status = new VduStatus();
- status.setState(VduStateType.INSTANTIATED);
- status.setLastAction(new PluginAction(null, null, null));
- expected.setStatus(status);
-
- CloudInfo cloudInfo = new CloudInfo();
- cloudInfo.setCloudSiteId("cloudSiteId");
- cloudInfo.setTenantId("tenantId");
- DeploymentInfo deployment =
- new DeploymentInfoBuilder().withId("id").withStatus(DeploymentStatus.INSTALLED).build();
- String instanceId = "instanceId";
-
- MsoCloudifyUtils cloudify = Mockito.spy(MsoCloudifyUtils.class);
-
- doReturn(deployment).when(cloudify).queryDeployment(cloudInfo.getCloudSiteId(), cloudInfo.getTenantId(),
- instanceId);
-
- VduInstance actual = cloudify.queryVdu(cloudInfo, instanceId);
-
- assertThat(actual, sameBeanAs(expected));
- }
-
- @Test
- public void deleteVduTest() throws MsoException {
- VduInstance expected = new VduInstance();
- expected.setVduInstanceId("id");
- expected.setVduInstanceName("id");
- VduStatus status = new VduStatus();
- status.setState(VduStateType.DELETING);
- status.setLastAction(new PluginAction("deleting", null, null));
- expected.setStatus(status);
-
- CloudInfo cloudInfo = new CloudInfo();
- cloudInfo.setCloudSiteId("cloudSiteId");
- cloudInfo.setTenantId("tenantId");
- String instanceId = "instanceId";
- int timeoutMinutes = 1;
- DeploymentInfo deploymentInfo = new DeploymentInfoBuilder().withId("id").withStatus(DeploymentStatus.CREATED)
- .withLastAction("deleting").build();
- MsoCloudifyUtils cloudify = Mockito.spy(MsoCloudifyUtils.class);
- doReturn(deploymentInfo).when(cloudify).uninstallAndDeleteDeployment(cloudInfo.getCloudSiteId(),
- cloudInfo.getTenantId(), instanceId, timeoutMinutes);
-
- VduInstance actual = cloudify.deleteVdu(cloudInfo, instanceId, timeoutMinutes);
-
- assertThat(actual, sameBeanAs(expected));
- }
-
- @Test
- public void deploymentInfoToVduInstanceTest() {
- VduInstance expected = new VduInstance();
- expected.setVduInstanceId("id");
- expected.setVduInstanceName("id");
- VduStatus status = new VduStatus();
- status.setState(VduStateType.DELETING);
- status.setLastAction(new PluginAction("deleting", null, null));
- expected.setStatus(status);
-
- DeploymentInfo deploymentInfo = new DeploymentInfoBuilder().withId("id").withStatus(DeploymentStatus.CREATED)
- .withLastAction("deleting").build();
-
- MsoCloudifyUtils cloudify = new MsoCloudifyUtils();
-
- VduInstance actual = cloudify.deploymentInfoToVduInstance(deploymentInfo);
-
- assertThat(actual, sameBeanAs(expected));
- }
-
- @Test
- public void deploymentStatusToVduStatusTest() {
- VduStatus expected = new VduStatus();
- expected.setState(VduStateType.DELETING);
- expected.setLastAction(new PluginAction("deleting", null, null));
-
- DeploymentInfo deploymentInfo = new DeploymentInfoBuilder().withId("id").withStatus(DeploymentStatus.CREATED)
- .withLastAction("deleting").build();
-
- MsoCloudifyUtils cloudify = new MsoCloudifyUtils();
-
- VduStatus actual = cloudify.deploymentStatusToVduStatus(deploymentInfo);
-
- assertThat(actual, sameBeanAs(expected));
- }
-
- @Test
- public void getAzureConfigTest() {
- AzureConfig expected = new AzureConfig();
- expected.setSubscriptionId("subscriptionId");
- expected.setTenantId("tenantId");
- expected.setClientId("msoId");
- expected.setClientSecret("msoPass");
-
- MsoCloudifyUtils cloudify = new MsoCloudifyUtils();
- CloudSite cloudSite = Mockito.mock(CloudSite.class);
- CloudIdentity cloudIdentity = Mockito.mock(CloudIdentity.class);
- when(cloudSite.getIdentityService()).thenReturn(cloudIdentity);
- when(cloudIdentity.getAdminTenant()).thenReturn("subscriptionId");
- when(cloudIdentity.getMsoId()).thenReturn("msoId");
- when(cloudIdentity.getMsoPass()).thenReturn("msoPass");
- String tenantId = "tenantId";
- AzureConfig actual = cloudify.getAzureConfig(cloudSite, tenantId);
-
- assertThat(actual, sameBeanAs(expected));
- }
-
- @Test
- public void uploadBlueprintSuccessful() throws MsoException {
- // given
- MsoCloudifyUtils testedObjectSpy = spy(MsoCloudifyUtils.class);
- testedObjectSpy.cloudConfig = mock(CloudConfig.class);
- Map<String, byte[]> blueprints = new HashMap<>();
-
- mockCloudConfig(testedObjectSpy);
- doReturn(true).when(testedObjectSpy).uploadBlueprint(any(Cloudify.class), eq(BLUEPRINT_ID), eq(FILE_NAME),
- eq(blueprints));
- // when
- testedObjectSpy.uploadBlueprint(CLOUD_SITE_ID, BLUEPRINT_ID, FILE_NAME, blueprints, true);
- // then
- verify(testedObjectSpy).uploadBlueprint(any(Cloudify.class), eq(BLUEPRINT_ID), eq(FILE_NAME), eq(blueprints));
- }
-
- @Test
- public void uploadBlueprint_exceptionThrown_blueprintExists() throws MsoException {
- // given
- MsoCloudifyUtils testedObjectSpy = spy(MsoCloudifyUtils.class);
- testedObjectSpy.cloudConfig = mock(CloudConfig.class);
- Map<String, byte[]> blueprints = new HashMap<>();
-
- mockCloudConfig(testedObjectSpy);
- doReturn(false).when(testedObjectSpy).uploadBlueprint(any(Cloudify.class), eq(BLUEPRINT_ID), eq(FILE_NAME),
- eq(blueprints));
- // when
- try {
- testedObjectSpy.uploadBlueprint(CLOUD_SITE_ID, BLUEPRINT_ID, FILE_NAME, blueprints, true);
- // then
- fail("MsoAdapterException should be thrown");
- } catch (MsoAdapterException e) {
- Assert.assertEquals(e.getMessage(), "Blueprint already exists");
- }
- verify(testedObjectSpy).uploadBlueprint(any(Cloudify.class), eq(BLUEPRINT_ID), eq(FILE_NAME), eq(blueprints));
- }
-
- @Test
- public void convertInputValueTest() throws JsonParseException, JsonMappingException, IOException {
- MsoCloudifyUtils utils = new MsoCloudifyUtils();
- ObjectMapper mapper = new ObjectMapper();
- HeatTemplateParam paramNum = new HeatTemplateParam();
- paramNum.setParamType("number");
- paramNum.setParamName("my-number");
-
- HeatTemplateParam paramString = new HeatTemplateParam();
- paramString.setParamType("string");
- paramString.setParamName("my-string");
-
- HeatTemplateParam paramJson = new HeatTemplateParam();
- paramJson.setParamType("json");
- paramJson.setParamName("my-json");
-
- HeatTemplateParam paramJsonEscaped = new HeatTemplateParam();
- paramJsonEscaped.setParamType("json");
- paramJsonEscaped.setParamName("my-json-escaped");
-
- Map<String, Object> jsonMap =
- mapper.readValue(getJson("free-form.json"), new TypeReference<Map<String, Object>>() {});
-
- assertEquals(3, utils.convertInputValue("3", paramNum));
- assertEquals("hello", utils.convertInputValue("hello", paramString));
- assertTrue("expect no change in type", utils.convertInputValue(jsonMap, paramJson) instanceof Map);
- assertTrue("expect string to become jsonNode",
- utils.convertInputValue(getJson("free-form.json"), paramJsonEscaped) instanceof JsonNode);
-
- JSONAssert.assertEquals(getJson("free-form.json"),
- mapper.writeValueAsString(utils.convertInputValue(getJson("free-form.json"), paramJsonEscaped)), false);
-
- }
-
- private String getJson(String filename) throws IOException {
- return new String(Files.readAllBytes(Paths.get("src/test/resources/__files/MsoHeatUtils/" + filename)));
- }
-
- private void mockCloudConfig(MsoCloudifyUtils testedObjectSpy) {
- CloudifyManager cloudifyManager = createCloudifyManager();
- when(testedObjectSpy.cloudConfig.getCloudSite(CLOUD_SITE_ID)).thenReturn(Optional.of(createCloudSite()));
- when(testedObjectSpy.cloudConfig.getCloudifyManager(CLOUD_SITE_ID)).thenReturn(cloudifyManager);
- }
-
- private CloudifyManager createCloudifyManager() {
- CloudifyManager cloudifyManager = new CloudifyManager();
- cloudifyManager.setCloudifyUrl("cloudUrlTest");
- cloudifyManager.setPassword("546573746F736973546573746F736973");
- return cloudifyManager;
- }
-
- private CloudSite createCloudSite() {
- CloudSite cloudSite = new CloudSite();
- cloudSite.setCloudifyId(CLOUD_SITE_ID);
- return cloudSite;
- }
-
-}
diff --git a/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceMacroHolder.java b/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceMacroHolder.java
index 305d52a997..89fd9a0147 100644
--- a/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceMacroHolder.java
+++ b/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceMacroHolder.java
@@ -37,10 +37,11 @@ public class QueryServiceMacroHolder extends CatalogQuery {
+ "\t\t\"modelUuid\" : <SERVICE_MODEL_UUID>,\n"
+ "\t\t\"modelInvariantUuid\" : <SERVICE_MODEL_INVARIANT_ID>,\n"
+ "\t\t\"modelVersion\" : <SERVICE_MODEL_VERSION>\n" + "\t},\n"
- + "\t\"serviceType\" : <SERVICE_TYPE>,\n" + "\t\"serviceRole\" : <SERVICE_ROLE>,\n"
- + "\t\"environmentContext\" : <ENVIRONMENT_CONTEXT>,\n" + "\t\"resourceOrder\" : <RESOURCE_ORDER>,\n"
- + "\t\"workloadContext\" : <WORKLOAD_CONTEXT>,\n" + "<_SERVICEVNFS_>,\n" + "<_SERVICENETWORKS_>,\n"
- + "<_SERVICEINFO_>,\n" + "<_SERVICEPROXY_>,\n" + "<_SERVICEALLOTTEDRESOURCES_>\n" + "\t}}";
+ + "\t\"serviceCategory\" : <SERVICE_CATEGORY>,\n" + "\t\"serviceType\" : <SERVICE_TYPE>,\n"
+ + "\t\"serviceRole\" : <SERVICE_ROLE>,\n" + "\t\"environmentContext\" : <ENVIRONMENT_CONTEXT>,\n"
+ + "\t\"resourceOrder\" : <RESOURCE_ORDER>,\n" + "\t\"workloadContext\" : <WORKLOAD_CONTEXT>,\n"
+ + "<_SERVICEVNFS_>,\n" + "<_SERVICENETWORKS_>,\n" + "<_SERVICEINFO_>,\n" + "<_SERVICEPROXY_>,\n"
+ + "<_SERVICEALLOTTEDRESOURCES_>\n" + "\t}}";
public QueryServiceMacroHolder() {
super();
@@ -80,6 +81,7 @@ public class QueryServiceMacroHolder extends CatalogQuery {
put(valueMap, "SERVICE_MODEL_VERSION", service.getModelVersion());
put(valueMap, "SERVICE_TYPE", service.getServiceType());
put(valueMap, "SERVICE_ROLE", service.getServiceRole());
+ put(valueMap, "SERVICE_CATEGORY", service.getCategory());
put(valueMap, "ENVIRONMENT_CONTEXT", service.getEnvironmentContext());
put(valueMap, "WORKLOAD_CONTEXT", service.getWorkloadContext());
put(valueMap, "RESOURCE_ORDER", service.getResourceOrder());
diff --git a/adapters/mso-catalog-db-adapter/src/main/resources/db/migration/R__MacroData.sql b/adapters/mso-catalog-db-adapter/src/main/resources/db/migration/R__MacroData.sql
index ea371f54f7..e4810840f1 100644
--- a/adapters/mso-catalog-db-adapter/src/main/resources/db/migration/R__MacroData.sql
+++ b/adapters/mso-catalog-db-adapter/src/main/resources/db/migration/R__MacroData.sql
@@ -33,6 +33,12 @@ INSERT INTO northbound_request_ref_lookup(MACRO_ACTION, ACTION, REQUEST_SCOPE, I
('VNF-InPlaceUpdate', 'inPlaceSoftwareUpdate', 'Vnf', true, true, '7','7', 'DEFAULT', '*'),
('VNF-Config-Update', 'applyUpdatedConfig', 'Vnf', true, true, '7','7', 'DEFAULT', '*');
+--
+-- northbound_request_ref_lookup for updateInstance (Macro Flow)
+--
+INSERT INTO northbound_request_ref_lookup(ID, REQUEST_SCOPE, MACRO_ACTION, ACTION, IS_ALACARTE, MIN_API_VERSION, MAX_API_VERSION, IS_TOPLEVELFLOW, CLOUD_OWNER, SERVICE_TYPE)
+VALUES (500, 'Vnf', 'VNF-Macro-Modify', 'updateInstance', 0, 7, 7, 1, 'k8scloudowner4', '*');
+
INSERT INTO orchestration_flow_reference(COMPOSITE_ACTION, SEQ_NO, FLOW_NAME, FLOW_VERSION, NB_REQ_REF_LOOKUP_ID) VALUES
('Service-Create', '1', 'AssignServiceInstanceBB', 1.0,(SELECT id from northbound_request_ref_lookup WHERE MACRO_ACTION = 'Service-Create' and CLOUD_OWNER = 'DEFAULT')),
@@ -211,6 +217,15 @@ INSERT INTO orchestration_flow_reference(COMPOSITE_ACTION, SEQ_NO, FLOW_NAME, FL
('VNF-Config-Update', '8', 'VNFUnsetInMaintFlagActivity', 1.0,(SELECT id from northbound_request_ref_lookup WHERE MACRO_ACTION = 'VNF-Config-Update' and CLOUD_OWNER = 'DEFAULT')),
('VNF-Config-Update', '9', 'VNFUnsetClosedLoopDisabledFlagActivity', 1.0,(SELECT id from northbound_request_ref_lookup WHERE MACRO_ACTION = 'VNF-Config-Update' and CLOUD_OWNER = 'DEFAULT'));
+--
+-- orchestration_flow_reference for updateInstance (Macro Flow)
+--
+insert into orchestration_flow_reference (id,COMPOSITE_ACTION,SEQ_NO,FLOW_NAME,FLOW_VERSION,NB_REQ_REF_LOOKUP_ID,SCOPE,ACTION)
+values (901, 'VNF-Macro-Modify',1,'ControllerExecutionBB',1,500,'vnf','config-assign');
+insert into orchestration_flow_reference (id,COMPOSITE_ACTION,SEQ_NO,FLOW_NAME,FLOW_VERSION,NB_REQ_REF_LOOKUP_ID,SCOPE,ACTION)
+values (902, 'VNF-Macro-Modify',2,'ControllerExecutionBB',1,500,'vnf','config-deploy');
+
+
INSERT INTO orchestration_flow_reference(COMPOSITE_ACTION, SEQ_NO, FLOW_NAME, FLOW_VERSION, NB_REQ_REF_LOOKUP_ID, SCOPE, ACTION) VALUES
('Service-Macro-Create', '10', 'ControllerExecutionBB', 1.0,(SELECT id from northbound_request_ref_lookup WHERE MACRO_ACTION = 'Service-Macro-Create' and CLOUD_OWNER = 'DEFAULT'), 'pnf', 'config-assign');
diff --git a/adapters/mso-catalog-db-adapter/src/main/resources/db/migration/V1.1__Initial_Recipe_Setup.sql b/adapters/mso-catalog-db-adapter/src/main/resources/db/migration/V1.1__Initial_Recipe_Setup.sql
index 1663fdd6a8..c5a3701a82 100644
--- a/adapters/mso-catalog-db-adapter/src/main/resources/db/migration/V1.1__Initial_Recipe_Setup.sql
+++ b/adapters/mso-catalog-db-adapter/src/main/resources/db/migration/V1.1__Initial_Recipe_Setup.sql
@@ -33,6 +33,8 @@ INSERT INTO `service_recipe` (`id`, `ACTION`, `VERSION_STR`, `DESCRIPTION`, `ORC
INSERT INTO `service_recipe` (`id`, `ACTION`, `VERSION_STR`, `DESCRIPTION`, `ORCHESTRATION_URI`, `SERVICE_PARAM_XSD`, `RECIPE_TIMEOUT`, `SERVICE_TIMEOUT_INTERIM`, `CREATION_TIMESTAMP`, `SERVICE_MODEL_UUID`) VALUES (2,'deleteInstance','1','VID_DEFAULT recipe to delete service-instance if no custom BPMN flow is found','/mso/async/services/DeleteGenericALaCarteServiceInstance',NULL,180,NULL,'2017-10-05 18:52:03','48cc36cc-a9fe-11e7-8b4b-0242ac120002');
INSERT INTO `service_recipe` (`id`, `ACTION`, `VERSION_STR`, `DESCRIPTION`, `ORCHESTRATION_URI`, `SERVICE_PARAM_XSD`, `RECIPE_TIMEOUT`, `SERVICE_TIMEOUT_INTERIM`, `CREATION_TIMESTAMP`, `SERVICE_MODEL_UUID`) VALUES (3,'createInstance','1','DEFAULT recipe to create service-instance if no custom BPMN flow is found','/mso/async/services/CreateGenericALaCarteServiceInstance',NULL,180,NULL,'2017-10-05 18:52:03','48cc3acd-a9fe-11e7-8b4b-0242ac120002');
INSERT INTO `service_recipe` (`id`, `ACTION`, `VERSION_STR`, `DESCRIPTION`, `ORCHESTRATION_URI`, `SERVICE_PARAM_XSD`, `RECIPE_TIMEOUT`, `SERVICE_TIMEOUT_INTERIM`, `CREATION_TIMESTAMP`, `SERVICE_MODEL_UUID`) VALUES (4,'deleteInstance','1','DEFAULT recipe to delete service-instance if no custom BPMN flow is found','/mso/async/services/DeleteGenericALaCarteServiceInstance',NULL,180,NULL,'2017-10-05 18:52:03','48cc3acd-a9fe-11e7-8b4b-0242ac120002');
+insert into `service_recipe` (`id`, `ACTION`, `VERSION_STR`, `DESCRIPTION`, `ORCHESTRATION_URI`, `SERVICE_PARAM_XSD`, `RECIPE_TIMEOUT`, `SERVICE_TIMEOUT_INTERIM`, `CREATION_TIMESTAMP`, `SERVICE_MODEL_UUID`) values (500,'updateInstance','1.0','Gr api recipe to update service-instance', '/mso/async/services/WorkflowActionBB', NULL, 180, NULL, '2017-10-05 18:52:03', 'd88da85c-d9e8-4f73-b837-3a72a431622b');
+
--
-- Custom Reciepe for the VoLTE service added temporarily
@@ -43,6 +45,16 @@ INSERT INTO `service` (`MODEL_UUID`, `MODEL_NAME`, `MODEL_INVARIANT_UUID`, `MODE
INSERT INTO `service_recipe` (`id`, `ACTION`, `VERSION_STR`, `DESCRIPTION`, `ORCHESTRATION_URI`, `SERVICE_PARAM_XSD`, `RECIPE_TIMEOUT`, `SERVICE_TIMEOUT_INTERIM`, `CREATION_TIMESTAMP`, `SERVICE_MODEL_UUID`) VALUES (11,'createInstance','1','Custom recipe to create E2E service-instance if no custom BPMN flow is found','/mso/async/services/CreateCustomE2EServiceInstance',NULL,180,NULL,'2017-10-05 18:52:03','dfcd7471-16c7-444e-8268-d4c50d90593a');
INSERT INTO `service_recipe` (`id`, `ACTION`, `VERSION_STR`, `DESCRIPTION`, `ORCHESTRATION_URI`, `SERVICE_PARAM_XSD`, `RECIPE_TIMEOUT`, `SERVICE_TIMEOUT_INTERIM`, `CREATION_TIMESTAMP`, `SERVICE_MODEL_UUID`) VALUES (12,'deleteInstance','1','Custom recipe to delete E2E service-instance if no custom BPMN flow is found','/mso/async/services/DeleteCustomE2EServiceInstance',NULL,180,NULL,'2017-10-05 18:52:03','dfcd7471-16c7-444e-8268-d4c50d90593a');
+-- Recipe for onap3gppServiceInstances
+
+INSERT INTO `service` (`MODEL_UUID`, `MODEL_NAME`, `MODEL_INVARIANT_UUID`, `MODEL_VERSION`, `DESCRIPTION`, `CREATION_TIMESTAMP`, `TOSCA_CSAR_ARTIFACT_UUID`) VALUES ('3d30a774-e149-11ea-87d0-0242ac130003','COMMON_SS_DEFAULT','3d30a774-e149-11ea-87d0-0242ac130003','1.0','Default service for common NSSMF','2020-08-18 17:40:03',NULL);
+
+INSERT INTO `service_recipe` (`id`, `ACTION`, `VERSION_STR`, `DESCRIPTION`, `ORCHESTRATION_URI`, `SERVICE_PARAM_XSD`, `RECIPE_TIMEOUT`, `SERVICE_TIMEOUT_INTERIM`, `CREATION_TIMESTAMP`, `SERVICE_MODEL_UUID`) VALUES (17,'createInstance','1','Custom recipe to allocate 3gpp service-instance if no custom BPMN flow is found','/mso/async/services/AllocateSliceSubnet',NULL,180,NULL,'2020-08-18 17:40:03','3d30a774-e149-11ea-87d0-0242ac130003');
+INSERT INTO `service_recipe` (`id`, `ACTION`, `VERSION_STR`, `DESCRIPTION`, `ORCHESTRATION_URI`, `SERVICE_PARAM_XSD`, `RECIPE_TIMEOUT`, `SERVICE_TIMEOUT_INTERIM`, `CREATION_TIMESTAMP`, `SERVICE_MODEL_UUID`) VALUES (18,'deleteInstance','1','Custom recipe to deallocate 3gpp service-instance if no custom BPMN flow is found','/mso/async/services/DeAllocateSliceSubnet',NULL,180,NULL,'2020-08-18 18:40:03','3d30a774-e149-11ea-87d0-0242ac130003');
+INSERT INTO `service_recipe` (`id`, `ACTION`, `VERSION_STR`, `DESCRIPTION`, `ORCHESTRATION_URI`, `SERVICE_PARAM_XSD`, `RECIPE_TIMEOUT`, `SERVICE_TIMEOUT_INTERIM`, `CREATION_TIMESTAMP`, `SERVICE_MODEL_UUID`) VALUES (19,'updateInstance','1','Custom recipe to modify 3gpp service-instance if no custom BPMN flow is found','/mso/async/services/ModifySliceSubnet',NULL,180,NULL,'2020-08-18 18:40:03','3d30a774-e149-11ea-87d0-0242ac130003');
+INSERT INTO `service_recipe` (`id`, `ACTION`, `VERSION_STR`, `DESCRIPTION`, `ORCHESTRATION_URI`, `SERVICE_PARAM_XSD`, `RECIPE_TIMEOUT`, `SERVICE_TIMEOUT_INTERIM`, `CREATION_TIMESTAMP`, `SERVICE_MODEL_UUID`) VALUES (20,'activateInstance','1','Custom recipe to activate/deactivate 3gpp service-instance if no custom BPMN flow is found','/mso/async/services/ActivateSliceSubnet',NULL,180,NULL,'2020-08-18 18:40:03','3d30a774-e149-11ea-87d0-0242ac130003');
+INSERT INTO `service_recipe` (`id`, `ACTION`, `VERSION_STR`, `DESCRIPTION`, `ORCHESTRATION_URI`, `SERVICE_PARAM_XSD`, `RECIPE_TIMEOUT`, `SERVICE_TIMEOUT_INTERIM`, `CREATION_TIMESTAMP`, `SERVICE_MODEL_UUID`) VALUES (21,'deactivateInstance','1','Custom recipe to activate/deactivate 3gpp service-instance if no custom BPMN flow is found','/mso/async/services/ActivateSliceSubnet',NULL,180,NULL,'2020-08-18 18:40:03','3d30a774-e149-11ea-87d0-0242ac130003');
+
-- Recipe for E2E service update (R2 just support adding/deleting network service)
INSERT INTO `service_recipe` (`id`, `ACTION`, `VERSION_STR`, `DESCRIPTION`, `ORCHESTRATION_URI`, `SERVICE_PARAM_XSD`, `RECIPE_TIMEOUT`, `SERVICE_TIMEOUT_INTERIM`, `CREATION_TIMESTAMP`, `SERVICE_MODEL_UUID`) VALUES (15,'updateInstance','1','Custom recipe to update E2E service-instance if no custom BPMN flow is found','/mso/async/services/UpdateCustomE2EServiceInstance',NULL,180,NULL,'2018-03-05 10:52:03','dfcd7471-16c7-444e-8268-d4c50d90593a');
INSERT INTO `service_recipe` (`id`, `ACTION`, `VERSION_STR`, `DESCRIPTION`, `ORCHESTRATION_URI`, `SERVICE_PARAM_XSD`, `RECIPE_TIMEOUT`, `SERVICE_TIMEOUT_INTERIM`, `CREATION_TIMESTAMP`, `SERVICE_MODEL_UUID`) VALUES (16,'scaleInstance','1','Custom recipe to scale E2E service-instance if no custom BPMN flow is found','/mso/async/services/ScaleCustomE2EServiceInstance',NULL,180,NULL,'2018-05-15 18:52:03','dfcd7471-16c7-444e-8268-d4c50d90593a');
@@ -60,6 +72,7 @@ INSERT INTO `vnf_components_recipe` (`id`, `VNF_TYPE`, `VNF_COMPONENT_TYPE`, `VF
INSERT INTO `vnf_components_recipe` (`id`, `VNF_TYPE`, `VNF_COMPONENT_TYPE`, `VF_MODULE_MODEL_UUID`, `ACTION`, `SERVICE_TYPE`, `VERSION`, `DESCRIPTION`, `ORCHESTRATION_URI`, `VNF_COMPONENT_PARAM_XSD`, `RECIPE_TIMEOUT`, `CREATION_TIMESTAMP`) VALUES (11,NULL,'vfModule','VID_DEFAULT','deleteInstance',NULL,'1','VID_DEFAULT recipe t','/mso/async/services/DeleteVfModuleInfra',null,180,'2017-10-05 18:52:03');
INSERT INTO `vnf_components_recipe` (`id`, `VNF_TYPE`, `VNF_COMPONENT_TYPE`, `VF_MODULE_MODEL_UUID`, `ACTION`, `SERVICE_TYPE`, `VERSION`, `DESCRIPTION`, `ORCHESTRATION_URI`, `VNF_COMPONENT_PARAM_XSD`, `RECIPE_TIMEOUT`, `CREATION_TIMESTAMP`) VALUES (12,NULL,'vfModule','VID_DEFAULT','updateInstance',NULL,'1','VID_DEFAULT recipe t','/mso/async/services/UpdateVfModuleInfra',null,180,'2017-10-05 18:52:03');
+
--
-- Default Reciepe for the VNF componnets added start #SO-334, to unblock the VNF operations
--
diff --git a/adapters/mso-cnf-adapter/pom.xml b/adapters/mso-cnf-adapter/pom.xml
index fb25157a96..0928da084e 100644
--- a/adapters/mso-cnf-adapter/pom.xml
+++ b/adapters/mso-cnf-adapter/pom.xml
@@ -110,11 +110,11 @@
<groupId>org.springframework.boot</groupId>
<artifactId>spring-boot-starter-data-jpa</artifactId>
</dependency>
- <!-- <dependency>
+ <dependency>
<groupId>org.springframework.boot</groupId>
<artifactId>spring-boot-starter-test</artifactId>
<scope>test</scope>
- </dependency> -->
+ </dependency>
<!-- <dependency>
<groupId>org.onap.so</groupId>
<artifactId>mso-requests-db</artifactId>
diff --git a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/MSOCnfApplication.java b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/MSOCnfApplication.java
index e94c283a98..0ba40e2700 100644
--- a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/MSOCnfApplication.java
+++ b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/MSOCnfApplication.java
@@ -28,8 +28,10 @@ import org.springframework.boot.autoconfigure.jdbc.DataSourceTransactionManagerA
import org.springframework.boot.autoconfigure.liquibase.LiquibaseAutoConfiguration;
import org.springframework.boot.autoconfigure.orm.jpa.HibernateJpaAutoConfiguration;
import org.springframework.boot.autoconfigure.security.servlet.SecurityAutoConfiguration;
+import org.springframework.context.annotation.Bean;
import org.springframework.context.annotation.ComponentScan;
import org.springframework.context.annotation.Configuration;
+import org.springframework.web.client.RestTemplate;
@SpringBootApplication
@ComponentScan(basePackages = {"org.onap.so.adapters.cnf"})
@@ -42,4 +44,9 @@ public class MSOCnfApplication {
public static void main(String... args) {
SpringApplication.run(MSOCnfApplication.class, args);
}
+
+ @Bean
+ public RestTemplate restTemplate() {
+ return new RestTemplate();
+ }
}
diff --git a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/exceptions/ApplicationException.java b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/exceptions/ApplicationException.java
new file mode 100644
index 0000000000..c950cf6b2a
--- /dev/null
+++ b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/exceptions/ApplicationException.java
@@ -0,0 +1,66 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.cnf.exceptions;
+
+import static org.onap.so.adapters.cnf.util.CNfAdapterUtil.marshal;
+import org.onap.so.adapters.cnf.model.ErrorResponse;
+import org.springframework.http.ResponseEntity;
+
+public class ApplicationException extends Exception {
+
+ private static final long serialVersionUID = 1L;
+
+ private int errorCode;
+
+ private String errorMsg;
+
+ public ApplicationException(int errorCode, String errorMsg) {
+ this.errorCode = errorCode;
+ this.errorMsg = errorMsg;
+ }
+
+ public int getErrorCode() {
+ return errorCode;
+ }
+
+ public void setErrorCode(int errorCode) {
+ this.errorCode = errorCode;
+ }
+
+ public String getErrorMsg() {
+ return errorMsg;
+ }
+
+ public void setErrorMsg(String errorMsg) {
+ this.errorMsg = errorMsg;
+ }
+
+ public ResponseEntity buildErrorResponse() {
+ String message;
+ try {
+ ErrorResponse err = new ErrorResponse(errorCode, errorMsg);
+ message = marshal(err);
+ } catch (ApplicationException e) {
+ return ResponseEntity.status(500).body("Internal Server Error");
+ }
+ return ResponseEntity.status(errorCode).body(message);
+ }
+}
diff --git a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/BpmnInstanceRequest.java b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/BpmnInstanceRequest.java
new file mode 100644
index 0000000000..2e76d51da2
--- /dev/null
+++ b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/BpmnInstanceRequest.java
@@ -0,0 +1,87 @@
+package org.onap.so.adapters.cnf.model;
+
+import java.util.Map;
+import com.fasterxml.jackson.annotation.JsonIgnoreProperties;
+import com.fasterxml.jackson.annotation.JsonProperty;
+
+@JsonIgnoreProperties(value = "true")
+public class BpmnInstanceRequest {
+
+ @JsonProperty(value = "modelInvariantId")
+ private String modelInvariantId;
+
+ @JsonProperty(value = "modelVersionId")
+ private String modelVersionId;
+
+ @JsonProperty(value = "k8sRBProfileName")
+ private String k8sRBProfileName;
+
+ @JsonProperty(value = "cloudRegionId")
+ private String cloudRegionId;
+
+ @JsonProperty(value = "vfModuleUUID")
+ private String vfModuleUUID;
+
+ @JsonProperty(value = "labels")
+ private Map<String, String> labels;
+
+ @JsonProperty(value = "overrideValues")
+ private Map<String, String> overrideValues;
+
+ public String getModelInvariantId() {
+ return modelInvariantId;
+ }
+
+ public void setModelInvariantId(String modelInvariantId) {
+ this.modelInvariantId = modelInvariantId;
+ }
+
+ public String getModelVersionId() {
+ return modelVersionId;
+ }
+
+ public void setModelVersionId(String modelVersionId) {
+ this.modelVersionId = modelVersionId;
+ }
+
+ public String getK8sRBProfileName() {
+ return k8sRBProfileName;
+ }
+
+ public void setK8sRBProfileName(String k8sRBProfileName) {
+ this.k8sRBProfileName = k8sRBProfileName;
+ }
+
+ public String getCloudRegionId() {
+ return cloudRegionId;
+ }
+
+ public void setCloudRegionId(String cloudRegionId) {
+ this.cloudRegionId = cloudRegionId;
+ }
+
+ public String getVfModuleUUID() {
+ return vfModuleUUID;
+ }
+
+ public void setVfModuleUUID(String vfModuleUUID) {
+ this.vfModuleUUID = vfModuleUUID;
+ }
+
+ public Map<String, String> getLabels() {
+ return labels;
+ }
+
+ public void setLabels(Map<String, String> labels) {
+ this.labels = labels;
+ }
+
+ public Map<String, String> getOverrideValues() {
+ return overrideValues;
+ }
+
+ public void setOverrideValues(Map<String, String> overrideValues) {
+ this.overrideValues = overrideValues;
+ }
+
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/ErrorResponse.java b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/ErrorResponse.java
index 188349c0bf..135adcc143 100644
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/ErrorResponse.java
+++ b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/ErrorResponse.java
@@ -18,7 +18,7 @@
* ============LICENSE_END=========================================================
*/
-package org.onap.so.adapters.nssmf.model;
+package org.onap.so.adapters.cnf.model;
public class ErrorResponse {
diff --git a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/GroupVersionKind.java b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/GroupVersionKind.java
new file mode 100644
index 0000000000..bfa5505ccc
--- /dev/null
+++ b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/GroupVersionKind.java
@@ -0,0 +1,66 @@
+
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+package org.onap.so.adapters.cnf.model;
+
+import com.fasterxml.jackson.annotation.JsonInclude;
+import com.fasterxml.jackson.annotation.JsonProperty;
+import com.fasterxml.jackson.annotation.JsonPropertyOrder;
+
+@JsonInclude(JsonInclude.Include.NON_NULL)
+@JsonPropertyOrder({"Group", "Version", "Kind"})
+public class GroupVersionKind {
+ @JsonProperty("Group")
+ private String group;
+ @JsonProperty("Version")
+ private String version;
+ @JsonProperty("Kind")
+ private String kind;
+
+ @JsonProperty("Group")
+ public String getGroup() {
+ return group;
+ }
+
+ @JsonProperty("Group")
+ public void setGroup(String group) {
+ this.group = group;
+ }
+
+ @JsonProperty("Version")
+ public String getVersion() {
+ return version;
+ }
+
+ @JsonProperty("Version")
+ public void setVersion(String version) {
+ this.version = version;
+ }
+
+ @JsonProperty("Kind")
+ public String getKind() {
+ return kind;
+ }
+
+ @JsonProperty("Kind")
+ public void setKind(String kind) {
+ this.kind = kind;
+ }
+}
diff --git a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceMiniResponse.java b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceMiniResponse.java
new file mode 100644
index 0000000000..58040826dd
--- /dev/null
+++ b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceMiniResponse.java
@@ -0,0 +1,62 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.cnf.model;
+
+import com.fasterxml.jackson.annotation.JsonIgnoreProperties;
+import com.fasterxml.jackson.annotation.JsonInclude;
+
+@JsonInclude(JsonInclude.Include.NON_NULL)
+@JsonIgnoreProperties(value = "true")
+public class InstanceMiniResponse extends Response {
+
+ private String id;
+ private MulticloudInstanceRequest request;
+ private String nameSpace;
+
+ public InstanceMiniResponse(String errorMsg) {
+ super(errorMsg);
+ }
+
+ public String getId() {
+ return id;
+ }
+
+ public void setId(String id) {
+ this.id = id;
+ }
+
+ public MulticloudInstanceRequest getRequest() {
+ return request;
+ }
+
+ public void setRequest(MulticloudInstanceRequest request) {
+ this.request = request;
+ }
+
+ public String getNameSpace() {
+ return nameSpace;
+ }
+
+ public void setNameSpace(String nameSpace) {
+ this.nameSpace = nameSpace;
+ }
+
+}
diff --git a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceMiniResponseList.java b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceMiniResponseList.java
new file mode 100644
index 0000000000..ad70fbb7d0
--- /dev/null
+++ b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceMiniResponseList.java
@@ -0,0 +1,45 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.cnf.model;
+
+import java.util.List;
+import com.fasterxml.jackson.annotation.JsonIgnoreProperties;
+import com.fasterxml.jackson.annotation.JsonInclude;
+
+@JsonInclude(JsonInclude.Include.NON_NULL)
+@JsonIgnoreProperties(value = "true")
+public class InstanceMiniResponseList extends Response {
+
+ public InstanceMiniResponseList(String errorMsg) {
+ super(errorMsg);
+ }
+
+ private List<InstanceMiniResponse> instancList;
+
+ public List<InstanceMiniResponse> getInstancList() {
+ return instancList;
+ }
+
+ public void setInstancList(List<InstanceMiniResponse> instancList) {
+ this.instancList = instancList;
+ }
+
+}
diff --git a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceResponse.java b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceResponse.java
new file mode 100644
index 0000000000..effaaf5f78
--- /dev/null
+++ b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceResponse.java
@@ -0,0 +1,87 @@
+
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+package org.onap.so.adapters.cnf.model;
+
+import java.util.List;
+import com.fasterxml.jackson.annotation.JsonIgnoreProperties;
+import com.fasterxml.jackson.annotation.JsonInclude;
+import com.fasterxml.jackson.annotation.JsonProperty;
+import com.fasterxml.jackson.annotation.JsonPropertyOrder;
+
+@JsonInclude(JsonInclude.Include.NON_NULL)
+@JsonPropertyOrder({"id", "request", "namespace", "resources"})
+@JsonIgnoreProperties(value = "true")
+public class InstanceResponse extends Response {
+
+ @JsonProperty("id")
+ private String id;
+ @JsonProperty("request")
+ private MulticloudInstanceRequest request;
+ @JsonProperty("namespace")
+ private String namespace;
+ @JsonProperty("resources")
+ private List<Resource> resources = null;
+
+ public InstanceResponse(String errorMsg) {
+ super(errorMsg);
+ }
+
+ @JsonProperty("id")
+ public String getId() {
+ return id;
+ }
+
+ @JsonProperty("id")
+ public void setId(String id) {
+ this.id = id;
+ }
+
+ @JsonProperty("request")
+ public MulticloudInstanceRequest getRequest() {
+ return request;
+ }
+
+ @JsonProperty("request")
+ public void setRequest(MulticloudInstanceRequest request) {
+ this.request = request;
+ }
+
+ @JsonProperty("namespace")
+ public String getNamespace() {
+ return namespace;
+ }
+
+ @JsonProperty("namespace")
+ public void setNamespace(String namespace) {
+ this.namespace = namespace;
+ }
+
+ @JsonProperty("resources")
+ public List<Resource> getResources() {
+ return resources;
+ }
+
+ @JsonProperty("resources")
+ public void setResources(List<Resource> resources) {
+ this.resources = resources;
+ }
+
+}
diff --git a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceStatusResponse.java b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceStatusResponse.java
new file mode 100644
index 0000000000..2472684bc0
--- /dev/null
+++ b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceStatusResponse.java
@@ -0,0 +1,84 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+package org.onap.so.adapters.cnf.model;
+
+import java.util.List;
+import com.fasterxml.jackson.annotation.JsonIgnoreProperties;
+import com.fasterxml.jackson.annotation.JsonInclude;
+
+@JsonInclude(JsonInclude.Include.NON_NULL)
+@JsonIgnoreProperties(value = "true")
+public class InstanceStatusResponse extends Response {
+
+ public InstanceStatusResponse(String errorMsg) {
+ super(errorMsg);
+ }
+
+ private MulticloudInstanceRequest request;
+
+ private boolean ready;
+
+ private String resourceCount;
+
+ private List<PodStatus> podStatuses;
+
+ private List<?> servicesStatuses;
+
+ public MulticloudInstanceRequest getRequest() {
+ return request;
+ }
+
+ public void setRequest(MulticloudInstanceRequest request) {
+ this.request = request;
+ }
+
+ public boolean isReady() {
+ return ready;
+ }
+
+ public void setReady(boolean ready) {
+ this.ready = ready;
+ }
+
+ public String getResourceCount() {
+ return resourceCount;
+ }
+
+ public void setResourceCount(String resourceCount) {
+ this.resourceCount = resourceCount;
+ }
+
+ public List<PodStatus> getPodStatuses() {
+ return podStatuses;
+ }
+
+ public void setPodStatuses(List<PodStatus> podStatuses) {
+ this.podStatuses = podStatuses;
+ }
+
+ public List<?> getServicesStatuses() {
+ return servicesStatuses;
+ }
+
+ public void setServicesStatuses(List<?> servicesStatuses) {
+ this.servicesStatuses = servicesStatuses;
+ }
+
+}
diff --git a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceEntity.java b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/MulticloudInstanceRequest.java
index 04f2f9d030..b1719cbd7d 100644
--- a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/InstanceEntity.java
+++ b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/MulticloudInstanceRequest.java
@@ -5,7 +5,7 @@ import com.fasterxml.jackson.annotation.JsonIgnoreProperties;
import com.fasterxml.jackson.annotation.JsonProperty;
@JsonIgnoreProperties(value = "true")
-public class InstanceEntity {
+public class MulticloudInstanceRequest {
@JsonProperty(value = "cloud-region")
private String cloudRegion;
@@ -25,6 +25,9 @@ public class InstanceEntity {
@JsonProperty(value = "override-values")
private Map<String, String> overrideValues;
+ @JsonProperty(value = "release-name")
+ private String vfModuleUuid;
+
public String getCloudRegion() {
return cloudRegion;
}
@@ -73,4 +76,12 @@ public class InstanceEntity {
this.overrideValues = overrideValues;
}
+ public String getVfModuleUuid() {
+ return vfModuleUuid;
+ }
+
+ public void setVfModuleUuid(String vfModuleUuid) {
+ this.vfModuleUuid = vfModuleUuid;
+ }
+
}
diff --git a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/PodStatus.java b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/PodStatus.java
new file mode 100644
index 0000000000..ed04601b2c
--- /dev/null
+++ b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/PodStatus.java
@@ -0,0 +1,71 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.cnf.model;
+
+public class PodStatus {
+
+ private String name;
+ private String nameSpace;
+ private boolean ready;
+ private String status;
+ private String[] ipAddresses;
+
+ public String getName() {
+ return name;
+ }
+
+ public void setName(String name) {
+ this.name = name;
+ }
+
+ public String getNameSpace() {
+ return nameSpace;
+ }
+
+ public void setNameSpace(String nameSpace) {
+ this.nameSpace = nameSpace;
+ }
+
+ public boolean isReady() {
+ return ready;
+ }
+
+ public void setReady(boolean ready) {
+ this.ready = ready;
+ }
+
+ public String getStatus() {
+ return status;
+ }
+
+ public void setStatus(String status) {
+ this.status = status;
+ }
+
+ public String[] getIpAddresses() {
+ return ipAddresses;
+ }
+
+ public void setIpAddresses(String[] ipAddresses) {
+ this.ipAddresses = ipAddresses;
+ }
+
+}
diff --git a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/Resource.java b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/Resource.java
new file mode 100644
index 0000000000..d18cd76039
--- /dev/null
+++ b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/Resource.java
@@ -0,0 +1,54 @@
+
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+package org.onap.so.adapters.cnf.model;
+
+import com.fasterxml.jackson.annotation.JsonInclude;
+import com.fasterxml.jackson.annotation.JsonProperty;
+import com.fasterxml.jackson.annotation.JsonPropertyOrder;
+
+@JsonInclude(JsonInclude.Include.NON_NULL)
+@JsonPropertyOrder({"GVK", "Name"})
+public class Resource {
+ @JsonProperty("GVK")
+ private GroupVersionKind gVK;
+ @JsonProperty("Name")
+ private String name;
+
+ @JsonProperty("GVK")
+ public GroupVersionKind getGVK() {
+ return gVK;
+ }
+
+ @JsonProperty("GVK")
+ public void setGVK(GroupVersionKind gVK) {
+ this.gVK = gVK;
+ }
+
+ @JsonProperty("Name")
+ public String getName() {
+ return name;
+ }
+
+ @JsonProperty("Name")
+ public void setName(String name) {
+ this.name = name;
+ }
+}
diff --git a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/Response.java b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/Response.java
new file mode 100644
index 0000000000..423022393c
--- /dev/null
+++ b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/model/Response.java
@@ -0,0 +1,39 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.cnf.model;
+
+public class Response {
+
+ private String errorMsg;
+
+ public Response(String errorMsg) {
+ this.errorMsg = errorMsg;
+ }
+
+ public String getErrorMsg() {
+ return errorMsg;
+ }
+
+ public void setErrorMsg(String errorMsg) {
+ this.errorMsg = errorMsg;
+ }
+
+}
diff --git a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/rest/CnfAdapterRest.java b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/rest/CnfAdapterRest.java
index 952edef7f6..825778b89a 100644
--- a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/rest/CnfAdapterRest.java
+++ b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/rest/CnfAdapterRest.java
@@ -1,27 +1,67 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
package org.onap.so.adapters.cnf.rest;
+import java.io.File;
+import java.io.IOException;
+import org.apache.http.HttpEntity;
import org.apache.http.client.methods.CloseableHttpResponse;
+import org.apache.http.client.methods.HttpDelete;
import org.apache.http.client.methods.HttpGet;
import org.apache.http.client.methods.HttpPost;
+import org.apache.http.client.methods.HttpPut;
import org.apache.http.entity.ContentType;
import org.apache.http.entity.StringEntity;
+import org.apache.http.entity.mime.HttpMultipartMode;
+import org.apache.http.entity.mime.MultipartEntityBuilder;
+import org.apache.http.entity.mime.content.FileBody;
import org.apache.http.impl.client.CloseableHttpClient;
import org.apache.http.impl.client.HttpClients;
import org.apache.http.util.EntityUtils;
+import org.onap.so.adapters.cnf.model.BpmnInstanceRequest;
import org.onap.so.adapters.cnf.model.ConfigTemplateEntity;
import org.onap.so.adapters.cnf.model.ConfigurationEntity;
+import org.onap.so.adapters.cnf.model.ConfigurationRollbackEntity;
import org.onap.so.adapters.cnf.model.ConnectivityInfo;
-import org.onap.so.adapters.cnf.model.InstanceEntity;
+import org.onap.so.adapters.cnf.model.InstanceMiniResponseList;
+import org.onap.so.adapters.cnf.model.InstanceResponse;
+import org.onap.so.adapters.cnf.model.InstanceStatusResponse;
import org.onap.so.adapters.cnf.model.ProfileEntity;
import org.onap.so.adapters.cnf.model.ResourceBundleEntity;
+import org.onap.so.adapters.cnf.model.Tag;
+import org.onap.so.adapters.cnf.service.CnfAdapterService;
import org.slf4j.Logger;
import org.slf4j.LoggerFactory;
+import org.springframework.beans.factory.annotation.Autowired;
+import org.springframework.http.ResponseEntity;
import org.springframework.web.bind.annotation.PathVariable;
import org.springframework.web.bind.annotation.RequestBody;
import org.springframework.web.bind.annotation.RequestMapping;
import org.springframework.web.bind.annotation.RequestMethod;
+import org.springframework.web.bind.annotation.RequestParam;
import org.springframework.web.bind.annotation.ResponseBody;
import org.springframework.web.bind.annotation.RestController;
+import org.springframework.web.multipart.MultipartFile;
+import com.fasterxml.jackson.core.JsonParseException;
+import com.fasterxml.jackson.databind.JsonMappingException;
import com.fasterxml.jackson.databind.ObjectMapper;
import com.fasterxml.jackson.databind.SerializationFeature;
@@ -31,23 +71,78 @@ public class CnfAdapterRest {
private static final Logger logger = LoggerFactory.getLogger(CnfAdapterRest.class);
private final CloseableHttpClient httpClient = HttpClients.createDefault();
+ @Autowired
+ private CnfAdapterService cnfAdapterService;
+
@ResponseBody
- @RequestMapping(value = {"/api/multicloud-k8s/v1/healthcheck"}, method = RequestMethod.GET,
+ @RequestMapping(value = {"/api/cnf-adapter/v1/healthcheck"}, method = RequestMethod.GET,
produces = "application/json")
- public String healthCheck() throws Exception {
+ public ResponseEntity<String> healthCheck() throws Exception {
- logger.info("health check called.");
+ logger.info("healthCheck called.");
+ return cnfAdapterService.healthCheck();
+
+ }
+
+ @ResponseBody
+ @RequestMapping(value = {"/api/cnf-adapter/v1/instance"}, method = RequestMethod.POST,
+ produces = "application/json", consumes = "application/json")
+ public ResponseEntity<InstanceResponse> createInstance(@RequestBody BpmnInstanceRequest bpmnInstanceRequest)
+ throws JsonParseException, JsonMappingException, IOException {
+
+ logger.info("createInstance called.");
+ return cnfAdapterService.createInstance(bpmnInstanceRequest);
+ }
+
+ @ResponseBody
+ @RequestMapping(value = {"/api/cnf-adapter/v1/instance/{instID}"}, method = RequestMethod.GET,
+ produces = "application/json")
+ public ResponseEntity<InstanceResponse> getInstanceByInstanceId(@PathVariable("instID") String instanceId)
+ throws JsonParseException, JsonMappingException, IOException {
+
+ logger.info("getInstanceByInstanceId called.");
+
+ return cnfAdapterService.getInstanceByInstanceId(instanceId);
- // TODO
- HttpGet req = new HttpGet("https://localhost:32780/api/multicloud-k8s/v1/healthcheck");
- try (CloseableHttpResponse response = httpClient.execute(req)) {
- logger.info("response:" + response.getEntity());
- return EntityUtils.toString(response.getEntity());
- }
}
@ResponseBody
- @RequestMapping(value = {"/api/multicloud-k8s/v1/v1/rb/definition"}, method = RequestMethod.POST,
+ @RequestMapping(value = {"/api/cnf-adapter/v1/instance/{instID}/status"}, method = RequestMethod.GET,
+ produces = "application/json")
+ public ResponseEntity<InstanceStatusResponse> getInstanceStatusByInstanceId(
+ @PathVariable("instID") String instanceId) throws JsonParseException, JsonMappingException, IOException {
+
+ logger.info("getInstanceStatusByInstanceId called.");
+
+ return cnfAdapterService.getInstanceStatusByInstanceId(instanceId);
+
+ }
+
+ @RequestMapping(value = {"/api/cnf-adapter/v1/instance"}, method = RequestMethod.GET, produces = "application/json")
+ public ResponseEntity<InstanceMiniResponseList> getInstanceByRBNameOrRBVersionOrProfileName(
+ @RequestParam(value = "rb-name", required = false) String rbName,
+ @RequestParam(value = "rb-version", required = false) String rbVersion,
+ @RequestParam(value = "profile-name", required = false) String profileName)
+ throws JsonParseException, JsonMappingException, IOException {
+
+ logger.info("getInstanceByRBNameOrRBVersionOrProfileName called.");
+ return cnfAdapterService.getInstanceByRBNameOrRBVersionOrProfileName(rbName, rbVersion, profileName);
+
+ }
+
+ @ResponseBody
+ @RequestMapping(value = {"/api/cnf-adapter/v1/instance/{instID}"}, method = RequestMethod.DELETE,
+ produces = "application/json")
+ public ResponseEntity<String> deleteInstanceByInstanceId(@PathVariable("instID") String instanceID)
+ throws JsonParseException, JsonMappingException, IOException {
+
+ logger.info("deleteInstanceByInstanceId called.");
+ return cnfAdapterService.deleteInstanceByInstanceId(instanceID);
+
+ }
+
+ @ResponseBody
+ @RequestMapping(value = {"/api/cnf-adapter/v1/rb/definition"}, method = RequestMethod.POST,
produces = "application/json")
public String createRB(@RequestBody ResourceBundleEntity rB) throws Exception {
@@ -55,7 +150,7 @@ public class CnfAdapterRest {
// TODO
// Below URL should be changed as appropriate multicloud URL.
