diff options
483 files changed, 35211 insertions, 1425 deletions
diff --git a/adapters/mso-adapter-utils/pom.xml b/adapters/mso-adapter-utils/pom.xml index aa9a1cea9e..b8dec73f80 100644 --- a/adapters/mso-adapter-utils/pom.xml +++ b/adapters/mso-adapter-utils/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>adapters</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <groupId>org.onap.so.adapters</groupId> <artifactId>mso-adapter-utils</artifactId> diff --git a/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/NovaClientImpl.java b/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/NovaClientImpl.java index 7f0f6e4a8b..4dc139f37d 100644 --- a/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/NovaClientImpl.java +++ b/adapters/mso-adapter-utils/src/main/java/org/onap/so/openstack/utils/NovaClientImpl.java @@ -26,14 +26,20 @@ import org.onap.so.openstack.exceptions.MsoException; import org.slf4j.Logger; import org.slf4j.LoggerFactory; import org.springframework.stereotype.Component; +import com.fasterxml.jackson.databind.JsonNode; +import com.fasterxml.jackson.databind.ObjectMapper; +import com.woorea.openstack.base.client.Entity; +import com.woorea.openstack.base.client.HttpMethod; import com.woorea.openstack.base.client.OpenStackRequest; import com.woorea.openstack.nova.Nova; import com.woorea.openstack.nova.model.Flavor; import com.woorea.openstack.nova.model.Flavors; import com.woorea.openstack.nova.model.HostAggregate; import com.woorea.openstack.nova.model.HostAggregates; +import com.woorea.openstack.nova.model.Hypervisors; import com.woorea.openstack.nova.model.QuotaSet; import com.woorea.openstack.nova.model.Server; +import com.woorea.openstack.nova.model.VolumeAttachment; @Component @@ -216,4 +222,61 @@ public class NovaClientImpl extends MsoCommonUtils { throw new NovaClientException("Error building Nova Client", e); } } + + public void postActionToServer(String cloudSiteId, String tenantId, String id, String request) + throws NovaClientException { + try { + ObjectMapper mapper = new ObjectMapper(); + JsonNode actualObj = mapper.readTree(request); + Entity<JsonNode> openstackEntity = new Entity<>(actualObj, "application/json"); + CharSequence actionPath = "/servers/" + id + "/action"; + Nova novaClient = getNovaClient(cloudSiteId, tenantId); + OpenStackRequest<Void> OSRequest = + new OpenStackRequest<>(novaClient, HttpMethod.POST, actionPath, openstackEntity, Void.class); + executeAndRecordOpenstackRequest(OSRequest, false); + } catch (Exception e) { + logger.error("Error building Nova Client", e); + throw new NovaClientException("Error building Nova Client", e); + } + } + + public void attachVolume(String cloudSiteId, String tenantId, String serverId, VolumeAttachment volumeAttachment) + throws NovaClientException { + Nova novaClient; + try { + novaClient = getNovaClient(cloudSiteId, tenantId); + OpenStackRequest<Void> request = novaClient.servers().attachVolume(serverId, volumeAttachment.getVolumeId(), + volumeAttachment.getDevice()); + executeAndRecordOpenstackRequest(request, false); + } catch (MsoException e) { + logger.error("Error building Nova Client", e); + throw new NovaClientException("Error building Nova Client", e); + } + } + + public void detachVolume(String cloudSiteId, String tenantId, String serverId, String volumeId) + throws NovaClientException { + Nova novaClient; + try { + novaClient = getNovaClient(cloudSiteId, tenantId); + OpenStackRequest<Void> request = novaClient.servers().detachVolume(serverId, volumeId); + executeAndRecordOpenstackRequest(request, false); + } catch (MsoException e) { + logger.error("Error building Nova Client", e); + throw new NovaClientException("Error building Nova Client", e); + } + } + + public Hypervisors getHypervisorDetails(String cloudSiteId, String tenantId) throws NovaClientException { + Nova novaClient; + try { + novaClient = getNovaClient(cloudSiteId, tenantId); + OpenStackRequest<Hypervisors> request = novaClient.hypervisors().listDetail(); + return executeAndRecordOpenstackRequest(request, false); + } catch (MsoException e) { + logger.error("Error building Nova Client", e); + throw new NovaClientException("Error building Nova Client", e); + } + } + } diff --git a/adapters/mso-adapters-rest-interface/pom.xml b/adapters/mso-adapters-rest-interface/pom.xml index 5f987e61ce..584c47fea6 100644 --- a/adapters/mso-adapters-rest-interface/pom.xml +++ b/adapters/mso-adapters-rest-interface/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>adapters</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <groupId>org.onap.so.adapters</groupId> <artifactId>mso-adapters-rest-interface</artifactId> diff --git a/adapters/mso-catalog-db-adapter/pom.xml b/adapters/mso-catalog-db-adapter/pom.xml index 9745935925..bcc523ab98 100644 --- a/adapters/mso-catalog-db-adapter/pom.xml +++ b/adapters/mso-catalog-db-adapter/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>adapters</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <groupId>org.onap.so.adapters</groupId> diff --git a/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceArtifact.java b/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceArtifact.java new file mode 100644 index 0000000000..ce39b9713a --- /dev/null +++ b/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceArtifact.java @@ -0,0 +1,118 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (c) 2019, CMCC Technologies Co., Ltd. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.catalogdb.catalogrest; + +import org.onap.so.db.catalog.beans.ServiceArtifact; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import javax.xml.bind.annotation.XmlRootElement; +import java.util.ArrayList; +import java.util.HashMap; +import java.util.List; +import java.util.Map; + +@XmlRootElement(name = "serviceArtifacts") +public class QueryServiceArtifact extends CatalogQuery { + + protected static Logger logger = LoggerFactory.getLogger(QueryServiceArtifact.class); + + private List<ServiceArtifact> serviceArtifactList; + + private static final String TEMPLATE = "\t{\n" + "\t\t\"artifactUUID\" : <ARTIFACT_UUID>,\n" + + "\t\t\"name\" : <NAME>,\n" + "\t\t\"version\" : <VERSION>,\n" + + "\t\t\"checksum\" : <CHECKSUM>,\n" + "\t\t\"type\" : <TYPE>,\n" + + "\t\t\"content\" : <CONTENT>,\n" + "\t\t\"description\" : <DESCRIPTION>\n" + "\t}"; + + public QueryServiceArtifact() { + super(); + serviceArtifactList = new ArrayList<>(); + } + + public QueryServiceArtifact(List<ServiceArtifact> alist) { + serviceArtifactList = new ArrayList<>(); + for (ServiceArtifact o : alist) { + if (logger.isDebugEnabled()) + logger.debug(o.toString()); + serviceArtifactList.add(o); + } + } + + public List<ServiceArtifact> getServiceArtifact() { + return this.serviceArtifactList; + } + + public void setServiceArtifact(List<ServiceArtifact> a) { + this.serviceArtifactList = a; + } + + @Override + public String toString() { + StringBuilder sb = new StringBuilder(); + + boolean first = true; + int i = 1; + for (ServiceArtifact o : serviceArtifactList) { + sb.append(i).append("\t"); + if (!first) + sb.append("\n"); + first = false; + sb.append(o); + } + return sb.toString(); + } + + @Override + public String JSON2(boolean isArray, boolean isEmbed) { + StringBuilder sb = new StringBuilder(); + if (!isEmbed && isArray) + sb.append("{ "); + if (isArray) + sb.append("\"serviceArtifact\": ["); + Map<String, String> valueMap = new HashMap<>(); + String sep = ""; + boolean first = true; + + for (ServiceArtifact o : serviceArtifactList) { + if (first) + sb.append("\n"); + first = false; + + boolean vrNull = o == null; + + put(valueMap, "ARTIFACT_UUID", vrNull ? null : o.getArtifactUUID()); + put(valueMap, "TYPE", vrNull ? null : o.getType()); + put(valueMap, "NAME", vrNull ? null : o.getName()); + put(valueMap, "VERSION", vrNull ? null : o.getVersion()); + put(valueMap, "DESCRIPTION", vrNull ? null : o.getDescription()); + put(valueMap, "CONTENT", vrNull ? null : o.getContent()); + put(valueMap, "CHECKSUM", vrNull ? null : o.getChecksum()); + sb.append(sep).append(this.setTemplate(TEMPLATE, valueMap)); + sep = ",\n"; + } + if (!first) + sb.append("\n"); + if (isArray) + sb.append("]"); + if (!isEmbed && isArray) + sb.append("}"); + return sb.toString(); + } +} diff --git a/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceInfo.java b/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceInfo.java new file mode 100644 index 0000000000..6c1c81c6ef --- /dev/null +++ b/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceInfo.java @@ -0,0 +1,85 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (c) 2019, CMCC Technologies Co., Ltd. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.catalogdb.catalogrest; + +import org.onap.so.db.catalog.beans.Service; +import org.onap.so.db.catalog.beans.ServiceInfo; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import javax.xml.bind.annotation.XmlRootElement; +import java.util.HashMap; +import java.util.Map; + +@XmlRootElement(name = "serviceInfo") +public class QueryServiceInfo extends CatalogQuery { + + protected static Logger logger = LoggerFactory.getLogger(QueryServiceInfo.class); + + private ServiceInfo serviceInfo; + + private static final String TEMPLATE = + "\n" + "\t{" + "\t\t\"id\" : <ID>,\n" + "\t\t\"serviceInput\" : <SERVICE_INPUT>,\n" + + "\t\"serviceProperties\" : <SERVICE_PROPERTIES>,\n" + "<_SERVICEARTIFACT_>\n"; + + + public QueryServiceInfo() { + super(); + this.serviceInfo = new ServiceInfo(); + } + + public QueryServiceInfo(ServiceInfo serviceInfo) { + this.serviceInfo = serviceInfo; + } + + public ServiceInfo getServiceInfo() { + return this.serviceInfo; + } + + public void setServiceInfo(ServiceInfo serviceInfo) { + this.serviceInfo = serviceInfo; + } + + @Override + public String toString() { + + return serviceInfo.toString(); + } + + @Override + public String JSON2(boolean isArray, boolean isEmbed) { + if (serviceInfo == null) { + return "\"serviceInfo\": null"; + } + StringBuilder sb = new StringBuilder(); + sb.append("\"serviceInfo\": "); + sb.append("\n"); + Map<String, String> valueMap = new HashMap<>(); + Service service = serviceInfo.getService(); + put(valueMap, "ID", null == serviceInfo ? null : serviceInfo.getId()); + put(valueMap, "SERVICE_INPUT", null == serviceInfo ? null : serviceInfo.getServiceInput()); + put(valueMap, "SERVICE_PROPERTIES", null == serviceInfo ? null : serviceInfo.getServiceProperties()); + String subitem = new QueryServiceArtifact(service.getServiceArtifactList()).JSON2(true, true); + valueMap.put("_SERVICEARTIFACT_", subitem.replaceAll("(?m)^", "\t\t")); + sb.append(this.setTemplate(TEMPLATE, valueMap)); + sb.append("}"); + return sb.toString(); + } +} diff --git a/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceMacroHolder.java b/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceMacroHolder.java index 0eb7d0418e..d5aa472c8d 100644 --- a/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceMacroHolder.java +++ b/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceMacroHolder.java @@ -40,7 +40,7 @@ public class QueryServiceMacroHolder extends CatalogQuery { + "\t\"serviceType\" : <SERVICE_TYPE>,\n" + "\t\"serviceRole\" : <SERVICE_ROLE>,\n" + "\t\"environmentContext\" : <ENVIRONMENT_CONTEXT>,\n" + "\t\"resourceOrder\" : <RESOURCE_ORDER>,\n" + "\t\"workloadContext\" : <WORKLOAD_CONTEXT>,\n" + "<_SERVICEVNFS_>,\n" + "<_SERVICENETWORKS_>,\n" - + "<_SERVICEALLOTTEDRESOURCES_>\n" + "\t}}"; + + "<_SERVICEINFO_>,\n" + "<_SERVICEPROXY_>,\n" + "<_SERVICEALLOTTEDRESOURCES_>\n" + "\t}}"; public QueryServiceMacroHolder() { super(); @@ -94,6 +94,12 @@ public class QueryServiceMacroHolder extends CatalogQuery { subitem = new QueryAllottedResourceCustomization(service.getAllottedCustomizations()).JSON2(true, true); valueMap.put("_SERVICEALLOTTEDRESOURCES_", subitem.replaceAll(LINE_BEGINNING, "\t")); + subitem = new QueryServiceInfo(serviceMacroHolder.getServiceInfo()).JSON2(true, true); + valueMap.put("_SERVICEINFO_", subitem.replaceAll(LINE_BEGINNING, "\t")); + + subitem = new QueryServiceProxyCustomization(service.getServiceProxyCustomizations()).JSON2(true, true); + valueMap.put("_SERVICEPROXY_", subitem.replaceAll(LINE_BEGINNING, "\t")); + buf.append(this.setTemplate(TEMPLATE, valueMap)); return buf.toString(); } diff --git a/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceProxyCustomization.java b/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceProxyCustomization.java new file mode 100644 index 0000000000..94cf304120 --- /dev/null +++ b/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceProxyCustomization.java @@ -0,0 +1,124 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (c) 2019, CMCC Technologies Co., Ltd. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.catalogdb.catalogrest; + +import org.onap.so.db.catalog.beans.ServiceProxyResourceCustomization; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import javax.xml.bind.annotation.XmlRootElement; +import java.util.ArrayList; +import java.util.HashMap; +import java.util.List; +import java.util.Map; + +@XmlRootElement(name = "serviceProxyCustomizations") +public class QueryServiceProxyCustomization extends CatalogQuery { + + protected static Logger logger = LoggerFactory.getLogger(QueryServiceProxyCustomization.class); + + private List<ServiceProxyResourceCustomization> serviceProxyResourceCustomizationList; + + private static final String TEMPLATE = + "\t{\n" + "\t\t\"modelInfo\" : {\n" + "\t\t\t\"modelName\" : <MODEL_NAME>,\n" + + "\t\t\t\"modelUuid\" : <MODEL_UUID>,\n" + + "\t\t\t\"modelInvariantUuid\" : <MODEL_INVARIANT_UUID>,\n" + + "\t\t\t\"modelVersion\" : <MODEL_VERSION>,\n" + + "\t\t\t\"modelCustomizationUuid\" : <MODEL_CUSTOMIZATION_UUID>,\n" + + "\t\t\t\"modelInstanceName\" : <MODEL_INSTANCE_NAME>\n" + "\t},\n" + + "\t\t\"toscaNodeType\" : <TOSCA_NODE_TYPE>,\n" + + "\t\t\"description\" : <DESCRIPTION>,\n" + + "\t\t\"sourceModelUuid\" : <SOURCE_SERVICE_MODEL_UUID>\n" + "\t}"; + + public QueryServiceProxyCustomization() { + super(); + this.serviceProxyResourceCustomizationList = new ArrayList<>(); + } + + public QueryServiceProxyCustomization( + List<ServiceProxyResourceCustomization> serviceProxyResourceCustomizationList) { + this.serviceProxyResourceCustomizationList = serviceProxyResourceCustomizationList; + } + + @Override + public String toString() { + StringBuilder sb = new StringBuilder(); + + boolean first = true; + int i = 1; + for (ServiceProxyResourceCustomization o : serviceProxyResourceCustomizationList) { + sb.append(i).append("\t"); + if (!first) + sb.append("\n"); + + first = false; + sb.append(o); + } + return sb.toString(); + } + + @Override + public String JSON2(boolean isArray, boolean isEmbed) { + StringBuilder sb = new StringBuilder(); + if (!isEmbed && isArray) + sb.append("{ "); + if (isArray) + sb.append("\"serviceProxy\": ["); + Map<String, String> valueMap = new HashMap<>(); + String sep = ""; + boolean first = true; + + if (this.serviceProxyResourceCustomizationList != null) { + for (ServiceProxyResourceCustomization o : serviceProxyResourceCustomizationList) { + if (first) + sb.append("\n"); + + first = false; + + boolean arNull = o == null; + + put(valueMap, "MODEL_CUSTOMIZATION_UUID", arNull ? null : o.getModelCustomizationUUID()); + put(valueMap, "MODEL_INSTANCE_NAME", arNull ? null : o.getModelInstanceName()); + put(valueMap, "MODEL_UUID", arNull ? null : o.getModelUUID()); + put(valueMap, "MODEL_INVARIANT_UUID", arNull ? null : o.getModelInvariantUUID()); + put(valueMap, "MODEL_VERSION", arNull ? null : o.getModelVersion()); + put(valueMap, "MODEL_NAME", arNull ? null : o.getModelName()); + put(valueMap, "TOSCA_NODE_TYPE", arNull ? null : o.getToscaNodeType()); + put(valueMap, "DESCRIPTION", arNull ? null : o.getDescription()); + put(valueMap, "SOURCE_SERVICE_MODEL_UUID", (String) (arNull ? null + : o.getSourceService() == null ? null : o.getSourceService().getModelUUID())); + + sb.append(sep).append(this.setTemplate(TEMPLATE, valueMap)); + sep = ",\n"; + } + } + if (!first) + sb.append("\n"); + + if (isArray) + sb.append("]"); + + if (!isEmbed && isArray) + sb.append("}"); + + return sb.toString(); + } + +} diff --git a/adapters/mso-catalog-db-adapter/src/main/resources/db/migration/V7.5__AddServiceArtifact.sql b/adapters/mso-catalog-db-adapter/src/main/resources/db/migration/V7.5__AddServiceArtifact.sql new file mode 100644 index 0000000000..d32c4666c5 --- /dev/null +++ b/adapters/mso-catalog-db-adapter/src/main/resources/db/migration/V7.5__AddServiceArtifact.sql @@ -0,0 +1,30 @@ +use catalogdb; + +CREATE TABLE IF NOT EXISTS `service_info` ( + `ID` int (11) AUTO_INCREMENT, + `SERVICE_INPUT` varchar (5000), + `SERVICE_PROPERTIES` varchar (5000), + PRIMARY KEY (`ID`) +)ENGINE=InnoDB DEFAULT CHARSET=latin1; + +CREATE TABLE IF NOT EXISTS `service_artifact`( + `ARTIFACT_UUID` varchar (200) NOT NULL, + `TYPE` varchar (200) NOT NULL, + `NAME` varchar (200) NOT NULL, + `VERSION` varchar (200) NOT NULL, + `DESCRIPTION` varchar (200) DEFAULT NULL, + `CONTENT` LONGTEXT DEFAULT NULL, + `CHECKSUM` varchar (200) DEFAULT NULL, + `CREATION_TIMESTAMP` DATETIME DEFAULT CURRENT_TIMESTAMP, + `SERVICE_MODEL_UUID` varchar (200) NOT NULL, + PRIMARY KEY (`ARTIFACT_UUID`), + CONSTRAINT `fk_service_artifact_service_info1` FOREIGN KEY (`SERVICE_MODEL_UUID`) REFERENCES `service` (`MODEL_UUID`) ON DELETE CASCADE ON UPDATE CASCADE +)ENGINE=InnoDB DEFAULT CHARSET=latin1; + +CREATE TABLE IF NOT EXISTS `service_to_service_info` ( + `SERVICE_MODEL_UUID` varchar (200) NOT NULL, + `SERVICE_INFO_ID` INT (11) NOT NULL, + PRIMARY KEY (`SERVICE_MODEL_UUID`,`SERVICE_INFO_ID`), + CONSTRAINT `fk_service_to_service_info__service1` FOREIGN KEY (`SERVICE_MODEL_UUID`) REFERENCES `service` (`MODEL_UUID`) ON DELETE CASCADE ON UPDATE CASCADE, + CONSTRAINT `fk_service_to_service_info__service_info1` FOREIGN KEY (`SERVICE_INFO_ID`) REFERENCES `service_info` (`ID`) ON DELETE CASCADE ON UPDATE CASCADE +)
\ No newline at end of file diff --git a/adapters/mso-catalog-db-adapter/src/main/resources/db/migration/V8.4__AddBBNameSelectionReference.sql b/adapters/mso-catalog-db-adapter/src/main/resources/db/migration/V8.4__AddBBNameSelectionReference.sql new file mode 100644 index 0000000000..2b8d4ea69f --- /dev/null +++ b/adapters/mso-catalog-db-adapter/src/main/resources/db/migration/V8.4__AddBBNameSelectionReference.sql @@ -0,0 +1,16 @@ +use catalogdb; + +CREATE TABLE IF NOT EXISTS `bbname_selection_reference` ( + `ID` INT(11) NOT NULL AUTO_INCREMENT, + `CONTROLLER_ACTOR` varchar(200) NOT NULL , + `SCOPE` varchar(200) NOT NULL, + `ACTION` varchar(200) NOT NULL, + `BB_NAME` varchar(200) NOT NULL, + PRIMARY KEY (`ID`) +) ENGINE=InnoDB DEFAULT CHARSET=latin1; + +INSERT INTO bbname_selection_reference (CONTROLLER_ACTOR,SCOPE,ACTION,BB_NAME) +VALUES +('APPC', 'vfModule', 'healthCheck','GenericVnfHealthCheckBB'), +('APPC', 'vfModule', 'configScaleOut','ConfigurationScaleOutBB'), +('APPC', 'vnf', 'healthCheck','GenericVnfHealthCheckBB');
\ No newline at end of file diff --git a/adapters/mso-catalog-db-adapter/src/test/java/org/onap/so/db/catalog/client/CatalogDbClientTest.java b/adapters/mso-catalog-db-adapter/src/test/java/org/onap/so/db/catalog/client/CatalogDbClientTest.java index 739b4b62de..03ef24ded0 100644 --- a/adapters/mso-catalog-db-adapter/src/test/java/org/onap/so/db/catalog/client/CatalogDbClientTest.java +++ b/adapters/mso-catalog-db-adapter/src/test/java/org/onap/so/db/catalog/client/CatalogDbClientTest.java @@ -33,6 +33,7 @@ import org.junit.Before; import org.junit.Test; import org.onap.so.adapters.catalogdb.CatalogDbAdapterBaseTest; import org.onap.so.db.catalog.beans.AuthenticationType; +import org.onap.so.db.catalog.beans.BBNameSelectionReference; import org.onap.so.db.catalog.beans.CloudIdentity; import org.onap.so.db.catalog.beans.CloudSite; import org.onap.so.db.catalog.beans.CloudifyManager; @@ -718,8 +719,8 @@ public class CatalogDbClientTest extends CatalogDbAdapterBaseTest { } @Test - public void getWorkflowByModelUUID_validUuid_expectedOutput() { - List<Workflow> workflows = client.findWorkflowByModelUUID("ff2ae348-214a-11e7-93ae-92361f002671"); + public void getWorkflowByVnfModelUUID_validUuid_expectedOutput() { + List<Workflow> workflows = client.findWorkflowByVnfModelUUID("ff2ae348-214a-11e7-93ae-92361f002671"); assertTrue(workflows != null); assertTrue(workflows.size() != 0); @@ -754,5 +755,21 @@ public class CatalogDbClientTest extends CatalogDbAdapterBaseTest { assertNotEquals(0, cloudSites.size()); } + @Test + public void getBBNameSelectionReference_validData_expectedOutput() { + BBNameSelectionReference bbNameSelectionReference = + client.getBBNameSelectionReference("APPC", "vfModule", "healthCheck"); + assertNotNull(bbNameSelectionReference); + assertEquals("GenericVnfHealthCheckBB", bbNameSelectionReference.getBbName()); + } + + @Test + public void getBBNameSelectionReference_invalidData_nullOutput() { + BBNameSelectionReference bbNameSelectionReference = + client.getBBNameSelectionReference("ABC", "vfModule", "healthCheck"); + assertNull(bbNameSelectionReference); + + } + } diff --git a/adapters/mso-nssmf-adapter/pom.xml b/adapters/mso-nssmf-adapter/pom.xml new file mode 100644 index 0000000000..b6b52ce7c5 --- /dev/null +++ b/adapters/mso-nssmf-adapter/pom.xml @@ -0,0 +1,149 @@ +<!-- + ~* + ~============LICENSE_START======================================================= + ~* ONAP - SO + ~*================================================================================ + ~* Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + ~*================================================================================ + ~* Licensed under the Apache License, Version 2.0 (the "License"); + ~* you may not use this file except in compliance with the License. + ~* You may obtain a copy of the License at + ~* + ~* http://www.apache.org/licenses/LICENSE-2.0 + ~* + ~* Unless required by applicable law or agreed to in writing, software + ~* distributed under the License is distributed on an "AS IS" BASIS, + ~* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + ~* See the License for the specific language governing permissions and + ~* limitations under the License. + ~* ============LICENSE_END========================================================= + ~*/ + --> + +<project xmlns="http://maven.apache.org/POM/4.0.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" + xsi:schemaLocation="http://maven.apache.org/POM/4.0.0 http://maven.apache.org/xsd/maven-4.0.0.xsd"> + <modelVersion>4.0.0</modelVersion> + <parent> + <groupId>org.onap.so</groupId> + <artifactId>adapters</artifactId> + <version>1.6.0-SNAPSHOT</version> + </parent> + <artifactId>mso-nssmf-adapter</artifactId> + <packaging>jar</packaging> + <name>mso-nssmf-adapter</name> + <description>Web service endpoint for nssmf operations</description> + <dependencyManagement> + <dependencies> + <dependency> + <groupId>org.springframework.boot</groupId> + <artifactId>spring-boot-dependencies</artifactId> + <version>${springboot.version}</version> + <type>pom</type> + <scope>import</scope> + </dependency> + </dependencies> + </dependencyManagement> + <build> + <finalName>${project.artifactId}-${project.version}</finalName> + <plugins> + <plugin> + <groupId>org.springframework.boot</groupId> + <artifactId>spring-boot-maven-plugin</artifactId> + <configuration> + <mainClass>org.onap.so.adapters.nssmf.MSONssmfApplication</mainClass> + </configuration> + <executions> + <execution> + <goals> + <goal>repackage</goal> + </goals> + </execution> + </executions> + </plugin> + <plugin> + <groupId>org.jacoco</groupId> + <artifactId>jacoco-maven-plugin</artifactId> + </plugin> + </plugins> + </build> + <dependencies> + <dependency> + <groupId>org.springframework.boot</groupId> + <artifactId>spring-boot-starter-actuator</artifactId> + </dependency> + <dependency> + <groupId>org.springframework.boot</groupId> + <artifactId>spring-boot-starter-web</artifactId> + </dependency> + <dependency> + <groupId>org.springframework.boot</groupId> + <artifactId>spring-boot-starter-jdbc</artifactId> + <exclusions> + <exclusion> + <groupId>org.apache.tomcat</groupId> + <artifactId>tomcat-jdbc</artifactId> + </exclusion> + </exclusions> + </dependency> + <dependency> + <groupId>org.apache.cxf</groupId> + <artifactId>cxf-spring-boot-starter-jaxws</artifactId> + <version>${cxf.version}</version> + </dependency> + <dependency> + <groupId>org.apache.cxf</groupId> + <artifactId>cxf-spring-boot-starter-jaxrs</artifactId> + <version>${cxf.version}</version> + </dependency> + <dependency> + <groupId>org.apache.cxf</groupId> + <artifactId>cxf-rt-rs-service-description-swagger</artifactId> + <version>${cxf.version}</version> + </dependency> + <dependency> + <groupId>org.springframework.boot</groupId> + <artifactId>spring-boot-starter-data-jpa</artifactId> + </dependency> + <dependency> + <groupId>org.springframework.boot</groupId> + <artifactId>spring-boot-starter-test</artifactId> + <scope>test</scope> + </dependency> + <dependency> + <groupId>org.onap.so</groupId> + <artifactId>mso-requests-db</artifactId> + <version>${project.version}</version> + </dependency> + <dependency> + <groupId>org.onap.so</groupId> + <artifactId>mso-requests-db-repositories</artifactId> + <version>${project.version}</version> + </dependency> + <dependency> + <groupId>org.mariadb.jdbc</groupId> + <artifactId>mariadb-java-client</artifactId> + </dependency> + <dependency> + <groupId>ch.vorburger.mariaDB4j</groupId> + <artifactId>mariaDB4j</artifactId> + <version>2.2.3</version> + <scope>test</scope> + </dependency> + <dependency> + <groupId>org.springframework.boot</groupId> + <artifactId>spring-boot-configuration-processor</artifactId> + <optional>true</optional> + </dependency> + <dependency> + <groupId>com.squareup.okhttp3</groupId> + <artifactId>okhttp</artifactId> + <version>3.14.0</version> + <scope>test</scope> + </dependency> + <dependency> + <groupId>org.projectlombok</groupId> + <artifactId>lombok</artifactId> + <version>1.18.2</version> + </dependency> + </dependencies> +</project> diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/MSONssmfApplication.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/MSONssmfApplication.java new file mode 100644 index 0000000000..cd011e6437 --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/MSONssmfApplication.java @@ -0,0 +1,32 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf; + +import org.springframework.boot.SpringApplication; +import org.springframework.boot.autoconfigure.SpringBootApplication; + +@SpringBootApplication(scanBasePackages = {"org.onap.so"}) +public class MSONssmfApplication { + + public static void main(String... args) { + SpringApplication.run(MSONssmfApplication.class, args); + } +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/RequestDbConfig.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/RequestDbConfig.java new file mode 100644 index 0000000000..484f7624aa --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/RequestDbConfig.java @@ -0,0 +1,68 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf; + +import javax.persistence.EntityManagerFactory; +import javax.sql.DataSource; +import org.springframework.beans.factory.annotation.Qualifier; +import org.springframework.boot.context.properties.ConfigurationProperties; +import org.springframework.boot.jdbc.DataSourceBuilder; +import org.springframework.boot.orm.jpa.EntityManagerFactoryBuilder; +import org.springframework.context.annotation.Bean; +import org.springframework.context.annotation.Configuration; +import org.springframework.context.annotation.Primary; +import org.springframework.context.annotation.Profile; +import org.springframework.data.jpa.repository.config.EnableJpaRepositories; +import org.springframework.orm.jpa.JpaTransactionManager; +import org.springframework.orm.jpa.LocalContainerEntityManagerFactoryBean; +import org.springframework.transaction.PlatformTransactionManager; +import org.springframework.transaction.annotation.EnableTransactionManagement; + +@Profile({"!test"}) +@Configuration +@EnableTransactionManagement +@EnableJpaRepositories(entityManagerFactoryRef = "requestEntityManagerFactory", + transactionManagerRef = "requestTransactionManager", basePackages = {"org.onap.so.db.request.data.repository"}) +public class RequestDbConfig { + + @Primary + @Bean(name = "requestDataSource") + @ConfigurationProperties(prefix = "spring.datasource") + public DataSource dataSource() { + return DataSourceBuilder.create().build(); + } + + @Primary + @Bean(name = "requestEntityManagerFactory") + public LocalContainerEntityManagerFactoryBean entityManagerFactory(EntityManagerFactoryBuilder builder, + @Qualifier("requestDataSource") DataSource dataSource) { + return builder.dataSource(dataSource).packages("org.onap.so.db.request.beans").persistenceUnit("requestDB") + .build(); + } + + @Primary + @Bean(name = "requestTransactionManager") + public PlatformTransactionManager transactionManager( + @Qualifier("requestEntityManagerFactory") EntityManagerFactory entityManagerFactory) { + return new JpaTransactionManager(entityManagerFactory); + } + +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/WebSecurityConfig.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/WebSecurityConfig.java new file mode 100644 index 0000000000..1522ca9c6d --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/WebSecurityConfig.java @@ -0,0 +1,37 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf; + +import org.springframework.context.annotation.Configuration; +import org.springframework.security.config.annotation.web.builders.HttpSecurity; +import org.springframework.security.config.annotation.web.configuration.EnableWebSecurity; +import org.springframework.security.config.annotation.web.configuration.WebSecurityConfigurerAdapter; + +@EnableWebSecurity +@Configuration +public class WebSecurityConfig extends WebSecurityConfigurerAdapter { + + @Override + protected void configure(HttpSecurity http) throws Exception { + http.csrf().disable(); + } + +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/exceptions/ApplicationException.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/exceptions/ApplicationException.java new file mode 100644 index 0000000000..f63ba356a1 --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/exceptions/ApplicationException.java @@ -0,0 +1,66 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf.exceptions; + +import org.onap.so.adapters.nssmf.model.ErrorResponse; +import org.springframework.http.ResponseEntity; +import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.marshal; + +public class ApplicationException extends Exception { + + private static final long serialVersionUID = 1L; + + private int errorCode; + + private String errorMsg; + + public ApplicationException(int errorCode, String errorMsg) { + this.errorCode = errorCode; + this.errorMsg = errorMsg; + } + + public int getErrorCode() { + return errorCode; + } + + public void setErrorCode(int errorCode) { + this.errorCode = errorCode; + } + + public String getErrorMsg() { + return errorMsg; + } + + public void setErrorMsg(String errorMsg) { + this.errorMsg = errorMsg; + } + + public ResponseEntity buildErrorResponse() { + String message; + try { + ErrorResponse err = new ErrorResponse(errorCode, errorMsg); + message = marshal(err); + } catch (ApplicationException e) { + return ResponseEntity.status(500).body("Internal Server Error"); + } + return ResponseEntity.status(errorCode).body(message); + } +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiClientPropertiesImpl.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiClientPropertiesImpl.java new file mode 100644 index 0000000000..3333c64cd8 --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiClientPropertiesImpl.java @@ -0,0 +1,69 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf.extclients.aai; + +import java.net.MalformedURLException; +import java.net.URL; +import org.onap.so.client.aai.AAIProperties; +import org.onap.so.client.aai.AAIVersion; +import org.onap.so.spring.SpringContextHelper; +import org.springframework.context.ApplicationContext; + +public class AaiClientPropertiesImpl implements AAIProperties { + + private final String endpoint; + + private final String encryptedBasicAuth; + + private final String encrytptionKey; + + public AaiClientPropertiesImpl() { + final ApplicationContext context = SpringContextHelper.getAppContext(); + this.endpoint = context.getEnvironment().getProperty("aai.endpoint"); + this.encryptedBasicAuth = context.getEnvironment().getProperty("aai.auth"); + this.encrytptionKey = context.getEnvironment().getProperty("mso.key"); + } + + @Override + public AAIVersion getDefaultVersion() { + return AAIVersion.LATEST; + } + + @Override + public String getAuth() { + return encryptedBasicAuth; + } + + @Override + public String getKey() { + return encrytptionKey; + } + + @Override + public URL getEndpoint() throws MalformedURLException { + return new URL(endpoint); + } + + @Override + public String getSystemName() { + return "MSO"; + } +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiClientProvider.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiClientProvider.java new file mode 100644 index 0000000000..48e3ef1666 --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiClientProvider.java @@ -0,0 +1,34 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf.extclients.aai; + +import org.onap.so.client.aai.AAIResourcesClient; +import org.springframework.context.annotation.Bean; +import org.springframework.context.annotation.Configuration; + +@Configuration +public class AaiClientProvider { + + @Bean + public AAIResourcesClient getAaiClient() { + return new AAIResourcesClient(); + } +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiServiceProvider.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiServiceProvider.java new file mode 100644 index 0000000000..c737ba6440 --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiServiceProvider.java @@ -0,0 +1,32 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf.extclients.aai; + +import org.onap.aai.domain.yang.EsrSystemInfoList; +import org.onap.aai.domain.yang.EsrThirdpartySdncList; + +public interface AaiServiceProvider { + + EsrThirdpartySdncList invokeGetThirdPartySdncList(); + + EsrSystemInfoList invokeGetThirdPartySdncEsrSystemInfo(String sdncId); + +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiServiceProviderImpl.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiServiceProviderImpl.java new file mode 100644 index 0000000000..f8422e2a8f --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/extclients/aai/AaiServiceProviderImpl.java @@ -0,0 +1,66 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf.extclients.aai; + + +import org.onap.aai.domain.yang.EsrSystemInfoList; +import org.onap.aai.domain.yang.EsrThirdpartySdncList; +import org.onap.so.client.aai.AAIObjectType; +import org.onap.so.client.aai.entities.uri.AAIUriFactory; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.stereotype.Service; + +@Service +public class AaiServiceProviderImpl implements AaiServiceProvider { + + private static final Logger logger = LoggerFactory.getLogger(AaiServiceProviderImpl.class); + + private final AaiClientProvider aaiClientProvider; + + @Autowired + public AaiServiceProviderImpl(final AaiClientProvider aaiClientProvider) { + this.aaiClientProvider = aaiClientProvider; + } + + @Override + public EsrThirdpartySdncList invokeGetThirdPartySdncList() { + return aaiClientProvider.getAaiClient() + .get(EsrThirdpartySdncList.class, AAIUriFactory.createResourceUri(AAIObjectType.THIRDPARTY_SDNC_LIST)) + .orElseGet(() -> { + logger.debug("No VNFMs in AAI"); + return null; + }); + } + + @Override + public EsrSystemInfoList invokeGetThirdPartySdncEsrSystemInfo(String sdncId) { + return aaiClientProvider.getAaiClient() + .get(EsrSystemInfoList.class, + AAIUriFactory.createResourceUri(AAIObjectType.THIRDPARTY_SDNC_SYSTEM_INFO_LIST, sdncId)) + .orElseGet(() -> { + logger.debug("VNFM not found in AAI"); + return null; + }); + } + +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/ErrorResponse.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/ErrorResponse.java new file mode 100644 index 0000000000..188349c0bf --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/ErrorResponse.java @@ -0,0 +1,63 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf.model; + +public class ErrorResponse { + + private int status; + + private String error; + + private String message; + + public ErrorResponse(int status, String message) { + this.status = status; + this.message = message; + this.error = "Bad Request"; + } + + public int getStatus() { + return status; + } + + public void setStatus(int status) { + this.status = status; + } + + public String getError() { + if (status == 500) { + this.error = "Internal Server Error"; + } + return error; + } + + public void setError(String error) { + this.error = error; + } + + public String getMessage() { + return message; + } + + public void setMessage(String message) { + this.message = message; + } +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/TokenRequest.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/TokenRequest.java new file mode 100644 index 0000000000..3590c683e6 --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/TokenRequest.java @@ -0,0 +1,54 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf.model; + +public class TokenRequest { + + private String grantType; + + private String userName; + + private String value; + + public String getGrantType() { + return grantType; + } + + public void setGrantType(String grantType) { + this.grantType = grantType; + } + + public String getUserName() { + return userName; + } + + public void setUserName(String userName) { + this.userName = userName; + } + + public String getValue() { + return value; + } + + public void setValue(String value) { + this.value = value; + } +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/TokenResponse.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/TokenResponse.java new file mode 100644 index 0000000000..8007075e04 --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/model/TokenResponse.java @@ -0,0 +1,44 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf.model; + +public class TokenResponse { + + private String accessToken; + + private int expires; + + public String getAccessToken() { + return accessToken; + } + + public void setAccessToken(String accessToken) { + this.accessToken = accessToken; + } + + public int getExpires() { + return expires; + } + + public void setExpires(int expires) { + this.expires = expires; + } +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/HttpMethod.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/HttpMethod.java new file mode 100644 index 0000000000..f6abd98794 --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/HttpMethod.java @@ -0,0 +1,41 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf.rest; + +public enum HttpMethod { + GET, POST, PUT, DELETE, PATCH; + + public static HttpMethod fromString(String s) { + if (s == null) + return null; + if (("get").equalsIgnoreCase(s)) + return GET; + if (("post").equalsIgnoreCase(s)) + return POST; + if (("put").equalsIgnoreCase(s)) + return PUT; + if (("delete").equalsIgnoreCase(s)) + return DELETE; + if (("patch").equalsIgnoreCase(s)) + return PATCH; + throw new IllegalArgumentException("Invalid value for HTTP Method: " + s); + } +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/JobStatus.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/JobStatus.java new file mode 100644 index 0000000000..f2e651fd6e --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/JobStatus.java @@ -0,0 +1,42 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf.rest; + +import org.onap.so.adapters.nssmf.exceptions.ApplicationException; + + +public enum JobStatus { + STARTED, PROCESSING, FINISHED, ERROR; + + public static JobStatus fromString(String s) throws ApplicationException { + if (s == null) + return null; + if (("started").equalsIgnoreCase(s)) + return STARTED; + if (("processing").equalsIgnoreCase(s)) + return PROCESSING; + if (("finished").equalsIgnoreCase(s)) + return FINISHED; + if (("error").equalsIgnoreCase(s)) + return ERROR; + throw new ApplicationException(500, "Invalid value for Job " + "Status: " + s); + } +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfAdapterRest.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfAdapterRest.java new file mode 100644 index 0000000000..d8e1e36058 --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfAdapterRest.java @@ -0,0 +1,205 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf.rest; + +import org.onap.so.adapters.nssmf.exceptions.ApplicationException; +import org.onap.so.beans.nsmf.JobStatusRequest; +import org.onap.so.beans.nsmf.NssiActDeActRequest; +import org.onap.so.beans.nsmf.NssiAllocateRequest; +import org.onap.so.beans.nsmf.NssiCreateRequest; +import org.onap.so.beans.nsmf.NssiDeAllocateRequest; +import org.onap.so.beans.nsmf.NssiTerminateRequest; +import org.onap.so.beans.nsmf.NssiUpdateRequest; +import org.onap.so.beans.nsmf.NssiUpdateRequestById; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.http.ResponseEntity; +import org.springframework.stereotype.Controller; +import org.springframework.web.bind.annotation.GetMapping; +import org.springframework.web.bind.annotation.PathVariable; +import org.springframework.web.bind.annotation.PostMapping; +import org.springframework.web.bind.annotation.PutMapping; +import org.springframework.web.bind.annotation.RequestBody; +import org.springframework.web.bind.annotation.RequestMapping; +import static javax.ws.rs.core.MediaType.APPLICATION_JSON; +import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.assertObjectNotNull; + +@Controller +@RequestMapping(value = "/api/rest/provMns/v1", produces = {APPLICATION_JSON}, consumes = {APPLICATION_JSON}) +public class NssmfAdapterRest { + + private static final Logger logger = LoggerFactory.getLogger(NssmfAdapterRest.class); + + @Autowired + private NssmfManager nssmfMgr; + + @PostMapping(value = "/NSS/SliceProfiles") + public ResponseEntity allocateNssi(@RequestBody NssiAllocateRequest allocate) { + try { + logger.info("Nssmi allocate request is invoked"); + assertObjectNotNull(allocate); + RestResponse rsp = getNssmfMgr().allocateNssi(allocate); + return buildResponse(rsp); + } catch (ApplicationException e) { + return e.buildErrorResponse(); + } + } + + @PostMapping(value = "/NSS/nssi") + public ResponseEntity createNssi(@RequestBody NssiCreateRequest create) { + try { + logger.info("Nssmf create request is invoked"); + assertObjectNotNull(create); + RestResponse rsp = getNssmfMgr().createNssi(create); + return buildResponse(rsp); + } catch (ApplicationException e) { + return e.buildErrorResponse(); + } + } + + @PostMapping(value = "/NSS/SliceProfiles/{sliceProfileId}") + public ResponseEntity deAllocateNssi(@RequestBody NssiDeAllocateRequest deAllocate, + @PathVariable("sliceProfileId") final String sliceId) { + try { + logger.info("Nssmf deallocate request is invoked"); + assertObjectNotNull(deAllocate); + RestResponse rsp = getNssmfMgr().deAllocateNssi(deAllocate, sliceId); + return buildResponse(rsp); + } catch (ApplicationException e) { + return e.buildErrorResponse(); + } + } + + @PostMapping(value = "/NSS/nssi/{nssiId}") + public ResponseEntity terminateNssi(@RequestBody NssiTerminateRequest terminate, + @PathVariable("nssiId") String nssiId) { + try { + logger.info("Nssmf terminate request is invoked"); + assertObjectNotNull(terminate); + RestResponse rsp = getNssmfMgr().terminateNssi(terminate, nssiId); + return buildResponse(rsp); + } catch (ApplicationException e) { + return e.buildErrorResponse(); + } + } + + @PutMapping(value = "/NSS/SliceProfiles/{sliceProfileId}") + public ResponseEntity modifyNssi(@RequestBody NssiUpdateRequest update, + @PathVariable("sliceProfileId") String sliceId) { + try { + logger.info("Nssmf modify request is invoked"); + assertObjectNotNull(update); + RestResponse rsp = getNssmfMgr().updateNssi(update, sliceId); + return buildResponse(rsp); + } catch (ApplicationException e) { + return e.buildErrorResponse(); + } + } + + @PutMapping(value = "/NSS/nssi/{nssiId}") + public ResponseEntity modifyNssiById(@RequestBody NssiUpdateRequestById updateById, + @PathVariable("nssiId") String nssiId) { + try { + logger.info("Nssmf modify by ID request is invoked"); + assertObjectNotNull(updateById); + RestResponse rsp = getNssmfMgr().updateNssiById(updateById, nssiId); + return buildResponse(rsp); + } catch (ApplicationException e) { + return e.buildErrorResponse(); + } + } + + @PostMapping(value = "/NSS/{snssai}/activation") + public ResponseEntity activateNssi(@RequestBody NssiActDeActRequest activate, + @PathVariable("snssai") String snssai) { + try { + logger.info("Nssmf activate request is invoked"); + assertObjectNotNull(activate); + RestResponse rsp = getNssmfMgr().activateNssi(activate, snssai); + return buildResponse(rsp); + } catch (ApplicationException e) { + return e.buildErrorResponse(); + } + } + + @PostMapping(value = "/NSS/{snssai}/deactivation") + public ResponseEntity deactivateNssi(@RequestBody NssiActDeActRequest deActivate, + @PathVariable("snssai") String snssai) { + try { + logger.info("Nssmf activate request is invoked"); + assertObjectNotNull(deActivate); + RestResponse rsp = getNssmfMgr().deActivateNssi(deActivate, snssai); + return buildResponse(rsp); + } catch (ApplicationException e) { + return e.buildErrorResponse(); + } + } + + @PostMapping(value = "/NSS/jobs/{jobId}") + public ResponseEntity queryJobStatus(@RequestBody JobStatusRequest jobStatusReq, + @PathVariable("jobId") String jobId) { + try { + logger.info("Nssmf query job status request is invoked"); + assertObjectNotNull(jobStatusReq); + RestResponse rsp = getNssmfMgr().queryJobStatus(jobStatusReq, jobId); + return buildResponse(rsp); + } catch (ApplicationException e) { + return e.buildErrorResponse(); + } + } + + @GetMapping(value = "/vendor/{vendorName}/type/{networkType}/NSS" + "/SliceProfiles/{sliceProfileId}") + public ResponseEntity queryNssi(@PathVariable("vendorName") String vendorName, + @PathVariable("networktype") String networkType, @PathVariable("sliceProfileId") String sliceId) { + try { + logger.info("Nssmf query nssi request is invoked"); + RestResponse rsp = getNssmfMgr().queryNssi(vendorName, networkType, sliceId); + return buildResponse(rsp); + } catch (ApplicationException e) { + return e.buildErrorResponse(); + } + } + + @GetMapping(value = "/vendor/{vendorName}/type/{networkType}/NSS/nssi" + "/{nssiId}") + public ResponseEntity queryNssiById(@PathVariable("vendorName") String vendorName, + @PathVariable("networkTtype") String networkType, @PathVariable("nssiId") String nssiId) { + try { + logger.info("Nssmf query nssi by ID request is invoked"); + RestResponse rsp = getNssmfMgr().queryNssiById(vendorName, networkType, nssiId); + return buildResponse(rsp); + } catch (ApplicationException e) { + return e.buildErrorResponse(); + } + } + + public void setNssmfMgr(NssmfManager nssmfMgr) { + this.nssmfMgr = nssmfMgr; + } + + public NssmfManager getNssmfMgr() { + return nssmfMgr; + } + + private ResponseEntity buildResponse(RestResponse rsp) { + return ResponseEntity.status(rsp.getStatus()).body(rsp.getResponseContent()); + } +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfInfo.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfInfo.java new file mode 100644 index 0000000000..6306643a97 --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfInfo.java @@ -0,0 +1,94 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf.rest; + +public class NssmfInfo { + + private String url; + + private String ipAddress; + + private String port; + + private String insecure; + + private String cacert; + + private String userName; + + private String password; + + public String getInsecure() { + return insecure; + } + + public void setInsecure(String insecure) { + this.insecure = insecure; + } + + public String getCacert() { + return cacert; + } + + public void setCacert(String cacert) { + this.cacert = cacert; + } + + public String getIpAddress() { + return ipAddress; + } + + public void setIpAddress(String ipAddress) { + this.ipAddress = ipAddress; + } + + public String getPort() { + return port; + } + + public void setPort(String port) { + this.port = port; + } + + public String getUrl() { + return url; + } + + public void setUrl(String url) { + this.url = url; + } + + public String getUserName() { + return userName; + } + + public void setUserName(String userName) { + this.userName = userName; + } + + public String getPassword() { + return password; + } + + public void setPassword(String password) { + this.password = password; + } +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfManager.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfManager.java new file mode 100644 index 0000000000..0e25729610 --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/NssmfManager.java @@ -0,0 +1,541 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf.rest; + +import org.onap.so.adapters.nssmf.exceptions.ApplicationException; +import org.onap.so.beans.nsmf.ActDeActNssi; +import org.onap.so.beans.nsmf.AllocateAnNssi; +import org.onap.so.beans.nsmf.AllocateCnNssi; +import org.onap.so.beans.nsmf.AllocateTnNssi; +import org.onap.so.beans.nsmf.CreateCnNssi; +import org.onap.so.beans.nsmf.DeAllocateNssi; +import org.onap.so.beans.nsmf.EsrInfo; +import org.onap.so.beans.nsmf.JobStatusRequest; +import org.onap.so.beans.nsmf.JobStatusResponse; +import org.onap.so.beans.nsmf.NetworkType; +import org.onap.so.beans.nsmf.NssiActDeActRequest; +import org.onap.so.beans.nsmf.NssiAllocateRequest; +import org.onap.so.beans.nsmf.NssiCreateRequest; +import org.onap.so.beans.nsmf.NssiDeAllocateRequest; +import org.onap.so.beans.nsmf.NssiResponse; +import org.onap.so.beans.nsmf.NssiTerminateRequest; +import org.onap.so.beans.nsmf.NssiUpdateRequest; +import org.onap.so.beans.nsmf.NssiUpdateRequestById; +import org.onap.so.beans.nsmf.ResponseDescriptor; +import org.onap.so.beans.nsmf.TerminateNssi; +import org.onap.so.beans.nsmf.UpdateCnNssi; +import org.onap.so.beans.nsmf.UpdateCnNssiById; +import org.onap.so.db.request.beans.ResourceOperationStatus; +import org.onap.so.db.request.data.repository.ResourceOperationStatusRepository; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.context.annotation.Primary; +import org.springframework.data.domain.Example; +import org.springframework.stereotype.Component; +import static java.lang.String.valueOf; +import static org.onap.so.adapters.nssmf.rest.HttpMethod.DELETE; +import static org.onap.so.adapters.nssmf.rest.HttpMethod.GET; +import static org.onap.so.adapters.nssmf.rest.HttpMethod.POST; +import static org.onap.so.adapters.nssmf.rest.HttpMethod.PUT; +import static org.onap.so.adapters.nssmf.rest.JobStatus.ERROR; +import static org.onap.so.adapters.nssmf.rest.JobStatus.FINISHED; +import static org.onap.so.adapters.nssmf.rest.JobStatus.PROCESSING; +import static org.onap.so.adapters.nssmf.rest.JobStatus.STARTED; +import static org.onap.so.adapters.nssmf.rest.JobStatus.fromString; +import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.StatusDesc.ACTIVATE_NSS_SUCCESS; +import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.StatusDesc.ALLOCATE_NSS_SUCCESS; +import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.StatusDesc.CREATE_NSS_SUCCESS; +import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.StatusDesc.DEACTIVATE_NSS_SUCCESS; +import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.StatusDesc.DEALLOCATE_NSS_SUCCESS; +import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.StatusDesc.QUERY_JOB_STATUS_FAILED; +import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.StatusDesc.QUERY_JOB_STATUS_SUCCESS; +import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.assertObjectNotNull; +import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.marshal; +import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.unMarshal; +import static org.onap.so.beans.nsmf.ActDeActNssi.ACT_URL; +import static org.onap.so.beans.nsmf.ActDeActNssi.DE_ACT_URL; + +@Component +@Primary +public class NssmfManager { + + private static final Logger logger = LoggerFactory.getLogger(NssmfManager.class); + + public final static String QUERY = "/api/rest/provMns/v1/NSS" + "/SliceProfiles/{sliceProfileId}"; + + public final static String QUERY_BY_ID = "/api/rest/provMns/v1/NSS/nssi" + "/{nssiId}"; + + @Autowired + private ResourceOperationStatusRepository rscOperStatusRepo; + + @Autowired + private RestUtil restUtil; + + + public RestResponse allocateNssi(NssiAllocateRequest nssmiAllocate) throws ApplicationException { + + assertObjectNotNull(nssmiAllocate.getEsrInfo()); + assertObjectNotNull(nssmiAllocate.getEsrInfo().getNetworkType()); + assertObjectNotNull(nssmiAllocate.getEsrInfo().getVendor()); + + String nsiId = null; + String allocateReq = null; + String allocateUrl = null; + logger.info("Allocate Nssi for " + nssmiAllocate.getEsrInfo().getNetworkType() + " Network has begun"); + + switch (nssmiAllocate.getEsrInfo().getNetworkType()) { + + case CORE: + AllocateCnNssi cn = nssmiAllocate.getAllocateCnNssi(); + assertObjectNotNull(cn); + assertObjectNotNull(cn.getNsiInfo()); + assertObjectNotNull(cn.getNsiInfo().getNsiId()); + nsiId = cn.getNsiInfo().getNsiId(); + assertObjectNotNull(nsiId); + allocateReq = marshal(cn); + allocateUrl = AllocateCnNssi.URL; + break; + + case ACCESS: + AllocateAnNssi an = nssmiAllocate.getAllocateAnNssi(); + assertObjectNotNull(an); + assertObjectNotNull(an.getNsiInfo()); + assertObjectNotNull(an.getNsiInfo().getNsiId()); + nsiId = an.getNsiInfo().getNsiId(); + assertObjectNotNull(nsiId); + allocateReq = marshal(an); + allocateUrl = AllocateAnNssi.URL; + break; + + case TRANSPORT: + AllocateTnNssi tn = nssmiAllocate.getAllocateTnNssi(); + assertObjectNotNull(tn); + assertObjectNotNull(tn.getNsiInfo()); + assertObjectNotNull(tn.getNsiInfo().getNsiId()); + nsiId = tn.getNsiInfo().getNsiId(); + allocateReq = marshal(tn); + allocateUrl = AllocateTnNssi.URL; + break; + + } + RestResponse rsp = restUtil.sendRequest(allocateUrl, POST, allocateReq, nssmiAllocate.getEsrInfo()); + assertObjectNotNull(rsp); + + if (valueOf(rsp.getStatus()).startsWith("2")) { + NssiResponse allocateRes = unMarshal(rsp.getResponseContent(), NssiResponse.class); + + ResourceOperationStatus status = + new ResourceOperationStatus(allocateRes.getNssiId(), allocateRes.getJobId(), nsiId); + logger.info("save segment and operaton info -> begin"); + updateDbStatus(status, rsp.getStatus(), STARTED, ALLOCATE_NSS_SUCCESS); + logger.info("save segment and operation info -> end"); + } + return rsp; + } + + public RestResponse createNssi(NssiCreateRequest nssiCreate) throws ApplicationException { + + assertObjectNotNull(nssiCreate.getEsrInfo()); + assertObjectNotNull(nssiCreate.getEsrInfo().getNetworkType()); + assertObjectNotNull(nssiCreate.getEsrInfo().getVendor()); + + String nsiId = null; + String createReq = null; + String createUrl = null; + logger.info("Create Nssi for " + nssiCreate.getEsrInfo().getNetworkType() + " Network has begun"); + + switch (nssiCreate.getEsrInfo().getNetworkType()) { + case CORE: + CreateCnNssi cn = nssiCreate.getCreateCnNssi(); + nsiId = cn.getNsiInfo().getNsiId(); + assertObjectNotNull(nsiId); + createReq = marshal(cn); + createUrl = AllocateCnNssi.URL; + break; + + case ACCESS: + case TRANSPORT: + throw new ApplicationException(1, "Create Nssi doesn't " + "support the Network type:" + + nssiCreate.getEsrInfo().getNetworkType()); + } + RestResponse rsp = restUtil.sendRequest(createUrl, POST, createReq, nssiCreate.getEsrInfo()); + assertObjectNotNull(rsp); + + if (valueOf(rsp.getStatus()).startsWith("2")) { + NssiResponse allocateRes = unMarshal(rsp.getResponseContent(), NssiResponse.class); + + ResourceOperationStatus status = + new ResourceOperationStatus(allocateRes.getNssiId(), allocateRes.getJobId(), nsiId); + logger.info("save segment and operaton info -> begin"); + updateDbStatus(status, rsp.getStatus(), STARTED, CREATE_NSS_SUCCESS); + logger.info("save segment and operaton info -> end"); + } + return rsp; + } + + public RestResponse deAllocateNssi(NssiDeAllocateRequest nssiDeallocate, String sliceId) + throws ApplicationException { + + assertObjectNotNull(nssiDeallocate.getEsrInfo()); + assertObjectNotNull(nssiDeallocate.getEsrInfo().getNetworkType()); + assertObjectNotNull(nssiDeallocate.getEsrInfo().getVendor()); + + DeAllocateNssi deAllocate = nssiDeallocate.getDeAllocateNssi(); + + assertObjectNotNull(sliceId); + assertObjectNotNull(deAllocate.getNssiId()); + assertObjectNotNull(deAllocate.getNsiId()); + + String deallocateUrl = formTnAndAnUrl(nssiDeallocate.getEsrInfo(), DeAllocateNssi.URL, sliceId); + String deAllocateReq = marshal(deAllocate); + + logger.info("Deallocate Nssi has begun"); + + RestResponse rsp = restUtil.sendRequest(deallocateUrl, DELETE, deAllocateReq, nssiDeallocate.getEsrInfo()); + assertObjectNotNull(rsp); + + if (valueOf(rsp.getStatus()).startsWith("2")) { + NssiResponse res = unMarshal(rsp.getResponseContent(), NssiResponse.class); + + ResourceOperationStatus status = + new ResourceOperationStatus(deAllocate.getNssiId(), res.getJobId(), deAllocate.getNsiId()); + logger.info("save segment and operaton info -> begin"); + updateDbStatus(status, rsp.getStatus(), STARTED, DEALLOCATE_NSS_SUCCESS); + logger.info("save segment and operaton info -> end"); + } + return rsp; + } + + private String formTnAndAnUrl(EsrInfo esrInfo, String origUrl, String variable) { + + origUrl = formatUrl(origUrl, variable); + String[] val; + + switch (esrInfo.getNetworkType()) { + + case TRANSPORT: + val = origUrl.split("v1"); + return val[0] + "v1/tn" + val[1]; + + case ACCESS: + val = origUrl.split("v1"); + return val[0] + "v1/an" + val[1]; + + case CORE: + return origUrl; + } + return origUrl; + } + + private String formatUrl(String origUrl, String variable) { + + if (variable != null) { + origUrl = String.format(origUrl, variable); + } + return origUrl; + } + + + public RestResponse terminateNssi(NssiTerminateRequest nssiTerminate, String nssiId) throws ApplicationException { + + assertObjectNotNull(nssiTerminate.getEsrInfo()); + assertObjectNotNull(nssiTerminate.getEsrInfo().getNetworkType()); + assertObjectNotNull(nssiTerminate.getEsrInfo().getVendor()); + + TerminateNssi terminate = nssiTerminate.getTerminateNssi(); + + assertObjectNotNull(nssiId); + assertObjectNotNull(terminate.getNsiId()); + + logger.info("Terminate Nssi has begun"); + + String terminateUrl = formTnAndAnUrl(nssiTerminate.getEsrInfo(), TerminateNssi.URL, nssiId); + String terminateReq = marshal(terminate); + + RestResponse rsp = restUtil.sendRequest(terminateUrl, DELETE, terminateReq, nssiTerminate.getEsrInfo()); + assertObjectNotNull(rsp); + + if (valueOf(rsp.getStatus()).startsWith("2")) { + NssiResponse res = unMarshal(rsp.getResponseContent(), NssiResponse.class); + + ResourceOperationStatus status = new ResourceOperationStatus(nssiId, res.getJobId(), terminate.getNsiId()); + logger.info("save segment and operaton info -> begin"); + updateDbStatus(status, rsp.getStatus(), STARTED, DEALLOCATE_NSS_SUCCESS); + logger.info("save segment and operaton info -> end"); + } + return rsp; + } + + public RestResponse activateNssi(NssiActDeActRequest nssiActivate, String snssai) throws ApplicationException { + + assertObjectNotNull(nssiActivate.getEsrInfo()); + assertObjectNotNull(nssiActivate.getEsrInfo().getNetworkType()); + assertObjectNotNull(nssiActivate.getEsrInfo().getVendor()); + + ActDeActNssi activate = nssiActivate.getActDeActNssi(); + + assertObjectNotNull(snssai); + assertObjectNotNull(activate.getNssiId()); + assertObjectNotNull(activate.getNsiId()); + + logger.info("Activate Nssi has begun"); + + String activateUrl = formTnAndAnUrl(nssiActivate.getEsrInfo(), ACT_URL, snssai); + String activateReq = marshal(activate); + + RestResponse rsp = restUtil.sendRequest(activateUrl, PUT, activateReq, nssiActivate.getEsrInfo()); + assertObjectNotNull(rsp); + + if (valueOf(rsp.getStatus()).startsWith("2")) { + NssiResponse activateRes = unMarshal(rsp.getResponseContent(), NssiResponse.class); + + ResourceOperationStatus status = + new ResourceOperationStatus(activate.getNssiId(), activateRes.getJobId(), activate.getNsiId()); + logger.info("save segment and operaton info -> begin"); + updateDbStatus(status, rsp.getStatus(), STARTED, ACTIVATE_NSS_SUCCESS); + logger.info("save segment and operaton info -> end"); + } + return rsp; + } + + public RestResponse deActivateNssi(NssiActDeActRequest nssiDeActivate, String snssai) throws ApplicationException { + + assertObjectNotNull(nssiDeActivate.getEsrInfo()); + assertObjectNotNull(nssiDeActivate.getEsrInfo().getNetworkType()); + assertObjectNotNull(nssiDeActivate.getEsrInfo().getVendor()); + + logger.info("Deactivate Nssi has begun"); + + ActDeActNssi deActivate = nssiDeActivate.getActDeActNssi(); + + assertObjectNotNull(snssai); + assertObjectNotNull(deActivate.getNssiId()); + assertObjectNotNull(deActivate.getNsiId()); + + String deActivateUrl = formTnAndAnUrl(nssiDeActivate.getEsrInfo(), DE_ACT_URL, snssai); + String deActivateReq = marshal(deActivate); + + RestResponse rsp = restUtil.sendRequest(deActivateUrl, PUT, deActivateReq, nssiDeActivate.getEsrInfo()); + assertObjectNotNull(rsp); + + if (valueOf(rsp.getStatus()).startsWith("2")) { + NssiResponse deActivateRes = unMarshal(rsp.getResponseContent(), NssiResponse.class); + + ResourceOperationStatus status = new ResourceOperationStatus(deActivate.getNssiId(), + deActivateRes.getJobId(), deActivate.getNsiId()); + logger.info("save segment and operaton info -> begin"); + updateDbStatus(status, rsp.getStatus(), STARTED, DEACTIVATE_NSS_SUCCESS); + logger.info("save segment and operaton info -> end"); + } + return rsp; + } + + public RestResponse queryJobStatus(JobStatusRequest jobReq, String jobId) throws ApplicationException { + + assertObjectNotNull(jobReq.getEsrInfo()); + assertObjectNotNull(jobReq.getEsrInfo().getNetworkType()); + assertObjectNotNull(jobReq.getEsrInfo().getVendor()); + assertObjectNotNull(jobId); + assertObjectNotNull(jobReq.getNssiId()); + assertObjectNotNull(jobReq.getNsiId()); + + logger.info("Query job status has begun"); + + ResourceOperationStatus status = new ResourceOperationStatus(jobReq.getNssiId(), jobId, jobReq.getNsiId()); + status = rscOperStatusRepo.findOne(Example.of(status)) + .orElseThrow(() -> new ApplicationException(404, "Cannot Find Operation Status")); + + String statusUrl = formatUrl(JobStatusRequest.URL, jobId); + if (jobReq.getResponseId() != null) { + statusUrl = statusUrl + "?responseId=" + jobReq.getResponseId(); + } + + RestResponse rsp = restUtil.sendRequest(statusUrl, GET, "", jobReq.getEsrInfo()); + assertObjectNotNull(rsp); + + if (!valueOf(rsp.getStatus()).startsWith("2")) { + updateDbStatus(status, rsp.getStatus(), ERROR, QUERY_JOB_STATUS_FAILED); + throw new ApplicationException(500, QUERY_JOB_STATUS_FAILED); + } + + ResponseDescriptor rspDesc = + unMarshal(rsp.getResponseContent(), JobStatusResponse.class).getResponseDescriptor(); + logger.info("save segment and operaton info -> begin"); + updateRequestDbJobStatus(rspDesc, status, rsp); + logger.info("save segment and operaton info -> end"); + return rsp; + } + + + public RestResponse updateNssi(NssiUpdateRequest nssiUpdate, String sliceId) throws ApplicationException { + + assertObjectNotNull(nssiUpdate.getEsrInfo()); + assertObjectNotNull(nssiUpdate.getEsrInfo().getNetworkType()); + assertObjectNotNull(nssiUpdate.getEsrInfo().getVendor()); + assertObjectNotNull(sliceId); + + String nsiId = null; + String nssiId = null; + String updateReq = null; + String updateUrl = null; + logger.info("Update Nssi for " + nssiUpdate.getEsrInfo().getNetworkType() + " Network has begun"); + + switch (nssiUpdate.getEsrInfo().getNetworkType()) { + case CORE: + UpdateCnNssi cn = nssiUpdate.getUpdateCnNssi(); + nsiId = cn.getNsiInfo().getNsiId(); + nssiId = cn.getNssiId(); + assertObjectNotNull(nsiId); + assertObjectNotNull(nssiId); + updateReq = marshal(cn); + updateUrl = formatUrl(UpdateCnNssi.URL, sliceId); + break; + + case ACCESS: + case TRANSPORT: + throw new ApplicationException(1, "Update Nssi doesn't " + "support the Network type:" + + nssiUpdate.getEsrInfo().getNetworkType()); + } + + RestResponse rsp = restUtil.sendRequest(updateUrl, PUT, updateReq, nssiUpdate.getEsrInfo()); + assertObjectNotNull(rsp); + + if (valueOf(rsp.getStatus()).startsWith("2")) { + NssiResponse allocateRes = unMarshal(rsp.getResponseContent(), NssiResponse.class); + + ResourceOperationStatus status = new ResourceOperationStatus(nssiId, allocateRes.getJobId(), nsiId); + logger.info("save segment and operaton info -> begin"); + updateDbStatus(status, rsp.getStatus(), STARTED, ALLOCATE_NSS_SUCCESS); + logger.info("save segment and operaton info -> end"); + } + return rsp; + } + + public RestResponse updateNssiById(NssiUpdateRequestById nssiUpdateById, String nssiId) + throws ApplicationException { + + assertObjectNotNull(nssiUpdateById.getEsrInfo()); + assertObjectNotNull(nssiUpdateById.getEsrInfo().getNetworkType()); + assertObjectNotNull(nssiUpdateById.getEsrInfo().getVendor()); + assertObjectNotNull(nssiId); + + String nsiId = null; + String updateReq = null; + String updateUrl = null; + logger.info("Update Nssi by ID for " + nssiUpdateById.getEsrInfo().getNetworkType() + " Network has begun"); + + switch (nssiUpdateById.getEsrInfo().getNetworkType()) { + case CORE: + UpdateCnNssiById cn = nssiUpdateById.getUpdateCnNssiById(); + nsiId = cn.getNsiInfo().getNsiId(); + assertObjectNotNull(nsiId); + updateReq = marshal(cn); + updateUrl = formatUrl(UpdateCnNssiById.URL, nssiId); + break; + + case ACCESS: + case TRANSPORT: + throw new ApplicationException(1, "Update Nssi doesn't " + "support the Network type:" + + nssiUpdateById.getEsrInfo().getNetworkType()); + } + + RestResponse rsp = restUtil.sendRequest(updateUrl, PUT, updateReq, nssiUpdateById.getEsrInfo()); + assertObjectNotNull(rsp); + + if (valueOf(rsp.getStatus()).startsWith("2")) { + NssiResponse allocateRes = unMarshal(rsp.getResponseContent(), NssiResponse.class); + + ResourceOperationStatus status = new ResourceOperationStatus(nssiId, allocateRes.getJobId(), nsiId); + logger.info("save segment and operaton info -> begin"); + updateDbStatus(status, rsp.getStatus(), STARTED, ALLOCATE_NSS_SUCCESS); + logger.info("save segment and operaton info -> end"); + } + return rsp; + } + + public RestResponse queryNssi(String vendor, String type, String sliceId) throws ApplicationException { + + logger.info("Query Nssi has begun"); + String getUrl = formatUrl(QUERY, sliceId); + EsrInfo esr = new EsrInfo(); + esr.setVendor(vendor); + esr.setNetworkType(NetworkType.valueOf(type)); + RestResponse rsp = restUtil.sendRequest(getUrl, GET, "", esr); + assertObjectNotNull(rsp); + return rsp; + } + + public RestResponse queryNssiById(String vendor, String type, String nssiId) throws ApplicationException { + + logger.info("Query Nssi by ID has begun"); + String getUrl = formatUrl(QUERY_BY_ID, nssiId); + EsrInfo esr = new EsrInfo(); + esr.setVendor(vendor); + esr.setNetworkType(NetworkType.valueOf(type)); + RestResponse rsp = restUtil.sendRequest(getUrl, GET, "", esr); + assertObjectNotNull(rsp); + return rsp; + } + + private void updateRequestDbJobStatus(ResponseDescriptor rspDesc, ResourceOperationStatus status, RestResponse rsp) + throws ApplicationException { + + switch (fromString(rspDesc.getStatus())) { + + case STARTED: + updateDbStatus(status, rsp.getStatus(), STARTED, QUERY_JOB_STATUS_SUCCESS); + break; + + case ERROR: + updateDbStatus(status, rsp.getStatus(), ERROR, QUERY_JOB_STATUS_FAILED); + throw new ApplicationException(500, QUERY_JOB_STATUS_FAILED); + + case FINISHED: + if (rspDesc.getProgress() == 100) { + updateDbStatus(status, rsp.getStatus(), FINISHED, QUERY_JOB_STATUS_SUCCESS); + } + break; + + case PROCESSING: + updateDbStatus(status, rsp.getStatus(), PROCESSING, QUERY_JOB_STATUS_SUCCESS); + break; + } + } + + private void updateDbStatus(ResourceOperationStatus status, int rspStatus, JobStatus jobStatus, + String description) { + status.setErrorCode(valueOf(rspStatus)); + status.setStatus(jobStatus.toString()); + status.setStatusDescription(description); + logger.info("Updating DB status"); + rscOperStatusRepo.save(status); + logger.info("Updating successful"); + } + + public void setRscOperStatusRepo(ResourceOperationStatusRepository rscOperStatusRepo) { + this.rscOperStatusRepo = rscOperStatusRepo; + } + + public void setRestUtil(RestUtil restUtil) { + this.restUtil = restUtil; + } +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/RestResponse.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/RestResponse.java new file mode 100644 index 0000000000..cc047e45c7 --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/RestResponse.java @@ -0,0 +1,92 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf.rest; + +import java.util.Map; + +public class RestResponse { + + // the response content + private String responseContent; + + // the response status + private int status; + + // the response header + private Map<String, String> respHeaderMap; + + public RestResponse() { + this.status = -1; + + this.respHeaderMap = null; + } + + public int getStatus() { + return this.status; + } + + public void setStatus(int status) { + this.status = status; + } + + public Map<String, String> getRespHeaderMap() { + return this.respHeaderMap; + } + + public void setRespHeaderMap(Map<String, String> header) { + this.respHeaderMap = header; + } + + public int getRespHeaderInt(String key) { + if (this.respHeaderMap != null) { + String result = this.respHeaderMap.get(key); + if (result != null) { + return Integer.parseInt(result); + } + } + return -1; + } + + public long getRespHeaderLong(String key) { + if (this.respHeaderMap != null) { + String result = this.respHeaderMap.get(key); + if (result != null) { + return Long.parseLong(result); + } + } + return -1L; + } + + public String getRespHeaderStr(String key) { + if (this.respHeaderMap != null) { + return this.respHeaderMap.get(key); + } + return null; + } + + public String getResponseContent() { + return this.responseContent; + } + + public void setResponseContent(String responseString) { + this.responseContent = responseString; + } +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/RestUtil.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/RestUtil.java new file mode 100644 index 0000000000..3592d4f6a3 --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/RestUtil.java @@ -0,0 +1,307 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf.rest; + +import javax.net.ssl.SSLContext; +import javax.net.ssl.TrustManager; +import javax.net.ssl.X509TrustManager; +import javax.ws.rs.core.UriBuilder; +import java.net.SocketTimeoutException; +import java.net.URI; +import org.apache.http.Header; +import org.apache.http.HttpResponse; +import org.apache.http.client.HttpClient; +import org.apache.http.client.config.RequestConfig; +import org.apache.http.client.methods.HttpEntityEnclosingRequestBase; +import org.apache.http.client.methods.HttpGet; +import org.apache.http.client.methods.HttpPost; +import org.apache.http.client.methods.HttpPut; +import org.apache.http.client.methods.HttpRequestBase; +import org.apache.http.conn.ConnectTimeoutException; +import org.apache.http.conn.ssl.SSLConnectionSocketFactory; +import org.apache.http.entity.StringEntity; +import org.apache.http.impl.client.HttpClients; +import org.apache.http.message.BasicHeader; +import org.apache.http.util.EntityUtils; +import org.onap.aai.domain.yang.EsrSystemInfo; +import org.onap.aai.domain.yang.EsrSystemInfoList; +import org.onap.aai.domain.yang.EsrThirdpartySdnc; +import org.onap.aai.domain.yang.EsrThirdpartySdncList; +import org.onap.so.adapters.nssmf.exceptions.ApplicationException; +import org.onap.so.adapters.nssmf.extclients.aai.AaiServiceProvider; +import org.onap.so.adapters.nssmf.model.TokenRequest; +import org.onap.so.adapters.nssmf.model.TokenResponse; +import org.onap.so.beans.nsmf.EsrInfo; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.stereotype.Component; +import static org.apache.http.entity.ContentType.APPLICATION_JSON; +import static org.onap.so.adapters.nssmf.rest.HttpMethod.POST; +import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.BAD_REQUEST; +import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.marshal; +import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.unMarshal; +import static org.onap.so.logger.ErrorCode.AvailabilityError; +import static org.onap.so.logger.LoggingAnchor.FOUR; +import static org.onap.so.logger.MessageEnum.RA_NS_EXC; + +@Component +public class RestUtil { + + private static final Logger logger = LoggerFactory.getLogger(RestUtil.class); + + private static final int DEFAULT_TIME_OUT = 60000; + + private static final String NSSMI_ADAPTER = "NSSMI Adapter"; + + private static final String TOKEN_URL = "/api/rest/securityManagement/v1" + "/oauth/token"; + + @Autowired + private AaiServiceProvider aaiSvcProv; + + + public NssmfInfo getNssmfHost(EsrInfo esrInfo) throws ApplicationException { + EsrThirdpartySdncList sdncList = aaiSvcProv.invokeGetThirdPartySdncList(); + if (sdncList != null && sdncList.getEsrThirdpartySdnc() != null) { + for (EsrThirdpartySdnc sdncEsr : sdncList.getEsrThirdpartySdnc()) { + + EsrSystemInfoList sysInfoList = + aaiSvcProv.invokeGetThirdPartySdncEsrSystemInfo(sdncEsr.getThirdpartySdncId()); + + if (sysInfoList != null && sysInfoList.getEsrSystemInfo() != null) { + for (EsrSystemInfo esr : sysInfoList.getEsrSystemInfo()) { + if (esr != null && esr.getType().equals(esrInfo.getNetworkType().getNetworkType()) + && esr.getVendor().equals(esrInfo.getVendor())) { + logger.info("Found an entry with vendor name " + esrInfo.getVendor() + " and network type " + + esrInfo.getNetworkType() + " in ESR."); + NssmfInfo nssmfInfo = new NssmfInfo(); + nssmfInfo.setIpAddress(esr.getIpAddress()); + nssmfInfo.setPort(esr.getPort()); + nssmfInfo.setCacert(esr.getSslCacert()); + nssmfInfo.setUserName(esr.getUserName()); + nssmfInfo.setPassword(esr.getPassword()); + String endPoint = UriBuilder.fromPath("").host(esr.getIpAddress()) + .port(Integer.valueOf(esr.getPort())).scheme("https").build().toString(); + nssmfInfo.setUrl(endPoint); + return nssmfInfo; + } + } + } + + } + } + + throw new ApplicationException(BAD_REQUEST, "ESR information is improper"); + } + + public RestResponse sendRequest(String url, HttpMethod methodType, String content, EsrInfo esrInfo) + throws ApplicationException { + + NssmfInfo nssmfInfo = getNssmfHost(esrInfo); + + TokenRequest req = new TokenRequest(); + req.setGrantType("password"); + req.setUserName(nssmfInfo.getUserName()); + req.setValue(nssmfInfo.getPassword()); + + String tokenReq = marshal(req); + + logger.info("Sending token request to NSSMF: " + tokenReq); + RestResponse tokenRes = send(nssmfInfo.getUrl() + TOKEN_URL, POST, tokenReq, null); + + TokenResponse res = unMarshal(tokenRes.getResponseContent(), TokenResponse.class); + String token = res.getAccessToken(); + Header header = new BasicHeader("X-Auth-Token", token); + String nssmfUrl = nssmfInfo.getUrl() + url; + return send(nssmfUrl, methodType, content, header); + } + + private RestResponse send(String url, HttpMethod methodType, String content, Header header) { + + HttpRequestBase req = null; + HttpResponse res = null; + + logger.debug("Beginning to send message {}: {}", methodType, url); + + try { + int timeout = DEFAULT_TIME_OUT; + + RequestConfig config = RequestConfig.custom().setSocketTimeout(timeout).setConnectTimeout(timeout) + .setConnectionRequestTimeout(timeout).build(); + logger.debug("Sending request to NSSMF: " + content); + req = getHttpReq(url, methodType, header, config, content); + res = getHttpsClient().execute(req); + + String resContent = null; + if (res.getEntity() != null) { + resContent = EntityUtils.toString(res.getEntity(), "UTF-8"); + } + + int statusCode = res.getStatusLine().getStatusCode(); + String statusMessage = res.getStatusLine().getReasonPhrase(); + logger.info("NSSMF Response: {} {}", statusCode, + statusMessage + (resContent == null ? "" : System.lineSeparator() + resContent)); + + if (res.getStatusLine().getStatusCode() >= 300) { + String errMsg = "{\n \"errorCode\": " + res.getStatusLine().getStatusCode() + + "\n \"errorDescription\": " + statusMessage + "\n}"; + logError(errMsg); + return createResponse(statusCode, errMsg); + } + if (null != req) { + req.reset(); + } else { + logger.debug("method is NULL:"); + } + req = null; + + return createResponse(statusCode, resContent); + + } catch (SocketTimeoutException | ConnectTimeoutException e) { + String errMsg = "Request to NSSMF timed out"; + logError(errMsg, e); + return createResponse(408, errMsg); + } catch (Exception e) { + String errMsg = "Error processing request to NSSMF"; + logError(errMsg, e); + return createResponse(500, errMsg); + } finally { + if (res != null) { + try { + EntityUtils.consume(res.getEntity()); + } catch (Exception e) { + logger.debug("Exception :", e); + } + } + if (req != null) { + try { + req.reset(); + } catch (Exception e) { + logger.debug("Exception :", e); + } + } + } + } + + private RestResponse createResponse(int statusCode, String errMsg) { + RestResponse restResponse = new RestResponse(); + restResponse.setStatus(statusCode); + restResponse.setResponseContent(errMsg); + return restResponse; + } + + private HttpRequestBase getHttpReq(String url, HttpMethod method, Header header, RequestConfig config, + String content) throws ApplicationException { + HttpRequestBase base = null; + switch (method) { + case POST: + HttpPost post = new HttpPost(url); + post.setEntity(new StringEntity(content, APPLICATION_JSON)); + base = post; + break; + + case GET: + base = new HttpGet(url); + break; + + case PUT: + HttpPut put = new HttpPut(url); + put.setEntity(new StringEntity(content, APPLICATION_JSON)); + base = put; + break; + + case PATCH: + break; + + case DELETE: + HttpDeleteWithBody delete = new HttpDeleteWithBody(url); + if (content != null) { + delete.setEntity(new StringEntity(content, APPLICATION_JSON)); + } + base = delete; + break; + + } + base.setConfig(config); + if (header != null) { + base.setHeader(header); + } + return base; + } + + class HttpDeleteWithBody extends HttpEntityEnclosingRequestBase { + public static final String METHOD_NAME = "DELETE"; + + public String getMethod() { + return METHOD_NAME; + } + + public HttpDeleteWithBody(final String uri) { + super(); + setURI(URI.create(uri)); + } + + public HttpDeleteWithBody(final URI uri) { + super(); + setURI(uri); + } + + public HttpDeleteWithBody() { + super(); + } + } + + + public HttpClient getHttpsClient() { + + TrustManager[] trustAllCerts = new TrustManager[] {new X509TrustManager() { + public java.security.cert.X509Certificate[] getAcceptedIssuers() { + return null; + } + + public void checkClientTrusted(java.security.cert.X509Certificate[] certs, String authType) {} + + public void checkServerTrusted(java.security.cert.X509Certificate[] certs, String authType) {} + }}; + + // Install the all-trusting trust manager + try { + SSLContext sc = SSLContext.getInstance("SSL"); + sc.init(null, trustAllCerts, new java.security.SecureRandom()); + // HttpsURLConnection.setDefaultSSLSocketFactory(sc.getSocketFactory()); + + SSLConnectionSocketFactory sslsf = + new SSLConnectionSocketFactory(sc, new String[] {"TLSv1"}, null, new TrustAllHostNameVerifier()); + return HttpClients.custom().setSSLSocketFactory(sslsf).build(); + } catch (Exception e) { + throw new IllegalArgumentException(e); + } + } + + private static void logError(String errMsg, Throwable t) { + logger.error(FOUR, RA_NS_EXC.toString(), NSSMI_ADAPTER, AvailabilityError.getValue(), errMsg, t); + } + + private static void logError(String errMsg) { + logger.error(FOUR, RA_NS_EXC.toString(), NSSMI_ADAPTER, AvailabilityError.toString(), errMsg); + } +} + diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/TrustAllHostNameVerifier.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/TrustAllHostNameVerifier.java new file mode 100644 index 0000000000..254186bda8 --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/rest/TrustAllHostNameVerifier.java @@ -0,0 +1,32 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf.rest; + +import javax.net.ssl.HostnameVerifier; +import javax.net.ssl.SSLSession; + +public class TrustAllHostNameVerifier implements HostnameVerifier { + + public boolean verify(String hostname, SSLSession session) { + return true; + } + +} diff --git a/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/util/NssmfAdapterUtil.java b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/util/NssmfAdapterUtil.java new file mode 100644 index 0000000000..b0b84d822b --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/java/org/onap/so/adapters/nssmf/util/NssmfAdapterUtil.java @@ -0,0 +1,94 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf.util; + +import com.fasterxml.jackson.databind.ObjectMapper; +import java.io.IOException; +import org.onap.so.adapters.nssmf.exceptions.ApplicationException; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.onap.so.logger.ErrorCode; +import static org.onap.so.logger.LoggingAnchor.THREE; +import static org.onap.so.logger.MessageEnum.RA_NS_EXC; + +public class NssmfAdapterUtil { + + private static final Logger LOGGER = LoggerFactory.getLogger(NssmfAdapterUtil.class); + + public static final int BAD_REQUEST = 400; + + private static final String UNMARSHAL_FAIL_MSG = "Failed to unmarshal json"; + + private static final String MARSHAL_FAIL_MSG = "Failed to marshal object"; + + private static final ObjectMapper MAPPER = new ObjectMapper(); + + public static class StatusDesc { + + public static final String ALLOCATE_NSS_SUCCESS = "Allocating nss is " + "successful"; + + public static final String CREATE_NSS_SUCCESS = "Creating nss is " + "successful"; + + public static final String DEALLOCATE_NSS_SUCCESS = "Deallocate nss " + "is successful"; + + public static final String ACTIVATE_NSS_SUCCESS = "Activate nss " + "is successful"; + + public static final String DEACTIVATE_NSS_SUCCESS = "Deactivate nss " + "is successful"; + + public static final String QUERY_JOB_STATUS_FAILED = "Query job " + "status failed"; + + public static final String QUERY_JOB_STATUS_SUCCESS = "Query job " + "status is successful"; + + private StatusDesc() { + + } + } + + private NssmfAdapterUtil() { + + } + + public static void assertObjectNotNull(Object object) throws ApplicationException { + if (null == object) { + LOGGER.error("Object is null."); + throw new ApplicationException(BAD_REQUEST, "An object is null."); + } + } + + public static <T> T unMarshal(String jsonstr, Class<T> type) throws ApplicationException { + try { + return MAPPER.readValue(jsonstr, type); + } catch (IOException e) { + LOGGER.error(THREE, RA_NS_EXC.toString(), ErrorCode.BusinessProcessError.getValue(), UNMARSHAL_FAIL_MSG, e); + throw new ApplicationException(BAD_REQUEST, UNMARSHAL_FAIL_MSG); + } + } + + public static String marshal(Object srcObj) throws ApplicationException { + try { + return MAPPER.writerWithDefaultPrettyPrinter().writeValueAsString(srcObj); + } catch (IOException e) { + LOGGER.error(THREE, RA_NS_EXC.toString(), ErrorCode.BusinessProcessError.getValue(), MARSHAL_FAIL_MSG, e); + throw new ApplicationException(BAD_REQUEST, MARSHAL_FAIL_MSG); + } + } + +} diff --git a/adapters/mso-nssmf-adapter/src/main/resources/META-INF/services/org.onap.so.client.RestProperties b/adapters/mso-nssmf-adapter/src/main/resources/META-INF/services/org.onap.so.client.RestProperties new file mode 100644 index 0000000000..f93ec63f37 --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/resources/META-INF/services/org.onap.so.client.RestProperties @@ -0,0 +1 @@ +org.onap.so.adapters.nssmf.extclients.aai.AaiClientPropertiesImpl
\ No newline at end of file diff --git a/adapters/mso-nssmf-adapter/src/main/resources/application.yaml b/adapters/mso-nssmf-adapter/src/main/resources/application.yaml new file mode 100644 index 0000000000..cb2f04d7ec --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/resources/application.yaml @@ -0,0 +1,61 @@ +# +# ============LICENSE_START======================================================= +# ONAP - SO +# ================================================================================ +# Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. +# ================================================================================ +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. +# ============LICENSE_END========================================================= +#/ +aai: + auth: 2A11B07DB6214A839394AA1EC5844695F5114FC407FF5422625FB00175A3DCB8A1FF745F22867EFA72D5369D599BBD88DA8BED4233CF5586 + endpoint: https://aai.onap:30233 +logging: + path: logs + +spring: + datasource: + driver-class-name: org.mariadb.jdbc.Driver + jdbcUrl: jdbc:mariadb://192.168.235.44:30444/requestdb + username: root + password: secretpassword + + jpa: + show-sql: false + hibernate: + dialect: org.hibernate.dialect.MySQL5Dialect + ddl-auto: validate + naming-strategy: org.hibernate.cfg.ImprovedNamingStrategy + enable-lazy-load-no-trans: true +server: + port: 8080 + tomcat: + max-threads: 50 + +mso: + key: 07a7159d3bf51a0e53be7a8f89699be7 + site-name: localSite + logPath: ./logs/nssmf + msb-ip: msb-iag.{{ include "common.namespace" . }} + msb-port: 80 + adapters: + requestDb: + endpoint: https://so-request-db-adapter.{{ include "common.namespace" . }}:8083 + auth: Basic YnBlbDpwYXNzd29yZDEk + +#Actuator +management: + security: + enabled: false + basic: + enabled: false
\ No newline at end of file diff --git a/adapters/mso-nssmf-adapter/src/main/resources/nssmf.jks b/adapters/mso-nssmf-adapter/src/main/resources/nssmf.jks Binary files differnew file mode 100644 index 0000000000..2ecce5bd3d --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/resources/nssmf.jks diff --git a/adapters/mso-nssmf-adapter/src/main/resources/nssmf.p12 b/adapters/mso-nssmf-adapter/src/main/resources/nssmf.p12 Binary files differnew file mode 100644 index 0000000000..25e7fbfca9 --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/resources/nssmf.p12 diff --git a/adapters/mso-nssmf-adapter/src/main/resources/org.onap.so.jks b/adapters/mso-nssmf-adapter/src/main/resources/org.onap.so.jks Binary files differnew file mode 100644 index 0000000000..f7cd9e8f86 --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/resources/org.onap.so.jks diff --git a/adapters/mso-nssmf-adapter/src/main/resources/org.onap.so.p12 b/adapters/mso-nssmf-adapter/src/main/resources/org.onap.so.p12 Binary files differnew file mode 100644 index 0000000000..1927b1f13f --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/main/resources/org.onap.so.p12 diff --git a/adapters/mso-nssmf-adapter/src/test/java/org/onap/so/adapters/nssmf/NssmfAdapterRestTest.java b/adapters/mso-nssmf-adapter/src/test/java/org/onap/so/adapters/nssmf/NssmfAdapterRestTest.java new file mode 100644 index 0000000000..5bfd39096c --- /dev/null +++ b/adapters/mso-nssmf-adapter/src/test/java/org/onap/so/adapters/nssmf/NssmfAdapterRestTest.java @@ -0,0 +1,392 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.nssmf; + +import java.io.ByteArrayInputStream; +import java.io.InputStream; +import java.util.LinkedList; +import java.util.List; +import org.apache.http.HttpEntity; +import org.apache.http.HttpResponse; +import org.apache.http.StatusLine; +import org.apache.http.client.HttpClient; +import org.apache.http.client.methods.HttpRequestBase; +import org.junit.Before; +import org.junit.Test; +import org.junit.runner.RunWith; +import org.mockito.Mock; +import org.mockito.invocation.InvocationOnMock; +import org.mockito.stubbing.Answer; +import org.onap.so.adapters.nssmf.model.TokenResponse; +import org.onap.so.adapters.nssmf.rest.HttpMethod; +import org.onap.so.adapters.nssmf.rest.NssmfAdapterRest; +import org.onap.so.adapters.nssmf.rest.NssmfInfo; +import org.onap.so.adapters.nssmf.rest.NssmfManager; +import org.onap.so.adapters.nssmf.rest.RestUtil; +import org.onap.so.beans.nsmf.ActDeActNssi; +import org.onap.so.beans.nsmf.AllocateCnNssi; +import org.onap.so.beans.nsmf.CnSliceProfile; +import org.onap.so.beans.nsmf.DeAllocateNssi; +import org.onap.so.beans.nsmf.EsrInfo; +import org.onap.so.beans.nsmf.JobStatusRequest; +import org.onap.so.beans.nsmf.NsiInfo; +import org.onap.so.beans.nsmf.NssiActDeActRequest; +import org.onap.so.beans.nsmf.NssiAllocateRequest; +import org.onap.so.beans.nsmf.NssiDeAllocateRequest; +import org.onap.so.beans.nsmf.NssiResponse; +import org.onap.so.beans.nsmf.PerfReq; +import org.onap.so.beans.nsmf.PerfReqEmbbList; +import org.onap.so.db.request.data.repository.ResourceOperationStatusRepository; +import org.springframework.http.ResponseEntity; +import org.springframework.test.context.junit4.SpringRunner; +import static java.nio.charset.StandardCharsets.UTF_8; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.assertNotNull; +import static org.mockito.ArgumentMatchers.any; +import static org.mockito.Mockito.doAnswer; +import static org.mockito.Mockito.when; +import static org.mockito.MockitoAnnotations.initMocks; +import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.marshal; +import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.unMarshal; +import static org.onap.so.beans.nsmf.NetworkType.CORE; +import static org.onap.so.beans.nsmf.ResourceSharingLevel.NON_SHARED; + +@RunWith(SpringRunner.class) +public class NssmfAdapterRestTest { + + private final static String ALLOCATE = "{\n" + " \"esrInfo\" : {\n" + " \"vendor\" : \"huawei\",\n" + + " \"networkType\" : \"cn\"\n" + " },\n" + " \"allocateCnNssi\" : {\n" + + " \"nssiId\" : \"NSST-C-001-HDBNJ-NSSMF-01-A-ZX\",\n" + " \"nssiName\" : \"eMBB-001\",\n" + + " \"sliceProfile\" : {\n" + " \"snssaiList\" : [ \"001-100001\" ],\n" + + " \"sliceProfileId\" : \"ab9af40f13f721b5f13539d87484098\",\n" + + " \"plmnIdList\" : [ \"460-00\", \"460-01\" ],\n" + " \"perfReq\" : {\n" + + " \"perfReqEmbbList\" : [ {\n" + " \"activityFactor\" : 50\n" + " } ]\n" + + " },\n" + " \"maxNumberofUEs\" : 200,\n" + + " \"coverageAreaTAList\" : [ \"1\", \"2\", \"3\" ],\n" + " \"latency\" : 6,\n" + + " \"resourceSharingLevel\" : \"non-shared\"\n" + " },\n" + " \"scriptName\" : \"CN1\",\n" + + " \"nsiInfo\" : {\n" + " \"nsiName\" : \"eMBB-001\",\n" + + " \"nsiId\" : \"NSI-M-001-HDBNJ-NSMF-01-A-ZX\"\n" + " }\n" + " }\n" + "}"; + + private NssmfManager nssmfMgr; + + @Mock + private ResourceOperationStatusRepository rscOperStatusRepo; + + @Mock + private RestUtil restUtil; + + @Mock + private NssmfAdapterRest nssmfRest; + + @Mock + private HttpResponse tokenResponse; + + @Mock + private HttpEntity tokenEntity; + + @Mock + private HttpResponse commonResponse; + + @Mock + private HttpEntity commonEntity; + + @Mock + private StatusLine statusLine; + + @Mock + private HttpClient httpClient; + + private InputStream postStream; + + private InputStream tokenStream; + + @Before + public void setUp() { + initMocks(this); + nssmfMgr = new NssmfManager(); + nssmfMgr.setRestUtil(restUtil); + nssmfMgr.setRscOperStatusRepo(rscOperStatusRepo); + } + + private void createCommonMock(int statusCode, NssmfInfo nssmf) throws Exception { + when(nssmfRest.getNssmfMgr()).thenReturn(nssmfMgr); + when(nssmfRest.allocateNssi(any(NssiAllocateRequest.class))).thenCallRealMethod(); + when(nssmfRest.deAllocateNssi(any(NssiDeAllocateRequest.class), any(String.class))).thenCallRealMethod(); + when(nssmfRest.activateNssi(any(NssiActDeActRequest.class), any(String.class))).thenCallRealMethod(); + when(nssmfRest.deactivateNssi(any(NssiActDeActRequest.class), any(String.class))).thenCallRealMethod(); + + when(nssmfRest.queryJobStatus(any(JobStatusRequest.class), any(String.class))).thenCallRealMethod(); + when(restUtil.sendRequest(any(String.class), any(HttpMethod.class), any(String.class), any(EsrInfo.class))) + .thenCallRealMethod(); + when(restUtil.getHttpsClient()).thenReturn(httpClient); + + when(statusLine.getStatusCode()).thenReturn(200); + when(restUtil.getNssmfHost(any(EsrInfo.class))).thenReturn(nssmf); + + when(tokenResponse.getEntity()).thenReturn(tokenEntity); + when(tokenResponse.getStatusLine()).thenReturn(statusLine); + when(tokenEntity.getContent()).thenReturn(tokenStream); + + when(commonResponse.getEntity()).thenReturn(commonEntity); + when(commonResponse.getStatusLine()).thenReturn(statusLine); + when(commonEntity.getContent()).thenReturn(postStream); + + Answer<HttpResponse> answer = new Answer<HttpResponse>() { + + public HttpResponse answer(InvocationOnMock invocation) throws Throwable { + Object[] arguments = invocation.getArguments(); + if (arguments != null && arguments.length == 1 && arguments[0] != null) { + + HttpRequestBase base = (HttpRequestBase) arguments[0]; + if (base.getURI().toString().endsWith("/oauth/token")) { + return tokenResponse; + } else { + return commonResponse; + } + } + return commonResponse; + } + }; + doAnswer(answer).when(httpClient).execute(any(HttpRequestBase.class)); + } + + @Test + public void testNssiAllocate() throws Exception { + NssmfInfo nssmf = new NssmfInfo(); + nssmf.setUserName("nssmf-user"); + nssmf.setPassword("nssmf-pass"); + nssmf.setPort("8080"); + nssmf.setIpAddress("127.0.0.1"); + + NssiResponse nssiRes = new NssiResponse(); + nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067"); + nssiRes.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX"); + + TokenResponse token = new TokenResponse(); + token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39"); + token.setExpires(1800); + + postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8)); + tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8)); + + createCommonMock(200, nssmf); + // assertEquals(prettyPrint(allocateNssi()), ALLOCATE); + ResponseEntity res = nssmfRest.allocateNssi(allocateNssi()); + assertNotNull(res); + assertNotNull(res.getBody()); + NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class); + assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067"); + assertEquals(allRes.getNssiId(), "NSSI-C-001-HDBNJ-NSSMF-01-A-ZX"); + } + + @Test + public void testNssiDeAllocate() throws Exception { + NssmfInfo nssmf = new NssmfInfo(); + nssmf.setUserName("nssmf-user"); + nssmf.setPassword("nssmf-pass"); + nssmf.setPort("8080"); + nssmf.setIpAddress("127.0.0.1"); + + NssiResponse nssiRes = new NssiResponse(); + nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067"); + + TokenResponse token = new TokenResponse(); + token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39"); + token.setExpires(1800); + + postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8)); + tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8)); + + createCommonMock(200, nssmf); + ResponseEntity res = nssmfRest.deAllocateNssi(deAllocateNssi(), "ab9af40f13f721b5f13539d87484098"); + assertNotNull(res); + assertNotNull(res.getBody()); + NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class); + assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067"); + } + + @Test + public void testNssiActivate() throws Exception { + NssmfInfo nssmf = new NssmfInfo(); + nssmf.setUserName("nssmf-user"); + nssmf.setPassword("nssmf-pass"); + nssmf.setPort("8080"); + nssmf.setIpAddress("127.0.0.1"); + + NssiResponse nssiRes = new NssiResponse(); + nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067"); + + TokenResponse token = new TokenResponse(); + token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39"); + token.setExpires(1800); + + postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8)); + tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8)); + + createCommonMock(200, nssmf); + ResponseEntity res = nssmfRest.activateNssi(activateNssi(), "001-100001"); + assertNotNull(res); + assertNotNull(res.getBody()); + NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class); + assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067"); + } + + @Test + public void testNssiDeActivate() throws Exception { + NssmfInfo nssmf = new NssmfInfo(); + nssmf.setUserName("nssmf-user"); + nssmf.setPassword("nssmf-pass"); + nssmf.setPort("8080"); + nssmf.setIpAddress("127.0.0.1"); + + NssiResponse nssiRes = new NssiResponse(); + nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067"); + + TokenResponse token = new TokenResponse(); + token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39"); + token.setExpires(1800); + + postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8)); + tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8)); + + createCommonMock(200, nssmf); + ResponseEntity res = nssmfRest.deactivateNssi(deActivateNssi(), "001-100001"); + assertNotNull(res); + assertNotNull(res.getBody()); + NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class); + assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067"); + } + + @Test + public void testAllocateJsonSerDeSer() throws Exception { + assertEquals(marshal(allocateNssi()), ALLOCATE); + NssiAllocateRequest all = unMarshal(ALLOCATE, NssiAllocateRequest.class); + assertNotNull(all); + assertNotNull(all.getAllocateCnNssi()); + assertNotNull(all.getAllocateCnNssi().getSliceProfile()); + assertEquals(all.getAllocateCnNssi().getSliceProfile().getResourceSharingLevel(), NON_SHARED); + assertNotNull(all.getAllocateCnNssi().getSliceProfile().getPerfReq()); + assertNotNull(all.getAllocateCnNssi().getSliceProfile().getPerfReq().getPerfReqEmbbList()); + PerfReqEmbbList embb = + all.getAllocateCnNssi().getSliceProfile().getPerfReq().getPerfReqEmbbList().iterator().next(); + assertNotNull(embb); + assertEquals(embb.getActivityFactor(), 50); + } + + public NssiAllocateRequest allocateNssi() throws Exception { + CnSliceProfile sP = new CnSliceProfile(); + List<String> sns = new LinkedList<>(); + sns.add("001-100001"); + List<String> plmn = new LinkedList<>(); + plmn.add("460-00"); + plmn.add("460-01"); + PerfReqEmbbList embb = new PerfReqEmbbList(); + embb.setActivityFactor(50); + List<PerfReqEmbbList> embbList = new LinkedList<>(); + embbList.add(embb); + PerfReq perfReq = new PerfReq(); + perfReq.setPerfReqEmbbList(embbList); + List<String> taList = new LinkedList<>(); + taList.add("1"); + taList.add("2"); + taList.add("3"); + sP.setSnssaiList(sns); + sP.setSliceProfileId("ab9af40f13f721b5f13539d87484098"); + sP.setPlmnIdList(plmn); + sP.setPerfReq(perfReq); + sP.setMaxNumberofUEs(200); + sP.setCoverageAreaTAList(taList); + sP.setLatency(6); + sP.setResourceSharingLevel(NON_SHARED); + NsiInfo nsiInfo = new NsiInfo(); + nsiInfo.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX"); + nsiInfo.setNsiName("eMBB-001"); + AllocateCnNssi cnNssi = new AllocateCnNssi(); + cnNssi.setNssiId("NSST-C-001-HDBNJ-NSSMF-01-A-ZX"); + cnNssi.setNssiName("eMBB-001"); + cnNssi.setScriptName("CN1"); + cnNssi.setSliceProfile(sP); + cnNssi.setNsiInfo(nsiInfo); + EsrInfo esrInfo = new EsrInfo(); + esrInfo.setVendor("huawei"); + esrInfo.setNetworkType(CORE); + NssiAllocateRequest allocate = new NssiAllocateRequest(); + allocate.setAllocateCnNssi(cnNssi); + allocate.setEsrInfo(esrInfo); + return allocate; + } + + public NssiDeAllocateRequest deAllocateNssi() throws Exception { + DeAllocateNssi deAllocateNssi = new DeAllocateNssi(); + deAllocateNssi.setTerminateNssiOption(0); + List<String> snssai = new LinkedList<>(); + snssai.add("001-100001"); + deAllocateNssi.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX"); + deAllocateNssi.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX"); + deAllocateNssi.setScriptName("CN1"); + deAllocateNssi.setSnssaiList(snssai); + EsrInfo esrInfo = new EsrInfo(); + esrInfo.setVendor("huawei"); + esrInfo.setNetworkType(CORE); + NssiDeAllocateRequest deAllocate = new NssiDeAllocateRequest(); + deAllocate.setDeAllocateNssi(deAllocateNssi); + deAllocate.setEsrInfo(esrInfo); + return deAllocate; + } + + public NssiActDeActRequest activateNssi() throws Exception { + EsrInfo esrInfo = new EsrInfo(); + esrInfo.setVendor("huawei"); + esrInfo.setNetworkType(CORE); + ActDeActNssi act = new ActDeActNssi(); + act.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX"); + act.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX"); + NssiActDeActRequest actReq = new NssiActDeActRequest(); + actReq.setActDeActNssi(act); + actReq.setEsrInfo(esrInfo); + return actReq; + } + + public NssiActDeActRequest deActivateNssi() throws Exception { + EsrInfo esrInfo = new EsrInfo(); + esrInfo.setVendor("huawei"); + esrInfo.setNetworkType(CORE); + ActDeActNssi deAct = new ActDeActNssi(); + deAct.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX"); + deAct.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX"); + NssiActDeActRequest deActReq = new NssiActDeActRequest(); + deActReq.setActDeActNssi(deAct); + deActReq.setEsrInfo(esrInfo); + return deActReq; + } + + public String queryJobStatusNssi() throws Exception { + EsrInfo esrInfo = new EsrInfo(); + esrInfo.setVendor("huawei"); + esrInfo.setNetworkType(CORE); + + JobStatusRequest jobStatus = new JobStatusRequest(); + jobStatus.setEsrInfo(esrInfo); + jobStatus.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX"); + jobStatus.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX"); + return marshal(jobStatus); + } +} diff --git a/adapters/mso-openstack-adapters/pom.xml b/adapters/mso-openstack-adapters/pom.xml index f0c066aa05..a668b42106 100644 --- a/adapters/mso-openstack-adapters/pom.xml +++ b/adapters/mso-openstack-adapters/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>adapters</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>mso-openstack-adapters</artifactId> <packaging>jar</packaging> diff --git a/adapters/mso-requests-db-adapter/pom.xml b/adapters/mso-requests-db-adapter/pom.xml index 366a207d60..2354272756 100644 --- a/adapters/mso-requests-db-adapter/pom.xml +++ b/adapters/mso-requests-db-adapter/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>adapters</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <groupId>org.onap.so.adapters</groupId> diff --git a/adapters/mso-requests-db-adapter/src/main/java/org/onap/so/adapters/requestsdb/ArchiveInfraRequestsScheduler.java b/adapters/mso-requests-db-adapter/src/main/java/org/onap/so/adapters/requestsdb/ArchiveInfraRequestsScheduler.java index 3deabb3ce1..24dab2fc5b 100644 --- a/adapters/mso-requests-db-adapter/src/main/java/org/onap/so/adapters/requestsdb/ArchiveInfraRequestsScheduler.java +++ b/adapters/mso-requests-db-adapter/src/main/java/org/onap/so/adapters/requestsdb/ArchiveInfraRequestsScheduler.java @@ -145,6 +145,8 @@ public class ArchiveInfraRequestsScheduler { archivedInfra.setVnfType(iar.getVnfType()); archivedInfra.setVolumeGroupId(iar.getVolumeGroupId()); archivedInfra.setVolumeGroupName(iar.getVolumeGroupName()); + archivedInfra.setProductFamilyName(iar.getProductFamilyName()); + archivedInfra.setTenantName(iar.getTenantName()); newArchivedReqs.add(archivedInfra); oldInfraReqs.add(iar); diff --git a/adapters/mso-requests-db-adapter/src/main/java/org/onap/so/adapters/requestsdb/MsoRequestsDbAdapter.java b/adapters/mso-requests-db-adapter/src/main/java/org/onap/so/adapters/requestsdb/MsoRequestsDbAdapter.java index 110fc6c03e..84ff054a7c 100644 --- a/adapters/mso-requests-db-adapter/src/main/java/org/onap/so/adapters/requestsdb/MsoRequestsDbAdapter.java +++ b/adapters/mso-requests-db-adapter/src/main/java/org/onap/so/adapters/requestsdb/MsoRequestsDbAdapter.java @@ -26,6 +26,7 @@ import javax.jws.WebService; import javax.xml.bind.annotation.XmlElement; import org.onap.so.adapters.requestsdb.exceptions.MsoRequestsDbException; import org.onap.so.db.request.beans.InfraActiveRequests; +import org.onap.so.db.request.beans.InstanceNfvoMapping; import org.onap.so.db.request.beans.ResourceOperationStatus; /** @@ -55,6 +56,20 @@ public interface MsoRequestsDbAdapter { throws MsoRequestsDbException; @WebMethod + public void setInstanceNfvoMappingRepository( + @WebParam(name = "instanceId") @XmlElement(required = true) String instanceId, + @WebParam(name = "nfvoName") @XmlElement(required = true) String nfvoName, + @WebParam(name = "endpoint") @XmlElement(required = true) String endpoint, + @WebParam(name = "username") @XmlElement(required = true) String username, + @WebParam(name = "password") @XmlElement(required = true) String password, + @WebParam(name = "apiRoot") @XmlElement(required = false) String apiRoot) throws MsoRequestsDbException; + + @WebMethod + public InstanceNfvoMapping getInstanceNfvoMapping( + @WebParam(name = "instanceId") @XmlElement(required = true) String instanceId) + throws MsoRequestsDbException; + + @WebMethod public InfraActiveRequests getInfraRequest( @WebParam(name = "requestId") @XmlElement(required = true) String requestId) throws MsoRequestsDbException; diff --git a/adapters/mso-requests-db-adapter/src/main/java/org/onap/so/adapters/requestsdb/MsoRequestsDbAdapterImpl.java b/adapters/mso-requests-db-adapter/src/main/java/org/onap/so/adapters/requestsdb/MsoRequestsDbAdapterImpl.java index 085a255948..052a53bb1f 100644 --- a/adapters/mso-requests-db-adapter/src/main/java/org/onap/so/adapters/requestsdb/MsoRequestsDbAdapterImpl.java +++ b/adapters/mso-requests-db-adapter/src/main/java/org/onap/so/adapters/requestsdb/MsoRequestsDbAdapterImpl.java @@ -31,12 +31,14 @@ import org.onap.so.adapters.requestsdb.exceptions.MsoRequestsDbException; import org.onap.so.db.request.beans.InfraActiveRequests; import org.onap.so.db.request.beans.OperationStatus; import org.onap.so.db.request.beans.ResourceOperationStatus; +import org.onap.so.db.request.beans.InstanceNfvoMapping; import org.onap.so.db.request.beans.ResourceOperationStatusId; import org.onap.so.db.request.beans.SiteStatus; import org.onap.so.db.request.data.repository.InfraActiveRequestsRepository; import org.onap.so.db.request.data.repository.OperationStatusRepository; import org.onap.so.db.request.data.repository.ResourceOperationStatusRepository; import org.onap.so.db.request.data.repository.SiteStatusRepository; +import org.onap.so.db.request.data.repository.InstanceNfvoMappingRepository; import org.onap.so.logger.ErrorCode; import org.onap.so.requestsdb.RequestsDbConstant; import org.slf4j.Logger; @@ -59,6 +61,9 @@ public class MsoRequestsDbAdapterImpl implements MsoRequestsDbAdapter { private InfraActiveRequestsRepository infraActive; @Autowired + private InstanceNfvoMappingRepository instanceNfvoMappingRepository; + + @Autowired private SiteStatusRepository siteRepo; @Autowired @@ -69,6 +74,40 @@ public class MsoRequestsDbAdapterImpl implements MsoRequestsDbAdapter { @Transactional @Override + public void setInstanceNfvoMappingRepository(String instanceId, String nfvoName, String endpoint, String username, + String password, String apiRoot) { + InstanceNfvoMapping instanceNfvoMapping = new InstanceNfvoMapping(); + if (apiRoot != null) { + instanceNfvoMapping.setApiRoot(apiRoot); + } + if (endpoint != null) { + instanceNfvoMapping.setEndpoint(endpoint); + } + if (instanceId != null) { + instanceNfvoMapping.setInstanceId(instanceId); + } + if (nfvoName != null) { + instanceNfvoMapping.setNfvoName(nfvoName); + } + if (username != null) { + instanceNfvoMapping.setUsername(username); + } + if (password != null) { + instanceNfvoMapping.setPassword(password); + } + + instanceNfvoMappingRepository.save(instanceNfvoMapping); + } + + @Transactional + @Override + public InstanceNfvoMapping getInstanceNfvoMapping(String instanceId) { + InstanceNfvoMapping instanceNfvoMapping = instanceNfvoMappingRepository.findOneByInstanceId(instanceId); + return instanceNfvoMapping; + } + + @Transactional + @Override public void updateInfraRequest(String requestId, String lastModifiedBy, String statusMessage, String responseBody, RequestStatusType requestStatus, String progress, String vnfOutputs, String serviceInstanceId, String networkId, String vnfId, String vfModuleId, String volumeGroupId, String serviceInstanceName, diff --git a/adapters/mso-requests-db-adapter/src/main/java/org/onap/so/adapters/requestsdb/OrchestrationTaskRepositoryCustomController.java b/adapters/mso-requests-db-adapter/src/main/java/org/onap/so/adapters/requestsdb/OrchestrationTaskRepositoryCustomController.java new file mode 100644 index 0000000000..e32d90b137 --- /dev/null +++ b/adapters/mso-requests-db-adapter/src/main/java/org/onap/so/adapters/requestsdb/OrchestrationTaskRepositoryCustomController.java @@ -0,0 +1,62 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License") + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.requestsdb; + +import org.onap.so.adapters.requestsdb.exceptions.MsoRequestsDbException; +import org.onap.so.db.request.beans.OrchestrationTask; +import org.onap.so.db.request.data.repository.OrchestrationTaskRepository; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.web.bind.annotation.*; +import java.util.List; + +@RestController +public class OrchestrationTaskRepositoryCustomController { + + @Autowired + private OrchestrationTaskRepository orchestrationTaskRepository; + + @RequestMapping(method = RequestMethod.GET, value = "/orchestrationTask") + public List<OrchestrationTask> getAllOrchestrationTask() { + return orchestrationTaskRepository.findAll(); + } + + @RequestMapping(method = RequestMethod.GET, value = "/orchestrationTask/{taskId}") + public OrchestrationTask getOrchestrationTask(@PathVariable("taskId") String taskId) throws MsoRequestsDbException { + return orchestrationTaskRepository.findById(taskId) + .orElseThrow(() -> new MsoRequestsDbException("orchestration task not found: " + taskId)); + } + + @RequestMapping(method = RequestMethod.POST, value = "/orchestrationTask/") + public OrchestrationTask createOrchestrationTask(@RequestBody OrchestrationTask orchestrationTask) { + return orchestrationTaskRepository.save(orchestrationTask); + } + + @RequestMapping(method = RequestMethod.PUT, value = "/orchestrationTask/{taskId}") + public OrchestrationTask updateOrchestrationTask(@PathVariable("taskId") String taskId, + @RequestBody OrchestrationTask orchestrationTask) throws MsoRequestsDbException { + return orchestrationTaskRepository.save(orchestrationTask); + } + + @RequestMapping(method = RequestMethod.DELETE, value = "/orchestrationTask/{taskId}") + public void deleteOrchestrationTask(@PathVariable("taskId") String taskId) { + orchestrationTaskRepository.deleteById(taskId); + } +} diff --git a/adapters/mso-requests-db-adapter/src/main/resources/db/migration/V6.1.1__Add_Instance_NFVO_Mapping_Table.sql b/adapters/mso-requests-db-adapter/src/main/resources/db/migration/V6.1.1__Add_Instance_NFVO_Mapping_Table.sql new file mode 100644 index 0000000000..165a9b33f8 --- /dev/null +++ b/adapters/mso-requests-db-adapter/src/main/resources/db/migration/V6.1.1__Add_Instance_NFVO_Mapping_Table.sql @@ -0,0 +1,12 @@ +use requestdb; + +CREATE TABLE `instance_nfvo_mapping` ( + `INSTANCE_ID` varchar(256) NOT NULL, + `NFVO_NAME` varchar(256) DEFAULT NULL, + `ENDPOINT` varchar(256) DEFAULT NULL, + `USERNAME` varchar(256) DEFAULT NULL, + `PASSWORD` varchar(256) DEFAULT NULL, + `API_ROOT` varchar(256) DEFAULT NULL, + `JOB_ID` varchar(256) DEFAULT NULL, + PRIMARY KEY (`INSTANCE_ID`) +) ENGINE=InnoDB DEFAULT CHARSET=latin1;