- HttpPost post = new HttpPost("https://localhost:32780/api/multicloud-k8s/v1/v1/rb/definition");
+ HttpPost post = new HttpPost("http://multicloud-k8s:9015/v1/rb/definition");
ObjectMapper objectMapper = new ObjectMapper();
objectMapper.configure(SerializationFeature.FAIL_ON_EMPTY_BEANS, false);
String requestBody = objectMapper.writeValueAsString(rB);
@@ -70,8 +165,8 @@ public class CnfAdapterRest {
}
@ResponseBody
- @RequestMapping(value = {"/api/multicloud-k8s/v1/v1/rb/definition/{rb-name}/{rb-version}"},
- method = RequestMethod.GET, produces = "application/json")
+ @RequestMapping(value = {"/api/cnf-adapter/v1/rb/definition/{rb-name}/{rb-version}"}, method = RequestMethod.GET,
+ produces = "application/json")
public String getRB(@PathVariable("rb-name") String rbName, @PathVariable("rb-version") String rbVersion)
throws Exception {
@@ -79,16 +174,101 @@ public class CnfAdapterRest {
// TODO
// Below URL should be changed as appropriate multicloud URL.
- HttpGet req = new HttpGet(
- "https://localhost:32780/api/multicloud-k8s/v1/v1/rb/definition/" + rbName + "/" + rbVersion);
+ HttpGet req = new HttpGet("http://multicloud-k8s:9015/v1/rb/definition/" + rbName + "/" + rbVersion);
+ try (CloseableHttpResponse response = httpClient.execute(req)) {
+ logger.info("response:" + response.getEntity());
+ return EntityUtils.toString(response.getEntity());
+ }
+ }
+
+ @ResponseBody
+ @RequestMapping(value = {"/api/cnf-adapter/v1/rb/definition/{rb-name}/{rb-version}"}, method = RequestMethod.DELETE,
+ produces = "application/json")
+ public String deleteRB(@PathVariable("rb-name") String rbName, @PathVariable("rb-version") String rbVersion)
+ throws Exception {
+
+ logger.info("delete RB called.");
+
+ // TODO
+ // Below URL should be changed as appropriate multicloud URL.
+ HttpDelete req = new HttpDelete("http://multicloud-k8s:9015/v1/rb/definition/" + rbName + "/" + rbVersion);
+
+ try (CloseableHttpResponse response = httpClient.execute(req)) {
+ logger.info("response:" + response.getEntity());
+ return EntityUtils.toString(response.getEntity());
+ }
+
+ }
+
+ @ResponseBody
+ @RequestMapping(value = {"/api/cnf-adapter/v1/rb/definition/{rb-name}"}, method = RequestMethod.GET,
+ produces = "application/json")
+ public String getListOfRB(@PathVariable("rb-name") String rbName) throws Exception {
+
+ logger.info("getListOfRB called.");
+
+ // TODO
+ // Below URL should be changed as appropriate multicloud URL.
+ HttpGet req = new HttpGet("http://multicloud-k8s:9015/v1/rb/definition/" + rbName);
+
+ try (CloseableHttpResponse response = httpClient.execute(req)) {
+ logger.info("response:" + response.getEntity());
+ return EntityUtils.toString(response.getEntity());
+ }
+
+ }
+
+ @ResponseBody
+ @RequestMapping(value = {"/api/cnf-adapter/v1/rb/definition"}, method = RequestMethod.GET,
+ produces = "application/json")
+ public String getListOfRBWithoutUsingRBName() throws Exception {
+
+ logger.info("getListOfRBWithoutUsingRBName called.");
+
+ // TODO
+ // Below URL should be changed as appropriate multicloud URL.
+ HttpGet req = new HttpGet("http://multicloud-k8s:9015/v1/rb/definition");
+
try (CloseableHttpResponse response = httpClient.execute(req)) {
logger.info("response:" + response.getEntity());
return EntityUtils.toString(response.getEntity());
}
+
}
@ResponseBody
- @RequestMapping(value = {"/api/multicloud-k8s/v1/v1/rb/definition/{rb-name}/{rb-version}/profile"},
+ @RequestMapping(value = {"/api/cnf-adapter/v1/rb/definition/{rb-name}/{rb-version}/content"},
+ method = RequestMethod.POST, produces = "multipart/form-data")
+ public String uploadArtifactForRB(@RequestParam("file") MultipartFile file, @PathVariable("rb-name") String rbName,
+ @PathVariable("rb-version") String rbVersion) throws Exception {
+
+ logger.info("Upload Artifact For RB called.");
+
+ File convFile = new File(file.getOriginalFilename());
+ file.transferTo(convFile);
+ FileBody fileBody = new FileBody(convFile, ContentType.DEFAULT_BINARY);
+ MultipartEntityBuilder builder = MultipartEntityBuilder.create();
+ builder.setMode(HttpMultipartMode.BROWSER_COMPATIBLE);
+ builder.addPart("file", fileBody);
+ HttpEntity entity = builder.build();
+
+ // TODO
+ // Below URL should be changed as appropriate multicloud URL.
+ HttpPost post =
+ new HttpPost("http://multicloud-k8s:9015/v1/rb/definition/" + rbName + "/" + rbVersion + "/content");
+ post.setHeader("Content-Type", "multipart/form-data");
+ logger.info(String.valueOf(post));
+ post.setEntity(entity);
+
+ try (CloseableHttpClient httpClient = HttpClients.createDefault();
+ CloseableHttpResponse response = httpClient.execute(post)) {
+ logger.info("response:" + response.getEntity());
+ return EntityUtils.toString(response.getEntity());
+ }
+ }
+
+ @ResponseBody
+ @RequestMapping(value = {"/api/cnf-adapter/v1/rb/definition/{rb-name}/{rb-version}/profile"},
method = RequestMethod.POST, produces = "application/json")
public String createProfile(@RequestBody ProfileEntity fE, @PathVariable("rb-name") String rbName,
@PathVariable("rb-version") String rbVersion) throws Exception {
@@ -97,8 +277,8 @@ public class CnfAdapterRest {
// TODO
// Below URL should be changed as appropriate multicloud URL.
- HttpPost post = new HttpPost("http://localhost:32780/api/multicloud-k8s/v1/v1/rb/definition/" + rbName + "/"
- + rbVersion + "/profile");
+ HttpPost post =
+ new HttpPost("http://multicloud-k8s:9015/v1/rb/definition/" + rbName + "/" + rbVersion + "/profile");
ObjectMapper objectMapper = new ObjectMapper();
String requestBody = objectMapper.writeValueAsString(fE);
StringEntity requestEntity = new StringEntity(requestBody, ContentType.APPLICATION_JSON);
@@ -112,7 +292,7 @@ public class CnfAdapterRest {
}
@ResponseBody
- @RequestMapping(value = {"/api/multicloud-k8s/v1/v1/rb/definition/{rb-name}/{rb-version}/profile/{pr-name}"},
+ @RequestMapping(value = {"/api/cnf-adapter/v1/rb/definition/{rb-name}/{rb-version}/profile/{pr-name}"},
method = RequestMethod.GET, produces = "application/json")
public String getProfile(@PathVariable("rb-name") String rbName, @PathVariable("rb-version") String rbVersion,
@PathVariable("pr-name") String prName) throws Exception {
@@ -121,8 +301,8 @@ public class CnfAdapterRest {
// TODO
// Below URL should be changed as appropriate multicloud URL.
- HttpGet req = new HttpGet("https://localhost:32780/api/multicloud-k8s/v1/v1/rb/definition/" + rbName + "/"
- + rbVersion + "/profile/" + prName);
+ HttpGet req = new HttpGet(
+ "http://multicloud-k8s:9015/v1/rb/definition/" + rbName + "/" + rbVersion + "/profile/" + prName);
try (CloseableHttpResponse response = httpClient.execute(req)) {
logger.info("response:" + response.getEntity());
@@ -131,48 +311,79 @@ public class CnfAdapterRest {
}
@ResponseBody
- @RequestMapping(value = {"/api/multicloud-k8s/v1/v1/instance"}, method = RequestMethod.POST,
- produces = "application/json")
- public String createInstance(@RequestBody InstanceEntity iE) throws Exception {
+ @RequestMapping(value = {"/api/cnf-adapter/v1/rb/definition/{rb-name}/{rb-version}/profile"},
+ method = RequestMethod.GET, produces = "application/json")
+ public String getListOfProfile(@PathVariable("rb-name") String rbName, @PathVariable("rb-version") String rbVersion)
+ throws Exception {
- logger.info("create Instance called.");
+ logger.info("getListOfProfile called.");
// TODO
// Below URL should be changed as appropriate multicloud URL.
- HttpPost post = new HttpPost("https://localhost:32780/api/multicloud-k8s/v1/v1/instance");
- ObjectMapper objectMapper = new ObjectMapper();
+ HttpGet req =
+ new HttpGet("http://multicloud-k8s:9015/v1/rb/definition/" + rbName + "/" + rbVersion + "/profile");
- objectMapper.configure(SerializationFeature.FAIL_ON_EMPTY_BEANS, false);
- String requestBody = objectMapper.writeValueAsString(iE);
- StringEntity requestEntity = new StringEntity(requestBody, ContentType.APPLICATION_JSON);
- post.setEntity(requestEntity);
-
- try (CloseableHttpClient httpClient = HttpClients.createDefault();
- CloseableHttpResponse response = httpClient.execute(post)) {
+ try (CloseableHttpResponse response = httpClient.execute(req)) {
logger.info("response:" + response.getEntity());
return EntityUtils.toString(response.getEntity());
}
}
@ResponseBody
- @RequestMapping(value = {"/api/multicloud-k8s/v1/v1/instance/{instID}"}, method = RequestMethod.GET,
- produces = "application/json")
- public String getInstance(@PathVariable("instID") String instanceId) throws Exception {
+ @RequestMapping(value = {"/api/cnf-adapter/v1/rb/definition/{rb-name}/{rb-version}/profile/{pr-name}"},
+ method = RequestMethod.DELETE, produces = "application/json")
+ public String deleteProfile(@PathVariable("rb-name") String rbName, @PathVariable("rb-version") String rbVersion,
+ @PathVariable("pr-name") String prName) throws Exception {
+
+ logger.info("delete Profile called.");
- logger.info("get Instance called.");
// TODO
// Below URL should be changed as appropriate multicloud URL.
- HttpGet req = new HttpGet("https://localhost:32780/api/multicloud-k8s/v1/v1/instance/" + instanceId);
+ HttpDelete req = new HttpDelete(
+ "http://multicloud-k8s:9015/v1/rb/definition/" + rbName + "/" + rbVersion + "/profile/" + prName);
try (CloseableHttpResponse response = httpClient.execute(req)) {
logger.info("response:" + response.getEntity());
return EntityUtils.toString(response.getEntity());
}
+
}
@ResponseBody
- @RequestMapping(
- value = {"/api/multicloud-k8s/v1/v1/definition/{rb-name}/{rb-version}/profile/{profile-name}/config"},
+ @RequestMapping(value = {"/api/cnf-adapter/v1/rb/definition/{rb-name}/{rb-version}/profile/{pr-name}/content"},
+ method = RequestMethod.POST, produces = "multipart/form-data")
+ public String uploadArtifactForProfile(@RequestParam("file") MultipartFile file,
+ @PathVariable("rb-name") String rbName, @PathVariable("rb-version") String rbVersion,
+ @PathVariable("pr-name") String prName) throws Exception {
+
+ logger.info("Upload Artifact For Profile called.");
+
+ File convFile = new File(file.getOriginalFilename());
+ file.transferTo(convFile);
+ FileBody fileBody = new FileBody(convFile, ContentType.DEFAULT_BINARY);
+ MultipartEntityBuilder builder = MultipartEntityBuilder.create();
+ builder.setMode(HttpMultipartMode.BROWSER_COMPATIBLE);
+ builder.addPart("file", fileBody);
+ HttpEntity entity = builder.build();
+
+ // TODO
+ // Below URL should be changed as appropriate multicloud URL.
+ HttpPost post = new HttpPost("http://multicloud-k8s:9015/v1/rb/definition/" + rbName + "/" + rbVersion
+ + "/profile/" + prName + "/content");
+ post.setHeader("Content-Type", "multipart/form-data");
+
+ logger.info(String.valueOf(post));
+ post.setEntity(entity);
+
+ try (CloseableHttpClient httpClient = HttpClients.createDefault();
+ CloseableHttpResponse response = httpClient.execute(post)) {
+ logger.info("response:" + response.getEntity());
+ return EntityUtils.toString(response.getEntity());
+ }
+ }
+
+ @ResponseBody
+ @RequestMapping(value = {"/api/cnf-adapter/v1/definition/{rb-name}/{rb-version}/profile/{profile-name}/config"},
method = RequestMethod.POST, produces = "application/json")
public String createConfiguration(@RequestBody ConfigurationEntity cE, @PathVariable("rb-name") String rbName,
@PathVariable("rb-version") String rbVersion, @PathVariable("profile-name") String prName)
@@ -182,8 +393,8 @@ public class CnfAdapterRest {
// TODO
// Below URL should be changed as appropriate multicloud URL.
- HttpPost post = new HttpPost("https://localhost:32780/api/multicloud-k8s/v1/v1/definition/" + rbName + "/"
- + rbVersion + "/profile/" + prName + "/config");
+ HttpPost post = new HttpPost("http://multicloud-k8s:9015/v1/definition/" + rbName + "/" + rbVersion
+ + "/profile/" + prName + "/config");
ObjectMapper objectMapper = new ObjectMapper();
String requestBody = objectMapper.writeValueAsString(cE);
StringEntity requestEntity = new StringEntity(requestBody, ContentType.APPLICATION_JSON);
@@ -197,8 +408,8 @@ public class CnfAdapterRest {
}
@ResponseBody
- @RequestMapping(value = {
- "/api/multicloud-k8s/v1/v1/definition/{rb-name}/{rb-version}/profile/{profile-name}/config/{cfg-name}"},
+ @RequestMapping(
+ value = {"/api/cnf-adapter/v1/definition/{rb-name}/{rb-version}/profile/{profile-name}/config/{cfg-name}"},
method = RequestMethod.GET, produces = "application/json")
public String getConfiguration(@PathVariable("rb-name") String rbName, @PathVariable("rb-version") String rbVersion,
@PathVariable("profile-name") String prName, @PathVariable("cfg-name") String cfgName) throws Exception {
@@ -207,17 +418,89 @@ public class CnfAdapterRest {
// TODO
// Below URL should be changed as appropriate multicloud URL.
- HttpGet req = new HttpGet("https://localhost:32780/api/multicloud-k8s/v1/v1/definition/" + rbName + "/"
- + rbVersion + "/profile/" + prName + "/config/" + cfgName);
+ HttpGet req = new HttpGet("http://multicloud-k8s:9015/v1/definition/" + rbName + "/" + rbVersion + "/profile/"
+ + prName + "/config/" + cfgName);
+
+ try (CloseableHttpResponse response = httpClient.execute(req)) {
+ logger.info("response:" + response.getEntity());
+ return EntityUtils.toString(response.getEntity());
+ }
+ }
+
+ @ResponseBody
+ @RequestMapping(
+ value = {"/api/cnf-adapter/v1/definition/{rb-name}/{rb-version}/profile/{profile-name}/config/{cfg-name}"},
+ method = RequestMethod.DELETE, produces = "application/json")
+ public String deleteConfiguration(@PathVariable("rb-name") String rbName,
+ @PathVariable("rb-version") String rbVersion, @PathVariable("profile-name") String prName,
+ @PathVariable("cfg-name") String cfgName) throws Exception {
+
+ logger.info("delete Configuration called.");
+
+ // TODO
+ // Below URL should be changed as appropriate multicloud URL.
+ HttpDelete req = new HttpDelete("http://multicloud-k8s:9015/v1/definition/" + rbName + "/" + rbVersion
+ + "/profile/" + prName + "/config/" + cfgName);
try (CloseableHttpResponse response = httpClient.execute(req)) {
logger.info("response:" + response.getEntity());
return EntityUtils.toString(response.getEntity());
}
+
+ }
+
+ @ResponseBody
+ @RequestMapping(
+ value = {"/api/cnf-adapter/v1/definition/{rb-name}/{rb-version}/profile/{profile-name}/config/{cfg-name}"},
+ method = RequestMethod.PUT, produces = "application/json")
+ public String updateConfiguration(@RequestBody ConfigurationEntity cE, @PathVariable("rb-name") String rbName,
+ @PathVariable("rb-version") String rbVersion, @PathVariable("profile-name") String prName,
+ @PathVariable("cfg-name") String cfgName) throws Exception {
+
+ logger.info("update Configuration called.");
+
+ // TODO
+ // Below URL should be changed as appropriate multicloud URL.
+ HttpPut post = new HttpPut("http://multicloud-k8s:9015/v1/definition/" + rbName + "/" + rbVersion + "/profile/"
+ + prName + "/config/" + cfgName);
+ ObjectMapper objectMapper = new ObjectMapper();
+ String requestBody = objectMapper.writeValueAsString(cE);
+ StringEntity requestEntity = new StringEntity(requestBody, ContentType.APPLICATION_JSON);
+ post.setEntity(requestEntity);
+
+ try (CloseableHttpClient httpClient = HttpClients.createDefault();
+ CloseableHttpResponse response = httpClient.execute(post)) {
+ logger.info("response:" + response.getEntity());
+ return EntityUtils.toString(response.getEntity());
+ }
+ }
+
+ @ResponseBody
+ @RequestMapping(value = {"/api/cnf-adapter/v1/definition/{rb-name}/{rb-version}/profile/{profile-name}/tagit"},
+ method = RequestMethod.POST, produces = "application/json")
+ public String tagConfigurationValue(@RequestBody Tag tag, @PathVariable("rb-name") String rbName,
+ @PathVariable("rb-version") String rbVersion, @PathVariable("pr-name") String prName) throws Exception {
+ logger.info("Tag Configuration called.");
+
+ // TODO
+ // Below URL should be changed as appropriate multicloud URL.
+ HttpPost post = new HttpPost("http://multicloud-k8s:9015/v1/definition/" + rbName + "/" + rbVersion
+ + "/profile/" + prName + "/config/tagit");
+
+ ObjectMapper objectMapper = new ObjectMapper();
+ String requestBody = objectMapper.writeValueAsString(tag);
+ StringEntity requestEntity = new StringEntity(requestBody, ContentType.APPLICATION_JSON);
+ post.setEntity(requestEntity);
+
+ try (CloseableHttpClient httpClient = HttpClients.createDefault();
+ CloseableHttpResponse response = httpClient.execute(post)) {
+ logger.info("response:" + response.getEntity());
+ return EntityUtils.toString(response.getEntity());
+ }
}
@ResponseBody
- @RequestMapping(value = {"/api/multicloud-k8s/v1/v1/connectivity-info"}, method = RequestMethod.POST,
+ @RequestMapping(value = {"/api/cnf-adapter/v1/connectivity-info"}, method = RequestMethod.POST,
produces = "application/json")
public String createConnectivityInfo(@RequestBody ConnectivityInfo cIE) throws Exception {
@@ -225,7 +508,7 @@ public class CnfAdapterRest {
// TODO
// Below URL should be changed as appropriate multicloud URL.
- HttpPost post = new HttpPost("https://localhost:32780/api/multicloud-k8s/v1/v1/connectivity-info");
+ HttpPost post = new HttpPost("http://multicloud-k8s:9015/v1/connectivity-info");
ObjectMapper objectMapper = new ObjectMapper();
String requestBody = objectMapper.writeValueAsString(cIE);
StringEntity requestEntity = new StringEntity(requestBody, ContentType.APPLICATION_JSON);
@@ -239,7 +522,7 @@ public class CnfAdapterRest {
}
@ResponseBody
- @RequestMapping(value = {"/api/multicloud-k8s/v1/v1/connectivity-info/{connname}"}, method = RequestMethod.GET,
+ @RequestMapping(value = {"/api/cnf-adapter/v1/connectivity-info/{connname}"}, method = RequestMethod.GET,
produces = "application/json")
public String getConnectivityInfo(@PathVariable("connname") String connName) throws Exception {
@@ -247,16 +530,34 @@ public class CnfAdapterRest {
// TODO
// Below URL should be changed as appropriate multicloud URL.
- HttpGet req = new HttpGet("https://localhost:32780/api/multicloud-k8s/v1/v1/connectivity-info/" + connName);
+ HttpGet req = new HttpGet("http://multicloud-k8s:9015/v1/connectivity-info/" + connName);
+
+ try (CloseableHttpResponse response = httpClient.execute(req)) {
+ logger.info("response:" + response.getEntity());
+ return EntityUtils.toString(response.getEntity());
+ }
+ }
+
+ @ResponseBody
+ @RequestMapping(value = {"/api/cnf-adapter/v1/connectivity-info/{connname}"}, method = RequestMethod.DELETE,
+ produces = "application/json")
+ public String deleteConnectivityInfo(@PathVariable("connname") String connName) throws Exception {
+
+ logger.info("delete Connectivity Info called.");
+
+ // TODO
+ // Below URL should be changed as appropriate multicloud URL.
+ HttpDelete req = new HttpDelete("http://multicloud-k8s:9015/v1/connectivity-info/" + connName);
try (CloseableHttpResponse response = httpClient.execute(req)) {
logger.info("response:" + response.getEntity());
return EntityUtils.toString(response.getEntity());
}
+
}
@ResponseBody
- @RequestMapping(value = {"/api/multicloud-k8s/v1/v1/rb/definition/{rb-name}/{rb-version}/config-template"},
+ @RequestMapping(value = {"/api/cnf-adapter/v1/rb/definition/{rb-name}/{rb-version}/config-template"},
method = RequestMethod.POST, produces = "application/json")
public String createConfigTemplate(@RequestBody ConfigTemplateEntity tE, @PathVariable("rb-name") String rbName,
@PathVariable("rb-version") String rbVersion) throws Exception {
@@ -265,8 +566,8 @@ public class CnfAdapterRest {
// TODO
// Below URL should be changed as appropriate multicloud URL.
- HttpPost post = new HttpPost("http://localhost:32780/api/multicloud-k8s/v1/v1/rb/definition/" + rbName + "/"
- + rbVersion + "/config-template");
+ HttpPost post = new HttpPost(
+ "http://multicloud-k8s:9015/v1/rb/definition/" + rbName + "/" + rbVersion + "/config-template");
ObjectMapper objectMapper = new ObjectMapper();
String requestBody = objectMapper.writeValueAsString(tE);
StringEntity requestEntity = new StringEntity(requestBody, ContentType.APPLICATION_JSON);
@@ -280,7 +581,7 @@ public class CnfAdapterRest {
}
@ResponseBody
- @RequestMapping(value = {"/api/multicloud-k8s/v1/v1/rb/definition/{rb-name}/{rb-version}/config-template/{tname}"},
+ @RequestMapping(value = {"/api/cnf-adapter/v1/rb/definition/{rb-name}/{rb-version}/config-template/{tname}"},
method = RequestMethod.GET, produces = "application/json")
public String getConfigTemplate(@PathVariable("rb-name") String rbName,
@PathVariable("rb-version") String rbVersion, @PathVariable("tname") String tName) throws Exception {
@@ -289,8 +590,8 @@ public class CnfAdapterRest {
// TODO
// Below URL should be changed as appropriate multicloud URL.
- HttpGet req = new HttpGet("https://localhost:32780/api/multicloud-k8s/v1/v1/rb/definition/" + rbName + "/"
- + rbVersion + "/config-template/" + tName);
+ HttpGet req = new HttpGet("http://multicloud-k8s:9015/v1/rb/definition/" + rbName + "/" + rbVersion
+ + "/config-template/" + tName);
try (CloseableHttpResponse response = httpClient.execute(req)) {
logger.info("response:" + response.getEntity());
@@ -298,4 +599,83 @@ public class CnfAdapterRest {
}
}
+ @ResponseBody
+ @RequestMapping(value = {"/api/cnf-adapter/v1/rb/definition/{rb-name}/{rb-version}/config-template/{tname}"},
+ method = RequestMethod.DELETE, produces = "application/json")
+ public String deleteTemplate(@PathVariable("rb-name") String rbName, @PathVariable("rb-version") String rbVersion,
+ @PathVariable("tname") String tName) throws Exception {
+
+ logger.info("deleteTemplate called.");
+
+ // TODO
+ // Below URL should be changed as appropriate multicloud URL.
+ HttpDelete req = new HttpDelete("http://multicloud-k8s:9015/v1/rb/definition/" + rbName + "/" + rbVersion
+ + "/config-template/" + tName);
+
+ try (CloseableHttpResponse response = httpClient.execute(req)) {
+ logger.info("response:" + response.getEntity());
+ return EntityUtils.toString(response.getEntity());
+ }
+
+ }
+
+ @ResponseBody
+ @RequestMapping(
+ value = {"/api/cnf-adapter/v1/rb/definition/{rb-name}/{rb-version}/config-template/{tname}/content"},
+ method = RequestMethod.POST, produces = "multipart/form-data")
+ public String uploadTarFileForTemplate(@RequestParam("file") MultipartFile file,
+ @PathVariable("rb-name") String rbName, @PathVariable("rb-version") String rbVersion,
+ @PathVariable("tname") String tName) throws Exception {
+
+ logger.info("uploadTarFileForTemplate called.");
+
+ File convFile = new File(file.getOriginalFilename());
+ file.transferTo(convFile);
+ FileBody fileBody = new FileBody(convFile, ContentType.DEFAULT_BINARY);
+ MultipartEntityBuilder builder = MultipartEntityBuilder.create();
+ builder.setMode(HttpMultipartMode.BROWSER_COMPATIBLE);
+ builder.addPart("file", fileBody);
+ HttpEntity entity = builder.build();
+
+ // TODO
+ // Below URL should be changed as appropriate multicloud URL.
+ HttpPost post = new HttpPost("http://multicloud-k8s:9015/v1/rb/definition/" + rbName + "/" + rbVersion
+ + "/config-template/" + tName + "/content");
+ post.setHeader("Content-Type", "multipart/form-data");
+
+ logger.info(String.valueOf(post));
+ post.setEntity(entity);
+
+ try (CloseableHttpClient httpClient = HttpClients.createDefault();
+ CloseableHttpResponse response = httpClient.execute(post)) {
+ logger.info("response:" + response.getEntity());
+ return EntityUtils.toString(response.getEntity());
+ }
+ }
+
+ @ResponseBody
+ @RequestMapping(value = {"/api/cnf-adapter/v1/definition/{rbName}/{rbVersion}/profile/{prName}/config/rollback"},
+ method = RequestMethod.DELETE, produces = "application/json")
+ public String rollbackConfiguration(@RequestBody ConfigurationRollbackEntity rE,
+ @PathVariable("rbName") String rbName, @PathVariable("rbVersion") String rbVersion,
+ @PathVariable("prName") String prName) throws Exception {
+ logger.info("rollbackConfiguration called.");
+
+ // TODO
+ // Below URL should be changed as appropriate multicloud URL.
+ HttpPost post = new HttpPost("http://multicloud-k8s:9015/v1/definition/" + rbName + "/" + rbVersion
+ + "/profile/" + prName + "/config/rollback");
+
+ ObjectMapper objectMapper = new ObjectMapper();
+ String requestBody = objectMapper.writeValueAsString(rE);
+ StringEntity requestEntity = new StringEntity(requestBody, ContentType.APPLICATION_JSON);
+ post.setEntity(requestEntity);
+
+ try (CloseableHttpClient httpClient = HttpClients.createDefault();
+ CloseableHttpResponse response = httpClient.execute(post)) {
+ logger.info("response:" + response.getEntity());
+ return EntityUtils.toString(response.getEntity());
+ }
+ }
+
}
diff --git a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/service/CnfAdapterService.java b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/service/CnfAdapterService.java
new file mode 100644
index 0000000000..06c09e3431
--- /dev/null
+++ b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/service/CnfAdapterService.java
@@ -0,0 +1,269 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.cnf.service;
+
+import java.io.IOException;
+import java.util.ArrayList;
+import java.util.List;
+import javax.persistence.EntityNotFoundException;
+import javax.ws.rs.core.UriBuilder;
+import org.apache.http.HttpStatus;
+import org.onap.so.adapters.cnf.model.BpmnInstanceRequest;
+import org.onap.so.adapters.cnf.model.InstanceMiniResponse;
+import org.onap.so.adapters.cnf.model.InstanceMiniResponseList;
+import org.onap.so.adapters.cnf.model.InstanceResponse;
+import org.onap.so.adapters.cnf.model.InstanceStatusResponse;
+import org.onap.so.adapters.cnf.model.MulticloudInstanceRequest;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+import org.springframework.beans.factory.annotation.Autowired;
+import org.springframework.http.HttpEntity;
+import org.springframework.http.HttpHeaders;
+import org.springframework.http.HttpMethod;
+import org.springframework.http.MediaType;
+import org.springframework.http.ResponseEntity;
+import org.springframework.stereotype.Service;
+import org.springframework.web.client.HttpClientErrorException;
+import org.springframework.web.client.HttpStatusCodeException;
+import org.springframework.web.client.RestTemplate;
+import com.fasterxml.jackson.core.JsonParseException;
+import com.fasterxml.jackson.databind.JsonMappingException;
+
+@Service
+public class CnfAdapterService {
+ private static final Logger logger = LoggerFactory.getLogger(CnfAdapterService.class);
+ @Autowired
+ private RestTemplate restTemplate;
+ private static final String INSTANCE_CREATE_PATH = "/v1/instance";
+ private static final String HEALTH_CHECK = "/v1/healthcheck";
+
+ public ResponseEntity<String> healthCheck() {
+
+ logger.info("CnfAdapterService createInstance called");
+ ResponseEntity<String> result = null;
+ try {
+
+ logger.info("CnfAdapterService createInstance called");
+
+ // String uri = env.getRequiredProperty("multicloud.endpoint"); //TODO:
+ // This needs to be added as well
+ // for configuration
+ String uri = "http://multicloud-k8s:9015"; // TODO: What is the correct uri?