\ No newline at end of file diff --git a/adapters/mso-requests-db-adapter/src/main/resources/db/migration/V7.2.1__Add_PNF_Column_Infra_Requests_archive_tables.sql b/adapters/mso-requests-db-adapter/src/main/resources/db/migration/V7.2.1__Add_PNF_Column_Infra_Requests_archive_tables.sql new file mode 100644 index 0000000000..8c042dcbaf --- /dev/null +++ b/adapters/mso-requests-db-adapter/src/main/resources/db/migration/V7.2.1__Add_PNF_Column_Infra_Requests_archive_tables.sql @@ -0,0 +1,4 @@ +use requestdb; + +ALTER TABLE infra_active_requests ADD COLUMN IF NOT EXISTS PNF_NAME varchar(45); +ALTER TABLE archived_infra_requests ADD COLUMN IF NOT EXISTS PNF_NAME varchar(45); diff --git a/adapters/mso-requests-db-adapter/src/main/resources/db/migration/V7.2__Add_PNF_Column_Infra_Requests_archive_tables.sql b/adapters/mso-requests-db-adapter/src/main/resources/db/migration/V7.2__Add_PNF_Column_Infra_Requests_archive_tables.sql index dbdc925dae..d82e666855 100644 --- a/adapters/mso-requests-db-adapter/src/main/resources/db/migration/V7.2__Add_PNF_Column_Infra_Requests_archive_tables.sql +++ b/adapters/mso-requests-db-adapter/src/main/resources/db/migration/V7.2__Add_PNF_Column_Infra_Requests_archive_tables.sql @@ -1,4 +1,4 @@ use requestdb; ALTER TABLE infra_active_requests ADD COLUMN IF NOT EXISTS PNF_ID varchar(45); -ALTER TABLE archived_infra_requests ADD COLUMN IF NOT EXISTS PNF_ID varchar(45);
\ No newline at end of file +ALTER TABLE archived_infra_requests ADD COLUMN IF NOT EXISTS PNF_ID varchar(45); diff --git a/adapters/mso-requests-db-adapter/src/main/resources/db/migration/V7.3__Add_Columns_Tenant_Name_Product_Family_Name.sql b/adapters/mso-requests-db-adapter/src/main/resources/db/migration/V7.3__Add_Columns_Tenant_Name_Product_Family_Name.sql new file mode 100644 index 0000000000..a79b1a86c1 --- /dev/null +++ b/adapters/mso-requests-db-adapter/src/main/resources/db/migration/V7.3__Add_Columns_Tenant_Name_Product_Family_Name.sql @@ -0,0 +1,7 @@ +use requestdb; + +ALTER TABLE infra_active_requests ADD COLUMN IF NOT EXISTS TENANT_NAME varchar(200); +ALTER TABLE archived_infra_requests ADD COLUMN IF NOT EXISTS TENANT_NAME varchar(200); + +ALTER TABLE infra_active_requests ADD COLUMN IF NOT EXISTS PRODUCT_FAMILY_NAME varchar(200); +ALTER TABLE archived_infra_requests ADD COLUMN IF NOT EXISTS PRODUCT_FAMILY_NAME varchar(200);
\ No newline at end of file diff --git a/adapters/mso-requests-db-adapter/src/main/resources/db/migration/V8.1__Add_Orchestration_Task_Table.sql b/adapters/mso-requests-db-adapter/src/main/resources/db/migration/V8.1__Add_Orchestration_Task_Table.sql new file mode 100644 index 0000000000..0d7cb7a62b --- /dev/null +++ b/adapters/mso-requests-db-adapter/src/main/resources/db/migration/V8.1__Add_Orchestration_Task_Table.sql @@ -0,0 +1,12 @@ +USE `requestdb`; + +CREATE TABLE `orchestration_task` ( + `TASK_ID` varchar(200) NOT NULL, + `REQUEST_ID` varchar(200) NOT NULL, + `NAME` varchar(200) NOT NULL, + `CREATED_TIME` datetime NOT NULL DEFAULT CURRENT_TIMESTAMP, + `STATUS` varchar(200) NOT NULL, + `IS_MANUAL` varchar(20) NOT NULL, + `PARAMS` varchar(20000) DEFAULT NULL, + PRIMARY KEY (`TASK_ID`) +) ENGINE=InnoDB DEFAULT CHARSET=latin1; diff --git a/adapters/mso-requests-db-adapter/src/test/java/org/onap/so/adapters/requestsdb/adapters/MSORequestDBImplTest.java b/adapters/mso-requests-db-adapter/src/test/java/org/onap/so/adapters/requestsdb/adapters/MSORequestDBImplTest.java index fef9dbc22c..9ded5b4b79 100644 --- a/adapters/mso-requests-db-adapter/src/test/java/org/onap/so/adapters/requestsdb/adapters/MSORequestDBImplTest.java +++ b/adapters/mso-requests-db-adapter/src/test/java/org/onap/so/adapters/requestsdb/adapters/MSORequestDBImplTest.java @@ -39,8 +39,10 @@ import org.onap.so.adapters.requestsdb.exceptions.MsoRequestsDbException; import org.onap.so.db.request.beans.InfraActiveRequests; import org.onap.so.db.request.beans.OperationStatus; import org.onap.so.db.request.beans.ResourceOperationStatus; +import org.onap.so.db.request.beans.InstanceNfvoMapping; import org.onap.so.db.request.data.repository.OperationStatusRepository; import org.onap.so.db.request.data.repository.ResourceOperationStatusRepository; +import org.onap.so.db.request.data.repository.InstanceNfvoMappingRepository; import org.onap.so.requestsdb.RequestsDbConstant; import org.springframework.beans.factory.annotation.Autowired; import org.springframework.boot.web.server.LocalServerPort; @@ -58,6 +60,9 @@ public class MSORequestDBImplTest extends RequestsAdapterBase { @Autowired private ResourceOperationStatusRepository resourceOperationStatusRepo; + @Autowired + private InstanceNfvoMappingRepository instanceNfvoMappingRepository; + @Rule public ExpectedException thrown = ExpectedException.none(); @@ -257,6 +262,29 @@ public class MSORequestDBImplTest extends RequestsAdapterBase { } @Test + public void setInstanceNfvoMappingRepository() throws MsoRequestsDbException { + InstanceNfvoMapping instanceNfvoMapping = new InstanceNfvoMapping(); + String instanceId = "9b9f02c0-298b-458a-bc9c-be3692e4f354"; + String nfvoName = "testNFVO"; + String endpoint = "http://127.0.0.1:80/"; + String username = "admin"; + String password = "admin"; + String apiRoot = "v1"; + + instanceNfvoMapping.setApiRoot(apiRoot); + instanceNfvoMapping.setEndpoint(endpoint); + instanceNfvoMapping.setInstanceId(instanceId); + instanceNfvoMapping.setNfvoName(nfvoName); + instanceNfvoMapping.setUsername(username); + instanceNfvoMapping.setPassword(password); + + dbAdapter.setInstanceNfvoMappingRepository(instanceId, nfvoName, endpoint, username, password, apiRoot); + InstanceNfvoMapping dbInstNfvoMap = dbAdapter.getInstanceNfvoMapping(instanceId); + assertThat(dbInstNfvoMap, sameBeanAs(instanceNfvoMapping)); + } + + + @Test public void updateServiceOperation() throws MsoRequestsDbException { String serviceId = "serviceid"; String operationId = "operationid"; diff --git a/adapters/mso-sdnc-adapter/pom.xml b/adapters/mso-sdnc-adapter/pom.xml index 07c8ed5eab..7fd1aa62d4 100644 --- a/adapters/mso-sdnc-adapter/pom.xml +++ b/adapters/mso-sdnc-adapter/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>adapters</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>mso-sdnc-adapter</artifactId> <properties> diff --git a/adapters/mso-ve-vnfm-adapter/pom.xml b/adapters/mso-ve-vnfm-adapter/pom.xml index 4472956eb7..3d054d9eca 100644 --- a/adapters/mso-ve-vnfm-adapter/pom.xml +++ b/adapters/mso-ve-vnfm-adapter/pom.xml @@ -8,7 +8,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>adapters</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <groupId>org.onap.so.adapters</groupId> @@ -30,6 +30,10 @@ <artifactId>spring-boot-starter-web</artifactId> </dependency> <dependency> + <groupId>org.springframework.retry</groupId> + <artifactId>spring-retry</artifactId> + </dependency> + <dependency> <groupId>org.onap.so.adapters</groupId> <artifactId>mso-vnfm-adapter-ext-clients</artifactId> <version>${project.version}</version> @@ -52,6 +56,10 @@ <artifactId>jersey-hk2</artifactId> </dependency> <dependency> + <groupId>org.projectlombok</groupId> + <artifactId>lombok</artifactId> + </dependency> + <dependency> <groupId>org.springframework.boot</groupId> <artifactId>spring-boot-starter-test</artifactId> <scope>test</scope> diff --git a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/aai/AaiConnection.java b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/aai/AaiConnection.java index 188b6718f2..9b2a8c3d62 100644 --- a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/aai/AaiConnection.java +++ b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/aai/AaiConnection.java @@ -20,13 +20,18 @@ package org.onap.so.adapters.vevnfm.aai; +import java.util.Collections; +import java.util.LinkedList; import java.util.List; import java.util.Optional; +import org.apache.logging.log4j.util.Strings; import org.onap.aai.domain.yang.EsrSystemInfo; import org.onap.aai.domain.yang.EsrVnfm; import org.onap.aai.domain.yang.EsrVnfmList; +import org.onap.so.adapters.vevnfm.exception.VeVnfmException; import org.onap.so.client.aai.AAIObjectType; import org.onap.so.client.aai.AAIResourcesClient; +import org.onap.so.client.aai.entities.uri.AAIResourceUri; import org.onap.so.client.aai.entities.uri.AAIUriFactory; import org.onap.so.client.graphinventory.entities.uri.Depth; import org.slf4j.Logger; @@ -40,43 +45,59 @@ public class AaiConnection { private static final int FIRST_INDEX = 0; - public EsrSystemInfo receiveVnfm() { + private static void isValid(final List<EsrSystemInfo> infos) throws VeVnfmException { + if (infos == null || infos.isEmpty() || Strings.isBlank(infos.get(FIRST_INDEX).getServiceUrl())) { + throw new VeVnfmException("No 'url' field in VNFM info"); + } + } + + public List<EsrSystemInfo> receiveVnfm() throws VeVnfmException { + List<EsrSystemInfo> infos; + + try { + infos = receiveVnfmInternal(); + } catch (Exception e) { + throw new VeVnfmException(e); + } + + isValid(infos); + + return infos; + } + + private List<EsrSystemInfo> receiveVnfmInternal() { final AAIResourcesClient resourcesClient = new AAIResourcesClient(); - final Optional<EsrVnfmList> response = - resourcesClient.get(EsrVnfmList.class, AAIUriFactory.createResourceUri(AAIObjectType.VNFM_LIST)); + final AAIResourceUri resourceUri = AAIUriFactory.createResourceUri(AAIObjectType.VNFM_LIST); + final Optional<EsrVnfmList> response = resourcesClient.get(EsrVnfmList.class, resourceUri); if (response.isPresent()) { final EsrVnfmList esrVnfmList = response.get(); logger.info("The VNFM replied with: {}", esrVnfmList); final List<EsrVnfm> esrVnfm = esrVnfmList.getEsrVnfm(); - if (esrVnfm.isEmpty()) { - return null; + final List<EsrSystemInfo> infos = new LinkedList<>(); + + for (final EsrVnfm vnfm : esrVnfm) { + final String vnfmId = vnfm.getVnfmId(); + infos.addAll(receiveVnfmServiceUrl(resourcesClient, vnfmId)); } - final String vnfmId = esrVnfm.get(FIRST_INDEX).getVnfmId(); - return receiveVnfmServiceUrl(resourcesClient, vnfmId); + return infos; } return null; } - private EsrSystemInfo receiveVnfmServiceUrl(final AAIResourcesClient resourcesClient, final String vnfmId) { + private List<EsrSystemInfo> receiveVnfmServiceUrl(final AAIResourcesClient resourcesClient, final String vnfmId) { final Optional<EsrVnfm> response = resourcesClient.get(EsrVnfm.class, AAIUriFactory.createResourceUri(AAIObjectType.VNFM, vnfmId).depth(Depth.ONE)); if (response.isPresent()) { final EsrVnfm esrVnfm = response.get(); logger.info("The VNFM replied with: {}", esrVnfm); - final List<EsrSystemInfo> esrSystemInfo = esrVnfm.getEsrSystemInfoList().getEsrSystemInfo(); - - if (esrSystemInfo.isEmpty()) { - return null; - } - - return esrSystemInfo.get(FIRST_INDEX); + return esrVnfm.getEsrSystemInfoList().getEsrSystemInfo(); } - return null; + return Collections.emptyList(); } } diff --git a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/aai/EsrId.java b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/aai/EsrId.java new file mode 100644 index 0000000000..13ff2b6397 --- /dev/null +++ b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/aai/EsrId.java @@ -0,0 +1,45 @@ +/*- + * ============LICENSE_START======================================================= + * SO + * ================================================================================ + * Copyright (C) 2020 Samsung. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.vevnfm.aai; + +import org.onap.aai.domain.yang.EsrSystemInfo; + +public class EsrId { + + private EsrSystemInfo info; + private String id; + + public EsrSystemInfo getInfo() { + return info; + } + + public void setInfo(final EsrSystemInfo info) { + this.info = info; + } + + public String getId() { + return id; + } + + public void setId(final String id) { + this.id = id; + } +} diff --git a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/configuration/StartupConfiguration.java b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/configuration/StartupConfiguration.java index f7b7283c59..c033fc3f96 100644 --- a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/configuration/StartupConfiguration.java +++ b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/configuration/StartupConfiguration.java @@ -20,7 +20,10 @@ package org.onap.so.adapters.vevnfm.configuration; +import java.util.List; +import org.onap.aai.domain.yang.EsrSystemInfo; import org.onap.so.adapters.vevnfm.service.StartupService; +import org.onap.so.adapters.vevnfm.service.SubscriptionScheduler; import org.springframework.beans.factory.annotation.Autowired; import org.springframework.boot.context.event.ApplicationReadyEvent; import org.springframework.context.annotation.Configuration; @@ -39,10 +42,14 @@ public class StartupConfiguration { @Autowired private StartupService startupService; + @Autowired + private SubscriptionScheduler subscriptionScheduler; + @EventListener(ApplicationReadyEvent.class) public void onApplicationReadyEvent() throws Exception { if (!environment.acceptsProfiles(Profiles.of(TEST_PROFILE))) { - startupService.run(); + final List<EsrSystemInfo> infos = startupService.receiveVnfm(); + subscriptionScheduler.setInfos(infos); } } } diff --git a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/controller/NotificationController.java b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/controller/NotificationController.java index 1882b4e183..cb324c32a9 100644 --- a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/controller/NotificationController.java +++ b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/controller/NotificationController.java @@ -38,7 +38,7 @@ public class NotificationController { @Autowired private DmaapService dmaapService; - @PostMapping("${notification.url}") + @PostMapping("${vnfm.notification}") public ResponseEntity receiveNotification(@RequestBody final VnfLcmOperationOccurrenceNotification notification) { logger.info("Notification received {}", notification); dmaapService.send(notification); diff --git a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/event/AaiEvent.java b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/event/AaiEvent.java new file mode 100644 index 0000000000..ceabb8a020 --- /dev/null +++ b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/event/AaiEvent.java @@ -0,0 +1,44 @@ +/*- + * ============LICENSE_START======================================================= + * SO + * ================================================================================ + * Copyright (C) 2020 Samsung. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.vevnfm.event; + +import com.fasterxml.jackson.annotation.JsonProperty; + +public class AaiEvent { + + private final boolean vserverIsClosedLoopDisabled; + private final String genericVnfVnfId; + + public AaiEvent(final boolean cld, final String id) { + this.vserverIsClosedLoopDisabled = cld; + this.genericVnfVnfId = id; + } + + @JsonProperty("vserver.is-closed-loop-disabled") + public boolean isVserverIsClosedLoopDisabled() { + return vserverIsClosedLoopDisabled; + } + + @JsonProperty("generic-vnf.vnf-id") + public String getGenericVnfVnfId() { + return genericVnfVnfId; + } +} diff --git a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/event/DmaapEvent.java b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/event/DmaapEvent.java new file mode 100644 index 0000000000..dc0c5502dd --- /dev/null +++ b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/event/DmaapEvent.java @@ -0,0 +1,110 @@ +/*- + * ============LICENSE_START======================================================= + * SO + * ================================================================================ + * Copyright (C) 2020 Samsung. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.vevnfm.event; + +import static java.time.temporal.ChronoField.INSTANT_SECONDS; +import com.fasterxml.jackson.annotation.JsonProperty; +import java.time.Instant; +import java.util.UUID; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.lcn.model.VnfLcmOperationOccurrenceNotification; + +public class DmaapEvent { + + public static final String MSERVICE = "microservice.stringmatcher"; + public static final String ONSET = "ONSET"; + public static final String VNF = "VNF"; + public static final String VNFID = "generic-vnf.vnf-id"; + public static final String ETSI = "ETSI"; + + private final String closedLoopControlName; + private final long closedLoopAlarmStart; + private final String closedLoopEventClient; + private final String closedLoopEventStatus; + private final String requestId; + private final String targetType; + private final String target; + private final AaiEvent aaiEvent; + private final String from; + private final String version; + private final VnfLcmOperationOccurrenceNotification etsiLcmEvent; + + public DmaapEvent(final String closedLoopControlName, final String version, + final VnfLcmOperationOccurrenceNotification etsiLcmEvent) { + this.closedLoopControlName = closedLoopControlName; + this.closedLoopAlarmStart = Instant.now().getLong(INSTANT_SECONDS); + this.closedLoopEventClient = MSERVICE; + this.closedLoopEventStatus = ONSET; + this.requestId = UUID.randomUUID().toString(); + this.targetType = VNF; + this.target = VNFID; + this.aaiEvent = new AaiEvent(false, etsiLcmEvent.getId()); + this.from = ETSI; + this.version = version; + this.etsiLcmEvent = etsiLcmEvent; + } + + public String getClosedLoopControlName() { + return closedLoopControlName; + } + + public long getClosedLoopAlarmStart() { + return closedLoopAlarmStart; + } + + public String getClosedLoopEventClient() { + return closedLoopEventClient; + } + + public String getClosedLoopEventStatus() { + return closedLoopEventStatus; + } + + @JsonProperty("requestID") + public String getRequestId() { + return requestId; + } + + @JsonProperty("target_type") + public String getTargetType() { + return targetType; + } + + public String getTarget() { + return target; + } + + @JsonProperty("AAI") + public AaiEvent getAaiEvent() { + return aaiEvent; + } + + public String getFrom() { + return from; + } + + public String getVersion() { + return version; + } + + public VnfLcmOperationOccurrenceNotification getEtsiLcmEvent() { + return etsiLcmEvent; + } +} diff --git a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/exception/VeVnfmException.java b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/exception/VeVnfmException.java index abd9ff9d33..a0c1c1e9db 100644 --- a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/exception/VeVnfmException.java +++ b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/exception/VeVnfmException.java @@ -25,4 +25,8 @@ public class VeVnfmException extends Exception { public VeVnfmException(final String message) { super(message); } + + public VeVnfmException(final Throwable cause) { + super(cause); + } } diff --git a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/provider/AuthorizationHeadersProvider.java b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/provider/AuthorizationHeadersProvider.java index 251e0c426b..838a67d115 100644 --- a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/provider/AuthorizationHeadersProvider.java +++ b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/provider/AuthorizationHeadersProvider.java @@ -20,11 +20,16 @@ package org.onap.so.adapters.vevnfm.provider; +import org.apache.logging.log4j.util.Strings; import org.onap.so.configuration.rest.BasicHttpHeadersProvider; public class AuthorizationHeadersProvider extends BasicHttpHeadersProvider { public void addAuthorization(final String authorization) { + if (Strings.isBlank(authorization)) { + return; + } + getHttpHeaders().set(AUTHORIZATION_HEADER, authorization); } diff --git a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/service/DmaapService.java b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/service/DmaapService.java index 59397cead3..c685ae815a 100644 --- a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/service/DmaapService.java +++ b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/service/DmaapService.java @@ -1,5 +1,26 @@ +/*- + * ============LICENSE_START======================================================= + * SO + * ================================================================================ + * Copyright (C) 2020 Samsung. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + package org.onap.so.adapters.vevnfm.service; +import org.onap.so.adapters.vevnfm.event.DmaapEvent; import org.onap.so.adapters.vnfmadapter.extclients.vnfm.lcn.model.VnfLcmOperationOccurrenceNotification; import org.onap.so.rest.service.HttpRestServiceProvider; import org.slf4j.Logger; @@ -21,16 +42,26 @@ public class DmaapService { @Value("${dmaap.topic}") private String topic; + @Value("${dmaap.closed-loop.control.name}") + private String closedLoopControlName; + + @Value("${dmaap.version}") + private String version; + @Autowired private HttpRestServiceProvider restProvider; public void send(final VnfLcmOperationOccurrenceNotification notification) { - final ResponseEntity<String> response = restProvider.postHttpRequest(notification, getUrl(), String.class); - - final HttpStatus statusCode = response.getStatusCode(); - final String body = response.getBody(); + try { + final DmaapEvent event = new DmaapEvent(closedLoopControlName, version, notification); + final ResponseEntity<String> response = restProvider.postHttpRequest(event, getUrl(), String.class); + final HttpStatus statusCode = response.getStatusCode(); + final String body = response.getBody(); - logger.info("The DMaaP replied with the code {} and the body {}", statusCode, body); + logger.info("The DMaaP replied with the code {} and the body {}", statusCode, body); + } catch (Exception e) { + logger.warn("An issue connecting to DMaaP", e); + } } private String getUrl() { diff --git a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/service/StartupService.java b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/service/StartupService.java index dfbafa223c..92906ef35c 100644 --- a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/service/StartupService.java +++ b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/service/StartupService.java @@ -20,35 +20,44 @@ package org.onap.so.adapters.vevnfm.service; -import org.apache.logging.log4j.util.Strings; +import java.util.Collections; +import java.util.List; import org.onap.aai.domain.yang.EsrSystemInfo; import org.onap.so.adapters.vevnfm.aai.AaiConnection; import org.onap.so.adapters.vevnfm.exception.VeVnfmException; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.beans.factory.annotation.Value; +import org.springframework.retry.annotation.Backoff; +import org.springframework.retry.annotation.EnableRetry; +import org.springframework.retry.annotation.Recover; +import org.springframework.retry.annotation.Retryable; import org.springframework.stereotype.Service; @Service +@EnableRetry public class StartupService { - @Autowired - private AaiConnection aaiConnection; + private static final Logger logger = LoggerFactory.getLogger(StartupService.class); + + @Value("${vnfm.default-endpoint}") + private String vnfmDefaultEndpoint; @Autowired - private SubscriberService subscriberService; + private AaiConnection aaiConnection; - private static void isValid(final EsrSystemInfo info) throws VeVnfmException { - if (Strings.isBlank(info.getServiceUrl())) { - throw new VeVnfmException("No 'url' field in VNFM info"); - } + @Retryable(value = {Exception.class}, maxAttempts = 5, backoff = @Backoff(delay = 5000, multiplier = 2)) + public List<EsrSystemInfo> receiveVnfm() throws VeVnfmException { + return aaiConnection.receiveVnfm(); } - public void run() throws Exception { - final EsrSystemInfo info = aaiConnection.receiveVnfm(); - isValid(info); - final boolean done = subscriberService.subscribe(info); - - if (!done) { - throw new VeVnfmException("Could not subscribe to VNFM"); - } + @Recover + public List<EsrSystemInfo> recoverReceiveVnfm(final Throwable t) { + logger.warn("Connection to AAI failed"); + final EsrSystemInfo info = new EsrSystemInfo(); + info.setServiceUrl(vnfmDefaultEndpoint); + logger.warn("This EsrSystemInfo is used by default: {}", info); + return Collections.singletonList(info); } } diff --git a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/subscription/SubscribeSender.java b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/service/SubscribeSender.java index 8fdfb41d26..d01c3c8f66 100644 --- a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/subscription/SubscribeSender.java +++ b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/service/SubscribeSender.java @@ -18,9 +18,11 @@ * ============LICENSE_END========================================================= */ -package org.onap.so.adapters.vevnfm.subscription; +package org.onap.so.adapters.vevnfm.service; +import com.fasterxml.jackson.annotation.JsonProperty; import org.onap.aai.domain.yang.EsrSystemInfo; +import org.onap.so.adapters.vevnfm.exception.VeVnfmException; import org.onap.so.adapters.vnfmadapter.extclients.vnfm.model.LccnSubscriptionRequest; import org.onap.so.rest.service.HttpRestServiceProvider; import org.slf4j.Logger; @@ -29,11 +31,14 @@ import org.springframework.beans.factory.annotation.Autowired; import org.springframework.beans.factory.annotation.Value; import org.springframework.http.HttpStatus; import org.springframework.http.ResponseEntity; -import org.springframework.stereotype.Component; +import org.springframework.stereotype.Service; +import lombok.ToString; -@Component +@Service public class SubscribeSender { + public static final String SLASH = "/"; + private static final Logger logger = LoggerFactory.getLogger(SubscribeSender.class); @Value("${vnfm.subscription}") @@ -42,18 +47,37 @@ public class SubscribeSender { @Autowired private HttpRestServiceProvider restProvider; - public boolean send(final EsrSystemInfo info, final LccnSubscriptionRequest request) { - final ResponseEntity<String> response = restProvider.postHttpRequest(request, getUrl(info), String.class); + public String send(final EsrSystemInfo info, final LccnSubscriptionRequest request) throws VeVnfmException { + final ResponseEntity<SubscribeToManoResponse> response = + restProvider.postHttpRequest(request, getUrl(info), SubscribeToManoResponse.class); final HttpStatus statusCode = response.getStatusCode(); - final String body = response.getBody(); + final SubscribeToManoResponse body = response.getBody(); logger.info("The VNFM replied with the code {} and the body {}", statusCode, body); - return HttpStatus.CREATED == statusCode; + if (HttpStatus.CREATED != statusCode) { + throw new VeVnfmException("The status code was different than " + HttpStatus.CREATED); + } + + return body.id; + } + + public boolean check(final EsrSystemInfo info, final String id) { + final ResponseEntity<SubscribeToManoResponse> response = + restProvider.getHttpResponse(getUrl(info) + SLASH + id, SubscribeToManoResponse.class); + return response.getBody() != null && response.getBody().id.equals(id); } private String getUrl(final EsrSystemInfo info) { return info.getServiceUrl() + vnfmSubscription; } + + @ToString + static class SubscribeToManoResponse { + @JsonProperty("id") + String id; + @JsonProperty("callbackUri") + String callbackUri; + } } diff --git a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/service/SubscriberService.java b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/service/SubscriberService.java index eefd9ba93b..9760584d7a 100644 --- a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/service/SubscriberService.java +++ b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/service/SubscriberService.java @@ -22,9 +22,10 @@ package org.onap.so.adapters.vevnfm.service; import com.squareup.okhttp.Credentials; import java.util.Collections; +import org.apache.logging.log4j.util.Strings; import org.onap.aai.domain.yang.EsrSystemInfo; +import org.onap.so.adapters.vevnfm.exception.VeVnfmException; import org.onap.so.adapters.vevnfm.provider.AuthorizationHeadersProvider; -import org.onap.so.adapters.vevnfm.subscription.SubscribeSender; import org.onap.so.adapters.vnfmadapter.extclients.vnfm.model.LccnSubscriptionRequest; import org.onap.so.adapters.vnfmadapter.extclients.vnfm.model.SubscriptionsAuthentication; import org.onap.so.adapters.vnfmadapter.extclients.vnfm.model.SubscriptionsAuthenticationParamsBasic; @@ -35,16 +36,11 @@ import org.springframework.stereotype.Service; @Service public class SubscriberService { - private static final char COLON = ':'; + @Value("${vevnfmadapter.endpoint}") + private String endpoint; - @Value("${system.url}") - private String systemUrl; - - @Value("${server.port}") - private String serverPort; - - @Value("${notification.url}") - private String notificationUrl; + @Value("${vnfm.notification}") + private String notification; @Value("${spring.security.usercredentials[0].username}") private String username; @@ -59,19 +55,40 @@ public class SubscriberService { private SubscribeSender sender; private static String getAuthorization(final EsrSystemInfo info) { - return Credentials.basic(info.getUserName(), info.getPassword()); + if (info == null) { + return null; + } + + final String userName = info.getUserName(); + + if (Strings.isBlank(userName)) { + return null; + } + + final String password = info.getPassword(); + return Credentials.basic(userName, password); } - public boolean subscribe(final EsrSystemInfo info) { + public String subscribe(final EsrSystemInfo info) throws VeVnfmException { try { headersProvider.addAuthorization(getAuthorization(info)); final LccnSubscriptionRequest request = createRequest(); return sender.send(info, request); + } catch (Exception e) { + throw new VeVnfmException(e); } finally { headersProvider.removeAuthorization(); } } + public boolean checkSubscription(final EsrSystemInfo info, final String id) throws VeVnfmException { + try { + return sender.check(info, id); + } catch (Exception e) { + throw new VeVnfmException(e); + } + } + private LccnSubscriptionRequest createRequest() { final LccnSubscriptionRequest request = new LccnSubscriptionRequest(); request.callbackUri(getCallbackUri()); @@ -87,6 +104,6 @@ public class SubscriberService { } private String getCallbackUri() { - return systemUrl + COLON + serverPort + notificationUrl; + return endpoint + notification; } } diff --git a/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/service/SubscriptionScheduler.java b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/service/SubscriptionScheduler.java new file mode 100644 index 0000000000..d9f3acc3df --- /dev/null +++ b/adapters/mso-ve-vnfm-adapter/src/main/java/org/onap/so/adapters/vevnfm/service/SubscriptionScheduler.java @@ -0,0 +1,98 @@ +/*- + * ============LICENSE_START======================================================= + * SO + * ================================================================================ + * Copyright (C) 2020 Samsung. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.vevnfm.service; + +import java.util.LinkedList; +import java.util.List; +import org.onap.aai.domain.yang.EsrSystemInfo; +import org.onap.so.adapters.vevnfm.aai.EsrId; +import org.onap.so.adapters.vevnfm.exception.VeVnfmException; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.scheduling.annotation.EnableScheduling; +import org.springframework.scheduling.annotation.Scheduled; +import org.springframework.stereotype.Service; + +@Service +@EnableScheduling +public class SubscriptionScheduler { + + private static final Logger logger = LoggerFactory.getLogger(SubscriptionScheduler.class); + + @Autowired + private SubscriberService subscriberService; + + private List<EsrId> esrIds; + + public void setInfos(final List<EsrSystemInfo> infos) { + esrIds = new LinkedList<>(); + + for (final EsrSystemInfo info : infos) { + final EsrId esrId = new EsrId(); + esrId.setInfo(info); + esrIds.add(esrId); + } + } + + List<EsrId> getEsrIds() { + return esrIds; + } + + @Scheduled(fixedRate = 5000, initialDelay = 2000) + void subscribeTask() throws VeVnfmException { + if (isEsrIdsValid()) { + for (final EsrId esrId : esrIds) { + singleSubscribe(esrId); + } + } + } + + @Scheduled(fixedRate = 20000) + void checkSubscribeTask() throws VeVnfmException { + if (isEsrIdsValid()) { + for (final EsrId esrId : esrIds) { + singleCheckSubscription(esrId); + } + } + } + + private boolean isEsrIdsValid() { + return esrIds != null && !esrIds.isEmpty(); + } + + private void singleSubscribe(final EsrId esrId) throws VeVnfmException { + if (esrId.getId() == null) { + logger.info("Single subscribe task"); + esrId.setId(subscriberService.subscribe(esrId.getInfo())); + } + } + + private void singleCheckSubscription(final EsrId esrId) throws VeVnfmException { + if (esrId.getId() != null) { + logger.info("Checking subscription: {}", esrId.getId()); + if (!subscriberService.checkSubscription(esrId.getInfo(), esrId.getId())) { + logger.info("Subscription {} not available", esrId.getId()); + esrId.setId(null); + } + } + } +} diff --git a/adapters/mso-ve-vnfm-adapter/src/main/resources/application.yaml b/adapters/mso-ve-vnfm-adapter/src/main/resources/application.yaml index 35871c51ac..a2a33bfb5c 100644 --- a/adapters/mso-ve-vnfm-adapter/src/main/resources/application.yaml +++ b/adapters/mso-ve-vnfm-adapter/src/main/resources/application.yaml @@ -15,13 +15,10 @@ # limitations under the License. server: - port: 8080 + port: 9098 -system: - url: http://localhost - -notification: - url: /lcm/v1/vnf/instances/notifications +vevnfmadapter: + endpoint: http://so-ve-vnfm-adapter.onap:9098 mso: key: 07a7159d3bf51a0e53be7a8f89699be7 @@ -31,11 +28,17 @@ aai: auth: 75C4483F9C05E2C33A8602635FA532397EC44AB667A2B64DED4FEE08DD932F2E3C1FEE vnfm: + default-endpoint: https://so-vnfm-simulator.onap:9093 subscription: /vnflcm/v1/subscriptions + notification: /lcm/v1/vnf/instances/notifications dmaap: - endpoint: http://message-router:30227 + endpoint: http://message-router.onap:30227 topic: /events/unauthenticated.DCAE_CL_OUTPUT + closed-loop: + control: + name: ClosedLoopControlName + version: 1.0.2 spring: security: diff --git a/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/controller/NotificationControllerTest.java b/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/controller/NotificationControllerTest.java index 57638a165a..974e6ec544 100644 --- a/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/controller/NotificationControllerTest.java +++ b/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/controller/NotificationControllerTest.java @@ -53,8 +53,8 @@ public class NotificationControllerTest { private static final String MINIMAL_JSON_CONTENT = "{}"; private static final int ZERO = 0; - @Value("${notification.url}") - private String notificationUrl; + @Value("${vnfm.notification}") + private String notification; @Autowired private WebApplicationContext webApplicationContext; @@ -74,7 +74,7 @@ public class NotificationControllerTest { @Test public void testReceiveNotification() throws Exception { // given - final MockHttpServletRequestBuilder request = MockMvcRequestBuilders.post(notificationUrl) + final MockHttpServletRequestBuilder request = MockMvcRequestBuilders.post(notification) .contentType(MediaType.APPLICATION_JSON).content(MINIMAL_JSON_CONTENT); mockRestServer.expect(once(), anything()).andRespond(withSuccess()); diff --git a/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/provider/AuthorizationHeadersProviderTest.java b/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/provider/AuthorizationHeadersProviderTest.java index 64503ddfc2..f9ae427086 100644 --- a/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/provider/AuthorizationHeadersProviderTest.java +++ b/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/provider/AuthorizationHeadersProviderTest.java @@ -28,6 +28,8 @@ import org.springframework.http.HttpHeaders; public class AuthorizationHeadersProviderTest { private static final String AUTHORIZATION_EXAMPLE = "authorization"; + private static final String BLANK_EXAMPLE = "\t\n"; + private static final String EMPTY = ""; private final AuthorizationHeadersProvider provider = new AuthorizationHeadersProvider(); @@ -44,4 +46,41 @@ public class AuthorizationHeadersProviderTest { assertEquals(size, headers.size()); assertFalse(headers.containsKey(AUTHORIZATION_HEADER)); } + + @Test + public void testBlankAuthorization() { + final HttpHeaders headers = provider.getHttpHeaders(); + final int size = headers.size(); + + provider.addAuthorization(BLANK_EXAMPLE); + assertEquals(size, headers.size()); + } + + @Test + public void testEmptyAuthorization() { + final HttpHeaders headers = provider.getHttpHeaders(); + final int size = headers.size(); + + provider.addAuthorization(EMPTY); + assertEquals(size, headers.size()); + } + + @Test + public void testNullAuthorization() { + final HttpHeaders headers = provider.getHttpHeaders(); + final int size = headers.size(); + + provider.addAuthorization(null); + assertEquals(size, headers.size()); + } + + @Test + public void testRemoveAuthorization() { + final HttpHeaders headers = provider.getHttpHeaders(); + final int size = headers.size(); + + provider.removeAuthorization(); + provider.removeAuthorization(); + assertEquals(size, headers.size()); + } } diff --git a/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/service/StartupServiceTest.java b/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/service/StartupServiceTest.java index 0f9c23e261..9b18cf96dc 100644 --- a/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/service/StartupServiceTest.java +++ b/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/service/StartupServiceTest.java @@ -20,7 +20,11 @@ package org.onap.so.adapters.vevnfm.service; -import static org.mockito.Mockito.*; +import static org.junit.Assert.assertEquals; +import static org.mockito.Mockito.verify; +import static org.mockito.Mockito.when; +import java.util.Collections; +import java.util.List; import org.junit.Rule; import org.junit.Test; import org.junit.rules.ExpectedException; @@ -30,62 +34,35 @@ import org.mockito.Mock; import org.mockito.junit.MockitoJUnitRunner; import org.onap.aai.domain.yang.EsrSystemInfo; import org.onap.so.adapters.vevnfm.aai.AaiConnection; -import org.onap.so.adapters.vevnfm.exception.VeVnfmException; @RunWith(MockitoJUnitRunner.class) public class StartupServiceTest { - @Mock - private AaiConnection aaiConnection; + private static final String URL = "rt"; + + @Rule + public ExpectedException thrown = ExpectedException.none(); @Mock - private SubscriberService subscriberService; + private AaiConnection aaiConnection; @InjectMocks private StartupService startupService; - @Rule - public ExpectedException thrown = ExpectedException.none(); - @Test public void testSuccess() throws Exception { // given final EsrSystemInfo info = new EsrSystemInfo(); - info.setServiceUrl("lh"); - when(aaiConnection.receiveVnfm()).thenReturn(info); - when(subscriberService.subscribe(info)).thenReturn(true); - - // when - startupService.run(); - - // then - verify(aaiConnection, times(1)).receiveVnfm(); - verify(subscriberService, times(1)).subscribe(info); - } - - @Test - public void testFailureAai() throws Exception { - // given - final EsrSystemInfo info = new EsrSystemInfo(); - when(aaiConnection.receiveVnfm()).thenReturn(info); + info.setServiceUrl(URL); + final List<EsrSystemInfo> infos = Collections.singletonList(info); - thrown.expect(VeVnfmException.class); + when(aaiConnection.receiveVnfm()).thenReturn(infos); // when - startupService.run(); - } + final List<EsrSystemInfo> systemInfo = startupService.receiveVnfm(); - @Test - public void testFailureSubscriber() throws Exception { - // given - final EsrSystemInfo info = new EsrSystemInfo(); - info.setServiceUrl("lh"); - when(aaiConnection.receiveVnfm()).thenReturn(info); - when(subscriberService.subscribe(info)).thenReturn(false); - - thrown.expect(VeVnfmException.class); - - // when - startupService.run(); + // then + verify(aaiConnection).receiveVnfm(); + assertEquals(infos, systemInfo); } } diff --git a/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/subscription/SubscribeSenderTest.java b/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/service/SubscribeSenderTest.java index d1fda0eee6..b7f1f982a2 100644 --- a/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/subscription/SubscribeSenderTest.java +++ b/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/service/SubscribeSenderTest.java @@ -18,9 +18,10 @@ * ============LICENSE_END========================================================= */ -package org.onap.so.adapters.vevnfm.subscription; +package org.onap.so.adapters.vevnfm.service; -import static org.junit.Assert.assertTrue; +import static org.junit.Assert.assertEquals; +import static org.onap.so.adapters.vevnfm.service.SubscribeSender.SLASH; import static org.springframework.http.HttpHeaders.CONTENT_TYPE; import static org.springframework.test.web.client.ExpectedCount.once; import static org.springframework.test.web.client.match.MockRestRequestMatchers.*; @@ -33,6 +34,7 @@ import org.junit.Test; import org.junit.runner.RunWith; import org.onap.aai.domain.yang.EsrSystemInfo; import org.onap.so.adapters.vevnfm.configuration.StartupConfiguration; +import org.onap.so.adapters.vevnfm.exception.VeVnfmException; import org.onap.so.adapters.vnfmadapter.extclients.vnfm.model.LccnSubscriptionRequest; import org.springframework.beans.factory.annotation.Autowired; import org.springframework.beans.factory.annotation.Value; @@ -50,8 +52,9 @@ import org.springframework.web.client.RestTemplate; @ActiveProfiles(StartupConfiguration.TEST_PROFILE) public class SubscribeSenderTest { - private static final String SLASH = "/"; - private static final String MINIMAL_JSON_CONTENT = "{}"; + private static final String URL = "lh"; + private static final String ID = "1a2s3d4f"; + private static final String JSON = "{\"id\":\"" + ID + "\"}"; private static final Gson GSON; @@ -78,22 +81,22 @@ public class SubscribeSenderTest { } @Test - public void testSuccess() { + public void testSuccess() throws VeVnfmException { // given final EsrSystemInfo info = new EsrSystemInfo(); - info.setServiceUrl("lh"); + info.setServiceUrl(URL); final LccnSubscriptionRequest request = new LccnSubscriptionRequest(); mockRestServer.expect(once(), requestTo(SLASH + info.getServiceUrl() + vnfmSubscription)) .andExpect(header(CONTENT_TYPE, CoreMatchers.containsString(MediaType.APPLICATION_JSON_VALUE))) .andExpect(method(HttpMethod.POST)).andExpect(content().json(GSON.toJson(request))) - .andRespond(withStatus(HttpStatus.CREATED).body(MINIMAL_JSON_CONTENT)); + .andRespond(withStatus(HttpStatus.CREATED).body(JSON).contentType(MediaType.APPLICATION_JSON)); // when - final boolean done = sender.send(info, request); + final String id = sender.send(info, request); // then - assertTrue(done); mockRestServer.verify(); + assertEquals(ID, id); } } diff --git a/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/service/SubscriptionSchedulerTest.java b/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/service/SubscriptionSchedulerTest.java new file mode 100644 index 0000000000..d3da7c86ec --- /dev/null +++ b/adapters/mso-ve-vnfm-adapter/src/test/java/org/onap/so/adapters/vevnfm/service/SubscriptionSchedulerTest.java @@ -0,0 +1,69 @@ +/*- + * ============LICENSE_START======================================================= + * SO + * ================================================================================ + * Copyright (C) 2020 Samsung. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.vevnfm.service; + +import static org.junit.Assert.assertNull; +import static org.mockito.ArgumentMatchers.eq; +import static org.mockito.Mockito.verify; +import static org.mockito.Mockito.when; +import java.util.Collections; +import java.util.List; +import org.junit.Test; +import org.junit.runner.RunWith; +import org.mockito.InjectMocks; +import org.mockito.Mock; +import org.mockito.junit.MockitoJUnitRunner; +import org.onap.aai.domain.yang.EsrSystemInfo; + +@RunWith(MockitoJUnitRunner.class) +public class SubscriptionSchedulerTest { + + private static final String URL = "url"; + private static final String ID = "id044"; + + @Mock + private SubscriberService subscriberService; + + @InjectMocks + private SubscriptionScheduler subscriptionScheduler; + + @Test + public void testFullScenario() throws Exception { + // given + final EsrSystemInfo info = new EsrSystemInfo(); + info.setServiceUrl(URL); + final List<EsrSystemInfo> infos = Collections.singletonList(info); + + when(subscriberService.subscribe(eq(info))).thenReturn(ID); + when(subscriberService.checkSubscription(eq(info), eq(ID))).thenReturn(false); + + // when + subscriptionScheduler.setInfos(infos); + subscriptionScheduler.subscribeTask(); + subscriptionScheduler.checkSubscribeTask(); + + // then + verify(subscriberService).subscribe(info); + verify(subscriberService).checkSubscription(info, ID); + + assertNull(subscriptionScheduler.getEsrIds().get(0).getId()); + } +} diff --git a/adapters/mso-vfc-adapter/pom.xml b/adapters/mso-vfc-adapter/pom.xml index 09dd512629..451831f966 100644 --- a/adapters/mso-vfc-adapter/pom.xml +++ b/adapters/mso-vfc-adapter/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>adapters</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <groupId>org.onap.so.adapters</groupId> <artifactId>mso-vfc-adapter</artifactId> diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/constant/CommonConstant.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/constant/CommonConstant.java index 04c6749b61..51a0fc0c97 100644 --- a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/constant/CommonConstant.java +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/constant/CommonConstant.java @@ -33,17 +33,32 @@ public class CommonConstant { public static final String STR_EMPTY = ""; public static final String NFVO_CREATE_URL = "/api/nslcm/v1/ns"; + public static final String SOL005_NFVO_CREATE_URL = "/api/nslcm/v1/ns_instances"; public static final String NFVO_INSTANTIATE_URL = "/api/nslcm/v1/ns/%s/instantiate"; + public static final String SOL005_NFVO_INSTANTIATE_URL = "/api/nslcm/v1/ns_instances/%s/instantiate"; public static final String NFVO_TERMINATE_URL = "/api/nslcm/v1/ns/%s/terminate"; + public static final String SOL005_NFVO_TERMINATE_URL = "/api/nslcm/v1/ns_instances/%s/terminate"; public static final String NFVO_DELETE_URL = "/api/nslcm/v1/ns/%s"; + public static final String SOL005_NFVO_DELETE_URL = "/api/nslcm/v1/ns_instances/%s"; public static final String NFVO_QUERY_URL = "/api/nslcm/v1/jobs/%s"; + public static final String SOL005_NFVO_QUERY_URL = "/api/nslcm/v1/ns_lcm_op_occs/%s"; public static final String NFVO_SCALE_URL = "/api/nslcm/v1/ns/%s/scale"; + public enum operationState { + PROCESSING, COMPLETED, PARTIALLY_COMPLETED, FAILED_TEMP, FAILED, ROLLING_BACK, ROLLED_BACK + } + public enum lcmOperationType { + INSTANTIATE, SCALE, UPDATE, TERMINATE, HEAL + }; + public enum cancelMode { + GRACEFUL, FORCEFUL + }; + /** * * <br> @@ -107,8 +122,11 @@ public class CommonConstant { public static final String DESC = "description"; public static final String NS_INSTANCE_ID = "nsInstanceId"; + public static final String SOL005_NS_INSTANCE_ID = "id"; + public static final String JOB_ID = "jobId"; + public static final String JOB_URI = "Location"; public static final String ADDITIONAL_PARAM_FOR_NS = "additionalParamForNs"; diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AddPnfData.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AddPnfData.java new file mode 100644 index 0000000000..d312501fd7 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AddPnfData.java @@ -0,0 +1,68 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + + +package org.onap.so.adapters.vfc.model; + +import java.util.List; + +public class AddPnfData { + private String pnfId; + private String pnfName; + private String pnfdId; + private String pnfProfileId; + private List<PnfExtCpData> cpData; + + /*** + * + * @return id of pnf + */ + public String getPnfId() { + return pnfId; + } + + public void setPnfId(String pnfId) { + this.pnfId = pnfId; + } + + public String getPnfName() { + return pnfName; + } + + public void setPnfName(String pnfName) { + this.pnfName = pnfName; + } + + public String getPnfdId() { + return pnfdId; + } + + public void setPnfdId(String pnfdId) { + this.pnfdId = pnfdId; + } + + public String getPnfProfileId() { + return pnfProfileId; + } + + public void setPnfProfileId(String pnfProfileId) { + this.pnfProfileId = pnfProfileId; + } + + public List<PnfExtCpData> getCpData() { + return cpData; + } + + public void setCpData(List<PnfExtCpData> cpData) { + this.cpData = cpData; + } +} + diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AddressRange.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AddressRange.java new file mode 100644 index 0000000000..9f357a549d --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AddressRange.java @@ -0,0 +1,33 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class AddressRange { + private String minAddress; + private String maxAddress; + + public String getMinAddress() { + return minAddress; + } + + public void setMinAddress(String minAddress) { + this.minAddress = minAddress; + } + + public String getMaxAddress() { + return maxAddress; + } + + public void setMaxAddress(String maxAddress) { + this.maxAddress = maxAddress; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedNs.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedNs.java new file mode 100644 index 0000000000..fa502f3962 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedNs.java @@ -0,0 +1,40 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class AffectedNs { + private String nsInstanceId; + private String nsdId; + + private enum changeType { + ADD, REMOVE, INSTANTIATE, TERMINATE, SCALE, UPDATE, HEAL + } + private enum changeResult { + COMPLETED, ROLLED_BACK, FAILED, PARTIALLY_COMPLETED + } + + public String getNsInstanceId() { + return nsInstanceId; + } + + public void setNsInstanceId(String nsInstanceId) { + this.nsInstanceId = nsInstanceId; + } + + public String getNsdId() { + return nsdId; + } + + public void setNsdId(String nsdId) { + this.nsdId = nsdId; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedPnf.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedPnf.java new file mode 100644 index 0000000000..9d98e1c256 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedPnf.java @@ -0,0 +1,67 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class AffectedPnf { + private String pnfid; + private String pnfdid; + private String pnfProfileId; + private String pnfName; + private String cpInstanceId; + + private enum changeType { + ADD, REMOVE, MODIFY + } + private enum changeResult { + COMPLETED, ROLLED_BACK, FAILED + } + + public String getPnfid() { + return pnfid; + } + + public void setPnfid(String pnfid) { + this.pnfid = pnfid; + } + + public String getPnfdid() { + return pnfdid; + } + + public void setPnfdid(String pnfdid) { + this.pnfdid = pnfdid; + } + + public String getPnfProfileId() { + return pnfProfileId; + } + + public void setPnfProfileId(String pnfProfileId) { + this.pnfProfileId = pnfProfileId; + } + + public String getPnfName() { + return pnfName; + } + + public void setPnfName(String pnfName) { + this.pnfName = pnfName; + } + + public String getCpInstanceId() { + return cpInstanceId; + } + + public void setCpInstanceId(String cpInstanceId) { + this.cpInstanceId = cpInstanceId; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedSap.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedSap.java new file mode 100644 index 0000000000..62f4f92fa9 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedSap.java @@ -0,0 +1,49 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class AffectedSap { + private String sapInstanceId; + private String sapdId; + private String sapName; + + private enum changeType { + ADD, REMOVE, MODIFY + } + private enum changeResult { + COMPLETED, ROLLED_BACK, FAILED + } + + public String getSapInstanceId() { + return sapInstanceId; + } + + public void setSapInstanceId(String sapInstanceId) { + this.sapInstanceId = sapInstanceId; + } + + public String getSapdId() { + return sapdId; + } + + public void setSapdId(String sapdId) { + this.sapdId = sapdId; + } + + public String getSapName() { + return sapName; + } + + public void setSapName(String sapName) { + this.sapName = sapName; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedVirtualLink.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedVirtualLink.java new file mode 100644 index 0000000000..ecaa1c5d3b --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedVirtualLink.java @@ -0,0 +1,49 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class AffectedVirtualLink { + private String nsVirtualLinkInstanceId; + private String nsVirtualLinkDescId; + private String vlProfileId; + + private enum changeType { + ADD, DELETE, MODIFY, ADD_LINK_PORT, REMOVE_LINK_PORT + }; + private enum changeResult { + COMPLETED, ROLLED_BACK, FAILED + } + + public String getNsVirtualLinkInstanceId() { + return nsVirtualLinkInstanceId; + } + + public void setNsVirtualLinkInstanceId(String nsVirtualLinkInstanceId) { + this.nsVirtualLinkInstanceId = nsVirtualLinkInstanceId; + } + + public String getNsVirtualLinkDescId() { + return nsVirtualLinkDescId; + } + + public void setNsVirtualLinkDescId(String nsVirtualLinkDescId) { + this.nsVirtualLinkDescId = nsVirtualLinkDescId; + } + + public String getVlProfileId() { + return vlProfileId; + } + + public void setVlProfileId(String vlProfileId) { + this.vlProfileId = vlProfileId; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedVnf.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedVnf.java new file mode 100644 index 0000000000..6463c7a129 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedVnf.java @@ -0,0 +1,78 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class AffectedVnf { + private String vnfInstanceId; + private String vnfdId; + private String vnfProfileId; + private String vnfName; + + private enum changeType { + ADD, + REMOVE, + INSTANTIATE, + TERMINATE, + SCALE, + CHANGE_FLAVOUR, + HEAL, + OPERATE, + MODIFY_INFORMATION, + CHANGE_EXTERNAL_VNF_CONNECTIVITY + }; + private enum changeResult { + COMPLETED, ROLLED_BACK, FAILED + } + + private ChangedInfo changedInfo; + + + public String getVnfInstanceId() { + return vnfInstanceId; + } + + public void setVnfInstanceId(String vnfInstanceId) { + this.vnfInstanceId = vnfInstanceId; + } + + public String getVnfdId() { + return vnfdId; + } + + public void setVnfdId(String vnfdId) { + this.vnfdId = vnfdId; + } + + public String getVnfProfileId() { + return vnfProfileId; + } + + public void setVnfProfileId(String vnfProfileId) { + this.vnfProfileId = vnfProfileId; + } + + public String getVnfName() { + return vnfName; + } + + public void setVnfName(String vnfName) { + this.vnfName = vnfName; + } + + public ChangedInfo getChangedInfo() { + return changedInfo; + } + + public void setChangedInfo(ChangedInfo changedInfo) { + this.changedInfo = changedInfo; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedVnffg.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedVnffg.java new file mode 100644 index 0000000000..04e9481190 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffectedVnffg.java @@ -0,0 +1,40 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class AffectedVnffg { + private String vnffgInstanceId; + private String vnffgdId; + + private enum changeType { + ADD, REMOVE, MODIFY + } + private enum changeResult { + COMPLETED, ROLLED_BACK, FAILED + } + + public String getVnffgInstanceId() { + return vnffgInstanceId; + } + + public void setVnffgInstanceId(String vnffgInstanceId) { + this.vnffgInstanceId = vnffgInstanceId; + } + + public String getVnffgdId() { + return vnffgdId; + } + + public void setVnffgdId(String vnffgdId) { + this.vnffgdId = vnffgdId; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffinityOrAntiAffinityRule.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffinityOrAntiAffinityRule.java new file mode 100644 index 0000000000..7f019bcf40 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/AffinityOrAntiAffinityRule.java @@ -0,0 +1,51 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import java.util.List; + +public class AffinityOrAntiAffinityRule { + private String vnfdId; + private List<String> vnfProfileId; + private List<String> vnfInstanceId; + + private enum affinityOrAntiAffiinty { + AFFINITY, ANTI_AFFIINTY + }; + private enum scope { + NFVI_POP, ZONE, ZONE_GROUP, NFVI_NODE + }; + + public String getVnfdId() { + return vnfdId; + } + + public void setVnfdId(String vnfdId) { + this.vnfdId = vnfdId; + } + + public List<String> getVnfProfileId() { + return vnfProfileId; + } + + public void setVnfProfileId(List<String> vnfProfileId) { + this.vnfProfileId = vnfProfileId; + } + + public List<String> getVnfInstanceId() { + return vnfInstanceId; + } + + public void setVnfInstanceId(List<String> vnfInstanceId) { + this.vnfInstanceId = vnfInstanceId; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ChangedInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ChangedInfo.java new file mode 100644 index 0000000000..5de6cbf139 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ChangedInfo.java @@ -0,0 +1,33 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class ChangedInfo { + private ModifyVnfInfoData changedVnfInfo; + private ExtVirtualLinkInfo changedExtConnectivity; + + public ModifyVnfInfoData getChangedVnfInfo() { + return changedVnfInfo; + } + + public void setChangedVnfInfo(ModifyVnfInfoData changedVnfInfo) { + this.changedVnfInfo = changedVnfInfo; + } + + public ExtVirtualLinkInfo getChangedExtConnectivity() { + return changedExtConnectivity; + } + + public void setChangedExtConnectivity(ExtVirtualLinkInfo changedExtConnectivity) { + this.changedExtConnectivity = changedExtConnectivity; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/CivicAddressElement.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/CivicAddressElement.java new file mode 100644 index 0000000000..2a63d39be0 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/CivicAddressElement.java @@ -0,0 +1,33 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class CivicAddressElement { + private int caType; + private String caValue; + + public int getCaType() { + return caType; + } + + public void setCaType(int caType) { + this.caType = caType; + } + + public String getCaValue() { + return caValue; + } + + public void setCaValue(String caValue) { + this.caValue = caValue; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/CpProtocolData.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/CpProtocolData.java new file mode 100644 index 0000000000..27272ea22a --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/CpProtocolData.java @@ -0,0 +1,33 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class CpProtocolData { + private String layerProtocol; + private IpOverEthernetAddressData ipOverEthernet; + + public String getLayerProtocol() { + return layerProtocol; + } + + public void setLayerProtocol(String layerProtocol) { + this.layerProtocol = layerProtocol; + } + + public IpOverEthernetAddressData getIpOverEthernet() { + return ipOverEthernet; + } + + public void setIpOverEthernet(IpOverEthernetAddressData ipOverEthernet) { + this.ipOverEthernet = ipOverEthernet; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/CpProtocolInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/CpProtocolInfo.java new file mode 100644 index 0000000000..5f1191efe9 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/CpProtocolInfo.java @@ -0,0 +1,31 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; + +public class CpProtocolInfo { + @NotNull + private enum layerProtocol { + IP_OVER_ETHERNET + }; + + private IpOverEthernetAddressData ipOverEthernet; + + public IpOverEthernetAddressData getIpOverEthernet() { + return ipOverEthernet; + } + + public void setIpOverEthernet(IpOverEthernetAddressData ipOverEthernet) { + this.ipOverEthernet = ipOverEthernet; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/CreateNsRequest.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/CreateNsRequest.java new file mode 100644 index 0000000000..878ce60ba1 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/CreateNsRequest.java @@ -0,0 +1,53 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class CreateNsRequest { + + String nsdId; + + String nsName; + + String nsDescription; + + + public String getNsdId() { + return nsdId; + } + + public void setNsdId(String nsdId) { + this.nsdId = nsdId; + } + + public String getNsDescription() { + return nsDescription; + } + + public void setNsDescription(String nsDescription) { + this.nsDescription = nsDescription; + } + + /** + * @return Returns the nsName. + */ + public String getNsName() { + return nsName; + } + + /** + * @param nsName The nsName to set. + */ + public void setNsName(String nsName) { + this.nsName = nsName; + } + +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ExtCpInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ExtCpInfo.java new file mode 100644 index 0000000000..63ca66bd43 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ExtCpInfo.java @@ -0,0 +1,27 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; +import java.util.List; + +public class ExtCpInfo { + @NotNull + private String id; + @NotNull + private String cpdId; + private List<CpProtocolData> cpProtocolInfo; + private List<String> extLinkPortId; + + + +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ExtLinkPortInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ExtLinkPortInfo.java new file mode 100644 index 0000000000..a1ab3fdb97 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ExtLinkPortInfo.java @@ -0,0 +1,33 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class ExtLinkPortInfo { + private String id; + private ResourceHandle resourceHandle; + + public String getId() { + return id; + } + + public void setId(String id) { + this.id = id; + } + + public ResourceHandle getResourceHandle() { + return resourceHandle; + } + + public void setResourceHandle(ResourceHandle resourceHandle) { + this.resourceHandle = resourceHandle; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ExtManagedVirtualLinkInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ExtManagedVirtualLinkInfo.java new file mode 100644 index 0000000000..3f643a8330 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ExtManagedVirtualLinkInfo.java @@ -0,0 +1,57 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; +import java.util.List; + +public class ExtManagedVirtualLinkInfo { + @NotNull + private String id; + @NotNull + private String vnfVirtualLinkDescId; + @NotNull + private ResourceHandle networkResource; + private List<VnfLinkPortInfo> vnfLinkPorts; + + public String getId() { + return id; + } + + public void setId(String id) { + this.id = id; + } + + public String getVnfVirtualLinkDescId() { + return vnfVirtualLinkDescId; + } + + public void setVnfVirtualLinkDescId(String vnfVirtualLinkDescId) { + this.vnfVirtualLinkDescId = vnfVirtualLinkDescId; + } + + public ResourceHandle getNetworkResource() { + return networkResource; + } + + public void setNetworkResource(ResourceHandle networkResource) { + this.networkResource = networkResource; + } + + public List<VnfLinkPortInfo> getVnfLinkPorts() { + return vnfLinkPorts; + } + + public void setVnfLinkPorts(List<VnfLinkPortInfo> vnfLinkPorts) { + this.vnfLinkPorts = vnfLinkPorts; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ExtVirtualLinkInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ExtVirtualLinkInfo.java new file mode 100644 index 0000000000..ce7d1cfe6d --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ExtVirtualLinkInfo.java @@ -0,0 +1,42 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class ExtVirtualLinkInfo { + private String id; + private ResourceHandle resourceHandle; + private ExtLinkPortInfo extLinkPorts; + + public String getId() { + return id; + } + + public void setId(String id) { + this.id = id; + } + + public ResourceHandle getResourceHandle() { + return resourceHandle; + } + + public void setResourceHandle(ResourceHandle resourceHandle) { + this.resourceHandle = resourceHandle; + } + + public ExtLinkPortInfo getExtLinkPorts() { + return extLinkPorts; + } + + public void setExtLinkPorts(ExtLinkPortInfo extLinkPorts) { + this.extLinkPorts = extLinkPorts; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/InstantiateNsRequest.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/InstantiateNsRequest.java new file mode 100644 index 0000000000..ff0730a527 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/InstantiateNsRequest.java @@ -0,0 +1,207 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import java.util.List; +import java.util.Map; + +public class InstantiateNsRequest { + + private String nsFlavourId; + private List<SapData> sapData; + private List<AddPnfData> addpnfData; + private List<VnfInstanceData> vnfInstanceData; + private List<String> nestedNsInstanceId; + private List<VnfLocationConstraint> localizationLanguage; + private Map<String, Object> aditionalParamsForNs; + private List<ParamsForVnf> additionalParamsForVnf; + private String startTime; + private String nsInstantiationLevelId; + private List<AffinityOrAntiAffinityRule> additionalAffinityOrAntiAffiniityRule; + + /*** + * + * @return nsFlavourId + */ + public String getNsFlavourId() { + return nsFlavourId; + } + + /*** + * + * @param nsFlavourId + */ + public void setNsFlavourId(String nsFlavourId) { + this.nsFlavourId = nsFlavourId; + } + + /*** + * + * @return + */ + public List<SapData> getSapData() { + return sapData; + } + + /*** + * + * @param sapData + */ + public void setSapData(List<SapData> sapData) { + this.sapData = sapData; + } + + /*** + * + * @return + */ + public List<AddPnfData> getAddpnfData() { + return addpnfData; + } + + /*** + * + * @param addpnfData + */ + public void setAddpnfData(List<AddPnfData> addpnfData) { + this.addpnfData = addpnfData; + } + + /*** + * + * @return + */ + public List<VnfInstanceData> getVnfInstanceData() { + return vnfInstanceData; + } + + /*** + * + * @param vnfInstanceData + */ + public void setVnfInstanceData(List<VnfInstanceData> vnfInstanceData) { + this.vnfInstanceData = vnfInstanceData; + } + + /*** + * + * @return + */ + public List<String> getNestedNsInstanceId() { + return nestedNsInstanceId; + } + + /*** + * + * @param nestedNsInstanceId + */ + public void setNestedNsInstanceId(List<String> nestedNsInstanceId) { + this.nestedNsInstanceId = nestedNsInstanceId; + } + + /*** + * + * @return + */ + public List<VnfLocationConstraint> getLocalizationLanguage() { + return localizationLanguage; + } + + /*** + * + * @param localizationLanguage + */ + public void setLocalizationLanguage(List<VnfLocationConstraint> localizationLanguage) { + this.localizationLanguage = localizationLanguage; + } + + /*** + * + * @return + */ + public Map<String, Object> getAditionalParamsForNs() { + return aditionalParamsForNs; + } + + /*** + * + * @param aditionalParamsForNs + */ + public void setAditionalParamsForNs(Map<String, Object> aditionalParamsForNs) { + this.aditionalParamsForNs = aditionalParamsForNs; + } + + /*** + * + * @return + */ + public List<ParamsForVnf> getAdditionalParamsForVnf() { + return additionalParamsForVnf; + } + + /*** + * + * @param additionalParamsForVnf + */ + public void setAdditionalParamsForVnf(List<ParamsForVnf> additionalParamsForVnf) { + this.additionalParamsForVnf = additionalParamsForVnf; + } + + /*** + * + * @return + */ + public String getStartTime() { + return startTime; + } + + /*** + * + * @param startTime + */ + public void setStartTime(String startTime) { + this.startTime = startTime; + } + + /*** + * + * @return + */ + public String getNsInstantiationLevelId() { + return nsInstantiationLevelId; + } + + /*** + * + * @param nsInstantiationLevelId + */ + public void setNsInstantiationLevelId(String nsInstantiationLevelId) { + this.nsInstantiationLevelId = nsInstantiationLevelId; + } + + /*** + * + * @return + */ + public List<AffinityOrAntiAffinityRule> getAdditionalAffinityOrAntiAffiniityRule() { + return additionalAffinityOrAntiAffiniityRule; + } + + /*** + * + * @param additionalAffinityOrAntiAffiniityRule + */ + public void setAdditionalAffinityOrAntiAffiniityRule( + List<AffinityOrAntiAffinityRule> additionalAffinityOrAntiAffiniityRule) { + this.additionalAffinityOrAntiAffiniityRule = additionalAffinityOrAntiAffiniityRule; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/InstantiatedVnfInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/InstantiatedVnfInfo.java new file mode 100644 index 0000000000..83a8a56756 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/InstantiatedVnfInfo.java @@ -0,0 +1,117 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; +import java.util.List; +import java.util.Map; + +public class InstantiatedVnfInfo { + @NotNull + private String flavourId; + @NotNull + private String vnfState; + private List<VnfScaleInfo> vnfScaleInfos; + @NotNull + private List<ExtCpInfo> extCpInfo; + private List<ExtVirtualLinkInfo> extVirtualLinkInfo; + private List<ExtManagedVirtualLinkInfo> extManagedVirtualLinkInfo; + // Defination of MonitoringParameter is not there in ETSI document + // considering as String + private List<String> monitoringParameters; + private String localizationLanguage; + + private List<VnfcResourceInfo> vnfcResourceInfo; + // Defination of VirtualStorageResourceInfo is not there in ETSI document + // considering as String + private List<String> virtualStorageResourceInfo; + + public String getFlavourId() { + return flavourId; + } + + public void setFlavourId(String flavourId) { + this.flavourId = flavourId; + } + + public String getVnfState() { + return vnfState; + } + + public void setVnfState(String vnfState) { + this.vnfState = vnfState; + } + + public List<VnfScaleInfo> getVnfScaleInfos() { + return vnfScaleInfos; + } + + public void setVnfScaleInfos(List<VnfScaleInfo> vnfScaleInfos) { + this.vnfScaleInfos = vnfScaleInfos; + } + + public List<ExtCpInfo> getExtCpInfo() { + return extCpInfo; + } + + public void setExtCpInfo(List<ExtCpInfo> extCpInfo) { + this.extCpInfo = extCpInfo; + } + + public List<ExtVirtualLinkInfo> getExtVirtualLinkInfo() { + return extVirtualLinkInfo; + } + + public void setExtVirtualLinkInfo(List<ExtVirtualLinkInfo> extVirtualLinkInfo) { + this.extVirtualLinkInfo = extVirtualLinkInfo; + } + + public List<ExtManagedVirtualLinkInfo> getExtManagedVirtualLinkInfo() { + return extManagedVirtualLinkInfo; + } + + public void setExtManagedVirtualLinkInfo(List<ExtManagedVirtualLinkInfo> extManagedVirtualLinkInfo) { + this.extManagedVirtualLinkInfo = extManagedVirtualLinkInfo; + } + + public List<String> getMonitoringParameters() { + return monitoringParameters; + } + + public void setMonitoringParameters(List<String> monitoringParameters) { + this.monitoringParameters = monitoringParameters; + } + + public String getLocalizationLanguage() { + return localizationLanguage; + } + + public void setLocalizationLanguage(String localizationLanguage) { + this.localizationLanguage = localizationLanguage; + } + + public List<VnfcResourceInfo> getVnfcResourceInfo() { + return vnfcResourceInfo; + } + + public void setVnfcResourceInfo(List<VnfcResourceInfo> vnfcResourceInfo) { + this.vnfcResourceInfo = vnfcResourceInfo; + } + + public List<String> getVirtualStorageResourceInfo() { + return virtualStorageResourceInfo; + } + + public void setVirtualStorageResourceInfo(List<String> virtualStorageResourceInfo) { + this.virtualStorageResourceInfo = virtualStorageResourceInfo; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/IpAddresses.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/IpAddresses.java new file mode 100644 index 0000000000..32c5571d96 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/IpAddresses.java @@ -0,0 +1,63 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import java.util.List; + +public class IpAddresses { + private String type; + private List<String> fixedAddresses; + private int numDynamicAddresses; + private AddressRange addressRange; + private String subnetId; + + + public String getType() { + return type; + } + + public void setType(String type) { + this.type = type; + } + + public List<String> getFixedAddresses() { + return fixedAddresses; + } + + public void setFixedAddresses(List<String> fixedAddresses) { + this.fixedAddresses = fixedAddresses; + } + + public int getNumDynamicAddresses() { + return numDynamicAddresses; + } + + public void setNumDynamicAddresses(int numDynamicAddresses) { + this.numDynamicAddresses = numDynamicAddresses; + } + + public AddressRange getAddressRange() { + return addressRange; + } + + public void setAddressRange(AddressRange addressRange) { + this.addressRange = addressRange; + } + + public String getSubnetId() { + return subnetId; + } + + public void setSubnetId(String subnetId) { + this.subnetId = subnetId; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/IpOverEthernetAddressData.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/IpOverEthernetAddressData.java new file mode 100644 index 0000000000..48529e5f76 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/IpOverEthernetAddressData.java @@ -0,0 +1,35 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import java.util.List; + +public class IpOverEthernetAddressData { + private String macAddress; + private List<IpAddresses> ipAddresses; + + public String getMacAddress() { + return macAddress; + } + + public void setMacAddress(String macAddress) { + this.macAddress = macAddress; + } + + public List<IpAddresses> getIpAddresses() { + return ipAddresses; + } + + public void setIpAddresses(List<IpAddresses> ipAddresses) { + this.ipAddresses = ipAddresses; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/Link.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/Link.java new file mode 100644 index 0000000000..2459346826 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/Link.java @@ -0,0 +1,24 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class Link { + private String href; + + public String getHref() { + return href; + } + + public void setHref(String href) { + this.href = href; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/Links.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/Links.java new file mode 100644 index 0000000000..8ad8f000c1 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/Links.java @@ -0,0 +1,78 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class Links { + private Link self; + private Link nsInstance; + private Link cancel; + private Link retry; + private Link rollback; + private Link continues; + private Link fail; + + public Link getSelf() { + return self; + } + + public void setSelf(Link self) { + this.self = self; + } + + public Link getNsInstance() { + return nsInstance; + } + + public void setNsInstance(Link nsInstance) { + this.nsInstance = nsInstance; + } + + public Link getCancel() { + return cancel; + } + + public void setCancel(Link cancel) { + this.cancel = cancel; + } + + public Link getRetry() { + return retry; + } + + public void setRetry(Link retry) { + this.retry = retry; + } + + public Link getRollback() { + return rollback; + } + + public void setRollback(Link rollback) { + this.rollback = rollback; + } + + public Link getContinues() { + return continues; + } + + public void setContinues(Link continues) { + this.continues = continues; + } + + public Link getFail() { + return fail; + } + + public void setFail(Link fail) { + this.fail = fail; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/LocationConstraints.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/LocationConstraints.java new file mode 100644 index 0000000000..b636d49edf --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/LocationConstraints.java @@ -0,0 +1,33 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class LocationConstraints { + private String countryCode; + private CivicAddressElement civicAddressElement; + + public String getCountryCode() { + return countryCode; + } + + public void setCountryCode(String countryCode) { + this.countryCode = countryCode; + } + + public CivicAddressElement getCivicAddressElement() { + return civicAddressElement; + } + + public void setCivicAddressElement(CivicAddressElement civicAddressElement) { + this.civicAddressElement = civicAddressElement; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/Mask.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/Mask.java new file mode 100644 index 0000000000..352f47e19f --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/Mask.java @@ -0,0 +1,47 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; + +public class Mask { + @NotNull + private int startingPoint; + @NotNull + private int length; + @NotNull + private String value; + + public int getStartingPoint() { + return startingPoint; + } + + public void setStartingPoint(int startingPoint) { + this.startingPoint = startingPoint; + } + + public int getLength() { + return length; + } + + public void setLength(int length) { + this.length = length; + } + + public String getValue() { + return value; + } + + public void setValue(String value) { + this.value = value; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ModifyVnfInfoData.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ModifyVnfInfoData.java new file mode 100644 index 0000000000..55ab21e8e2 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ModifyVnfInfoData.java @@ -0,0 +1,80 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import java.util.Map; + +public class ModifyVnfInfoData { + private String vnfInstanceId; + private String vnfInstanceName; + private String vnfInstanceDescription; + private String vnfPkgId; + private Map<String, Object> vnfConfigurableProperties; + private Map<String, Object> Metadata; + private Map<String, Object> Extensions; + + public String getVnfInstanceId() { + return vnfInstanceId; + } + + public void setVnfInstanceId(String vnfInstanceId) { + this.vnfInstanceId = vnfInstanceId; + } + + public String getVnfInstanceName() { + return vnfInstanceName; + } + + public void setVnfInstanceName(String vnfInstanceName) { + this.vnfInstanceName = vnfInstanceName; + } + + public String getVnfInstanceDescription() { + return vnfInstanceDescription; + } + + public void setVnfInstanceDescription(String vnfInstanceDescription) { + this.vnfInstanceDescription = vnfInstanceDescription; + } + + public String getVnfPkgId() { + return vnfPkgId; + } + + public void setVnfPkgId(String vnfPkgId) { + this.vnfPkgId = vnfPkgId; + } + + public Map<String, Object> getVnfConfigurableProperties() { + return vnfConfigurableProperties; + } + + public void setVnfConfigurableProperties(Map<String, Object> vnfConfigurableProperties) { + this.vnfConfigurableProperties = vnfConfigurableProperties; + } + + public Map<String, Object> getMetadata() { + return Metadata; + } + + public void setMetadata(Map<String, Object> metadata) { + Metadata = metadata; + } + + public Map<String, Object> getExtensions() { + return Extensions; + } + + public void setExtensions(Map<String, Object> extensions) { + Extensions = extensions; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NfpInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NfpInfo.java new file mode 100644 index 0000000000..a6e3963725 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NfpInfo.java @@ -0,0 +1,89 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; +import java.util.List; + +public class NfpInfo { + @NotNull + private String id; + private String nfpdId; + private String nfpName; + private String description; + @NotNull + private List<NsCpHandle> nscpHandle; + private int totalCp; + @NotNull + private NfpRule nfpRule; + + @NotNull + private enum nfpState { + ENABLED, DISABLED + }; + + public String getId() { + return id; + } + + public void setId(String id) { + this.id = id; + } + + public String getNfpdId() { + return nfpdId; + } + + public void setNfpdId(String nfpdId) { + this.nfpdId = nfpdId; + } + + public String getNfpName() { + return nfpName; + } + + public void setNfpName(String nfpName) { + this.nfpName = nfpName; + } + + public String getDescription() { + return description; + } + + public void setDescription(String description) { + this.description = description; + } + + public List<NsCpHandle> getNscpHandle() { + return nscpHandle; + } + + public void setNscpHandle(List<NsCpHandle> nscpHandle) { + this.nscpHandle = nscpHandle; + } + + public int getTotalCp() { + return totalCp; + } + + public void setTotalCp(int totalCp) { + this.totalCp = totalCp; + } + + public NfpRule getNfpRule() { + return nfpRule; + } + + public void setNfpRule(NfpRule nfpRule) { + this.nfpRule = nfpRule; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NfpRule.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NfpRule.java new file mode 100644 index 0000000000..b4f684a3e2 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NfpRule.java @@ -0,0 +1,108 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import java.util.List; + +public class NfpRule { + private String etherDestinationAddress; + private String etherSourceAddress; + + private enum etherType { + IPV4, IPV6 + }; + + private List<String> vlanTag; + + private enum protocol { + TCP, UDP, ICMP + } + + private String dscp; + private PortRange sourcePortRange; + private PortRange destinationPortRange; + private String sourceIpAddressPrefix; + private String destinationIpAddressPrefix; + private List<Mask> extendedCriteria; + + public String getEtherDestinationAddress() { + return etherDestinationAddress; + } + + public void setEtherDestinationAddress(String etherDestinationAddress) { + this.etherDestinationAddress = etherDestinationAddress; + } + + public String getEtherSourceAddress() { + return etherSourceAddress; + } + + public void setEtherSourceAddress(String etherSourceAddress) { + this.etherSourceAddress = etherSourceAddress; + } + + public List<String> getVlanTag() { + return vlanTag; + } + + public void setVlanTag(List<String> vlanTag) { + this.vlanTag = vlanTag; + } + + public String getDscp() { + return dscp; + } + + public void setDscp(String dscp) { + this.dscp = dscp; + } + + public PortRange getSourcePortRange() { + return sourcePortRange; + } + + public void setSourcePortRange(PortRange sourcePortRange) { + this.sourcePortRange = sourcePortRange; + } + + public PortRange getDestinationPortRange() { + return destinationPortRange; + } + + public void setDestinationPortRange(PortRange destinationPortRange) { + this.destinationPortRange = destinationPortRange; + } + + public String getSourceIpAddressPrefix() { + return sourceIpAddressPrefix; + } + + public void setSourceIpAddressPrefix(String sourceIpAddressPrefix) { + this.sourceIpAddressPrefix = sourceIpAddressPrefix; + } + + public String getDestinationIpAddressPrefix() { + return destinationIpAddressPrefix; + } + + public void setDestinationIpAddressPrefix(String destinationIpAddressPrefix) { + this.destinationIpAddressPrefix = destinationIpAddressPrefix; + } + + public List<Mask> getExtendedCriteria() { + return extendedCriteria; + } + + public void setExtendedCriteria(List<Mask> extendedCriteria) { + this.extendedCriteria = extendedCriteria; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsCpHandle.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsCpHandle.java new file mode 100644 index 0000000000..326488fb76 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsCpHandle.java @@ -0,0 +1,69 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class NsCpHandle { + private String vnfInstanceId; + private String vnfExtCpInstanceId; + private String pnfInfoId; + private String pnfExtCpInstanceId; + private String nsInstanceId; + private String nsSapInstanceId; + + public String getVnfInstanceId() { + return vnfInstanceId; + } + + public void setVnfInstanceId(String vnfInstanceId) { + this.vnfInstanceId = vnfInstanceId; + } + + public String getVnfExtCpInstanceId() { + return vnfExtCpInstanceId; + } + + public void setVnfExtCpInstanceId(String vnfExtCpInstanceId) { + this.vnfExtCpInstanceId = vnfExtCpInstanceId; + } + + public String getPnfInfoId() { + return pnfInfoId; + } + + public void setPnfInfoId(String pnfInfoId) { + this.pnfInfoId = pnfInfoId; + } + + public String getPnfExtCpInstanceId() { + return pnfExtCpInstanceId; + } + + public void setPnfExtCpInstanceId(String pnfExtCpInstanceId) { + this.pnfExtCpInstanceId = pnfExtCpInstanceId; + } + + public String getNsInstanceId() { + return nsInstanceId; + } + + public void setNsInstanceId(String nsInstanceId) { + this.nsInstanceId = nsInstanceId; + } + + public String getNsSapInstanceId() { + return nsSapInstanceId; + } + + public void setNsSapInstanceId(String nsSapInstanceId) { + this.nsSapInstanceId = nsSapInstanceId; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsInstance.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsInstance.java new file mode 100644 index 0000000000..d2d4b4e772 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsInstance.java @@ -0,0 +1,166 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; +import java.util.List; + +public class NsInstance { + @NotNull + private String id; + @NotNull + private String nsInstanceName; + @NotNull + private String nsInstanceDescription; + @NotNull + private String nsdId; + @NotNull + private String nsdInfoId; + private String flavourId; + private List<VnfInstance> vnfInstance; + private List<PnfInfo> pnfInfo; + private List<NsVirtualLinkInfo> virtualLinkInfo; + private List<VnffgInfo> vnffgInfo; + private List<SapInfo> sapInfo; + private List<String> nestedNsInstanceId; + + @NotNull + private enum nsState { + NOT_INSTANTIATED, INSTANTIATED + }; + + private List<NsScaleInfo> nsScaleStatus; + private List<AffinityOrAntiAffinityRule> additionalAffinityOrAntiAffinityRule; + @NotNull + private NsInstanceLinks _links; + + public String getId() { + return id; + } + + public void setId(String id) { + this.id = id; + } + + public String getNsInstanceName() { + return nsInstanceName; + } + + public void setNsInstanceName(String nsInstanceName) { + this.nsInstanceName = nsInstanceName; + } + + public String getNsInstanceDescription() { + return nsInstanceDescription; + } + + public void setNsInstanceDescription(String nsInstanceDescription) { + this.nsInstanceDescription = nsInstanceDescription; + } + + public String getNsdId() { + return nsdId; + } + + public void setNsdId(String nsdId) { + this.nsdId = nsdId; + } + + public String getNsdInfoId() { + return nsdInfoId; + } + + public void setNsdInfoId(String nsdInfoId) { + this.nsdInfoId = nsdInfoId; + } + + public String getFlavourId() { + return flavourId; + } + + public void setFlavourId(String flavourId) { + this.flavourId = flavourId; + } + + public List<VnfInstance> getVnfInstance() { + return vnfInstance; + } + + public void setVnfInstance(List<VnfInstance> vnfInstance) { + this.vnfInstance = vnfInstance; + } + + public List<PnfInfo> getPnfInfo() { + return pnfInfo; + } + + public void setPnfInfo(List<PnfInfo> pnfInfo) { + this.pnfInfo = pnfInfo; + } + + public List<NsVirtualLinkInfo> getVirtualLinkInfo() { + return virtualLinkInfo; + } + + public void setVirtualLinkInfo(List<NsVirtualLinkInfo> virtualLinkInfo) { + this.virtualLinkInfo = virtualLinkInfo; + } + + public List<VnffgInfo> getVnffgInfo() { + return vnffgInfo; + } + + public void setVnffgInfo(List<VnffgInfo> vnffgInfo) { + this.vnffgInfo = vnffgInfo; + } + + public List<SapInfo> getSapInfo() { + return sapInfo; + } + + public void setSapInfo(List<SapInfo> sapInfo) { + this.sapInfo = sapInfo; + } + + public List<String> getNestedNsInstanceId() { + return nestedNsInstanceId; + } + + public void setNestedNsInstanceId(List<String> nestedNsInstanceId) { + this.nestedNsInstanceId = nestedNsInstanceId; + } + + public List<NsScaleInfo> getNsScaleStatus() { + return nsScaleStatus; + } + + public void setNsScaleStatus(List<NsScaleInfo> nsScaleStatus) { + this.nsScaleStatus = nsScaleStatus; + } + + public List<AffinityOrAntiAffinityRule> getAdditionalAffinityOrAntiAffinityRule() { + return additionalAffinityOrAntiAffinityRule; + } + + public void setAdditionalAffinityOrAntiAffinityRule( + List<AffinityOrAntiAffinityRule> additionalAffinityOrAntiAffinityRule) { + this.additionalAffinityOrAntiAffinityRule = additionalAffinityOrAntiAffinityRule; + } + + public NsInstanceLinks get_links() { + return _links; + } + + public void set_links(NsInstanceLinks _links) { + this._links = _links; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsInstanceLinks.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsInstanceLinks.java new file mode 100644 index 0000000000..08b3c63c08 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsInstanceLinks.java @@ -0,0 +1,82 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; +import java.util.List; + +public class NsInstanceLinks { + @NotNull + private Link self; + private List<Link> nestedNsInstances; + private Link instantiate; + private Link terminate; + private Link update; + private Link scale; + private Link heal; + + public Link getSelf() { + return self; + } + + public void setSelf(Link self) { + this.self = self; + } + + public List<Link> getNestedNsInstances() { + return nestedNsInstances; + } + + public void setNestedNsInstances(List<Link> nestedNsInstances) { + this.nestedNsInstances = nestedNsInstances; + } + + public Link getInstantiate() { + return instantiate; + } + + public void setInstantiate(Link instantiate) { + this.instantiate = instantiate; + } + + public Link getTerminate() { + return terminate; + } + + public void setTerminate(Link terminate) { + this.terminate = terminate; + } + + public Link getUpdate() { + return update; + } + + public void setUpdate(Link update) { + this.update = update; + } + + public Link getScale() { + return scale; + } + + public void setScale(Link scale) { + this.scale = scale; + } + + public Link getHeal() { + return heal; + } + + public void setHeal(Link heal) { + this.heal = heal; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsLcmOpOcc.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsLcmOpOcc.java new file mode 100644 index 0000000000..559b1f7ba7 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsLcmOpOcc.java @@ -0,0 +1,125 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.onap.so.adapters.vfc.constant.CommonConstant; + +public class NsLcmOpOcc { + private String id; + private CommonConstant.operationState operationState; + private String statusEnteredTime; + private String nsInstanceId; + private CommonConstant.lcmOperationType lcmOperationType; + private String startTime; + private Boolean isAutomaticInvocation; + private String operationParams; + private Boolean isCancelPending; + private CommonConstant.cancelMode cancelMode; + private ProblemDetails error; + private Links links; + + public CommonConstant.lcmOperationType getLcmOperationType() { + return lcmOperationType; + } + + public void setLcmOperationType(CommonConstant.lcmOperationType lcmOperationType) { + this.lcmOperationType = lcmOperationType; + } + + public CommonConstant.cancelMode getCancelMode() { + return cancelMode; + } + + public void setCancelMode(CommonConstant.cancelMode cancelMode) { + this.cancelMode = cancelMode; + } + + public CommonConstant.operationState getOperationState() { + return operationState; + } + + public void setOperationState(CommonConstant.operationState operationState) { + this.operationState = operationState; + } + + public String getId() { + return id; + } + + public void setId(String id) { + this.id = id; + } + + public String getStatusEnteredTime() { + return statusEnteredTime; + } + + public void setStatusEnteredTime(String statusEnteredTime) { + this.statusEnteredTime = statusEnteredTime; + } + + public String getNsInstanceId() { + return nsInstanceId; + } + + public void setNsInstanceId(String nsInstanceId) { + this.nsInstanceId = nsInstanceId; + } + + public String getStartTime() { + return startTime; + } + + public void setStartTime(String startTime) { + this.startTime = startTime; + } + + public Boolean getAutomaticInvocation() { + return isAutomaticInvocation; + } + + public void setAutomaticInvocation(Boolean automaticInvocation) { + isAutomaticInvocation = automaticInvocation; + } + + public String getOperationParams() { + return operationParams; + } + + public void setOperationParams(String operationParams) { + this.operationParams = operationParams; + } + + public Boolean getCancelPending() { + return isCancelPending; + } + + public void setCancelPending(Boolean cancelPending) { + isCancelPending = cancelPending; + } + + public ProblemDetails getError() { + return error; + } + + public void setError(ProblemDetails error) { + this.error = error; + } + + public Links getLinks() { + return links; + } + + public void setLinks(Links links) { + this.links = links; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsLinkPortInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsLinkPortInfo.java new file mode 100644 index 0000000000..20c8972c98 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsLinkPortInfo.java @@ -0,0 +1,47 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; +import java.util.List; + +public class NsLinkPortInfo { + @NotNull + private String id; + @NotNull + private ResourceHandle resourceHandle; + private NsCpHandle nsCpHandle; + + public String getId() { + return id; + } + + public void setId(String id) { + this.id = id; + } + + public ResourceHandle getResourceHandle() { + return resourceHandle; + } + + public void setResourceHandle(ResourceHandle resourceHandle) { + this.resourceHandle = resourceHandle; + } + + public NsCpHandle getNsCpHandle() { + return nsCpHandle; + } + + public void setNsCpHandle(NsCpHandle nsCpHandle) { + this.nsCpHandle = nsCpHandle; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsScaleInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsScaleInfo.java new file mode 100644 index 0000000000..59acf564c2 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsScaleInfo.java @@ -0,0 +1,37 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; + +public class NsScaleInfo { + @NotNull + private String nsScalingAspectId; + @NotNull + private String nsScaleLevelId; + + public String getNsScalingAspectId() { + return nsScalingAspectId; + } + + public void setNsScalingAspectId(String nsScalingAspectId) { + this.nsScalingAspectId = nsScalingAspectId; + } + + public String getNsScaleLevelId() { + return nsScaleLevelId; + } + + public void setNsScaleLevelId(String nsScaleLevelId) { + this.nsScaleLevelId = nsScaleLevelId; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsVirtualLinkInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsVirtualLinkInfo.java new file mode 100644 index 0000000000..ed2debd2e6 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/NsVirtualLinkInfo.java @@ -0,0 +1,57 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; +import java.util.List; + +public class NsVirtualLinkInfo { + @NotNull + private String id; + @NotNull + private String nsVirtualLinkDescId; + @NotNull + private List<ResourceHandle> resourceHandle; + private List<NsLinkPortInfo> linkPort; + + public String getId() { + return id; + } + + public void setId(String id) { + this.id = id; + } + + public String getNsVirtualLinkDescId() { + return nsVirtualLinkDescId; + } + + public void setNsVirtualLinkDescId(String nsVirtualLinkDescId) { + this.nsVirtualLinkDescId = nsVirtualLinkDescId; + } + + public List<ResourceHandle> getResourceHandle() { + return resourceHandle; + } + + public void setResourceHandle(List<ResourceHandle> resourceHandle) { + this.resourceHandle = resourceHandle; + } + + public List<NsLinkPortInfo> getLinkPort() { + return linkPort; + } + + public void setLinkPort(List<NsLinkPortInfo> linkPort) { + this.linkPort = linkPort; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ParamsForVnf.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ParamsForVnf.java new file mode 100644 index 0000000000..b7324e50fe --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ParamsForVnf.java @@ -0,0 +1,35 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import java.util.Map; + +public class ParamsForVnf { + private String vnfProfileId; + private Map<String, Object> additionalParams; + + public String getVnfProfileId() { + return vnfProfileId; + } + + public void setVnfProfileId(String vnfProfileId) { + this.vnfProfileId = vnfProfileId; + } + + public Map<String, Object> getAdditionalParams() { + return additionalParams; + } + + public void setAdditionalParams(Map<String, Object> additionalParams) { + this.additionalParams = additionalParams; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/PnfExtCpData.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/PnfExtCpData.java new file mode 100644 index 0000000000..d5d091fcb1 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/PnfExtCpData.java @@ -0,0 +1,44 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import java.util.List; + +public class PnfExtCpData { + private String cpInstanceI16; + private String cpdId; + private List<CpProtocolData> cpProtocolData; + + public String getCpInstanceI16() { + return cpInstanceI16; + } + + public void setCpInstanceI16(String cpInstanceI16) { + this.cpInstanceI16 = cpInstanceI16; + } + + public String getCpdId() { + return cpdId; + } + + public void setCpdId(String cpdId) { + this.cpdId = cpdId; + } + + public List<CpProtocolData> getCpProtocolData() { + return cpProtocolData; + } + + public void setCpProtocolData(List<CpProtocolData> cpProtocolData) { + this.cpProtocolData = cpProtocolData; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/PnfExtCpInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/PnfExtCpInfo.java new file mode 100644 index 0000000000..402cb83147 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/PnfExtCpInfo.java @@ -0,0 +1,48 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; +import java.util.List; + +public class PnfExtCpInfo { + @NotNull + private String cpInstanceId; + @NotNull + private String cpdId; + @NotNull + private List<CpProtocolData> cpProtocolData; + + public String getCpInstanceI16() { + return cpInstanceId; + } + + public void setCpInstanceI16(String cpInstanceI16) { + this.cpInstanceId = cpInstanceI16; + } + + public String getCpdId() { + return cpdId; + } + + public void setCpdId(String cpdId) { + this.cpdId = cpdId; + } + + public List<CpProtocolData> getCpProtocolData() { + return cpProtocolData; + } + + public void setCpProtocolData(List<CpProtocolData> cpProtocolData) { + this.cpProtocolData = cpProtocolData; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/PnfInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/PnfInfo.java new file mode 100644 index 0000000000..a1cc11bd0c --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/PnfInfo.java @@ -0,0 +1,74 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; +import java.util.List; + +public class PnfInfo { + + @NotNull + private String pnfId; + @NotNull + private String pnfName; + @NotNull + private String pnfdId; + @NotNull + private String pnfdInfoId; + @NotNull + private String pnfProfileId; + private List<PnfExtCpData> cpData; + + /*** + * + * @return id of pnf + */ + public String getPnfId() { + return pnfId; + } + + public void setPnfId(String pnfId) { + this.pnfId = pnfId; + } + + public String getPnfName() { + return pnfName; + } + + public void setPnfName(String pnfName) { + this.pnfName = pnfName; + } + + public String getPnfdId() { + return pnfdId; + } + + public void setPnfdId(String pnfdId) { + this.pnfdId = pnfdId; + } + + public String getPnfProfileId() { + return pnfProfileId; + } + + public void setPnfProfileId(String pnfProfileId) { + this.pnfProfileId = pnfProfileId; + } + + public List<PnfExtCpData> getCpData() { + return cpData; + } + + public void setCpData(List<PnfExtCpData> cpData) { + this.cpData = cpData; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/PortRange.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/PortRange.java new file mode 100644 index 0000000000..8318a8ccff --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/PortRange.java @@ -0,0 +1,37 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; + +public class PortRange { + @NotNull + private int lowerPort; + @NotNull + private int upperPort; + + public int getLowerPort() { + return lowerPort; + } + + public void setLowerPort(int lowerPort) { + this.lowerPort = lowerPort; + } + + public int getUpperPort() { + return upperPort; + } + + public void setUpperPort(int upperPort) { + this.upperPort = upperPort; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ProblemDetails.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ProblemDetails.java new file mode 100644 index 0000000000..efaa5de7a8 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ProblemDetails.java @@ -0,0 +1,62 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class ProblemDetails { + private String type; + private String title; + private int status; + private String detail; + private String instance; + + public String getType() { + return type; + } + + public void setType(String type) { + this.type = type; + } + + public String getTitle() { + return title; + } + + public void setTitle(String title) { + this.title = title; + } + + public int getStatus() { + return status; + } + + public void setStatus(int status) { + this.status = status; + } + + public String getDetail() { + return detail; + } + + public void setDetail(String detail) { + this.detail = detail; + } + + public String getInstance() { + return instance; + } + + public void setInstance(String instance) { + this.instance = instance; + } + + +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ResourceChanges.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ResourceChanges.java new file mode 100644 index 0000000000..062a6aa32a --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ResourceChanges.java @@ -0,0 +1,71 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import java.util.List; + +public class ResourceChanges { + private List<AffectedVnf> affectedVnfs; + private List<AffectedPnf> affectedPnfs; + private List<AffectedVirtualLink> affectedVls; + private List<AffectedVnffg> affectedVnffgs; + private List<AffectedNs> affectedNss; + private List<AffectedSap> affectedSaps; + + public List<AffectedVnf> getAffectedVnfs() { + return affectedVnfs; + } + + public void setAffectedVnfs(List<AffectedVnf> affectedVnfs) { + this.affectedVnfs = affectedVnfs; + } + + public List<AffectedPnf> getAffectedPnfs() { + return affectedPnfs; + } + + public void setAffectedPnfs(List<AffectedPnf> affectedPnfs) { + this.affectedPnfs = affectedPnfs; + } + + public List<AffectedVirtualLink> getAffectedVls() { + return affectedVls; + } + + public void setAffectedVls(List<AffectedVirtualLink> affectedVls) { + this.affectedVls = affectedVls; + } + + public List<AffectedVnffg> getAffectedVnffgs() { + return affectedVnffgs; + } + + public void setAffectedVnffgs(List<AffectedVnffg> affectedVnffgs) { + this.affectedVnffgs = affectedVnffgs; + } + + public List<AffectedNs> getAffectedNss() { + return affectedNss; + } + + public void setAffectedNss(List<AffectedNs> affectedNss) { + this.affectedNss = affectedNss; + } + + public List<AffectedSap> getAffectedSaps() { + return affectedSaps; + } + + public void setAffectedSaps(List<AffectedSap> affectedSaps) { + this.affectedSaps = affectedSaps; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ResourceHandle.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ResourceHandle.java new file mode 100644 index 0000000000..fbfecaa007 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/ResourceHandle.java @@ -0,0 +1,51 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class ResourceHandle { + private String vimId; + private String resourceProviderId; + private String resourceId; + private String vimLevelResourceType; + + public String getVimId() { + return vimId; + } + + public void setVimId(String vimId) { + this.vimId = vimId; + } + + public String getResourceProviderId() { + return resourceProviderId; + } + + public void setResourceProviderId(String resourceProviderId) { + this.resourceProviderId = resourceProviderId; + } + + public String getResourceId() { + return resourceId; + } + + public void setResourceId(String resourceId) { + this.resourceId = resourceId; + } + + public String getVimLevelResourceType() { + return vimLevelResourceType; + } + + public void setVimLevelResourceType(String vimLevelResourceType) { + this.vimLevelResourceType = vimLevelResourceType; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/SapData.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/SapData.java new file mode 100644 index 0000000000..d8e96e22f5 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/SapData.java @@ -0,0 +1,56 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import java.util.List; + +public class SapData { + private String sapdId; + private String sapName; + private String description; + private List<CpProtocolData> sapProtocolData; + + public String getSapdId() { + return sapdId; + } + + public void setSapdId(String sapdId) { + this.sapdId = sapdId; + } + + public String getSapName() { + return sapName; + } + + public void setSapName(String sapName) { + this.sapName = sapName; + } + + public String getDescription() { + return description; + } + + public void setDescription(String description) { + this.description = description; + } + + public List<CpProtocolData> getSapProtocolData() { + return sapProtocolData; + } + + public void setSapProtocolData(List<CpProtocolData> sapProtocolData) { + this.sapProtocolData = sapProtocolData; + } + + + +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/SapInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/SapInfo.java new file mode 100644 index 0000000000..182aceb127 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/SapInfo.java @@ -0,0 +1,68 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; +import java.util.List; + +public class SapInfo { + @NotNull + private String id; + @NotNull + private String sapdId; + @NotNull + private String sapName; + @NotNull + private String description; + @NotNull + private List<CpProtocolInfo> sapProtocolInfo; + + public String getId() { + return id; + } + + public void setId(String id) { + this.id = id; + } + + public String getSapdId() { + return sapdId; + } + + public void setSapdId(String sapdId) { + this.sapdId = sapdId; + } + + public String getSapName() { + return sapName; + } + + public void setSapName(String sapName) { + this.sapName = sapName; + } + + public String getDescription() { + return description; + } + + public void setDescription(String description) { + this.description = description; + } + + public List<CpProtocolInfo> getSapProtocolInfo() { + return sapProtocolInfo; + } + + public void setSapProtocolInfo(List<CpProtocolInfo> sapProtocolInfo) { + this.sapProtocolInfo = sapProtocolInfo; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfInstance.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfInstance.java new file mode 100644 index 0000000000..ccd6532ee0 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfInstance.java @@ -0,0 +1,156 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; +import java.util.Map; + +public class VnfInstance { + @NotNull + private String id; + private String vnfInstanceName; + private String vnfInstanceDescription; + @NotNull + private String vnfdId; + @NotNull + private String vnfProvider; + @NotNull + private String vnfProductName; + @NotNull + private String vnfSoftwareVersion; + @NotNull + private String vnfdVersion; + @NotNull + private String vnfPkgId; + private Map<String, Object> vnfConfigurableProperties; + private String vimId; + + private enum instantiationState { + NOT_INSTANTIATED, INSTANTIATED + }; + + private InstantiatedVnfInfo instantiatedVnfInfo; + private Map<String, Object> metadata; + private Map<String, Object> extensions; + + public String getId() { + return id; + } + + public void setId(String id) { + this.id = id; + } + + public String getVnfInstanceName() { + return vnfInstanceName; + } + + public void setVnfInstanceName(String vnfInstanceName) { + this.vnfInstanceName = vnfInstanceName; + } + + public String getVnfInstanceDescription() { + return vnfInstanceDescription; + } + + public void setVnfInstanceDescription(String vnfInstanceDescription) { + this.vnfInstanceDescription = vnfInstanceDescription; + } + + public String getVnfdId() { + return vnfdId; + } + + public void setVnfdId(String vnfdId) { + this.vnfdId = vnfdId; + } + + public String getVnfProvider() { + return vnfProvider; + } + + public void setVnfProvider(String vnfProvider) { + this.vnfProvider = vnfProvider; + } + + public String getVnfProductName() { + return vnfProductName; + } + + public void setVnfProductName(String vnfProductName) { + this.vnfProductName = vnfProductName; + } + + public String getVnfSoftwareVersion() { + return vnfSoftwareVersion; + } + + public void setVnfSoftwareVersion(String vnfSoftwareVersion) { + this.vnfSoftwareVersion = vnfSoftwareVersion; + } + + public String getVnfdVersion() { + return vnfdVersion; + } + + public void setVnfdVersion(String vnfdVersion) { + this.vnfdVersion = vnfdVersion; + } + + public String getVnfPkgId() { + return vnfPkgId; + } + + public void setVnfPkgId(String vnfPkgId) { + this.vnfPkgId = vnfPkgId; + } + + public Map<String, Object> getVnfConfigurableProperties() { + return vnfConfigurableProperties; + } + + public void setVnfConfigurableProperties(Map<String, Object> vnfConfigurableProperties) { + this.vnfConfigurableProperties = vnfConfigurableProperties; + } + + public String getVimId() { + return vimId; + } + + public void setVimId(String vimId) { + this.vimId = vimId; + } + + public InstantiatedVnfInfo getInstantiatedVnfInfo() { + return instantiatedVnfInfo; + } + + public void setInstantiatedVnfInfo(InstantiatedVnfInfo instantiatedVnfInfo) { + this.instantiatedVnfInfo = instantiatedVnfInfo; + } + + public Map<String, Object> getMetadata() { + return metadata; + } + + public void setMetadata(Map<String, Object> metadata) { + this.metadata = metadata; + } + + public Map<String, Object> getExtensions() { + return extensions; + } + + public void setExtensions(Map<String, Object> extensions) { + this.extensions = extensions; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfInstanceData.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfInstanceData.java new file mode 100644 index 0000000000..83345fcb4c --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfInstanceData.java @@ -0,0 +1,33 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class VnfInstanceData { + private String vnfInstanceId; + private String vnfProfileId; + + public String getVnfInstanceId() { + return vnfInstanceId; + } + + public void setVnfInstanceId(String vnfInstanceId) { + this.vnfInstanceId = vnfInstanceId; + } + + public String getVnfProfileId() { + return vnfProfileId; + } + + public void setVnfProfileId(String vnfProfileId) { + this.vnfProfileId = vnfProfileId; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfLinkPortInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfLinkPortInfo.java new file mode 100644 index 0000000000..0b09d066fa --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfLinkPortInfo.java @@ -0,0 +1,46 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; + +public class VnfLinkPortInfo { + @NotNull + private String id; + @NotNull + private ResourceHandle resourceHandle; + private String cpInstanceId; + + public String getId() { + return id; + } + + public void setId(String id) { + this.id = id; + } + + public ResourceHandle getResourceHandle() { + return resourceHandle; + } + + public void setResourceHandle(ResourceHandle resourceHandle) { + this.resourceHandle = resourceHandle; + } + + public String getCpInstanceId() { + return cpInstanceId; + } + + public void setCpInstanceId(String cpInstanceId) { + this.cpInstanceId = cpInstanceId; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfLocationConstraint.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfLocationConstraint.java new file mode 100644 index 0000000000..5db3060b88 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfLocationConstraint.java @@ -0,0 +1,33 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +public class VnfLocationConstraint { + private String vnfProfileId; + private LocationConstraint locationConstraints; + + public String getVnfProfileId() { + return vnfProfileId; + } + + public void setVnfProfileId(String vnfProfileId) { + this.vnfProfileId = vnfProfileId; + } + + public LocationConstraint getLocationConstraints() { + return locationConstraints; + } + + public void setLocationConstraints(LocationConstraint locationConstraints) { + this.locationConstraints = locationConstraints; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfScaleInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfScaleInfo.java new file mode 100644 index 0000000000..e702edc821 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfScaleInfo.java @@ -0,0 +1,38 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; + +public class VnfScaleInfo { + @NotNull + private String aspectlId; + @NotNull + private int scaleLevel; + + public String getAspectlId() { + return aspectlId; + } + + public void setAspectlId(String aspectlId) { + this.aspectlId = aspectlId; + } + + public int getScaleLevel() { + return scaleLevel; + } + + public void setScaleLevel(int scaleLevel) { + this.scaleLevel = scaleLevel; + } + +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfVirtualLinkResourceInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfVirtualLinkResourceInfo.java new file mode 100644 index 0000000000..9f41a383fc --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfVirtualLinkResourceInfo.java @@ -0,0 +1,76 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; +import java.util.List; +import java.util.Map; + +public class VnfVirtualLinkResourceInfo { + @NotNull + private String id; + @NotNull + private String virtualLinkDescId; + @NotNull + private ResourceHandle networkResource; + private String reservationId; + private List<VnfLinkPortInfo> vnfLinkPorts; + Map<String, Object> metadata; + + public String getId() { + return id; + } + + public void setId(String id) { + this.id = id; + } + + public String getVirtualLinkDescId() { + return virtualLinkDescId; + } + + public void setVirtualLinkDescId(String virtualLinkDescId) { + this.virtualLinkDescId = virtualLinkDescId; + } + + public ResourceHandle getNetworkResource() { + return networkResource; + } + + public void setNetworkResource(ResourceHandle networkResource) { + this.networkResource = networkResource; + } + + public String getReservationId() { + return reservationId; + } + + public void setReservationId(String reservationId) { + this.reservationId = reservationId; + } + + public List<VnfLinkPortInfo> getVnfLinkPorts() { + return vnfLinkPorts; + } + + public void setVnfLinkPorts(List<VnfLinkPortInfo> vnfLinkPorts) { + this.vnfLinkPorts = vnfLinkPorts; + } + + public Map<String, Object> getMetadata() { + return metadata; + } + + public void setMetadata(Map<String, Object> metadata) { + this.metadata = metadata; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfcCpInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfcCpInfo.java new file mode 100644 index 0000000000..ec629effd2 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfcCpInfo.java @@ -0,0 +1,65 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; +import java.util.List; + +public class VnfcCpInfo { + @NotNull + private String id; + @NotNull + private String cpdId; + private String vnfExtCpId; + private List<CpProtocolInfo> cpProtocolInfo; + private String vnfLinkPortId; + + public String getId() { + return id; + } + + public void setId(String id) { + this.id = id; + } + + public String getCpdId() { + return cpdId; + } + + public void setCpdId(String cpdId) { + this.cpdId = cpdId; + } + + public String getVnfExtCpId() { + return vnfExtCpId; + } + + public void setVnfExtCpId(String vnfExtCpId) { + this.vnfExtCpId = vnfExtCpId; + } + + public List<CpProtocolInfo> getCpProtocolInfo() { + return cpProtocolInfo; + } + + public void setCpProtocolInfo(List<CpProtocolInfo> cpProtocolInfo) { + this.cpProtocolInfo = cpProtocolInfo; + } + + public String getVnfLinkPortId() { + return vnfLinkPortId; + } + + public void setVnfLinkPortId(String vnfLinkPortId) { + this.vnfLinkPortId = vnfLinkPortId; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfcResourceInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfcResourceInfo.java new file mode 100644 index 0000000000..1f7aa67b8d --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnfcResourceInfo.java @@ -0,0 +1,85 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; +import java.util.List; +import java.util.Map; + +public class VnfcResourceInfo { + @NotNull + private String id; + @NotNull + private String vduId; + @NotNull + private ResourceHandle computeResource; + private List<String> storageResourceIds; + private String reservationId; + private List<VnfcCpInfo> vnfcCpInfo; + private Map<String, Object> metadata; + + public String getId() { + return id; + } + + public void setId(String id) { + this.id = id; + } + + public String getVduId() { + return vduId; + } + + public void setVduId(String vduId) { + this.vduId = vduId; + } + + public ResourceHandle getComputeResource() { + return computeResource; + } + + public void setComputeResource(ResourceHandle computeResource) { + this.computeResource = computeResource; + } + + public List<String> getStorageResourceIds() { + return storageResourceIds; + } + + public void setStorageResourceIds(List<String> storageResourceIds) { + this.storageResourceIds = storageResourceIds; + } + + public String getReservationId() { + return reservationId; + } + + public void setReservationId(String reservationId) { + this.reservationId = reservationId; + } + + public List<VnfcCpInfo> getVnfcCpInfo() { + return vnfcCpInfo; + } + + public void setVnfcCpInfo(List<VnfcCpInfo> vnfcCpInfo) { + this.vnfcCpInfo = vnfcCpInfo; + } + + public Map<String, Object> getMetadata() { + return metadata; + } + + public void setMetadata(Map<String, Object> metadata) { + this.metadata = metadata; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnffgInfo.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnffgInfo.java new file mode 100644 index 0000000000..c02d5177db --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/model/VnffgInfo.java @@ -0,0 +1,87 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import javax.validation.constraints.NotNull; +import java.util.List; + +public class VnffgInfo { + @NotNull + private String id; + @NotNull + private String vnffgdId; + @NotNull + private List<String> vnfInstanceId; + private String pnfInfoId; + @NotNull + private List<String> nsVirtualLinkInfoId; + @NotNull + private List<NsCpHandle> nsCpHandle; + @NotNull + private List<NfpInfo> nfpInfo; + + public String getId() { + return id; + } + + public void setId(String id) { + this.id = id; + } + + public String getVnffgdId() { + return vnffgdId; + } + + public void setVnffgdId(String vnffgdId) { + this.vnffgdId = vnffgdId; + } + + public List<String> getVnfInstanceId() { + return vnfInstanceId; + } + + public void setVnfInstanceId(List<String> vnfInstanceId) { + this.vnfInstanceId = vnfInstanceId; + } + + public String getPnfInfoId() { + return pnfInfoId; + } + + public void setPnfInfoId(String pnfInfoId) { + this.pnfInfoId = pnfInfoId; + } + + public List<String> getNsVirtualLinkInfoId() { + return nsVirtualLinkInfoId; + } + + public void setNsVirtualLinkInfoId(List<String> nsVirtualLinkInfoId) { + this.nsVirtualLinkInfoId = nsVirtualLinkInfoId; + } + + public List<NsCpHandle> getNsCpHandle() { + return nsCpHandle; + } + + public void setNsCpHandle(List<NsCpHandle> nsCpHandle) { + this.nsCpHandle = nsCpHandle; + } + + public List<NfpInfo> getNfpInfo() { + return nfpInfo; + } + + public void setNfpInfo(List<NfpInfo> nfpInfo) { + this.nfpInfo = nfpInfo; + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/rest/VfcAdapterRest.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/rest/VfcAdapterRest.java index bb9ae69f51..5a89c04a5a 100644 --- a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/rest/VfcAdapterRest.java +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/rest/VfcAdapterRest.java @@ -37,6 +37,8 @@ import org.onap.so.adapters.vfc.model.NsOperationKey; import org.onap.so.adapters.vfc.model.RestfulResponse; import org.onap.so.adapters.vfc.util.JsonUtil; import org.onap.so.adapters.vfc.util.ValidateUtil; +import org.onap.so.db.request.beans.InstanceNfvoMapping; +import org.onap.so.db.request.data.repository.InstanceNfvoMappingRepository; import org.slf4j.Logger; import org.slf4j.LoggerFactory; import org.springframework.beans.factory.annotation.Autowired; @@ -58,7 +60,12 @@ public class VfcAdapterRest { private static final String REQUEST_DEBUG_MSG = "body from request is {}"; private static final String APPLICATION_EXCEPTION = "ApplicationException: "; @Autowired + private VfcManagerSol005 vfcManagerSol005; + + @Autowired private VfcManager driverMgr; + @Autowired + private InstanceNfvoMappingRepository instanceNfvoMappingRepository; public VfcAdapterRest() { @@ -80,7 +87,13 @@ public class VfcAdapterRest { ValidateUtil.assertObjectNotNull(data); logger.debug(REQUEST_DEBUG_MSG + data); NSResourceInputParameter nsInput = JsonUtil.unMarshal(data, NSResourceInputParameter.class); - RestfulResponse rsp = driverMgr.createNs(nsInput); + RestfulResponse rsp; + if (nsInput.getNsParameters().getAdditionalParamForNs().containsKey("isSol005Interface")) { + rsp = vfcManagerSol005.createNs(nsInput); + } else { + rsp = driverMgr.createNs(nsInput); + } + return buildResponse(rsp); } catch (ApplicationException e) { logger.debug(APPLICATION_EXCEPTION, e); @@ -106,7 +119,13 @@ public class VfcAdapterRest { ValidateUtil.assertObjectNotNull(data); logger.debug(REQUEST_DEBUG_MSG + data); NsOperationKey nsOperationKey = JsonUtil.unMarshal(data, NsOperationKey.class); - RestfulResponse rsp = driverMgr.deleteNs(nsOperationKey, nsInstanceId); + RestfulResponse rsp; + InstanceNfvoMapping instanceNfvoMapping = instanceNfvoMappingRepository.findOneByInstanceId(nsInstanceId); + if (instanceNfvoMapping != null) { + rsp = vfcManagerSol005.deleteNs(nsOperationKey, nsInstanceId); + } else { + rsp = driverMgr.deleteNs(nsOperationKey, nsInstanceId); + } return buildResponse(rsp); } catch (ApplicationException e) { logger.debug(APPLICATION_EXCEPTION, e); @@ -131,7 +150,13 @@ public class VfcAdapterRest { ValidateUtil.assertObjectNotNull(data); logger.debug(REQUEST_DEBUG_MSG + data); NsOperationKey nsOperationKey = JsonUtil.unMarshal(data, NsOperationKey.class); - RestfulResponse rsp = driverMgr.getNsProgress(nsOperationKey, jobId); + RestfulResponse rsp; + InstanceNfvoMapping instanceNfvoMapping = instanceNfvoMappingRepository.findOneByJobId(jobId); + if (instanceNfvoMapping != null) { + rsp = vfcManagerSol005.getNsProgress(nsOperationKey, jobId); + } else { + rsp = driverMgr.getNsProgress(nsOperationKey, jobId); + } return buildResponse(rsp); } catch (ApplicationException e) { logger.debug(APPLICATION_EXCEPTION, e); @@ -156,7 +181,12 @@ public class VfcAdapterRest { ValidateUtil.assertObjectNotNull(data); logger.debug(REQUEST_DEBUG_MSG + data); NSResourceInputParameter nsInput = JsonUtil.unMarshal(data, NSResourceInputParameter.class); - RestfulResponse rsp = driverMgr.instantiateNs(nsInstanceId, nsInput); + RestfulResponse rsp; + if (nsInput.getNsParameters().getAdditionalParamForNs().containsKey("isSol005Interface")) { + rsp = vfcManagerSol005.instantiateNs(nsInstanceId, nsInput); + } else { + rsp = driverMgr.instantiateNs(nsInstanceId, nsInput); + } return buildResponse(rsp); } catch (ApplicationException e) { logger.debug(APPLICATION_EXCEPTION, e); @@ -181,7 +211,14 @@ public class VfcAdapterRest { ValidateUtil.assertObjectNotNull(data); logger.debug(REQUEST_DEBUG_MSG + data); NsOperationKey nsOperationKey = JsonUtil.unMarshal(data, NsOperationKey.class); - RestfulResponse rsp = driverMgr.terminateNs(nsOperationKey, nsInstanceId); + RestfulResponse rsp; + InstanceNfvoMapping instanceNfvoMapping = instanceNfvoMappingRepository.findOneByInstanceId(nsInstanceId); + if (instanceNfvoMapping != null) { + rsp = vfcManagerSol005.terminateNs(nsOperationKey, nsInstanceId); + } else { + rsp = driverMgr.terminateNs(nsOperationKey, nsInstanceId); + } + return buildResponse(rsp); } catch (ApplicationException e) { logger.debug(APPLICATION_EXCEPTION, e); diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/rest/VfcManagerSol005.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/rest/VfcManagerSol005.java new file mode 100644 index 0000000000..9033becf8a --- /dev/null +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/rest/VfcManagerSol005.java @@ -0,0 +1,620 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.rest; + +import java.time.LocalDateTime; +import java.util.*; +import org.onap.so.adapters.vfc.constant.CommonConstant; +import org.onap.so.adapters.vfc.constant.CommonConstant.Step; +import org.onap.so.adapters.vfc.constant.DriverExceptionID; +import org.onap.so.adapters.vfc.constant.HttpCode; +import org.onap.so.adapters.vfc.exceptions.ApplicationException; +import org.onap.so.adapters.vfc.model.*; +import org.onap.so.adapters.vfc.util.JsonUtil; +import org.onap.so.adapters.vfc.util.RestfulUtil; +import org.onap.so.adapters.vfc.util.ValidateUtil; +import org.onap.so.db.request.beans.InstanceNfvoMapping; +import org.onap.so.db.request.beans.OperationStatus; +import org.onap.so.db.request.beans.ResourceOperationStatus; +import org.onap.so.db.request.data.repository.InstanceNfvoMappingRepository; +import org.onap.so.db.request.data.repository.OperationStatusRepository; +import org.onap.so.db.request.data.repository.ResourceOperationStatusRepository; +import org.onap.so.requestsdb.RequestsDbConstant; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.context.annotation.Primary; +import org.springframework.data.domain.Example; +import org.springframework.stereotype.Component; + +/** + * VF-C Manager <br> + * <p> + * </p> + * + * @author + * @version ONAP Amsterdam Release 2017-08-28 + */ +@Component +@Primary +public class VfcManagerSol005 { + + private static final Logger LOGGER = LoggerFactory.getLogger(VfcManagerSol005.class); + + /** + * nfvo url map + */ + private Map<String, String> nfvoUrlMap; + + @Autowired + private ResourceOperationStatusRepository resourceOperationStatusRepository; + + @Autowired + private RestfulUtil restfulUtil; + + @Autowired + private OperationStatusRepository operationStatusRepository; + + @Autowired + private InstanceNfvoMappingRepository instanceNfvoMappingRepository; + + private InstanceNfvoMapping instanceNfvoMapping = new InstanceNfvoMapping(); + + public VfcManagerSol005() { + nfvoUrlMap = new HashMap<>(); + nfvoUrlMap.put(Step.CREATE, CommonConstant.SOL005_NFVO_CREATE_URL); + nfvoUrlMap.put(Step.INSTANTIATE, CommonConstant.SOL005_NFVO_INSTANTIATE_URL); + nfvoUrlMap.put(Step.TERMINATE, CommonConstant.SOL005_NFVO_TERMINATE_URL); + nfvoUrlMap.put(Step.DELETE, CommonConstant.SOL005_NFVO_DELETE_URL); + nfvoUrlMap.put(Step.QUERY, CommonConstant.SOL005_NFVO_QUERY_URL); + nfvoUrlMap.put(Step.SCALE, CommonConstant.NFVO_SCALE_URL); + } + + /** + * create network service <br> + * + * @param segInput input parameters for current node from http request + * @return + * @since ONAP Dubilin Release + */ + public RestfulResponse createNs(NSResourceInputParameter segInput) throws ApplicationException { + + Map<String, String> nfvoDetails; + // Step1: get service template by node type + String nsdId = segInput.getNsServiceModelUUID(); + // nsdId for NFVO is "id" in the response, while for SDNO is "servcice template id" + LOGGER.info("serviceTemplateId is {}, id is {}", nsdId, nsdId); + + + LOGGER.info("SOL005 create ns -> begin"); + // Step2: Prepare url and method type + String url = getUrl(null, CommonConstant.Step.CREATE); + String methodType = CommonConstant.MethodType.POST; + + // Step3: Prepare restful parameters and options + CreateNsRequest createNsRequest = new CreateNsRequest(); + createNsRequest.setNsDescription(segInput.getNsServiceDescription()); + createNsRequest.setNsdId(segInput.getNsServiceModelUUID()); + createNsRequest.setNsName(segInput.getNsServiceName()); + + String createReq = JsonUtil.marshal(createNsRequest); + RestfulResponse aaiRestfulResponse = null; + NsParameters nsParameters = segInput.getNsParameters(); + if (nsParameters.getAdditionalParamForNs().containsKey("orchestrator")) { + if (nsParameters.getAdditionalParamForNs().get("orchestrator") != null) { + String nfvo = nsParameters.getAdditionalParamForNs().get("nfvo").toString(); + aaiRestfulResponse = restfulUtil.getNfvoFromAAI(nfvo); + nfvoDetails = JsonUtil.unMarshal(aaiRestfulResponse.getResponseContent(), Map.class); + url = nfvoDetails.get("url") + nfvoDetails.get("api-root") + url; + + } + } else { + LOGGER.error("Nfvo not present in AAI"); + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, DriverExceptionID.FAIL_TO_CREATE_NS); + } + + + // Prepare request header for createNs request. + Map<String, String> requestHeader = new HashMap<>(); + requestHeader.put("GLOBALCUSTOMERID", segInput.getNsOperationKey().getGlobalSubscriberId()); + requestHeader.put("SERVICETYPE", segInput.getNsOperationKey().getServiceType()); + + // Step4: Call NFVO or SDNO lcm to create ns + LOGGER.info("Request Payload for CreateNs: " + createReq); + + RestfulResponse createRsp = restfulUtil.send(url, methodType, createReq, requestHeader); + ValidateUtil.assertObjectNotNull(createRsp); + LOGGER.info("create ns response status is : {}", createRsp.getStatus()); + LOGGER.info("create ns response content is : {}", createRsp.getResponseContent()); + + // Step 5: save resource operation information + ResourceOperationStatus status = new ResourceOperationStatus(segInput.getNsOperationKey().getServiceId(), + segInput.getNsOperationKey().getOperationId(), segInput.getNsOperationKey().getNodeTemplateUUID()); + status.setStatus(RequestsDbConstant.Status.PROCESSING); + status = resourceOperationStatusRepository.save(status); + if (!HttpCode.isSucess(createRsp.getStatus())) { + LOGGER.error("update segment operation status : fail to create ns"); + status.setProgress("40"); + status.setStatusDescription("NS not created"); + status.setStatus(RequestsDbConstant.Status.ERROR); + status.setErrorCode(String.valueOf(createRsp.getStatus())); + resourceOperationStatusRepository.save(status); + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, DriverExceptionID.FAIL_TO_CREATE_NS); + } + // TODO: Capture all the content of the response. Currently fetching ID value alone. + // Should be converted into the NsInstance.class + @SuppressWarnings("unchecked") + Map<String, String> rsp = JsonUtil.unMarshal(createRsp.getResponseContent(), Map.class); + String nsInstanceId = rsp.get(CommonConstant.SOL005_NS_INSTANCE_ID); + if (ValidateUtil.isStrEmpty(nsInstanceId)) { + LOGGER.error("Invalid instanceId from create operation"); + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, + DriverExceptionID.INVALID_RESPONSEE_FROM_CREATE_OPERATION); + } + + nfvoDetails = JsonUtil.unMarshal(aaiRestfulResponse.getResponseContent(), Map.class); + instanceNfvoMapping.setInstanceId(nsInstanceId); + instanceNfvoMapping.setPassword(nfvoDetails.get("password")); + instanceNfvoMapping.setUsername(nfvoDetails.get("userName")); + instanceNfvoMapping.setNfvoName(nfvoDetails.get("nfvoId")); + instanceNfvoMapping.setEndpoint(nfvoDetails.get("url")); + instanceNfvoMapping.setApiRoot(nfvoDetails.get("api-root")); + instanceNfvoMappingRepository.save(instanceNfvoMapping); + LOGGER.info("create ns -> end"); + LOGGER.info("save segment and operaton info -> begin"); + // Step 6: add relation between service and NS + AaiUtil.addRelation(segInput.getNsOperationKey().getGlobalSubscriberId(), + segInput.getNsOperationKey().getServiceType(), segInput.getNsOperationKey().getServiceId(), + nsInstanceId); + LOGGER.info("save segment and operation info -> end"); + return createRsp; + } + + /** + * delete network service <br> + * + * @param nsOperationKey The operation key of the NS resource + * @param nsInstanceId The NS instance id + * @return + * @since ONAP Dublin Release + */ + public RestfulResponse deleteNs(NsOperationKey nsOperationKey, String nsInstanceId) throws ApplicationException { + LOGGER.info("SOL005 delete ns -> begin"); + // Step1: prepare url and methodType + String url = getUrl(nsInstanceId, CommonConstant.Step.DELETE); + String methodType = CommonConstant.MethodType.DELETE; + + // Step2: prepare restful parameters and options + RestfulResponse deleteRsp = restfulUtil.send(url, methodType, ""); + ValidateUtil.assertObjectNotNull(deleteRsp); + LOGGER.info("delete ns response status is : {}", deleteRsp.getStatus()); + LOGGER.info("delete ns response content is : {}", deleteRsp.getResponseContent()); + LOGGER.info("delete ns -> end"); + + ResourceOperationStatus status = new ResourceOperationStatus(nsOperationKey.getServiceId(), + nsOperationKey.getOperationId(), nsOperationKey.getNodeTemplateUUID()); + if (!HttpCode.isSucess(deleteRsp.getStatus())) { + LOGGER.error("fail to delete ns"); + + status.setStatus(RequestsDbConstant.Status.ERROR); + status.setErrorCode(String.valueOf(deleteRsp.getStatus())); + status.setStatusDescription(CommonConstant.StatusDesc.TERMINATE_NS_FAILED); + resourceOperationStatusRepository.save(status); + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, DriverExceptionID.FAIL_TO_DELETE_NS); + } + + // Step3: remove relation info between service and ns + AaiUtil.removeRelation(nsOperationKey.getGlobalSubscriberId(), nsOperationKey.getServiceType(), + nsOperationKey.getServiceId(), nsInstanceId); + LOGGER.info("delete segment information -> end"); + + // Step4: update service segment operation status + status.setStatus(RequestsDbConstant.Status.FINISHED); + status.setErrorCode(String.valueOf(deleteRsp.getStatus())); + status.setProgress("100"); + status.setStatusDescription("VFC resource deletion finished"); + resourceOperationStatusRepository.save(status); + LOGGER.info("update segment operaton status for delete -> end"); + + return deleteRsp; + + } + + /** + * instantiate network service <br> + * + * @param nsInstanceId The NS instance id + * @param segInput input parameters for current node from http request + * @return + * @since ONAP Dublin Release + */ + public RestfulResponse instantiateNs(String nsInstanceId, NSResourceInputParameter segInput) + throws ApplicationException { + // Call the NFVO or SDNO service to instantiate service + LOGGER.info("SOL005 instantiate ns -> begin"); + + // Step1: Prepare restful parameters and options + InstantiateNsRequest instantiateNsRequest = new InstantiateNsRequest(); + + NsInstantiateReq oRequest = new NsInstantiateReq(); + oRequest.setNsInstanceId(nsInstanceId); + NsParameters nsParameters = segInput.getNsParameters(); + + ArrayList<VnfLocationConstraint> vnfLocationConstraints = new ArrayList<VnfLocationConstraint>(); + for (LocationConstraint locationConstraint : nsParameters.getLocationConstraints()) { + VnfLocationConstraint vnfLocationConstraint = new VnfLocationConstraint(); + vnfLocationConstraint.setVnfProfileId(locationConstraint.getVnfProfileId()); + vnfLocationConstraint.setLocationConstraints(null); + vnfLocationConstraints.add(vnfLocationConstraint); + + } + instantiateNsRequest.setAditionalParamsForNs(nsParameters.getAdditionalParamForNs()); + // Setting FlavourID which is a mandatory paramater to default + // as UUI is not sending this parameter to so + instantiateNsRequest.setNsFlavourId("default"); + String instReq = JsonUtil.marshal(instantiateNsRequest); + LOGGER.info("Request Payload for InstantiateNs: " + instReq); + // Step2: prepare url and + String url = getUrl(nsInstanceId, CommonConstant.Step.INSTANTIATE); + String methodType = CommonConstant.MethodType.POST; + instanceNfvoMapping = instanceNfvoMappingRepository.findOneByInstanceId(nsInstanceId); + + if (instanceNfvoMapping != null) { + + url = instanceNfvoMapping.getEndpoint() + instanceNfvoMapping.getApiRoot() + url; + + } else { + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, DriverExceptionID.FAIL_TO_INSTANTIATE_NS); + + } + // Step3: prepare restful parameters and options + Map<String, String> reqBody = new HashMap<>(); + reqBody.put("terminationTime", LocalDateTime.now().toString()); + RestfulResponse instRsp = restfulUtil.send(url, methodType, instReq); + ResourceOperationStatus status = new ResourceOperationStatus(segInput.getNsOperationKey().getServiceId(), + segInput.getNsOperationKey().getOperationId(), segInput.getNsOperationKey().getNodeTemplateUUID()); + ValidateUtil.assertObjectNotNull(instRsp); + if (!HttpCode.isSucess(instRsp.getStatus())) { + LOGGER.error("update segment operation status : fail to instantiate ns"); + status.setStatus(RequestsDbConstant.Status.ERROR); + status.setErrorCode(String.valueOf(instRsp.getStatus())); + status.setStatusDescription(CommonConstant.StatusDesc.INSTANTIATE_NS_FAILED); + resourceOperationStatusRepository.save(status); + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, DriverExceptionID.FAIL_TO_INSTANTIATE_NS); + } + LOGGER.info("instantiate ns response status is : {}", instRsp.getStatus()); + LOGGER.info("response payload is {}", instRsp.getResponseContent()); + String jobId = null; + if (instRsp.getStatus() == 202) { + String jobUri = instRsp.getRespHeaderStr(CommonConstant.JOB_URI); + LOGGER.info("JOB URI" + jobUri); + jobId = jobUri.split("/")[4]; + if (ValidateUtil.isStrEmpty(jobId)) { + LOGGER.error("Invalid jobId from instantiate operation"); + status.setStatus(RequestsDbConstant.Status.ERROR); + status.setErrorCode(String.valueOf(instRsp.getStatus())); + status.setStatusDescription(CommonConstant.StatusDesc.INSTANTIATE_NS_FAILED); + resourceOperationStatusRepository.save(status); + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, + DriverExceptionID.INVALID_RESPONSE_FROM_INSTANTIATE_OPERATION); + } + + } else if (instRsp.getStatus() > 400 && instRsp.getStatus() < 600) { + LOGGER.error("ERROR while executing instantiateNs request"); + ProblemDetails problemDetails = JsonUtil.unMarshal(instRsp.getResponseContent(), ProblemDetails.class); + status.setStatus(RequestsDbConstant.Status.ERROR); + status.setErrorCode(String.valueOf(instRsp.getStatus())); + status.setStatusDescription(CommonConstant.StatusDesc.INSTANTIATE_NS_FAILED + problemDetails.getDetail()); + resourceOperationStatusRepository.save(status); + if (instRsp.getStatus() == 406) { + throw new ApplicationException(HttpCode.NOT_ACCEPTABLE, DriverExceptionID.FAIL_TO_INSTANTIATE_NS); + } else if (instRsp.getStatus() == 400) { + throw new ApplicationException(HttpCode.BAD_REQUEST, DriverExceptionID.FAIL_TO_INSTANTIATE_NS); + } else if (instRsp.getStatus() == 404) { + throw new ApplicationException(HttpCode.NOT_FOUND, DriverExceptionID.FAIL_TO_INSTANTIATE_NS); + } else if (instRsp.getStatus() == 409) { + LOGGER.error("The operation cannot be executed currently,\n" + + "due to a conflict with the state of the resource"); + throw new ApplicationException(HttpCode.RESPOND_CONFLICT, DriverExceptionID.FAIL_TO_INSTANTIATE_NS); + } else if (instRsp.getStatus() == 500) { + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, + DriverExceptionID.FAIL_TO_INSTANTIATE_NS); + } else { + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, + DriverExceptionID.FAIL_TO_INSTANTIATE_NS); + } + + } + LOGGER.info("Job id is " + jobId); + LOGGER.info("Nfvo Details" + instanceNfvoMapping.toString()); + LOGGER.info("instantiate ns -> end"); + // Step 3: update segment operation job id + LOGGER.info("update resource operation status job id -> begin"); + status.setJobId(jobId); + status.setProgress("100"); + status.setStatusDescription("NS initiation completed."); + resourceOperationStatusRepository.save(status); + instanceNfvoMapping.setJobId(jobId); + instanceNfvoMappingRepository.save(instanceNfvoMapping); + LOGGER.info("update segment operation job id -> end" + instanceNfvoMapping.toString()); + return instRsp; + } + + /** + * terminate network service <br> + * + * @param nsOperationKey The operation key for NS resource + * @param nsInstanceId The NS instance id + * @return + * @since ONAP Dublin Release + */ + public RestfulResponse terminateNs(NsOperationKey nsOperationKey, String nsInstanceId) throws ApplicationException { + // Step1: save segment operation info for delete process + LOGGER.info("save segment operation for delete process"); + ResourceOperationStatus status = new ResourceOperationStatus(nsOperationKey.getServiceId(), + nsOperationKey.getOperationId(), nsOperationKey.getNodeTemplateUUID()); + status.setStatus(RequestsDbConstant.Status.PROCESSING); + resourceOperationStatusRepository.save(status); + + LOGGER.info("SOL005 terminate ns -> begin"); + // Step2: prepare url and method type + String url = getUrl(nsInstanceId, CommonConstant.Step.TERMINATE); + String methodType = CommonConstant.MethodType.POST; + + instanceNfvoMapping = instanceNfvoMappingRepository.findOneByInstanceId(nsInstanceId); + + if (instanceNfvoMapping != null) { + + url = instanceNfvoMapping.getEndpoint() + instanceNfvoMapping.getApiRoot() + url; + + } else { + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, DriverExceptionID.FAIL_TO_TERMINATE_NS); + } + // Step3: prepare restful parameters and options + Map<String, String> reqBody = new HashMap<>(); + reqBody.put("terminationTime", LocalDateTime.now().toString()); + + // Step4: Call the NFVO or SDNO service to terminate service + LOGGER.info("request body for terminate NS" + JsonUtil.marshal(reqBody)); + RestfulResponse terminateRsp = restfulUtil.send(url, methodType, JsonUtil.marshal(reqBody)); + ValidateUtil.assertObjectNotNull(terminateRsp); + LOGGER.info("terminate ns response status is : {}", terminateRsp.getStatus()); + LOGGER.info("terminate ns response content is : {}", terminateRsp.getResponseContent()); + // Step 3: update segment operation + if (!HttpCode.isSucess(terminateRsp.getStatus())) { + LOGGER.error("fail to terminate ns"); + status.setStatus(RequestsDbConstant.Status.ERROR); + status.setErrorCode(String.valueOf(terminateRsp.getStatus())); + status.setStatusDescription(CommonConstant.StatusDesc.TERMINATE_NS_FAILED); + resourceOperationStatusRepository.save(status); + + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, DriverExceptionID.FAIL_TO_TERMINATE_NS); + } + // @SuppressWarnings("unchecked") + String jobId = null; + Map<String, String> rsp = new HashMap<>(); + if (terminateRsp.getStatus() == 202) { + String jobUri = terminateRsp.getRespHeaderStr(CommonConstant.JOB_URI); + jobId = jobUri.split("/")[4]; + jobId.split("/"); + if (ValidateUtil.isStrEmpty(jobId)) { + LOGGER.error("Invalid jobId from instantiate operation"); + status.setStatus(RequestsDbConstant.Status.ERROR); + status.setErrorCode(String.valueOf(terminateRsp.getStatus())); + status.setStatusDescription(CommonConstant.StatusDesc.INSTANTIATE_NS_FAILED); + resourceOperationStatusRepository.save(status); + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, + DriverExceptionID.INVALID_RESPONSE_FROM_INSTANTIATE_OPERATION); + } + rsp.put(CommonConstant.JOB_ID, jobId); + LOGGER.info("terminate ns -> end"); + LOGGER.info("update segment job id -> begin"); + status.setProgress("60"); + status.setStatusDescription("NS is termination completed"); + status.setJobId(jobId); + resourceOperationStatusRepository.save(status); + LOGGER.info("update segment job id -> end"); + } else if (terminateRsp.getStatus() > 400 && terminateRsp.getStatus() < 600) { + LOGGER.error("ERROR while executing instantiateNs request"); + ProblemDetails problemDetails = JsonUtil.unMarshal(terminateRsp.getResponseContent(), ProblemDetails.class); + status.setStatus(RequestsDbConstant.Status.ERROR); + status.setErrorCode(String.valueOf(terminateRsp.getStatus())); + status.setStatusDescription(CommonConstant.StatusDesc.TERMINATE_NS_FAILED + problemDetails.getDetail()); + resourceOperationStatusRepository.save(status); + if (terminateRsp.getStatus() == 406) { + throw new ApplicationException(HttpCode.NOT_ACCEPTABLE, DriverExceptionID.FAIL_TO_TERMINATE_NS); + } else if (terminateRsp.getStatus() == 400) { + throw new ApplicationException(HttpCode.BAD_REQUEST, DriverExceptionID.FAIL_TO_TERMINATE_NS); + } else if (terminateRsp.getStatus() == 404) { + throw new ApplicationException(HttpCode.NOT_FOUND, DriverExceptionID.FAIL_TO_TERMINATE_NS); + } else if (terminateRsp.getStatus() == 409) { + LOGGER.error("The operation cannot be executed currently,\n" + + "due to a conflict with the state of the resource"); + throw new ApplicationException(HttpCode.RESPOND_CONFLICT, DriverExceptionID.FAIL_TO_TERMINATE_NS); + } else if (terminateRsp.getStatus() == 500) { + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, DriverExceptionID.FAIL_TO_TERMINATE_NS); + } else { + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, DriverExceptionID.FAIL_TO_TERMINATE_NS); + } + + } + instanceNfvoMapping.setJobId(jobId); + instanceNfvoMappingRepository.save(instanceNfvoMapping); + terminateRsp.setResponseContent(rsp.toString()); + return terminateRsp; + } + + /** + * get ns progress by job Id <br> + * + * @param nsOperationKey The OperationKey for NS resource + * @param jobId the job id + * @return + * @since ONAP Dublin Release + */ + public RestfulResponse getNsProgress(NsOperationKey nsOperationKey, String jobId) throws ApplicationException { + + ValidateUtil.assertObjectNotNull(jobId); + // Step 1: query the current resource operation status + ResourceOperationStatus status = new ResourceOperationStatus(nsOperationKey.getServiceId(), + nsOperationKey.getOperationId(), nsOperationKey.getNodeTemplateUUID()); + // status = resourceOperationStatusRepository.findOne(Example.of(status)) + // .orElseThrow(() -> new ApplicationException(404, "Cannot Find Operation Status")); + + // Get NFVO details + instanceNfvoMapping = instanceNfvoMappingRepository.findOneByJobId(jobId); + + // Step 2: start query + LOGGER.info("SOL005 query ns status -> begin"); + String url = getUrl(jobId, CommonConstant.Step.QUERY); + String methodType = CommonConstant.MethodType.GET; + if (instanceNfvoMapping != null) { + + url = instanceNfvoMapping.getEndpoint() + instanceNfvoMapping.getApiRoot() + url; + + } else { + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, DriverExceptionID.FAIL_TO_QUERY_JOB_STATUS); + } + + // prepare restful parameters and options + RestfulResponse rsp = restfulUtil.send(url, methodType, ""); + ValidateUtil.assertObjectNotNull(rsp); + LOGGER.info("query ns progress response status is : {}", rsp.getStatus()); + LOGGER.info("query ns progress response content is : {}", rsp.getResponseContent()); + // Step 3:check the response staus + if (!HttpCode.isSucess(rsp.getStatus())) { + LOGGER.info("fail to query job status"); + ProblemDetails problemDetails = JsonUtil.unMarshal(rsp.getResponseContent(), ProblemDetails.class); + status.setErrorCode(String.valueOf(rsp.getStatus())); + status.setStatus(RequestsDbConstant.Status.ERROR); + status.setStatusDescription(CommonConstant.StatusDesc.QUERY_JOB_STATUS_FAILED + problemDetails.getDetail()); + resourceOperationStatusRepository.save(status); + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, DriverExceptionID.FAIL_TO_QUERY_JOB_STATUS); + } + // Step 4: Process Network Service Instantiate Response + NsLcmOpOcc nsProgress = JsonUtil.unMarshal(rsp.getResponseContent(), NsLcmOpOcc.class); + if (CommonConstant.operationState.FAILED.equals(nsProgress.getOperationState())) { + LOGGER.info("NS instantiate fails"); + status.setErrorCode(String.valueOf(rsp.getStatus())); + status.setStatus(RequestsDbConstant.Status.ERROR); + status.setStatusDescription( + CommonConstant.StatusDesc.INSTANTIATE_NS_FAILED + nsProgress.getError().getDetail()); + resourceOperationStatusRepository.save(status); + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, DriverExceptionID.FAIL_TO_QUERY_JOB_STATUS); + } + // Step 5: update segment operation progress + + if (nsProgress.getOperationState().equals(CommonConstant.operationState.PROCESSING)) { + status.setProgress("40"); + status.setStatus(RequestsDbConstant.Status.PROCESSING); + status.setStatusDescription("NS operation is in progress"); + resourceOperationStatusRepository.save(status); + updateOperationStatusBasedOnResourceStatus(status); + } else if (nsProgress.getOperationState().equals(CommonConstant.operationState.PARTIALLY_COMPLETED)) { + status.setProgress("60"); + status.setStatus(RequestsDbConstant.Status.PROCESSING); + status.setStatusDescription("NS operation is partially completed"); + resourceOperationStatusRepository.save(status); + } else if (nsProgress.getOperationState().equals(CommonConstant.operationState.COMPLETED)) { + status.setStatus(RequestsDbConstant.Status.FINISHED); + status.setProgress("100"); + status.setStatusDescription("NS operation is Completed"); + resourceOperationStatusRepository.save(status); + updateOperationStatusBasedOnResourceStatus(status); + + } else if (nsProgress.getOperationState().equals(CommonConstant.operationState.FAILED) + || nsProgress.getOperationState().equals(CommonConstant.operationState.FAILED_TEMP)) { + status.setStatus(RequestsDbConstant.Status.ERROR); + status.setProgress("0"); + status.setStatusDescription("NS operation Failed"); + resourceOperationStatusRepository.save(status); + updateOperationStatusBasedOnResourceStatus(status); + throw new ApplicationException(HttpCode.INTERNAL_SERVER_ERROR, DriverExceptionID.JOB_STATUS_ERROR); + } else { + LOGGER.error("unexcepted response status"); + + } + return rsp; + } + + /** + * get url for the operation <br> + * + * @param variable variable should be put in the url + * @param step step of the operation (terminate,query,delete) + * @return + * @since ONAP Dublin Release + */ + private String getUrl(String variable, String step) { + + String url; + String originalUrl; + originalUrl = nfvoUrlMap.get(step); + url = String.format(originalUrl, variable); + return url; + + } + + private void updateOperationStatusBasedOnResourceStatus(ResourceOperationStatus operStatus) { + String serviceId = operStatus.getServiceId(); + String operationId = operStatus.getOperationId(); + + LOGGER.debug("Request database - update Operation Status Based On Resource Operation Status with service Id: " + + "{}, operationId: {}", serviceId, operationId); + + List<ResourceOperationStatus> lstResourceStatus = + resourceOperationStatusRepository.findByServiceIdAndOperationId(serviceId, operationId); + if (lstResourceStatus == null) { + LOGGER.error("Unable to retrieve resourceOperStatus Object by ServiceId: {} operationId: {}", serviceId, + operationId); + return; + } + + // count the total progress + int resourceCount = lstResourceStatus.size(); + int progress = 0; + boolean isFinished = true; + for (ResourceOperationStatus lstResourceStatu : lstResourceStatus) { + progress = progress + Integer.valueOf(lstResourceStatu.getProgress()) / resourceCount; + if (RequestsDbConstant.Status.PROCESSING.equals(lstResourceStatu.getStatus())) { + isFinished = false; + } + } + + OperationStatus serviceOperStatus = + operationStatusRepository.findOneByServiceIdAndOperationId(serviceId, operationId); + if (serviceOperStatus == null) { + String error = "Entity not found. Unable to retrieve OperationStatus Object ServiceId: " + serviceId + + " operationId: " + operationId; + LOGGER.error(error); + + serviceOperStatus = new OperationStatus(); + serviceOperStatus.setOperationId(operationId); + serviceOperStatus.setServiceId(serviceId); + } + + progress = progress > 100 ? 100 : progress; + serviceOperStatus.setProgress(String.valueOf(progress)); + serviceOperStatus.setOperationContent(operStatus.getStatusDescription()); + // if current resource failed. service failed. + if (RequestsDbConstant.Status.ERROR.equals(operStatus.getStatus())) { + serviceOperStatus.setResult(RequestsDbConstant.Status.ERROR); + serviceOperStatus.setReason(operStatus.getStatusDescription()); + } else if (isFinished) { + // if finished + serviceOperStatus.setResult(RequestsDbConstant.Status.FINISHED); + serviceOperStatus.setProgress(RequestsDbConstant.Progress.ONE_HUNDRED); + } + + operationStatusRepository.save(serviceOperStatus); + } +} diff --git a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/util/RestfulUtil.java b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/util/RestfulUtil.java index 647fcafa66..984cdb8016 100644 --- a/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/util/RestfulUtil.java +++ b/adapters/mso-vfc-adapter/src/main/java/org/onap/so/adapters/vfc/util/RestfulUtil.java @@ -26,8 +26,13 @@ package org.onap.so.adapters.vfc.util; import java.net.HttpURLConnection; import java.net.SocketTimeoutException; +import java.util.Base64; +import java.util.HashMap; +import java.util.List; +import java.util.Map; import javax.ws.rs.core.UriBuilder; import org.onap.so.logger.LoggingAnchor; +import org.apache.http.Header; import org.apache.http.HttpResponse; import org.apache.http.client.HttpClient; import org.apache.http.client.config.RequestConfig; @@ -102,9 +107,10 @@ public class RestfulUtil { } - public RestfulResponse send(String url, String methodType, String content) { - String msbUrl = getMsbHost() + url; - logger.debug("Begin to sent message {}: {}", methodType, msbUrl); + + public RestfulResponse send(String msbUrl, String methodType, String content, Map<String, String> requestHeader) { + // String msbUrl = getMsbHost() + url; + logger.debug("Begin to sent message " + methodType + ": " + msbUrl); HttpRequestBase method = null; HttpResponse httpResponse = null; @@ -115,9 +121,14 @@ public class RestfulUtil { RequestConfig requestConfig = RequestConfig.custom().setSocketTimeout(timeout).setConnectTimeout(timeout) .setConnectionRequestTimeout(timeout).build(); + HttpClient client = HttpClientBuilder.create().build(); + if ("POST".equalsIgnoreCase(methodType)) { HttpPost httpPost = new HttpPost(msbUrl); httpPost.setConfig(requestConfig); + for (String key : requestHeader.keySet()) { + httpPost.setHeader(key, requestHeader.get(key)); + } httpPost.setEntity(new StringEntity(content, ContentType.APPLICATION_JSON)); method = httpPost; } else if ("PUT".equalsIgnoreCase(methodType)) { @@ -135,11 +146,24 @@ public class RestfulUtil { method = httpDelete; } - httpResponse = client.execute(method); + // now VFC have no auth + // String userCredentials = + // SDNCAdapterProperties.getEncryptedProperty(Constants.SDNC_AUTH_PROP, + // Constants.DEFAULT_SDNC_AUTH, Constants.ENCRYPTION_KEY); + // String authorization = "Basic " + + // DatatypeConverter.printBase64Binary(userCredentials.getBytes()); + // method.setHeader("Authorization", authorization); + httpResponse = client.execute(method); + Map<String, String> responseHeader = new HashMap<>(); String responseContent = null; if (httpResponse.getEntity() != null) { responseContent = EntityUtils.toString(httpResponse.getEntity(), "UTF-8"); + Header[] httpResponseAllHeaders = httpResponse.getAllHeaders(); + for (Header header : httpResponseAllHeaders) { + responseHeader.put(header.getName(), header.getValue()); + + } } int statusCode = httpResponse.getStatusLine().getStatusCode(); @@ -163,7 +187,115 @@ public class RestfulUtil { } method = null; - return createResponse(statusCode, responseContent); + return createResponse(statusCode, responseContent, responseHeader); + + } catch (SocketTimeoutException | ConnectTimeoutException e) { + String errMsg = "Request to VFC timed out"; + logError(errMsg, e); + return createResponse(HttpURLConnection.HTTP_CLIENT_TIMEOUT, errMsg); + + } catch (Exception e) { + String errMsg = "Error processing request to VFC"; + logError(errMsg, e); + return createResponse(HttpURLConnection.HTTP_INTERNAL_ERROR, errMsg); + + } finally { + if (httpResponse != null) { + try { + EntityUtils.consume(httpResponse.getEntity()); + } catch (Exception e) { + logger.debug("Exception :", e); + } + } + + if (method != null) { + try { + method.reset(); + } catch (Exception e) { + logger.debug("Exception :", e); + } + } + } + } + + public RestfulResponse send(String msbUrl, String methodType, String content) { + if (!msbUrl.contains("http")) { + msbUrl = getMsbHost() + msbUrl; + } + // String msbUrl = getMsbHost() + url; + logger.debug("Begin to sent message " + methodType + ": " + msbUrl); + + HttpRequestBase method = null; + HttpResponse httpResponse = null; + + try { + int timeout = DEFAULT_TIME_OUT; + + RequestConfig requestConfig = RequestConfig.custom().setSocketTimeout(timeout).setConnectTimeout(timeout) + .setConnectionRequestTimeout(timeout).build(); + + if ("POST".equalsIgnoreCase(methodType)) { + HttpPost httpPost = new HttpPost(msbUrl); + httpPost.setConfig(requestConfig); + httpPost.setEntity(new StringEntity(content, ContentType.APPLICATION_JSON)); + method = httpPost; + } else if ("PUT".equalsIgnoreCase(methodType)) { + HttpPut httpPut = new HttpPut(msbUrl); + httpPut.setConfig(requestConfig); + httpPut.setEntity(new StringEntity(content, ContentType.APPLICATION_JSON)); + method = httpPut; + } else if ("GET".equalsIgnoreCase(methodType)) { + HttpGet httpGet = new HttpGet(msbUrl); + httpGet.setConfig(requestConfig); + method = httpGet; + } else if ("DELETE".equalsIgnoreCase(methodType)) { + HttpDelete httpDelete = new HttpDelete(msbUrl); + httpDelete.setConfig(requestConfig); + method = httpDelete; + } + + // now VFC have no auth + // String userCredentials = + // SDNCAdapterProperties.getEncryptedProperty(Constants.SDNC_AUTH_PROP, + // Constants.DEFAULT_SDNC_AUTH, Constants.ENCRYPTION_KEY); + // String authorization = "Basic " + + // DatatypeConverter.printBase64Binary(userCredentials.getBytes()); + // method.setHeader("Authorization", authorization); + + httpResponse = client.execute(method); + Map<String, String> responseHeader = new HashMap<>(); + String responseContent = null; + if (httpResponse.getEntity() != null) { + responseContent = EntityUtils.toString(httpResponse.getEntity(), "UTF-8"); + Header[] httpResponseAllHeaders = httpResponse.getAllHeaders(); + for (Header header : httpResponseAllHeaders) { + responseHeader.put(header.getName(), header.getValue()); + + } + } + + int statusCode = httpResponse.getStatusLine().getStatusCode(); + String statusMessage = httpResponse.getStatusLine().getReasonPhrase(); + + logger.debug("VFC Response: " + statusCode + " " + statusMessage + + (responseContent == null ? "" : System.lineSeparator() + responseContent)); + + if (httpResponse.getStatusLine().getStatusCode() >= 300) { + String errMsg = "VFC returned " + statusCode + " " + statusMessage; + logError(errMsg); + return createResponse(statusCode, errMsg); + } + + httpResponse = null; + + if (null != method) { + method.reset(); + } else { + logger.debug("method is NULL:"); + } + + method = null; + return createResponse(statusCode, responseContent, responseHeader); } catch (SocketTimeoutException | ConnectTimeoutException e) { String errMsg = "Request to VFC timed out"; @@ -194,6 +326,46 @@ public class RestfulUtil { } } + public RestfulResponse getNfvoFromAAI(String nfvo) { + HttpRequestBase method = null; + HttpResponse httpResponse = null; + String endPoint = getMsbHost() + "/api/aai-esr-server/v1/nfvos/" + nfvo; + logger.info("Endpoint URL" + endPoint); + RequestConfig requestConfig = RequestConfig.custom().setSocketTimeout(DEFAULT_TIME_OUT) + .setConnectTimeout(DEFAULT_TIME_OUT).setConnectionRequestTimeout(DEFAULT_TIME_OUT).build(); + HttpClient client = HttpClientBuilder.create().build(); + HttpGet httpGet = new HttpGet(endPoint); + httpGet.setConfig(requestConfig); + String encoding = Base64.getEncoder().encodeToString(("AAI:AAI").getBytes()); + httpGet.setHeader("Authorization", "Basic " + encoding); + method = httpGet; + String responseContent = null; + Map<String, String> responseHeader = null; + try { + httpResponse = client.execute(method); + if (httpResponse.getEntity() != null) { + responseContent = EntityUtils.toString(httpResponse.getEntity(), "UTF-8"); + } + + int statusCode = httpResponse.getStatusLine().getStatusCode(); + String statusMessage = httpResponse.getStatusLine().getReasonPhrase(); + + logger.debug("AAI Response: " + statusCode + " " + statusMessage + + (responseContent == null ? "" : System.lineSeparator() + responseContent)); + + if (httpResponse.getStatusLine().getStatusCode() >= 300) { + String errMsg = "AAI returned " + statusCode + " " + statusMessage; + logError(errMsg); + return createResponse(statusCode, errMsg); + } + } catch (Exception e) { + String errMsg = "Error processing request to AAI"; + logError(errMsg, e); + return createResponse(HttpURLConnection.HTTP_INTERNAL_ERROR, errMsg); + } + return createResponse(200, responseContent); + } + private static void logError(String errMsg, Throwable t) { logger.error(LoggingAnchor.FOUR, MessageEnum.RA_NS_EXC.toString(), VFC_ADAPTER, ErrorCode.AvailabilityError.getValue(), errMsg, t); @@ -211,4 +383,12 @@ public class RestfulUtil { return rsp; } + private static RestfulResponse createResponse(int statusCode, String content, Map<String, String> responseHeader) { + RestfulResponse rsp = new RestfulResponse(); + rsp.setStatus(statusCode); + rsp.setRespHeaderMap(responseHeader); + rsp.setResponseContent(content); + return rsp; + } + } diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AddPnfDataTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AddPnfDataTest.java new file mode 100644 index 0000000000..1fedac9cc9 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AddPnfDataTest.java @@ -0,0 +1,189 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import java.util.Collection; +import java.util.Iterator; +import java.util.List; +import java.util.ListIterator; +import static org.junit.Assert.*; + +public class AddPnfDataTest { + AddPnfData pnfData = new AddPnfData(); + + @Test + public void getPnfId() { + pnfData.getPnfId(); + } + + + @Test + public void setPnfId() { + pnfData.setPnfId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getPnfName() { + pnfData.getPnfName(); + } + + @Test + public void setPnfName() { + pnfData.setPnfName("Router"); + } + + @Test + public void getPnfdId() { + pnfData.getPnfdId(); + } + + @Test + public void setPnfdId() { + pnfData.setPnfdId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getPnfProfileId() { + pnfData.getPnfProfileId(); + } + + @Test + public void setPnfProfileId() { + pnfData.setPnfProfileId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getCpData() { + pnfData.getCpData(); + } + + @Test + public void setCpData() { + pnfData.setCpData(new List<PnfExtCpData>() { + @Override + public int size() { + return 0; + } + + @Override + public boolean isEmpty() { + return false; + } + + @Override + public boolean contains(Object o) { + return false; + } + + @Override + public Iterator<PnfExtCpData> iterator() { + return null; + } + + @Override + public Object[] toArray() { + return new Object[0]; + } + + @Override + public <T> T[] toArray(T[] a) { + return null; + } + + @Override + public boolean add(PnfExtCpData pnfExtCpData) { + return false; + } + + @Override + public boolean remove(Object o) { + return false; + } + + @Override + public boolean containsAll(Collection<?> c) { + return false; + } + + @Override + public boolean addAll(Collection<? extends PnfExtCpData> c) { + return false; + } + + @Override + public boolean addAll(int index, Collection<? extends PnfExtCpData> c) { + return false; + } + + @Override + public boolean removeAll(Collection<?> c) { + return false; + } + + @Override + public boolean retainAll(Collection<?> c) { + return false; + } + + @Override + public void clear() { + + } + + @Override + public PnfExtCpData get(int index) { + return null; + } + + @Override + public PnfExtCpData set(int index, PnfExtCpData element) { + return null; + } + + @Override + public void add(int index, PnfExtCpData element) { + + } + + @Override + public PnfExtCpData remove(int index) { + return null; + } + + @Override + public int indexOf(Object o) { + return 0; + } + + @Override + public int lastIndexOf(Object o) { + return 0; + } + + @Override + public ListIterator<PnfExtCpData> listIterator() { + return null; + } + + @Override + public ListIterator<PnfExtCpData> listIterator(int index) { + return null; + } + + @Override + public List<PnfExtCpData> subList(int fromIndex, int toIndex) { + return null; + } + }); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AddressRangeTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AddressRangeTest.java new file mode 100644 index 0000000000..9444efd4c5 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AddressRangeTest.java @@ -0,0 +1,39 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class AddressRangeTest { + AddressRange addressRange = new AddressRange(); + + @Test + public void getMinAddress() { + addressRange.getMinAddress(); + } + + @Test + public void setMinAddress() { + addressRange.setMinAddress("192.168.10.10"); + } + + @Test + public void getMaxAddress() { + addressRange.getMaxAddress(); + } + + @Test + public void setMaxAddress() { + addressRange.setMaxAddress("192.168.10.10"); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedNsTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedNsTest.java new file mode 100644 index 0000000000..06c52e2e52 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedNsTest.java @@ -0,0 +1,40 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class AffectedNsTest { + + AffectedNs affectedNs = new AffectedNs(); + + @Test + public void getNsInstanceId() { + affectedNs.getNsInstanceId(); + } + + @Test + public void setNsInstanceId() { + affectedNs.setNsInstanceId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getNsdId() { + affectedNs.getNsdId(); + } + + @Test + public void setNsdId() { + affectedNs.setNsdId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedPnfTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedPnfTest.java new file mode 100644 index 0000000000..beecbe0675 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedPnfTest.java @@ -0,0 +1,69 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class AffectedPnfTest { + AffectedPnf affectedPnf = new AffectedPnf(); + + @Test + public void getPnfid() { + affectedPnf.getPnfid(); + } + + @Test + public void setPnfid() { + affectedPnf.setPnfid("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getPnfdid() { + affectedPnf.getPnfdid(); + } + + @Test + public void setPnfdid() { + affectedPnf.setPnfdid("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getPnfProfileId() { + affectedPnf.getPnfProfileId(); + } + + @Test + public void setPnfProfileId() { + affectedPnf.setPnfProfileId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getPnfName() { + affectedPnf.getPnfName(); + } + + @Test + public void setPnfName() { + affectedPnf.setPnfName("Router"); + } + + @Test + public void getCpInstanceId() { + affectedPnf.getCpInstanceId(); + } + + @Test + public void setCpInstanceId() { + affectedPnf.setCpInstanceId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedSapTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedSapTest.java new file mode 100644 index 0000000000..b96fe32836 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedSapTest.java @@ -0,0 +1,49 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class AffectedSapTest { + AffectedSap affectedSap = new AffectedSap(); + + @Test + public void getSapInstanceId() { + affectedSap.getSapInstanceId(); + } + + @Test + public void setSapInstanceId() { + affectedSap.setSapInstanceId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getSapdId() { + affectedSap.getSapdId(); + } + + @Test + public void setSapdId() { + affectedSap.setSapdId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getSapName() { + affectedSap.getSapName(); + } + + @Test + public void setSapName() { + affectedSap.setSapName("Dummy SAP"); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedVirtualLinkTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedVirtualLinkTest.java new file mode 100644 index 0000000000..dbc6d0811f --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedVirtualLinkTest.java @@ -0,0 +1,49 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class AffectedVirtualLinkTest { + AffectedVirtualLink affectedVirtualLink = new AffectedVirtualLink(); + + @Test + public void getNsVirtualLinkInstanceId() { + affectedVirtualLink.getNsVirtualLinkInstanceId(); + } + + @Test + public void setNsVirtualLinkInstanceId() { + affectedVirtualLink.setNsVirtualLinkInstanceId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getNsVirtualLinkDescId() { + affectedVirtualLink.getNsVirtualLinkDescId(); + } + + @Test + public void setNsVirtualLinkDescId() { + affectedVirtualLink.setNsVirtualLinkDescId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getVlProfileId() { + affectedVirtualLink.getVlProfileId(); + } + + @Test + public void setVlProfileId() { + affectedVirtualLink.setVlProfileId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedVnfTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedVnfTest.java new file mode 100644 index 0000000000..810f32d005 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedVnfTest.java @@ -0,0 +1,69 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class AffectedVnfTest { + AffectedVnf affectedVnf = new AffectedVnf(); + + @Test + public void getVnfInstanceId() { + affectedVnf.getVnfInstanceId(); + } + + @Test + public void setVnfInstanceId() { + affectedVnf.setVnfInstanceId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getVnfdId() { + affectedVnf.getVnfdId(); + } + + @Test + public void setVnfdId() { + affectedVnf.setVnfdId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getVnfProfileId() { + affectedVnf.getVnfProfileId(); + } + + @Test + public void setVnfProfileId() { + affectedVnf.setVnfProfileId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getVnfName() { + affectedVnf.getVnfName(); + } + + @Test + public void setVnfName() { + affectedVnf.setVnfName("Dummy Vnf Name"); + } + + @Test + public void getChangedInfo() { + affectedVnf.getChangedInfo(); + } + + @Test + public void setChangedInfo() { + affectedVnf.setChangedInfo(new ChangedInfo()); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedVnffgTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedVnffgTest.java new file mode 100644 index 0000000000..0d5670133d --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffectedVnffgTest.java @@ -0,0 +1,39 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class AffectedVnffgTest { + AffectedVnffg affectedVnffg = new AffectedVnffg(); + + @Test + public void getVnffgInstanceId() { + affectedVnffg.getVnffgInstanceId(); + } + + @Test + public void setVnffgInstanceId() { + affectedVnffg.setVnffgInstanceId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getVnffgdId() { + affectedVnffg.getVnffgdId(); + } + + @Test + public void setVnffgdId() { + affectedVnffg.setVnffgdId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffinityOrAntiAffinityRuleTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffinityOrAntiAffinityRuleTest.java new file mode 100644 index 0000000000..99a40e4ee1 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/AffinityOrAntiAffinityRuleTest.java @@ -0,0 +1,283 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import java.util.Collection; +import java.util.Iterator; +import java.util.List; +import java.util.ListIterator; +import static org.junit.Assert.*; + +public class AffinityOrAntiAffinityRuleTest { + AffinityOrAntiAffinityRule affinityOrAntiAffinityRule = new AffinityOrAntiAffinityRule(); + + @Test + public void getVnfdId() { + affinityOrAntiAffinityRule.getVnfdId(); + } + + @Test + public void setVnfdId() { + affinityOrAntiAffinityRule.setVnfdId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getVnfProfileId() { + affinityOrAntiAffinityRule.getVnfProfileId(); + } + + @Test + public void setVnfProfileId() { + affinityOrAntiAffinityRule.setVnfProfileId(new List<String>() { + @Override + public int size() { + return 0; + } + + @Override + public boolean isEmpty() { + return false; + } + + @Override + public boolean contains(Object o) { + return false; + } + + @Override + public Iterator<String> iterator() { + return null; + } + + @Override + public Object[] toArray() { + return new Object[0]; + } + + @Override + public <T> T[] toArray(T[] a) { + return null; + } + + @Override + public boolean add(String s) { + return false; + } + + @Override + public boolean remove(Object o) { + return false; + } + + @Override + public boolean containsAll(Collection<?> c) { + return false; + } + + @Override + public boolean addAll(Collection<? extends String> c) { + return false; + } + + @Override + public boolean addAll(int index, Collection<? extends String> c) { + return false; + } + + @Override + public boolean removeAll(Collection<?> c) { + return false; + } + + @Override + public boolean retainAll(Collection<?> c) { + return false; + } + + @Override + public void clear() { + + } + + @Override + public String get(int index) { + return null; + } + + @Override + public String set(int index, String element) { + return null; + } + + @Override + public void add(int index, String element) { + + } + + @Override + public String remove(int index) { + return null; + } + + @Override + public int indexOf(Object o) { + return 0; + } + + @Override + public int lastIndexOf(Object o) { + return 0; + } + + @Override + public ListIterator<String> listIterator() { + return null; + } + + @Override + public ListIterator<String> listIterator(int index) { + return null; + } + + @Override + public List<String> subList(int fromIndex, int toIndex) { + return null; + } + }); + } + + @Test + public void getVnfInstanceId() { + affinityOrAntiAffinityRule.getVnfInstanceId(); + } + + @Test + public void setVnfInstanceId() { + affinityOrAntiAffinityRule.setVnfInstanceId(new List<String>() { + @Override + public int size() { + return 0; + } + + @Override + public boolean isEmpty() { + return false; + } + + @Override + public boolean contains(Object o) { + return false; + } + + @Override + public Iterator<String> iterator() { + return null; + } + + @Override + public Object[] toArray() { + return new Object[0]; + } + + @Override + public <T> T[] toArray(T[] a) { + return null; + } + + @Override + public boolean add(String s) { + return false; + } + + @Override + public boolean remove(Object o) { + return false; + } + + @Override + public boolean containsAll(Collection<?> c) { + return false; + } + + @Override + public boolean addAll(Collection<? extends String> c) { + return false; + } + + @Override + public boolean addAll(int index, Collection<? extends String> c) { + return false; + } + + @Override + public boolean removeAll(Collection<?> c) { + return false; + } + + @Override + public boolean retainAll(Collection<?> c) { + return false; + } + + @Override + public void clear() { + + } + + @Override + public String get(int index) { + return null; + } + + @Override + public String set(int index, String element) { + return null; + } + + @Override + public void add(int index, String element) { + + } + + @Override + public String remove(int index) { + return null; + } + + @Override + public int indexOf(Object o) { + return 0; + } + + @Override + public int lastIndexOf(Object o) { + return 0; + } + + @Override + public ListIterator<String> listIterator() { + return null; + } + + @Override + public ListIterator<String> listIterator(int index) { + return null; + } + + @Override + public List<String> subList(int fromIndex, int toIndex) { + return null; + } + }); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ChangedInfoTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ChangedInfoTest.java new file mode 100644 index 0000000000..41077fbe67 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ChangedInfoTest.java @@ -0,0 +1,39 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class ChangedInfoTest { + ChangedInfo changedInfo = new ChangedInfo(); + + @Test + public void getChangedVnfInfo() { + changedInfo.getChangedVnfInfo(); + } + + @Test + public void setChangedVnfInfo() { + changedInfo.setChangedVnfInfo(new ModifyVnfInfoData()); + } + + @Test + public void getChangedExtConnectivity() { + changedInfo.getChangedExtConnectivity(); + } + + @Test + public void setChangedExtConnectivity() { + changedInfo.setChangedExtConnectivity(new ExtVirtualLinkInfo()); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/CivicAddressElementTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/CivicAddressElementTest.java new file mode 100644 index 0000000000..e9c011b86a --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/CivicAddressElementTest.java @@ -0,0 +1,39 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class CivicAddressElementTest { + CivicAddressElement civicAddressElement = new CivicAddressElement(); + + @Test + public void getCaType() { + civicAddressElement.getCaType(); + } + + @Test + public void setCaType() { + civicAddressElement.setCaType(12); + } + + @Test + public void getCaValue() { + civicAddressElement.getCaValue(); + } + + @Test + public void setCaValue() { + civicAddressElement.setCaValue("Dummy Ca value"); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/CpProtocolDataTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/CpProtocolDataTest.java new file mode 100644 index 0000000000..e47d02c926 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/CpProtocolDataTest.java @@ -0,0 +1,39 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class CpProtocolDataTest { + CpProtocolData cpProtocolData = new CpProtocolData(); + + @Test + public void getLayerProtocol() { + cpProtocolData.getLayerProtocol(); + } + + @Test + public void setLayerProtocol() { + cpProtocolData.setLayerProtocol("BGP"); + } + + @Test + public void getIpOverEthernet() { + cpProtocolData.getIpOverEthernet(); + } + + @Test + public void setIpOverEthernet() { + cpProtocolData.setIpOverEthernet(new IpOverEthernetAddressData()); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/CreateNsRequestTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/CreateNsRequestTest.java new file mode 100644 index 0000000000..a2a6ae4fe1 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/CreateNsRequestTest.java @@ -0,0 +1,49 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class CreateNsRequestTest { + CreateNsRequest createNsRequest = new CreateNsRequest(); + + @Test + public void getNsdId() { + createNsRequest.getNsdId(); + } + + @Test + public void setNsdId() { + createNsRequest.setNsdId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getNsDescription() { + createNsRequest.getNsDescription(); + } + + @Test + public void setNsDescription() { + createNsRequest.setNsDescription("Dummy description"); + } + + @Test + public void getNsName() { + createNsRequest.getNsName(); + } + + @Test + public void setNsName() { + createNsRequest.setNsName("Dummy Name"); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ExtLinkPortInfoTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ExtLinkPortInfoTest.java new file mode 100644 index 0000000000..92cec88b34 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ExtLinkPortInfoTest.java @@ -0,0 +1,40 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class ExtLinkPortInfoTest { + + ExtLinkPortInfo extLinkPortInfo = new ExtLinkPortInfo(); + + @Test + public void getId() { + extLinkPortInfo.getId(); + } + + @Test + public void setId() { + extLinkPortInfo.setId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getResourceHandle() { + extLinkPortInfo.getResourceHandle(); + } + + @Test + public void setResourceHandle() { + extLinkPortInfo.setResourceHandle(new ResourceHandle()); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ExtVirtualLinkInfoTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ExtVirtualLinkInfoTest.java new file mode 100644 index 0000000000..c455b36a46 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ExtVirtualLinkInfoTest.java @@ -0,0 +1,49 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class ExtVirtualLinkInfoTest { + ExtVirtualLinkInfo extVirtualLinkInfo = new ExtVirtualLinkInfo(); + + @Test + public void getId() { + extVirtualLinkInfo.getId(); + } + + @Test + public void setId() { + extVirtualLinkInfo.setId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getResourceHandle() { + extVirtualLinkInfo.getResourceHandle(); + } + + @Test + public void setResourceHandle() { + extVirtualLinkInfo.setResourceHandle(new ResourceHandle()); + } + + @Test + public void getExtLinkPorts() { + extVirtualLinkInfo.getExtLinkPorts(); + } + + @Test + public void setExtLinkPorts() { + extVirtualLinkInfo.setExtLinkPorts(new ExtLinkPortInfo()); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/InstantiateNsRequestTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/InstantiateNsRequestTest.java new file mode 100644 index 0000000000..f27b041690 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/InstantiateNsRequestTest.java @@ -0,0 +1,413 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import java.util.Collection; +import java.util.Iterator; +import java.util.List; +import java.util.ListIterator; +import static org.junit.Assert.*; + +public class InstantiateNsRequestTest { + InstantiateNsRequest instantiateNsRequest = new InstantiateNsRequest(); + + @Test + public void getNsFlavourId() { + instantiateNsRequest.getNsFlavourId(); + } + + @Test + public void setNsFlavourId() { + instantiateNsRequest.setNsFlavourId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getSapData() { + instantiateNsRequest.getSapData(); + } + + @Test + public void setSapData() { + instantiateNsRequest.setSapData(new List<SapData>() { + @Override + public int size() { + return 0; + } + + @Override + public boolean isEmpty() { + return false; + } + + @Override + public boolean contains(Object o) { + return false; + } + + @Override + public Iterator<SapData> iterator() { + return null; + } + + @Override + public Object[] toArray() { + return new Object[0]; + } + + @Override + public <T> T[] toArray(T[] a) { + return null; + } + + @Override + public boolean add(SapData sapData) { + return false; + } + + @Override + public boolean remove(Object o) { + return false; + } + + @Override + public boolean containsAll(Collection<?> c) { + return false; + } + + @Override + public boolean addAll(Collection<? extends SapData> c) { + return false; + } + + @Override + public boolean addAll(int index, Collection<? extends SapData> c) { + return false; + } + + @Override + public boolean removeAll(Collection<?> c) { + return false; + } + + @Override + public boolean retainAll(Collection<?> c) { + return false; + } + + @Override + public void clear() { + + } + + @Override + public SapData get(int index) { + return null; + } + + @Override + public SapData set(int index, SapData element) { + return null; + } + + @Override + public void add(int index, SapData element) { + + } + + @Override + public SapData remove(int index) { + return null; + } + + @Override + public int indexOf(Object o) { + return 0; + } + + @Override + public int lastIndexOf(Object o) { + return 0; + } + + @Override + public ListIterator<SapData> listIterator() { + return null; + } + + @Override + public ListIterator<SapData> listIterator(int index) { + return null; + } + + @Override + public List<SapData> subList(int fromIndex, int toIndex) { + return null; + } + }); + } + + @Test + public void getAddpnfData() { + instantiateNsRequest.getAddpnfData(); + } + + @Test + public void setAddpnfData() { + instantiateNsRequest.setAddpnfData(new List<AddPnfData>() { + @Override + public int size() { + return 0; + } + + @Override + public boolean isEmpty() { + return false; + } + + @Override + public boolean contains(Object o) { + return false; + } + + @Override + public Iterator<AddPnfData> iterator() { + return null; + } + + @Override + public Object[] toArray() { + return new Object[0]; + } + + @Override + public <T> T[] toArray(T[] a) { + return null; + } + + @Override + public boolean add(AddPnfData addPnfData) { + return false; + } + + @Override + public boolean remove(Object o) { + return false; + } + + @Override + public boolean containsAll(Collection<?> c) { + return false; + } + + @Override + public boolean addAll(Collection<? extends AddPnfData> c) { + return false; + } + + @Override + public boolean addAll(int index, Collection<? extends AddPnfData> c) { + return false; + } + + @Override + public boolean removeAll(Collection<?> c) { + return false; + } + + @Override + public boolean retainAll(Collection<?> c) { + return false; + } + + @Override + public void clear() { + + } + + @Override + public AddPnfData get(int index) { + return null; + } + + @Override + public AddPnfData set(int index, AddPnfData element) { + return null; + } + + @Override + public void add(int index, AddPnfData element) { + + } + + @Override + public AddPnfData remove(int index) { + return null; + } + + @Override + public int indexOf(Object o) { + return 0; + } + + @Override + public int lastIndexOf(Object o) { + return 0; + } + + @Override + public ListIterator<AddPnfData> listIterator() { + return null; + } + + @Override + public ListIterator<AddPnfData> listIterator(int index) { + return null; + } + + @Override + public List<AddPnfData> subList(int fromIndex, int toIndex) { + return null; + } + }); + } + + @Test + public void getVnfInstanceData() { + instantiateNsRequest.getVnfInstanceData(); + } + + @Test + public void setVnfInstanceData() { + instantiateNsRequest.setVnfInstanceData(new List<VnfInstanceData>() { + @Override + public int size() { + return 0; + } + + @Override + public boolean isEmpty() { + return false; + } + + @Override + public boolean contains(Object o) { + return false; + } + + @Override + public Iterator<VnfInstanceData> iterator() { + return null; + } + + @Override + public Object[] toArray() { + return new Object[0]; + } + + @Override + public <T> T[] toArray(T[] a) { + return null; + } + + @Override + public boolean add(VnfInstanceData vnfInstanceData) { + return false; + } + + @Override + public boolean remove(Object o) { + return false; + } + + @Override + public boolean containsAll(Collection<?> c) { + return false; + } + + @Override + public boolean addAll(Collection<? extends VnfInstanceData> c) { + return false; + } + + @Override + public boolean addAll(int index, Collection<? extends VnfInstanceData> c) { + return false; + } + + @Override + public boolean removeAll(Collection<?> c) { + return false; + } + + @Override + public boolean retainAll(Collection<?> c) { + return false; + } + + @Override + public void clear() { + + } + + @Override + public VnfInstanceData get(int index) { + return null; + } + + @Override + public VnfInstanceData set(int index, VnfInstanceData element) { + return null; + } + + @Override + public void add(int index, VnfInstanceData element) { + + } + + @Override + public VnfInstanceData remove(int index) { + return null; + } + + @Override + public int indexOf(Object o) { + return 0; + } + + @Override + public int lastIndexOf(Object o) { + return 0; + } + + @Override + public ListIterator<VnfInstanceData> listIterator() { + return null; + } + + @Override + public ListIterator<VnfInstanceData> listIterator(int index) { + return null; + } + + @Override + public List<VnfInstanceData> subList(int fromIndex, int toIndex) { + return null; + } + }); + } + + @Test + public void getNestedNsInstanceId() { + instantiateNsRequest.getNestedNsInstanceId(); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/IpAddressesTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/IpAddressesTest.java new file mode 100644 index 0000000000..edf6346bca --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/IpAddressesTest.java @@ -0,0 +1,188 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import java.util.Collection; +import java.util.Iterator; +import java.util.List; +import java.util.ListIterator; +import static org.junit.Assert.*; + +public class IpAddressesTest { + IpAddresses ipAddresses = new IpAddresses(); + + @Test + public void getType() { + ipAddresses.getType(); + } + + @Test + public void setType() { + ipAddresses.setType("Dummy Type"); + } + + @Test + public void getFixedAddresses() { + ipAddresses.getFixedAddresses(); + } + + @Test + public void setFixedAddresses() { + ipAddresses.setFixedAddresses(new List<String>() { + @Override + public int size() { + return 0; + } + + @Override + public boolean isEmpty() { + return false; + } + + @Override + public boolean contains(Object o) { + return false; + } + + @Override + public Iterator<String> iterator() { + return null; + } + + @Override + public Object[] toArray() { + return new Object[0]; + } + + @Override + public <T> T[] toArray(T[] a) { + return null; + } + + @Override + public boolean add(String s) { + return false; + } + + @Override + public boolean remove(Object o) { + return false; + } + + @Override + public boolean containsAll(Collection<?> c) { + return false; + } + + @Override + public boolean addAll(Collection<? extends String> c) { + return false; + } + + @Override + public boolean addAll(int index, Collection<? extends String> c) { + return false; + } + + @Override + public boolean removeAll(Collection<?> c) { + return false; + } + + @Override + public boolean retainAll(Collection<?> c) { + return false; + } + + @Override + public void clear() { + + } + + @Override + public String get(int index) { + return null; + } + + @Override + public String set(int index, String element) { + return null; + } + + @Override + public void add(int index, String element) { + + } + + @Override + public String remove(int index) { + return null; + } + + @Override + public int indexOf(Object o) { + return 0; + } + + @Override + public int lastIndexOf(Object o) { + return 0; + } + + @Override + public ListIterator<String> listIterator() { + return null; + } + + @Override + public ListIterator<String> listIterator(int index) { + return null; + } + + @Override + public List<String> subList(int fromIndex, int toIndex) { + return null; + } + }); + } + + @Test + public void getNumDynamicAddresses() { + ipAddresses.getNumDynamicAddresses(); + } + + @Test + public void setNumDynamicAddresses() { + ipAddresses.setNumDynamicAddresses(5); + } + + @Test + public void getAddressRange() { + ipAddresses.getAddressRange(); + } + + @Test + public void setAddressRange() { + ipAddresses.setAddressRange(new AddressRange()); + } + + @Test + public void getSubnetId() { + ipAddresses.getSubnetId(); + } + + @Test + public void setSubnetId() { + ipAddresses.setSubnetId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/IpOverEthernetAddressDataTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/IpOverEthernetAddressDataTest.java new file mode 100644 index 0000000000..0088cdc50b --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/IpOverEthernetAddressDataTest.java @@ -0,0 +1,158 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import java.util.Collection; +import java.util.Iterator; +import java.util.List; +import java.util.ListIterator; +import static org.junit.Assert.*; + +public class IpOverEthernetAddressDataTest { + IpOverEthernetAddressData ipOverEthernetAddressData = new IpOverEthernetAddressData(); + + @Test + public void getMacAddress() { + ipOverEthernetAddressData.getMacAddress(); + } + + @Test + public void setMacAddress() { + ipOverEthernetAddressData.setMacAddress("4e:86:9f:62:c1:bf"); + } + + @Test + public void getIpAddresses() { + ipOverEthernetAddressData.getIpAddresses(); + } + + @Test + public void setIpAddresses() { + ipOverEthernetAddressData.setIpAddresses(new List<IpAddresses>() { + @Override + public int size() { + return 0; + } + + @Override + public boolean isEmpty() { + return false; + } + + @Override + public boolean contains(Object o) { + return false; + } + + @Override + public Iterator<IpAddresses> iterator() { + return null; + } + + @Override + public Object[] toArray() { + return new Object[0]; + } + + @Override + public <T> T[] toArray(T[] a) { + return null; + } + + @Override + public boolean add(IpAddresses ipAddresses) { + return false; + } + + @Override + public boolean remove(Object o) { + return false; + } + + @Override + public boolean containsAll(Collection<?> c) { + return false; + } + + @Override + public boolean addAll(Collection<? extends IpAddresses> c) { + return false; + } + + @Override + public boolean addAll(int index, Collection<? extends IpAddresses> c) { + return false; + } + + @Override + public boolean removeAll(Collection<?> c) { + return false; + } + + @Override + public boolean retainAll(Collection<?> c) { + return false; + } + + @Override + public void clear() { + + } + + @Override + public IpAddresses get(int index) { + return null; + } + + @Override + public IpAddresses set(int index, IpAddresses element) { + return null; + } + + @Override + public void add(int index, IpAddresses element) { + + } + + @Override + public IpAddresses remove(int index) { + return null; + } + + @Override + public int indexOf(Object o) { + return 0; + } + + @Override + public int lastIndexOf(Object o) { + return 0; + } + + @Override + public ListIterator<IpAddresses> listIterator() { + return null; + } + + @Override + public ListIterator<IpAddresses> listIterator(int index) { + return null; + } + + @Override + public List<IpAddresses> subList(int fromIndex, int toIndex) { + return null; + } + }); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/LinkTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/LinkTest.java new file mode 100644 index 0000000000..e447c85ee7 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/LinkTest.java @@ -0,0 +1,29 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class LinkTest { + Link link = new Link(); + + @Test + public void getHref() { + link.getHref(); + } + + @Test + public void setHref() { + link.setHref("dummy href"); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/LinksTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/LinksTest.java new file mode 100644 index 0000000000..aef87c47b1 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/LinksTest.java @@ -0,0 +1,89 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class LinksTest { + Links links = new Links(); + + @Test + public void getSelf() { + links.getSelf(); + } + + @Test + public void setSelf() { + links.setSelf(new Link()); + } + + @Test + public void getNsInstance() { + links.getNsInstance(); + } + + @Test + public void setNsInstance() { + links.setNsInstance(new Link()); + } + + @Test + public void getCancel() { + links.getCancel(); + } + + @Test + public void setCancel() { + links.setCancel(new Link()); + } + + @Test + public void getRetry() { + links.getRetry(); + } + + @Test + public void setRetry() { + links.setRetry(new Link()); + } + + @Test + public void getRollback() { + links.getRollback(); + } + + @Test + public void setRollback() { + links.setRollback(new Link()); + } + + @Test + public void getContinues() { + links.getContinues(); + } + + @Test + public void setContinues() { + links.setContinues(new Link()); + } + + @Test + public void getFail() { + links.getFail(); + } + + @Test + public void setFail() { + links.setFail(new Link()); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/LocationConstraintsTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/LocationConstraintsTest.java new file mode 100644 index 0000000000..e68b12a626 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/LocationConstraintsTest.java @@ -0,0 +1,40 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class LocationConstraintsTest { + LocationConstraints locationConstraints = new LocationConstraints(); + + @Test + public void getCountryCode() { + locationConstraints.getCountryCode(); + } + + @Test + public void setCountryCode() { + locationConstraints.setCountryCode("IND"); + + } + + @Test + public void getCivicAddressElement() { + locationConstraints.getCivicAddressElement(); + } + + @Test + public void setCivicAddressElement() { + locationConstraints.setCivicAddressElement(new CivicAddressElement()); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ModifyVnfInfoDataTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ModifyVnfInfoDataTest.java new file mode 100644 index 0000000000..c300923857 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ModifyVnfInfoDataTest.java @@ -0,0 +1,90 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import java.util.HashMap; +import static org.junit.Assert.*; + +public class ModifyVnfInfoDataTest { + ModifyVnfInfoData modifyVnfInfoData = new ModifyVnfInfoData(); + + @Test + public void getVnfInstanceId() { + modifyVnfInfoData.getVnfInstanceId(); + } + + @Test + public void setVnfInstanceId() { + modifyVnfInfoData.setVnfInstanceId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getVnfInstanceName() { + modifyVnfInfoData.getVnfInstanceName(); + } + + @Test + public void setVnfInstanceName() { + modifyVnfInfoData.setVnfInstanceName("Dummy vnfInstanceName"); + } + + @Test + public void getVnfInstanceDescription() { + modifyVnfInfoData.getVnfInstanceDescription(); + } + + @Test + public void setVnfInstanceDescription() { + modifyVnfInfoData.setVnfInstanceDescription("Dummy vnfInstanceDescription"); + } + + @Test + public void getVnfPkgId() { + modifyVnfInfoData.getVnfPkgId(); + } + + @Test + public void setVnfPkgId() { + modifyVnfInfoData.setVnfPkgId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getVnfConfigurableProperties() { + modifyVnfInfoData.getVnfConfigurableProperties(); + } + + @Test + public void setVnfConfigurableProperties() { + modifyVnfInfoData.setVnfConfigurableProperties(new HashMap<>()); + } + + @Test + public void getMetadata() { + modifyVnfInfoData.getMetadata(); + } + + @Test + public void setMetadata() { + modifyVnfInfoData.setMetadata(new HashMap<>()); + } + + @Test + public void getExtensions() { + modifyVnfInfoData.getExtensions(); + } + + @Test + public void setExtensions() { + modifyVnfInfoData.setExtensions(new HashMap<>()); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/NsLcmOpOccTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/NsLcmOpOccTest.java new file mode 100644 index 0000000000..f5d485a8c7 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/NsLcmOpOccTest.java @@ -0,0 +1,142 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import org.onap.so.adapters.vfc.constant.CommonConstant; +import java.time.LocalDateTime; +import java.util.Date; +import static org.junit.Assert.*; + +public class NsLcmOpOccTest { + NsLcmOpOcc nsLcmOpOcc = new NsLcmOpOcc(); + + @Test + public void getLcmOperationType() { + nsLcmOpOcc.getLcmOperationType(); + } + + @Test + public void setLcmOperationType() { + nsLcmOpOcc.setLcmOperationType(CommonConstant.lcmOperationType.INSTANTIATE); + } + + @Test + public void getCancelMode() { + nsLcmOpOcc.getCancelMode(); + } + + @Test + public void setCancelMode() { + nsLcmOpOcc.setCancelMode(CommonConstant.cancelMode.GRACEFUL); + } + + @Test + public void getOperationState() { + nsLcmOpOcc.getOperationState(); + } + + @Test + public void setOperationState() { + nsLcmOpOcc.setOperationState(CommonConstant.operationState.COMPLETED); + } + + @Test + public void getId() { + nsLcmOpOcc.getId(); + } + + @Test + public void setId() { + nsLcmOpOcc.setId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getStatusEnteredTime() { + nsLcmOpOcc.getStatusEnteredTime(); + } + + @Test + public void setStatusEnteredTime() { + nsLcmOpOcc.setStatusEnteredTime(LocalDateTime.now().toString()); + } + + @Test + public void getNsInstanceId() { + nsLcmOpOcc.getNsInstanceId(); + } + + @Test + public void setNsInstanceId() { + nsLcmOpOcc.setNsInstanceId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getStartTime() { + nsLcmOpOcc.getStartTime(); + } + + @Test + public void setStartTime() { + nsLcmOpOcc.setStartTime(LocalDateTime.now().toString()); + } + + @Test + public void getAutomaticInvocation() { + nsLcmOpOcc.getAutomaticInvocation(); + } + + @Test + public void setAutomaticInvocation() { + nsLcmOpOcc.setAutomaticInvocation(true); + } + + @Test + public void getOperationParams() { + nsLcmOpOcc.getOperationParams(); + } + + @Test + public void setOperationParams() { + nsLcmOpOcc.setOperationParams("Dummy operationParams"); + } + + @Test + public void getCancelPending() { + nsLcmOpOcc.getCancelPending(); + } + + @Test + public void setCancelPending() { + nsLcmOpOcc.setCancelPending(true); + } + + @Test + public void getError() { + nsLcmOpOcc.getError(); + } + + @Test + public void setError() { + nsLcmOpOcc.setError(new ProblemDetails()); + } + + @Test + public void getLinks() { + nsLcmOpOcc.getLinks(); + } + + @Test + public void setLinks() { + nsLcmOpOcc.setLinks(new Links()); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ParamsForVnfTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ParamsForVnfTest.java new file mode 100644 index 0000000000..e0455b0728 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ParamsForVnfTest.java @@ -0,0 +1,41 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import java.util.HashMap; +import static org.junit.Assert.*; + +public class ParamsForVnfTest { + + ParamsForVnf paramsForVnf = new ParamsForVnf(); + + @Test + public void getVnfProfileId() { + paramsForVnf.getVnfProfileId(); + } + + @Test + public void setVnfProfileId() { + paramsForVnf.setVnfProfileId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getAdditionalParams() { + paramsForVnf.getAdditionalParams(); + } + + @Test + public void setAdditionalParams() { + paramsForVnf.setAdditionalParams(new HashMap<>()); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/PnfExtCpDataTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/PnfExtCpDataTest.java new file mode 100644 index 0000000000..c586c7eb65 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/PnfExtCpDataTest.java @@ -0,0 +1,168 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import java.util.Collection; +import java.util.Iterator; +import java.util.List; +import java.util.ListIterator; +import static org.junit.Assert.*; + +public class PnfExtCpDataTest { + PnfExtCpData pnfExtCpData = new PnfExtCpData(); + + @Test + public void getCpInstanceI16() { + pnfExtCpData.getCpInstanceI16(); + } + + @Test + public void setCpInstanceI16() { + pnfExtCpData.setCpInstanceI16("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getCpdId() { + pnfExtCpData.getCpdId(); + } + + @Test + public void setCpdId() { + pnfExtCpData.setCpdId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getCpProtocolData() { + pnfExtCpData.getCpProtocolData(); + } + + @Test + public void setCpProtocolData() { + pnfExtCpData.setCpProtocolData(new List<CpProtocolData>() { + @Override + public int size() { + return 0; + } + + @Override + public boolean isEmpty() { + return false; + } + + @Override + public boolean contains(Object o) { + return false; + } + + @Override + public Iterator<CpProtocolData> iterator() { + return null; + } + + @Override + public Object[] toArray() { + return new Object[0]; + } + + @Override + public <T> T[] toArray(T[] a) { + return null; + } + + @Override + public boolean add(CpProtocolData cpProtocolData) { + return false; + } + + @Override + public boolean remove(Object o) { + return false; + } + + @Override + public boolean containsAll(Collection<?> c) { + return false; + } + + @Override + public boolean addAll(Collection<? extends CpProtocolData> c) { + return false; + } + + @Override + public boolean addAll(int index, Collection<? extends CpProtocolData> c) { + return false; + } + + @Override + public boolean removeAll(Collection<?> c) { + return false; + } + + @Override + public boolean retainAll(Collection<?> c) { + return false; + } + + @Override + public void clear() { + + } + + @Override + public CpProtocolData get(int index) { + return null; + } + + @Override + public CpProtocolData set(int index, CpProtocolData element) { + return null; + } + + @Override + public void add(int index, CpProtocolData element) { + + } + + @Override + public CpProtocolData remove(int index) { + return null; + } + + @Override + public int indexOf(Object o) { + return 0; + } + + @Override + public int lastIndexOf(Object o) { + return 0; + } + + @Override + public ListIterator<CpProtocolData> listIterator() { + return null; + } + + @Override + public ListIterator<CpProtocolData> listIterator(int index) { + return null; + } + + @Override + public List<CpProtocolData> subList(int fromIndex, int toIndex) { + return null; + } + }); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ProblemDetailsTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ProblemDetailsTest.java new file mode 100644 index 0000000000..ddea6cca40 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ProblemDetailsTest.java @@ -0,0 +1,69 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class ProblemDetailsTest { + ProblemDetails problemDetails = new ProblemDetails(); + + @Test + public void getType() { + problemDetails.getType(); + } + + @Test + public void setType() { + problemDetails.setType("Dummy Type"); + } + + @Test + public void getTitle() { + problemDetails.getTitle(); + } + + @Test + public void setTitle() { + problemDetails.setTitle("Dummy Title"); + } + + @Test + public void getStatus() { + problemDetails.getStatus(); + } + + @Test + public void setStatus() { + problemDetails.setStatus(200); + } + + @Test + public void getDetail() { + problemDetails.getDetail(); + } + + @Test + public void setDetail() { + problemDetails.setTitle("Dummy Title"); + } + + @Test + public void getInstance() { + problemDetails.getInstance(); + } + + @Test + public void setInstance() { + problemDetails.setInstance("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ResourceChangesTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ResourceChangesTest.java new file mode 100644 index 0000000000..9c4a0295e6 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ResourceChangesTest.java @@ -0,0 +1,773 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import java.util.Collection; +import java.util.Iterator; +import java.util.List; +import java.util.ListIterator; +import static org.junit.Assert.*; + +public class ResourceChangesTest { + ResourceChanges resourceChanges = new ResourceChanges(); + + @Test + public void getAffectedVnfs() { + resourceChanges.getAffectedVnfs(); + } + + @Test + public void setAffectedVnfs() { + resourceChanges.setAffectedVnfs(new List<AffectedVnf>() { + @Override + public int size() { + return 0; + } + + @Override + public boolean isEmpty() { + return false; + } + + @Override + public boolean contains(Object o) { + return false; + } + + @Override + public Iterator<AffectedVnf> iterator() { + return null; + } + + @Override + public Object[] toArray() { + return new Object[0]; + } + + @Override + public <T> T[] toArray(T[] a) { + return null; + } + + @Override + public boolean add(AffectedVnf affectedVnf) { + return false; + } + + @Override + public boolean remove(Object o) { + return false; + } + + @Override + public boolean containsAll(Collection<?> c) { + return false; + } + + @Override + public boolean addAll(Collection<? extends AffectedVnf> c) { + return false; + } + + @Override + public boolean addAll(int index, Collection<? extends AffectedVnf> c) { + return false; + } + + @Override + public boolean removeAll(Collection<?> c) { + return false; + } + + @Override + public boolean retainAll(Collection<?> c) { + return false; + } + + @Override + public void clear() { + + } + + @Override + public AffectedVnf get(int index) { + return null; + } + + @Override + public AffectedVnf set(int index, AffectedVnf element) { + return null; + } + + @Override + public void add(int index, AffectedVnf element) { + + } + + @Override + public AffectedVnf remove(int index) { + return null; + } + + @Override + public int indexOf(Object o) { + return 0; + } + + @Override + public int lastIndexOf(Object o) { + return 0; + } + + @Override + public ListIterator<AffectedVnf> listIterator() { + return null; + } + + @Override + public ListIterator<AffectedVnf> listIterator(int index) { + return null; + } + + @Override + public List<AffectedVnf> subList(int fromIndex, int toIndex) { + return null; + } + }); + } + + @Test + public void getAffectedPnfs() { + resourceChanges.getAffectedPnfs(); + } + + @Test + public void setAffectedPnfs() { + resourceChanges.setAffectedPnfs(new List<AffectedPnf>() { + @Override + public int size() { + return 0; + } + + @Override + public boolean isEmpty() { + return false; + } + + @Override + public boolean contains(Object o) { + return false; + } + + @Override + public Iterator<AffectedPnf> iterator() { + return null; + } + + @Override + public Object[] toArray() { + return new Object[0]; + } + + @Override + public <T> T[] toArray(T[] a) { + return null; + } + + @Override + public boolean add(AffectedPnf affectedPnf) { + return false; + } + + @Override + public boolean remove(Object o) { + return false; + } + + @Override + public boolean containsAll(Collection<?> c) { + return false; + } + + @Override + public boolean addAll(Collection<? extends AffectedPnf> c) { + return false; + } + + @Override + public boolean addAll(int index, Collection<? extends AffectedPnf> c) { + return false; + } + + @Override + public boolean removeAll(Collection<?> c) { + return false; + } + + @Override + public boolean retainAll(Collection<?> c) { + return false; + } + + @Override + public void clear() { + + } + + @Override + public AffectedPnf get(int index) { + return null; + } + + @Override + public AffectedPnf set(int index, AffectedPnf element) { + return null; + } + + @Override + public void add(int index, AffectedPnf element) { + + } + + @Override + public AffectedPnf remove(int index) { + return null; + } + + @Override + public int indexOf(Object o) { + return 0; + } + + @Override + public int lastIndexOf(Object o) { + return 0; + } + + @Override + public ListIterator<AffectedPnf> listIterator() { + return null; + } + + @Override + public ListIterator<AffectedPnf> listIterator(int index) { + return null; + } + + @Override + public List<AffectedPnf> subList(int fromIndex, int toIndex) { + return null; + } + }); + } + + @Test + public void getAffectedVls() { + resourceChanges.getAffectedVls(); + } + + @Test + public void setAffectedVls() { + resourceChanges.setAffectedVls(new List<AffectedVirtualLink>() { + @Override + public int size() { + return 0; + } + + @Override + public boolean isEmpty() { + return false; + } + + @Override + public boolean contains(Object o) { + return false; + } + + @Override + public Iterator<AffectedVirtualLink> iterator() { + return null; + } + + @Override + public Object[] toArray() { + return new Object[0]; + } + + @Override + public <T> T[] toArray(T[] a) { + return null; + } + + @Override + public boolean add(AffectedVirtualLink affectedVirtualLink) { + return false; + } + + @Override + public boolean remove(Object o) { + return false; + } + + @Override + public boolean containsAll(Collection<?> c) { + return false; + } + + @Override + public boolean addAll(Collection<? extends AffectedVirtualLink> c) { + return false; + } + + @Override + public boolean addAll(int index, Collection<? extends AffectedVirtualLink> c) { + return false; + } + + @Override + public boolean removeAll(Collection<?> c) { + return false; + } + + @Override + public boolean retainAll(Collection<?> c) { + return false; + } + + @Override + public void clear() { + + } + + @Override + public AffectedVirtualLink get(int index) { + return null; + } + + @Override + public AffectedVirtualLink set(int index, AffectedVirtualLink element) { + return null; + } + + @Override + public void add(int index, AffectedVirtualLink element) { + + } + + @Override + public AffectedVirtualLink remove(int index) { + return null; + } + + @Override + public int indexOf(Object o) { + return 0; + } + + @Override + public int lastIndexOf(Object o) { + return 0; + } + + @Override + public ListIterator<AffectedVirtualLink> listIterator() { + return null; + } + + @Override + public ListIterator<AffectedVirtualLink> listIterator(int index) { + return null; + } + + @Override + public List<AffectedVirtualLink> subList(int fromIndex, int toIndex) { + return null; + } + }); + } + + @Test + public void getAffectedVnffgs() { + resourceChanges.getAffectedVnffgs(); + } + + @Test + public void setAffectedVnffgs() { + resourceChanges.setAffectedVnffgs(new List<AffectedVnffg>() { + @Override + public int size() { + return 0; + } + + @Override + public boolean isEmpty() { + return false; + } + + @Override + public boolean contains(Object o) { + return false; + } + + @Override + public Iterator<AffectedVnffg> iterator() { + return null; + } + + @Override + public Object[] toArray() { + return new Object[0]; + } + + @Override + public <T> T[] toArray(T[] a) { + return null; + } + + @Override + public boolean add(AffectedVnffg affectedVnffg) { + return false; + } + + @Override + public boolean remove(Object o) { + return false; + } + + @Override + public boolean containsAll(Collection<?> c) { + return false; + } + + @Override + public boolean addAll(Collection<? extends AffectedVnffg> c) { + return false; + } + + @Override + public boolean addAll(int index, Collection<? extends AffectedVnffg> c) { + return false; + } + + @Override + public boolean removeAll(Collection<?> c) { + return false; + } + + @Override + public boolean retainAll(Collection<?> c) { + return false; + } + + @Override + public void clear() { + + } + + @Override + public AffectedVnffg get(int index) { + return null; + } + + @Override + public AffectedVnffg set(int index, AffectedVnffg element) { + return null; + } + + @Override + public void add(int index, AffectedVnffg element) { + + } + + @Override + public AffectedVnffg remove(int index) { + return null; + } + + @Override + public int indexOf(Object o) { + return 0; + } + + @Override + public int lastIndexOf(Object o) { + return 0; + } + + @Override + public ListIterator<AffectedVnffg> listIterator() { + return null; + } + + @Override + public ListIterator<AffectedVnffg> listIterator(int index) { + return null; + } + + @Override + public List<AffectedVnffg> subList(int fromIndex, int toIndex) { + return null; + } + }); + } + + @Test + public void getAffectedNss() { + resourceChanges.getAffectedNss(); + } + + @Test + public void setAffectedNss() { + resourceChanges.setAffectedNss(new List<AffectedNs>() { + @Override + public int size() { + return 0; + } + + @Override + public boolean isEmpty() { + return false; + } + + @Override + public boolean contains(Object o) { + return false; + } + + @Override + public Iterator<AffectedNs> iterator() { + return null; + } + + @Override + public Object[] toArray() { + return new Object[0]; + } + + @Override + public <T> T[] toArray(T[] a) { + return null; + } + + @Override + public boolean add(AffectedNs affectedNs) { + return false; + } + + @Override + public boolean remove(Object o) { + return false; + } + + @Override + public boolean containsAll(Collection<?> c) { + return false; + } + + @Override + public boolean addAll(Collection<? extends AffectedNs> c) { + return false; + } + + @Override + public boolean addAll(int index, Collection<? extends AffectedNs> c) { + return false; + } + + @Override + public boolean removeAll(Collection<?> c) { + return false; + } + + @Override + public boolean retainAll(Collection<?> c) { + return false; + } + + @Override + public void clear() { + + } + + @Override + public AffectedNs get(int index) { + return null; + } + + @Override + public AffectedNs set(int index, AffectedNs element) { + return null; + } + + @Override + public void add(int index, AffectedNs element) { + + } + + @Override + public AffectedNs remove(int index) { + return null; + } + + @Override + public int indexOf(Object o) { + return 0; + } + + @Override + public int lastIndexOf(Object o) { + return 0; + } + + @Override + public ListIterator<AffectedNs> listIterator() { + return null; + } + + @Override + public ListIterator<AffectedNs> listIterator(int index) { + return null; + } + + @Override + public List<AffectedNs> subList(int fromIndex, int toIndex) { + return null; + } + }); + } + + @Test + public void getAffectedSaps() { + resourceChanges.getAffectedSaps(); + } + + @Test + public void setAffectedSaps() { + resourceChanges.setAffectedSaps(new List<AffectedSap>() { + @Override + public int size() { + return 0; + } + + @Override + public boolean isEmpty() { + return false; + } + + @Override + public boolean contains(Object o) { + return false; + } + + @Override + public Iterator<AffectedSap> iterator() { + return null; + } + + @Override + public Object[] toArray() { + return new Object[0]; + } + + @Override + public <T> T[] toArray(T[] a) { + return null; + } + + @Override + public boolean add(AffectedSap affectedSap) { + return false; + } + + @Override + public boolean remove(Object o) { + return false; + } + + @Override + public boolean containsAll(Collection<?> c) { + return false; + } + + @Override + public boolean addAll(Collection<? extends AffectedSap> c) { + return false; + } + + @Override + public boolean addAll(int index, Collection<? extends AffectedSap> c) { + return false; + } + + @Override + public boolean removeAll(Collection<?> c) { + return false; + } + + @Override + public boolean retainAll(Collection<?> c) { + return false; + } + + @Override + public void clear() { + + } + + @Override + public AffectedSap get(int index) { + return null; + } + + @Override + public AffectedSap set(int index, AffectedSap element) { + return null; + } + + @Override + public void add(int index, AffectedSap element) { + + } + + @Override + public AffectedSap remove(int index) { + return null; + } + + @Override + public int indexOf(Object o) { + return 0; + } + + @Override + public int lastIndexOf(Object o) { + return 0; + } + + @Override + public ListIterator<AffectedSap> listIterator() { + return null; + } + + @Override + public ListIterator<AffectedSap> listIterator(int index) { + return null; + } + + @Override + public List<AffectedSap> subList(int fromIndex, int toIndex) { + return null; + } + }); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ResourceHandleTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ResourceHandleTest.java new file mode 100644 index 0000000000..6390c5afbd --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/ResourceHandleTest.java @@ -0,0 +1,59 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class ResourceHandleTest { + ResourceHandle resourceHandle = new ResourceHandle(); + + @Test + public void getVimId() { + resourceHandle.getVimId(); + } + + @Test + public void setVimId() { + resourceHandle.setVimId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getResourceProviderId() { + resourceHandle.getResourceProviderId(); + } + + @Test + public void setResourceProviderId() { + resourceHandle.setResourceProviderId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getResourceId() { + resourceHandle.getResourceId(); + } + + @Test + public void setResourceId() { + resourceHandle.setResourceId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getVimLevelResourceType() { + resourceHandle.getVimLevelResourceType(); + } + + @Test + public void setVimLevelResourceType() { + resourceHandle.setVimLevelResourceType("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/SapDataTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/SapDataTest.java new file mode 100644 index 0000000000..2a455994b8 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/SapDataTest.java @@ -0,0 +1,179 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import java.util.Collection; +import java.util.Iterator; +import java.util.List; +import java.util.ListIterator; +import static org.junit.Assert.*; + +public class SapDataTest { + + SapData sapData = new SapData(); + + @Test + public void getSapdId() { + sapData.getSapdId(); + } + + @Test + public void setSapdId() { + sapData.setSapdId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getSapName() { + sapData.getSapName(); + } + + @Test + public void setSapName() { + sapData.setSapName("Dummy SapName"); + } + + @Test + public void getDescription() { + sapData.getDescription(); + } + + @Test + public void setDescription() { + sapData.setDescription("Dummy Description"); + } + + @Test + public void getSapProtocolData() { + sapData.getSapProtocolData(); + } + + @Test + public void setSapProtocolData() { + sapData.setSapProtocolData(new List<CpProtocolData>() { + @Override + public int size() { + return 0; + } + + @Override + public boolean isEmpty() { + return false; + } + + @Override + public boolean contains(Object o) { + return false; + } + + @Override + public Iterator<CpProtocolData> iterator() { + return null; + } + + @Override + public Object[] toArray() { + return new Object[0]; + } + + @Override + public <T> T[] toArray(T[] a) { + return null; + } + + @Override + public boolean add(CpProtocolData cpProtocolData) { + return false; + } + + @Override + public boolean remove(Object o) { + return false; + } + + @Override + public boolean containsAll(Collection<?> c) { + return false; + } + + @Override + public boolean addAll(Collection<? extends CpProtocolData> c) { + return false; + } + + @Override + public boolean addAll(int index, Collection<? extends CpProtocolData> c) { + return false; + } + + @Override + public boolean removeAll(Collection<?> c) { + return false; + } + + @Override + public boolean retainAll(Collection<?> c) { + return false; + } + + @Override + public void clear() { + + } + + @Override + public CpProtocolData get(int index) { + return null; + } + + @Override + public CpProtocolData set(int index, CpProtocolData element) { + return null; + } + + @Override + public void add(int index, CpProtocolData element) { + + } + + @Override + public CpProtocolData remove(int index) { + return null; + } + + @Override + public int indexOf(Object o) { + return 0; + } + + @Override + public int lastIndexOf(Object o) { + return 0; + } + + @Override + public ListIterator<CpProtocolData> listIterator() { + return null; + } + + @Override + public ListIterator<CpProtocolData> listIterator(int index) { + return null; + } + + @Override + public List<CpProtocolData> subList(int fromIndex, int toIndex) { + return null; + } + }); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/VnfInstanceDataTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/VnfInstanceDataTest.java new file mode 100644 index 0000000000..b9bdfe3f6e --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/VnfInstanceDataTest.java @@ -0,0 +1,39 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class VnfInstanceDataTest { + VnfInstanceData vnfInstanceData = new VnfInstanceData(); + + @Test + public void getVnfInstanceId() { + vnfInstanceData.getVnfInstanceId(); + } + + @Test + public void setVnfInstanceId() { + vnfInstanceData.setVnfInstanceId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getVnfProfileId() { + vnfInstanceData.getVnfProfileId(); + } + + @Test + public void setVnfProfileId() { + vnfInstanceData.setVnfProfileId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/VnfLocationConstraintTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/VnfLocationConstraintTest.java new file mode 100644 index 0000000000..b8f9b8e3e2 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/model/VnfLocationConstraintTest.java @@ -0,0 +1,39 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.model; + +import org.junit.Test; +import static org.junit.Assert.