+ String endpoint = UriBuilder.fromUri(uri).path(HEALTH_CHECK).build().toString();
+ HttpEntity<?> requestEntity = new HttpEntity<>(getHttpHeaders());
+ result = restTemplate.exchange(endpoint, HttpMethod.GET, requestEntity, String.class);
+ return result;
+ } catch (HttpClientErrorException e) {
+ logger.error("Error Calling Multicloud, e");
+ if (HttpStatus.SC_NOT_FOUND == e.getStatusCode().value()) {
+ throw new EntityNotFoundException(e.getResponseBodyAsString());
+ }
+ throw e;
+ } catch (HttpStatusCodeException e) {
+ logger.error("Error in Multicloud, e");
+ String responseString = e.getResponseBodyAsString();
+ return ResponseEntity.status(e.getStatusCode()).body(responseString);
+ }
+ }
+
+ public ResponseEntity<InstanceResponse> createInstance(BpmnInstanceRequest bpmnInstanceRequest)
+ throws JsonParseException, JsonMappingException, IOException {
+ try {
+ logger.info("CnfAdapterService createInstance called");
+ MulticloudInstanceRequest multicloudInstanceRequest = new MulticloudInstanceRequest();
+ ResponseEntity<InstanceResponse> instanceResponse = null;
+ if (bpmnInstanceRequest.getK8sRBProfileName() != null) {
+ multicloudInstanceRequest.setCloudRegion(bpmnInstanceRequest.getCloudRegionId());
+ multicloudInstanceRequest.setLabels(bpmnInstanceRequest.getLabels());
+ multicloudInstanceRequest.setOverrideValues(bpmnInstanceRequest.getOverrideValues());
+ multicloudInstanceRequest.setProfileName(bpmnInstanceRequest.getK8sRBProfileName());
+ multicloudInstanceRequest.setRbName(bpmnInstanceRequest.getModelInvariantId());
+ multicloudInstanceRequest.setRbVersion(bpmnInstanceRequest.getModelVersionId());
+ multicloudInstanceRequest.setVfModuleUuid(bpmnInstanceRequest.getVfModuleUUID());
+ } else {
+ logger.error("k8sProfileName should not be null");
+ return instanceResponse;
+ }
+ // String uri = env.getRequiredProperty("multicloud.endpoint"); //TODO:
+ // This needs to be added as well
+ // for configuration
+ String uri = "http://multicloud-k8s:9015"; // TODO: What is the correct uri?
+ String endpoint = UriBuilder.fromUri(uri).path(INSTANCE_CREATE_PATH).build().toString();
+ HttpEntity<?> entity = getHttpEntity(multicloudInstanceRequest);
+ instanceResponse = restTemplate.exchange(endpoint, HttpMethod.POST, entity, InstanceResponse.class);
+ return instanceResponse;
+ } catch (HttpClientErrorException e) {
+ logger.error("Error Calling Multicloud, e");
+ if (HttpStatus.SC_NOT_FOUND == e.getStatusCode().value()) {
+ throw new EntityNotFoundException(e.getResponseBodyAsString());
+ }
+ throw e;
+ } catch (HttpStatusCodeException e) {
+ logger.error("Error in Multicloud, e");
+ String responseString = e.getResponseBodyAsString();
+ InstanceResponse result = new InstanceResponse(responseString.trim());
+ return ResponseEntity.status(e.getStatusCode()).body(result);
+ }
+ }
+
+ public ResponseEntity<InstanceResponse> getInstanceByInstanceId(String instanceId)
+ throws JsonParseException, JsonMappingException, IOException {
+
+ logger.info("CnfAdapterService createInstance called");
+ ResponseEntity<InstanceResponse> instanceResponse = null;
+ try {
+
+ // String uri = env.getRequiredProperty("multicloud.endpoint"); //TODO:
+ // This needs to be added as well
+ // for configuration
+ String uri = "http://multicloud-k8s:9015"; // TODO: What is the correct uri?
+ String path = "/v1/instance/" + instanceId;
+ String endpoint = UriBuilder.fromUri(uri).path(path).build().toString();
+ HttpEntity<?> requestEntity = new HttpEntity<>(getHttpHeaders());
+ instanceResponse = restTemplate.exchange(endpoint, HttpMethod.GET, requestEntity, InstanceResponse.class);
+ return instanceResponse;
+ } catch (HttpClientErrorException e) {
+ logger.error("Error Calling Multicloud, e");
+ if (HttpStatus.SC_NOT_FOUND == e.getStatusCode().value()) {
+ throw new EntityNotFoundException(e.getResponseBodyAsString());
+ }
+ throw e;
+ } catch (HttpStatusCodeException e) {
+ logger.error("Error in Multicloud, e");
+ String responseString = e.getResponseBodyAsString();
+ InstanceResponse result = new InstanceResponse(responseString.trim());
+ return ResponseEntity.status(e.getStatusCode()).body(result);
+ }
+ }
+
+ public ResponseEntity<InstanceStatusResponse> getInstanceStatusByInstanceId(String instanceId)
+ throws JsonParseException, JsonMappingException, IOException {
+
+ logger.info("CnfAdapterService createInstance called");
+ ResponseEntity<InstanceStatusResponse> instanceResponse = null;
+ try {
+
+ // String uri = env.getRequiredProperty("multicloud.endpoint"); //TODO:
+ // This needs to be added as well
+ // for configuration
+ String uri = "http://multicloud-k8s:9015"; // TODO: What is the correct uri?
+ String path = "/v1/instance/" + instanceId + "/status";
+ String endpoint = UriBuilder.fromUri(uri).path(path).build().toString();
+ HttpEntity<?> requestEntity = new HttpEntity<>(getHttpHeaders());
+ instanceResponse =
+ restTemplate.exchange(endpoint, HttpMethod.GET, requestEntity, InstanceStatusResponse.class);
+ return instanceResponse;
+ } catch (HttpClientErrorException e) {
+ logger.error("Error Calling Multicloud, e");
+ if (HttpStatus.SC_NOT_FOUND == e.getStatusCode().value()) {
+ throw new EntityNotFoundException(e.getResponseBodyAsString());
+ }
+ throw e;
+ } catch (HttpStatusCodeException e) {
+ logger.error("Error in Multicloud, e");
+ String responseString = e.getResponseBodyAsString();
+ InstanceStatusResponse result = new InstanceStatusResponse(responseString.trim());
+ return ResponseEntity.status(e.getStatusCode()).body(result);
+ }
+
+ }
+
+ public ResponseEntity<InstanceMiniResponseList> getInstanceByRBNameOrRBVersionOrProfileName(String rbName,
+ String rbVersion, String profileName) throws JsonParseException, JsonMappingException, IOException {
+
+ logger.info("CnfAdapterService createInstance called");
+ ResponseEntity<InstanceMiniResponseList> instanceMiniResponseList = null;
+ try {
+
+ // String uri = env.getRequiredProperty("multicloud.endpoint"); //TODO:
+ // This needs to be added as well
+ // for configuration
+ String uri = "http://multicloud-k8s:9015"; // TODO: What is the correct uri?
+ String path =
+ "/v1/instance" + "?rb-name=" + rbName + "&rb-version=" + rbVersion + "&profile-name=" + profileName;
+ String endPoint = uri + path;
+ HttpEntity<?> requestEntity = new HttpEntity<>(getHttpHeaders());
+ instanceMiniResponseList =
+ restTemplate.exchange(endPoint, HttpMethod.GET, requestEntity, InstanceMiniResponseList.class);
+ return instanceMiniResponseList;
+ } catch (HttpClientErrorException e) {
+ logger.error("Error Calling Multicloud, e");
+ if (HttpStatus.SC_NOT_FOUND == e.getStatusCode().value()) {
+ throw new EntityNotFoundException(e.getResponseBodyAsString());
+ }
+ throw e;
+ } catch (HttpStatusCodeException e) {
+ logger.error("Error in Multicloud, e");
+ String responseString = e.getResponseBodyAsString();
+ InstanceMiniResponseList result = new InstanceMiniResponseList(responseString.trim());
+ return ResponseEntity.status(e.getStatusCode()).body(result);
+ }
+ }
+
+ public ResponseEntity<String> deleteInstanceByInstanceId(String instanceId)
+ throws JsonParseException, JsonMappingException, IOException {
+
+ logger.info("CnfAdapterService createInstance called");
+ ResponseEntity<String> result = null;
+ try {
+
+ // String uri = env.getRequiredProperty("multicloud.endpoint"); //TODO:
+ // This needs to be added as well
+ // for configuration
+ String uri = "http://multicloud-k8s:9015"; // TODO: What is the correct uri?
+ String path = "/v1/instance/" + instanceId;
+ String endpoint = UriBuilder.fromUri(uri).path(path).build().toString();
+ HttpEntity<?> requestEntity = new HttpEntity<>(getHttpHeaders());
+ result = restTemplate.exchange(endpoint, HttpMethod.DELETE, requestEntity, String.class);
+ return result;
+ } catch (HttpClientErrorException e) {
+ logger.error("Error Calling Multicloud, e");
+ if (HttpStatus.SC_NOT_FOUND == e.getStatusCode().value()) {
+ throw new EntityNotFoundException(e.getResponseBodyAsString());
+ }
+ throw e;
+ } catch (HttpStatusCodeException e) {
+ logger.error("Error in Multicloud, e");
+ String responseString = e.getResponseBodyAsString();
+ return ResponseEntity.status(e.getStatusCode()).body(responseString);
+ }
+ }
+
+ protected HttpHeaders getHttpHeaders() {
+ HttpHeaders headers = new HttpHeaders();
+ List<MediaType> acceptableMediaTypes = new ArrayList<>();
+ acceptableMediaTypes.add(MediaType.APPLICATION_JSON);
+ headers.setAccept(acceptableMediaTypes);
+ headers.setContentType(MediaType.APPLICATION_JSON);
+ /*
+ * try { String userCredentials = CryptoUtils.decrypt(env.getRequiredProperty("mso.cnf.adapter.auth"),
+ * env.getRequiredProperty("mso.msoKey")); if (userCredentials != null) { headers.add(HttpHeaders.AUTHORIZATION,
+ * "Basic " + DatatypeConverter.printBase64Binary(userCredentials.getBytes())); } } catch
+ * (GeneralSecurityException e) { logger.error("Security exception", e); }
+ */
+ return headers;
+ }
+
+ protected HttpEntity<?> getHttpEntity(MulticloudInstanceRequest request) {
+ HttpHeaders headers = getHttpHeaders();
+ return new HttpEntity<>(request, headers);
+ }
+}
diff --git a/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/util/CNfAdapterUtil.java b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/util/CNfAdapterUtil.java
new file mode 100644
index 0000000000..25e506c55e
--- /dev/null
+++ b/adapters/mso-cnf-adapter/src/main/java/org/onap/so/adapters/cnf/util/CNfAdapterUtil.java
@@ -0,0 +1,94 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.cnf.util;
+
+import com.fasterxml.jackson.databind.ObjectMapper;
+import java.io.IOException;
+import org.onap.so.adapters.cnf.exceptions.ApplicationException;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+import org.onap.logging.filter.base.ErrorCode;
+import static org.onap.so.logger.LoggingAnchor.THREE;
+import static org.onap.so.logger.MessageEnum.RA_NS_EXC;
+
+public class CNfAdapterUtil {
+
+ private static final Logger LOGGER = LoggerFactory.getLogger(CNfAdapterUtil.class);
+
+ public static final int BAD_REQUEST = 400;
+
+ private static final String UNMARSHAL_FAIL_MSG = "Failed to unmarshal json";
+
+ private static final String MARSHAL_FAIL_MSG = "Failed to marshal object";
+
+ private static final ObjectMapper MAPPER = new ObjectMapper();
+
+ public static class StatusDesc {
+
+ public static final String ALLOCATE_NSS_SUCCESS = "Allocating nss is " + "successful";
+
+ public static final String CREATE_NSS_SUCCESS = "Creating nss is " + "successful";
+
+ public static final String DEALLOCATE_NSS_SUCCESS = "Deallocate nss " + "is successful";
+
+ public static final String ACTIVATE_NSS_SUCCESS = "Activate nss " + "is successful";
+
+ public static final String DEACTIVATE_NSS_SUCCESS = "Deactivate nss " + "is successful";
+
+ public static final String QUERY_JOB_STATUS_FAILED = "Query job " + "status failed";
+
+ public static final String QUERY_JOB_STATUS_SUCCESS = "Query job " + "status is successful";
+
+ private StatusDesc() {
+
+ }
+ }
+
+ private CNfAdapterUtil() {
+
+ }
+
+ public static void assertObjectNotNull(Object object) throws ApplicationException {
+ if (null == object) {
+ LOGGER.error("Object is null.");
+ throw new ApplicationException(BAD_REQUEST, "An object is null.");
+ }
+ }
+
+ public static <T> T unMarshal(String jsonstr, Class<T> type) throws ApplicationException {
+ try {
+ return MAPPER.readValue(jsonstr, type);
+ } catch (IOException e) {
+ LOGGER.error(THREE, RA_NS_EXC.toString(), ErrorCode.BusinessProcessError.getValue(), UNMARSHAL_FAIL_MSG, e);
+ throw new ApplicationException(BAD_REQUEST, UNMARSHAL_FAIL_MSG);
+ }
+ }
+
+ public static String marshal(Object srcObj) throws ApplicationException {
+ try {
+ return MAPPER.writerWithDefaultPrettyPrinter().writeValueAsString(srcObj);
+ } catch (IOException e) {
+ LOGGER.error(THREE, RA_NS_EXC.toString(), ErrorCode.BusinessProcessError.getValue(), MARSHAL_FAIL_MSG, e);
+ throw new ApplicationException(BAD_REQUEST, MARSHAL_FAIL_MSG);
+ }
+ }
+
+}
diff --git a/adapters/mso-cnf-adapter/src/main/resources/META-INF/services/org.onap.so.client.RestProperties b/adapters/mso-cnf-adapter/src/main/resources/META-INF/services/org.onap.so.client.RestProperties
index f93ec63f37..bccd43aea7 100644
--- a/adapters/mso-cnf-adapter/src/main/resources/META-INF/services/org.onap.so.client.RestProperties
+++ b/adapters/mso-cnf-adapter/src/main/resources/META-INF/services/org.onap.so.client.RestProperties
@@ -1 +1 @@
-org.onap.so.adapters.nssmf.extclients.aai.AaiClientPropertiesImpl \ No newline at end of file
+org.onap.so.adapters.cnf.extclients.aai.AaiClientPropertiesImpl \ No newline at end of file
diff --git a/adapters/mso-cnf-adapter/src/main/resources/application.yaml b/adapters/mso-cnf-adapter/src/main/resources/application.yaml
index 30b1b626a5..5a9adbfd04 100644
--- a/adapters/mso-cnf-adapter/src/main/resources/application.yaml
+++ b/adapters/mso-cnf-adapter/src/main/resources/application.yaml
@@ -38,14 +38,14 @@
# naming-strategy: org.hibernate.cfg.ImprovedNamingStrategy
# enable-lazy-load-no-trans: true
server:
- port: 9013
+ port: 9012
tomcat:
max-threads: 50
#mso:
# key: 07a7159d3bf51a0e53be7a8f89699be7
# site-name: localSite
-# logPath: ./logs/nssmf
+# logPath: ./logs/cnf
# msb-ip: msb-iag.{{ include "common.namespace" . }}
# msb-port: 80
# adapters:
diff --git a/adapters/mso-cnf-adapter/src/test/java/org/onap/so/adapters/cnf/CnfAdapterRestTest.java b/adapters/mso-cnf-adapter/src/test/java/org/onap/so/adapters/cnf/CnfAdapterRestTest.java
new file mode 100644
index 0000000000..ee7a771034
--- /dev/null
+++ b/adapters/mso-cnf-adapter/src/test/java/org/onap/so/adapters/cnf/CnfAdapterRestTest.java
@@ -0,0 +1,63 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+
+
+package org.onap.so.adapters.cnf;
+
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertNotNull;
+import java.util.HashMap;
+import java.util.Map;
+import org.junit.Test;
+import org.junit.runner.RunWith;
+import org.mockito.InjectMocks;
+import org.onap.so.adapters.cnf.model.BpmnInstanceRequest;
+import org.onap.so.adapters.cnf.rest.CnfAdapterRest;
+import org.springframework.test.context.junit4.SpringRunner;
+
+@RunWith(SpringRunner.class)
+public class CnfAdapterRestTest {
+
+ @InjectMocks
+ CnfAdapterRest cnfAdapterRest;
+
+ @Test
+ public void createInstanceTest() throws Exception {
+
+ Map<String, String> labels = new HashMap<String, String>();
+ labels.put("custom-label-1", "label1");
+ Map<String, String> overrideValues = new HashMap<String, String>();
+ labels.put("image.tag", "latest");
+ labels.put("dcae_collector_ip", "1.2.3.4");
+ BpmnInstanceRequest bpmnInstanceRequest = new BpmnInstanceRequest();
+ bpmnInstanceRequest.setCloudRegionId("v1");
+ bpmnInstanceRequest.setLabels(labels);
+ bpmnInstanceRequest.setModelInvariantId("krd");
+ bpmnInstanceRequest.setModelVersionId("p1");
+ bpmnInstanceRequest.setOverrideValues(overrideValues);
+ bpmnInstanceRequest.setVfModuleUUID("20200824");
+
+ String mockedResponse = "K8sRBProfileName is required";
+ String actualResponse = cnfAdapterRest.createInstance(bpmnInstanceRequest);
+ assertNotNull(actualResponse);
+ assertEquals(mockedResponse, actualResponse);
+ }
+
+}
+*/
diff --git a/adapters/mso-cnf-adapter/src/test/java/org/onap/so/adapters/cnf/rest/CnfAdapterRestTest.java b/adapters/mso-cnf-adapter/src/test/java/org/onap/so/adapters/cnf/rest/CnfAdapterRestTest.java
new file mode 100644
index 0000000000..df21a4212f
--- /dev/null
+++ b/adapters/mso-cnf-adapter/src/test/java/org/onap/so/adapters/cnf/rest/CnfAdapterRestTest.java
@@ -0,0 +1,161 @@
+
+/*
+ * ============LICENSE_START======================================================= ONAP - SO
+ * ================================================================================ Copyright (C) 2020 Huawei
+ * Technologies Co., Ltd. All rights reserved.
+ * ================================================================================ Licensed under the Apache License,
+ * Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy
+ * of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on
+ * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the
+ * specific language governing permissions and limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.cnf.rest;
+
+
+import java.util.ArrayList;
+import java.util.HashMap;
+import java.util.List;
+import java.util.Map;
+import org.junit.Assert;
+import org.junit.Test;
+import org.junit.runner.RunWith;
+import org.mockito.InjectMocks;
+import org.mockito.Mock;
+import org.mockito.Mockito;
+import org.onap.so.adapters.cnf.model.BpmnInstanceRequest;
+import org.onap.so.adapters.cnf.model.InstanceMiniResponse;
+import org.onap.so.adapters.cnf.model.InstanceMiniResponseList;
+import org.onap.so.adapters.cnf.model.InstanceResponse;
+import org.onap.so.adapters.cnf.model.InstanceStatusResponse;
+import org.onap.so.adapters.cnf.model.MulticloudInstanceRequest;
+import org.onap.so.adapters.cnf.model.Resource;
+import org.onap.so.adapters.cnf.service.CnfAdapterService;
+import org.springframework.http.HttpStatus;
+import org.springframework.http.ResponseEntity;
+import org.springframework.test.context.junit4.SpringRunner;
+
+
+@RunWith(SpringRunner.class)
+public class CnfAdapterRestTest {
+
+ @InjectMocks
+ CnfAdapterRest cnfAdapterRest;
+
+ @Mock
+ CnfAdapterService cnfAdapterService;
+
+ @Mock
+ ResponseEntity<InstanceResponse> createInstanceResponse;
+
+ @Mock
+ ResponseEntity<InstanceMiniResponseList> instacneMiniResponseList;
+
+ @Mock
+ ResponseEntity<InstanceStatusResponse> instanceStatusResponse;
+
+ @Test
+ public void healthCheckTest() throws Exception {
+
+ ResponseEntity<String> response = new ResponseEntity<String>(HttpStatus.OK);
+ CnfAdapterService cnfAdapterService = Mockito.mock(CnfAdapterService.class);
+ Mockito.when(cnfAdapterService.healthCheck()).thenReturn(response);
+ cnfAdapterRest.healthCheck();
+ Assert.assertNotNull(response);
+ Assert.assertEquals(HttpStatus.OK, response.getStatusCode());
+ }
+
+ @Test
+ public void createInstanceTest() throws Exception {
+
+ Map<String, String> labels = new HashMap<String, String>();
+ labels.put("custom-label-1", "label1");
+ Map<String, String> overrideValues = new HashMap<String, String>();
+ labels.put("image.tag", "latest");
+ labels.put("dcae_collector_ip", "1.2.3.4");
+ BpmnInstanceRequest bpmnInstanceRequest = new BpmnInstanceRequest();
+ bpmnInstanceRequest.setCloudRegionId("v1");
+ bpmnInstanceRequest.setLabels(labels);
+ bpmnInstanceRequest.setModelInvariantId("krd");
+ bpmnInstanceRequest.setModelVersionId("p1");
+ bpmnInstanceRequest.setOverrideValues(overrideValues);
+ bpmnInstanceRequest.setVfModuleUUID("20200824");
+ List<Resource> resourceList = new ArrayList<Resource>();
+ InstanceResponse instanceResponse = new InstanceResponse(HttpStatus.CREATED.toString());
+ instanceResponse.setId("123");
+ instanceResponse.setNamespace("testNamespace");
+ instanceResponse.setRequest(new MulticloudInstanceRequest());
+ instanceResponse.setResources(resourceList);
+ createInstanceResponse = new ResponseEntity<InstanceResponse>(instanceResponse, HttpStatus.CREATED);
+ CnfAdapterService cnfAdapterService = Mockito.mock(CnfAdapterService.class);
+ Mockito.when(cnfAdapterService.createInstance(bpmnInstanceRequest)).thenReturn(createInstanceResponse);
+ cnfAdapterRest.createInstance(bpmnInstanceRequest);
+ Assert.assertNotNull(createInstanceResponse);
+ Assert.assertEquals(HttpStatus.CREATED, createInstanceResponse.getStatusCode());
+ }
+
+ @Test
+ public void getInstanceByInstanceIdTest() throws Exception {
+
+ String instanceId = "123";
+ createInstanceResponse = new ResponseEntity<InstanceResponse>(HttpStatus.OK);
+ CnfAdapterService cnfAdapterService = Mockito.mock(CnfAdapterService.class);
+ Mockito.when(cnfAdapterService.getInstanceByInstanceId(instanceId)).thenReturn(createInstanceResponse);
+ cnfAdapterRest.getInstanceByInstanceId(instanceId);
+ Assert.assertNotNull(createInstanceResponse);
+ Assert.assertEquals(HttpStatus.OK, createInstanceResponse.getStatusCode());
+ }
+
+ @Test
+ public void deleteInstanceByInstanceIdTest() throws Exception {
+
+ String instanceId = "123";
+ ResponseEntity<String> response = new ResponseEntity<String>(HttpStatus.OK);
+ CnfAdapterService cnfAdapterService = Mockito.mock(CnfAdapterService.class);
+ Mockito.when(cnfAdapterService.deleteInstanceByInstanceId(instanceId)).thenReturn(response);
+ cnfAdapterRest.deleteInstanceByInstanceId(instanceId);
+ Assert.assertNotNull(response);
+ Assert.assertEquals(HttpStatus.OK, response.getStatusCode());
+ }
+
+ @Test
+ public void getInstanceStatusByInstanceIdTest() throws Exception {
+
+ String instanceId = "123";
+ instanceStatusResponse = new ResponseEntity<InstanceStatusResponse>(HttpStatus.OK);
+ CnfAdapterService cnfAdapterService = Mockito.mock(CnfAdapterService.class);
+ Mockito.when(cnfAdapterService.getInstanceStatusByInstanceId(instanceId)).thenReturn(instanceStatusResponse);
+ cnfAdapterRest.getInstanceStatusByInstanceId(instanceId);
+ Assert.assertNotNull(instanceStatusResponse);
+ Assert.assertEquals(HttpStatus.OK, instanceStatusResponse.getStatusCode());
+ }
+
+ @Test
+ public void getInstanceByRBNameOrRBVersionOrProfileNameTest() throws Exception {
+
+ String rbName = "xyz";
+ String rbVersion = "v1";
+ String profileName = "p1";
+ InstanceMiniResponse instanceMiniResponse = new InstanceMiniResponse(HttpStatus.OK.toString());
+ List<InstanceMiniResponse> instancList = new ArrayList<InstanceMiniResponse>();
+ instancList.add(instanceMiniResponse);
+ InstanceMiniResponseList instanceMiniRespList = new InstanceMiniResponseList(HttpStatus.OK.toString());
+ instanceMiniRespList.setInstancList(instancList);
+ instanceMiniRespList.setErrorMsg(HttpStatus.OK.toString());
+ ResponseEntity<InstanceMiniResponseList> respone =
+ new ResponseEntity<InstanceMiniResponseList>(instanceMiniRespList, HttpStatus.OK);
+ CnfAdapterService cnfAdapterService = Mockito.mock(CnfAdapterService.class);
+ Mockito.when(cnfAdapterService.getInstanceByRBNameOrRBVersionOrProfileName(rbName, rbVersion, profileName))
+ .thenReturn(instacneMiniResponseList);
+ cnfAdapterRest.getInstanceByRBNameOrRBVersionOrProfileName(rbName, rbVersion, profileName);
+ Assert.assertNotNull(instacneMiniResponseList);
+ Assert.assertEquals(HttpStatus.OK.toString(), instanceMiniRespList.getErrorMsg());
+ }
+
+}
+
diff --git a/adapters/mso-cnf-adapter/src/test/java/org/onap/so/adapters/cnf/service/CnfAdapterServiceTest.java b/adapters/mso-cnf-adapter/src/test/java/org/onap/so/adapters/cnf/service/CnfAdapterServiceTest.java
new file mode 100644
index 0000000000..0d3d8598bb
--- /dev/null
+++ b/adapters/mso-cnf-adapter/src/test/java/org/onap/so/adapters/cnf/service/CnfAdapterServiceTest.java
@@ -0,0 +1,139 @@
+package org.onap.so.adapters.cnf.service;
+
+import javax.ws.rs.InternalServerErrorException;
+import org.junit.Assert;
+import org.junit.Test;
+import org.junit.runner.RunWith;
+import org.mockito.InjectMocks;
+import org.mockito.Matchers;
+import org.mockito.Mock;
+import org.mockito.Mockito;
+import org.onap.so.adapters.cnf.model.BpmnInstanceRequest;
+import org.onap.so.adapters.cnf.model.InstanceMiniResponseList;
+import org.onap.so.adapters.cnf.model.InstanceResponse;
+import org.onap.so.adapters.cnf.model.InstanceStatusResponse;
+import org.springframework.http.HttpEntity;
+import org.springframework.http.HttpMethod;
+import org.springframework.http.HttpStatus;
+import org.springframework.http.ResponseEntity;
+import org.springframework.test.context.junit4.SpringRunner;
+import org.springframework.web.client.RestTemplate;
+
+@RunWith(SpringRunner.class)
+public class CnfAdapterServiceTest {
+
+ @InjectMocks
+ CnfAdapterService cnfAdapterService;
+
+ @Mock
+ ResponseEntity<InstanceResponse> createInstanceResponse;
+
+ @Mock
+ ResponseEntity<InstanceMiniResponseList> instacneMiniResponseList;
+
+ @Mock
+ ResponseEntity<InstanceStatusResponse> instanceStatusResponse;
+
+ @Mock
+ private RestTemplate restTemplate;
+
+ @Test
+ public void healthCheckTest() throws Exception {
+
+ ResponseEntity<String> response = new ResponseEntity<String>(HttpStatus.OK);
+
+ Mockito.when(restTemplate.exchange(Matchers.anyString(), Matchers.any(HttpMethod.class),
+ Matchers.<HttpEntity<?>>any(), Matchers.<Class<String>>any())).thenReturn(response);
+
+ ResponseEntity<String> actualResponse = cnfAdapterService.healthCheck();
+ Assert.assertNotNull(actualResponse);
+ Assert.assertEquals(HttpStatus.OK, actualResponse.getStatusCode());
+
+ }
+
+ @Test
+ public void createInstanceTest() throws Exception {
+
+ ResponseEntity<InstanceResponse> response = new ResponseEntity<InstanceResponse>(HttpStatus.OK);
+ BpmnInstanceRequest bpmnInstanceRequest = new BpmnInstanceRequest();
+ bpmnInstanceRequest.setK8sRBProfileName("k8sRBProfileName");
+ Mockito.when(restTemplate.exchange(Matchers.anyString(), Matchers.any(HttpMethod.class),
+ Matchers.<HttpEntity<?>>any(), Matchers.<Class<InstanceResponse>>any())).thenReturn(response);
+
+ ResponseEntity<InstanceResponse> actualResponse = cnfAdapterService.createInstance(bpmnInstanceRequest);
+ Assert.assertNotNull(response);
+ Assert.assertEquals(actualResponse.getStatusCode(), response.getStatusCode());
+
+ }
+
+ @Test
+ public void createInstanceExceptionTest() throws Exception {
+
+ BpmnInstanceRequest bpmnInstanceRequest = new BpmnInstanceRequest();
+ ResponseEntity<InstanceResponse> response = cnfAdapterService.createInstance(bpmnInstanceRequest);
+ Assert.assertNull(response);
+
+ }
+
+ @Test
+ public void getInstanceByInstanceIdTest() throws Exception {
+
+ ResponseEntity<InstanceResponse> response = new ResponseEntity<InstanceResponse>(HttpStatus.OK);
+ String instanceId = "123";
+ Mockito.when(restTemplate.exchange(Matchers.anyString(), Matchers.any(HttpMethod.class),
+ Matchers.<HttpEntity<?>>any(), Matchers.<Class<InstanceResponse>>any())).thenReturn(response);
+
+ ResponseEntity<InstanceResponse> actualResponse = cnfAdapterService.getInstanceByInstanceId(instanceId);
+ Assert.assertNotNull(actualResponse);
+ Assert.assertEquals(HttpStatus.OK, actualResponse.getStatusCode());
+
+ }
+
+ @Test
+ public void getInstanceStatusByInstanceIdTest() throws Exception {
+
+ ResponseEntity<InstanceStatusResponse> response = new ResponseEntity<InstanceStatusResponse>(HttpStatus.OK);
+ String instanceId = "123";
+ Mockito.when(restTemplate.exchange(Matchers.anyString(), Matchers.any(HttpMethod.class),
+ Matchers.<HttpEntity<?>>any(), Matchers.<Class<InstanceStatusResponse>>any())).thenReturn(response);
+
+ ResponseEntity<InstanceStatusResponse> actualResponse =
+ cnfAdapterService.getInstanceStatusByInstanceId(instanceId);
+ Assert.assertNotNull(actualResponse);
+ Assert.assertEquals(HttpStatus.OK, response.getStatusCode());
+
+ }
+
+ @Test
+ public void getInstanceByRBNameOrRBVersionOrProfileNameTest() throws Exception {
+
+ ResponseEntity<InstanceMiniResponseList> response = new ResponseEntity<InstanceMiniResponseList>(HttpStatus.OK);
+ String rbName = "xyz";
+ String rbVersion = "v1";
+ String profileName = "p1";
+
+ Mockito.when(restTemplate.exchange(Matchers.anyString(), Matchers.any(HttpMethod.class),
+ Matchers.<HttpEntity<?>>any(), Matchers.<Class<InstanceMiniResponseList>>any())).thenReturn(response);
+
+ ResponseEntity<InstanceMiniResponseList> actualResponse =
+ cnfAdapterService.getInstanceByRBNameOrRBVersionOrProfileName(rbName, rbVersion, profileName);
+ Assert.assertNotNull(actualResponse);
+ Assert.assertEquals(HttpStatus.OK, actualResponse.getStatusCode());
+
+ }
+
+ @Test
+ public void deleteInstanceByInstanceIdTest() throws Exception {
+
+ ResponseEntity<String> response = new ResponseEntity<String>(HttpStatus.OK);
+ String instanceId = "123";
+ Mockito.when(restTemplate.exchange(Matchers.anyString(), Matchers.any(HttpMethod.class),
+ Matchers.<HttpEntity<?>>any(), Matchers.<Class<String>>any())).thenReturn(response);
+
+ ResponseEntity<String> actualResponse = cnfAdapterService.deleteInstanceByInstanceId(instanceId);
+ Assert.assertNotNull(response);
+ Assert.assertEquals(HttpStatus.OK, response.getStatusCode());
+
+ }
+
+}
diff --git a/adapters/mso-nssmf-adapter/pom.xml b/adapters/mso-nssmf-adapter/pom.xml
index db791826c3..45fe77eecc 100644
--- a/adapters/mso-nssmf-adapter/pom.xml
+++ b/adapters/mso-nssmf-adapter/pom.xml
@@ -162,7 +162,6 @@
<dependency>
<groupId>org.projectlombok</groupId>
<artifactId>lombok</artifactId>
- <version>1.18.2</version>
</dependency>
</dependencies>
</project>
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/MSONssmfApplication.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/MSONssmfApplication.java
index cd011e6437..83a09dc343 100644
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/MSONssmfApplication.java
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/MSONssmfApplication.java
@@ -20,6 +20,7 @@
package org.onap.so.adapters.nssmf;
+
import org.springframework.boot.SpringApplication;
import org.springframework.boot.autoconfigure.SpringBootApplication;
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/annotation/ServiceLogger.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/annotation/ServiceLogger.java
new file mode 100644
index 0000000000..1de29bcc2b
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/annotation/ServiceLogger.java
@@ -0,0 +1,36 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.annotation;
+
+
+import java.lang.annotation.ElementType;
+import java.lang.annotation.Retention;
+import java.lang.annotation.RetentionPolicy;
+import java.lang.annotation.Target;
+
+@Target({ElementType.METHOD, ElementType.TYPE})
+@Retention(RetentionPolicy.RUNTIME)
+public @interface ServiceLogger {
+
+ String value() default "";
+
+ boolean ignore() default false;
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/config/NssmfAdapterConfig.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/config/NssmfAdapterConfig.java
new file mode 100644
index 0000000000..6a592448a6
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/config/NssmfAdapterConfig.java
@@ -0,0 +1,36 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.config;
+
+import lombok.Getter;
+import org.springframework.beans.factory.annotation.Value;
+import org.springframework.context.annotation.Configuration;
+
+@Configuration
+@Getter
+public class NssmfAdapterConfig {
+
+ @Value("${mso.infra.endpoint}")
+ private String infraEndpoint;
+
+ @Value("${mso.infra.auth}")
+ private String infraAuth;
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/RequestDbConfig.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/config/RequestDbConfig.java
index 484f7624aa..dcb5d6198c 100644
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/RequestDbConfig.java
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/config/RequestDbConfig.java
@@ -18,7 +18,7 @@
* ============LICENSE_END=========================================================
*/
-package org.onap.so.adapters.nssmf;
+package org.onap.so.adapters.nssmf.config;
import javax.persistence.EntityManagerFactory;
import javax.sql.DataSource;
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/WebSecurityConfig.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/config/WebSecurityConfig.java
index 1522ca9c6d..dfb2b61978 100644
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/WebSecurityConfig.java
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/config/WebSecurityConfig.java
@@ -18,7 +18,7 @@
* ============LICENSE_END=========================================================
*/
-package org.onap.so.adapters.nssmf;
+package org.onap.so.adapters.nssmf.config;
import org.springframework.context.annotation.Configuration;
import org.springframework.security.config.annotation.web.builders.HttpSecurity;
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/consts/NssmfAdapterConsts.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/consts/NssmfAdapterConsts.java
new file mode 100644
index 0000000000..28789f2a98
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/consts/NssmfAdapterConsts.java
@@ -0,0 +1,187 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.consts;
+
+import org.onap.so.adapters.nssmf.entity.NssmfUrlInfo;
+import org.onap.so.adapters.nssmf.enums.ActionType;
+import org.onap.so.adapters.nssmf.enums.ExecutorType;
+import org.onap.so.adapters.nssmf.enums.HttpMethod;
+import org.onap.so.beans.nsmf.NetworkType;
+import java.util.HashMap;
+import java.util.Map;
+
+public class NssmfAdapterConsts {
+
+ public final static String ONAP_INTERNAL_TAG = "ONAP_internal";
+
+ public final static String CURRENT_INTERNAL_NSSMF_API_VERSION = "v1";
+
+ private static Map<String, NssmfUrlInfo> urlInfoMap = new HashMap<>();
+
+ private final static String EXTERNAL_CN_ALLOCATE_URL = "/api/rest/provMns/{apiVersion}/NSS/SliceProfiles";
+
+ private final static String EXTERNAL_TN_ALLOCATE_URL = "/api/rest/provMns/{apiVersion}/tn/NSS/SliceProfiles";
+
+ private final static String EXTERNAL_AN_ALLOCATE_URL = "/ObjectManagement/NSS/SliceProfiles";
+
+ private final static String INTERNAL_ALLOCATE_URL = "/onap/so/infra/3gppservices/{apiVersion}/allocate";
+
+ private final static String EXTERNAL_CN_DEALLOCATE_URL =
+ "/api/rest/provMns/{apiVersion}/NSS/SliceProfiles/{sliceProfileId}";
+
+ private final static String EXTERNAL_TN_DEALLOCATE_URL =
+ "/api/rest/provMns/{apiVersion}/tn/NSS/SliceProfiles/{sliceProfileId}";
+
+ private final static String EXTERNAL_AN_DEALLOCATE_URL = "/ObjectManagement/NSS/SliceProfiles/{sliceProfileId}";
+
+ private final static String INTERNAL_DEALLOCATE_URL = "/onap/so/infra/3gppservices/{apiVersion}/deAllocate";
+
+ private final static String EXTERNAL_CN_ACTIVATE_URL = "/api/rest/provMns/{apiVersion}/NSS/{snssai}/activation";
+
+ private final static String EXTERNAL_TN_ACTIVATE_URL = "/api/rest/provMns/{apiVersion}/tn/NSS/{snssai}/activation";
+
+ private final static String EXTERNAL_AN_ACTIVATE_URL = "/api/rest/provMns/{apiVersion}/an/NSS/{snssai}/activations";
+
+ private final static String INTERNAL_ACTIVATE_URL = "/onap/so/infra/3gppservices/{apiVersion}/activate";
+
+ private final static String EXTERNAL_CN_DEACTIVATE_URL = "/api/rest/provMns/{apiVersion}/NSS/{snssai}/deactivation";
+
+ private final static String EXTERNAL_TN_DEACTIVATE_URL =
+ "/api/rest/provMns/{apiVersion}/tn/NSS/{snssai}/deactivation";
+
+ private final static String EXTERNAL_AN_DEACTIVATE_URL =
+ "/api/rest/provMns/{apiVersion}/an/NSS/{snssai}/deactivation";
+
+ private final static String INTERNAL_DEACTIVATE_URL = "/onap/so/infra/3gppservices/{apiVersion}/deActivate";
+
+ //
+ private final static String EXTERNAL_CN_TERMINATE_URL =
+ "/api/rest/provMns/{apiVersion}/NSS/SliceProfiles/{SliceProfileId}";
+
+ private final static String EXTERNAL_TN_TERMINATE_URL =
+ "/api/rest/provMns/{apiVersion}/tn/NSS/SliceProfiles/{SliceProfileId}";
+
+ private final static String EXTERNAL_AN_TERMINATE_URL =
+ "/api/rest/provMns/{apiVersion}/an/NSS/SliceProfiles/{SliceProfileId}";
+
+ private final static String INTERNAL_TERMINATE_URL = "/onap/so/infra/3gppservices/{apiVersion}/terminate";
+
+ //
+ private final static String EXTERNAL_AN_MODIFY_URL =
+ "/api/rest/provMns/{apiVersion}/an/NSS/SliceProfiles/{SliceProfileId}";
+
+ private final static String INTERNAL_MODIFY_URL = "/onap/so/infra/3gppservices/{apiVersion}/modify";
+
+ //
+ private final static String EXTERNAL_QUERY_JOB_STATUS =
+ "/api/rest/provMns/{apiVersion}/NSS/jobs/{jobId}?responseId={responseId}";
+
+ private final static String INTERNAL_QUERY_SUB_NET_CAPABILITY =
+ "/onap/so/infra/3gppservices/{apiVersion}/subnetCapabilityQuery";
+
+ static {
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.ACCESS, ActionType.ALLOCATE),
+ new NssmfUrlInfo(EXTERNAL_AN_ALLOCATE_URL, HttpMethod.POST));
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.TRANSPORT, ActionType.ALLOCATE),
+ new NssmfUrlInfo(EXTERNAL_TN_ALLOCATE_URL, HttpMethod.POST));
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.CORE, ActionType.ALLOCATE),
+ new NssmfUrlInfo(EXTERNAL_CN_ALLOCATE_URL, HttpMethod.POST));
+ urlInfoMap.put(generateKey(ExecutorType.INTERNAL, null, ActionType.ALLOCATE),
+ new NssmfUrlInfo(INTERNAL_ALLOCATE_URL, HttpMethod.POST));
+
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.ACCESS, ActionType.DEALLOCATE),
+ new NssmfUrlInfo(EXTERNAL_AN_DEALLOCATE_URL, HttpMethod.DELETE));
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.TRANSPORT, ActionType.DEALLOCATE),
+ new NssmfUrlInfo(EXTERNAL_TN_DEALLOCATE_URL, HttpMethod.DELETE));
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.CORE, ActionType.DEALLOCATE),
+ new NssmfUrlInfo(EXTERNAL_CN_DEALLOCATE_URL, HttpMethod.DELETE));
+ urlInfoMap.put(generateKey(ExecutorType.INTERNAL, null, ActionType.DEALLOCATE),
+ new NssmfUrlInfo(INTERNAL_DEALLOCATE_URL, HttpMethod.DELETE));
+
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.ACCESS, ActionType.ACTIVATE),
+ new NssmfUrlInfo(EXTERNAL_AN_ACTIVATE_URL, HttpMethod.PUT));
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.TRANSPORT, ActionType.ACTIVATE),
+ new NssmfUrlInfo(EXTERNAL_TN_ACTIVATE_URL, HttpMethod.PUT));
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.CORE, ActionType.ACTIVATE),
+ new NssmfUrlInfo(EXTERNAL_CN_ACTIVATE_URL, HttpMethod.PUT));
+ urlInfoMap.put(generateKey(ExecutorType.INTERNAL, null, ActionType.ACTIVATE),
+ new NssmfUrlInfo(INTERNAL_ACTIVATE_URL, HttpMethod.PUT));
+
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.ACCESS, ActionType.DEACTIVATE),
+ new NssmfUrlInfo(EXTERNAL_AN_DEACTIVATE_URL, HttpMethod.PUT));
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.TRANSPORT, ActionType.DEACTIVATE),
+ new NssmfUrlInfo(EXTERNAL_TN_DEACTIVATE_URL, HttpMethod.PUT));
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.CORE, ActionType.DEACTIVATE),
+ new NssmfUrlInfo(EXTERNAL_CN_DEACTIVATE_URL, HttpMethod.PUT));
+ urlInfoMap.put(generateKey(ExecutorType.INTERNAL, null, ActionType.DEACTIVATE),
+ new NssmfUrlInfo(INTERNAL_DEACTIVATE_URL, HttpMethod.PUT));
+
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.ACCESS, ActionType.TERMINATE),
+ new NssmfUrlInfo(EXTERNAL_AN_TERMINATE_URL, HttpMethod.DELETE));
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.TRANSPORT, ActionType.TERMINATE),
+ new NssmfUrlInfo(EXTERNAL_TN_TERMINATE_URL, HttpMethod.DELETE));
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.CORE, ActionType.TERMINATE),
+ new NssmfUrlInfo(EXTERNAL_CN_TERMINATE_URL, HttpMethod.DELETE));
+ urlInfoMap.put(generateKey(ExecutorType.INTERNAL, null, ActionType.TERMINATE),
+ new NssmfUrlInfo(INTERNAL_TERMINATE_URL, HttpMethod.DELETE));
+
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.ACCESS, ActionType.MODIFY),
+ new NssmfUrlInfo(EXTERNAL_AN_MODIFY_URL, HttpMethod.PUT));
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.CORE, ActionType.MODIFY),
+ new NssmfUrlInfo(EXTERNAL_CN_ALLOCATE_URL, HttpMethod.PUT));
+ urlInfoMap.put(generateKey(ExecutorType.INTERNAL, null, ActionType.MODIFY),
+ new NssmfUrlInfo(INTERNAL_MODIFY_URL, HttpMethod.PUT));
+
+
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.CORE, ActionType.QUERY_JOB_STATUS),
+ new NssmfUrlInfo(EXTERNAL_QUERY_JOB_STATUS, HttpMethod.GET));
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.ACCESS, ActionType.QUERY_JOB_STATUS),
+ new NssmfUrlInfo(EXTERNAL_QUERY_JOB_STATUS, HttpMethod.GET));
+ urlInfoMap.put(generateKey(ExecutorType.EXTERNAL, NetworkType.TRANSPORT, ActionType.QUERY_JOB_STATUS),
+ new NssmfUrlInfo(EXTERNAL_QUERY_JOB_STATUS, HttpMethod.GET));
+
+ urlInfoMap.put(generateKey(ExecutorType.INTERNAL, null, ActionType.QUERY_SUB_NET_CAPABILITY),
+ new NssmfUrlInfo(INTERNAL_QUERY_SUB_NET_CAPABILITY, HttpMethod.POST));
+ }
+
+ /**
+ * get nssmf url info from consts
+ *
+ * @param executorType {@link ExecutorType}
+ * @param networkType {@link NetworkType}
+ * @param actionType {@link ActionType}
+ * @return {@link NssmfUrlInfo}
+ */
+ public static NssmfUrlInfo getNssmfUrlInfo(ExecutorType executorType, NetworkType networkType,
+ ActionType actionType) {
+
+ return urlInfoMap.get(generateKey(executorType, networkType, actionType));
+ }
+
+ private static String generateKey(ExecutorType executorType, NetworkType networkType, ActionType actionType) {
+ if (ExecutorType.EXTERNAL.equals(executorType)) {
+ return executorType.name() + "_" + networkType.name() + "_" + actionType.name();
+ }
+ return executorType.name() + "_" + actionType.name();
+ }
+
+
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/controller/NssmfAdapterController.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/controller/NssmfAdapterController.java
new file mode 100644
index 0000000000..02d7468a0c
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/controller/NssmfAdapterController.java
@@ -0,0 +1,57 @@
+package org.onap.so.adapters.nssmf.controller;
+
+import org.onap.so.adapters.nssmf.service.NssmfManagerService;
+import org.onap.so.beans.nsmf.*;
+import org.springframework.beans.factory.annotation.Autowired;
+import org.springframework.http.ResponseEntity;
+import org.springframework.web.bind.annotation.*;
+import static javax.ws.rs.core.MediaType.APPLICATION_JSON;
+
+@RestController
+@RequestMapping(value = "/api/rest/provMns/v1", produces = {APPLICATION_JSON}, consumes = {APPLICATION_JSON})
+public class NssmfAdapterController {
+
+ @Autowired
+ private NssmfManagerService nssmfManagerService;
+
+ @PostMapping(value = "/NSS/SliceProfiles")
+ public ResponseEntity allocateNssi(@RequestBody NssmfAdapterNBIRequest nbiRequest) {
+ return nssmfManagerService.allocateNssi(nbiRequest);
+ }
+
+ @PostMapping(value = "/NSS/SliceProfiles/{sliceProfileId}")
+ public ResponseEntity deAllocateNssi(@RequestBody NssmfAdapterNBIRequest nbiRequest,
+ @PathVariable("sliceProfileId") final String sliceProfileId) {
+ return nssmfManagerService.deAllocateNssi(nbiRequest, sliceProfileId);
+ }
+
+
+ @PostMapping(value = "/NSS/{snssai}/activation")
+ public ResponseEntity activateNssi(@RequestBody NssmfAdapterNBIRequest nbiRequest,
+ @PathVariable("snssai") String snssai) {
+ return nssmfManagerService.activateNssi(nbiRequest, snssai);
+ }
+
+ @PostMapping(value = "/NSS/{snssai}/deactivation")
+ public ResponseEntity deactivateNssi(@RequestBody NssmfAdapterNBIRequest nbiRequest,
+ @PathVariable("snssai") String snssai) {
+ return nssmfManagerService.deActivateNssi(nbiRequest, snssai);
+ }
+
+ @PostMapping(value = "/NSS/jobs/{jobId}")
+ public ResponseEntity queryJobStatus(@RequestBody NssmfAdapterNBIRequest nbiRequest,
+ @PathVariable("jobId") String jobId) {
+ return nssmfManagerService.queryJobStatus(nbiRequest, jobId);
+ }
+
+ @PostMapping(value = "/NSS/NSSISelectionCapability")
+ public ResponseEntity queryNSSISelectionCapability(@RequestBody NssmfAdapterNBIRequest nbiRequest) {
+ return nssmfManagerService.queryNSSISelectionCapability(nbiRequest);
+ }
+
+ @PostMapping(value = "/NSS/subnetCapabilityQuery")
+ public ResponseEntity querySubnetCapability(@RequestBody NssmfAdapterNBIRequest nbiRequest) {
+ return nssmfManagerService.querySubnetCapability(nbiRequest);
+ }
+
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/ErrorResponse.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/ErrorResponse.java
new file mode 100644
index 0000000000..a8653f8d73
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/ErrorResponse.java
@@ -0,0 +1,63 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.entity;
+
+public class ErrorResponse {
+
+ private int status;
+
+ private String error;
+
+ private String message;
+
+ public ErrorResponse(int status, String message) {
+ this.status = status;
+ this.message = message;
+ this.error = "Bad Request";
+ }
+
+ public int getStatus() {
+ return status;
+ }
+
+ public void setStatus(int status) {
+ this.status = status;
+ }
+
+ public String getError() {
+ if (status == 500) {
+ this.error = "Internal Server Error";
+ }
+ return error;
+ }
+
+ public void setError(String error) {
+ this.error = error;
+ }
+
+ public String getMessage() {
+ return message;
+ }
+
+ public void setMessage(String message) {
+ this.message = message;
+ }
+}
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/beans/DeploymentStatus.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/NssmfInfo.java
index f7d6a9d214..af26264074 100644
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/beans/DeploymentStatus.java
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/NssmfInfo.java
@@ -2,14 +2,14 @@
* ============LICENSE_START=======================================================
* ONAP - SO
* ================================================================================
- * Copyright (C) 2017 AT&T Intellectual Property. All rights reserved.