*; + +public class VnfLocationConstraintTest { + VnfLocationConstraint vnfLocationConstraint = new VnfLocationConstraint(); + + @Test + public void getVnfProfileId() { + vnfLocationConstraint.getVnfProfileId(); + } + + @Test + public void setVnfProfileId() { + vnfLocationConstraint.setVnfProfileId("c9f0a95e-dea0-4698-96e5-5a79bc5a233d"); + } + + @Test + public void getLocationConstraints() { + vnfLocationConstraint.getLocationConstraints(); + } + + @Test + public void setLocationConstraints() { + vnfLocationConstraint.setLocationConstraints(new LocationConstraint()); + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/rest/VfcManagerSol005Test.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/rest/VfcManagerSol005Test.java new file mode 100644 index 0000000000..799283ddb4 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/rest/VfcManagerSol005Test.java @@ -0,0 +1,221 @@ +/* + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.adapters.vfc.rest; + +import org.junit.Test; +import org.junit.runner.RunWith; +import org.mockito.InjectMocks; +import org.mockito.Mock; +import org.mockito.Mockito; +import org.mockito.MockitoAnnotations; +import org.onap.so.adapters.vfc.exceptions.ApplicationException; +import org.onap.so.adapters.vfc.model.NSResourceInputParameter; +import org.onap.so.adapters.vfc.model.RestfulResponse; +import org.onap.so.adapters.vfc.util.JsonUtil; +import org.onap.so.adapters.vfc.util.RestfulUtil; +import org.onap.so.db.request.beans.InstanceNfvoMapping; +import org.onap.so.db.request.beans.OperationStatus; +import org.onap.so.db.request.beans.ResourceOperationStatus; +import org.onap.so.db.request.data.repository.InstanceNfvoMappingRepository; +import org.onap.so.db.request.data.repository.OperationStatusRepository; +import org.onap.so.db.request.data.repository.ResourceOperationStatusRepository; +import org.springframework.test.context.junit4.SpringRunner; +import java.io.File; +import java.nio.file.Files; +import java.util.ArrayList; +import java.util.HashMap; +import java.util.List; +import java.util.Map; +import static org.mockito.Mockito.when; + +@RunWith(SpringRunner.class) +public class VfcManagerSol005Test { + @InjectMocks + VfcManagerSol005 vfcManagerSol005; + + @Mock + InstanceNfvoMappingRepository instanceNfvoMappingRepository; + + @Mock + ResourceOperationStatusRepository resourceOperationStatusRepository; + + @Mock + OperationStatusRepository operationStatusRepository; + + @Mock + RestfulUtil restfulUtil; + + OperationStatus operationStatus = new OperationStatus(); + + InstanceNfvoMapping instanceNfvoMapping = new InstanceNfvoMapping(); + RestfulResponse restfulResponse = new RestfulResponse(); + RestfulResponse vfcrestfulResponse = new RestfulResponse(); + NSResourceInputParameter nsResourceInputParameter = new NSResourceInputParameter(); + ResourceOperationStatus resourceOperationStatus = new ResourceOperationStatus(); + + @Test + public void createNs() throws ApplicationException, Exception { + restfulResponse.setStatus(200); + ClassLoader classLoader = ClassLoader.getSystemClassLoader(); + + File file = new File(classLoader.getResource("json/createNsReq.json").getFile()); + String content = new String(Files.readAllBytes(file.toPath())).replace("\n", ""); + nsResourceInputParameter = JsonUtil.unMarshal(content, NSResourceInputParameter.class); + file = new File(classLoader.getResource("json/aainfvoResponse.json").getFile()); + content = new String(Files.readAllBytes(file.toPath())).replace("\n", ""); + restfulResponse.setResponseContent(content); + // restfulResponse.setResponseContent("{\"nfvoId\":\"6ee79fe2-9579-475a-9bb9-20cf4358a19e\",\"name\":\"external_nfvo\",\"api-root\":\"xyz\",\"vendor\":\"vz\",\"version\":\"v1.0\",\"url\":\"http://sample.com/\",\"userName\":\"admin\",\"password\":\"sacjnasnc\"}"); + file = new File(classLoader.getResource("json/createNsSol005Response.json").getFile()); + content = new String(Files.readAllBytes(file.toPath())).replace("\n", ""); + vfcrestfulResponse.setStatus(202); + vfcrestfulResponse.setResponseContent(content); + // vfcrestfulResponse.setResponseContent("{\"_links\": {\"heal\": {\"href\": \"\"}, \"instantiate\": {\"href\": + // \"\"}, \"nestedNsInstances\": {\"href\": \"\"}, \"scale\": {\"href\": \"\"}, \"self\": {\"href\": \"\"}, + // \"terminate\": {\"href\": \"\"}, \"update\": {\"href\": \"\"}}, \"additionalAffinityOrAntiAffiniityRule\": + // [{\"Scope\": \"\", \"affinityOrAntiAffiinty\": \"\", \"vnfInstanceId\": [], \"vnfProfileId\": [], \"vnfdId\": + // []}], \"flavourId\": \"\", \"id\": \"c9f0a95e-dea0-4698-96e5-5a79bc5a233d\", \"nestedNsInstanceId\": [], + // \"nsInstanceDescription\": \"\", \"nsInstanceName\": \"\", \"nsScaleStatus\": [{\"nsScaleLevelId\": \"\", + // \"nsScalingAspectId\": \"\"}], \"nsState\": \"\", \"nsdId\": \"\", \"nsdInfoId\": \"\", \"pnfInfo\": + // [{\"cpInfo\": [{\"cpInstanceId\": \"\", \"cpProtocolData\": {\"ipOverEthernet\": {\"ipAddresses\": + // {\"addressRange\": {\"maxAddress\": \"\", \"minAddress\": \"\"}, \"fixedAddresses\": \"\", + // \"numDynamicAddresses\": 1, \"subnetId\": \"\", \"type\": \"\"}, \"macAddress\": {}}, \"layerProtocol\": + // \"IP_OVER_ETHERNET\"}, \"cpdId\": \"\"}], \"pnfId\": \"\", \"pnfName\": \"\", \"pnfProfileId\": \"\", + // \"pnfdId\": \"\", \"pnfdInfoId\": \"\"}], \"sapInfo\": [{\"description\": \"\", \"id\": \"\", \"sapName\": + // \"\", \"sapProtocolInfo\": {\"ipOverEthernet\": {\"ipAddresses\": {\"addressRange\": {\"maxAddress\": \"\", + // \"minAddress\": \"\"}, \"fixedAddresses\": \"\", \"numDynamicAddresses\": 1, \"subnetId\": \"\", \"type\": + // \"\"}, \"macAddress\": \"\"}, \"layerProtocol\": \"IP_OVER_ETHERNET\"}, \"sapdId\": \"\"}], + // \"virtualLinkInfo\": [{\"id\": \"\", \"linkPort\": [{\"id\": \"\", \"resourceHandle\": {\"resourceId\": \"\", + // \"resourceProviderId\": \"\", \"vimId\": \"\", \"vimLevelResourceType\": \"\"}}], \"nsVirtualLinkDescId\": + // \"\", \"resourceHandle\": [{\"resourceId\": \"\", \"resourceProviderId\": \"\", \"vimId\": \"\", + // \"vimLevelResourceType\": \"\"}]}], \"vnfInstance\": [{\"vnfInstanceId\": \"\", \"vnfProfileId\": \"\"}], + // \"vnffgInfo\": [{\"id\": \"\", \"nfpInfo\": [{\"description\": \"\", \"id\": \"\", \"nfpName\": \"\", + // \"nfpRule\": {\"destinationIpAddressPrefix\": \"\", \"destinationPortRange\": \"\", \"dscp\": \"\", + // \"etherDestinationAddress\": \"\", \"etherSourceAddress\": \"\", \"etherType\": \"\", \"extendedCriteria\": + // [{\"length\": 1, \"startingPoint\": 1, \"value\": \"\"}], \"protocol\": \"\", \"sourceIpAddressPrefix\": + // \"\", \"sourcePortRange\": \"\", \"vlanTag\": []}, \"nfpState\": \"\", \"nfpdId\": \"\", \"nscpHandle\": + // [{\"nsInstanceId\": \"\", \"nsSapInstanceId\": \"\", \"pnfExtCpInstanceId\": \"\", \"pnfInfoId\": \"\", + // \"vnfExtCpInstanceId\": \"\", \"vnfInstanceId\": \"\"}], \"totalCp\": 1}], \"nsCpHandle\": + // [{\"nsInstanceId\": \"\", \"nsSapInstanceId\": \"\", \"pnfExtCpInstanceId\": \"\", \"pnfInfoId\": \"\", + // \"vnfExtCpInstanceId\": \"\", \"vnfInstanceId\": \"\"}], \"nsVirtualLinkInfoId\": [], \"pnfInfoId\": [], + // \"vnfInstanceId\": [], \"vnffgdId\": \"\"}]}"); + + resourceOperationStatus.setStatus("processing"); + resourceOperationStatus.setOperationId(nsResourceInputParameter.getNsOperationKey().getOperationId()); + resourceOperationStatus.setServiceId(nsResourceInputParameter.getNsOperationKey().getServiceId()); + resourceOperationStatus + .setResourceTemplateUUID(nsResourceInputParameter.getNsOperationKey().getNodeTemplateUUID()); + when(instanceNfvoMappingRepository.save(instanceNfvoMapping)).thenReturn(instanceNfvoMapping); + when(restfulUtil.getNfvoFromAAI("b1bb0ce7-2222-4fa7-95ed-4840d70a1101")).thenReturn(restfulResponse); + when(restfulUtil.send(Mockito.anyString(), Mockito.anyString(), Mockito.anyString(), Mockito.anyMap())) + .thenReturn(vfcrestfulResponse); + when(resourceOperationStatusRepository.save(resourceOperationStatus)).thenReturn(resourceOperationStatus); + vfcManagerSol005.createNs(nsResourceInputParameter); + + } + + @Test + public void terminateNs() throws Exception { + instanceNfvoMapping.setInstanceId("b1bb0ce7-2222-4fa7-95ed-4840d70a1101"); + instanceNfvoMapping.setPassword("sacjnasnc"); + instanceNfvoMapping.setUsername("admin"); + instanceNfvoMapping.setNfvoName("external_nfvo"); + instanceNfvoMapping.setEndpoint("http://sample.com/"); + instanceNfvoMapping.setApiRoot("xyz"); + String nsInstanceId = "c9f0a95e-dea0-4698-96e5-5a79bc5a233d"; + ClassLoader classLoader = ClassLoader.getSystemClassLoader(); + File file = new File(classLoader.getResource("json/createNsReq.json").getFile()); + String content = new String(Files.readAllBytes(file.toPath())).replace("\n", ""); + nsResourceInputParameter = JsonUtil.unMarshal(content, NSResourceInputParameter.class); + Map<String, String> header = new HashMap<>(); + header.put("Location", "http://192.168.10.57:5000/ns_lcm_op_ops/12204a12-7da2-4ddf-8c2f-992a1a1acebf"); + vfcrestfulResponse.setStatus(202); + vfcrestfulResponse.setResponseContent(null); + vfcrestfulResponse.setRespHeaderMap(header); + when(instanceNfvoMappingRepository.findOneByInstanceId(nsInstanceId)).thenReturn(instanceNfvoMapping); + when(restfulUtil.send(Mockito.anyString(), Mockito.anyString(), Mockito.anyString())) + .thenReturn(vfcrestfulResponse); + vfcManagerSol005.terminateNs(nsResourceInputParameter.getNsOperationKey(), nsInstanceId); + } + + @Test + public void getNsProgress() throws Exception { + String jobId = "12204a12-7da2-4ddf-8c2f-992a1a1acebf"; + instanceNfvoMapping.setInstanceId("b1bb0ce7-2222-4fa7-95ed-4840d70a1101"); + instanceNfvoMapping.setPassword("sacjnasnc"); + instanceNfvoMapping.setUsername("admin"); + instanceNfvoMapping.setNfvoName("external_nfvo"); + instanceNfvoMapping.setEndpoint("http://sample.com/"); + instanceNfvoMapping.setApiRoot("xyz"); + instanceNfvoMapping.setJobId(jobId); + ClassLoader classLoader = ClassLoader.getSystemClassLoader(); + File file = new File(classLoader.getResource("json/createNsReq.json").getFile()); + String content = new String(Files.readAllBytes(file.toPath())).replace("\n", ""); + nsResourceInputParameter = JsonUtil.unMarshal(content, NSResourceInputParameter.class); + operationStatus.setProgress("40"); + operationStatus.setServiceId(nsResourceInputParameter.getNsOperationKey().getServiceId()); + operationStatus.setOperationId(nsResourceInputParameter.getNsOperationKey().getOperationId()); + ResourceOperationStatus resourceOperationStatus = + new ResourceOperationStatus(nsResourceInputParameter.getNsOperationKey().getServiceId(), + nsResourceInputParameter.getNsOperationKey().getOperationId(), + nsResourceInputParameter.getNsOperationKey().getNodeTemplateUUID()); + file = new File(classLoader.getResource("json/lcmOperRsp.json").getFile()); + content = new String(Files.readAllBytes(file.toPath())).replace("\n", ""); + vfcrestfulResponse.setStatus(202); + vfcrestfulResponse.setResponseContent(content); + List<ResourceOperationStatus> resourceOperationStatuses = new ArrayList<>(); + resourceOperationStatuses.add(resourceOperationStatus); + when(instanceNfvoMappingRepository.findOneByJobId(jobId)).thenReturn(instanceNfvoMapping); + when(restfulUtil.send(Mockito.anyString(), Mockito.anyString(), Mockito.anyString())) + .thenReturn(vfcrestfulResponse); + when(operationStatusRepository.findOneByServiceIdAndOperationId( + nsResourceInputParameter.getNsOperationKey().getServiceId(), + nsResourceInputParameter.getNsOperationKey().getOperationId())).thenReturn(operationStatus); + when(resourceOperationStatusRepository.findByServiceIdAndOperationId( + nsResourceInputParameter.getNsOperationKey().getServiceId(), + nsResourceInputParameter.getNsOperationKey().getOperationId())).thenReturn(resourceOperationStatuses); + when(operationStatusRepository.save(operationStatus)).thenReturn(operationStatus); + vfcManagerSol005.getNsProgress(nsResourceInputParameter.getNsOperationKey(), jobId); + + } + + @Test + public void instantiateNs() throws Exception { + String nsInstanceId = "c9f0a95e-dea0-4698-96e5-5a79bc5a233d"; + ClassLoader classLoader = ClassLoader.getSystemClassLoader(); + File file = new File(classLoader.getResource("json/createNsReq.json").getFile()); + String content = new String(Files.readAllBytes(file.toPath())).replace("\n", ""); + nsResourceInputParameter = JsonUtil.unMarshal(content, NSResourceInputParameter.class); + instanceNfvoMapping.setInstanceId("b1bb0ce7-2222-4fa7-95ed-4840d70a1101"); + instanceNfvoMapping.setPassword("sacjnasnc"); + instanceNfvoMapping.setUsername("admin"); + instanceNfvoMapping.setNfvoName("external_nfvo"); + instanceNfvoMapping.setEndpoint("http://sample.com/"); + instanceNfvoMapping.setApiRoot("xyz"); + resourceOperationStatus.setStatus("processing"); + resourceOperationStatus.setOperationId(nsResourceInputParameter.getNsOperationKey().getOperationId()); + resourceOperationStatus.setServiceId(nsResourceInputParameter.getNsOperationKey().getServiceId()); + resourceOperationStatus + .setResourceTemplateUUID(nsResourceInputParameter.getNsOperationKey().getNodeTemplateUUID()); + Map<String, String> header = new HashMap<>(); + header.put("Location", "http://192.168.10.57:5000/ns_lcm_op_ops/12204a12-7da2-4ddf-8c2f-992a1a1acebf"); + vfcrestfulResponse.setStatus(202); + vfcrestfulResponse.setResponseContent(null); + vfcrestfulResponse.setRespHeaderMap(header); + when(instanceNfvoMappingRepository.findOneByInstanceId(nsInstanceId)).thenReturn(instanceNfvoMapping); + when(restfulUtil.send(Mockito.anyString(), Mockito.anyString(), Mockito.anyString())) + .thenReturn(vfcrestfulResponse); + when(resourceOperationStatusRepository.save(resourceOperationStatus)).thenReturn(resourceOperationStatus); + when(instanceNfvoMappingRepository.save(instanceNfvoMapping)).thenReturn(instanceNfvoMapping); + vfcManagerSol005.instantiateNs(nsInstanceId, nsResourceInputParameter); + + } +} diff --git a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/util/RestfulUtilTest.java b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/util/RestfulUtilTest.java index c388016ab4..4b6baa5cf4 100644 --- a/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/util/RestfulUtilTest.java +++ b/adapters/mso-vfc-adapter/src/test/java/org/onap/so/adapters/vfc/util/RestfulUtilTest.java @@ -22,6 +22,8 @@ package org.onap.so.adapters.vfc.util; import org.apache.http.HttpEntity; import org.apache.http.HttpResponse; +import org.apache.http.Header; +import org.apache.http.message.BasicHeader; import org.apache.http.StatusLine; import org.apache.http.client.HttpClient; import org.apache.http.client.methods.HttpDelete; @@ -59,21 +61,27 @@ public class RestfulUtilTest { private HttpEntity httpEntity; private HttpResponse httpResponse; private StatusLine statusLine; + private Header httpResponseHeader; @Before public void setUp() { httpEntity = mock(HttpEntity.class); httpResponse = mock(HttpResponse.class); statusLine = mock(StatusLine.class); + httpResponseHeader = mock(Header.class); } private void sendInit() throws IOException { + Header[] headerList = new BasicHeader[2]; + headerList[0] = new BasicHeader("Content-Type", "application/json"); + headerList[1] = new BasicHeader("cache-control", "no-cache"); doReturn("https://testHost/").when(restfulUtil).getMsbHost(); when(statusLine.getStatusCode()).thenReturn(HttpStatus.OK.value()); when(httpResponse.getStatusLine()).thenReturn(statusLine); when(httpResponse.getEntity()).thenReturn(httpEntity); + when(httpResponse.getAllHeaders()).thenReturn(headerList); } @Test diff --git a/adapters/mso-vfc-adapter/src/test/resources/json/aainfvoResponse.json b/adapters/mso-vfc-adapter/src/test/resources/json/aainfvoResponse.json new file mode 100644 index 0000000000..35047a9c21 --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/resources/json/aainfvoResponse.json @@ -0,0 +1,10 @@ +{ + "nfvoId":"6ee79fe2-9579-475a-9bb9-20cf4358a19e", + "name":"external_nfvo", + "api-root":"xyz", + "vendor":"vz", + "version":"v1.0", + "url":"http://sample.com/", + "userName":"admin", + "password":"sacjnasnc" +}
\ No newline at end of file diff --git a/adapters/mso-vfc-adapter/src/test/resources/json/createNsReq.json b/adapters/mso-vfc-adapter/src/test/resources/json/createNsReq.json index 047c81081e..aec8ae809d 100644 --- a/adapters/mso-vfc-adapter/src/test/resources/json/createNsReq.json +++ b/adapters/mso-vfc-adapter/src/test/resources/json/createNsReq.json @@ -1,32 +1,56 @@ { - "nsServiceName":"vIMS", - "nsServiceDescription":"vIMS NS", + "nsServiceName":"vcpe_e2e_vnf_test2", + "nsServiceDescription":"null", + "nsServiceModelUUID":"c9f0a95e-dea0-4698-96e5-5a79bc5a233d", "nsOperationKey":{ - "globalSubscriberId":"9b9f02c0-298b-458a-bc9c-be3692e4f350", - "serviceType":"service", - "serviceId":"9b9f02c0-298b-458a-bc9c-be3692e4f351", - "operationId":"9b9f02c0-298b-458a-bc9c-be3692e4f352", - "nodeTemplateUUID":"9b9f02c0-298b-458a-bc9c-be3692e4f353" + "globalSubscriberId":"Demonstration", + "serviceType":"vCPE", + "serviceId":"996fadbb-e806-4a19-b0e5-3454ad6ac29e", + "operationId":"1f1dd6b2-b027-4008-a9df-3b6c8274fb24", + "nodeTemplateUUID":"4d3a835c-29c8-4a63-83a4-50de5f7ffe16" }, "nsParameters":{ "locationConstraints":[ { - "vnfProfileId":"zte-CSCF-1.0", "locationConstraints":{ - "vimId":"1" - } + "vimId":"CloudOwner_regionOne" + }, + "vnfProfileId":"b1bb0ce7-2222-4fa7-95ed-4840d70a1101" + }, + { + "locationConstraints":{ + "vimId":"CloudOwner_regionOne" + }, + "vnfProfileId":"0408f076-e6c0-4c82-9940-272fddbb82de" + }, + { + "locationConstraints":{ + "vimId":"CloudOwner_regionOne" + }, + "vnfProfileId":"b1bb0ce7-2222-4fa7-95ed-4840d70a1100" + }, + { + "locationConstraints":{ + "vimId":"CloudOwner_regionOne" + }, + "vnfProfileId":"b1bb0ce7-2222-4fa7-95ed-4840d70a1102" + }, + { + "locationConstraints":{ + "vimId":"CloudOwner_regionOne" + }, + "vnfProfileId":"3fca3543-07f5-492f-812c-ed462e4f94f4" } ], "additionalParamForNs":{ - "externalDataNetworkName":"Flow_out_net", - "m6000_mng_ip":"192.168.20.2", - "externalCompanyFtpDataNetworkName":"Flow_out_net", - "externalPluginManageNetworkName":"plugin_net_2014", - "externalManageNetworkName":"mng_net_2017", - "sfc_data_network":"sfc_data_net_2016", - "NatIpRange":"210.1.1.10-210.1.1.20", - "location":"4050083f-465f-4838-af1e-47a545222ad0", - "sdncontroller":"9b9f02c0-298b-458a-bc9c-be3692e4f35e" + "orchestrator":"", + "nfvo":"b1bb0ce7-2222-4fa7-95ed-4840d70a1101", + "nf_naming":"true", + "multi_stage_design":"false", + "availability_zone_max_count":"1", + "xyz":"123", + "nsd0_providing_service_invariant_uuid":"12204a12-7da2-4ddf-8c2f-992a1a1acebf", + "nsd0_providing_service_uuid":"5791dbeb-19d4-43e8-bf44-5b327ccf6bca" } } -}
\ No newline at end of file +} diff --git a/adapters/mso-vfc-adapter/src/test/resources/json/createNsSol005Response.json b/adapters/mso-vfc-adapter/src/test/resources/json/createNsSol005Response.json new file mode 100644 index 0000000000..938969a87f --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/resources/json/createNsSol005Response.json @@ -0,0 +1,210 @@ +{ + "_links":{ + "heal":{ + "href":"" + }, + "instantiate":{ + "href":"" + }, + "nestedNsInstances":{ + "href":"" + }, + "scale":{ + "href":"" + }, + "self":{ + "href":"" + }, + "terminate":{ + "href":"" + }, + "update":{ + "href":"" + } + }, + "additionalAffinityOrAntiAffiniityRule":[ + { + "Scope":"", + "affinityOrAntiAffiinty":"", + "vnfInstanceId":[ + + ], + "vnfProfileId":[ + + ], + "vnfdId":[ + + ] + } + ], + "flavourId":"", + "id":"c9f0a95e-dea0-4698-96e5-5a79bc5a233d", + "nestedNsInstanceId":[ + + ], + "nsInstanceDescription":"", + "nsInstanceName":"", + "nsScaleStatus":[ + { + "nsScaleLevelId":"", + "nsScalingAspectId":"" + } + ], + "nsState":"", + "nsdId":"", + "nsdInfoId":"", + "pnfInfo":[ + { + "cpInfo":[ + { + "cpInstanceId":"", + "cpProtocolData":{ + "ipOverEthernet":{ + "ipAddresses":{ + "addressRange":{ + "maxAddress":"", + "minAddress":"" + }, + "fixedAddresses":"", + "numDynamicAddresses":1, + "subnetId":"", + "type":"" + }, + "macAddress":{ + + } + }, + "layerProtocol":"IP_OVER_ETHERNET" + }, + "cpdId":"" + } + ], + "pnfId":"", + "pnfName":"", + "pnfProfileId":"", + "pnfdId":"", + "pnfdInfoId":"" + } + ], + "sapInfo":[ + { + "description":"", + "id":"", + "sapName":"", + "sapProtocolInfo":{ + "ipOverEthernet":{ + "ipAddresses":{ + "addressRange":{ + "maxAddress":"", + "minAddress":"" + }, + "fixedAddresses":"", + "numDynamicAddresses":1, + "subnetId":"", + "type":"" + }, + "macAddress":"" + }, + "layerProtocol":"IP_OVER_ETHERNET" + }, + "sapdId":"" + } + ], + "virtualLinkInfo":[ + { + "id":"", + "linkPort":[ + { + "id":"", + "resourceHandle":{ + "resourceId":"", + "resourceProviderId":"", + "vimId":"", + "vimLevelResourceType":"" + } + } + ], + "nsVirtualLinkDescId":"", + "resourceHandle":[ + { + "resourceId":"", + "resourceProviderId":"", + "vimId":"", + "vimLevelResourceType":"" + } + ] + } + ], + "vnfInstance":[ + { + "vnfInstanceId":"", + "vnfProfileId":"" + } + ], + "vnffgInfo":[ + { + "id":"", + "nfpInfo":[ + { + "description":"", + "id":"", + "nfpName":"", + "nfpRule":{ + "destinationIpAddressPrefix":"", + "destinationPortRange":"", + "dscp":"", + "etherDestinationAddress":"", + "etherSourceAddress":"", + "etherType":"", + "extendedCriteria":[ + { + "length":1, + "startingPoint":1, + "value":"" + } + ], + "protocol":"", + "sourceIpAddressPrefix":"", + "sourcePortRange":"", + "vlanTag":[ + + ] + }, + "nfpState":"", + "nfpdId":"", + "nscpHandle":[ + { + "nsInstanceId":"", + "nsSapInstanceId":"", + "pnfExtCpInstanceId":"", + "pnfInfoId":"", + "vnfExtCpInstanceId":"", + "vnfInstanceId":"" + } + ], + "totalCp":1 + } + ], + "nsCpHandle":[ + { + "nsInstanceId":"", + "nsSapInstanceId":"", + "pnfExtCpInstanceId":"", + "pnfInfoId":"", + "vnfExtCpInstanceId":"", + "vnfInstanceId":"" + } + ], + "nsVirtualLinkInfoId":[ + + ], + "pnfInfoId":[ + + ], + "vnfInstanceId":[ + + ], + "vnffgdId":"" + } + ] +}
\ No newline at end of file diff --git a/adapters/mso-vfc-adapter/src/test/resources/json/lcmOperRsp.json b/adapters/mso-vfc-adapter/src/test/resources/json/lcmOperRsp.json new file mode 100644 index 0000000000..111afc1a7c --- /dev/null +++ b/adapters/mso-vfc-adapter/src/test/resources/json/lcmOperRsp.json @@ -0,0 +1,7 @@ +{ + "id":"12204a12-7da2-4ddf-8c2f-992a1a1acebf", + "lcmOperationType":"INSTANTIATE", + "nsInstanceId":"c9f0a95e-dea0-4698-96e5-5a79bc5a233d", + "operationState":"PROCESSING", + "statusEnteredTime":"Time" +}
\ No newline at end of file diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-adapter-api/pom.xml b/adapters/mso-vnfm-adapter/mso-vnfm-adapter-api/pom.xml index bf293e5f4b..bb322eb1d8 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-adapter-api/pom.xml +++ b/adapters/mso-vnfm-adapter/mso-vnfm-adapter-api/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so.adapters</groupId> <artifactId>mso-vnfm-adapter</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>mso-vnfm-adapter-api</artifactId> <properties> diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-adapter-api/src/main/resources/ETSI-Catalog-Notification-API.json b/adapters/mso-vnfm-adapter/mso-vnfm-adapter-api/src/main/resources/ETSI-Catalog-Notification-API.json index 6f9b2c3bbe..6db54435d2 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-adapter-api/src/main/resources/ETSI-Catalog-Notification-API.json +++ b/adapters/mso-vnfm-adapter/mso-vnfm-adapter-api/src/main/resources/ETSI-Catalog-Notification-API.json @@ -6,18 +6,26 @@ "version": "v1" }, "host": "127.0.0.1:8000", - "schemes": ["http"], + "schemes": [ + "http" + ], "basePath": "/", - "consumes": ["application/json"], - "produces": ["application/json"], + "consumes": [ + "application/json" + ], + "produces": [ + "application/json" + ], "securityDefinitions": { "Basic": { "type": "basic" } }, - "security": [{ - "Basic": [] - }], + "security": [ + { + "Basic": [] + } + ], "paths": { "/URI-is-provided-by-the-client-when-creating-the-subscription-VnfPackageChangeNotification": { "get": { @@ -35,25 +43,31 @@ } } }, - "tags": ["VNF Package Management interface"] + "tags": [ + "VNF Package Management interface" + ] }, "post": { "operationId": "URI-is-provided-by-the-client-when-creating-the-subscription-VnfPackageChangeNotification_create", "description": "", - "parameters": [{ - "name": "data", - "in": "body", - "required": true, - "schema": { - "$ref": "#/definitions/PkgChangeNotification" + "parameters": [ + { + "name": "data", + "in": "body", + "required": true, + "schema": { + "$ref": "#/definitions/PkgChangeNotification" + } } - }], + ], "responses": { "204": { "description": "" } }, - "tags": ["VNF Package Management interface"] + "tags": [ + "VNF Package Management interface" + ] }, "parameters": [] }, @@ -73,25 +87,31 @@ } } }, - "tags": ["VNF Package Management interface"] + "tags": [ + "VNF Package Management interface" + ] }, "post": { "operationId": "URI-is-provided-by-the-client-when-creating-the-subscription-VnfPackageOnboardingNotification_create", "description": "", - "parameters": [{ - "name": "data", - "in": "body", - "required": true, - "schema": { - "$ref": "#/definitions/PkgOnboardingNotification" + "parameters": [ + { + "name": "data", + "in": "body", + "required": true, + "schema": { + "$ref": "#/definitions/PkgOnboardingNotification" + } } - }], + ], "responses": { "204": { "description": "" } }, - "tags": ["VNF Package Management interface"] + "tags": [ + "VNF Package Management interface" + ] }, "parameters": [] } @@ -100,7 +120,9 @@ "NOTIFICATION_LINKSERIALIZER": { "title": "Vnfpackage", "description": "Link to the resource representing the VNF package to which the notified change applies.", - "required": ["href"], + "required": [ + "href" + ], "type": "object", "properties": { "href": { @@ -125,7 +147,16 @@ } }, "PkgChangeNotification": { - "required": ["id", "notificationType", "timeStamp", "subscriptionId", "vnfPkgId", "changeType", "vnfdId", "_links"], + "required": [ + "id", + "notificationType", + "timeStamp", + "subscriptionId", + "vnfPkgId", + "changeType", + "vnfdId", + "_links" + ], "type": "object", "properties": { "id": { @@ -138,7 +169,9 @@ "title": "Notificationtype", "description": "Discriminator for the different notification types.", "type": "string", - "enum": ["VnfPackageChangeNotification"] + "enum": [ + "VnfPackageChangeNotification" + ] }, "timeStamp": { "title": "Timestamp", @@ -156,19 +189,25 @@ "title": "Vnfpkgid", "description": "Identifier of the VNF package.", "type": "string", - "format": "uuid" + "minLength": 1 }, "changeType": { "title": "Changetype", "description": "The type of change of the VNF package.", "type": "string", - "enum": ["OP_STATE_CHANGE", "PKG_DELETE"] + "enum": [ + "OP_STATE_CHANGE", + "PKG_DELETE" + ] }, "operationalState": { "title": "Operationalstate", "description": "New operational state of the VNF package.", "type": "string", - "enum": ["ENABLED", "DISABLED"] + "enum": [ + "ENABLED", + "DISABLED" + ] }, "vnfdId": { "title": "Vnfdid", @@ -182,7 +221,15 @@ } }, "PkgOnboardingNotification": { - "required": ["id", "notificationType", "subscriptionId", "timeStamp", "vnfPkgId", "vnfdId", "_links"], + "required": [ + "id", + "notificationType", + "subscriptionId", + "timeStamp", + "vnfPkgId", + "vnfdId", + "_links" + ], "type": "object", "properties": { "id": { @@ -195,7 +242,9 @@ "title": "Notificationtype", "description": "Discriminator for the different notification types.", "type": "string", - "enum": ["VnfPackageOnboardingNotification"] + "enum": [ + "VnfPackageOnboardingNotification" + ] }, "subscriptionId": { "title": "Subscriptionid", @@ -213,13 +262,13 @@ "title": "Vnfpkgid", "description": "Identifier of the VNF package.", "type": "string", - "format": "uuid" + "minLength": 1 }, "vnfdId": { "title": "Vnfdid", "description": "This identifier, which is managed by the VNF provider, identifies the VNF package and the VNFD in a globally unique way.", "type": "string", - "format": "uuid" + "minLength": 1 }, "_links": { "$ref": "#/definitions/PkgmLinks" @@ -227,4 +276,4 @@ } } } -}
\ No newline at end of file +} diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-adapter-ext-clients/pom.xml b/adapters/mso-vnfm-adapter/mso-vnfm-adapter-ext-clients/pom.xml index 8e2cfd2be4..a643aaa5b8 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-adapter-ext-clients/pom.xml +++ b/adapters/mso-vnfm-adapter/mso-vnfm-adapter-ext-clients/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so.adapters</groupId> <artifactId>mso-vnfm-adapter</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>mso-vnfm-adapter-ext-clients</artifactId> <properties> diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/pom.xml b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/pom.xml index bc491a6fc5..66b1d2e12e 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/pom.xml +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so.adapters</groupId> <artifactId>mso-vnfm-adapter</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>mso-vnfm-etsi-adapter</artifactId> <properties> diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/Constants.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/Constants.java index fb32fb9605..d798267918 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/Constants.java +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/Constants.java @@ -32,8 +32,12 @@ public class Constants { public static final String SERVICE_VERSION = "v1"; public static final String BASE_URL = "/so/" + SERVICE_NAME + "/" + SERVICE_VERSION; public static final String PACKAGE_MANAGEMENT_BASE_URL = BASE_URL + "/vnfpkgm/v1"; - public static final String ETSI_SUBSCRIPTION_NOTIFICATION_BASE_URL = BASE_URL + "/etsicatalogmanager/notification"; - public static final String ETSI_SUBSCRIPTION_NOTIFICATION_CONTROLLER_BASE_URL = BASE_URL + "/etsicatalogmanager"; + public static final String ETSI_CATALOG_MANAGER_BASE_ENDPOINT = "/etsicatalogmanager"; + public static final String ETSI_SUBSCRIPTION_NOTIFICATION_ENDPOINT = "/notification"; + public static final String ETSI_SUBSCRIPTION_NOTIFICATION_CONTROLLER_BASE_URL = + BASE_URL + ETSI_CATALOG_MANAGER_BASE_ENDPOINT; + public static final String ETSI_SUBSCRIPTION_NOTIFICATION_BASE_URL = + ETSI_SUBSCRIPTION_NOTIFICATION_CONTROLLER_BASE_URL + ETSI_SUBSCRIPTION_NOTIFICATION_ENDPOINT; public static final String APPLICATION_ZIP = "application/zip"; public static final String OPERATION_NOTIFICATION_ENDPOINT = "/lcn/VnfLcmOperationOccurrenceNotification"; diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/MessageConverterConfiguration.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/MessageConverterConfiguration.java index 61d5adf9d8..87e8bb4d57 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/MessageConverterConfiguration.java +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/MessageConverterConfiguration.java @@ -23,6 +23,8 @@ import com.google.gson.Gson; import com.google.gson.GsonBuilder; import java.util.ArrayList; import java.util.Collection; +import org.onap.so.adapters.vnfmadapter.converters.etsicatalog.sol003.PkgChangeNotificationConverter; +import org.onap.so.adapters.vnfmadapter.converters.etsicatalog.sol003.PkgOnboardingNotificationConverter; import org.onap.so.adapters.vnfmadapter.converters.etsicatalog.sol003.VnfPkgInfoConverter; import org.onap.so.adapters.vnfmadapter.converters.sol003.etsicatalog.PkgmSubscriptionRequestConverter; import org.onap.so.adapters.vnfmadapter.oauth.OAuth2AccessTokenAdapter; @@ -46,6 +48,8 @@ public class MessageConverterConfiguration { final DefaultConversionService service = new DefaultConversionService(); service.addConverter(new VnfPkgInfoConverter()); service.addConverter(new PkgmSubscriptionRequestConverter()); + service.addConverter(new PkgChangeNotificationConverter()); + service.addConverter(new PkgOnboardingNotificationConverter()); return service; } diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/VnfmBasicHttpSecurityConfigurer.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/VnfmBasicHttpSecurityConfigurer.java index 1e0a18a339..f1815054e3 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/VnfmBasicHttpSecurityConfigurer.java +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/VnfmBasicHttpSecurityConfigurer.java @@ -9,9 +9,9 @@ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at - * + * * http://www.apache.org/licenses/LICENSE-2.0 - * + * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. @@ -35,7 +35,6 @@ import org.springframework.util.StringUtils; /** * @author Waqas Ikram (waqas.ikram@est.tech) * @author Gareth Roper (gareth.roper@est.tech) - * */ @Primary @Component @@ -53,10 +52,10 @@ public class VnfmBasicHttpSecurityConfigurer implements HttpSecurityConfigurer { http.csrf().disable().authorizeRequests().anyRequest().permitAll(); } else { http.csrf().disable().authorizeRequests().antMatchers("/manage/health", "/manage/info").permitAll() - .antMatchers(HttpMethod.GET, "/etsi/subscription/notification").permitAll().antMatchers("/**") + .antMatchers(HttpMethod.GET, Constants.ETSI_SUBSCRIPTION_NOTIFICATION_BASE_URL).permitAll() + .antMatchers("/**") .hasAnyRole(StringUtils.collectionToDelimitedString(soUserCredentialConfiguration.getRoles(), ",")) .and().httpBasic(); - } } } diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/converters/etsicatalog/sol003/AbstractPkgNotificationConverter.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/converters/etsicatalog/sol003/AbstractPkgNotificationConverter.java new file mode 100644 index 0000000000..e1c43098f8 --- /dev/null +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/converters/etsicatalog/sol003/AbstractPkgNotificationConverter.java @@ -0,0 +1,56 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix Foundation. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.vnfmadapter.converters.etsicatalog.sol003; + +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.notification.model.PkgmLinks; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.notification.model.URIisprovidedbytheclientwhencreatingthesubscriptionVnfPackageOnboardingNotificationLinks; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.notification.model.URIisprovidedbytheclientwhencreatingthesubscriptionVnfPackageOnboardingNotificationLinksVnfPackage; + +/** + * A base class that can be extended by classes for converting Etsi Catalog Manager Pkg Notification classes. Provides + * common methods that will be useful to those classes. + * + * @author andrew.a.lamb@est.tech + */ +abstract public class AbstractPkgNotificationConverter { + + protected URIisprovidedbytheclientwhencreatingthesubscriptionVnfPackageOnboardingNotificationLinks convert( + final PkgmLinks pkgmLinks) { + final URIisprovidedbytheclientwhencreatingthesubscriptionVnfPackageOnboardingNotificationLinksVnfPackage linksVnfPackage = + new URIisprovidedbytheclientwhencreatingthesubscriptionVnfPackageOnboardingNotificationLinksVnfPackage(); + if (pkgmLinks.getVnfPackage() != null) { + linksVnfPackage.setHref(pkgmLinks.getVnfPackage().getHref()); + } + + final URIisprovidedbytheclientwhencreatingthesubscriptionVnfPackageOnboardingNotificationLinksVnfPackage linksSubscription = + new URIisprovidedbytheclientwhencreatingthesubscriptionVnfPackageOnboardingNotificationLinksVnfPackage(); + if (pkgmLinks.getSubscription() != null) { + linksSubscription.setHref(pkgmLinks.getSubscription().getHref()); + } + + final URIisprovidedbytheclientwhencreatingthesubscriptionVnfPackageOnboardingNotificationLinks links = + new URIisprovidedbytheclientwhencreatingthesubscriptionVnfPackageOnboardingNotificationLinks(); + links.setVnfPackage(linksVnfPackage); + links.setSubscription(linksSubscription); + return links; + } + +} diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/converters/etsicatalog/sol003/PkgChangeNotificationConverter.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/converters/etsicatalog/sol003/PkgChangeNotificationConverter.java new file mode 100644 index 0000000000..8c4168632b --- /dev/null +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/converters/etsicatalog/sol003/PkgChangeNotificationConverter.java @@ -0,0 +1,79 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix Foundation. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.vnfmadapter.converters.etsicatalog.sol003; + +import static org.slf4j.LoggerFactory.getLogger; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.notification.model.PkgChangeNotification; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.notification.model.VnfPackageChangeNotification; +import org.slf4j.Logger; +import org.springframework.core.convert.converter.Converter; +import org.springframework.stereotype.Service; + +/** + * Converter to convert from an Etsi Catalog Manager {@link PkgChangeNotification} Object to its equivalent SOL003 + * {@link VnfPackageChangeNotification} Object + * + * @author andrew.a.lamb@est.tech + */ +@Service +public class PkgChangeNotificationConverter extends AbstractPkgNotificationConverter + implements Converter<PkgChangeNotification, VnfPackageChangeNotification> { + private static final Logger logger = getLogger(PkgChangeNotificationConverter.class); + + /** + * Convert a {@link PkgChangeNotification} Object to an {@link VnfPackageChangeNotification} Object + * + * @param pkgChangeNotification The PkgChangeNotification Object to Convert + * @return The Converted VnfPackageChangeNotification Object + */ + @Override + public VnfPackageChangeNotification convert(final PkgChangeNotification pkgChangeNotification) { + logger.info("Converting PkgChangeNotification\n{}", pkgChangeNotification.toString()); + final VnfPackageChangeNotification vnfPackageChangeNotification = new VnfPackageChangeNotification(); + vnfPackageChangeNotification.setId(pkgChangeNotification.getId()); + + if (pkgChangeNotification.getNotificationType() != null) { + vnfPackageChangeNotification.setNotificationType(VnfPackageChangeNotification.NotificationTypeEnum + .fromValue(pkgChangeNotification.getNotificationType().getValue())); + } + + vnfPackageChangeNotification.setSubscriptionId(pkgChangeNotification.getSubscriptionId()); + vnfPackageChangeNotification.setTimeStamp(pkgChangeNotification.getTimeStamp()); + vnfPackageChangeNotification.setVnfPkgId(pkgChangeNotification.getVnfPkgId()); + + vnfPackageChangeNotification.setVnfdId(pkgChangeNotification.getVnfdId()); + + if (pkgChangeNotification.getChangeType() != null) { + vnfPackageChangeNotification.setChangeType(VnfPackageChangeNotification.ChangeTypeEnum + .fromValue(pkgChangeNotification.getChangeType().getValue())); + } + + if (pkgChangeNotification.getOperationalState() != null) { + vnfPackageChangeNotification.setOperationalState(VnfPackageChangeNotification.OperationalStateEnum + .fromValue(pkgChangeNotification.getOperationalState().getValue())); + } + + vnfPackageChangeNotification.setLinks(convert((pkgChangeNotification.getLinks()))); + + return vnfPackageChangeNotification; + } + +} diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/converters/etsicatalog/sol003/PkgOnboardingNotificationConverter.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/converters/etsicatalog/sol003/PkgOnboardingNotificationConverter.java new file mode 100644 index 0000000000..836acb6d36 --- /dev/null +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/converters/etsicatalog/sol003/PkgOnboardingNotificationConverter.java @@ -0,0 +1,69 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix Foundation. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.vnfmadapter.converters.etsicatalog.sol003; + +import static org.slf4j.LoggerFactory.getLogger; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.notification.model.PkgOnboardingNotification; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.notification.model.VnfPackageOnboardingNotification; +import org.slf4j.Logger; +import org.springframework.core.convert.converter.Converter; +import org.springframework.stereotype.Service; + +/** + * Converter to convert from an Etsi Catalog Manager {@link PkgOnboardingNotification} Object to its equivalent SOL003 + * {@link VnfPackageOnboardingNotification} Object + * + * @author andrew.a.lamb@est.tech + */ +@Service +public class PkgOnboardingNotificationConverter extends AbstractPkgNotificationConverter + implements Converter<PkgOnboardingNotification, VnfPackageOnboardingNotification> { + private static final Logger logger = getLogger(PkgOnboardingNotificationConverter.class); + + /** + * Convert a {@link PkgOnboardingNotification} Object to an {@link VnfPackageOnboardingNotification} Object + * + * @param pkgOnboardingNotification The PkgOnboardingNotification Object to Convert + * @return The Converted VnfPackageOnboardingNotification Object + */ + @Override + public VnfPackageOnboardingNotification convert(final PkgOnboardingNotification pkgOnboardingNotification) { + logger.info("Converting PkgChangeNotification\n{}", pkgOnboardingNotification.toString()); + final VnfPackageOnboardingNotification vnfPackageOnboardingNotification = + new VnfPackageOnboardingNotification(); + vnfPackageOnboardingNotification.setId(pkgOnboardingNotification.getId()); + + if (pkgOnboardingNotification.getNotificationType() != null) { + vnfPackageOnboardingNotification.setNotificationType(VnfPackageOnboardingNotification.NotificationTypeEnum + .fromValue(pkgOnboardingNotification.getNotificationType().getValue())); + } + + vnfPackageOnboardingNotification.setSubscriptionId(pkgOnboardingNotification.getSubscriptionId()); + vnfPackageOnboardingNotification.setTimeStamp(pkgOnboardingNotification.getTimeStamp()); + vnfPackageOnboardingNotification.setVnfPkgId(pkgOnboardingNotification.getVnfPkgId()); + vnfPackageOnboardingNotification.setVnfdId(pkgOnboardingNotification.getVnfdId()); + + vnfPackageOnboardingNotification.setLinks(convert((pkgOnboardingNotification.getLinks()))); + + return vnfPackageOnboardingNotification; + } + +} diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/converters/sol003/etsicatalog/PkgmSubscriptionRequestConverter.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/converters/sol003/etsicatalog/PkgmSubscriptionRequestConverter.java index c6d51c99aa..6d566c07ad 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/converters/sol003/etsicatalog/PkgmSubscriptionRequestConverter.java +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/converters/sol003/etsicatalog/PkgmSubscriptionRequestConverter.java @@ -20,14 +20,10 @@ package org.onap.so.adapters.vnfmadapter.converters.sol003.etsicatalog; -import static org.slf4j.LoggerFactory.getLogger; import java.util.ArrayList; import java.util.Arrays; import java.util.Collections; import java.util.List; -import java.util.Optional; -import java.util.UUID; -import javax.swing.text.html.Option; import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.Version; import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.VnfProducts; import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.VnfProductsProviders; @@ -38,7 +34,6 @@ import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model. import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsFilterVersions; import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsFilterVnfProducts; import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsFilterVnfProductsFromProviders; -import org.slf4j.Logger; import org.springframework.core.convert.converter.Converter; import org.springframework.stereotype.Service; @@ -48,17 +43,14 @@ import org.springframework.stereotype.Service; * * @author Ronan Kenny (ronan.kenny@est.tech) * @author Gareth Roper (gareth.roper@est.tech) - * */ @Service public class PkgmSubscriptionRequestConverter implements Converter<PkgmSubscriptionRequest, org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.PkgmSubscriptionRequest> { - private static final Logger logger = getLogger(PkgmSubscriptionRequestConverter.class); - @Override public org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.PkgmSubscriptionRequest convert( - PkgmSubscriptionRequest pkgmSubscriptionRequest) { + final PkgmSubscriptionRequest pkgmSubscriptionRequest) { final org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.PkgmSubscriptionRequest etsiCatalogManagerSubscriptionRequest = new org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.PkgmSubscriptionRequest(); @@ -94,8 +86,10 @@ public class PkgmSubscriptionRequestConverter implements return etsiCatalogManagerFilters; } - // TODO 'operationalState' in the Sol003 Swagger is type 'OperationalStateEnum'. The ETSI Catalog Manager Swagger - // 'operationalState' is type 'List<OperationalStateEnum>'. This method needs to be updated once swagger is updated. + // TODO 'operationalState' in the Sol003 Swagger is type 'OperationalStateEnum'. The ETSI + // Catalog Manager Swagger + // 'operationalState' is type 'List<OperationalStateEnum>'. This method needs to be updated once + // swagger is updated. private List<org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.PkgmNotificationsFilter.OperationalStateEnum> getOperationalState( final OperationalStateEnum operationalState) { if (operationalState != null) { @@ -112,6 +106,7 @@ public class PkgmSubscriptionRequestConverter implements vnfPkgId.forEach(type -> { etsiCatalogManagerVnfPkgId.add(type); }); + return etsiCatalogManagerVnfPkgId; } return Collections.emptyList(); } @@ -122,6 +117,7 @@ public class PkgmSubscriptionRequestConverter implements vnfdId.forEach(type -> { etsiCatalogManagerVnfdId.add(type); }); + return etsiCatalogManagerVnfdId; } return Collections.emptyList(); } @@ -133,7 +129,8 @@ public class PkgmSubscriptionRequestConverter implements final List<VnfProductsProviders> etsiCatalogManagerVnfProductsProviders = new ArrayList<>(); filterProductsFromProvider.forEach(vnfProduct -> { etsiCatalogManagerVnfProductsProviders - .add(new VnfProductsProviders().vnfProducts(getVnfProducts(vnfProduct.getVnfProducts()))); + .add(new VnfProductsProviders().vnfProvider(vnfProduct.getVnfProvider()) + .vnfProducts(getVnfProducts(vnfProduct.getVnfProducts()))); }); return etsiCatalogManagerVnfProductsProviders; } @@ -154,7 +151,7 @@ public class PkgmSubscriptionRequestConverter implements private List<Version> getVersion(final List<SubscriptionsFilterVersions> sol003FilterVersions) { if (sol003FilterVersions != null && !sol003FilterVersions.isEmpty()) { - List<Version> etsiCatalogVersionList = new ArrayList<>(); + final List<Version> etsiCatalogVersionList = new ArrayList<>(); sol003FilterVersions.forEach(vnfFilterVersion -> { etsiCatalogVersionList.add(new Version().vnfSoftwareVersion(vnfFilterVersion.getVnfSoftwareVersion()) .vnfdVersions(vnfFilterVersion.getVnfdVersions())); @@ -173,6 +170,7 @@ public class PkgmSubscriptionRequestConverter implements notificationTypes.forEach(type -> etsiCatalogManagerNotificationTypes.add( org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.PkgmNotificationsFilter.NotificationTypesEnum .fromValue(type.getValue()))); + return etsiCatalogManagerNotificationTypes; } return Collections.emptyList(); } diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/extclients/etsicatalog/EtsiCatalogServiceProvider.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/extclients/etsicatalog/EtsiCatalogServiceProvider.java index e0eed159c2..0dcc49eeac 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/extclients/etsicatalog/EtsiCatalogServiceProvider.java +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/extclients/etsicatalog/EtsiCatalogServiceProvider.java @@ -21,6 +21,7 @@ package org.onap.so.adapters.vnfmadapter.extclients.etsicatalog; import java.util.Optional; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.NsdmSubscription; import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.PkgmSubscription; import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.InlineResponse2001; @@ -81,10 +82,18 @@ public interface EtsiCatalogServiceProvider { final org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.PkgmSubscriptionRequest etsiCatalogManagerSubscriptionRequest); /** + * Get the Subscription from ETSI Catalog. + * + * @param subscriptionId Subscription ID + * @return The Subscription {@link NsdmSubscription} from ETSI Catalog + */ + Optional<NsdmSubscription> getSubscription(final String subscriptionId); + + /** * DELETE the SubscriptionRequest Object. * * @return A Boolean representing if the delete was successful or not. */ - Boolean deleteSubscription(final String subscriptionId); + boolean deleteSubscription(final String subscriptionId); } diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/extclients/etsicatalog/EtsiCatalogServiceProviderImpl.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/extclients/etsicatalog/EtsiCatalogServiceProviderImpl.java index 573a798410..30d084629c 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/extclients/etsicatalog/EtsiCatalogServiceProviderImpl.java +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/extclients/etsicatalog/EtsiCatalogServiceProviderImpl.java @@ -21,11 +21,13 @@ package org.onap.so.adapters.vnfmadapter.extclients.etsicatalog; import java.util.Optional; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.NsdmSubscription; import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.PkgmSubscription; import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.VnfPkgInfo; import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.InlineResponse2001; import org.onap.so.adapters.vnfmadapter.rest.exceptions.EtsiCatalogManagerBadRequestException; import org.onap.so.adapters.vnfmadapter.rest.exceptions.EtsiCatalogManagerRequestFailureException; +import org.onap.so.adapters.vnfmadapter.rest.exceptions.SubscriptionNotFoundException; import org.onap.so.adapters.vnfmadapter.rest.exceptions.VnfPkgBadRequestException; import org.onap.so.adapters.vnfmadapter.rest.exceptions.VnfPkgConflictException; import org.onap.so.adapters.vnfmadapter.rest.exceptions.VnfPkgNotFoundException; @@ -79,7 +81,7 @@ public class EtsiCatalogServiceProviderImpl implements EtsiCatalogServiceProvide etsiCatalogUrlProvider.getVnfPackageArtifactUrl(vnfPkgId, artifactPath), byte[].class); logger.info("getVnfPackageArtifact Request to ETSI Catalog Manager Status Code: {}", response.getStatusCodeValue()); - if (response.getStatusCode() == HttpStatus.OK) { + if (response.getStatusCode().is2xxSuccessful()) { return Optional.ofNullable(response.getBody()); } } catch (final HttpResouceNotFoundException httpResouceNotFoundException) { @@ -104,7 +106,7 @@ public class EtsiCatalogServiceProviderImpl implements EtsiCatalogServiceProvide httpServiceProvider.getHttpResponse(etsiCatalogUrlProvider.getVnfPackagesUrl(), VnfPkgInfo[].class); logger.info("getVnfPackages Request to ETSI Catalog Manager Status Code: {}", response.getStatusCodeValue()); - if (response.getStatusCode() == HttpStatus.OK) { + if (response.getStatusCode().is2xxSuccessful()) { if (response.hasBody()) { final VnfPkgInfo[] vnfPackages = response.getBody(); assert (vnfPackages != null); @@ -145,7 +147,7 @@ public class EtsiCatalogServiceProviderImpl implements EtsiCatalogServiceProvide .getHttpResponse(etsiCatalogUrlProvider.getVnfPackageUrl(vnfPkgId), VnfPkgInfo.class); logger.info("getVnfPackage Request for vnfPkgId {} to ETSI Catalog Manager Status Code: {}", vnfPkgId, response.getStatusCodeValue()); - if (response.getStatusCode() == HttpStatus.OK) { + if (response.getStatusCode().is2xxSuccessful()) { if (response.hasBody()) { final VnfPkgInfo vnfPkgInfo = response.getBody(); if (conversionService.canConvert(vnfPkgInfo.getClass(), InlineResponse2001.class)) { @@ -183,7 +185,7 @@ public class EtsiCatalogServiceProviderImpl implements EtsiCatalogServiceProvide final ResponseEntity<PkgmSubscription> responseEntity = httpServiceProvider.postHttpRequest(etsiCatalogManagerSubscriptionRequest, etsiCatalogUrlProvider.getSubscriptionUrl(), PkgmSubscription.class); - if (responseEntity.getStatusCode() == HttpStatus.OK) { + if (responseEntity.getStatusCode().is2xxSuccessful()) { if (responseEntity.hasBody()) { return Optional.of(responseEntity.getBody()); } @@ -204,18 +206,23 @@ public class EtsiCatalogServiceProviderImpl implements EtsiCatalogServiceProvide } } - public Boolean deleteSubscription(final String subscriptionId) { + @Override + public boolean deleteSubscription(final String subscriptionId) { try { final ResponseEntity<Void> responseEntity = httpServiceProvider .deleteHttpRequest(etsiCatalogUrlProvider.getSubscriptionUrl() + "/" + subscriptionId, Void.class); - if (responseEntity.getStatusCode() == HttpStatus.NO_CONTENT) { + if (responseEntity.getStatusCode().is2xxSuccessful()) { logger.info("Subscription with ID: {} has been successfully deleted from the ETSI Catalog Manager", subscriptionId); return true; } logger.error("Unexpected Status Code Received on deleteSubscription: {}", responseEntity.getStatusCode()); return false; + } catch (final HttpResouceNotFoundException resouceNotFoundException) { + final String message = "Unable to find subscription in ETSI Catalog Manager using id: " + subscriptionId; + logger.error(message); + throw new SubscriptionNotFoundException(message); } catch (final InvalidRestRequestException invalidRestRequestException) { logger.error("Caught InvalidRestRequestException on deleteSubscription call to ETSI Catalog Manager.", invalidRestRequestException); @@ -224,7 +231,27 @@ public class EtsiCatalogServiceProviderImpl implements EtsiCatalogServiceProvide } } + @Override + public Optional<NsdmSubscription> getSubscription(final String subscriptionId) { + try { + final ResponseEntity<NsdmSubscription> responseEntity = httpServiceProvider.getHttpResponse( + etsiCatalogUrlProvider.getSubscriptionUrl() + "/" + subscriptionId, NsdmSubscription.class); + if (responseEntity.getStatusCode().is2xxSuccessful()) { + logger.debug("Found subscription with ID: {} in ETSI Catalog Manager", subscriptionId); + return Optional.ofNullable(responseEntity.getBody()); + } + logger.error("Unexpected Status Code Received on getting subscription from ETSI Catalog Manager: {}", + responseEntity.getStatusCode()); + } catch (final HttpResouceNotFoundException resouceNotFoundException) { + logger.error("Unable to find subscription in ETSI Catalog Manager using id: {}", subscriptionId); + return Optional.empty(); + } catch (final RestProcessingException | InvalidRestRequestException exception) { + logger.error("Unable to query ETSI Catalog Manager for subscription using id: {}", subscriptionId, + exception); + } + throw new EtsiCatalogManagerRequestFailureException("Internal Server Error Occurred."); + } private Optional<byte[]> requestVnfElement(final String vnfPkgId, final String vnfRequestUrl, final String vnfRequestName) { diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/AbstractNotificationServiceProvider.