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
* ================================================================================
* Licensed under the Apache License, Version 2.0 (the "License");
* you may not use this file except in compliance with the License.
* You may obtain a copy of the License at
- *
+ *
* http://www.apache.org/licenses/LICENSE-2.0
- *
+ *
* Unless required by applicable law or agreed to in writing, software
* distributed under the License is distributed on an "AS IS" BASIS,
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
@@ -18,14 +18,24 @@
* ============LICENSE_END=========================================================
*/
-package org.onap.so.cloudify.beans;
+package org.onap.so.adapters.nssmf.entity;
+import lombok.Data;
-/*
- * Enum status values to capture the state of a deployment, based on last known workflow (assume only INSTALL and
- * UNINSTALL at this point).
- */
-public enum DeploymentStatus {
- NOTFOUND, CREATED, INSTALLED, FAILED, INSTALLING, UNINSTALLING, UNKNOWN
-}
+@Data
+public class NssmfInfo {
+
+ private String url;
+
+ private String ipAddress;
+
+ private String port;
+ private String insecure;
+
+ private String cacert;
+
+ private String userName;
+
+ private String password;
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/NssmfUrlInfo.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/NssmfUrlInfo.java
new file mode 100644
index 0000000000..f55ff10f1c
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/NssmfUrlInfo.java
@@ -0,0 +1,17 @@
+package org.onap.so.adapters.nssmf.entity;
+
+import lombok.Data;
+import org.onap.so.adapters.nssmf.enums.HttpMethod;
+
+@Data
+public class NssmfUrlInfo {
+
+ private String url;
+
+ private HttpMethod httpMethod;
+
+ public NssmfUrlInfo(String url, HttpMethod httpMethod) {
+ this.url = url;
+ this.httpMethod = httpMethod;
+ }
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/RestResponse.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/RestResponse.java
index cc047e45c7..218867c1ab 100644
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/RestResponse.java
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/RestResponse.java
@@ -18,7 +18,7 @@
* ============LICENSE_END=========================================================
*/
-package org.onap.so.adapters.nssmf.rest;
+package org.onap.so.adapters.nssmf.entity;
import java.util.Map;
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/TokenRequest.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/TokenRequest.java
index 3590c683e6..bfcb875290 100644
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/TokenRequest.java
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/TokenRequest.java
@@ -18,8 +18,11 @@
* ============LICENSE_END=========================================================
*/
-package org.onap.so.adapters.nssmf.model;
+package org.onap.so.adapters.nssmf.entity;
+import lombok.Data;
+
+@Data
public class TokenRequest {
private String grantType;
@@ -27,28 +30,4 @@ public class TokenRequest {
private String userName;
private String value;
-
- public String getGrantType() {
- return grantType;
- }
-
- public void setGrantType(String grantType) {
- this.grantType = grantType;
- }
-
- public String getUserName() {
- return userName;
- }
-
- public void setUserName(String userName) {
- this.userName = userName;
- }
-
- public String getValue() {
- return value;
- }
-
- public void setValue(String value) {
- this.value = value;
- }
}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/TokenResponse.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/TokenResponse.java
index 8007075e04..552612a6fb 100644
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/TokenResponse.java
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/entity/TokenResponse.java
@@ -18,27 +18,15 @@
* ============LICENSE_END=========================================================
*/
-package org.onap.so.adapters.nssmf.model;
+package org.onap.so.adapters.nssmf.entity;
+
+import lombok.Data;
+
+@Data
public class TokenResponse {
private String accessToken;
private int expires;
-
- public String getAccessToken() {
- return accessToken;
- }
-
- public void setAccessToken(String accessToken) {
- this.accessToken = accessToken;
- }
-
- public int getExpires() {
- return expires;
- }
-
- public void setExpires(int expires) {
- this.expires = expires;
- }
}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/ActionType.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/ActionType.java
new file mode 100644
index 0000000000..9df20bac1c
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/ActionType.java
@@ -0,0 +1,55 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.enums;
+
+import lombok.Getter;
+
+@Getter
+public enum ActionType {
+ ALLOCATE("allocate"),
+
+ DEALLOCATE("deallocate"),
+
+ CREATE("create"),
+
+ TERMINATE("terminate"),
+
+ ACTIVATE("activate"),
+
+ DEACTIVATE("deactivate"),
+
+ QUERY_JOB_STATUS("query_job_status"),
+
+ MODIFY_BY_ID("modify_by_id"),
+
+ MODIFY("modify"),
+
+ QUERY_NSSI_SELECTION_CAPABILITY("query_nssi_selection_capability"),
+
+ QUERY_SUB_NET_CAPABILITY("query_sub_net_capability"),;
+
+ private String type;
+
+
+ ActionType(String type) {
+ this.type = type;
+ }
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/ExecutorType.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/ExecutorType.java
new file mode 100644
index 0000000000..a76a54c348
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/ExecutorType.java
@@ -0,0 +1,25 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.enums;
+
+public enum ExecutorType {
+ INTERNAL, EXTERNAL
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/HttpMethod.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/HttpMethod.java
index f6abd98794..9271bb50b3 100644
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/HttpMethod.java
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/HttpMethod.java
@@ -18,7 +18,7 @@
* ============LICENSE_END=========================================================
*/
-package org.onap.so.adapters.nssmf.rest;
+package org.onap.so.adapters.nssmf.enums;
public enum HttpMethod {
GET, POST, PUT, DELETE, PATCH;
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/JobStatus.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/JobStatus.java
index f2e651fd6e..d5cc1df377 100644
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/JobStatus.java
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/JobStatus.java
@@ -18,7 +18,7 @@
* ============LICENSE_END=========================================================
*/
-package org.onap.so.adapters.nssmf.rest;
+package org.onap.so.adapters.nssmf.enums;
import org.onap.so.adapters.nssmf.exceptions.ApplicationException;
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/SelectionType.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/SelectionType.java
new file mode 100644
index 0000000000..420dfdce49
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/enums/SelectionType.java
@@ -0,0 +1,27 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.enums;
+
+public enum SelectionType {
+ NSSMF,
+
+ NSMF
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/exceptions/ApplicationException.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/exceptions/ApplicationException.java
index f63ba356a1..2461f5ca78 100644
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/exceptions/ApplicationException.java
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/exceptions/ApplicationException.java
@@ -20,7 +20,7 @@
package org.onap.so.adapters.nssmf.exceptions;
-import org.onap.so.adapters.nssmf.model.ErrorResponse;
+import org.onap.so.adapters.nssmf.entity.ErrorResponse;
import org.springframework.http.ResponseEntity;
import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.marshal;
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiServiceProvider.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiServiceProvider.java
index c737ba6440..665b111e03 100644
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiServiceProvider.java
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiServiceProvider.java
@@ -22,6 +22,7 @@ package org.onap.so.adapters.nssmf.extclients.aai;
import org.onap.aai.domain.yang.EsrSystemInfoList;
import org.onap.aai.domain.yang.EsrThirdpartySdncList;
+import org.onap.aai.domain.yang.ServiceInstance;
public interface AaiServiceProvider {
@@ -29,4 +30,7 @@ public interface AaiServiceProvider {
EsrSystemInfoList invokeGetThirdPartySdncEsrSystemInfo(String sdncId);
+ void invokeCreateServiceInstance(ServiceInstance nssiInstance, String globalSubscriberId, String serviceType,
+ String serviceInstanceId);
+
}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiServiceProviderImpl.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiServiceProviderImpl.java
index 8cb47ebf38..3f2e5b23f2 100644
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiServiceProviderImpl.java
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiServiceProviderImpl.java
@@ -23,7 +23,9 @@ package org.onap.so.adapters.nssmf.extclients.aai;
import org.onap.aai.domain.yang.EsrSystemInfoList;
import org.onap.aai.domain.yang.EsrThirdpartySdncList;
+import org.onap.aai.domain.yang.ServiceInstance;
import org.onap.aaiclient.client.aai.AAIObjectType;
+import org.onap.aaiclient.client.aai.entities.uri.AAIResourceUri;
import org.onap.aaiclient.client.aai.entities.uri.AAIUriFactory;
import org.slf4j.Logger;
import org.slf4j.LoggerFactory;
@@ -63,4 +65,12 @@ public class AaiServiceProviderImpl implements AaiServiceProvider {
});
}
+
+ @Override
+ public void invokeCreateServiceInstance(ServiceInstance nssiInstance, String globalSubscriberId, String serviceType,
+ String serviceInstanceId) {
+ AAIResourceUri uri = AAIUriFactory.createResourceUri(AAIObjectType.SERVICE_INSTANCE, globalSubscriberId,
+ serviceType, serviceInstanceId);
+ aaiClientProvider.getAaiClient().create(uri, nssiInstance);
+ }
}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/interceptor/LoggerInterceptor.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/interceptor/LoggerInterceptor.java
new file mode 100644
index 0000000000..ea6a1250d9
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/interceptor/LoggerInterceptor.java
@@ -0,0 +1,92 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+package org.onap.so.adapters.nssmf.interceptor;
+
+import org.aspectj.lang.ProceedingJoinPoint;
+import org.aspectj.lang.annotation.Around;
+import org.aspectj.lang.annotation.Aspect;
+import org.aspectj.lang.annotation.Pointcut;
+import org.aspectj.lang.reflect.MethodSignature;
+import org.onap.so.adapters.nssmf.annotation.ServiceLogger;
+import org.onap.so.adapters.nssmf.util.NssmfAdapterUtil;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+import org.springframework.core.annotation.Order;
+import org.springframework.stereotype.Component;
+import java.lang.reflect.Method;
+
+/**
+ * support to print logger of service method
+ */
+@Aspect
+@Order(100)
+@Component
+public class LoggerInterceptor {
+
+ private static final Logger logger = LoggerFactory.getLogger(LoggerInterceptor.class);
+
+ @Pointcut("execution(* org.onap.so.adapters.nssmf.service..*(..))")
+ public void serviceLogger() {
+
+ }
+
+ @Around("serviceLogger()")
+ public Object around(ProceedingJoinPoint joinPoint) {
+ try {
+ MethodSignature signature = (MethodSignature) joinPoint.getSignature();
+ Method method = signature.getMethod();
+
+ Class<?> targetClass = method.getDeclaringClass();
+
+ StringBuilder classAndMethod = new StringBuilder();
+ ServiceLogger classAnnotation = targetClass.getAnnotation(ServiceLogger.class);
+ ServiceLogger methodAnnotation = method.getAnnotation(ServiceLogger.class);
+
+ if (classAnnotation == null && methodAnnotation == null) {
+ return joinPoint.proceed();
+ }
+
+ if (classAnnotation != null) {
+ if (classAnnotation.ignore()) {
+ return joinPoint.proceed();
+ }
+ classAndMethod.append(classAnnotation.value()).append("-");
+ }
+
+ String target = targetClass.getName() + "#" + method.getName();
+
+ String params = NssmfAdapterUtil.marshal(joinPoint.getArgs());
+
+ logger.info("{} Start: Method = {} \nParams = {}", classAndMethod.toString(), target, params);
+
+ long start = System.currentTimeMillis();
+ Object result = joinPoint.proceed();
+ long timeConsuming = System.currentTimeMillis() - start;
+
+ logger.info("\n{} End: Method = {}, Spend time = {}ms \nResult = {}", classAndMethod.toString(), target,
+ timeConsuming, NssmfAdapterUtil.marshal(result));
+ return result;
+
+ } catch (Throwable e) {
+ logger.error(e.getMessage(), e);
+ }
+ return null;
+ }
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/NssmfManager.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/NssmfManager.java
new file mode 100644
index 0000000000..54ef1e09dd
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/NssmfManager.java
@@ -0,0 +1,44 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.manager;
+
+import org.onap.so.adapters.nssmf.exceptions.ApplicationException;
+import org.onap.so.adapters.nssmf.entity.RestResponse;
+import org.onap.so.beans.nsmf.*;
+
+public interface NssmfManager {
+
+ RestResponse allocateNssi(NssmfAdapterNBIRequest nssmfRequest) throws ApplicationException;
+
+ RestResponse deAllocateNssi(NssmfAdapterNBIRequest nssmfRequest, String sliceId) throws ApplicationException;
+
+ RestResponse activateNssi(NssmfAdapterNBIRequest nssmfRequest, String snssai) throws ApplicationException;
+
+ RestResponse deActivateNssi(NssmfAdapterNBIRequest nssmfRequest, String snssai) throws ApplicationException;
+
+ RestResponse queryJobStatus(NssmfAdapterNBIRequest jobReq, String jobId) throws ApplicationException;
+
+ RestResponse queryNSSISelectionCapability(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException;
+
+ RestResponse querySubnetCapability(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException;
+
+ RestResponse modifyNssi(NssmfAdapterNBIRequest modifyRequest) throws ApplicationException;
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/NssmfManagerBuilder.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/NssmfManagerBuilder.java
new file mode 100644
index 0000000000..0b332af607
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/NssmfManagerBuilder.java
@@ -0,0 +1,125 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.manager;
+
+import org.onap.so.adapters.nssmf.config.NssmfAdapterConfig;
+import org.onap.so.adapters.nssmf.consts.NssmfAdapterConsts;
+import org.onap.so.adapters.nssmf.enums.ActionType;
+import org.onap.so.adapters.nssmf.enums.ExecutorType;
+import org.onap.so.adapters.nssmf.exceptions.ApplicationException;
+import org.onap.so.adapters.nssmf.manager.impl.external.ExternalAnNssmfManager;
+import org.onap.so.adapters.nssmf.manager.impl.external.ExternalCnNssmfManager;
+import org.onap.so.adapters.nssmf.manager.impl.internal.InternalAnNssmfManager;
+import org.onap.so.adapters.nssmf.manager.impl.internal.InternalCnNssmfManager;
+import org.onap.so.adapters.nssmf.manager.impl.internal.InternalTnNssmfManager;
+import org.onap.so.adapters.nssmf.manager.impl.*;
+import org.onap.so.adapters.nssmf.util.RestUtil;
+import org.onap.so.beans.nsmf.EsrInfo;
+import org.onap.so.beans.nsmf.NetworkType;
+import org.onap.so.beans.nsmf.ServiceInfo;
+import org.onap.so.db.request.data.repository.ResourceOperationStatusRepository;
+
+public class NssmfManagerBuilder {
+
+ private BaseNssmfManager nssmfManger;
+
+ private RestUtil restUtil;
+
+ private ActionType actionType;
+
+ private ResourceOperationStatusRepository repository;
+
+ private ServiceInfo serviceInfo;
+
+ private NssmfAdapterConfig adapterConfig;
+
+ public NssmfManagerBuilder(EsrInfo esrInfo) throws ApplicationException {
+
+ ExecutorType executorType = getExecutorType(esrInfo);
+ NetworkType networkType = esrInfo.getNetworkType();
+
+ if (ExecutorType.INTERNAL.equals(executorType) && NetworkType.CORE.equals(networkType)) {
+ this.nssmfManger = new InternalCnNssmfManager().setEsrInfo(esrInfo).setExecutorType(executorType);
+ return;
+ }
+
+ if (ExecutorType.INTERNAL.equals(executorType) && NetworkType.TRANSPORT.equals(networkType)) {
+ this.nssmfManger = new InternalTnNssmfManager().setEsrInfo(esrInfo).setExecutorType(executorType);
+ return;
+ }
+
+ if (ExecutorType.INTERNAL.equals(executorType) && NetworkType.ACCESS.equals(networkType)) {
+ this.nssmfManger = new InternalAnNssmfManager().setEsrInfo(esrInfo).setExecutorType(executorType);
+ return;
+ }
+
+ if (ExecutorType.EXTERNAL.equals(executorType) && NetworkType.CORE.equals(networkType)) {
+ this.nssmfManger = new ExternalCnNssmfManager().setEsrInfo(esrInfo).setExecutorType(executorType)
+ .setInitStatus("deactivated");
+ return;
+ }
+
+ if (ExecutorType.EXTERNAL.equals(executorType) && NetworkType.ACCESS.equals(networkType)) {
+ this.nssmfManger = new ExternalAnNssmfManager().setEsrInfo(esrInfo).setExecutorType(executorType)
+ .setInitStatus("activated");
+ return;
+ }
+
+ throw new ApplicationException(404, "invalid domain and simulator");
+ }
+
+ private ExecutorType getExecutorType(EsrInfo esrInfo) {
+ if (NssmfAdapterConsts.ONAP_INTERNAL_TAG.equals(esrInfo.getVendor())) {
+ return ExecutorType.INTERNAL;
+ }
+ return ExecutorType.EXTERNAL;
+ }
+
+ public NssmfManagerBuilder setRestUtil(RestUtil restUtil) {
+ this.restUtil = restUtil;
+ return this;
+ }
+
+ public NssmfManagerBuilder setActionType(ActionType actionType) {
+ this.actionType = actionType;
+ return this;
+ }
+
+ public NssmfManagerBuilder setRepository(ResourceOperationStatusRepository repository) {
+ this.repository = repository;
+ return this;
+ }
+
+ public NssmfManagerBuilder setServiceInfo(ServiceInfo serviceInfo) {
+ this.serviceInfo = serviceInfo;
+ return this;
+ }
+
+ public NssmfManagerBuilder setAdapterConfig(NssmfAdapterConfig adapterConfig) {
+ this.adapterConfig = adapterConfig;
+ return this;
+ }
+
+ public NssmfManager build() {
+ return this.nssmfManger.setRestUtil(restUtil).setAdapterConfig(adapterConfig).setRepository(repository)
+ .setActionType(actionType).setServiceInfo(serviceInfo);
+ }
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/BaseNssmfManager.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/BaseNssmfManager.java
new file mode 100644
index 0000000000..97a4c5e889
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/BaseNssmfManager.java
@@ -0,0 +1,267 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.manager.impl;
+
+import org.onap.so.adapters.nssmf.config.NssmfAdapterConfig;
+import org.onap.so.adapters.nssmf.consts.NssmfAdapterConsts;
+import org.onap.so.adapters.nssmf.entity.NssmfUrlInfo;
+import org.onap.so.adapters.nssmf.enums.*;
+import org.onap.so.adapters.nssmf.exceptions.ApplicationException;
+import org.onap.so.adapters.nssmf.entity.RestResponse;
+import org.onap.so.adapters.nssmf.manager.NssmfManager;
+import org.onap.so.adapters.nssmf.util.RestUtil;
+import org.onap.so.beans.nsmf.*;
+import org.onap.so.db.request.beans.ResourceOperationStatus;
+import org.onap.so.db.request.data.repository.ResourceOperationStatusRepository;
+import org.springframework.data.domain.Example;
+import java.util.HashMap;
+import java.util.Map;
+import java.util.Optional;
+import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.marshal;
+
+public abstract class BaseNssmfManager implements NssmfManager {
+
+ protected RestUtil restUtil;
+
+ protected ResourceOperationStatusRepository repository;
+
+ protected NssmfAdapterConfig adapterConfig;
+
+ protected ActionType actionType;
+
+ protected EsrInfo esrInfo;
+
+ protected String nssmfUrl;
+
+ protected HttpMethod httpMethod;
+
+ protected String initStatus;
+
+ protected ServiceInfo serviceInfo;
+
+ protected RestResponse restResponse;
+
+ private ExecutorType executorType = ExecutorType.INTERNAL;
+
+ private Map<String, String> params = new HashMap<>(); // request params
+
+ @Override
+ public RestResponse allocateNssi(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException {
+
+ this.params.clear();
+ this.urlHandler();
+ String requestBody = wrapAllocateReqBody(nbiRequest);
+
+ this.restResponse = sendRequest(requestBody);
+
+ this.afterRequest();
+
+ return restResponse;
+ }
+
+ protected abstract String wrapAllocateReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException;
+
+ @Override
+ public RestResponse modifyNssi(NssmfAdapterNBIRequest modifyRequest) throws ApplicationException {
+ this.params.clear();
+ this.urlHandler();
+ String requestBody = wrapModifyReqBody(modifyRequest);
+
+ this.restResponse = sendRequest(requestBody);
+
+ this.afterRequest();
+
+ return restResponse;
+ }
+
+ protected abstract String wrapModifyReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException;
+
+ @Override
+ public RestResponse deAllocateNssi(NssmfAdapterNBIRequest nbiRequest, String sliceId) throws ApplicationException {
+ this.params.clear();
+ this.params.put("sliceProfileId", sliceId);
+
+ this.urlHandler();
+
+ String reqBody = wrapDeAllocateReqBody(nbiRequest.getDeAllocateNssi());
+
+ this.restResponse = sendRequest(reqBody);
+
+ this.afterRequest();
+
+ return restResponse;
+ }
+
+ protected abstract String wrapDeAllocateReqBody(DeAllocateNssi deAllocateNssi) throws ApplicationException;
+
+ protected abstract String wrapReqBody(Object object) throws ApplicationException;
+
+ @Override
+ public RestResponse activateNssi(NssmfAdapterNBIRequest nbiRequest, String snssai) throws ApplicationException {
+ this.params.clear();
+ this.params.put("snssai", snssai);
+
+ this.urlHandler();
+
+ String reqBody = wrapActDeActReqBody(nbiRequest.getActDeActNssi());
+
+ this.restResponse = sendRequest(reqBody);
+
+ this.afterRequest();
+
+ return restResponse;
+ }
+
+ @Override
+ public RestResponse deActivateNssi(NssmfAdapterNBIRequest nbiRequest, String snssai) throws ApplicationException {
+ return activateNssi(nbiRequest, snssai);
+ }
+
+ protected abstract String wrapActDeActReqBody(ActDeActNssi actDeActNssi) throws ApplicationException;
+
+ @Override
+ public RestResponse queryJobStatus(NssmfAdapterNBIRequest jobReq, String jobId) throws ApplicationException {
+ this.params.clear();
+ this.params.put("jobId", jobId);
+ this.params.put("responseId", jobReq.getResponseId());
+ this.urlHandler();
+
+ /**
+ * find by jobId and nsiId jobId -> OperationId nsiId -> ServiceId serviceUuid -> resourceTemplateUUID
+ */
+ ResourceOperationStatus status =
+ getOperationStatus(serviceInfo.getNsiId(), jobId, serviceInfo.getServiceUuid());
+
+ this.restResponse = doQueryJobStatus(status);
+
+ afterQueryJobStatus(status);
+ return restResponse;
+ }
+
+ protected abstract RestResponse doQueryJobStatus(ResourceOperationStatus status) throws ApplicationException;
+
+
+ protected abstract void afterQueryJobStatus(ResourceOperationStatus status);
+
+ private ResourceOperationStatus getOperationStatus(String nsiId, String jobId, String serviceUuid) {
+
+ ResourceOperationStatus status = new ResourceOperationStatus(nsiId, jobId, serviceUuid);
+
+ Optional<ResourceOperationStatus> optional = repository.findOne(Example.of(status));
+
+ return optional.orElse(null);
+ }
+
+ @Override
+ public RestResponse queryNSSISelectionCapability(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException {
+ SelectionType res = doQueryNSSISelectionCapability();
+ HashMap<String, String> hashMap = new HashMap<>();
+ hashMap.put("selection", res.name());
+ RestResponse restResponse = new RestResponse();
+ restResponse.setStatus(200);
+ restResponse.setResponseContent(marshal(hashMap));
+ return restResponse;
+ }
+
+ protected abstract SelectionType doQueryNSSISelectionCapability();
+
+ @Override
+ public RestResponse querySubnetCapability(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException {
+ this.params.clear();
+ this.urlHandler();
+
+ return doQuerySubnetCapability(nbiRequest.getSubnetCapabilityQuery());
+ }
+
+ protected abstract RestResponse doQuerySubnetCapability(String req) throws ApplicationException;
+
+ /**
+ * send request to nssmf
+ *
+ * @param content request body
+ * @return response
+ * @throws ApplicationException
+ */
+ protected abstract RestResponse sendRequest(String content) throws ApplicationException;
+
+ /**
+ * handle the url before request to nssmf, include get the nssmf request url, replace the path variable
+ */
+ private void urlHandler() {
+ NssmfUrlInfo nssmfUrlInfo =
+ NssmfAdapterConsts.getNssmfUrlInfo(this.executorType, this.esrInfo.getNetworkType(), actionType);
+ this.nssmfUrl = nssmfUrlInfo.getUrl();
+ this.httpMethod = nssmfUrlInfo.getHttpMethod();
+ this.nssmfUrl = nssmfUrl.replaceAll("\\{apiVersion}", getApiVersion());
+ this.params.forEach((k, v) -> this.nssmfUrl = this.nssmfUrl.replaceAll("\\{" + k + "}", v));
+ }
+
+ /**
+ * after request
+ */
+ protected abstract void afterRequest() throws ApplicationException;
+
+ protected abstract String getApiVersion();
+
+ public RestUtil getRestUtil() {
+ return restUtil;
+ }
+
+ public BaseNssmfManager setEsrInfo(EsrInfo esrInfo) {
+ this.esrInfo = esrInfo;
+ return this;
+ }
+
+ public BaseNssmfManager setExecutorType(ExecutorType executorType) {
+ this.executorType = executorType;
+ return this;
+ }
+
+ public BaseNssmfManager setRestUtil(RestUtil restUtil) {
+ this.restUtil = restUtil;
+ return this;
+ }
+
+ public BaseNssmfManager setActionType(ActionType actionType) {
+ this.actionType = actionType;
+ return this;
+ }
+
+ public BaseNssmfManager setRepository(ResourceOperationStatusRepository repository) {
+ this.repository = repository;
+ return this;
+ }
+
+ public BaseNssmfManager setServiceInfo(ServiceInfo serviceInfo) {
+ this.serviceInfo = serviceInfo;
+ return this;
+ }
+
+ public BaseNssmfManager setInitStatus(String initStatus) {
+ this.initStatus = initStatus;
+ return this;
+ }
+
+ public BaseNssmfManager setAdapterConfig(NssmfAdapterConfig adapterConfig) {
+ this.adapterConfig = adapterConfig;
+ return this;
+ }
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/ExternalNssmfManager.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/ExternalNssmfManager.java
new file mode 100644
index 0000000000..d8a9088a42
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/ExternalNssmfManager.java
@@ -0,0 +1,187 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.manager.impl;
+
+import org.apache.http.Header;
+import org.apache.http.message.BasicHeader;
+import org.onap.aai.domain.yang.ServiceInstance;
+import org.onap.so.adapters.nssmf.entity.NssmfInfo;
+import org.onap.so.adapters.nssmf.entity.RestResponse;
+import org.onap.so.adapters.nssmf.enums.JobStatus;
+import org.onap.so.adapters.nssmf.exceptions.ApplicationException;
+import org.onap.so.adapters.nssmf.util.NssmfAdapterUtil;
+import org.onap.so.beans.nsmf.*;
+import org.onap.so.db.request.beans.ResourceOperationStatus;
+import static java.lang.String.valueOf;
+import static org.onap.so.adapters.nssmf.enums.JobStatus.*;
+import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.StatusDesc.*;
+import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.marshal;
+import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.unMarshal;
+
+public abstract class ExternalNssmfManager extends BaseNssmfManager {
+
+ @Override
+ protected String wrapAllocateReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException {
+ return doWrapExtAllocateReqBody(nbiRequest);
+ }
+
+ protected abstract String doWrapExtAllocateReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException;
+
+ @Override
+ protected String wrapModifyReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException {
+ return doWrapModifyReqBody(nbiRequest);
+ }
+
+ protected abstract String doWrapModifyReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException;
+
+ @Override
+ protected String wrapDeAllocateReqBody(DeAllocateNssi deAllocateNssi) throws ApplicationException {
+ return doWrapDeAllocateReqBody(deAllocateNssi);
+ }
+
+ protected abstract String doWrapDeAllocateReqBody(DeAllocateNssi deAllocateNssi) throws ApplicationException;
+
+ @Override
+ protected void afterQueryJobStatus(ResourceOperationStatus status) {
+ if (Integer.parseInt(status.getProgress()) == 100) {
+
+ ServiceInstance nssiInstance = new ServiceInstance();
+ nssiInstance.setServiceInstanceId(serviceInfo.getNssiId());
+ nssiInstance.setServiceInstanceName(serviceInfo.getNssiName());
+ nssiInstance.setServiceType(serviceInfo.getSST());
+
+ nssiInstance.setOrchestrationStatus(initStatus);
+ nssiInstance.setModelInvariantId(serviceInfo.getServiceInvariantUuid());
+ nssiInstance.setModelVersionId(serviceInfo.getServiceUuid());
+ nssiInstance.setServiceInstanceLocationId(serviceInfo.getPLMNIdList());
+ nssiInstance.setEnvironmentContext(esrInfo.getNetworkType().getNetworkType());
+ nssiInstance.setServiceRole("nssi");
+
+ restUtil.createServiceInstance(nssiInstance, serviceInfo);
+ }
+ }
+
+
+
+ @Override
+ protected String wrapActDeActReqBody(ActDeActNssi actDeActNssi) throws ApplicationException {
+ return marshal(actDeActNssi);
+ }
+
+ protected RestResponse doQueryJobStatus(ResourceOperationStatus status) throws ApplicationException {
+ return doResponseStatus(status);
+ }
+
+ private RestResponse doResponseStatus(ResourceOperationStatus status) throws ApplicationException {
+ RestResponse restResponse = sendRequest(null);
+ JobStatusResponse jobStatusResponse = unMarshal(restResponse.getResponseContent(), JobStatusResponse.class);
+
+ ResponseDescriptor rspDesc = jobStatusResponse.getResponseDescriptor();
+ rspDesc.setNssiId(status.getResourceInstanceID());
+
+ jobStatusResponse.setResponseDescriptor(rspDesc);
+ restResponse.setResponseContent(marshal(jobStatusResponse));
+ updateRequestDbJobStatus(rspDesc, status, restResponse);
+ return restResponse;
+ }
+
+ @Override
+ protected String wrapReqBody(Object object) throws ApplicationException {
+ return marshal(object);
+ }
+
+ @Override
+ protected RestResponse sendRequest(String content) throws ApplicationException {
+ return sendExternalRequest(content);
+ }
+
+ @Override
+ protected String getApiVersion() {
+ return "v1";
+ }
+
+
+ // external
+ protected RestResponse sendExternalRequest(String content) throws ApplicationException {
+ NssmfInfo nssmfInfo = restUtil.getNssmfHost(esrInfo);
+ Header header = new BasicHeader("X-Auth-Token", restUtil.getToken(nssmfInfo));
+ String nssmfUrl = nssmfInfo.getUrl() + this.nssmfUrl;
+ return restUtil.send(nssmfUrl, this.httpMethod, content, header);
+ }
+
+ private void updateRequestDbJobStatus(ResponseDescriptor rspDesc, ResourceOperationStatus status, RestResponse rsp)
+ throws ApplicationException {
+
+ switch (fromString(rspDesc.getStatus())) {
+ case STARTED:
+ updateDbStatus(status, rsp.getStatus(), STARTED, QUERY_JOB_STATUS_SUCCESS);
+ break;
+ case PROCESSING:
+ updateDbStatus(status, rsp.getStatus(), PROCESSING, QUERY_JOB_STATUS_SUCCESS);
+ break;
+ case FINISHED:
+ if (rspDesc.getProgress() == 100) {
+ updateDbStatus(status, rsp.getStatus(), FINISHED, QUERY_JOB_STATUS_SUCCESS);
+ }
+ break;
+ case ERROR:
+ updateDbStatus(status, rsp.getStatus(), ERROR, QUERY_JOB_STATUS_FAILED);
+ throw new ApplicationException(500, QUERY_JOB_STATUS_FAILED);
+ }
+ }
+
+ protected void updateDbStatus(ResourceOperationStatus status, int rspStatus, JobStatus jobStatus,
+ String description) {
+ status.setErrorCode(valueOf(rspStatus));
+ status.setStatus(jobStatus.toString());
+ status.setStatusDescription(description);
+ repository.save(status);
+ }
+
+ @Override
+ protected RestResponse doQuerySubnetCapability(String req) throws ApplicationException {
+ RestResponse response = new RestResponse();
+ response.setStatus(200);
+ response.setResponseContent(null);
+ return response;
+ }
+
+ /**
+ * after request, if response code is 2XX, continue handle, else return
+ */
+ @Override
+ protected void afterRequest() throws ApplicationException {
+ if (valueOf(restResponse.getStatus()).startsWith("2")) {
+ doAfterRequest();
+ }
+ }
+
+
+ protected void doAfterRequest() throws ApplicationException {
+ //
+ NssiResponse response = unMarshal(restResponse.getResponseContent(), NssiResponse.class);
+ ResourceOperationStatus status =
+ new ResourceOperationStatus(serviceInfo.getNsiId(), response.getJobId(), serviceInfo.getServiceUuid());
+ status.setResourceInstanceID(response.getNssiId());
+
+ updateDbStatus(status, restResponse.getStatus(), STARTED, NssmfAdapterUtil.getStatusDesc(actionType));
+ }
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/InternalNssmfManager.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/InternalNssmfManager.java
new file mode 100644
index 0000000000..348bf12bcb
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/InternalNssmfManager.java
@@ -0,0 +1,129 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.manager.impl;
+
+import org.apache.http.Header;
+import org.apache.http.message.BasicHeader;
+import org.onap.so.adapters.nssmf.consts.NssmfAdapterConsts;
+import org.onap.so.adapters.nssmf.entity.RestResponse;
+import org.onap.so.adapters.nssmf.enums.SelectionType;
+import org.onap.so.adapters.nssmf.exceptions.ApplicationException;
+import org.onap.so.beans.nsmf.*;
+import org.onap.so.db.request.beans.ResourceOperationStatus;
+import static org.onap.so.adapters.nssmf.enums.JobStatus.PROCESSING;
+import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.marshal;
+
+public abstract class InternalNssmfManager extends BaseNssmfManager {
+
+ @Override
+ protected String wrapAllocateReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException {
+ return doWrapAllocateReqBody(nbiRequest);
+ }
+
+ protected abstract String doWrapAllocateReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException;
+
+ @Override
+ protected String wrapReqBody(Object object) throws ApplicationException {
+ NssmfRequest nssmfRequest = new NssmfRequest(serviceInfo, esrInfo.getNetworkType(), object);
+ return marshal(nssmfRequest);
+ }
+
+
+ @Override
+ protected String wrapActDeActReqBody(ActDeActNssi actDeActNssi) throws ApplicationException {
+
+ return wrapReqBody(actDeActNssi);
+ }
+
+
+ @Override
+ protected String wrapDeAllocateReqBody(DeAllocateNssi deAllocateNssi) throws ApplicationException {
+ return wrapReqBody(deAllocateNssi);
+ }
+
+
+ @Override
+ protected RestResponse doQueryJobStatus(ResourceOperationStatus status) throws ApplicationException {
+ return responseDBStatus(status);
+ }
+
+ private RestResponse responseDBStatus(ResourceOperationStatus status) throws ApplicationException {
+ ResponseDescriptor descriptor = new ResponseDescriptor();
+ if (status == null) {
+ descriptor.setProgress(0);
+ descriptor.setStatus(PROCESSING.name());
+ descriptor.setStatusDescription("Initiating Nssi Instance");
+ return restUtil.createResponse(200, marshal(descriptor));
+ }
+ descriptor.setStatus(status.getStatus());
+ descriptor.setStatusDescription(status.getStatusDescription());
+ descriptor.setProgress(Integer.parseInt(status.getProgress()));
+ descriptor.setNssiId(status.getResourceInstanceID());
+ // descriptor.setResponseId(status.getOperationId());
+ return restUtil.createResponse(200, marshal(descriptor));
+ }
+
+ @Override
+ protected RestResponse sendRequest(String content) {
+ return sendInternalRequest(content);
+ }
+
+ @Override
+ protected void afterRequest() {
+ //
+ }
+
+ @Override
+ protected void afterQueryJobStatus(ResourceOperationStatus status) {
+ // internal
+ }
+
+ // internal
+ private RestResponse sendInternalRequest(String content) {
+ Header header = new BasicHeader("X-Auth-Token", adapterConfig.getInfraAuth());
+ this.nssmfUrl = adapterConfig.getInfraEndpoint() + this.nssmfUrl;
+ return restUtil.send(this.nssmfUrl, this.httpMethod, content, header);
+ }
+
+ @Override
+ protected String getApiVersion() {
+ return NssmfAdapterConsts.CURRENT_INTERNAL_NSSMF_API_VERSION;
+ }
+
+
+ @Override
+ protected SelectionType doQueryNSSISelectionCapability() {
+ return SelectionType.NSSMF;
+ }
+
+ @Override
+ protected String wrapModifyReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException {
+ return doWrapModifyReqBody(nbiRequest);
+ }
+
+ protected abstract String doWrapModifyReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException;
+
+ @Override
+ protected RestResponse doQuerySubnetCapability(String req) throws ApplicationException {
+ // handler
+ return sendRequest(req);
+ }
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/external/ExternalAnNssmfManager.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/external/ExternalAnNssmfManager.java
new file mode 100644
index 0000000000..bc7a3d0bb7
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/external/ExternalAnNssmfManager.java
@@ -0,0 +1,117 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.manager.impl.external;
+
+import org.onap.so.adapters.nssmf.entity.RestResponse;
+import org.onap.so.adapters.nssmf.enums.ActionType;
+import org.onap.so.adapters.nssmf.enums.JobStatus;
+import org.onap.so.adapters.nssmf.enums.SelectionType;
+import org.onap.so.adapters.nssmf.exceptions.ApplicationException;
+import org.onap.so.adapters.nssmf.manager.impl.ExternalNssmfManager;
+import org.onap.so.adapters.nssmf.util.NssmfAdapterUtil;
+import org.onap.so.beans.nsmf.DeAllocateNssi;
+import org.onap.so.beans.nsmf.NssiResponse;
+import org.onap.so.beans.nsmf.NssmfAdapterNBIRequest;
+import org.onap.so.db.request.beans.ResourceOperationStatus;
+import java.util.HashMap;
+import java.util.Map;
+import java.util.UUID;
+import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.marshal;
+import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.unMarshal;
+
+
+public class ExternalAnNssmfManager extends ExternalNssmfManager {
+
+ private Map<String, String> bodyParams = new HashMap<>(); // request body params
+
+ @Override
+ protected String doWrapExtAllocateReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException {
+ Map<String, Object> request = new HashMap<>();
+ request.put("attributeListIn", nbiRequest.getAllocateAnNssi().getSliceProfile());
+ return marshal(request);
+ }
+
+ @Override
+ protected void doAfterRequest() throws ApplicationException {
+ if (ActionType.ALLOCATE.equals(actionType) || ActionType.DEALLOCATE.equals(actionType)) {
+ String nssiId;
+ if (ActionType.ALLOCATE.equals(actionType)) {
+ @SuppressWarnings("unchecked")
+ Map<String, String> response = unMarshal(restResponse.getResponseContent(), Map.class);
+ nssiId = response.get("href");
+ } else {
+ nssiId = this.bodyParams.get("nssiId");
+ }
+
+ NssiResponse resp = new NssiResponse();
+ resp.setJobId(UUID.randomUUID().toString());
+ resp.setNssiId(nssiId);
+
+ RestResponse returnRsp = new RestResponse();
+
+ returnRsp.setStatus(202);
+ returnRsp.setResponseContent(marshal(resp));
+ restResponse = returnRsp;
+
+ ResourceOperationStatus status =
+ new ResourceOperationStatus(serviceInfo.getNsiId(), nssiId, serviceInfo.getServiceUuid());
+ status.setResourceInstanceID(nssiId);
+
+ updateDbStatus(status, restResponse.getStatus(), JobStatus.FINISHED,
+ NssmfAdapterUtil.getStatusDesc(actionType));
+ }
+ // todo
+ }
+
+ @Override
+ protected String doWrapModifyReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException {
+ // TODO
+ return null;
+ }
+
+ @Override
+ protected String doWrapDeAllocateReqBody(DeAllocateNssi deAllocateNssi) throws ApplicationException {
+ this.bodyParams.clear();
+ this.bodyParams.put("nssiId", deAllocateNssi.getNssiId());
+
+ Map<String, String> request = new HashMap<>();
+ request.put("nSSId", deAllocateNssi.getNssiId());
+ return marshal(request);
+ }
+
+
+ @Override
+ public RestResponse modifyNssi(NssmfAdapterNBIRequest modifyRequest) throws ApplicationException {
+ // TODO
+ return null;
+ }
+
+ @Override
+ public RestResponse activateNssi(NssmfAdapterNBIRequest nbiRequest, String snssai) throws ApplicationException {
+ // TODO
+ return null;
+ }
+
+ @Override
+ protected SelectionType doQueryNSSISelectionCapability() {
+ return SelectionType.NSSMF;
+ }
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/external/ExternalCnNssmfManager.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/external/ExternalCnNssmfManager.java
new file mode 100644
index 0000000000..fb76adcce6
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/external/ExternalCnNssmfManager.java
@@ -0,0 +1,53 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.manager.impl.external;
+
+import org.onap.so.adapters.nssmf.enums.SelectionType;
+import org.onap.so.adapters.nssmf.exceptions.ApplicationException;
+import org.onap.so.adapters.nssmf.manager.impl.ExternalNssmfManager;
+import org.onap.so.beans.nsmf.DeAllocateNssi;
+import org.onap.so.beans.nsmf.NssmfAdapterNBIRequest;
+import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.marshal;
+
+public class ExternalCnNssmfManager extends ExternalNssmfManager {
+
+ @Override
+ protected String doWrapExtAllocateReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException {
+ return marshal(nbiRequest.getAllocateCnNssi());
+ }
+
+ @Override
+ protected String doWrapModifyReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException {
+ return marshal(nbiRequest.getAllocateCnNssi());
+ }
+
+ @Override
+ protected String doWrapDeAllocateReqBody(DeAllocateNssi deAllocateNssi) throws ApplicationException {
+ return marshal(deAllocateNssi);
+ }
+
+ @Override
+ protected SelectionType doQueryNSSISelectionCapability() {
+
+ return SelectionType.NSMF;
+ }
+
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/internal/InternalAnNssmfManager.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/internal/InternalAnNssmfManager.java
new file mode 100644
index 0000000000..dc6528381b
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/internal/InternalAnNssmfManager.java
@@ -0,0 +1,54 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.manager.impl.internal;
+
+import org.onap.so.adapters.nssmf.exceptions.ApplicationException;
+import org.onap.so.adapters.nssmf.manager.impl.InternalNssmfManager;
+import org.onap.so.beans.nsmf.*;
+import java.util.HashMap;
+import java.util.Map;
+import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.marshal;
+
+
+public class InternalAnNssmfManager extends InternalNssmfManager {
+
+ @Override
+ protected String doWrapAllocateReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException {
+ NssmfRequest request =
+ new NssmfRequest(serviceInfo, nbiRequest.getEsrInfo().getNetworkType(), nbiRequest.getAllocateAnNssi());
+ request.setName(nbiRequest.getAllocateAnNssi().getNssiName());
+ return marshal(request);
+ }
+
+ @Override
+ protected String doWrapModifyReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException {
+ AllocateAnNssi allocateAnNssi = nbiRequest.getAllocateAnNssi();
+ AnSliceProfile sliceProfile = allocateAnNssi.getSliceProfile();
+ Map<String, Object> additional = new HashMap<>();
+ additional.put("modifyAction", "allocate");
+ additional.put("snssaiList", sliceProfile.getSNSSAIList());
+ additional.put("sliceProfileId", sliceProfile.getSliceProfileId());
+ additional.put("nsiInfo", allocateAnNssi.getNsiInfo());
+ additional.put("scriptName", allocateAnNssi.getScriptName());
+ NssmfRequest request = new NssmfRequest(serviceInfo, esrInfo.getNetworkType(), additional);
+ return marshal(request);
+ }
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/internal/InternalCnNssmfManager.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/internal/InternalCnNssmfManager.java
new file mode 100644
index 0000000000..4a93b3007c
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/internal/InternalCnNssmfManager.java
@@ -0,0 +1,56 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.manager.impl.internal;
+
+import org.onap.so.adapters.nssmf.exceptions.ApplicationException;
+import org.onap.so.adapters.nssmf.manager.impl.InternalNssmfManager;
+import org.onap.so.beans.nsmf.*;
+import java.util.HashMap;
+import java.util.Map;
+import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.marshal;
+
+public class InternalCnNssmfManager extends InternalNssmfManager {
+
+ @Override
+ protected String doWrapAllocateReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException {
+
+ NssmfRequest request =
+ new NssmfRequest(serviceInfo, nbiRequest.getEsrInfo().getNetworkType(), nbiRequest.getAllocateCnNssi());
+ request.setName(nbiRequest.getAllocateCnNssi().getNssiName());
+ return marshal(request);
+ }
+
+ @Override
+ protected String doWrapModifyReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException {
+ AllocateCnNssi allocateCnNssi = nbiRequest.getAllocateCnNssi();
+ CnSliceProfile cnSliceProfile = allocateCnNssi.getSliceProfile();
+ Map<String, Object> additional = new HashMap<>();
+ additional.put("modifyAction", "allocate");
+ additional.put("nsiInfo", allocateCnNssi.getNsiInfo());
+ additional.put("scriptName", allocateCnNssi.getScriptName());
+ additional.put("snssaiList", cnSliceProfile.getSnssaiList());
+ additional.put("sliceProfileId", cnSliceProfile.getSliceProfileId());
+
+ NssmfRequest request = new NssmfRequest(serviceInfo, esrInfo.getNetworkType(), additional);
+ return marshal(request);
+ }
+
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/internal/InternalTnNssmfManager.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/internal/InternalTnNssmfManager.java
new file mode 100644
index 0000000000..8bfbd55387
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/manager/impl/internal/InternalTnNssmfManager.java
@@ -0,0 +1,42 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.manager.impl.internal;
+
+import org.onap.so.adapters.nssmf.exceptions.ApplicationException;
+import org.onap.so.adapters.nssmf.manager.impl.InternalNssmfManager;
+import org.onap.so.beans.nsmf.*;
+import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.marshal;
+
+public class InternalTnNssmfManager extends InternalNssmfManager {
+
+ @Override
+ protected String doWrapAllocateReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException {
+
+ return marshal(new NssmfRequest(serviceInfo, nbiRequest.getEsrInfo().getNetworkType(),
+ nbiRequest.getAllocateTnNssi()));
+ }
+
+ @Override
+ protected String doWrapModifyReqBody(NssmfAdapterNBIRequest nbiRequest) throws ApplicationException {
+ // TODO
+ return null;
+ }
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfAdapterRest.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfAdapterRest.java
index d8e1e36058..4fdcbf110f 100644
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfAdapterRest.java
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfAdapterRest.java
@@ -20,6 +20,7 @@
package org.onap.so.adapters.nssmf.rest;
+import org.onap.so.adapters.nssmf.entity.RestResponse;
import org.onap.so.adapters.nssmf.exceptions.ApplicationException;
import org.onap.so.beans.nsmf.JobStatusRequest;
import org.onap.so.beans.nsmf.NssiActDeActRequest;
@@ -43,6 +44,7 @@ import org.springframework.web.bind.annotation.RequestMapping;
import static javax.ws.rs.core.MediaType.APPLICATION_JSON;
import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.assertObjectNotNull;
+@Deprecated
@Controller
@RequestMapping(value = "/api/rest/provMns/v1", produces = {APPLICATION_JSON}, consumes = {APPLICATION_JSON})
public class NssmfAdapterRest {
@@ -52,17 +54,6 @@ public class NssmfAdapterRest {
@Autowired
private NssmfManager nssmfMgr;
- @PostMapping(value = "/NSS/SliceProfiles")
- public ResponseEntity allocateNssi(@RequestBody NssiAllocateRequest allocate) {
- try {
- logger.info("Nssmi allocate request is invoked");
- assertObjectNotNull(allocate);
- RestResponse rsp = getNssmfMgr().allocateNssi(allocate);
- return buildResponse(rsp);
- } catch (ApplicationException e) {
- return e.buildErrorResponse();
- }
- }
@PostMapping(value = "/NSS/nssi")
public ResponseEntity createNssi(@RequestBody NssiCreateRequest create) {
@@ -76,19 +67,6 @@ public class NssmfAdapterRest {
}
}
- @PostMapping(value = "/NSS/SliceProfiles/{sliceProfileId}")
- public ResponseEntity deAllocateNssi(@RequestBody NssiDeAllocateRequest deAllocate,
- @PathVariable("sliceProfileId") final String sliceId) {
- try {
- logger.info("Nssmf deallocate request is invoked");
- assertObjectNotNull(deAllocate);
- RestResponse rsp = getNssmfMgr().deAllocateNssi(deAllocate, sliceId);
- return buildResponse(rsp);
- } catch (ApplicationException e) {
- return e.buildErrorResponse();
- }
- }
-
@PostMapping(value = "/NSS/nssi/{nssiId}")
public ResponseEntity terminateNssi(@RequestBody NssiTerminateRequest terminate,
@PathVariable("nssiId") String nssiId) {
@@ -128,44 +106,6 @@ public class NssmfAdapterRest {
}
}
- @PostMapping(value = "/NSS/{snssai}/activation")
- public ResponseEntity activateNssi(@RequestBody NssiActDeActRequest activate,
- @PathVariable("snssai") String snssai) {
- try {
- logger.info("Nssmf activate request is invoked");
- assertObjectNotNull(activate);
- RestResponse rsp = getNssmfMgr().activateNssi(activate, snssai);
- return buildResponse(rsp);
- } catch (ApplicationException e) {
- return e.buildErrorResponse();
- }
- }
-
- @PostMapping(value = "/NSS/{snssai}/deactivation")
- public ResponseEntity deactivateNssi(@RequestBody NssiActDeActRequest deActivate,
- @PathVariable("snssai") String snssai) {
- try {
- logger.info("Nssmf activate request is invoked");
- assertObjectNotNull(deActivate);
- RestResponse rsp = getNssmfMgr().deActivateNssi(deActivate, snssai);
- return buildResponse(rsp);
- } catch (ApplicationException e) {
- return e.buildErrorResponse();
- }
- }
-
- @PostMapping(value = "/NSS/jobs/{jobId}")
- public ResponseEntity queryJobStatus(@RequestBody JobStatusRequest jobStatusReq,
- @PathVariable("jobId") String jobId) {
- try {
- logger.info("Nssmf query job status request is invoked");
- assertObjectNotNull(jobStatusReq);
- RestResponse rsp = getNssmfMgr().queryJobStatus(jobStatusReq, jobId);
- return buildResponse(rsp);
- } catch (ApplicationException e) {
- return e.buildErrorResponse();
- }
- }
@GetMapping(value = "/vendor/{vendorName}/type/{networkType}/NSS" + "/SliceProfiles/{sliceProfileId}")
public ResponseEntity queryNssi(@PathVariable("vendorName") String vendorName,
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfInfo.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfInfo.java
deleted file mode 100644
index 6306643a97..0000000000
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfInfo.java
+++ /dev/null
@@ -1,94 +0,0 @@
-/*-
- * ============LICENSE_START=======================================================
- * ONAP - SO
- * ================================================================================
- * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
- * ================================================================================
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- * ============LICENSE_END=========================================================
- */
-
-package org.onap.so.adapters.nssmf.rest;
-
-public class NssmfInfo {
-
- private String url;
-
- private String ipAddress;
-
- private String port;
-
- private String insecure;
-
- private String cacert;
-
- private String userName;
-
- private String password;
-
- public String getInsecure() {
- return insecure;
- }
-
- public void setInsecure(String insecure) {
- this.insecure = insecure;
- }
-
- public String getCacert() {
- return cacert;
- }
-
- public void setCacert(String cacert) {
- this.cacert = cacert;
- }
-
- public String getIpAddress() {
- return ipAddress;
- }
-
- public void setIpAddress(String ipAddress) {
- this.ipAddress = ipAddress;
- }
-
- public String getPort() {
- return port;
- }
-
- public void setPort(String port) {
- this.port = port;
- }
-
- public String getUrl() {
- return url;
- }
-
- public void setUrl(String url) {
- this.url = url;
- }
-
- public String getUserName() {
- return userName;
- }
-
- public void setUserName(String userName) {
- this.userName = userName;
- }
-
- public String getPassword() {
- return password;
- }
-
- public void setPassword(String password) {
- this.password = password;
- }
-}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfManager.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfManager.java
index 0e25729610..2d0980f60e 100644
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfManager.java
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfManager.java
@@ -20,7 +20,10 @@
package org.onap.so.adapters.nssmf.rest;
+import org.onap.so.adapters.nssmf.entity.RestResponse;
+import org.onap.so.adapters.nssmf.enums.JobStatus;
import org.onap.so.adapters.nssmf.exceptions.ApplicationException;
+import org.onap.so.adapters.nssmf.util.RestUtil;
import org.onap.so.beans.nsmf.ActDeActNssi;
import org.onap.so.beans.nsmf.AllocateAnNssi;
import org.onap.so.beans.nsmf.AllocateCnNssi;
@@ -52,15 +55,15 @@ import org.springframework.context.annotation.Primary;
import org.springframework.data.domain.Example;
import org.springframework.stereotype.Component;
import static java.lang.String.valueOf;
-import static org.onap.so.adapters.nssmf.rest.HttpMethod.DELETE;
-import static org.onap.so.adapters.nssmf.rest.HttpMethod.GET;
-import static org.onap.so.adapters.nssmf.rest.HttpMethod.POST;
-import static org.onap.so.adapters.nssmf.rest.HttpMethod.PUT;
-import static org.onap.so.adapters.nssmf.rest.JobStatus.ERROR;
-import static org.onap.so.adapters.nssmf.rest.JobStatus.FINISHED;
-import static org.onap.so.adapters.nssmf.rest.JobStatus.PROCESSING;
-import static org.onap.so.adapters.nssmf.rest.JobStatus.STARTED;
-import static org.onap.so.adapters.nssmf.rest.JobStatus.fromString;
+import static org.onap.so.adapters.nssmf.enums.HttpMethod.DELETE;
+import static org.onap.so.adapters.nssmf.enums.HttpMethod.GET;
+import static org.onap.so.adapters.nssmf.enums.HttpMethod.POST;
+import static org.onap.so.adapters.nssmf.enums.HttpMethod.PUT;
+import static org.onap.so.adapters.nssmf.enums.JobStatus.ERROR;
+import static org.onap.so.adapters.nssmf.enums.JobStatus.FINISHED;
+import static org.onap.so.adapters.nssmf.enums.JobStatus.PROCESSING;
+import static org.onap.so.adapters.nssmf.enums.JobStatus.STARTED;
+import static org.onap.so.adapters.nssmf.enums.JobStatus.fromString;
import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.StatusDesc.ACTIVATE_NSS_SUCCESS;
import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.StatusDesc.ALLOCATE_NSS_SUCCESS;
import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.StatusDesc.CREATE_NSS_SUCCESS;
@@ -76,6 +79,7 @@ import static org.onap.so.beans.nsmf.ActDeActNssi.DE_ACT_URL;
@Component
@Primary
+@Deprecated
public class NssmfManager {
private static final Logger logger = LoggerFactory.getLogger(NssmfManager.class);
@@ -129,14 +133,15 @@ public class NssmfManager {
case TRANSPORT:
AllocateTnNssi tn = nssmiAllocate.getAllocateTnNssi();
assertObjectNotNull(tn);
- assertObjectNotNull(tn.getNsiInfo());
- assertObjectNotNull(tn.getNsiInfo().getNsiId());
- nsiId = tn.getNsiInfo().getNsiId();
+ // assertObjectNotNull(tn.getNsiInfo());
+ // assertObjectNotNull(tn.getNsiInfo().getNsiId());
+ // nsiId = tn.getNsiInfo().getNsiId();
allocateReq = marshal(tn);
- allocateUrl = AllocateTnNssi.URL;
+ // allocateUrl = AllocateTnNssi.URL;
break;
}
+
RestResponse rsp = restUtil.sendRequest(allocateUrl, POST, allocateReq, nssmiAllocate.getEsrInfo());
assertObjectNotNull(rsp);
@@ -152,6 +157,8 @@ public class NssmfManager {
return rsp;
}
+
+
public RestResponse createNssi(NssiCreateRequest nssiCreate) throws ApplicationException {
assertObjectNotNull(nssiCreate.getEsrInfo());
@@ -192,6 +199,7 @@ public class NssmfManager {
return rsp;
}
+ @Deprecated
public RestResponse deAllocateNssi(NssiDeAllocateRequest nssiDeallocate, String sliceId)
throws ApplicationException {
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/TrustAllHostNameVerifier.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/TrustAllHostNameVerifier.java
index 254186bda8..fc0f3ddde5 100644
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/TrustAllHostNameVerifier.java
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/TrustAllHostNameVerifier.java
@@ -23,6 +23,7 @@ package org.onap.so.adapters.nssmf.rest;
import javax.net.ssl.HostnameVerifier;
import javax.net.ssl.SSLSession;
+@Deprecated
public class TrustAllHostNameVerifier implements HostnameVerifier {
public boolean verify(String hostname, SSLSession session) {
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/service/NssmfManagerService.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/service/NssmfManagerService.java
new file mode 100644
index 0000000000..92fe5576dd
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/service/NssmfManagerService.java
@@ -0,0 +1,45 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.service;
+
+import org.onap.so.adapters.nssmf.annotation.ServiceLogger;
+import org.onap.so.beans.nsmf.*;
+import org.springframework.http.ResponseEntity;
+import org.springframework.stereotype.Service;
+
+@Service
+@ServiceLogger
+public interface NssmfManagerService {
+ ResponseEntity allocateNssi(NssmfAdapterNBIRequest allocateRequest);
+
+ ResponseEntity deAllocateNssi(NssmfAdapterNBIRequest allocateRequest, String sliceProfileId);
+
+ ResponseEntity activateNssi(NssmfAdapterNBIRequest deActRequest, String snssai);
+
+ ResponseEntity deActivateNssi(NssmfAdapterNBIRequest nssiDeActivate, String snssai);
+
+ ResponseEntity queryJobStatus(NssmfAdapterNBIRequest jobReq, String jobId);
+
+ ResponseEntity queryNSSISelectionCapability(NssmfAdapterNBIRequest nbiRequest);
+
+ ResponseEntity querySubnetCapability(NssmfAdapterNBIRequest nbiRequest);
+
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/service/impl/NssmfManagerServiceImpl.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/service/impl/NssmfManagerServiceImpl.java
new file mode 100644
index 0000000000..5b53856f2f
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/service/impl/NssmfManagerServiceImpl.java
@@ -0,0 +1,143 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.service.impl;
+
+import org.apache.commons.lang3.StringUtils;
+import org.onap.so.adapters.nssmf.annotation.ServiceLogger;
+import org.onap.so.adapters.nssmf.config.NssmfAdapterConfig;
+import org.onap.so.adapters.nssmf.enums.ActionType;
+import org.onap.so.adapters.nssmf.exceptions.ApplicationException;
+import org.onap.so.adapters.nssmf.manager.NssmfManagerBuilder;
+import org.onap.so.adapters.nssmf.entity.RestResponse;
+import org.onap.so.adapters.nssmf.manager.NssmfManager;
+import org.onap.so.adapters.nssmf.service.NssmfManagerService;
+import org.onap.so.adapters.nssmf.util.RestUtil;
+import org.onap.so.beans.nsmf.*;
+import org.onap.so.db.request.data.repository.ResourceOperationStatusRepository;
+import org.springframework.beans.factory.annotation.Autowired;
+import org.springframework.http.ResponseEntity;
+import org.springframework.stereotype.Service;
+
+
+@Service
+@ServiceLogger
+public class NssmfManagerServiceImpl implements NssmfManagerService {
+
+ @Autowired
+ private RestUtil restUtil;
+
+ @Autowired
+ private ResourceOperationStatusRepository repository;
+
+ @Autowired
+ private NssmfAdapterConfig nssmfAdapterConfig;
+
+ @Override
+ public ResponseEntity allocateNssi(NssmfAdapterNBIRequest request) {
+ try {
+
+ if (StringUtils.isNotBlank(request.getServiceInfo().getNssiId())) {
+ return buildResponse(buildNssmfManager(request, ActionType.MODIFY).modifyNssi(request));
+ }
+
+ return buildResponse(buildNssmfManager(request, ActionType.ALLOCATE).allocateNssi(request));
+
+ } catch (ApplicationException e) {
+ return e.buildErrorResponse();
+ }
+ }
+
+ @Override
+ public ResponseEntity deAllocateNssi(NssmfAdapterNBIRequest request, String sliceProfileId) {
+ try {
+ return buildResponse(
+ buildNssmfManager(request, ActionType.DEALLOCATE).deAllocateNssi(request, sliceProfileId));
+ } catch (ApplicationException e) {
+ return e.buildErrorResponse();
+ }
+ }
+
+ @Override
+ public ResponseEntity activateNssi(NssmfAdapterNBIRequest request, String snssai) {
+ try {
+ return buildResponse(buildNssmfManager(request, ActionType.ACTIVATE).activateNssi(request, snssai));
+ } catch (ApplicationException e) {
+ return e.buildErrorResponse();
+ }
+ }
+
+ @Override
+ public ResponseEntity deActivateNssi(NssmfAdapterNBIRequest request, String snssai) {
+ try {
+ return buildResponse(buildNssmfManager(request, ActionType.DEACTIVATE).deActivateNssi(request, snssai));
+ } catch (ApplicationException e) {
+ return e.buildErrorResponse();
+ }
+ }
+
+ @Override
+ public ResponseEntity queryJobStatus(NssmfAdapterNBIRequest jobReq, String jobId) {
+ try {
+ return buildResponse(buildNssmfManager(jobReq, ActionType.QUERY_JOB_STATUS).queryJobStatus(jobReq, jobId));
+ } catch (ApplicationException e) {
+ return e.buildErrorResponse();
+ }
+ }
+
+ @Override
+ public ResponseEntity queryNSSISelectionCapability(NssmfAdapterNBIRequest nbiRequest) {
+ EsrInfo esrInfo = nbiRequest.getEsrInfo();
+ try {
+ return buildResponse(buildNssmfManager(esrInfo, ActionType.QUERY_NSSI_SELECTION_CAPABILITY, null)
+ .queryNSSISelectionCapability(nbiRequest));
+ } catch (ApplicationException e) {
+ return e.buildErrorResponse();
+ }
+ }
+
+ @Override
+ public ResponseEntity querySubnetCapability(NssmfAdapterNBIRequest nbiRequest) {
+ EsrInfo esrInfo = nbiRequest.getEsrInfo();
+ try {
+ return buildResponse(buildNssmfManager(esrInfo, ActionType.QUERY_SUB_NET_CAPABILITY, null)
+ .querySubnetCapability(nbiRequest));
+ } catch (ApplicationException e) {
+ return e.buildErrorResponse();
+ }
+ }
+
+ private ResponseEntity buildResponse(RestResponse rsp) {
+ return ResponseEntity.status(rsp.getStatus()).body(rsp.getResponseContent());
+ }
+
+
+ private NssmfManager buildNssmfManager(NssmfAdapterNBIRequest request, ActionType actionType)
+ throws ApplicationException {
+ return buildNssmfManager(request.getEsrInfo(), actionType, request.getServiceInfo());
+ }
+
+ private NssmfManager buildNssmfManager(EsrInfo esrInfo, ActionType actionType, ServiceInfo serviceInfo)
+ throws ApplicationException {
+
+ return new NssmfManagerBuilder(esrInfo).setActionType(actionType).setRepository(repository)
+ .setRestUtil(restUtil).setAdapterConfig(nssmfAdapterConfig).setServiceInfo(serviceInfo).build();
+ }
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/util/NssmfAdapterUtil.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/util/NssmfAdapterUtil.java
index 3a7c2f19df..090417ddc2 100644
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/util/NssmfAdapterUtil.java
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/util/NssmfAdapterUtil.java
@@ -22,10 +22,12 @@ package org.onap.so.adapters.nssmf.util;
import com.fasterxml.jackson.databind.ObjectMapper;
import java.io.IOException;
+import org.onap.so.adapters.nssmf.enums.ActionType;
import org.onap.so.adapters.nssmf.exceptions.ApplicationException;
import org.slf4j.Logger;
import org.slf4j.LoggerFactory;
import org.onap.logging.filter.base.ErrorCode;
+import org.springframework.stereotype.Component;
import static org.onap.so.logger.LoggingAnchor.THREE;
import static org.onap.so.logger.MessageEnum.RA_NS_EXC;
@@ -45,6 +47,8 @@ public class NssmfAdapterUtil {
public static final String ALLOCATE_NSS_SUCCESS = "Allocating nss is " + "successful";
+ public static final String MODIFY_NSS_SUCCESS = "Modify nss is " + "successful";
+
public static final String CREATE_NSS_SUCCESS = "Creating nss is " + "successful";
public static final String DEALLOCATE_NSS_SUCCESS = "Deallocate nss " + "is successful";
@@ -91,4 +95,29 @@ public class NssmfAdapterUtil {
}
}
+
+ public static String getStatusDesc(ActionType actionType) {
+ String desc = "";
+ switch (actionType) {
+ case ALLOCATE:
+ desc = StatusDesc.ALLOCATE_NSS_SUCCESS;
+ break;
+ case DEALLOCATE:
+ desc = StatusDesc.DEALLOCATE_NSS_SUCCESS;
+ break;
+ case ACTIVATE:
+ desc = StatusDesc.ACTIVATE_NSS_SUCCESS;
+ break;
+ case DEACTIVATE:
+ desc = StatusDesc.DEACTIVATE_NSS_SUCCESS;
+ break;
+ case MODIFY:
+ desc = StatusDesc.MODIFY_NSS_SUCCESS;
+ break;
+ default:
+ break;
+ }
+
+ return desc;
+ }
}
diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/RestUtil.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/util/RestUtil.java
index dcc6f5ba72..0c5999b20e 100644
--- a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/RestUtil.java
+++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/util/RestUtil.java
@@ -18,11 +18,9 @@
* ============LICENSE_END=========================================================
*/
-package org.onap.so.adapters.nssmf.rest;
+package org.onap.so.adapters.nssmf.util;
-import javax.net.ssl.SSLContext;
-import javax.net.ssl.TrustManager;
-import javax.net.ssl.X509TrustManager;
+import javax.net.ssl.*;
import javax.ws.rs.core.UriBuilder;
import java.net.SocketTimeoutException;
import java.net.URI;
@@ -30,32 +28,29 @@ import org.apache.http.Header;
import org.apache.http.HttpResponse;
import org.apache.http.client.HttpClient;
import org.apache.http.client.config.RequestConfig;
-import org.apache.http.client.methods.HttpEntityEnclosingRequestBase;
-import org.apache.http.client.methods.HttpGet;
-import org.apache.http.client.methods.HttpPost;
-import org.apache.http.client.methods.HttpPut;
-import org.apache.http.client.methods.HttpRequestBase;
+import org.apache.http.client.methods.*;
import org.apache.http.conn.ConnectTimeoutException;
import org.apache.http.conn.ssl.SSLConnectionSocketFactory;
import org.apache.http.entity.StringEntity;
import org.apache.http.impl.client.HttpClients;
import org.apache.http.message.BasicHeader;
import org.apache.http.util.EntityUtils;
-import org.onap.aai.domain.yang.EsrSystemInfo;
-import org.onap.aai.domain.yang.EsrSystemInfoList;
-import org.onap.aai.domain.yang.EsrThirdpartySdnc;
-import org.onap.aai.domain.yang.EsrThirdpartySdncList;
+import org.onap.aai.domain.yang.*;
import org.onap.so.adapters.nssmf.exceptions.ApplicationException;
import org.onap.so.adapters.nssmf.extclients.aai.AaiServiceProvider;
-import org.onap.so.adapters.nssmf.model.TokenRequest;
-import org.onap.so.adapters.nssmf.model.TokenResponse;
+import org.onap.so.adapters.nssmf.entity.TokenRequest;
+import org.onap.so.adapters.nssmf.entity.TokenResponse;
+import org.onap.so.adapters.nssmf.enums.HttpMethod;
+import org.onap.so.adapters.nssmf.entity.NssmfInfo;
+import org.onap.so.adapters.nssmf.entity.RestResponse;
import org.onap.so.beans.nsmf.EsrInfo;
+import org.onap.so.beans.nsmf.ServiceInfo;
import org.slf4j.Logger;
import org.slf4j.LoggerFactory;
import org.springframework.beans.factory.annotation.Autowired;
import org.springframework.stereotype.Component;
import static org.apache.http.entity.ContentType.APPLICATION_JSON;
-import static org.onap.so.adapters.nssmf.rest.HttpMethod.POST;
+import static org.onap.so.adapters.nssmf.enums.HttpMethod.POST;
import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.BAD_REQUEST;
import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.marshal;
import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.unMarshal;
@@ -77,6 +72,10 @@ public class RestUtil {
@Autowired
private AaiServiceProvider aaiSvcProv;
+ public void createServiceInstance(ServiceInstance serviceInstance, ServiceInfo serviceInfo) {
+ aaiSvcProv.invokeCreateServiceInstance(serviceInstance, serviceInfo.getGlobalSubscriberId(),
+ serviceInfo.getSubscriptionServiceType(), serviceInfo.getNssiId());
+ }
public NssmfInfo getNssmfHost(EsrInfo esrInfo) throws ApplicationException {
EsrThirdpartySdncList sdncList = aaiSvcProv.invokeGetThirdPartySdncList();
@@ -112,10 +111,9 @@ public class RestUtil {
throw new ApplicationException(BAD_REQUEST, "ESR information is improper");
}
- public RestResponse sendRequest(String url, HttpMethod methodType, String content, EsrInfo esrInfo)
- throws ApplicationException {
- NssmfInfo nssmfInfo = getNssmfHost(esrInfo);
+ public String getToken(NssmfInfo nssmfInfo) throws ApplicationException {
+
TokenRequest req = new TokenRequest();
req.setGrantType("password");
@@ -128,13 +126,12 @@ public class RestUtil {
RestResponse tokenRes = send(nssmfInfo.getUrl() + TOKEN_URL, POST, tokenReq, null);
TokenResponse res = unMarshal(tokenRes.getResponseContent(), TokenResponse.class);
- String token = res.getAccessToken();
- Header header = new BasicHeader("X-Auth-Token", token);
- String nssmfUrl = nssmfInfo.getUrl() + url;
- return send(nssmfUrl, methodType, content, header);
+
+ return res.getAccessToken();
}
- private RestResponse send(String url, HttpMethod methodType, String content, Header header) {
+
+ public RestResponse send(String url, HttpMethod methodType, String content, Header header) {
HttpRequestBase req = null;
HttpResponse res = null;
@@ -168,8 +165,6 @@ public class RestUtil {
}
if (null != req) {
req.reset();
- } else {
- logger.debug("method is NULL:");
}
req = null;
@@ -201,7 +196,7 @@ public class RestUtil {
}
}
- private RestResponse createResponse(int statusCode, String errMsg) {
+ public RestResponse createResponse(int statusCode, String errMsg) {
RestResponse restResponse = new RestResponse();
restResponse.setStatus(statusCode);
restResponse.setResponseContent(errMsg);
@@ -210,7 +205,7 @@ public class RestUtil {
private HttpRequestBase getHttpReq(String url, HttpMethod method, Header header, RequestConfig config,
String content) throws ApplicationException {
- HttpRequestBase base = null;
+ HttpRequestBase base;
switch (method) {
case POST:
HttpPost post = new HttpPost(url);
@@ -229,6 +224,7 @@ public class RestUtil {
break;
case PATCH:
+ base = new HttpPatch(url);
break;
case DELETE:
@@ -238,6 +234,8 @@ public class RestUtil {
}
base = delete;
break;
+ default:
+ throw new ApplicationException(404, "invalid method: " + method);
}
base.setConfig(config);
@@ -247,6 +245,14 @@ public class RestUtil {
return base;
}
+ public RestResponse sendRequest(String allocateUrl, HttpMethod post, String allocateReq, EsrInfo esrInfo)
+ throws ApplicationException {
+ NssmfInfo nssmfInfo = getNssmfHost(esrInfo);
+ Header header = new BasicHeader("X-Auth-Token", getToken(nssmfInfo));
+ String nssmfUrl = nssmfInfo.getUrl() + allocateUrl;
+ return send(nssmfUrl, post, allocateReq, header);
+ }
+
class HttpDeleteWithBody extends HttpEntityEnclosingRequestBase {
public static final String METHOD_NAME = "DELETE";
@@ -289,7 +295,7 @@ public class RestUtil {
// HttpsURLConnection.setDefaultSSLSocketFactory(sc.getSocketFactory());
SSLConnectionSocketFactory sslsf =
- new SSLConnectionSocketFactory(sc, new String[] {"TLSv1"}, null, new TrustAllHostNameVerifier());
+ new SSLConnectionSocketFactory(sc, new String[] {"TLSv1"}, null, (s, sslSession) -> true);
return HttpClients.custom().setSSLSocketFactory(sslsf).build();
} catch (Exception e) {
throw new IllegalArgumentException(e);
diff --git a/adapters/mso-nssmf-adapter/src/main/resources/application-test.yaml b/adapters/mso-nssmf-adapter/src/main/resources/application-test.yaml
new file mode 100644
index 0000000000..8e10dfb72b
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/resources/application-test.yaml
@@ -0,0 +1,60 @@
+
+aai:
+ auth: 2A11B07DB6214A839394AA1EC5844695F5114FC407FF5422625FB00175A3DCB8A1FF745F22867EFA72D5369D599BBD88DA8BED4233CF5586
+ endpoint: https://aai.onap:30233
+logging:
+ path: logs
+
+spring:
+ datasource:
+ jdbcUrl: jdbc:mariadb://49.232.146.162:8989/requestdb
+ username: root
+ password: 123456
+ driver-class-name: org.mariadb.jdbc.Driver
+ initialization-mode: always
+ jpa:
+ generate-ddl: false
+ show-sql: false
+ hibernate:
+ ddl-auto: none
+ naming-strategy: org.hibernate.cfg.ImprovedNamingStrategy
+ enable-lazy-load-no-trans: true
+ database-platform: org.hibernate.dialect.MySQL5InnoDBDialect
+ security:
+ usercredentials:
+ - username: bpel
+ password: '$2a$10$Fh9ffgPw2vnmsghsRD3ZauBL1aKXebigbq3BB1RPWtE62UDILsjke'
+ role: BPEL-Client
+ - username: mso_admin
+ password: '$2a$10$Fh9ffgPw2vnmsghsRD3ZauBL1aKXebigbq3BB1RPWtE62UDILsjke'
+ role: ACTUATOR
+server:
+ port: 8080
+ tomcat:
+ max-threads: 50
+
+mso:
+ key: 07a7159d3bf51a0e53be7a8f89699be7
+ site-name: localSite
+ logPath: ./logs/nssmf
+ adapters:
+ requestDb:
+ endpoint: https://so-request-db-adapter.onap:8083
+ auth: Basic YnBlbDpwYXNzd29yZDEk
+ infra:
+ endpoint: https://so.onap:8080
+ auth: Basic SW5mcmFQb3J0YWxDbGllbnQ6cGFzc3dvcmQxJA==
+
+#Actuator
+management:
+ endpoints:
+ web:
+ base-path: /manage
+ exposure:
+ include: "*"
+ metrics:
+ se-global-registry: false
+ export:
+ prometheus:
+ enabled: true # Whether exporting of metrics to Prometheus is enabled.
+ step: 1m # Step size (i.e. reporting frequency) to use. \ No newline at end of file
diff --git a/adapters/mso-nssmf-adapter/src/main/resources/application.yaml b/adapters/mso-nssmf-adapter/src/main/resources/application.yaml
index 303d63d4a2..8da911d4e0 100644
--- a/adapters/mso-nssmf-adapter/src/main/resources/application.yaml
+++ b/adapters/mso-nssmf-adapter/src/main/resources/application.yaml
@@ -58,6 +58,9 @@ mso:
requestDb:
endpoint: https://so-request-db-adapter.{{ include "common.namespace" . }}:8083
auth: Basic YnBlbDpwYXNzd29yZDEk
+ infra:
+ endpoint: https://so.{{ include "common.namespace" . }}:8080
+ auth: Basic SW5mcmFQb3J0YWxDbGllbnQ6cGFzc3dvcmQxJA==
#Actuator
management:
diff --git a/adapters/mso-nssmf-adapter/src/test/java/org/onap/so/adapters/nssmf/NssmfAdapterRestTest.java b/adapters/mso-nssmf-adapter/src/test/java/org/onap/so/adapters/nssmf/NssmfAdapterRestTest.java
index 5bfd39096c..67cd913b3e 100644
--- a/adapters/mso-nssmf-adapter/src/test/java/org/onap/so/adapters/nssmf/NssmfAdapterRestTest.java
+++ b/adapters/mso-nssmf-adapter/src/test/java/org/onap/so/adapters/nssmf/NssmfAdapterRestTest.java
@@ -24,6 +24,7 @@ import java.io.ByteArrayInputStream;
import java.io.InputStream;
import java.util.LinkedList;
import java.util.List;
+import org.apache.http.Header;
import org.apache.http.HttpEntity;
import org.apache.http.HttpResponse;
import org.apache.http.StatusLine;
@@ -35,12 +36,12 @@ import org.junit.runner.RunWith;
import org.mockito.Mock;
import org.mockito.invocation.InvocationOnMock;
import org.mockito.stubbing.Answer;
-import org.onap.so.adapters.nssmf.model.TokenResponse;
-import org.onap.so.adapters.nssmf.rest.HttpMethod;
+import org.onap.so.adapters.nssmf.entity.TokenResponse;
+import org.onap.so.adapters.nssmf.enums.HttpMethod;
import org.onap.so.adapters.nssmf.rest.NssmfAdapterRest;
-import org.onap.so.adapters.nssmf.rest.NssmfInfo;
+import org.onap.so.adapters.nssmf.entity.NssmfInfo;
import org.onap.so.adapters.nssmf.rest.NssmfManager;
-import org.onap.so.adapters.nssmf.rest.RestUtil;
+import org.onap.so.adapters.nssmf.util.RestUtil;
import org.onap.so.beans.nsmf.ActDeActNssi;
import org.onap.so.beans.nsmf.AllocateCnNssi;
import org.onap.so.beans.nsmf.CnSliceProfile;
@@ -53,7 +54,7 @@ import org.onap.so.beans.nsmf.NssiAllocateRequest;
import org.onap.so.beans.nsmf.NssiDeAllocateRequest;
import org.onap.so.beans.nsmf.NssiResponse;
import org.onap.so.beans.nsmf.PerfReq;
-import org.onap.so.beans.nsmf.PerfReqEmbbList;
+import org.onap.so.beans.nsmf.PerfReqEmbb;
import org.onap.so.db.request.data.repository.ResourceOperationStatusRepository;
import org.springframework.http.ResponseEntity;
import org.springframework.test.context.junit4.SpringRunner;
@@ -127,13 +128,16 @@ public class NssmfAdapterRestTest {
}
private void createCommonMock(int statusCode, NssmfInfo nssmf) throws Exception {
+ when(this.restUtil.send(any(String.class), any(HttpMethod.class), any(String.class), any(Header.class)))
+ .thenCallRealMethod();
+ when(this.restUtil.createResponse(any(Integer.class), any(String.class))).thenCallRealMethod();
when(nssmfRest.getNssmfMgr()).thenReturn(nssmfMgr);
- when(nssmfRest.allocateNssi(any(NssiAllocateRequest.class))).thenCallRealMethod();
- when(nssmfRest.deAllocateNssi(any(NssiDeAllocateRequest.class), any(String.class))).thenCallRealMethod();
- when(nssmfRest.activateNssi(any(NssiActDeActRequest.class), any(String.class))).thenCallRealMethod();
- when(nssmfRest.deactivateNssi(any(NssiActDeActRequest.class), any(String.class))).thenCallRealMethod();
-
- when(nssmfRest.queryJobStatus(any(JobStatusRequest.class), any(String.class))).thenCallRealMethod();
+ // when(nssmfRest.createAllocateNssi(any(NssiAllocateRequest.class))).thenCallRealMethod();
+ // when(nssmfRest.deAllocateNssi(any(NssiDeAllocateRequest.class), any(String.class))).thenCallRealMethod();
+ // when(nssmfRest.activateNssi(any(NssiActDeActRequest.class), any(String.class))).thenCallRealMethod();
+ // when(nssmfRest.deactivateNssi(any(NssiActDeActRequest.class), any(String.class))).thenCallRealMethod();
+ //
+ // when(nssmfRest.queryJobStatus(any(JobStatusRequest.class), any(String.class))).thenCallRealMethod();
when(restUtil.sendRequest(any(String.class), any(HttpMethod.class), any(String.class), any(EsrInfo.class)))
.thenCallRealMethod();
when(restUtil.getHttpsClient()).thenReturn(httpClient);
@@ -168,113 +172,113 @@ public class NssmfAdapterRestTest {
doAnswer(answer).when(httpClient).execute(any(HttpRequestBase.class));
}
- @Test
- public void testNssiAllocate() throws Exception {
- NssmfInfo nssmf = new NssmfInfo();
- nssmf.setUserName("nssmf-user");
- nssmf.setPassword("nssmf-pass");
- nssmf.setPort("8080");
- nssmf.setIpAddress("127.0.0.1");
-
- NssiResponse nssiRes = new NssiResponse();
- nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067");
- nssiRes.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
-
- TokenResponse token = new TokenResponse();
- token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39");
- token.setExpires(1800);
-
- postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8));
- tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8));
-
- createCommonMock(200, nssmf);
- // assertEquals(prettyPrint(allocateNssi()), ALLOCATE);
- ResponseEntity res = nssmfRest.allocateNssi(allocateNssi());
- assertNotNull(res);
- assertNotNull(res.getBody());
- NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class);
- assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067");
- assertEquals(allRes.getNssiId(), "NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
- }
-
- @Test
- public void testNssiDeAllocate() throws Exception {
- NssmfInfo nssmf = new NssmfInfo();
- nssmf.setUserName("nssmf-user");
- nssmf.setPassword("nssmf-pass");
- nssmf.setPort("8080");
- nssmf.setIpAddress("127.0.0.1");
-
- NssiResponse nssiRes = new NssiResponse();
- nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067");
-
- TokenResponse token = new TokenResponse();
- token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39");
- token.setExpires(1800);
-
- postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8));
- tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8));
-
- createCommonMock(200, nssmf);
- ResponseEntity res = nssmfRest.deAllocateNssi(deAllocateNssi(), "ab9af40f13f721b5f13539d87484098");
- assertNotNull(res);
- assertNotNull(res.getBody());
- NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class);
- assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067");
- }
-
- @Test
- public void testNssiActivate() throws Exception {
- NssmfInfo nssmf = new NssmfInfo();
- nssmf.setUserName("nssmf-user");
- nssmf.setPassword("nssmf-pass");
- nssmf.setPort("8080");
- nssmf.setIpAddress("127.0.0.1");
-
- NssiResponse nssiRes = new NssiResponse();
- nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067");
-
- TokenResponse token = new TokenResponse();
- token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39");
- token.setExpires(1800);
-
- postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8));
- tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8));
-
- createCommonMock(200, nssmf);
- ResponseEntity res = nssmfRest.activateNssi(activateNssi(), "001-100001");
- assertNotNull(res);
- assertNotNull(res.getBody());
- NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class);
- assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067");
- }
-
- @Test
- public void testNssiDeActivate() throws Exception {
- NssmfInfo nssmf = new NssmfInfo();
- nssmf.setUserName("nssmf-user");
- nssmf.setPassword("nssmf-pass");
- nssmf.setPort("8080");
- nssmf.setIpAddress("127.0.0.1");
-
- NssiResponse nssiRes = new NssiResponse();
- nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067");
-
- TokenResponse token = new TokenResponse();
- token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39");
- token.setExpires(1800);
-
- postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8));
- tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8));
-
- createCommonMock(200, nssmf);
- ResponseEntity res = nssmfRest.deactivateNssi(deActivateNssi(), "001-100001");
- assertNotNull(res);
- assertNotNull(res.getBody());
- NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class);
- assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067");
- }
-
+ // @Test
+ // public void testNssiAllocate() throws Exception {
+ // NssmfInfo nssmf = new NssmfInfo();
+ // nssmf.setUserName("nssmf-user");
+ // nssmf.setPassword("nssmf-pass");
+ // nssmf.setPort("8080");
+ // nssmf.setIpAddress("127.0.0.1");
+ //
+ // NssiResponse nssiRes = new NssiResponse();
+ // nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067");
+ // nssiRes.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
+ //
+ // TokenResponse token = new TokenResponse();
+ // token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39");
+ // token.setExpires(1800);
+ //
+ // postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8));
+ // tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8));
+ //
+ // createCommonMock(200, nssmf);
+ // // assertEquals(prettyPrint(createAllocateNssi()), ALLOCATE);
+ // ResponseEntity res = nssmfRest.createAllocateNssi(createAllocateNssi());
+ // assertNotNull(res);
+ // assertNotNull(res.getBody());
+ // NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class);
+ // assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067");
+ // assertEquals(allRes.getNssiId(), "NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
+ // }
+ //
+ // @Test
+ // public void testNssiDeAllocate() throws Exception {
+ // NssmfInfo nssmf = new NssmfInfo();
+ // nssmf.setUserName("nssmf-user");
+ // nssmf.setPassword("nssmf-pass");
+ // nssmf.setPort("8080");
+ // nssmf.setIpAddress("127.0.0.1");
+ //
+ // NssiResponse nssiRes = new NssiResponse();
+ // nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067");
+ //
+ // TokenResponse token = new TokenResponse();
+ // token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39");
+ // token.setExpires(1800);
+ //
+ // postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8));
+ // tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8));
+ //
+ // createCommonMock(200, nssmf);
+ // ResponseEntity res = nssmfRest.deAllocateNssi(deAllocateNssi(), "ab9af40f13f721b5f13539d87484098");
+ // assertNotNull(res);
+ // assertNotNull(res.getBody());
+ // NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class);
+ // assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067");
+ // }
+ //
+ // @Test
+ // public void testNssiActivate() throws Exception {
+ // NssmfInfo nssmf = new NssmfInfo();
+ // nssmf.setUserName("nssmf-user");
+ // nssmf.setPassword("nssmf-pass");
+ // nssmf.setPort("8080");
+ // nssmf.setIpAddress("127.0.0.1");
+ //
+ // NssiResponse nssiRes = new NssiResponse();
+ // nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067");
+ //
+ // TokenResponse token = new TokenResponse();
+ // token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39");
+ // token.setExpires(1800);
+ //
+ // postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8));
+ // tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8));
+ //
+ // createCommonMock(200, nssmf);
+ // ResponseEntity res = nssmfRest.activateNssi(activateNssi(), "001-100001");
+ // assertNotNull(res);
+ // assertNotNull(res.getBody());
+ // NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class);
+ // assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067");
+ // }
+ //
+ // @Test
+ // public void testNssiDeActivate() throws Exception {
+ // NssmfInfo nssmf = new NssmfInfo();
+ // nssmf.setUserName("nssmf-user");
+ // nssmf.setPassword("nssmf-pass");
+ // nssmf.setPort("8080");
+ // nssmf.setIpAddress("127.0.0.1");
+ //
+ // NssiResponse nssiRes = new NssiResponse();
+ // nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067");
+ //
+ // TokenResponse token = new TokenResponse();
+ // token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39");
+ // token.setExpires(1800);
+ //
+ // postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8));
+ // tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8));
+ //
+ // createCommonMock(200, nssmf);
+ // ResponseEntity res = nssmfRest.deactivateNssi(deActivateNssi(), "001-100001");
+ // assertNotNull(res);
+ // assertNotNull(res.getBody());
+ // NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class);
+ // assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067");
+ // }
+ //
@Test
public void testAllocateJsonSerDeSer() throws Exception {
assertEquals(marshal(allocateNssi()), ALLOCATE);
@@ -285,7 +289,7 @@ public class NssmfAdapterRestTest {
assertEquals(all.getAllocateCnNssi().getSliceProfile().getResourceSharingLevel(), NON_SHARED);
assertNotNull(all.getAllocateCnNssi().getSliceProfile().getPerfReq());
assertNotNull(all.getAllocateCnNssi().getSliceProfile().getPerfReq().getPerfReqEmbbList());
- PerfReqEmbbList embb =
+ PerfReqEmbb embb =
all.getAllocateCnNssi().getSliceProfile().getPerfReq().getPerfReqEmbbList().iterator().next();
assertNotNull(embb);
assertEquals(embb.getActivityFactor(), 50);
@@ -298,9 +302,9 @@ public class NssmfAdapterRestTest {
List<String> plmn = new LinkedList<>();
plmn.add("460-00");
plmn.add("460-01");
- PerfReqEmbbList embb = new PerfReqEmbbList();
+ PerfReqEmbb embb = new PerfReqEmbb();
embb.setActivityFactor(50);
- List<PerfReqEmbbList> embbList = new LinkedList<>();
+ List<PerfReqEmbb> embbList = new LinkedList<>();
embbList.add(embb);
PerfReq perfReq = new PerfReq();
perfReq.setPerfReqEmbbList(embbList);
@@ -334,50 +338,51 @@ public class NssmfAdapterRestTest {
return allocate;
}
- public NssiDeAllocateRequest deAllocateNssi() throws Exception {
- DeAllocateNssi deAllocateNssi = new DeAllocateNssi();
- deAllocateNssi.setTerminateNssiOption(0);
- List<String> snssai = new LinkedList<>();
- snssai.add("001-100001");
- deAllocateNssi.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX");
- deAllocateNssi.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
- deAllocateNssi.setScriptName("CN1");
- deAllocateNssi.setSnssaiList(snssai);
- EsrInfo esrInfo = new EsrInfo();
- esrInfo.setVendor("huawei");
- esrInfo.setNetworkType(CORE);
- NssiDeAllocateRequest deAllocate = new NssiDeAllocateRequest();
- deAllocate.setDeAllocateNssi(deAllocateNssi);
- deAllocate.setEsrInfo(esrInfo);
- return deAllocate;
- }
-
- public NssiActDeActRequest activateNssi() throws Exception {
- EsrInfo esrInfo = new EsrInfo();
- esrInfo.setVendor("huawei");
- esrInfo.setNetworkType(CORE);
- ActDeActNssi act = new ActDeActNssi();
- act.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX");
- act.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
- NssiActDeActRequest actReq = new NssiActDeActRequest();
- actReq.setActDeActNssi(act);
- actReq.setEsrInfo(esrInfo);
- return actReq;
- }
-
- public NssiActDeActRequest deActivateNssi() throws Exception {
- EsrInfo esrInfo = new EsrInfo();
- esrInfo.setVendor("huawei");
- esrInfo.setNetworkType(CORE);
- ActDeActNssi deAct = new ActDeActNssi();
- deAct.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX");
- deAct.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
- NssiActDeActRequest deActReq = new NssiActDeActRequest();
- deActReq.setActDeActNssi(deAct);
- deActReq.setEsrInfo(esrInfo);
- return deActReq;
- }
-
+ //
+ // public NssiDeAllocateRequest deAllocateNssi() throws Exception {
+ // DeAllocateNssi deAllocateNssi = new DeAllocateNssi();
+ // deAllocateNssi.setTerminateNssiOption(0);
+ // List<String> snssai = new LinkedList<>();
+ // snssai.add("001-100001");
+ // deAllocateNssi.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX");
+ // deAllocateNssi.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
+ // deAllocateNssi.setScriptName("CN1");
+ // deAllocateNssi.setSnssaiList(snssai);
+ // EsrInfo esrInfo = new EsrInfo();
+ // esrInfo.setVendor("huawei");
+ // esrInfo.setNetworkType(CORE);
+ // NssiDeAllocateRequest deAllocate = new NssiDeAllocateRequest();
+ // deAllocate.setDeAllocateNssi(deAllocateNssi);
+ // deAllocate.setEsrInfo(esrInfo);
+ // return deAllocate;
+ // }
+ //
+ // public NssiActDeActRequest activateNssi() throws Exception {
+ // EsrInfo esrInfo = new EsrInfo();
+ // esrInfo.setVendor("huawei");
+ // esrInfo.setNetworkType(CORE);
+ // ActDeActNssi act = new ActDeActNssi();
+ // act.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX");
+ // act.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
+ // NssiActDeActRequest actReq = new NssiActDeActRequest();
+ // actReq.setActDeActNssi(act);
+ // actReq.setEsrInfo(esrInfo);
+ // return actReq;
+ // }
+ //
+ // public NssiActDeActRequest deActivateNssi() throws Exception {
+ // EsrInfo esrInfo = new EsrInfo();
+ // esrInfo.setVendor("huawei");
+ // esrInfo.setNetworkType(CORE);
+ // ActDeActNssi deAct = new ActDeActNssi();
+ // deAct.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX");
+ // deAct.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
+ // NssiActDeActRequest deActReq = new NssiActDeActRequest();
+ // deActReq.setActDeActNssi(deAct);
+ // deActReq.setEsrInfo(esrInfo);
+ // return deActReq;
+ // }
+ //
public String queryJobStatusNssi() throws Exception {
EsrInfo esrInfo = new EsrInfo();
esrInfo.setVendor("huawei");
diff --git a/adapters/mso-nssmf-adapter/src/test/java/org/onap/so/adapters/nssmf/service/impl/NssmfManagerServiceImplTest.java b/adapters/mso-nssmf-adapter/src/test/java/org/onap/so/adapters/nssmf/service/impl/NssmfManagerServiceImplTest.java
new file mode 100644
index 0000000000..4a659e1ca3
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/test/java/org/onap/so/adapters/nssmf/service/impl/NssmfManagerServiceImplTest.java
@@ -0,0 +1,438 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2020, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf.service.impl;
+
+
+import org.apache.http.Header;
+import org.apache.http.HttpEntity;
+import org.apache.http.HttpResponse;
+import org.apache.http.StatusLine;
+import org.apache.http.client.HttpClient;
+import org.apache.http.client.methods.HttpRequestBase;
+import org.junit.Before;
+import org.junit.Test;
+import org.junit.runner.RunWith;
+import org.mockito.Mock;
+import org.mockito.stubbing.Answer;
+import org.onap.so.adapters.nssmf.consts.NssmfAdapterConsts;
+import org.onap.so.adapters.nssmf.entity.NssmfInfo;
+import org.onap.so.adapters.nssmf.entity.TokenResponse;
+import org.onap.so.adapters.nssmf.enums.HttpMethod;
+import org.onap.so.adapters.nssmf.util.RestUtil;
+import org.onap.so.beans.nsmf.*;
+import org.onap.so.db.request.beans.ResourceOperationStatus;
+import org.onap.so.db.request.data.repository.ResourceOperationStatusRepository;
+import org.springframework.http.ResponseEntity;
+import org.springframework.test.context.junit4.SpringRunner;
+import java.io.ByteArrayInputStream;
+import java.io.InputStream;
+import java.lang.reflect.Field;
+import java.util.*;
+import static java.nio.charset.StandardCharsets.UTF_8;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertNotNull;
+import static org.mockito.ArgumentMatchers.any;
+import static org.mockito.Mockito.doAnswer;
+import static org.mockito.Mockito.when;
+import static org.mockito.MockitoAnnotations.initMocks;
+import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.marshal;
+import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.unMarshal;
+import static org.onap.so.beans.nsmf.NetworkType.CORE;
+import static org.onap.so.beans.nsmf.ResourceSharingLevel.NON_SHARED;
+
+@RunWith(SpringRunner.class)
+public class NssmfManagerServiceImplTest {
+
+ @Mock
+ private RestUtil restUtil;
+
+
+ private NssmfManagerServiceImpl nssiManagerService;
+
+ @Mock
+ private HttpResponse tokenResponse;
+
+ @Mock
+ private HttpEntity tokenEntity;
+
+ @Mock
+ private HttpResponse commonResponse;
+
+ @Mock
+ private HttpEntity commonEntity;
+
+ @Mock
+ private StatusLine statusLine;
+
+ @Mock
+ private HttpClient httpClient;
+
+ private InputStream postStream;
+
+ private InputStream tokenStream;
+
+ @Mock
+ private ResourceOperationStatusRepository repository;
+
+ @Before
+ public void setUp() throws Exception {
+ initMocks(this);
+
+ nssiManagerService = new NssmfManagerServiceImpl();
+
+ Field restUtil = nssiManagerService.getClass().getDeclaredField("restUtil");
+ restUtil.setAccessible(true);
+ restUtil.set(nssiManagerService, this.restUtil);
+
+ Field repository = nssiManagerService.getClass().getDeclaredField("repository");
+ repository.setAccessible(true);
+ repository.set(nssiManagerService, this.repository);
+ // nssiManagerService.setRestUtil(this.restUtil);
+
+ when(this.restUtil.send(any(String.class), any(HttpMethod.class), any(), any(Header.class)))
+ .thenCallRealMethod();
+ when(this.restUtil.createResponse(any(Integer.class), any(String.class))).thenCallRealMethod();
+ }
+
+ private void createCommonMock(int statusCode, NssmfInfo nssmf) throws Exception {
+ when(restUtil.getToken(any(NssmfInfo.class))).thenReturn("7512eb3feb5249eca5ddd742fedddd39");
+ when(restUtil.getHttpsClient()).thenReturn(httpClient);
+
+ when(statusLine.getStatusCode()).thenReturn(statusCode);
+ when(restUtil.getNssmfHost(any(EsrInfo.class))).thenReturn(nssmf);
+
+ when(tokenResponse.getEntity()).thenReturn(tokenEntity);
+ when(tokenResponse.getStatusLine()).thenReturn(statusLine);
+ when(tokenEntity.getContent()).thenReturn(tokenStream);
+
+ when(commonResponse.getEntity()).thenReturn(commonEntity);
+ when(commonResponse.getStatusLine()).thenReturn(statusLine);
+ when(commonEntity.getContent()).thenReturn(postStream);
+
+ Answer<HttpResponse> answer = invocation -> {
+ Object[] arguments = invocation.getArguments();
+ if (arguments != null && arguments.length == 1 && arguments[0] != null) {
+
+ HttpRequestBase base = (HttpRequestBase) arguments[0];
+ if (base.getURI().toString().endsWith("/oauth/token")) {
+ return tokenResponse;
+ } else {
+ return commonResponse;
+ }
+ }
+ return commonResponse;
+ };
+
+ doAnswer(answer).when(httpClient).execute(any(HttpRequestBase.class));
+
+ }
+
+ @Test
+ public void allocateNssi() throws Exception {
+
+ NssmfInfo nssmf = new NssmfInfo();
+ nssmf.setUserName("nssmf-user");
+ nssmf.setPassword("nssmf-pass");
+ nssmf.setPort("8080");
+ nssmf.setIpAddress("127.0.0.1");
+ nssmf.setUrl("http://127.0.0.1:8080");
+
+ NssiResponse nssiRes = new NssiResponse();
+ nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067");
+ nssiRes.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
+
+ TokenResponse token = new TokenResponse();
+ token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39");
+ token.setExpires(1800);
+
+ postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8));
+ tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8));
+
+ createCommonMock(200, nssmf);
+
+
+ NssmfAdapterNBIRequest nbiRequest = createAllocateNssi();
+ assertNotNull(nbiRequest);
+ System.out.println(marshal(nbiRequest));
+ ResponseEntity res = nssiManagerService.allocateNssi(nbiRequest);
+ assertNotNull(res);
+ assertNotNull(res.getBody());
+ NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class);
+ assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067");
+ assertEquals(allRes.getNssiId(), "NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
+
+ System.out.println(res);
+ }
+
+
+
+ private NssmfAdapterNBIRequest createAllocateNssi() {
+ CnSliceProfile sP = new CnSliceProfile();
+ List<String> sns = new LinkedList<>();
+ sns.add("001-100001");
+ List<String> plmn = new LinkedList<>();
+ plmn.add("460-00");
+ plmn.add("460-01");
+ PerfReqEmbb embb = new PerfReqEmbb();
+ embb.setActivityFactor(50);
+ List<PerfReqEmbb> embbList = new LinkedList<>();
+ embbList.add(embb);
+ PerfReq perfReq = new PerfReq();
+ perfReq.setPerfReqEmbbList(embbList);
+ List<String> taList = new LinkedList<>();
+ taList.add("1");
+ taList.add("2");
+ taList.add("3");
+ sP.setSnssaiList(sns);
+ sP.setSliceProfileId("ab9af40f13f721b5f13539d87484098");
+ sP.setPlmnIdList(plmn);
+ sP.setPerfReq(perfReq);
+ sP.setMaxNumberofUEs(200);
+ sP.setCoverageAreaTAList(taList);
+ sP.setLatency(6);
+ sP.setResourceSharingLevel(NON_SHARED);
+ NsiInfo nsiInfo = new NsiInfo();
+ nsiInfo.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX");
+ nsiInfo.setNsiName("eMBB-001");
+ AllocateCnNssi cnNssi = new AllocateCnNssi();
+ cnNssi.setNssiId("NSST-C-001-HDBNJ-NSSMF-01-A-ZX");
+ cnNssi.setNssiName("eMBB-001");
+ cnNssi.setScriptName("CN1");
+ cnNssi.setSliceProfile(sP);
+ cnNssi.setNsiInfo(nsiInfo);
+
+ NssmfAdapterNBIRequest nbiRequest = createNbiRequest();
+ nbiRequest.setAllocateCnNssi(cnNssi);
+ return nbiRequest;
+ }
+
+ @Test
+ public void deAllocateNssi() throws Exception {
+ DeAllocateNssi deAllocateNssi = new DeAllocateNssi();
+ deAllocateNssi.setTerminateNssiOption(0);
+ List<String> snssai = new LinkedList<>();
+ snssai.add("001-100001");
+ deAllocateNssi.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX");
+ deAllocateNssi.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
+ deAllocateNssi.setScriptName("CN1");
+ deAllocateNssi.setSnssaiList(snssai);
+
+ NssmfAdapterNBIRequest nbiRequest = createNbiRequest();
+ nbiRequest.setDeAllocateNssi(deAllocateNssi);
+
+ NssmfInfo nssmf = new NssmfInfo();
+ nssmf.setUserName("nssmf-user");
+ nssmf.setPassword("nssmf-pass");
+ nssmf.setPort("8080");
+ nssmf.setIpAddress("127.0.0.1");
+
+ NssiResponse nssiRes = new NssiResponse();
+ nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067");
+
+ TokenResponse token = new TokenResponse();
+ token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39");
+ token.setExpires(1800);
+
+ postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8));
+ tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8));
+
+ createCommonMock(202, nssmf);
+ ResponseEntity res = nssiManagerService.deAllocateNssi(nbiRequest, "ab9af40f13f721b5f13539d87484098");
+ assertNotNull(res);
+ assertNotNull(res.getBody());
+ NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class);
+ assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067");
+ assertNotNull(res);
+ assertNotNull(res.getBody());
+ }
+
+ @Test
+ public void activateNssi() throws Exception {
+ NssmfInfo nssmf = new NssmfInfo();
+ nssmf.setUserName("nssmf-user");
+ nssmf.setPassword("nssmf-pass");
+ nssmf.setPort("8080");
+ nssmf.setIpAddress("127.0.0.1");
+
+ NssiResponse nssiRes = new NssiResponse();
+ nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067");
+
+ TokenResponse token = new TokenResponse();
+ token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39");
+ token.setExpires(1800);
+
+ postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8));
+ tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8));
+
+ ActDeActNssi act = new ActDeActNssi();
+ act.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX");
+ act.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
+
+ NssmfAdapterNBIRequest nbiRequest = createNbiRequest();
+ nbiRequest.setActDeActNssi(act);
+
+ createCommonMock(200, nssmf);
+ ResponseEntity res = nssiManagerService.activateNssi(nbiRequest, "001-100001");
+ assertNotNull(res);
+ assertNotNull(res.getBody());
+ NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class);
+ assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067");
+ }
+
+ @Test
+ public void deActivateNssi() throws Exception {
+ NssmfInfo nssmf = new NssmfInfo();
+ nssmf.setUserName("nssmf-user");
+ nssmf.setPassword("nssmf-pass");
+ nssmf.setPort("8080");
+ nssmf.setIpAddress("127.0.0.1");
+
+ NssiResponse nssiRes = new NssiResponse();
+ nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067");
+
+ TokenResponse token = new TokenResponse();
+ token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39");
+ token.setExpires(1800);
+
+ postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8));
+ tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8));
+
+ ActDeActNssi act = new ActDeActNssi();
+ act.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX");
+ act.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
+
+ NssmfAdapterNBIRequest nbiRequest = createNbiRequest();
+ nbiRequest.setActDeActNssi(act);
+
+ createCommonMock(200, nssmf);
+ ResponseEntity res = nssiManagerService.deActivateNssi(nbiRequest, "001-100001");
+ assertNotNull(res);
+ assertNotNull(res.getBody());
+ NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class);
+ assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067");
+ }
+
+ @Test
+ public void queryJobStatus() throws Exception {
+ NssmfInfo nssmf = new NssmfInfo();
+ nssmf.setUserName("nssmf-user");
+ nssmf.setPassword("nssmf-pass");
+ nssmf.setPort("8080");
+ nssmf.setIpAddress("127.0.0.1");
+
+ JobStatusResponse jobStatusResponse = new JobStatusResponse();
+ ResponseDescriptor descriptor = new ResponseDescriptor();
+ descriptor.setResponseId("7512eb3feb5249eca5ddd742fedddd39");
+ descriptor.setProgress(20);
+ descriptor.setStatusDescription("Initiating VNF Instance");
+ descriptor.setStatus("processing");
+ jobStatusResponse.setResponseDescriptor(descriptor);
+
+ TokenResponse token = new TokenResponse();
+ token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39");
+ token.setExpires(1800);
+
+ postStream = new ByteArrayInputStream(marshal(jobStatusResponse).getBytes(UTF_8));
+ tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8));
+
+ ResourceOperationStatus operationStatus = new ResourceOperationStatus();
+ operationStatus.setOperationId("4b45d919816ccaa2b762df5120f72067");
+ operationStatus.setResourceTemplateUUID("8ee5926d-720b-4bb2-86f9-d20e921c143b");
+ operationStatus.setServiceId("NSI-M-001-HDBNJ-NSMF-01-A-ZX");
+
+ NssmfAdapterNBIRequest nbiRequest = createNbiRequest();
+ nbiRequest.setResponseId("7512eb3feb5249eca5ddd742fedddd39");
+ Optional<ResourceOperationStatus> optional = Optional.of(operationStatus);
+
+ doAnswer(invocation -> optional).when(repository).findOne(any());
+
+ createCommonMock(200, nssmf);
+
+ ResponseEntity res = nssiManagerService.queryJobStatus(nbiRequest, "4b45d919816ccaa2b762df5120f72067");
+ assertNotNull(res);
+ assertNotNull(res.getBody());
+ JobStatusResponse allRes = unMarshal(res.getBody().toString(), JobStatusResponse.class);
+ assertEquals(allRes.getResponseDescriptor().getProgress(), 20);
+ assertEquals(allRes.getResponseDescriptor().getStatus(), "processing");
+ assertEquals(allRes.getResponseDescriptor().getResponseId(), "7512eb3feb5249eca5ddd742fedddd39");
+
+ System.out.println(res);
+
+ }
+
+ @Test
+ public void queryNSSISelectionCapability() throws Exception {
+
+ NssmfAdapterNBIRequest nbiRequest = createNbiRequest();
+ ResponseEntity res = nssiManagerService.queryNSSISelectionCapability(nbiRequest);
+ assertNotNull(res);
+ assertNotNull(res.getBody());
+ Map allRes = unMarshal(res.getBody().toString(), Map.class);
+ assertEquals(allRes.get("selection"), "NSMF");
+
+ System.out.println(res);
+
+ nbiRequest.getEsrInfo().setVendor(NssmfAdapterConsts.ONAP_INTERNAL_TAG);
+ res = nssiManagerService.queryNSSISelectionCapability(nbiRequest);
+ assertNotNull(res);
+ assertNotNull(res.getBody());
+ allRes = unMarshal(res.getBody().toString(), Map.class);
+ assertEquals(allRes.get("selection"), "NSSMF");
+
+ System.out.println(res);
+
+ nbiRequest.getEsrInfo().setNetworkType(NetworkType.ACCESS);
+ res = nssiManagerService.queryNSSISelectionCapability(nbiRequest);
+ assertNotNull(res);
+ assertNotNull(res.getBody());
+ allRes = unMarshal(res.getBody().toString(), Map.class);
+ assertEquals(allRes.get("selection"), "NSSMF");
+
+ System.out.println(res);
+ }
+
+ private NssmfAdapterNBIRequest createNbiRequest() {
+ NssmfAdapterNBIRequest nbiRequest = new NssmfAdapterNBIRequest();
+ EsrInfo esrInfo = new EsrInfo();
+ esrInfo.setVendor("huawei");
+ esrInfo.setNetworkType(CORE);
+ ServiceInfo serviceInfo = new ServiceInfo();
+ serviceInfo.setServiceUuid("8ee5926d-720b-4bb2-86f9-d20e921c143b");
+ serviceInfo.setServiceInvariantUuid("e75698d9-925a-4cdd-a6c0-edacbe6a0b51");
+ serviceInfo.setGlobalSubscriberId("5GCustomer");
+ serviceInfo.setServiceType("5G");
+ serviceInfo.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX");
+ nbiRequest.setEsrInfo(esrInfo);
+ nbiRequest.setServiceInfo(serviceInfo);
+ return nbiRequest;
+ }
+
+ @Test
+ public void querySubnetCapability() {
+ NssmfAdapterNBIRequest nbiRequest = createNbiRequest();
+
+ String subnetCapabilityQuery = "\"subnetTypes\": [\"TN-FH\",\"TN-MH\",\"TN-BH\"]";
+ nbiRequest.setSubnetCapabilityQuery(subnetCapabilityQuery);
+ ResponseEntity res = nssiManagerService.queryNSSISelectionCapability(nbiRequest);
+ assertNotNull(res);
+ assertNotNull(res.getBody());
+ }
+}
diff --git a/adapters/mso-nssmf-adapter/src/test/resources/application-test.yaml b/adapters/mso-nssmf-adapter/src/test/resources/application-test.yaml
new file mode 100644
index 0000000000..fa323e887b
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/test/resources/application-test.yaml
@@ -0,0 +1,60 @@
+
+aai:
+ auth: 2A11B07DB6214A839394AA1EC5844695F5114FC407FF5422625FB00175A3DCB8A1FF745F22867EFA72D5369D599BBD88DA8BED4233CF5586
+ endpoint: https://aai.onap:30233
+logging:
+ path: logs
+
+spring:
+ datasource:
+ username: root
+ password: 123456
+ driver-class-name: org.mariadb.jdbc.Driver
+ initialization-mode: always
+ url: jdbc:mariadb://49.232.146.162:8989/requestdb
+ jpa:
+ generate-ddl: false
+ show-sql: false
+ hibernate:
+ ddl-auto: none
+ naming-strategy: org.hibernate.cfg.ImprovedNamingStrategy
+ enable-lazy-load-no-trans: true
+ database-platform: org.hibernate.dialect.MySQL5InnoDBDialect
+ security:
+ usercredentials:
+ - username: bpel
+ password: '$2a$10$Fh9ffgPw2vnmsghsRD3ZauBL1aKXebigbq3BB1RPWtE62UDILsjke'
+ role: BPEL-Client
+ - username: mso_admin
+ password: '$2a$10$Fh9ffgPw2vnmsghsRD3ZauBL1aKXebigbq3BB1RPWtE62UDILsjke'
+ role: ACTUATOR
+server:
+ port: 8080
+ tomcat:
+ max-threads: 50
+
+mso:
+ key: 07a7159d3bf51a0e53be7a8f89699be7
+ site-name: localSite
+ logPath: ./logs/nssmf
+ adapters:
+ requestDb:
+ endpoint: https://so-request-db-adapter.{{ include "common.namespace" . }}:8083
+ auth: Basic YnBlbDpwYXNzd29yZDEk
+ infra:
+ endpoint: https://so.{{ include "common.namespace" . }}:8080
+ auth: Basic SW5mcmFQb3J0YWxDbGllbnQ6cGFzc3dvcmQxJA==
+
+#Actuator
+management:
+ endpoints:
+ web:
+ base-path: /manage
+ exposure:
+ include: "*"
+ metrics:
+ se-global-registry: false
+ export:
+ prometheus:
+ enabled: true # Whether exporting of metrics to Prometheus is enabled.
+ step: 1m # Step size (i.e. reporting frequency) to use. \ No newline at end of file
diff --git a/adapters/mso-oof-adapter/.gitignore b/adapters/mso-oof-adapter/.gitignore
new file mode 100644
index 0000000000..549e00a2a9
--- /dev/null
+++ b/adapters/mso-oof-adapter/.gitignore
@@ -0,0 +1,33 @@
+HELP.md
+target/
+!.mvn/wrapper/maven-wrapper.jar
+!**/src/main/**/target/
+!**/src/test/**/target/
+
+### STS ###
+.apt_generated
+.classpath
+.factorypath
+.project
+.settings
+.springBeans
+.sts4-cache
+
+### IntelliJ IDEA ###
+.idea
+*.iws
+*.iml
+*.ipr
+
+### NetBeans ###
+/nbproject/private/
+/nbbuild/
+/dist/
+/nbdist/
+/.nb-gradle/
+build/
+!**/src/main/**/build/
+!**/src/test/**/build/
+
+### VS Code ###
+.vscode/
diff --git a/adapters/mso-oof-adapter/pom.xml b/adapters/mso-oof-adapter/pom.xml
new file mode 100644
index 0000000000..98150d39e0
--- /dev/null
+++ b/adapters/mso-oof-adapter/pom.xml
@@ -0,0 +1,120 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project xmlns="http://maven.apache.org/POM/4.0.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
+ xsi:schemaLocation="http://maven.apache.org/POM/4.0.0 https://maven.apache.org/xsd/maven-4.0.0.xsd">
+ <modelVersion>4.0.0</modelVersion>
+ <parent>
+ <groupId>org.onap.so</groupId>
+ <artifactId>adapters</artifactId>
+ <version>1.7.1-SNAPSHOT</version>
+ </parent>
+ <groupId>org.onap.so.adapters</groupId>
+ <artifactId>mso-oof-adapter</artifactId>
+ <name>mso-oof-adapter</name>
+ <description>mso oof adapter</description>
+
+ <dependencyManagement>
+ <dependencies>
+ <dependency>
+ <groupId>org.springframework.boot</groupId>
+ <artifactId>spring-boot-dependencies</artifactId>
+ <version>${springboot.version}</version>
+ <type>pom</type>
+ <scope>import</scope>
+ </dependency>
+ </dependencies>
+ </dependencyManagement>
+ <dependencies>
+ <dependency>
+ <groupId>org.springframework.boot</groupId>
+ <artifactId>spring-boot-starter-web</artifactId>
+ </dependency>
+ <dependency>
+ <groupId>org.springframework.boot</groupId>
+ <artifactId>spring-boot-starter-webflux</artifactId>
+ </dependency>
+
+ <dependency>
+ <groupId>org.apache.cxf</groupId>
+ <artifactId>cxf-spring-boot-starter-jaxrs</artifactId>
+ <version>${cxf.version}</version>
+ </dependency>
+ <dependency>
+ <groupId>org.apache.cxf</groupId>
+ <artifactId>cxf-rt-rs-service-description-swagger</artifactId>
+ <version>${cxf.version}</version>
+ </dependency>
+ <dependency>
+ <groupId>org.springframework.boot</groupId>
+ <artifactId>spring-boot-starter-test</artifactId>
+ <scope>test</scope>
+ <exclusions>
+ <exclusion>
+ <groupId>org.junit.vintage</groupId>
+ <artifactId>junit-vintage-engine</artifactId>
+ </exclusion>
+ </exclusions>
+ </dependency>
+ <dependency>
+ <groupId>org.junit.jupiter</groupId>
+ <artifactId>junit-jupiter-api</artifactId>
+ <scope>test</scope>
+ </dependency>
+ <dependency>
+ <groupId>junit</groupId>
+ <artifactId>junit</artifactId>
+ <scope>test</scope>
+ </dependency>
+ <dependency>
+ <groupId>org.junit.jupiter</groupId>
+ <artifactId>junit-jupiter-engine</artifactId>
+ <scope>test</scope>
+ </dependency>
+ <dependency>
+ <groupId>org.junit.vintage</groupId>
+ <artifactId>junit-vintage-engine</artifactId>
+ <scope>test</scope>
+ </dependency>
+ </dependencies>
+ <build>
+ <finalName>${project.artifactId}-${project.version}</finalName>
+ <testSourceDirectory>${project.basedir}/src/test/java</testSourceDirectory>
+ <plugins>
+ <plugin>
+ <groupId>org.springframework.boot</groupId>
+ <artifactId>spring-boot-maven-plugin</artifactId>
+ <configuration>
+ <mainClass>org.onap.so.adapters.oof.MsoOofAdapterApplication</mainClass>
+ </configuration>
+ <executions>
+ <execution>
+ <goals>
+ <goal>repackage</goal>
+ </goals>
+ </execution>
+ </executions>
+ </plugin>
+ <plugin>
+ <groupId>org.jacoco</groupId>
+ <artifactId>jacoco-maven-plugin</artifactId>
+ </plugin>
+ </plugins>
+ <resources>
+ <resource>
+ <directory>src/main/resources</directory>
+ <filtering>true</filtering>
+ <excludes>
+ <exclude>**/*.p12</exclude>
+ <exclude>**/*.jks</exclude>
+ </excludes>
+ </resource>
+ <resource>
+ <directory>src/main/resources</directory>
+ <filtering>false</filtering>
+ <includes>
+ <include>**/*.p12</include>
+ <include>**/*.jks</include>
+ </includes>
+ </resource>
+ </resources>
+ </build>
+</project>
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoDeploymentAlreadyExists.java b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/MsoOofAdapterApplication.java
index 62112f4feb..78fbe6e271 100644
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoDeploymentAlreadyExists.java
+++ b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/MsoOofAdapterApplication.java
@@ -2,14 +2,14 @@
* ============LICENSE_START=======================================================
* ONAP - SO
* ================================================================================
- * Copyright (C) 2017 AT&T Intellectual Property. All rights reserved.
+ * Copyright (C) 2020 Wipro Limited. All rights reserved.
* ================================================================================
* Licensed under the Apache License, Version 2.0 (the "License");
* you may not use this file except in compliance with the License.
* You may obtain a copy of the License at
- *
+ *
* http://www.apache.org/licenses/LICENSE-2.0
- *
+ *
* Unless required by applicable law or agreed to in writing, software
* distributed under the License is distributed on an "AS IS" BASIS,
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
@@ -18,17 +18,15 @@
* ============LICENSE_END=========================================================
*/
-package org.onap.so.cloudify.exceptions;
+package org.onap.so.adapters.oof;
-public class MsoDeploymentAlreadyExists extends MsoCloudifyException {
+import org.springframework.boot.SpringApplication;
+import org.springframework.boot.autoconfigure.SpringBootApplication;
- private static final long serialVersionUID = 1L;
+@SpringBootApplication
+public class MsoOofAdapterApplication {
- // Constructor to create a new MsoCloudifyException instance
- public MsoDeploymentAlreadyExists(String deploymentId, String cloud) {
- // Set the detailed error as the Exception 'message'
- super(409, "Conflict",
- "Deployment " + deploymentId + " already exists in Cloudify Manager suppporting cloud " + cloud);
+ public static void main(String[] args) {
+ SpringApplication.run(MsoOofAdapterApplication.class, args);
}
-
}
diff --git a/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/OofAdapterClientConfig.java b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/OofAdapterClientConfig.java
new file mode 100644
index 0000000000..5e13c592b7
--- /dev/null
+++ b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/OofAdapterClientConfig.java
@@ -0,0 +1,76 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Wipro Limited. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.oof;
+
+import javax.net.ssl.HostnameVerifier;
+import javax.net.ssl.SSLContext;
+import javax.net.ssl.SSLSession;
+import javax.net.ssl.TrustManager;
+import javax.net.ssl.X509TrustManager;
+import org.apache.http.client.HttpClient;
+import org.apache.http.conn.ssl.SSLConnectionSocketFactory;
+import org.apache.http.impl.client.HttpClients;
+import org.springframework.context.annotation.Bean;
+import org.springframework.context.annotation.Configuration;
+import org.springframework.http.client.HttpComponentsClientHttpRequestFactory;
+import org.springframework.web.client.RestTemplate;
+
+@Configuration
+public class OofAdapterClientConfig {
+
+ @Bean
+ public RestTemplate getRestTemplate() {
+ HttpComponentsClientHttpRequestFactory requestFactory =
+ new HttpComponentsClientHttpRequestFactory(getHttpsClient());
+ requestFactory.setConnectTimeout(60000);
+ requestFactory.setReadTimeout(60000);
+ return new RestTemplate(requestFactory);
+ }
+
+ private HttpClient getHttpsClient() {
+ TrustManager[] trustAllCerts = new TrustManager[] {new X509TrustManager() {
+ public java.security.cert.X509Certificate[] getAcceptedIssuers() {
+ return null;
+ }
+
+ public void checkClientTrusted(java.security.cert.X509Certificate[] certs, String authType) {}
+
+ public void checkServerTrusted(java.security.cert.X509Certificate[] certs, String authType) {}
+ }};
+
+ // Install the all-trusting trust manager
+ try {
+ SSLContext sc = SSLContext.getInstance("SSL");
+ sc.init(null, trustAllCerts, new java.security.SecureRandom());
+ HostnameVerifier hostnameVerifier = new HostnameVerifier() {
+ @Override
+ public boolean verify(String hostname, SSLSession session) {
+ return true;
+ }
+ };
+ SSLConnectionSocketFactory sslsf = new SSLConnectionSocketFactory(sc,
+ new String[] {"TLSv1", "TLSv1.1", "TLSv1.2", "TLSv1.3"}, null, hostnameVerifier);
+ return HttpClients.custom().setSSLSocketFactory(sslsf).build();
+ } catch (Exception e) {
+ throw new IllegalArgumentException(e);
+ }
+ }
+}
diff --git a/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/WebSecurityConfig.java b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/WebSecurityConfig.java
new file mode 100644
index 0000000000..9a07b0119f
--- /dev/null
+++ b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/WebSecurityConfig.java
@@ -0,0 +1,37 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Wipro Limited. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.oof;
+
+import org.springframework.context.annotation.Configuration;
+import org.springframework.security.config.annotation.web.builders.HttpSecurity;
+import org.springframework.security.config.annotation.web.configuration.EnableWebSecurity;
+import org.springframework.security.config.annotation.web.configuration.WebSecurityConfigurerAdapter;
+
+@EnableWebSecurity
+@Configuration
+public class WebSecurityConfig extends WebSecurityConfigurerAdapter {
+
+ @Override
+ protected void configure(HttpSecurity http) throws Exception {
+ http.csrf().disable();
+ }
+
+}
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoBlueprintAlreadyExists.java b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/constants/Constants.java
index 95912994bc..5d91bf38f8 100644
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoBlueprintAlreadyExists.java
+++ b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/constants/Constants.java
@@ -2,14 +2,14 @@
* ============LICENSE_START=======================================================
* ONAP - SO
* ================================================================================
- * Copyright (C) 2017 AT&T Intellectual Property. All rights reserved.
+ * Copyright (C) 2020 Wipro Limited. All rights reserved.
* ================================================================================
* Licensed under the Apache License, Version 2.0 (the "License");
* you may not use this file except in compliance with the License.
* You may obtain a copy of the License at
- *
+ *
* http://www.apache.org/licenses/LICENSE-2.0
- *
+ *
* Unless required by applicable law or agreed to in writing, software
* distributed under the License is distributed on an "AS IS" BASIS,
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
@@ -17,18 +17,15 @@
* limitations under the License.
* ============LICENSE_END=========================================================
*/
+package org.onap.so.adapters.oof.constants;
-package org.onap.so.cloudify.exceptions;
+public class Constants {
-public class MsoBlueprintAlreadyExists extends MsoCloudifyException {
-
- private static final long serialVersionUID = 1L;
-
- // Constructor to create a new MsoCloudifyException instance
- public MsoBlueprintAlreadyExists(String blueprintId, String cloud) {
- // Set the detailed error as the Exception 'message'
- super(409, "Conflict",
- "Blueprint " + blueprintId + " already exists in Cloudify Manager supporting cloud site + " + cloud);
- }
+ public static final String OOF_ENDPOINT = "mso.oof.endpoint";
+ public static final String OOF_AUTH = "mso.oof.auth";
+ public static final String MSO_KEY = "mso.msoKey";
+ public static final String CAMUNDA_URL = "mso.camundaURL";
+ public static final String CAMUNDA_AUTH = "mso.camundaAuth";
+ public static final String WORKFLOW_MESSAGE_ENPOINT = "mso.workflow.message.endpoint";
}
diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoCloudifyManagerNotFound.java b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/exceptions/OofAdapterException.java
index bc6fd6204c..ff16d7442c 100644
--- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/cloudify/exceptions/MsoCloudifyManagerNotFound.java
+++ b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/exceptions/OofAdapterException.java
@@ -2,14 +2,14 @@
* ============LICENSE_START=======================================================
* ONAP - SO
* ================================================================================
- * Copyright (C) 2017 AT&T Intellectual Property. All rights reserved.
+ * Copyright (C) 2020 Wipro Limited. All rights reserved.
* ================================================================================
* Licensed under the Apache License, Version 2.0 (the "License");
* you may not use this file except in compliance with the License.
* You may obtain a copy of the License at
- *
+ *
* http://www.apache.org/licenses/LICENSE-2.0
- *
+ *
* Unless required by applicable law or agreed to in writing, software
* distributed under the License is distributed on an "AS IS" BASIS,
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
@@ -18,16 +18,22 @@
* ============LICENSE_END=========================================================
*/
-package org.onap.so.cloudify.exceptions;
+package org.onap.so.adapters.oof.exceptions;
-public class MsoCloudifyManagerNotFound extends MsoCloudifyException {
+public class OofAdapterException extends Exception {
private static final long serialVersionUID = 1L;
- // Constructor to create a new MsoCloudifyException instance
- public MsoCloudifyManagerNotFound(String cloudSiteId) {
- // Set the detailed error as the Exception 'message'
- super(0, "Cloudify Manager Not Found", "No Cloudify Manager configured for cloud site " + cloudSiteId);
+ public OofAdapterException(String message) {
+ super(message);
+ }
+
+ public OofAdapterException(Throwable e) {
+ super(e);
+ }
+
+ public OofAdapterException(String message, Throwable e) {
+ super(message, e);
}
}
diff --git a/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/model/OofRequest.java b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/model/OofRequest.java
new file mode 100644
index 0000000000..1eb694fd96
--- /dev/null
+++ b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/model/OofRequest.java
@@ -0,0 +1,52 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Wipro Limited. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+package org.onap.so.adapters.oof.model;
+
+/**
+ * POJO representing generic request payload from BPMN processes
+ */
+public class OofRequest {
+
+ private String apiPath;
+
+ private Object requestDetails;
+
+ public String getApiPath() {
+ return apiPath;
+ }
+
+ public void setApiPath(String apiPath) {
+ this.apiPath = apiPath;
+ }
+
+ public Object getRequestDetails() {
+ return requestDetails;
+ }
+
+ public void setRequestDetails(Object requestDetails) {
+ this.requestDetails = requestDetails;
+ }
+
+ @Override
+ public String toString() {
+ return "{\"apiPath:\"\"" + apiPath + "\"\", requestDetails:\"\"" + requestDetails + "}";
+ }
+
+}
diff --git a/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/rest/OofCallbackHandler.java b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/rest/OofCallbackHandler.java
new file mode 100644
index 0000000000..f8da6c6d2e
--- /dev/null
+++ b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/rest/OofCallbackHandler.java
@@ -0,0 +1,71 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Wipro Limited. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.oof.rest;
+
+import org.onap.so.adapters.oof.exceptions.OofAdapterException;
+import org.onap.so.adapters.oof.utils.OofUtils;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+import org.springframework.beans.factory.annotation.Autowired;
+import org.springframework.http.HttpEntity;
+import org.springframework.http.ResponseEntity;
+import org.springframework.web.bind.annotation.PathVariable;
+import org.springframework.web.bind.annotation.PostMapping;
+import org.springframework.web.bind.annotation.RequestBody;
+import org.springframework.web.bind.annotation.RequestMapping;
+import org.springframework.web.bind.annotation.RestController;
+import org.springframework.web.client.RestTemplate;
+
+/**
+ * A generic call back handler to receive async response from OOF
+ */
+@RestController
+@RequestMapping("/so/adapters/oof/callback/")
+public class OofCallbackHandler {
+
+ @Autowired
+ OofUtils utils;
+
+ @Autowired
+ RestTemplate restTemplate;
+
+ private static final Logger logger = LoggerFactory.getLogger(OofCallbackHandler.class);
+
+ @PostMapping("/{version:[vV][1]}/{messageEventName}/{correlator}")
+ public ResponseEntity<String> processCallback(@PathVariable("messageEventName") String messageEventName,
+ @PathVariable("correlator") String correlator, @RequestBody String oofCallbackRequest)
+ throws OofAdapterException {
+ logger.debug("Oof Async response received for event : {} , callback request body : {} ", messageEventName,
+ oofCallbackRequest);
+ String camundaMsgUrl = utils.getCamundaMsgUrl(messageEventName, correlator);
+ HttpEntity<String> request = new HttpEntity<String>(oofCallbackRequest, utils.getCamundaHeaders());
+ try {
+ ResponseEntity<String> response = restTemplate.postForEntity(camundaMsgUrl, request, String.class);
+ logger.debug("Response from BPMN : {} ", response);
+ return response;
+ } catch (Exception e) {
+ logger.warn("Error injecting message event into BPMN {} {} ", e.getCause(), e.getMessage());
+ throw new OofAdapterException(e);
+ }
+
+ }
+
+}
diff --git a/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/rest/OofClient.java b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/rest/OofClient.java
new file mode 100644
index 0000000000..3a91ec495e
--- /dev/null
+++ b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/rest/OofClient.java
@@ -0,0 +1,67 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Wipro Limited. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.oof.rest;
+
+import org.onap.so.adapters.oof.exceptions.OofAdapterException;
+import org.onap.so.adapters.oof.model.OofRequest;
+import org.onap.so.adapters.oof.utils.OofUtils;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+import org.springframework.beans.factory.annotation.Autowired;
+import org.springframework.http.HttpEntity;
+import org.springframework.http.ResponseEntity;
+import org.springframework.web.bind.annotation.PostMapping;
+import org.springframework.web.bind.annotation.RequestBody;
+import org.springframework.web.bind.annotation.RequestMapping;
+import org.springframework.web.bind.annotation.RestController;
+import org.springframework.web.client.RestTemplate;
+
+/**
+ * A generic client class to call OOF with request from BPMN
+ */
+@RestController
+@RequestMapping("/so/adapters/oof/")
+public class OofClient {
+
+ @Autowired
+ RestTemplate restTemplate;
+
+ @Autowired
+ OofUtils utils;
+
+ private static final Logger logger = LoggerFactory.getLogger(OofClient.class);
+
+ @PostMapping("/{version:[vV][1]}")
+ public ResponseEntity<String> callOof(@RequestBody OofRequest oofRequest) throws OofAdapterException {
+ try {
+ logger.debug("Received Request from BPEL {} ", oofRequest);
+ String oofUrl = utils.getOofurl(oofRequest.getApiPath());
+ HttpEntity<?> request = new HttpEntity<>(oofRequest.getRequestDetails(), utils.getOofHttpHeaders());
+ ResponseEntity<String> response = restTemplate.postForEntity(oofUrl, request, String.class);
+ logger.debug("Response from OOF : {} ", response);
+ return response;
+ } catch (Exception e) {
+ logger.warn("Error while calling OOF {} {} ", e.getCause(), e.getMessage());
+ throw new OofAdapterException(e);
+ }
+ }
+
+}
diff --git a/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/utils/OofUtils.java b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/utils/OofUtils.java
new file mode 100644
index 0000000000..f45baa30fe
--- /dev/null
+++ b/adapters/mso-oof-adapter/src/main/java/org/onap/so/adapters/oof/utils/OofUtils.java
@@ -0,0 +1,110 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Wipro Limited. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.oof.utils;
+
+import java.security.GeneralSecurityException;
+import java.util.ArrayList;
+import java.util.List;
+import javax.xml.bind.DatatypeConverter;
+import org.onap.so.adapters.oof.constants.Constants;
+import org.onap.so.utils.CryptoUtils;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+import org.springframework.beans.factory.annotation.Autowired;
+import org.springframework.core.env.Environment;
+import org.springframework.http.HttpHeaders;
+import org.springframework.http.MediaType;
+import org.springframework.stereotype.Component;
+
+@Component
+public class OofUtils {
+ private static Logger logger = LoggerFactory.getLogger(OofUtils.class);
+
+ @Autowired
+ private Environment env;
+
+ /**
+ * @param messageEventName
+ * @param correlator
+ * @return
+ */
+ public String getCamundaMsgUrl(String messageEventName, String correlator) {
+ System.out.println(env);
+ String camundaMsgUrl = new StringBuilder(env.getRequiredProperty(Constants.WORKFLOW_MESSAGE_ENPOINT))
+ .append("/").append(messageEventName).append("/").append(correlator).toString();
+ return camundaMsgUrl;
+ }
+
+ /**
+ * @return
+ */
+ public HttpHeaders getCamundaHeaders() {
+ HttpHeaders headers = new HttpHeaders();
+ List<MediaType> acceptableMediaTypes = new ArrayList<>();
+ acceptableMediaTypes.add(MediaType.ALL);
+ headers.setAccept(acceptableMediaTypes);
+ headers.setContentType(MediaType.APPLICATION_JSON);
+ headers.add(HttpHeaders.AUTHORIZATION, addAuthorizationHeader(env.getRequiredProperty(Constants.CAMUNDA_AUTH),
+ env.getRequiredProperty(Constants.MSO_KEY)));
+ return headers;
+ }
+
+ /**
+ * @param auth
+ * @param msoKey
+ * @return
+ */
+ protected String addAuthorizationHeader(String auth, String msoKey) {
+ String basicAuth = null;
+ try {
+ String userCredentials = CryptoUtils.decrypt(auth, msoKey);
+ if (userCredentials != null) {
+ basicAuth = "Basic " + DatatypeConverter.printBase64Binary(userCredentials.getBytes());
+ }
+ } catch (GeneralSecurityException e) {
+ logger.error("Security exception", e);
+ }
+ return basicAuth;
+ }
+
+ /**
+ * @return
+ * @throws Exception
+ */
+ public HttpHeaders getOofHttpHeaders() throws Exception {
+ HttpHeaders headers = new HttpHeaders();
+ List<MediaType> acceptableMediaTypes = new ArrayList<>();
+ acceptableMediaTypes.add(MediaType.APPLICATION_JSON);
+ headers.setAccept(acceptableMediaTypes);
+ headers.setContentType(MediaType.APPLICATION_JSON);
+ return headers;
+ }
+
+ /**
+ * @param apiPath
+ * @return
+ */
+ public String getOofurl(String apiPath) {
+ return new StringBuilder(env.getRequiredProperty(Constants.OOF_ENDPOINT)).append(apiPath).toString();
+ }
+
+
+}
diff --git a/adapters/mso-oof-adapter/src/test/java/org/onap/so/adapters/oof/rest/OofCallbackHandlerTest.java b/adapters/mso-oof-adapter/src/test/java/org/onap/so/adapters/oof/rest/OofCallbackHandlerTest.java
new file mode 100644
index 0000000000..3a2f7f5e11
--- /dev/null
+++ b/adapters/mso-oof-adapter/src/test/java/org/onap/so/adapters/oof/rest/OofCallbackHandlerTest.java
@@ -0,0 +1,85 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Wipro Limited. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.oof.rest;
+
+import static org.mockito.Mockito.when;
+import java.io.File;
+import java.io.IOException;
+import org.junit.Before;
+import org.junit.jupiter.api.Assertions;
+import org.junit.jupiter.api.Test;
+import org.mockito.Mockito;
+import org.onap.so.adapters.oof.utils.OofUtils;
+import org.springframework.beans.factory.annotation.Autowired;
+import org.springframework.boot.test.context.SpringBootTest;
+import org.springframework.boot.test.context.SpringBootTest.WebEnvironment;
+import org.springframework.boot.test.mock.mockito.MockBean;
+import org.springframework.boot.test.web.client.TestRestTemplate;
+import org.springframework.core.io.ClassPathResource;
+import org.springframework.http.HttpEntity;
+import org.springframework.http.HttpHeaders;
+import org.springframework.http.HttpStatus;
+import org.springframework.http.MediaType;
+import org.springframework.http.ResponseEntity;
+import org.springframework.web.client.RestTemplate;
+import com.fasterxml.jackson.databind.ObjectMapper;
+
+
+@SpringBootTest(webEnvironment = WebEnvironment.RANDOM_PORT)
+class OofCallbackHandlerTest {
+
+ @Autowired
+ TestRestTemplate restTemplate;
+
+ @MockBean
+ OofUtils oofutils;
+
+ @MockBean
+ RestTemplate mockrestTemplate;
+
+ @Before
+ void prepareMocks() throws Exception {
+ ResponseEntity<Object> responseEntity = new ResponseEntity<>(HttpStatus.OK);
+ when(oofutils.getCamundaHeaders()).thenReturn(new HttpHeaders());
+ when(oofutils.getCamundaMsgUrl(Mockito.anyString(), Mockito.anyString())).thenReturn("oofurl");
+ when(mockrestTemplate.postForEntity(Mockito.anyString(), Mockito.any(), Mockito.any()))
+ .thenReturn(responseEntity);
+ }
+
+ @Test
+ void processCallbackTest() throws Exception {
+ Object request = prepareOofResponse();
+ HttpHeaders headers = new HttpHeaders();
+ headers.setContentType(MediaType.APPLICATION_JSON);
+ HttpEntity<Object> entity = new HttpEntity<Object>(request, headers);
+ ResponseEntity<String> response = restTemplate.postForEntity(
+ "/so/adapters/oof/callback/v1/NSISelectionResponse/d88da85c-d9e8-4f73-b837-3a72a431622a", entity,
+ String.class);
+ Assertions.assertEquals(HttpStatus.OK, response.getStatusCode());
+ }
+
+ private Object prepareOofResponse() throws IOException {
+ File file = new ClassPathResource("testInputs/NsiSelectionResponse.json").getFile();
+ ObjectMapper objectMapper = new ObjectMapper();
+ return objectMapper.readValue(file, Object.class);
+ }
+
+}
diff --git a/adapters/mso-oof-adapter/src/test/java/org/onap/so/adapters/oof/rest/OofClientTest.java b/adapters/mso-oof-adapter/src/test/java/org/onap/so/adapters/oof/rest/OofClientTest.java
new file mode 100644
index 0000000000..ff38a9af63
--- /dev/null
+++ b/adapters/mso-oof-adapter/src/test/java/org/onap/so/adapters/oof/rest/OofClientTest.java
@@ -0,0 +1,86 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Wipro Limited. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.oof.rest;
+
+import static org.mockito.Mockito.when;
+import java.io.File;
+import java.io.IOException;
+import org.junit.Before;
+import org.junit.jupiter.api.Assertions;
+import org.junit.jupiter.api.Test;
+import org.junit.runner.RunWith;
+import org.mockito.Mockito;
+import org.onap.so.adapters.oof.model.OofRequest;
+import org.onap.so.adapters.oof.utils.OofUtils;
+import org.springframework.beans.factory.annotation.Autowired;
+import org.springframework.boot.test.context.SpringBootTest;
+import org.springframework.boot.test.context.SpringBootTest.WebEnvironment;
+import org.springframework.boot.test.mock.mockito.MockBean;
+import org.springframework.boot.test.web.client.TestRestTemplate;
+import org.springframework.core.io.ClassPathResource;
+import org.springframework.http.HttpEntity;
+import org.springframework.http.HttpHeaders;
+import org.springframework.http.HttpStatus;
+import org.springframework.http.MediaType;
+import org.springframework.http.ResponseEntity;
+import org.springframework.web.client.RestTemplate;
+import com.fasterxml.jackson.databind.ObjectMapper;
+
+@SpringBootTest(webEnvironment = WebEnvironment.RANDOM_PORT)
+class OofClientTest {
+
+ @Autowired
+ TestRestTemplate restTemplate;
+
+ @MockBean
+ OofUtils oofutils;
+
+ @MockBean
+ RestTemplate mockrestTemplate;
+
+ @Before
+ void prepareMocks() throws Exception {
+ ResponseEntity<Object> responseEntity = new ResponseEntity<>(HttpStatus.OK);
+ when(oofutils.getOofHttpHeaders()).thenReturn(new HttpHeaders());
+ when(oofutils.getOofurl(Mockito.anyString())).thenReturn("oofurl");
+ when(mockrestTemplate.postForEntity(Mockito.anyString(), Mockito.any(), Mockito.any()))
+ .thenReturn(responseEntity);
+ }
+
+ @Test
+ void callOofTest() throws Exception {
+ OofRequest request = prepareOofRequest();
+ System.out.println(request);
+ HttpHeaders headers = new HttpHeaders();
+ headers.setContentType(MediaType.APPLICATION_JSON);
+ HttpEntity<OofRequest> entity = new HttpEntity<OofRequest>(request, headers);
+ ResponseEntity<String> response = restTemplate.postForEntity("/so/adapters/oof/v1", entity, String.class);
+ Assertions.assertEquals(HttpStatus.OK, response.getStatusCode());
+ }
+
+ private OofRequest prepareOofRequest() throws IOException {
+ File file = new ClassPathResource("testInputs/NsiSelectionOofRequest.json").getFile();
+ ObjectMapper objectMapper = new ObjectMapper();
+ return objectMapper.readValue(file, OofRequest.class);
+ }
+
+
+}
diff --git a/adapters/mso-oof-adapter/src/test/java/org/onap/so/adapters/oof/utils/OofUtilsTest.java b/adapters/mso-oof-adapter/src/test/java/org/onap/so/adapters/oof/utils/OofUtilsTest.java
new file mode 100644
index 0000000000..e68fa10c3e
--- /dev/null
+++ b/adapters/mso-oof-adapter/src/test/java/org/onap/so/adapters/oof/utils/OofUtilsTest.java
@@ -0,0 +1,76 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Wipro Limited. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.oof.utils;
+
+import static org.mockito.Mockito.when;
+import java.security.GeneralSecurityException;
+import javax.xml.bind.DatatypeConverter;
+import org.junit.jupiter.api.Assertions;
+import org.junit.jupiter.api.Test;
+import org.junit.jupiter.api.extension.ExtendWith;
+import org.mockito.InjectMocks;
+import org.mockito.Mock;
+import org.mockito.Mockito;
+import org.onap.so.utils.CryptoUtils;
+import org.springframework.core.env.Environment;
+import org.springframework.http.HttpHeaders;
+import org.springframework.test.context.junit.jupiter.SpringExtension;
+
+@ExtendWith(SpringExtension.class)
+class OofUtilsTest {
+
+ @InjectMocks
+ OofUtils oofUtils;
+
+ @Mock
+ Environment env;
+
+ @Test
+ void testGetCamundaMsgUrl() {
+ when(env.getRequiredProperty(Mockito.anyString())).thenReturn("dummyString");
+ String camundamsgUrl = oofUtils.getCamundaMsgUrl("samplemessage", "sampleCorrelator");
+ Assertions.assertNotNull(camundamsgUrl);
+ }
+
+
+ void testGetCamundaHeaders() throws GeneralSecurityException {
+ when(env.getRequiredProperty(Mockito.anyString())).thenReturn("dummyString");
+ when(CryptoUtils.decrypt(Mockito.anyString(), Mockito.anyString())).thenReturn("decryptedString");
+ HttpHeaders headers = oofUtils.getCamundaHeaders();
+ Assertions.assertNotNull(headers);
+ }
+
+
+ @Test
+ void testGetOofHttpHeaders() throws Exception {
+ when(env.getRequiredProperty(Mockito.anyString())).thenReturn("dummyString");
+ HttpHeaders headers = oofUtils.getOofHttpHeaders();
+ Assertions.assertNotNull(headers);
+ }
+
+ @Test
+ void testGetOofurl() {
+ when(env.getRequiredProperty(Mockito.anyString())).thenReturn("dummyString");
+ String oofurl = oofUtils.getOofurl("/api/v1/");
+ Assertions.assertNotNull(oofurl);
+ }
+
+}
diff --git a/adapters/mso-oof-adapter/src/test/resources/testInputs/NsiSelectionOofRequest.json b/adapters/mso-oof-adapter/src/test/resources/testInputs/NsiSelectionOofRequest.json
new file mode 100644
index 0000000000..569aae9f38
--- /dev/null
+++ b/adapters/mso-oof-adapter/src/test/resources/testInputs/NsiSelectionOofRequest.json
@@ -0,0 +1,84 @@
+{
+ "apiPath":"/api/oof/selection/nsi/v1",
+ "requestDetails":{
+ "serviceProfile":{
+ "blob":"content"
+ },
+ "requestInfo":{
+ "transactionId":"d290f1ee-6c54-4b01-90e6-d701748f0851",
+ "requestId":"d290f1ee-6c54-4b01-90e6-d701748f0851",
+ "callbackUrl":"myDomain.com/myCallback",
+ "callbackHeader":{
+ "blob":"content"
+ },
+ "sourceId":"d290f1ee-6c54-4b01-90e6-d701748f0851",
+ "timeout":5,
+ "numSolutions":1
+ },
+ "NSTInfo":{
+ "UUID":"3fa85f64-5717-4562-b3fc-2c963f66afa1",
+ "invariantUUID":"7ua85f64-5717-4562-b3fc-2c963f66afa6",
+ "name":"embb-nst"
+ },
+ "NSSTInfo":[
+ {
+ "UUID":"3fa85f64-5717-4562-b3fc-2c963f66afa2",
+ "invariantUUID":"2fa85f64-5717-4562-b3fc-2c963f66afa6",
+ "name":"embb-an-nf"
+ },
+ {
+ "UUID":"3fa85f64-5717-4562-b3fc-2c963f66afa3",
+ "invariantUUID":"4fa85f64-5717-4562-b3fc-2c963f66afa6",
+ "name":"embb-cn"
+ },
+ {
+ "UUID":"3fa85f64-5717-4562-b3fc-2c963f66afa4",
+ "invariantUUID":"5ta85f64-5717-4562-b3fc-2c963f66afa6",
+ "name":"embb-tn-fh"
+ },
+ {
+ "UUID":"3fa85f64-5717-4562-b3fc-2c963f66afa5",
+ "invariantUUID":"6ya85f64-5717-4562-b3fc-2c963f66afa6",
+ "name":"embb-tn-mh"
+ },
+ {
+ "UUID":"3fa85f64-5717-4562-b3fc-2c963f66afa7",
+ "invariantUUID":"7ua85f64-5717-4562-b3fc-2c963f66afa6",
+ "name":"embb-tn-bh"
+ }
+ ],
+ "preferReuse":false,
+ "subnetCapabilities":[
+ {
+ "domainType":"AN-NF",
+ "capabilityDetails":{
+ "blob":"content"
+ }
+ },
+ {
+ "domainType":"CN",
+ "capabilityDetails":{
+ "blob":"content"
+ }
+ },
+ {
+ "domainType":"TN-FH",
+ "capabilityDetails":{
+ "blob":"content"
+ }
+ },
+ {
+ "domainType":"TN-MH",
+ "capabilityDetails":{
+ "blob":"content"
+ }
+ },
+ {
+ "domainType":"TN-BH",
+ "capabilityDetails":{
+ "blob":"content"
+ }
+ }
+ ]
+}
+} \ No newline at end of file
diff --git a/adapters/mso-oof-adapter/src/test/resources/testInputs/NsiSelectionResponse.json b/adapters/mso-oof-adapter/src/test/resources/testInputs/NsiSelectionResponse.json
new file mode 100644
index 0000000000..4ddca3eaf9
--- /dev/null
+++ b/adapters/mso-oof-adapter/src/test/resources/testInputs/NsiSelectionResponse.json
@@ -0,0 +1,20 @@
+{
+ "transactionId": "s4r0f1ee-6c54-4b01-90e6-d701748f0851",
+ "requestId": "r500f1ee-6c54-4b01-90e6-d701748f0851",
+ "requestStatus": "completed",
+ "solutions": [
+ {
+ "existingNSI": false,
+ "newNSISolution": {
+ "sliceProfiles": [
+ {
+ "domainType":"CN"
+ }
+ ],
+ "matchLevel": {
+ "blob": "content"
+ }
+ }
+ }
+ ]
+}
diff --git a/adapters/mso-openstack-adapters/pom.xml b/adapters/mso-openstack-adapters/pom.xml
index ad41b0f050..eb6cba5510 100644
--- a/adapters/mso-openstack-adapters/pom.xml
+++ b/adapters/mso-openstack-adapters/pom.xml
@@ -298,7 +298,7 @@
<dependency>
<groupId>commons-validator</groupId>
<artifactId>commons-validator</artifactId>
- <version>1.4.0</version>
+ <version>1.4.1</version>
</dependency>
<!-- added for unit testing -->
diff --git a/adapters/mso-openstack-adapters/src/main/java/org/onap/so/adapters/inventory/delete/DeleteAAIInventory.java b/adapters/mso-openstack-adapters/src/main/java/org/onap/so/adapters/inventory/delete/DeleteAAIInventory.java
index 1f0422b0b2..22e6b1fc22 100644
--- a/adapters/mso-openstack-adapters/src/main/java/org/onap/so/adapters/inventory/delete/DeleteAAIInventory.java
+++ b/adapters/mso-openstack-adapters/src/main/java/org/onap/so/adapters/inventory/delete/DeleteAAIInventory.java
@@ -54,9 +54,9 @@ public class DeleteAAIInventory {
CloudSite cloudSite = cloudConfig.getCloudSite(cloudInformation.getRegionId())
.orElseThrow(() -> new MsoCloudSiteNotFound(cloudInformation.getRegionId()));
CloudIdentity cloudIdentity = cloudSite.getIdentityService();
- HeatBridgeApi heatBridgeClient =
- new HeatBridgeImpl(new AAIResourcesClient(), cloudIdentity, cloudInformation.getOwner(),
- cloudInformation.getRegionId(), cloudSite.getRegionId(), cloudInformation.getTenantId());
+ HeatBridgeApi heatBridgeClient = new HeatBridgeImpl(new AAIResourcesClient(), cloudIdentity,
+ cloudInformation.getOwner(), cloudInformation.getRegionId(), cloudSite.getRegionId(),
+ cloudInformation.getTenantId(), cloudInformation.getNodeType());
heatBridgeClient.authenticate();
heatBridgeClient.deleteVfModuleData(cloudInformation.getVnfId(), cloudInformation.getVfModuleId());
diff --git a/adapters/mso-openstack-adapters/src/main/java/org/onap/so/adapters/tasks/inventory/CreateAAIInventory.java b/adapters/mso-openstack-adapters/src/main/java/org/onap/so/adapters/tasks/inventory/CreateAAIInventory.java
index 12751f8c27..3f79c43bf8 100644
--- a/adapters/mso-openstack-adapters/src/main/java/org/onap/so/adapters/tasks/inventory/CreateAAIInventory.java
+++ b/adapters/mso-openstack-adapters/src/main/java/org/onap/so/adapters/tasks/inventory/CreateAAIInventory.java
@@ -64,9 +64,9 @@ public class CreateAAIInventory {
List<String> oobMgtNetNames = new ArrayList<>();
- HeatBridgeApi heatBridgeClient =
- new HeatBridgeImpl(new AAIResourcesClient(), cloudIdentity, cloudInformation.getOwner(),
- cloudInformation.getRegionId(), cloudSite.getRegionId(), cloudInformation.getTenantId());
+ HeatBridgeApi heatBridgeClient = new HeatBridgeImpl(new AAIResourcesClient(), cloudIdentity,
+ cloudInformation.getOwner(), cloudInformation.getRegionId(), cloudSite.getRegionId(),
+ cloudInformation.getTenantId(), cloudInformation.getNodeType());
heatBridgeClient.authenticate();
@@ -119,8 +119,8 @@ public class CreateAAIInventory {
"Successfully queried neutron resources and built AAI actions to add l-interfaces to vservers.");
// Update AAI
- logger.debug("Current Dry Run Value: {}", env.getProperty("heatBridgeDryrun", Boolean.class, true));
- heatBridgeClient.submitToAai(env.getProperty("heatBridgeDryrun", Boolean.class, true));
+ logger.debug("Current Dry Run Value: {}", env.getProperty("heatBridgeDryrun", Boolean.class, false));
+ heatBridgeClient.submitToAai(env.getProperty("heatBridgeDryrun", Boolean.class, false));
} catch (Exception ex) {
logger.debug("Heatbrige failed for stackId: " + cloudInformation.getTemplateInstanceId(), ex);
}
diff --git a/adapters/mso-openstack-adapters/src/main/java/org/onap/so/heatbridge/HeatBridgeApi.java b/adapters/mso-openstack-adapters/src/main/java/org/onap/so/heatbridge/HeatBridgeApi.java
index a4e6cccc06..bafba3e901 100644
--- a/adapters/mso-openstack-adapters/src/main/java/org/onap/so/heatbridge/HeatBridgeApi.java
+++ b/adapters/mso-openstack-adapters/src/main/java/org/onap/so/heatbridge/HeatBridgeApi.java
@@ -155,7 +155,7 @@ public interface HeatBridgeApi {
* @param cloudOwner
*/
void buildAddVserverLInterfacesToAaiAction(List<Resource> stackResources, List<String> oobMgtNetIds,
- String cloudOwner);
+ String cloudOwner) throws HeatBridgeException;
/**
* Query and build AAI actions for Openstack Compute resources to AAI's pserver and pinterface objects
diff --git a/adapters/mso-openstack-adapters/src/main/java/org/onap/so/heatbridge/HeatBridgeImpl.java b/adapters/mso-openstack-adapters/src/main/java/org/onap/so/heatbridge/HeatBridgeImpl.java
index ef2577d6fe..90a578d3b4 100644
--- a/adapters/mso-openstack-adapters/src/main/java/org/onap/so/heatbridge/HeatBridgeImpl.java
+++ b/adapters/mso-openstack-adapters/src/main/java/org/onap/so/heatbridge/HeatBridgeImpl.java
@@ -32,6 +32,8 @@
*/
package org.onap.so.heatbridge;
+import java.io.IOException;
+import java.util.ArrayList;
import java.util.HashMap;
import java.util.List;
import java.util.Map;
@@ -49,6 +51,7 @@ import org.apache.commons.validator.routines.InetAddressValidator;
import org.onap.aai.domain.yang.Flavor;
import org.onap.aai.domain.yang.Image;
import org.onap.aai.domain.yang.L3InterfaceIpv4AddressList;
+import org.onap.aai.domain.yang.L3InterfaceIpv6AddressList;
import org.onap.aai.domain.yang.L3Network;
import org.onap.aai.domain.yang.LInterface;
import org.onap.aai.domain.yang.PInterface;
@@ -59,22 +62,31 @@ import org.onap.aai.domain.yang.SriovPf;
import org.onap.aai.domain.yang.SriovPfs;
import org.onap.aai.domain.yang.Subnets;
import org.onap.aai.domain.yang.SriovVf;
-import org.onap.aai.domain.yang.SriovVfs;
import org.onap.aai.domain.yang.VfModule;
import org.onap.aai.domain.yang.Vlan;
-import org.onap.aai.domain.yang.Vlans;
import org.onap.aai.domain.yang.Vserver;
-import org.onap.aaiclient.client.aai.AAIObjectType;
+import org.onap.aaiclient.client.aai.AAIDSLQueryClient;
import org.onap.aaiclient.client.aai.AAIResourcesClient;
import org.onap.aaiclient.client.aai.AAISingleTransactionClient;
import org.onap.aaiclient.client.aai.entities.AAIResultWrapper;
import org.onap.aaiclient.client.aai.entities.Relationships;
+import org.onap.aaiclient.client.aai.entities.Results;
import org.onap.aaiclient.client.aai.entities.uri.AAIResourceUri;
import org.onap.aaiclient.client.aai.entities.uri.AAIUriFactory;
import org.onap.aaiclient.client.generated.fluentbuilders.AAIFluentTypeBuilder;
+import org.onap.aaiclient.client.generated.fluentbuilders.AAIFluentTypeBuilder.Types;
+import org.onap.aaiclient.client.graphinventory.Format;
+import org.onap.aaiclient.client.graphinventory.entities.DSLQuery;
+import org.onap.aaiclient.client.graphinventory.entities.DSLQueryBuilder;
+import org.onap.aaiclient.client.graphinventory.entities.DSLStartNode;
+import org.onap.aaiclient.client.graphinventory.entities.Node;
+import org.onap.aaiclient.client.graphinventory.entities.Start;
+import org.onap.aaiclient.client.graphinventory.entities.TraversalBuilder;
+import org.onap.aaiclient.client.graphinventory.entities.__;
import org.onap.aaiclient.client.graphinventory.entities.uri.Depth;
import org.onap.aaiclient.client.graphinventory.exceptions.BulkProcessFailed;
import org.onap.logging.filter.base.ErrorCode;
+import org.onap.so.cloud.resource.beans.NodeType;
import org.onap.so.db.catalog.beans.CloudIdentity;
import org.onap.so.db.catalog.beans.ServerType;
import org.onap.so.heatbridge.constants.HeatBridgeConstants;
@@ -96,6 +108,8 @@ import org.openstack4j.model.network.Subnet;
import org.slf4j.Logger;
import org.slf4j.LoggerFactory;
import org.springframework.core.env.Environment;
+import com.fasterxml.jackson.core.type.TypeReference;
+import com.fasterxml.jackson.databind.ObjectMapper;
import com.google.common.base.Preconditions;
import com.google.common.base.Strings;
import com.google.common.collect.ImmutableMap;
@@ -110,21 +124,34 @@ public class HeatBridgeImpl implements HeatBridgeApi {
private static final String ERR_MSG_NULL_OS_CLIENT =
"Initialization error: Null openstack client. Authenticate with Keystone first.";
private static final String OOB_MGT_NETWORK_IDENTIFIER = "Management";
+
+ protected static final String DIRECT = "direct";
+ protected static final String PCI_SLOT = "pci_slot";
+ protected static final String OVSNET = "ovsnet";
+ protected static final String SRIOV = "SRIOV";
+ protected static final String RESOURCE_LINK = "resource-link";
+
+ protected static final Object PRIVATE_VLANS = "private_vlans";
+ protected static final Object PUBLIC_VLANS = "public_vlans";
+
+ protected ObjectMapper mapper = new ObjectMapper();
+
private OpenstackClient osClient;
private AAIResourcesClient resourcesClient;
+ private AAIDSLQueryClient aaiDSLClient;
private AAISingleTransactionClient transaction;
private String cloudOwner;
private String cloudRegionId;
private String regionId;
private String tenantId;
+ private NodeType nodeType;
private AaiHelper aaiHelper = new AaiHelper();
private CloudIdentity cloudIdentity;
private Environment env;
-
public HeatBridgeImpl(AAIResourcesClient resourcesClient, final CloudIdentity cloudIdentity,
@Nonnull final String cloudOwner, @Nonnull final String cloudRegionId, @Nonnull final String regionId,
- @Nonnull final String tenantId) {
+ @Nonnull final String tenantId, @Nonnull final NodeType nodeType) {
Objects.requireNonNull(cloudOwner, "Null cloud-owner value!");
Objects.requireNonNull(cloudRegionId, "Null cloud-region identifier!");
Objects.requireNonNull(tenantId, "Null tenant identifier!");
@@ -136,6 +163,7 @@ public class HeatBridgeImpl implements HeatBridgeApi {
this.regionId = regionId;
this.tenantId = tenantId;
this.resourcesClient = resourcesClient;
+ this.nodeType = nodeType;
if (resourcesClient != null)
this.transaction = resourcesClient.beginSingleTransaction();
if (SpringContextHelper.getAppContext() != null)
@@ -201,6 +229,11 @@ public class HeatBridgeImpl implements HeatBridgeApi {
return serverIds.stream().map(serverId -> osClient.getServerById(serverId)).collect(Collectors.toList());
}
+
+ protected Server getOpenstackServerById(String deviceId) {
+ return osClient.getServerById(deviceId);
+ }
+
@Override
public List<Network> getAllOpenstackProviderNetworks(final List<Resource> stackResources) {
Objects.requireNonNull(osClient, ERR_MSG_NULL_OS_CLIENT);
@@ -240,7 +273,8 @@ public class HeatBridgeImpl implements HeatBridgeApi {
l3Network.setRelationshipList(relationshipList);
transaction.createIfNotExists(
- AAIUriFactory.createResourceUri(AAIObjectType.L3_NETWORK, l3Network.getNetworkId()),
+ AAIUriFactory
+ .createResourceUri(AAIFluentTypeBuilder.network().l3Network(l3Network.getNetworkId())),
Optional.of(l3Network));
}
});
@@ -252,8 +286,8 @@ public class HeatBridgeImpl implements HeatBridgeApi {
for (org.openstack4j.model.compute.Image image : images) {
Image aaiImage = aaiHelper.buildImage(image);
try {
- AAIResourceUri uri = AAIUriFactory.createResourceUri(AAIObjectType.IMAGE, cloudOwner, cloudRegionId,
- aaiImage.getImageId());
+ AAIResourceUri uri = AAIUriFactory.createResourceUri(AAIFluentTypeBuilder.cloudInfrastructure()
+ .cloudRegion(cloudOwner, cloudRegionId).image(aaiImage.getImageId()));
if (!resourcesClient.exists(uri)) {
transaction.create(uri, aaiImage);
logger.debug("Queuing AAI command to add image: " + aaiImage.getImageId());
@@ -273,8 +307,8 @@ public class HeatBridgeImpl implements HeatBridgeApi {
for (org.openstack4j.model.compute.Flavor flavor : flavors) {
Flavor aaiFlavor = aaiHelper.buildFlavor(flavor);
try {
- AAIResourceUri uri = AAIUriFactory.createResourceUri(AAIObjectType.FLAVOR, cloudOwner, cloudRegionId,
- aaiFlavor.getFlavorId());
+ AAIResourceUri uri = AAIUriFactory.createResourceUri(AAIFluentTypeBuilder.cloudInfrastructure()
+ .cloudRegion(cloudOwner, cloudRegionId).flavor(aaiFlavor.getFlavorId()));
transaction.createIfNotExists(uri, Optional.of(aaiFlavor));
} catch (WebApplicationException e) {
throw new HeatBridgeException(
@@ -292,18 +326,24 @@ public class HeatBridgeImpl implements HeatBridgeApi {
// Build vserver relationships to: image, flavor, pserver, vf-module
vserver.setRelationshipList(
aaiHelper.getVserverRelationshipList(cloudOwner, cloudRegionId, genericVnfId, vfModuleId, server));
- transaction.createIfNotExists(AAIUriFactory.createResourceUri(AAIObjectType.VSERVER, cloudOwner,
- cloudRegionId, tenantId, vserver.getVserverId()), Optional.of(vserver));
+ transaction.createIfNotExists(
+ AAIUriFactory.createResourceUri(AAIFluentTypeBuilder.cloudInfrastructure()
+ .cloudRegion(cloudOwner, cloudRegionId).tenant(tenantId).vserver(vserver.getVserverId())),
+ Optional.of(vserver));
});
}
@Override
public void buildAddVserverLInterfacesToAaiAction(final List<Resource> stackResources,
- final List<String> oobMgtNetIds, String cloudOwner) {
+ final List<String> oobMgtNetIds, String cloudOwner) throws HeatBridgeException {
Objects.requireNonNull(osClient, ERR_MSG_NULL_OS_CLIENT);
List<String> portIds =
extractStackResourceIdsByResourceType(stackResources, HeatBridgeConstants.OS_PORT_RESOURCE_TYPE);
+
+ if (portIds == null)
+ return;
for (String portId : portIds) {
+ boolean isL2Multicast = false;
Port port = osClient.getPortById(portId);
Network network = osClient.getNetworkById(port.getNetworkId());
LInterface lIf = new LInterface();
@@ -314,32 +354,54 @@ public class HeatBridgeImpl implements HeatBridgeApi {
lIf.setIsPortMirrored(false);
lIf.setIsIpUnnumbered(false);
lIf.setInMaint(false);
- if (oobMgtNetIds != null && oobMgtNetIds.contains(port.getNetworkId())) {
- lIf.setInterfaceRole(OOB_MGT_NETWORK_IDENTIFIER);
- } else {
- lIf.setInterfaceRole(port.getvNicType());
- }
- boolean isL2Multicast = false;
- if (port.getProfile().get("trusted") != null) {
+
+ if (port.getProfile() != null && port.getProfile().get("trusted") != null) {
String trusted = port.getProfile().get("trusted").toString();
if (Boolean.parseBoolean(trusted)) {
isL2Multicast = true;
}
}
lIf.setL2Multicasting(isL2Multicast);
+ lIf.setInterfaceType(getInterfaceType(nodeType, port.getvNicType()));
+ lIf.setRelationshipList(new RelationshipList());
- transaction.createIfNotExists(AAIUriFactory.createResourceUri(AAIObjectType.L_INTERFACE, cloudOwner,
- cloudRegionId, tenantId, port.getDeviceId(), lIf.getInterfaceName()), Optional.of(lIf));
+ if (oobMgtNetIds != null && oobMgtNetIds.contains(port.getNetworkId())) {
+ lIf.setInterfaceRole(OOB_MGT_NETWORK_IDENTIFIER);
+ } else {
+ lIf.setInterfaceRole(port.getvNicType());
+ }
+
+ // Update l-interface to the vserver
+ transaction.createIfNotExists(
+ AAIUriFactory.createResourceUri(
+ AAIFluentTypeBuilder.cloudInfrastructure().cloudRegion(cloudOwner, cloudRegionId)
+ .tenant(tenantId).vserver(port.getDeviceId()).lInterface(lIf.getInterfaceName())),
+ Optional.of(lIf));
updateLInterfaceIps(port, lIf);
+
if (cloudOwner.equals(env.getProperty("mso.cloudOwner.included", ""))) {
- updateLInterfaceVlan(port, lIf);
+ Server server = getOpenstackServerById(port.getDeviceId());
+ updateLInterfaceVlan(port, lIf, server.getHypervisorHostname());
}
updateSriovPfToPserver(port, lIf);
}
}
+ protected String getInterfaceType(NodeType nodeType, String nicType) {
+ logger.debug("nicType: " + nicType + "nodeType: " + nodeType);
+ if (DIRECT.equalsIgnoreCase(nicType)) {
+ return SRIOV;
+ } else {
+ if (nodeType == NodeType.GREENFIELD) {
+ return NodeType.GREENFIELD.getNetworkTechnologyName();
+ } else {
+ return NodeType.BROWNFIELD.getNetworkTechnologyName();
+ }
+ }
+ }
+
@Override
public void createPserversAndPinterfacesIfNotPresentInAai(final List<Resource> stackResources)
throws HeatBridgeException {
@@ -353,8 +415,10 @@ public class HeatBridgeImpl implements HeatBridgeApi {
for (String portId : portIds) {
Port port = osClient.getPortById(portId);
if (port.getvNicType().equalsIgnoreCase(HeatBridgeConstants.OS_SRIOV_PORT_TYPE)) {
- createPServerPInterfaceIfNotExists(serverHostnames.get(port.getHostId()).getHostname(),
- aaiHelper.buildPInterface(port));
+ Pserver foundServer = serverHostnames.get(port.getHostId());
+ if (foundServer != null) {
+ createPServerPInterfaceIfNotExists(foundServer.getHostname(), aaiHelper.buildPInterface(port));
+ }
}
}
}
@@ -366,6 +430,7 @@ public class HeatBridgeImpl implements HeatBridgeApi {
for (Server server : osServers) {
Pserver pserver = aaiHelper.buildPserver(server);
if (pserver != null) {
+ logger.debug("Adding Pserver: " + server.getHost());
pserverMap.put(server.getHost(), pserver);
}
}
@@ -389,18 +454,21 @@ public class HeatBridgeImpl implements HeatBridgeApi {
private void createPServerIfNotExists(Map<String, Pserver> serverHostnames) {
for (Pserver pserver : serverHostnames.values()) {
- AAIResourceUri uri = AAIUriFactory.createResourceUri(AAIObjectType.PSERVER, pserver.getHostname());
+ AAIResourceUri uri = AAIUriFactory
+ .createResourceUri(AAIFluentTypeBuilder.cloudInfrastructure().pserver(pserver.getHostname()));
resourcesClient.createIfNotExists(uri, Optional.of(pserver));
}
}
private void createPServerPInterfaceIfNotExists(String pserverHostname, PInterface pInterface) {
- AAIResourceUri uri = AAIUriFactory.createResourceUri(AAIObjectType.P_INTERFACE, pserverHostname,
- pInterface.getInterfaceName());
+ AAIResourceUri uri = AAIUriFactory.createResourceUri(AAIFluentTypeBuilder.cloudInfrastructure()
+ .pserver(pserverHostname).pInterface(pInterface.getInterfaceName()));
resourcesClient.createIfNotExists(uri, Optional.of(pInterface));
}
- private void updateLInterfaceVlan(final Port port, final LInterface lIf) {
+ private void updateLInterfaceVlan(final Port port, final LInterface lIf, final String hostName)
+ throws HeatBridgeException {
+ // add back all vlan logic
Vlan vlan = new Vlan();
Network network = osClient.getNetworkById(port.getNetworkId());
if (network.getNetworkType() != null && network.getNetworkType().equals(NetworkType.VLAN)) {
@@ -410,7 +478,6 @@ public class HeatBridgeImpl implements HeatBridgeApi {
vlan.setInMaint(false);
vlan.setIsIpUnnumbered(false);
vlan.setIsPrivate(false);
-
transaction
.createIfNotExists(
AAIUriFactory.createResourceUri(AAIFluentTypeBuilder.cloudInfrastructure()
@@ -419,6 +486,32 @@ public class HeatBridgeImpl implements HeatBridgeApi {
Optional.of(vlan));
}
+ if (nodeType == NodeType.GREENFIELD) {
+ validatePhysicalNetwork(port, network);
+ processOVS(lIf, hostName, NodeType.GREENFIELD.getInterfaceName());
+ } else {
+ processOVS(lIf, hostName, NodeType.BROWNFIELD.getInterfaceName());
+ }
+
+ List<String> privateVlans = (ArrayList<String>) port.getProfile().get(PRIVATE_VLANS);
+ List<String> publicVlans = (ArrayList<String>) port.getProfile().get(PUBLIC_VLANS);
+ List<String> vlans = null;
+ if (publicVlans != null && !publicVlans.isEmpty()) {
+ vlans = publicVlans.stream().filter(publicVlan -> !Strings.isNullOrEmpty(publicVlan))
+ .collect(Collectors.toList());
+ } else {
+ vlans = new ArrayList<>();
+ }
+
+ if (privateVlans != null && !privateVlans.isEmpty()) {
+ List<String> temp = privateVlans.stream().filter(privateVlan -> !Strings.isNullOrEmpty(privateVlan))
+ .collect(Collectors.toList());
+ vlans.addAll(temp);
+ }
+ vlans.stream().forEach(vlanLocal -> logger.debug("Vlan Id: {}", vlanLocal));
+
+ processVlanTag(lIf, vlans);
+
if (port.getvNicType() != null && port.getvNicType().equalsIgnoreCase(HeatBridgeConstants.OS_SRIOV_PORT_TYPE)) {
SriovVf sriovVf = new SriovVf();
sriovVf.setPciId(port.getProfile().get(HeatBridgeConstants.OS_PCI_SLOT_KEY).toString());
@@ -436,6 +529,49 @@ public class HeatBridgeImpl implements HeatBridgeApi {
}
}
+ protected String createVlanTagUri(String vlanIdOuter) throws HeatBridgeException {
+ int vlanOuterInt = Integer.parseInt(vlanIdOuter);
+ DSLQueryBuilder<Start, Node> builder = TraversalBuilder
+ .fragment(new DSLStartNode(Types.CLOUD_REGION, __.key("cloud-owner", cloudOwner),
+ __.key("cloud-region-id", cloudRegionId)))
+ .to(__.node(Types.VLAN_RANGE))
+ .to(__.node(Types.VLAN_TAG, __.key("vlan-id-outer", vlanOuterInt)).output());
+ String results = getAAIDSLClient().query(Format.PATHED, new DSLQuery(builder.build()));
+ Optional<String> vlanTagURI = findLinkedURI(results);
+ if (vlanTagURI.isPresent())
+ return vlanTagURI.get();
+ else
+ throw new HeatBridgeException("Cannot find VlanTag Related Link " + vlanIdOuter);
+ }
+
+
+ protected void processVlanTag(LInterface lInterface, List<String> vlanTags) throws HeatBridgeException {
+ for (String vlanTag : vlanTags) {
+ Relationship vlanTagRelationship = new Relationship();
+ vlanTagRelationship.setRelatedLink(createVlanTagUri(vlanTag));
+ lInterface.getRelationshipList().getRelationship().add(vlanTagRelationship);
+ }
+ }
+
+ protected void validatePhysicalNetwork(Port neutronPort, Network network) throws HeatBridgeException {
+ String physicalNetworkType = network.getProviderPhyNet();
+ if (!OVSNET.equalsIgnoreCase(physicalNetworkType)) {
+ String exceptionMessage = String.format(
+ "The OVS-DPDK port is expected to have a physical network of type ovsnet but was found to have %s instead.",
+ physicalNetworkType);
+ throw new HeatBridgeException(exceptionMessage);
+ }
+ }
+
+ protected void processOVS(LInterface lInterface, String hostName, String interfaceName) {
+ Relationship lagRelationship = new Relationship();
+ lagRelationship.setRelatedLink(AAIUriFactory
+ .createResourceUri(
+ AAIFluentTypeBuilder.cloudInfrastructure().pserver(hostName).lagInterface(interfaceName))
+ .build().toString());
+ lInterface.getRelationshipList().getRelationship().add(lagRelationship);
+ }
+
/**
* Needs to be corrected according to the specification that is in draft If pserver/p-interface does not have a
* SRIOV-PF object matching the PCI-ID of the Openstack port object, then create it in AAI. Openstack SRIOV Port
@@ -461,9 +597,11 @@ public class HeatBridgeImpl implements HeatBridgeApi {
lIf.setInterfaceDescription(
"Attached to SR-IOV port: " + pserverHostName + "::" + matchingPifName.get());
try {
- Optional<PInterface> matchingPIf = resourcesClient.get(PInterface.class, AAIUriFactory
- .createResourceUri(AAIObjectType.P_INTERFACE, pserverHostName, matchingPifName.get())
- .depth(Depth.ONE));
+ Optional<PInterface> matchingPIf = resourcesClient.get(PInterface.class,
+ AAIUriFactory
+ .createResourceUri(AAIFluentTypeBuilder.cloudInfrastructure()
+ .pserver(pserverHostName).pInterface(matchingPifName.get()))
+ .depth(Depth.ONE));
if (matchingPIf.isPresent()) {
SriovPfs pIfSriovPfs = matchingPIf.get().getSriovPfs();
if (pIfSriovPfs == null) {
@@ -481,16 +619,18 @@ public class HeatBridgeImpl implements HeatBridgeApi {
logger.debug("Queuing AAI command to update sriov-pf object to pserver: " + pserverHostName
+ "/" + matchingPifName.get());
- AAIResourceUri sriovPfUri = AAIUriFactory.createResourceUri(AAIObjectType.SRIOV_PF,
- pserverHostName, matchingPifName.get(), sriovPf.getPfPciId());
+ AAIResourceUri sriovPfUri = AAIUriFactory.createResourceUri(
+ AAIFluentTypeBuilder.cloudInfrastructure().pserver(pserverHostName)
+ .pInterface(matchingPifName.get()).sriovPf(sriovPf.getPfPciId()));
+
if (!resourcesClient.exists(sriovPfUri)) {
transaction.create(sriovPfUri, sriovPf);
- AAIResourceUri sriovVfUri = AAIUriFactory.createResourceUri(AAIObjectType.SRIOV_VF,
- cloudOwner, cloudRegionId, tenantId, port.getDeviceId(), lIf.getInterfaceName(),
- port.getProfile().get(HeatBridgeConstants.OS_PCI_SLOT_KEY).toString());
-
+ AAIResourceUri sriovVfUri = AAIUriFactory.createResourceUri(AAIFluentTypeBuilder
+ .cloudInfrastructure().cloudRegion(cloudOwner, cloudRegionId).tenant(tenantId)
+ .vserver(port.getDeviceId()).lInterface(lIf.getInterfaceName()).sriovVf(
+ port.getProfile().get(HeatBridgeConstants.OS_PCI_SLOT_KEY).toString()));
transaction.connect(sriovPfUri, sriovVfUri);
}
}
@@ -505,13 +645,14 @@ public class HeatBridgeImpl implements HeatBridgeApi {
}
}
- private void updateLInterfaceIps(final Port port, final LInterface lIf) {
+ protected void updateLInterfaceIps(final Port port, final LInterface lIf) {
for (IP ip : port.getFixedIps()) {
String ipAddress = ip.getIpAddress();
if (InetAddressValidator.getInstance().isValidInet4Address(ipAddress)) {
Subnet subnet = osClient.getSubnetById(ip.getSubnetId());
IPAddressString cidr = new IPAddressString(subnet.getCidr());
L3InterfaceIpv4AddressList lInterfaceIp = new L3InterfaceIpv4AddressList();
+ lInterfaceIp.setIsFloating(false);
lInterfaceIp.setL3InterfaceIpv4Address(ipAddress);
lInterfaceIp.setNeutronNetworkId(port.getNetworkId());
lInterfaceIp.setNeutronSubnetId(ip.getSubnetId());
@@ -522,6 +663,21 @@ public class HeatBridgeImpl implements HeatBridgeApi {
.cloudRegion(cloudOwner, cloudRegionId).tenant(tenantId).vserver(port.getDeviceId())
.lInterface(lIf.getInterfaceName()).l3InterfaceIpv4AddressList(ipAddress)),
Optional.of(lInterfaceIp));
+ } else if (InetAddressValidator.getInstance().isValidInet6Address(ipAddress)) {
+ Subnet subnet = osClient.getSubnetById(ip.getSubnetId());
+ IPAddressString cidr = new IPAddressString(subnet.getCidr());
+ L3InterfaceIpv6AddressList ipv6 = new L3InterfaceIpv6AddressList();
+ ipv6.setIsFloating(false);
+ ipv6.setL3InterfaceIpv6Address(ipAddress);
+ ipv6.setNeutronNetworkId(port.getNetworkId());
+ ipv6.setNeutronSubnetId(ip.getSubnetId());
+ ipv6.setL3InterfaceIpv6PrefixLength(Long.parseLong(cidr.getNetworkPrefixLength().toString()));
+
+ transaction.createIfNotExists(
+ AAIUriFactory.createResourceUri(AAIFluentTypeBuilder.cloudInfrastructure()
+ .cloudRegion(cloudOwner, cloudRegionId).tenant(tenantId).vserver(port.getDeviceId())
+ .lInterface(lIf.getInterfaceName()).l3InterfaceIpv6AddressList(ipAddress)),
+ Optional.of(ipv6));
}
}
}
@@ -543,17 +699,16 @@ public class HeatBridgeImpl implements HeatBridgeApi {
Objects.requireNonNull(vnfId, "Null vnf-id!");
Objects.requireNonNull(vfModuleId, "Null vf-module-id!");
try {
- Optional<VfModule> vfModule = resourcesClient
- .get(AAIUriFactory.createResourceUri(AAIObjectType.VF_MODULE, vnfId, vfModuleId).depth(Depth.ONE),
- NotFoundException.class)
- .asBean(VfModule.class);
+ Optional<VfModule> vfModule = resourcesClient.get(AAIUriFactory
+ .createResourceUri(AAIFluentTypeBuilder.network().genericVnf(vnfId).vfModule(vfModuleId))
+ .depth(Depth.ONE), NotFoundException.class).asBean(VfModule.class);
AAIResultWrapper resultWrapper = new AAIResultWrapper(vfModule.get());
Optional<Relationships> relationships = resultWrapper.getRelationships();
logger.debug("VfModule contains relationships in AAI: {}", relationships.isPresent());
if (relationships.isPresent()) {
- List<AAIResourceUri> l3NetworkUris = relationships.get().getRelatedUris(AAIObjectType.L3_NETWORK);
+ List<AAIResourceUri> l3NetworkUris = relationships.get().getRelatedUris(Types.L3_NETWORK);
logger.debug("L3Network contains {} relationships in AAI", l3NetworkUris.size());
if (!l3NetworkUris.isEmpty()) {
@@ -566,13 +721,13 @@ public class HeatBridgeImpl implements HeatBridgeApi {
}
}
- List<AAIResourceUri> vserverUris = relationships.get().getRelatedUris(AAIObjectType.VSERVER);
+ List<AAIResourceUri> vserverUris = relationships.get().getRelatedUris(Types.VSERVER);
logger.debug("VServer contains {} relationships in AAI", vserverUris.size());
createTransactionToDeleteSriovPfFromPserver(vserverUris);
if (!vserverUris.isEmpty()) {
for (AAIResourceUri vserverUri : vserverUris) {
- if (env.getProperty("heatBridgeDryrun", Boolean.class, true)) {
+ if (env.getProperty("heatBridgeDryrun", Boolean.class, false)) {
logger.debug("Would delete Vserver: {}", vserverUri.build().toString());
} else {
resourcesClient.delete(vserverUri);
@@ -598,7 +753,8 @@ public class HeatBridgeImpl implements HeatBridgeApi {
String pserverName = entry.getKey();
List<String> pciIds = entry.getValue();
Optional<Pserver> pserver = resourcesClient.get(Pserver.class,
- AAIUriFactory.createResourceUri(AAIObjectType.PSERVER, pserverName).depth(Depth.TWO));
+ AAIUriFactory.createResourceUri(AAIFluentTypeBuilder.cloudInfrastructure().pserver(pserverName))
+ .depth(Depth.TWO));
if (pserver.isPresent()) {
// For each pserver/p-interface match sriov-vfs by pic-id and delete them.
pserver.get().getPInterfaces().getPInterface().stream().filter(
@@ -607,15 +763,15 @@ public class HeatBridgeImpl implements HeatBridgeApi {
if (pciIds.contains(sriovPf.getPfPciId())) {
logger.debug("creating transaction to delete SR-IOV PF: " + pIf.getInterfaceName()
+ " from PServer: " + pserverName);
- if (env.getProperty("heatBridgeDryrun", Boolean.class, true)) {
+ if (env.getProperty("heatBridgeDryrun", Boolean.class, false)) {
logger.debug("Would delete Sriov Pf: {}",
- AAIUriFactory
- .createResourceUri(AAIObjectType.SRIOV_PF, pserverName,
- pIf.getInterfaceName(), sriovPf.getPfPciId())
- .build().toString());
+ AAIUriFactory.createResourceUri(AAIFluentTypeBuilder.cloudInfrastructure()
+ .pserver(pserverName).pInterface(pIf.getInterfaceName())
+ .sriovPf(sriovPf.getPfPciId())).build());
} else {
- resourcesClient.delete(AAIUriFactory.createResourceUri(AAIObjectType.SRIOV_PF,
- pserverName, pIf.getInterfaceName(), sriovPf.getPfPciId()));
+ resourcesClient.delete(AAIUriFactory.createResourceUri(
+ AAIFluentTypeBuilder.cloudInfrastructure().pserver(pserverName)
+ .pInterface(pIf.getInterfaceName()).sriovPf(sriovPf.getPfPciId())));
}
}
}));
@@ -629,12 +785,11 @@ public class HeatBridgeImpl implements HeatBridgeApi {
AAIResultWrapper vserverWrapper = resourcesClient.get(vserverUri.depth(Depth.TWO));
Optional<Relationships> vserverRelationships = vserverWrapper.getRelationships();
if (vserverRelationships.isPresent()
- && CollectionUtils.isNotEmpty(vserverRelationships.get().getRelatedLinks(AAIObjectType.PSERVER))) {
+ && CollectionUtils.isNotEmpty(vserverRelationships.get().getRelatedLinks(Types.PSERVER))) {
Vserver vserver = vserverWrapper.asBean(Vserver.class).get();
List<String> pciIds = HeatBridgeUtils.extractPciIdsFromVServer(vserver);
if (CollectionUtils.isNotEmpty(pciIds)) {
- List<AAIResourceUri> matchingPservers =
- vserverRelationships.get().getRelatedUris(AAIObjectType.PSERVER);
+ List<AAIResourceUri> matchingPservers = vserverRelationships.get().getRelatedUris(Types.PSERVER);
if (matchingPservers != null && matchingPservers.size() == 1) {
pserverToPciIdMap.put(matchingPservers.get(0).getURIKeys().get("hostname"), pciIds);
}
@@ -648,4 +803,28 @@ public class HeatBridgeImpl implements HeatBridgeApi {
Map<Object, Boolean> map = new ConcurrentHashMap<>();
return t -> map.putIfAbsent(keyExtractor.apply(t), Boolean.TRUE) == null;
}
+
+ protected Optional<String> findLinkedURI(String jsonResultsString) {
+ Results<Map<String, String>> results;
+ try {
+ results = mapper.readValue(jsonResultsString, new TypeReference<Results<Map<String, String>>>() {});
+ if (results.getResult().size() == 1) {
+ return Optional.of(results.getResult().get(0).get(RESOURCE_LINK));
+ } else if (results.getResult().isEmpty()) {
+ return Optional.empty();
+ } else {
+ throw new IllegalStateException("more than one result returned");
+ }
+ } catch (IOException e) {
+ logger.error("Error retrieving URI from Results JSON", e);
+ return Optional.empty();
+ }
+ }
+
+ protected AAIDSLQueryClient getAAIDSLClient() {
+ if (aaiDSLClient == null) {
+ aaiDSLClient = new AAIDSLQueryClient();
+ }
+ return aaiDSLClient;
+ }
}
diff --git a/adapters/mso-openstack-adapters/src/main/java/org/onap/so/heatbridge/helpers/AaiHelper.java b/adapters/mso-openstack-adapters/src/main/java/org/onap/so/heatbridge/helpers/AaiHelper.java
index 7d4e92d9ad..1fa757f547 100644
--- a/adapters/mso-openstack-adapters/src/main/java/org/onap/so/heatbridge/helpers/AaiHelper.java
+++ b/adapters/mso-openstack-adapters/src/main/java/org/onap/so/heatbridge/helpers/AaiHelper.java
@@ -252,6 +252,9 @@ public class AaiHelper {
.filter(link -> link.getRel().equals(HeatBridgeConstants.OS_RESOURCES_SELF_LINK_KEY)).findFirst()
.ifPresent(link -> aaiImage.setImageSelflink(link.getHref()));
}
+ if (aaiImage.getImageSelflink() == null || aaiImage.getImageSelflink().isEmpty()) {
+ aaiImage.setImageSelflink("NA");
+ }
return aaiImage;
}
diff --git a/adapters/mso-openstack-adapters/src/test/java/org/onap/so/heatbridge/HeatBridgeImplTest.java b/adapters/mso-openstack-adapters/src/test/java/org/onap/so/heatbridge/HeatBridgeImplTest.java
index 8c21e3f7f7..cea436b799 100644
--- a/adapters/mso-openstack-adapters/src/test/java/org/onap/so/heatbridge/HeatBridgeImplTest.java
+++ b/adapters/mso-openstack-adapters/src/test/java/org/onap/so/heatbridge/HeatBridgeImplTest.java
@@ -32,9 +32,12 @@
*/
package org.onap.so.heatbridge;
+import static com.shazam.shazamcrest.matcher.Matchers.sameBeanAs;
import static org.junit.Assert.assertEquals;
import static org.junit.Assert.assertFalse;
import static org.junit.Assert.assertNotNull;
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.assertTrue;
import static org.mockito.ArgumentMatchers.any;
import static org.mockito.ArgumentMatchers.anyString;
import static org.mockito.ArgumentMatchers.eq;
@@ -65,15 +68,20 @@ import org.mockito.InjectMocks;
import org.mockito.Mock;
import org.mockito.Spy;
import org.mockito.junit.MockitoJUnitRunner;
+import org.onap.aai.domain.yang.L3InterfaceIpv6AddressList;
import org.onap.aai.domain.yang.LInterface;
import org.onap.aai.domain.yang.PInterface;
import org.onap.aai.domain.yang.SriovPf;
+import org.onap.aaiclient.client.aai.AAIDSLQueryClient;
import org.onap.aaiclient.client.aai.AAIObjectType;
import org.onap.aaiclient.client.aai.AAIResourcesClient;
import org.onap.aaiclient.client.aai.AAISingleTransactionClient;
import org.onap.aaiclient.client.aai.entities.uri.AAIResourceUri;
import org.onap.aaiclient.client.aai.entities.uri.AAIUriFactory;
+import org.onap.aaiclient.client.generated.fluentbuilders.AAIFluentTypeBuilder;
+import org.onap.aaiclient.client.graphinventory.GraphInventoryCommonObjectMapperProvider;
import org.onap.aaiclient.client.graphinventory.exceptions.BulkProcessFailed;
+import org.onap.so.cloud.resource.beans.NodeType;
import org.onap.so.db.catalog.beans.CloudIdentity;
import org.onap.so.heatbridge.constants.HeatBridgeConstants;
import org.onap.so.heatbridge.helpers.AaiHelper;
@@ -93,11 +101,14 @@ import org.openstack4j.model.network.Subnet;
import org.openstack4j.openstack.heat.domain.HeatResource;
import org.openstack4j.openstack.heat.domain.HeatResource.Resources;
import org.springframework.core.env.Environment;
+import com.fasterxml.jackson.core.JsonParseException;
+import com.fasterxml.jackson.databind.JsonMappingException;
import com.fasterxml.jackson.databind.ObjectMapper;
import com.google.common.collect.ImmutableMap;
+import inet.ipaddr.IPAddressString;
-@RunWith(MockitoJUnitRunner.class)
+@RunWith(MockitoJUnitRunner.Silent.class)
public class HeatBridgeImplTest {
private static final String CLOUD_OWNER = "CloudOwner";
@@ -117,33 +128,24 @@ public class HeatBridgeImplTest {
private AAISingleTransactionClient transaction;
@Mock
+ private AAIDSLQueryClient mockDSLClient;
+
+ @Mock
private Environment env;
+ @Mock
+ private Server server;
+
@InjectMocks
- private HeatBridgeImpl heatbridge =
- new HeatBridgeImpl(resourcesClient, cloudIdentity, CLOUD_OWNER, REGION_ID, REGION_ID, TENANT_ID);
+ private HeatBridgeImpl heatbridge = new HeatBridgeImpl(resourcesClient, cloudIdentity, CLOUD_OWNER, REGION_ID,
+ REGION_ID, TENANT_ID, NodeType.GREENFIELD);
@Before
public void setUp() throws HeatBridgeException, OpenstackClientException, BulkProcessFailed {
when(resourcesClient.beginSingleTransaction()).thenReturn(transaction);
}
- @Ignore
- @Test
- public void testQueryNestedHeatStackResources() throws HeatBridgeException {
- // Arrange
- String heatStackId = "1234567";
- List<Resource> expectedResourceList = (List<Resource>) extractTestStackResources();
- when(osClient.getStackBasedResources(heatStackId, HeatBridgeConstants.OS_DEFAULT_HEAT_NESTING))
- .thenReturn(expectedResourceList);
-
- // Act
- List<Resource> resourceList = heatbridge.queryNestedHeatStackResources(heatStackId);
- // Assert
- verify(osClient).getStackBasedResources(heatStackId, HeatBridgeConstants.OS_DEFAULT_HEAT_NESTING);
- assertEquals(resourceList, expectedResourceList);
- }
@Test
public void testExtractStackResourceIdsByResourceType() throws HeatBridgeException {
@@ -160,73 +162,6 @@ public class HeatBridgeImplTest {
assertEquals(expectedServerIds, serverIds);
}
- @Ignore
- @Test
- public void testGetAllOpenstackServers() {
- // Arrange
- List<Resource> stackResources = (List<Resource>) extractTestStackResources();
-
- Server server1 = mock(Server.class);
- Server server2 = mock(Server.class);
- List<Server> expectedServers = Arrays.asList(server1, server2);
-
- when(osClient.getServerById("43c2159b-2c04-46ac-bda5-594110cae2d3")).thenReturn(server1);
- when(osClient.getServerById("7cff109a-b2b7-4933-97b4-ec44a8365568")).thenReturn(server2);
-
- // Act
- List<Server> servers = heatbridge.getAllOpenstackServers(stackResources);
-
- // Assert
- assertEquals(expectedServers, servers);
- }
-
- @Ignore
- @Test
- public void testExtractOpenstackImagesFromServers() {
- // Arrange
- Server server1 = mock(Server.class);
- Server server2 = mock(Server.class);
- List<Server> servers = Arrays.asList(server1, server2);
-
- Image image1 = mock(Image.class);
- Image image2 = mock(Image.class);
- when(image1.getId()).thenReturn("1");
- when(image2.getId()).thenReturn("1");
- List<Image> expectedDistinctImages = Collections.singletonList(image1);
-
- when(server1.getImage()).thenReturn(image1);
- when(server2.getImage()).thenReturn(image2);
-
- // Act
- List<Image> images = heatbridge.extractOpenstackImagesFromServers(servers);
-
- // Assert
- assertEquals(expectedDistinctImages, images);
- }
-
- @Ignore
- @Test
- public void testExtractOpenstackFlavorsFromServers() {
- // Arrange
- Server server1 = mock(Server.class);
- Server server2 = mock(Server.class);
- List<Server> servers = Arrays.asList(server1, server2);
-
- Flavor flavor1 = mock(Flavor.class);
- Flavor flavor2 = mock(Flavor.class);
- when(flavor1.getId()).thenReturn("1");
- when(flavor2.getId()).thenReturn("2");
- List<Flavor> expectedFlavors = Arrays.asList(flavor1, flavor2);
-
- when(server1.getFlavor()).thenReturn(flavor1);
- when(server2.getFlavor()).thenReturn(flavor2);
-
- // Act
- List<Flavor> flavors = heatbridge.extractOpenstackFlavorsFromServers(servers);
-
- // Assert
- assertEquals(expectedFlavors, flavors);
- }
@Test
public void testUpdateVserversToAai() throws HeatBridgeException {
@@ -419,14 +354,30 @@ public class HeatBridgeImplTest {
when(port.getMacAddress()).thenReturn("78:4f:43:68:e2:78");
when(port.getNetworkId()).thenReturn("890a203a-23gg-56jh-df67-731656a8f13a");
when(port.getDeviceId()).thenReturn("test-device-id");
+
+ when(osClient.getServerById("test-device-id")).thenReturn(server);
+ when(server.getHypervisorHostname()).thenReturn("test.server.name");
String pfPciId = "0000:08:00.0";
when(port.getProfile()).thenReturn(ImmutableMap.of(HeatBridgeConstants.OS_PCI_SLOT_KEY, pfPciId,
HeatBridgeConstants.OS_PHYSICAL_NETWORK_KEY, "physical_network_id"));
+ IP ip = mock(IP.class);
+
+ Set<IP> ipSet = new HashSet<>();
+ ipSet.add(ip);
+ when(ip.getIpAddress()).thenReturn("2606:ae00:2e60:100::226");
+ when(ip.getSubnetId()).thenReturn("testSubnetId");
+ when(port.getFixedIps()).thenAnswer(x -> ipSet);
+
+ Subnet subnet = mock(Subnet.class);
+ when(subnet.getCidr()).thenReturn("169.254.100.0/24");
+ when(osClient.getSubnetById("testSubnetId")).thenReturn(subnet);
+
Network network = mock(Network.class);
when(network.getId()).thenReturn("test-network-id");
when(network.getNetworkType()).thenReturn(NetworkType.VLAN);
when(network.getProviderSegID()).thenReturn("2345");
+ when(network.getProviderPhyNet()).thenReturn("ovsnet");
when(osClient.getPortById("212a203a-9764-4f42-84ea-731536a8f13a")).thenReturn(port);
when(osClient.getPortById("387e3904-8948-43d1-8635-b6c2042b54da")).thenReturn(port);
@@ -446,8 +397,9 @@ public class HeatBridgeImplTest {
heatbridge.buildAddVserverLInterfacesToAaiAction(stackResources, Arrays.asList("1", "2"), "CloudOwner");
// Assert
- verify(transaction, times(15)).createIfNotExists(any(AAIResourceUri.class), any(Optional.class));
+ verify(transaction, times(20)).createIfNotExists(any(AAIResourceUri.class), any(Optional.class));
verify(osClient, times(5)).getPortById(anyString());
+ verify(osClient, times(5)).getSubnetById("testSubnetId");
verify(osClient, times(10)).getNetworkById(anyString());
}
@@ -516,6 +468,54 @@ public class HeatBridgeImplTest {
}
@Test
+ public void testUpdateLInterfaceIps()
+ throws HeatBridgeException, JsonParseException, JsonMappingException, IOException {
+
+ Port port = mock(Port.class);
+ when(port.getNetworkId()).thenReturn("890a203a-23gg-56jh-df67-731656a8f13a");
+ when(port.getDeviceId()).thenReturn("test-device-id");
+
+ IP ip = mock(IP.class);
+
+ Set<IP> ipSet = new HashSet<>();
+ ipSet.add(ip);
+ when(ip.getIpAddress()).thenReturn("2606:ae00:2e60:100::226");
+ when(ip.getSubnetId()).thenReturn("testSubnetId");
+ when(port.getFixedIps()).thenAnswer(x -> ipSet);
+
+ Subnet subnet = mock(Subnet.class);
+ when(subnet.getCidr()).thenReturn("169.254.100.0/24");
+ when(osClient.getSubnetById("testSubnetId")).thenReturn(subnet);
+
+ LInterface lIf = new LInterface();
+ lIf.setInterfaceName("test-port-name");
+
+ // Act
+ heatbridge.updateLInterfaceIps(port, lIf);
+
+ L3InterfaceIpv6AddressList ipv6 = new L3InterfaceIpv6AddressList();
+ ipv6.setIsFloating(false);
+ ipv6.setL3InterfaceIpv6Address("2606:ae00:2e60:100::226");
+ ipv6.setNeutronNetworkId(port.getNetworkId());
+ ipv6.setNeutronSubnetId(ip.getSubnetId());
+ ipv6.setL3InterfaceIpv6PrefixLength(Long.parseLong("24"));
+
+ ArgumentCaptor<Optional> argument = ArgumentCaptor.forClass(Optional.class);
+
+ // Assert
+ verify(transaction).createIfNotExists(
+ eq(AAIUriFactory.createResourceUri(
+ AAIFluentTypeBuilder.cloudInfrastructure().cloudRegion("CloudOwner", "RegionOne")
+ .tenant("7320ec4a5b9d4589ba7c4412ccfd290f").vserver("test-device-id")
+ .lInterface("test-port-name").l3InterfaceIpv6AddressList("2606:ae00:2e60:100::226"))),
+ argument.capture());
+
+ assertTrue(argument.getValue().isPresent());
+
+ assertThat((L3InterfaceIpv6AddressList) argument.getValue().get(), sameBeanAs(ipv6));
+ }
+
+ @Test
public void testUpdateVserverLInterfacesToAai_skipVlans() throws HeatBridgeException {
// Arrange
List<Resource> stackResources = (List<Resource>) extractTestStackResources();
diff --git a/adapters/pom.xml b/adapters/pom.xml
index 3c71b3c031..49f25b8102 100644
--- a/adapters/pom.xml
+++ b/adapters/pom.xml
@@ -24,6 +24,7 @@
<module>mso-openstack-adapters</module>
<module>etsi-sol003-adapter</module>
<module>mso-nssmf-adapter</module>
+ <module>mso-oof-adapter</module>
<module>so-appc-orchestrator</module>
</modules>