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/AbstractNotificationServiceProvider.java new file mode 100644 index 0000000000..86ca59cffe --- /dev/null +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/AbstractNotificationServiceProvider.java @@ -0,0 +1,64 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.adapters.vnfmadapter.packagemanagement.subscriptionmanagement; + +import static org.onap.so.client.RestTemplateConfig.CONFIGURABLE_REST_TEMPLATE; +import java.nio.charset.StandardCharsets; +import org.apache.commons.codec.binary.Base64; +import org.onap.so.configuration.rest.BasicHttpHeadersProvider; +import org.onap.so.configuration.rest.HttpHeadersProvider; +import org.onap.so.rest.service.HttpRestServiceProvider; +import org.onap.so.rest.service.HttpRestServiceProviderImpl; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.beans.factory.annotation.Qualifier; +import org.springframework.web.client.RestTemplate; + +/** + * A base class that can be extended by classes for providing notification services. Provides common methods that will + * be useful to those classes. + * + * @author Waqas Ikram (waqas.ikram@est.tech) + * @author Andrew Lamb (andrew.a.lamb@est.tech) + */ +public abstract class AbstractNotificationServiceProvider { + + @Autowired + @Qualifier(CONFIGURABLE_REST_TEMPLATE) + private RestTemplate restTemplate; + + protected HttpRestServiceProvider getHttpRestServiceProvider(final HttpHeadersProvider httpHeadersProvider) { + final HttpRestServiceProvider httpRestServiceProvider = + new HttpRestServiceProviderImpl(restTemplate, httpHeadersProvider); + return httpRestServiceProvider; + } + + protected BasicHttpHeadersProvider getBasicHttpHeadersProviderWithBasicAuth(final String username, + final String password) { + final byte[] encodedAuth = getBasicAuth(username, password); + final String authHeader = "Basic " + new String(encodedAuth); + return new BasicHttpHeadersProvider(authHeader); + } + + protected byte[] getBasicAuth(final String username, final String password) { + final String auth = username + ":" + password; + return Base64.encodeBase64(auth.getBytes(StandardCharsets.ISO_8859_1)); + } + +} diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/BasicAuthNotificationServiceProvider.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/BasicAuthNotificationServiceProvider.java new file mode 100644 index 0000000000..6f9d94e9de --- /dev/null +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/BasicAuthNotificationServiceProvider.java @@ -0,0 +1,68 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.adapters.vnfmadapter.packagemanagement.subscriptionmanagement; + +import static org.slf4j.LoggerFactory.getLogger; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsAuthentication; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsAuthentication.AuthTypeEnum; +import org.onap.so.configuration.rest.HttpHeadersProvider; +import org.onap.so.rest.service.HttpRestServiceProvider; +import org.slf4j.Logger; +import org.springframework.http.ResponseEntity; +import org.springframework.stereotype.Service; + +/** + * Implementation of a NotificationServiceProvider which supports Basic Authentication + * + * @author Waqas Ikram (waqas.ikram@est.tech) + * @author Andrew Lamb (andrew.a.lamb@est.tech) + */ +@Service +public class BasicAuthNotificationServiceProvider extends AbstractNotificationServiceProvider + implements NotificationServiceProvider { + + private static final Logger logger = getLogger(BasicAuthNotificationServiceProvider.class); + + @Override + public boolean send(final Object notification, final SubscriptionsAuthentication subscriptionsAuthentication, + final String callbackUri) { + logger.info("Sending notification to uri: {}", callbackUri); + final HttpHeadersProvider httpHeadersProvider = + getBasicHttpHeadersProviderWithBasicAuth(subscriptionsAuthentication.getParamsBasic().getUserName(), + subscriptionsAuthentication.getParamsBasic().getPassword()); + final HttpRestServiceProvider httpRestServiceProvider = getHttpRestServiceProvider(httpHeadersProvider); + + final ResponseEntity<Void> responseEntity = + httpRestServiceProvider.postHttpRequest(notification, callbackUri, Void.class); + if (responseEntity.getStatusCode().is2xxSuccessful()) { + logger.info("Notification sent successfully."); + return true; + } + + logger.error("Failed to send notification."); + return false; + } + + @Override + public AuthTypeEnum getAuthType() { + return AuthTypeEnum.BASIC; + } + +} diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/NotificationManager.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/NotificationManager.java new file mode 100644 index 0000000000..c1051d1c9d --- /dev/null +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/NotificationManager.java @@ -0,0 +1,137 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix Foundation. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.vnfmadapter.packagemanagement.subscriptionmanagement; + +import static org.slf4j.LoggerFactory.getLogger; +import java.util.List; +import java.util.Optional; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.notification.model.PkgChangeNotification; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.notification.model.PkgOnboardingNotification; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.PkgmSubscriptionRequest; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsAuthentication; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsAuthentication.AuthTypeEnum; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.notification.model.VnfPackageChangeNotification; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.notification.model.VnfPackageOnboardingNotification; +import org.onap.so.adapters.vnfmadapter.rest.exceptions.AuthenticationTypeNotSupportedException; +import org.onap.so.adapters.vnfmadapter.rest.exceptions.ConversionFailedException; +import org.onap.so.adapters.vnfmadapter.rest.exceptions.NotificationTypeNotSupportedException; +import org.onap.so.adapters.vnfmadapter.rest.exceptions.SubscriptionNotFoundException; +import org.slf4j.Logger; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.core.convert.ConversionService; +import org.springframework.stereotype.Service; + +/** + * Manages package management subscription notifications to the VNFMs + * + * @author Andrew Lamb (andrew.a.lamb@est.tech) + * + */ +@Service +public class NotificationManager { + + private static final Logger logger = getLogger(NotificationManager.class); + private final ConversionService conversionService; + private final SubscriptionManager subscriptionManager; + private final NotificationServiceProviderFactory notificationServiceProviderFactory; + + @Autowired + public NotificationManager(final SubscriptionManager subscriptionManager, final ConversionService conversionService, + final NotificationServiceProviderFactory notificationServiceProviderFactory) { + this.subscriptionManager = subscriptionManager; + this.conversionService = conversionService; + this.notificationServiceProviderFactory = notificationServiceProviderFactory; + } + + /** + * Process a subscription notification. Checks for a subscription request stored in the adapter and if there is, it + * sends the notification to the subscribed vnfm. + * + * @param notification the notification to send to the vnfm + * @param subscriptionId the id of the subscription request + * @return true if the notification is successfully sent + */ + public boolean processSubscriptionNotification(final Object notification, final String subscriptionId) { + final Optional<PkgmSubscriptionRequest> optionalSubscription = + subscriptionManager.getSubscriptionRequest(subscriptionId); + if (optionalSubscription.isPresent()) { + final PkgmSubscriptionRequest subscriptionRequest = optionalSubscription.get(); + return notifyVnfm(subscriptionRequest, notification); + } + final String errorMessage = "No subscription found with subscriptionId " + subscriptionId + + ". Unable to forward notification to subscriber."; + logger.error(errorMessage); + throw new SubscriptionNotFoundException(errorMessage); + } + + private boolean notifyVnfm(final PkgmSubscriptionRequest subscriptionRequest, final Object notification) { + if (!(notification instanceof PkgOnboardingNotification) && !(notification instanceof PkgChangeNotification)) { + final String errorMessage = + "An error occurred. Notification type not supported for: " + notification.getClass(); + logger.error(errorMessage); + throw new NotificationTypeNotSupportedException(errorMessage); + } + + final SubscriptionsAuthentication subscriptionsAuthentication = subscriptionRequest.getAuthentication(); + final AuthTypeEnum authType = getAuthType(subscriptionsAuthentication.getAuthType()); + final NotificationServiceProvider sender = notificationServiceProviderFactory.getNotificationSender(authType); + + final Object vnfmNotificationObject = convertEtsiCatalogNotification(notification); + + if (sender.send(vnfmNotificationObject, subscriptionsAuthentication, subscriptionRequest.getCallbackUri())) { + logger.info("Notification delivered successfully {}", notification); + return true; + } + + logger.error("Failed to deliver notification."); + return false; + } + + private SubscriptionsAuthentication.AuthTypeEnum getAuthType(final List<AuthTypeEnum> authTypes) { + if (authTypes.contains(SubscriptionsAuthentication.AuthTypeEnum.TLS_CERT)) { + return SubscriptionsAuthentication.AuthTypeEnum.TLS_CERT; + } + if (authTypes.contains(SubscriptionsAuthentication.AuthTypeEnum.OAUTH2_CLIENT_CREDENTIALS)) { + return SubscriptionsAuthentication.AuthTypeEnum.OAUTH2_CLIENT_CREDENTIALS; + } + if (authTypes.contains(SubscriptionsAuthentication.AuthTypeEnum.BASIC)) { + return SubscriptionsAuthentication.AuthTypeEnum.BASIC; + } + final String errorMessage = + "An error occurred. No supported authentication type provided in subscription request."; + logger.error(errorMessage); + throw new AuthenticationTypeNotSupportedException(errorMessage); + } + + private Object convertEtsiCatalogNotification(final Object etsiCatalogNotification) { + logger.info("Converting notification:\n {}", etsiCatalogNotification); + if (conversionService.canConvert(etsiCatalogNotification.getClass(), VnfPackageOnboardingNotification.class)) { + return conversionService.convert(etsiCatalogNotification, VnfPackageOnboardingNotification.class); + } else if (conversionService.canConvert(etsiCatalogNotification.getClass(), + VnfPackageChangeNotification.class)) { + return conversionService.convert(etsiCatalogNotification, VnfPackageChangeNotification.class); + } + final String errorMessage = "An error occurred. Unable to convert provided notification object."; + logger.error(errorMessage + "\n" + etsiCatalogNotification); + throw new ConversionFailedException(errorMessage); + } + +} diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/NotificationServiceProvider.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/NotificationServiceProvider.java new file mode 100644 index 0000000000..2be80eec75 --- /dev/null +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/NotificationServiceProvider.java @@ -0,0 +1,51 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.adapters.vnfmadapter.packagemanagement.subscriptionmanagement; + +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsAuthentication; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsAuthentication.AuthTypeEnum; + +/** + * Interface which lays out requirements for a Notification Service Provider + * + * @author Waqas Ikram (waqas.ikram@est.tech) + * @author Andrew Lamb (andrew.a.lamb@est.tech) + */ +public interface NotificationServiceProvider { + + /** + * Method to send a notification to a uri, given the subscription authentication + * + * @param notification The notification to send + * @param subscriptionsAuthentication Object containing the authentication details + * @param callbackUri The uri to send the notification to + * @return true if notification is delivered successfully, otherwise false + */ + boolean send(final Object notification, final SubscriptionsAuthentication subscriptionsAuthentication, + final String callbackUri); + + /** + * Method to get the supported authorization type of the service provider + * + * @return the supported AuthTypeEnum + */ + AuthTypeEnum getAuthType(); + +} diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/NotificationServiceProviderFactory.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/NotificationServiceProviderFactory.java new file mode 100644 index 0000000000..ab67afed82 --- /dev/null +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/NotificationServiceProviderFactory.java @@ -0,0 +1,67 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.adapters.vnfmadapter.packagemanagement.subscriptionmanagement; + +import static org.slf4j.LoggerFactory.getLogger; +import java.util.HashMap; +import java.util.List; +import java.util.Map; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsAuthentication.AuthTypeEnum; +import org.onap.so.adapters.vnfmadapter.rest.exceptions.AuthenticationTypeNotSupportedException; +import org.slf4j.Logger; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.stereotype.Component; + +/** + * Factory to provide a notification services + * + * @author Waqas Ikram (waqas.ikram@est.tech) + * @author Andrew Lamb (andrew.a.lamb@est.tech) + */ +@Component +public class NotificationServiceProviderFactory { + + private static final Logger logger = getLogger(NotificationServiceProviderFactory.class); + private static final Map<AuthTypeEnum, NotificationServiceProvider> CACHE = new HashMap<>(); + + @Autowired + public NotificationServiceProviderFactory(final List<NotificationServiceProvider> services) { + for (final NotificationServiceProvider notificationServiceProvider : services) { + logger.debug("Adding {} of type {} to cache", notificationServiceProvider.getClass().getCanonicalName(), + notificationServiceProvider.getAuthType()); + CACHE.put(notificationServiceProvider.getAuthType(), notificationServiceProvider); + } + } + + /** + * Get a notification service for a given authorization type + * + * @param type the type of authentication required + * @return the notification service + */ + public NotificationServiceProvider getNotificationSender(final AuthTypeEnum type) { + final NotificationServiceProvider service = CACHE.get(type); + if (service == null) { + throw new AuthenticationTypeNotSupportedException("Unknown type: " + type); + } + return service; + } + +} diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/OAuthNotificationServiceProvider.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/OAuthNotificationServiceProvider.java new file mode 100644 index 0000000000..496fb083cf --- /dev/null +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/OAuthNotificationServiceProvider.java @@ -0,0 +1,102 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.adapters.vnfmadapter.packagemanagement.subscriptionmanagement; + +import static org.slf4j.LoggerFactory.getLogger; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsAuthentication; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsAuthentication.AuthTypeEnum; +import org.onap.so.adapters.vnfmadapter.rest.exceptions.InternalServerErrorException; +import org.onap.so.configuration.rest.BasicHttpHeadersProvider; +import org.onap.so.configuration.rest.HttpHeadersProvider; +import org.onap.so.rest.service.HttpRestServiceProvider; +import org.slf4j.Logger; +import org.springframework.http.ResponseEntity; +import org.springframework.stereotype.Service; + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * @author Andrew Lamb (andrew.a.lamb@est.tech) + * + */ +@Service +public class OAuthNotificationServiceProvider extends AbstractNotificationServiceProvider + implements NotificationServiceProvider { + + private static final Logger logger = getLogger(OAuthNotificationServiceProvider.class); + + @Override + public boolean send(final Object notification, final SubscriptionsAuthentication subscriptionsAuthentication, + final String callbackUri) { + logger.info("Sending notification to uri: {}", callbackUri); + final String token = getAccessToken(subscriptionsAuthentication); + + if (token == null) { + return false; + } + + final HttpHeadersProvider httpHeadersProvider = getHttpHeadersProvider(token); + final HttpRestServiceProvider httpRestServiceProvider = getHttpRestServiceProvider(httpHeadersProvider); + final ResponseEntity<Void> responseEntity = + httpRestServiceProvider.postHttpRequest(notification, callbackUri, Void.class); + if (responseEntity.getStatusCode().is2xxSuccessful()) { + logger.info("Notification sent successfully."); + return true; + } + + logger.error("Failed to send notification."); + return false; + } + + @Override + public AuthTypeEnum getAuthType() { + return AuthTypeEnum.OAUTH2_CLIENT_CREDENTIALS; + } + + private BasicHttpHeadersProvider getHttpHeadersProvider(final String token) { + final String authHeader = "Bearer " + token; + return new BasicHttpHeadersProvider(authHeader); + } + + private String getAccessToken(final SubscriptionsAuthentication subscriptionsAuthentication) { + logger.info("Requesting Access Token."); + + final String tokenEndpoint = subscriptionsAuthentication.getParamsOauth2ClientCredentials().getTokenEndpoint(); + + final HttpHeadersProvider httpHeadersProvider = getBasicHttpHeadersProviderWithBasicAuth( + subscriptionsAuthentication.getParamsOauth2ClientCredentials().getClientId(), + subscriptionsAuthentication.getParamsOauth2ClientCredentials().getClientPassword()); + + final HttpRestServiceProvider httpRestServiceProvider = getHttpRestServiceProvider(httpHeadersProvider); + final ResponseEntity<OAuthTokenResponse> responseEntity = + httpRestServiceProvider.postHttpRequest(null, tokenEndpoint, OAuthTokenResponse.class); + if (responseEntity.getStatusCode().is2xxSuccessful()) { + if (responseEntity.getBody() != null) { + logger.info("Returning Access Token."); + return responseEntity.getBody().getAccessToken(); + } + } + + final String errorMessage = "An error occurred. Unable to retrieve OAuth Token from VNFM for notification."; + logger.error(errorMessage); + throw new InternalServerErrorException(errorMessage); + } + + +} diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/OAuthTokenResponse.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/OAuthTokenResponse.java new file mode 100644 index 0000000000..146641cc7c --- /dev/null +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/OAuthTokenResponse.java @@ -0,0 +1,56 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.adapters.vnfmadapter.packagemanagement.subscriptionmanagement; + +import java.io.Serializable; +import javax.xml.bind.annotation.XmlElement; +import com.google.gson.annotations.SerializedName; + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * @author Andrew Lamb (andrew.a.lamb@est.tech) + */ +public class OAuthTokenResponse implements Serializable { + + private static final long serialVersionUID = -6455742984985959926L; + + @XmlElement(name = "access_token") + @SerializedName("access_token") + private String accessToken; + + /** + * Get the Accees Token + * + * @return the Access Token + */ + public String getAccessToken() { + return accessToken; + } + + /** + * Set the Access Token + * + * @param accessToken + */ + public void setAccessToken(final String accessToken) { + this.accessToken = accessToken; + } + +} diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/SubscriptionManager.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/SubscriptionManager.java index bbf8b74952..a4c52fd13d 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/SubscriptionManager.java +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/SubscriptionManager.java @@ -31,8 +31,8 @@ import java.util.Objects; import java.util.Optional; import org.onap.so.adapters.vnfmadapter.Constants; import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.EtsiCatalogServiceProvider; -import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.EtsiCatalogUrlProvider; import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.BasicAuth; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.NsdmSubscription; import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.PkgmSubscription; import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.InlineResponse2002; import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.PkgmSubscriptionRequest; @@ -40,13 +40,12 @@ import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model. import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.VnfPackagesLinksSelf; import org.onap.so.adapters.vnfmadapter.packagemanagement.subscriptionmanagement.cache.PackageManagementCacheServiceProvider; import org.onap.so.adapters.vnfmadapter.rest.exceptions.InternalServerErrorException; -import org.onap.so.adapters.vnfmadapter.rest.exceptions.SubscriptionRequestConversionException; -import org.onap.so.rest.service.HttpRestServiceProvider; +import org.onap.so.adapters.vnfmadapter.rest.exceptions.SubscriptionNotFoundException; +import org.onap.so.adapters.vnfmadapter.rest.exceptions.ConversionFailedException; import org.onap.so.utils.CryptoUtils; import org.slf4j.Logger; import org.springframework.beans.factory.annotation.Autowired; import org.springframework.beans.factory.annotation.Value; -import org.springframework.core.convert.ConversionException; import org.springframework.core.convert.ConversionService; import org.springframework.stereotype.Service; @@ -55,34 +54,26 @@ import org.springframework.stereotype.Service; * * @author Ronan Kenny (ronan.kenny@est.tech) * @author Gareth Roper (gareth.roper@est.tech) - * */ @Service public class SubscriptionManager { private static final Logger logger = getLogger(SubscriptionManager.class); private final PackageManagementCacheServiceProvider packageManagementCacheServiceProvider; - private final EtsiCatalogUrlProvider etsiCatalogUrlProvider; - private final HttpRestServiceProvider httpServiceProvider; private final ConversionService conversionService; private final EtsiCatalogServiceProvider etsiCatalogServiceProvider; private final String vnfmAdapterEndpoint; private final String msoKeyString; private final String vnfmAdapterAuth; - @Autowired public SubscriptionManager(final PackageManagementCacheServiceProvider packageManagementCacheServiceProvider, - final ConversionService conversionService, final HttpRestServiceProvider httpServiceProvider, - final EtsiCatalogUrlProvider etsiCatalogUrlProvider, - final EtsiCatalogServiceProvider etsiCatalogServiceProvider, + final ConversionService conversionService, final EtsiCatalogServiceProvider etsiCatalogServiceProvider, @Value("${vnfmadapter.endpoint}") final String vnfmAdapterEndpoint, @Value("${mso.key}") final String msoKeyString, - @Value("${vnfmadapter.auth:D6CFE56451508B75536C5E8A1E7AE06D0346006A693BF29293A6E1C762EFD59C671911DB6E9294E4FE15E4C1C5524B}") final String vnfmAdapterAuth) { + @Value("${vnfmadapter.auth:BF29BA36F0CFE1C05507781F6B97EFBCA7EFAC9F595954D465FC43F646883EF585C20A58CBB02528A6FAAC}") final String vnfmAdapterAuth) { this.packageManagementCacheServiceProvider = packageManagementCacheServiceProvider; - this.etsiCatalogUrlProvider = etsiCatalogUrlProvider; this.conversionService = conversionService; - this.httpServiceProvider = httpServiceProvider; this.etsiCatalogServiceProvider = etsiCatalogServiceProvider; this.vnfmAdapterEndpoint = vnfmAdapterEndpoint; this.vnfmAdapterAuth = vnfmAdapterAuth; @@ -99,10 +90,10 @@ public class SubscriptionManager { etsiCatalogServiceProvider.postSubscription(etsiCatalogManagerSubscriptionRequest); if (optionalEtsiCatalogManagerSubscription.isPresent()) { - PkgmSubscription etsiCatalogManagerSubscription = optionalEtsiCatalogManagerSubscription.get(); + final PkgmSubscription etsiCatalogManagerSubscription = optionalEtsiCatalogManagerSubscription.get(); logger.debug("postPkgmSubscriptionRequest Response SubscriptionId: {}", - Objects.requireNonNull(etsiCatalogManagerSubscription.getId().toString())); - final String subscriptionId = etsiCatalogManagerSubscription.getId().toString(); + Objects.requireNonNull(etsiCatalogManagerSubscription.getId())); + final String subscriptionId = etsiCatalogManagerSubscription.getId(); packageManagementCacheServiceProvider.addSubscription(subscriptionId, pkgmSubscriptionRequest); @@ -119,13 +110,24 @@ public class SubscriptionManager { "Received empty response from POST to ETSI Catalog Manager Subscription Endpoint."); } - - public Optional<String> getSubscriptionId(final PkgmSubscriptionRequest pkgmSubscriptionRequest) { return packageManagementCacheServiceProvider.getSubscriptionId(pkgmSubscriptionRequest); } public Optional<InlineResponse2002> getSubscription(final String subscriptionId) { + + logger.debug("Checking if subscrition with id: {} exists in ETSI Catalog Manager", subscriptionId); + final Optional<NsdmSubscription> etsiCatalogSubscriptionOption = + etsiCatalogServiceProvider.getSubscription(subscriptionId); + + if (!etsiCatalogSubscriptionOption.isPresent()) { + logger.debug("Unable to find subscription in ETSI Catalog Manager using id: {}", subscriptionId); + if (packageManagementCacheServiceProvider.getSubscription(subscriptionId).isPresent()) { + logger.debug("will remove subcription with id: {} from local cache", subscriptionId); + packageManagementCacheServiceProvider.deleteSubscription(subscriptionId); + } + } + final Optional<PkgmSubscriptionRequest> optional = packageManagementCacheServiceProvider.getSubscription(subscriptionId); if (optional.isPresent()) { @@ -139,13 +141,25 @@ public class SubscriptionManager { final Map<String, PkgmSubscriptionRequest> subscriptions = packageManagementCacheServiceProvider.getSubscriptions(); final List<InlineResponse2002> response = new ArrayList<>(); - subscriptions.forEach((key, value) -> response.add(getInlineResponse2002(key, value))); + subscriptions.forEach((key, value) -> { + final Optional<InlineResponse2002> optional = getSubscription(key); + if (optional.isPresent()) { + response.add(optional.get()); + } + }); return response; } public boolean deleteSubscription(final String subscriptionId) { - if (getSubscription(subscriptionId).isPresent()) { - if (etsiCatalogServiceProvider.deleteSubscription(subscriptionId)) { + if (packageManagementCacheServiceProvider.getSubscription(subscriptionId).isPresent()) { + try { + if (etsiCatalogServiceProvider.deleteSubscription(subscriptionId)) { + return packageManagementCacheServiceProvider.deleteSubscription(subscriptionId); + } + } catch (final SubscriptionNotFoundException subscriptionNotFoundException) { + logger.error( + "Unable to find subscription in ETSI Catalog Manager using id: {} will delete it from local cache", + subscriptionId); return packageManagementCacheServiceProvider.deleteSubscription(subscriptionId); } } @@ -157,23 +171,27 @@ public class SubscriptionManager { vnfmAdapterEndpoint + Constants.PACKAGE_MANAGEMENT_BASE_URL + "/subscriptions/" + subscriptionId); } + public Optional<PkgmSubscriptionRequest> getSubscriptionRequest(final String subscriptionId) { + return packageManagementCacheServiceProvider.getSubscription(subscriptionId); + } + private InlineResponse2002 getInlineResponse2002(final String id, final PkgmSubscriptionRequest subscription) { return new InlineResponse2002().id(id).filter(subscription.getFilter()) .callbackUri(subscription.getCallbackUri()); } private org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.PkgmSubscriptionRequest buildEtsiCatalogManagerPkgmSubscriptionRequest( - PkgmSubscriptionRequest pkgmSubscriptionRequest) throws GeneralSecurityException { + final PkgmSubscriptionRequest pkgmSubscriptionRequest) throws GeneralSecurityException { final org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.PkgmSubscriptionRequest etsiCatalogManagerSubscriptionRequest; try { etsiCatalogManagerSubscriptionRequest = conversionService.convert(pkgmSubscriptionRequest, org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.PkgmSubscriptionRequest.class); - } catch (ConversionException conversionException) { + } catch (final org.springframework.core.convert.ConversionException conversionException) { logger.error(conversionException.getMessage()); - throw new SubscriptionRequestConversionException( + throw new ConversionFailedException( "Could not convert Sol003 PkgmSubscriptionRequest to ETSI-Catalog Manager PkgmSubscriptionRequest"); - } catch (Exception exception) { + } catch (final Exception exception) { logger.error(exception.getMessage()); throw new InternalServerErrorException( "Could not convert Sol003 PkgmSubscriptionRequest to ETSI-Catalog Manager PkgmSubscriptionRequest"); @@ -192,7 +210,7 @@ public class SubscriptionManager { .addAuthTypeItem(BASIC).paramsBasic(new BasicAuth().userName(username).password(password))); return etsiCatalogManagerSubscriptionRequest; } - throw new SubscriptionRequestConversionException( + throw new ConversionFailedException( "Failed to convert Sol003 PkgmSubscriptionRequest to ETSI-Catalog Manager PkgmSubscriptionRequest"); } diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/TlsNotificationServiceProvider.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/TlsNotificationServiceProvider.java new file mode 100644 index 0000000000..c9babbd345 --- /dev/null +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/packagemanagement/subscriptionmanagement/TlsNotificationServiceProvider.java @@ -0,0 +1,56 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.adapters.vnfmadapter.packagemanagement.subscriptionmanagement; + +import static org.slf4j.LoggerFactory.getLogger; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsAuthentication; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsAuthentication.AuthTypeEnum; +import org.onap.so.adapters.vnfmadapter.rest.exceptions.AuthenticationTypeNotSupportedException; +import org.slf4j.Logger; +import org.springframework.stereotype.Service; + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * @author Andrew Lamb (andrew.a.lamb@est.tech) + */ +@Service +public class TlsNotificationServiceProvider extends AbstractNotificationServiceProvider + implements NotificationServiceProvider { + + private static final Logger logger = getLogger(TlsNotificationServiceProvider.class); + + @Override + public boolean send(final Object notification, final SubscriptionsAuthentication subscriptionsAuthentication, + final String callbackUri) { + final String errorMessage = "An error occurred. Authentication type " + + subscriptionsAuthentication.getAuthType().toString() + " not currently supported."; + logger.error(errorMessage); + throw new AuthenticationTypeNotSupportedException(errorMessage); + } + + + @Override + public AuthTypeEnum getAuthType() { + return AuthTypeEnum.TLS_CERT; + } + + + +} diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/EtsiSubscriptionNotificationController.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/EtsiSubscriptionNotificationController.java index c5bd5bc14e..a97f04bcc8 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/EtsiSubscriptionNotificationController.java +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/EtsiSubscriptionNotificationController.java @@ -22,30 +22,110 @@ package org.onap.so.adapters.vnfmadapter.rest; import static org.onap.so.adapters.vnfmadapter.Constants.ETSI_SUBSCRIPTION_NOTIFICATION_CONTROLLER_BASE_URL; import static org.slf4j.LoggerFactory.getLogger; +import java.util.AbstractMap; +import java.util.Map.Entry; import javax.ws.rs.core.MediaType; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.notification.model.PkgChangeNotification; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.notification.model.PkgOnboardingNotification; +import org.onap.so.adapters.vnfmadapter.packagemanagement.subscriptionmanagement.NotificationManager; +import org.onap.so.adapters.vnfmadapter.rest.exceptions.InternalServerErrorException; +import org.onap.so.adapters.vnfmadapter.rest.exceptions.NotificationTypeNotSupportedException; import org.slf4j.Logger; +import org.springframework.beans.factory.annotation.Autowired; import org.springframework.http.ResponseEntity; import org.springframework.stereotype.Controller; import org.springframework.web.bind.annotation.GetMapping; +import org.springframework.web.bind.annotation.PostMapping; +import org.springframework.web.bind.annotation.RequestBody; import org.springframework.web.bind.annotation.RequestMapping; +import com.google.gson.Gson; +import com.google.gson.GsonBuilder; +import com.google.gson.JsonObject; +import com.google.gson.JsonParser; /** * This controller handles the ETSI Subscription Notification Endpoints. * * @author Ronan Kenny (ronan.kenny@est.tech) * @author Gareth Roper (gareth.roper@est.tech) + * @author Andrew Lamb (andrew.a.lamb@est.tech) */ @Controller -@RequestMapping(value = ETSI_SUBSCRIPTION_NOTIFICATION_CONTROLLER_BASE_URL, - produces = {MediaType.APPLICATION_JSON, MediaType.APPLICATION_XML}, - consumes = {MediaType.APPLICATION_JSON, MediaType.APPLICATION_XML}) +@RequestMapping(value = ETSI_SUBSCRIPTION_NOTIFICATION_CONTROLLER_BASE_URL) public class EtsiSubscriptionNotificationController { private static final Logger logger = getLogger(EtsiSubscriptionNotificationController.class); + private final NotificationManager notificationManager; + private final Gson gson; + + @Autowired + public EtsiSubscriptionNotificationController(final NotificationManager notificationManager) { + this.notificationManager = notificationManager; + this.gson = new GsonBuilder().create(); + } @GetMapping(value = "/notification") public ResponseEntity<Void> testSubscriptionNotificationEndPoint() { logger.debug("Testing Notification Endpoint"); return ResponseEntity.noContent().build(); } + + /** + * POST notification on to subscriber. + * + * @param notification The notification to send. + * @return Response Code: 204 No Content if Successful, ProblemDetails Object if not. + */ + @PostMapping(value = "/notification", consumes = MediaType.APPLICATION_JSON, produces = MediaType.APPLICATION_JSON) + public ResponseEntity<?> postSubscriptionNotification(@RequestBody final String notification) { + logger.info("Posting subscription notification \n{}", notification); + + final Entry<String, Object> notificationObject = getNotificationObject(notification); + if (notificationManager.processSubscriptionNotification(notificationObject.getValue(), + notificationObject.getKey())) { + logger.info("Notification Delivered Successfully"); + return ResponseEntity.noContent().build(); + } + final String errorMessage = "An error occurred. Sending of notification to VNFM failed."; + logger.error(errorMessage); + throw new InternalServerErrorException(errorMessage); + } + + private Entry<String, Object> getNotificationObject(final String notification) { + final String notificationType = getNotificationType(notification); + if (PkgOnboardingNotification.NotificationTypeEnum.VNFPACKAGEONBOARDINGNOTIFICATION.getValue() + .equals(notificationType)) { + final PkgOnboardingNotification pkgOnboardingNotification = + gson.fromJson(notification, PkgOnboardingNotification.class); + logger.info("Onboarding notification received:\n{}", pkgOnboardingNotification); + return new AbstractMap.SimpleEntry<>(pkgOnboardingNotification.getSubscriptionId(), + pkgOnboardingNotification); + } + if (PkgChangeNotification.NotificationTypeEnum.VNFPACKAGECHANGENOTIFICATION.getValue() + .equals(notificationType)) { + final PkgChangeNotification pkgChangeNotification = + gson.fromJson(notification, PkgChangeNotification.class); + logger.info("Change notification received:\n{}", pkgChangeNotification); + return new AbstractMap.SimpleEntry<>(pkgChangeNotification.getSubscriptionId(), pkgChangeNotification); + + } + + final String errorMessage = "An error occurred. Notification type not supported for: " + notificationType; + logger.error(errorMessage); + throw new NotificationTypeNotSupportedException(errorMessage); + + } + + private String getNotificationType(final String notification) { + try { + final JsonParser parser = new JsonParser(); + final JsonObject element = (JsonObject) parser.parse(notification); + return element.get("notificationType").getAsString(); + } catch (final Exception e) { + logger.error("An error occurred processing notificiation: {}", e.getMessage()); + } + throw new NotificationTypeNotSupportedException( + "Unable to parse notification type in object \n" + notification); + } + } diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/Sol003GrantController.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/Sol003GrantController.java index 3ead98fce2..21b20b0134 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/Sol003GrantController.java +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/Sol003GrantController.java @@ -50,8 +50,6 @@ import org.springframework.web.bind.annotation.RequestMapping; @RequestMapping(value = BASE_URL, produces = MediaType.APPLICATION_JSON, consumes = MediaType.APPLICATION_JSON) public class Sol003GrantController { - private static final String SEPARATOR = "_"; - private static final String VIM_TYPE = "OPENSTACK"; private static final Logger logger = LoggerFactory.getLogger(Sol003GrantController.class); public final AaiServiceProvider aaiServiceProvider; public final AaiHelper aaiHelper; diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/Sol003PackageManagementController.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/Sol003PackageManagementController.java index cce7241757..f1d20c65ef 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/Sol003PackageManagementController.java +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/Sol003PackageManagementController.java @@ -109,19 +109,19 @@ public class Sol003PackageManagementController { */ @GetMapping(value = "/vnf_packages/{vnfPkgId}/vnfd", produces = {MediaType.TEXT_PLAIN, APPLICATION_ZIP, MediaType.APPLICATION_JSON}) - public ResponseEntity<byte[]> getVnfPackageVnfd(@PathVariable("vnfPkgId") final String vnfPkgId) { + public ResponseEntity<?> getVnfPackageVnfd(@PathVariable("vnfPkgId") final String vnfPkgId) { logger.info(LOG_REQUEST_RECEIVED, "getVnfPackageVnfd Endpoint Invoked with VNF Package ID: ", vnfPkgId); final Optional<byte[]> response = etsiCatalogServiceProvider.getVnfPackageVnfd(vnfPkgId); if (response.isPresent()) { logger.info(LOG_REQUEST_RECEIVED, "getVnfPackageVnfd Response: ", HttpStatus.OK); - return new ResponseEntity(response.get(), HttpStatus.OK); + return new ResponseEntity<>(response.get(), HttpStatus.OK); } final String errorMessage = "An error occurred, a null response was received by the\n" + " Sol003PackageManagementController from the EtsiCatalogManager using the GET \"vnfd\" \n" + "endpoint."; logger.error(errorMessage); - return new ResponseEntity(new ProblemDetails().detail(errorMessage), HttpStatus.INTERNAL_SERVER_ERROR); + return new ResponseEntity<>(new ProblemDetails().detail(errorMessage), HttpStatus.INTERNAL_SERVER_ERROR); } /** diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/Sol003PackageManagementSubscriptionController.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/Sol003PackageManagementSubscriptionController.java index 4be0838c08..6db3797f9b 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/Sol003PackageManagementSubscriptionController.java +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/Sol003PackageManagementSubscriptionController.java @@ -79,7 +79,7 @@ public class Sol003PackageManagementSubscriptionController { @PostMapping(value = "/subscriptions") public ResponseEntity<?> postSubscriptionRequest(@RequestBody final PkgmSubscriptionRequest pkgmSubscriptionRequest) throws GeneralSecurityException { - logger.info(LOG_REQUEST_RECEIVED, " postSubscriptionRequest Endpoint Called"); + logger.info(LOG_REQUEST_RECEIVED, " postSubscriptionRequest Endpoint Called", pkgmSubscriptionRequest); // Check if subscription exists already. final Optional<String> exists = subscriptionManager.getSubscriptionId(pkgmSubscriptionRequest); diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/exceptions/AuthenticationTypeNotSupportedException.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/exceptions/AuthenticationTypeNotSupportedException.java new file mode 100644 index 0000000000..303420f1e8 --- /dev/null +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/exceptions/AuthenticationTypeNotSupportedException.java @@ -0,0 +1,44 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix Foundation. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.adapters.vnfmadapter.rest.exceptions; + +import org.springframework.http.HttpStatus; +import org.springframework.web.bind.annotation.ResponseStatus; + +/** + * Exception for an unsupported authentication type + * + * @author Andrew Lamb (andrew.a.lamb@est.tech) + */ +@ResponseStatus(code = HttpStatus.INTERNAL_SERVER_ERROR) +public class AuthenticationTypeNotSupportedException extends RuntimeException { + + private static final long serialVersionUID = 2939423208362066902L; + + public AuthenticationTypeNotSupportedException(final String message) { + super(message); + } + + @Override + public synchronized Throwable fillInStackTrace() { + return this; + } + +} diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/exceptions/SubscriptionRequestConversionException.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/exceptions/ConversionFailedException.java index daa544f928..e19a53d1dc 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/exceptions/SubscriptionRequestConversionException.java +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/exceptions/ConversionFailedException.java @@ -23,16 +23,17 @@ import org.springframework.http.HttpStatus; import org.springframework.web.bind.annotation.ResponseStatus; /** - * Exception for an ETSI Catalog Manager Request Failure + * Exception for Conversion Failures * - * @author gareth.roper@est.tech + * @author Gareth Roper (gareth.roper@est.tech) + * @author Andrew Lamb (andrew.a.lamb@est.tech) */ @ResponseStatus(code = HttpStatus.INTERNAL_SERVER_ERROR) -public class SubscriptionRequestConversionException extends RuntimeException { +public class ConversionFailedException extends RuntimeException { private static final long serialVersionUID = 45898561453196895L; - public SubscriptionRequestConversionException(final String message) { + public ConversionFailedException(final String message) { super(message); } diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/exceptions/EtsiSubscriptionNotificationControllerExceptionHandler.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/exceptions/EtsiSubscriptionNotificationControllerExceptionHandler.java new file mode 100644 index 0000000000..e8e1ce35b9 --- /dev/null +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/exceptions/EtsiSubscriptionNotificationControllerExceptionHandler.java @@ -0,0 +1,112 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix Foundation. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.vnfmadapter.rest.exceptions; + +import static org.slf4j.LoggerFactory.getLogger; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.ProblemDetails; +import org.onap.so.adapters.vnfmadapter.rest.EtsiSubscriptionNotificationController; +import org.onap.so.rest.exceptions.HttpResouceNotFoundException; +import org.onap.so.rest.exceptions.InvalidRestRequestException; +import org.onap.so.rest.exceptions.RestProcessingException; +import org.slf4j.Logger; +import org.springframework.http.HttpStatus; +import org.springframework.http.ResponseEntity; +import org.springframework.web.bind.annotation.ControllerAdvice; +import org.springframework.web.bind.annotation.ExceptionHandler; + +/** + * Exception Handler for the Etsi Subscription Notification Controller {@link EtsiSubscriptionNotificationController + * EtsiSubscriptionNotificationController} + * + * @author Andrew Lamb (andrew.a.lamb@est.tech) + */ +@ControllerAdvice(assignableTypes = EtsiSubscriptionNotificationController.class) +public class EtsiSubscriptionNotificationControllerExceptionHandler { + + private static final Logger logger = getLogger(EtsiSubscriptionNotificationControllerExceptionHandler.class); + + @ExceptionHandler(InvalidRestRequestException.class) + public ResponseEntity<ProblemDetails> handleInvalidRestRequestException( + final InvalidRestRequestException invalidRestRequestException) { + final String errorMessage = "An error occurred. Sending of notification to VNFM failed with response: " + + HttpStatus.BAD_REQUEST + ".\n" + invalidRestRequestException.getMessage(); + logger.error(errorMessage); + return ResponseEntity.status(HttpStatus.INTERNAL_SERVER_ERROR).body(new ProblemDetails().detail(errorMessage)); + } + + @ExceptionHandler(HttpResouceNotFoundException.class) + public ResponseEntity<ProblemDetails> handleHttpResourceNotFoundException( + final HttpResouceNotFoundException httpResourceNotFoundException) { + final String errorMessage = "An error occurred. Sending of notification to VNFM failed with response: " + + HttpStatus.NOT_FOUND + ".\n" + httpResourceNotFoundException.getMessage(); + logger.error(errorMessage); + return ResponseEntity.status(HttpStatus.INTERNAL_SERVER_ERROR).body(new ProblemDetails().detail(errorMessage)); + } + + @ExceptionHandler(RestProcessingException.class) + public ResponseEntity<ProblemDetails> handleRestProcessingException( + final RestProcessingException restProcessingException) { + final String errorMessage = "An error occurred. Sending of notification to VNFM failed with response: " + + restProcessingException.getStatusCode() + ".\n" + restProcessingException.getMessage(); + logger.error(errorMessage); + return ResponseEntity.status(HttpStatus.INTERNAL_SERVER_ERROR).body(new ProblemDetails().detail(errorMessage)); + } + + @ExceptionHandler(InternalServerErrorException.class) + public ResponseEntity<ProblemDetails> handleInternalServerErrorException( + final InternalServerErrorException internalServerErrorException) { + logger.error(internalServerErrorException.getMessage()); + return ResponseEntity.status(HttpStatus.INTERNAL_SERVER_ERROR) + .body(new ProblemDetails().detail(internalServerErrorException.getMessage())); + } + + @ExceptionHandler(AuthenticationTypeNotSupportedException.class) + public ResponseEntity<ProblemDetails> handleAuthenticationTypeNotSupportedException( + final AuthenticationTypeNotSupportedException authenticationTypeNotSupportedException) { + logger.error(authenticationTypeNotSupportedException.getMessage()); + return ResponseEntity.status(HttpStatus.INTERNAL_SERVER_ERROR) + .body(new ProblemDetails().detail(authenticationTypeNotSupportedException.getMessage())); + } + + @ExceptionHandler(ConversionFailedException.class) + public ResponseEntity<ProblemDetails> handleConversionFailedException( + final ConversionFailedException conversionFailedException) { + logger.error(conversionFailedException.getMessage()); + return ResponseEntity.status(HttpStatus.INTERNAL_SERVER_ERROR) + .body(new ProblemDetails().detail(conversionFailedException.getMessage())); + } + + @ExceptionHandler(NotificationTypeNotSupportedException.class) + public ResponseEntity<ProblemDetails> handleNotificationTypeNotSupportedException( + final NotificationTypeNotSupportedException notificationTypeNotSupportedException) { + logger.error(notificationTypeNotSupportedException.getMessage()); + return ResponseEntity.status(HttpStatus.INTERNAL_SERVER_ERROR) + .body(new ProblemDetails().detail(notificationTypeNotSupportedException.getMessage())); + } + + @ExceptionHandler(SubscriptionNotFoundException.class) + public ResponseEntity<ProblemDetails> handleSubscriptionNotFoundException( + final SubscriptionNotFoundException subscriptionNotFoundException) { + logger.error(subscriptionNotFoundException.getMessage()); + return ResponseEntity.status(HttpStatus.INTERNAL_SERVER_ERROR) + .body(new ProblemDetails().detail(subscriptionNotFoundException.getMessage())); + } +} diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/exceptions/NotificationTypeNotSupportedException.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/exceptions/NotificationTypeNotSupportedException.java new file mode 100644 index 0000000000..dcc98864aa --- /dev/null +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/exceptions/NotificationTypeNotSupportedException.java @@ -0,0 +1,44 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix Foundation. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.adapters.vnfmadapter.rest.exceptions; + +import org.springframework.http.HttpStatus; +import org.springframework.web.bind.annotation.ResponseStatus; + +/** + * Exception for an unsupported notification type + * + * @author Andrew Lamb (andrew.a.lamb@est.tech) + */ +@ResponseStatus(code = HttpStatus.INTERNAL_SERVER_ERROR) +public class NotificationTypeNotSupportedException extends RuntimeException { + + private static final long serialVersionUID = 2939423208362066902L; + + public NotificationTypeNotSupportedException(final String message) { + super(message); + } + + @Override + public synchronized Throwable fillInStackTrace() { + return this; + } + +} diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/exceptions/Sol003PackageManagementControllerExceptionHandler.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/exceptions/Sol003PackageManagementControllerExceptionHandler.java index da8b0cbff2..8091f35da6 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/exceptions/Sol003PackageManagementControllerExceptionHandler.java +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/main/java/org/onap/so/adapters/vnfmadapter/rest/exceptions/Sol003PackageManagementControllerExceptionHandler.java @@ -22,10 +22,6 @@ package org.onap.so.adapters.vnfmadapter.rest.exceptions; import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.ProblemDetails; import org.onap.so.adapters.vnfmadapter.rest.Sol003PackageManagementController; -import org.onap.so.adapters.vnfmadapter.rest.exceptions.EtsiCatalogManagerRequestFailureException; -import org.onap.so.adapters.vnfmadapter.rest.exceptions.VnfPkgBadRequestException; -import org.onap.so.adapters.vnfmadapter.rest.exceptions.VnfPkgConflictException; -import org.onap.so.adapters.vnfmadapter.rest.exceptions.VnfPkgNotFoundException; import org.springframework.http.HttpStatus; import org.springframework.http.ResponseEntity; import org.springframework.web.bind.annotation.ControllerAdvice; @@ -64,11 +60,11 @@ public class Sol003PackageManagementControllerExceptionHandler { return ResponseEntity.status(HttpStatus.NOT_FOUND).body(problemDetails); } - @ExceptionHandler(SubscriptionRequestConversionException.class) - public ResponseEntity<ProblemDetails> handleSubscriptionRequestConversionException( - final SubscriptionRequestConversionException subscriptionRequestConversionException) { + @ExceptionHandler(ConversionFailedException.class) + public ResponseEntity<ProblemDetails> handleConversionFailedException( + final ConversionFailedException conversionFailedException) { final ProblemDetails problemDetails = new ProblemDetails(); - problemDetails.setDetail(subscriptionRequestConversionException.getMessage()); + problemDetails.setDetail(conversionFailedException.getMessage()); return ResponseEntity.status(HttpStatus.INTERNAL_SERVER_ERROR).body(problemDetails); } diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/test/java/org/onap/so/adapters/vnfmadapter/rest/EtsiSubscriptionNotificationControllerTest.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/test/java/org/onap/so/adapters/vnfmadapter/rest/EtsiSubscriptionNotificationControllerTest.java new file mode 100644 index 0000000000..322251e753 --- /dev/null +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/test/java/org/onap/so/adapters/vnfmadapter/rest/EtsiSubscriptionNotificationControllerTest.java @@ -0,0 +1,595 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix Foundation. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ + +package org.onap.so.adapters.vnfmadapter.rest; + +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.assertTrue; +import static org.onap.so.adapters.vnfmadapter.Constants.ETSI_SUBSCRIPTION_NOTIFICATION_CONTROLLER_BASE_URL; +import static org.onap.so.client.RestTemplateConfig.CONFIGURABLE_REST_TEMPLATE; +import static org.springframework.test.annotation.DirtiesContext.ClassMode.BEFORE_CLASS; +import static org.springframework.test.web.client.match.MockRestRequestMatchers.*; +import static org.springframework.test.web.client.response.MockRestResponseCreators.withStatus; +import static org.springframework.test.web.client.response.MockRestResponseCreators.withSuccess; +import java.net.URI; +import java.util.ArrayList; +import java.util.List; +import java.util.UUID; +import org.junit.After; +import org.junit.Before; +import org.junit.Test; +import org.junit.runner.RunWith; +import org.onap.so.adapters.vnfmadapter.Constants; +import org.onap.so.adapters.vnfmadapter.VnfmAdapterApplication; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.ProblemDetails; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.notification.model.NOTIFICATIONLINKSERIALIZER; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.notification.model.PkgChangeNotification; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.notification.model.PkgOnboardingNotification; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.notification.model.PkgmLinks; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.PkgmSubscriptionRequest; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsAuthentication; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsAuthenticationParamsBasic; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsAuthenticationParamsOauth2ClientCredentials; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.notification.model.VnfPackageChangeNotification; +import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.notification.model.VnfPackageOnboardingNotification; +import org.onap.so.configuration.rest.BasicHttpHeadersProvider; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.beans.factory.annotation.Qualifier; +import org.springframework.boot.test.context.SpringBootTest; +import org.springframework.boot.test.web.client.TestRestTemplate; +import org.springframework.boot.web.server.LocalServerPort; +import org.springframework.cache.Cache; +import org.springframework.cache.CacheManager; +import org.springframework.http.*; +import org.springframework.test.annotation.DirtiesContext; +import org.springframework.test.context.ActiveProfiles; +import org.springframework.test.context.junit4.SpringRunner; +import org.springframework.test.web.client.MockRestServiceServer; +import org.springframework.web.client.RestTemplate; +import org.threeten.bp.LocalDateTime; +import org.threeten.bp.OffsetDateTime; +import org.threeten.bp.ZoneOffset; +import com.google.gson.Gson; +import com.google.gson.GsonBuilder; + +/** + * @author Andrew Lamb (andrew.a.lamb@est.tech) + * + */ +@RunWith(SpringRunner.class) +@SpringBootTest(classes = VnfmAdapterApplication.class, webEnvironment = SpringBootTest.WebEnvironment.RANDOM_PORT) +@ActiveProfiles("test") +@DirtiesContext(classMode = BEFORE_CLASS) +public class EtsiSubscriptionNotificationControllerTest { + + @LocalServerPort + private int port; + + private static final URI CALLBACK_URI = URI.create("http://test_callback_uri/notification"); + private static final String TOKEN_ENDPOINT = "http://test_token_endpoint_uri/"; + private static final String TOKEN = "dXNlcm5hbWU6cGFzc3dvcmQ=......"; + private static final String JSON_TOKEN = "{\"access_token\":\"" + TOKEN + "\"}"; + private static final String LOCALHOST_URL = "http://localhost:"; + private static final String NOTIFICATION_BASE_URL = + ETSI_SUBSCRIPTION_NOTIFICATION_CONTROLLER_BASE_URL + "/notification"; + private static final String USERNAME = "username"; + private static final String PASSWORD = "password"; + private static final String EXPECTED_BASIC_AUTHORIZATION = "Basic dXNlcm5hbWU6cGFzc3dvcmQ="; + private static final String EXPECTED_OAUTH_AUTHORIZATION = "Bearer " + TOKEN; + private static final String NOTIFICATION_ID = "NOTIFICATION_ID"; + private static final String SUBSCRIPTION_ID = "SUBSCRIPTION_ID"; + private static final OffsetDateTime TIMESTAMP = + OffsetDateTime.of(LocalDateTime.of(2020, 1, 1, 1, 1, 1, 1), ZoneOffset.ofHours(1)); + private static final String VNFPKG_ID = UUID.randomUUID().toString(); + private static final String VNFD_ID = UUID.randomUUID().toString(); + + private BasicHttpHeadersProvider basicHttpHeadersProvider; + private final Gson gson = new GsonBuilder().create();; + + @Autowired + @Qualifier(CONFIGURABLE_REST_TEMPLATE) + private RestTemplate restTemplate; + private MockRestServiceServer mockRestServer; + + @Autowired + private TestRestTemplate testRestTemplate; + + @Autowired + private CacheManager cacheServiceProvider; + private Cache cache; + + @Before + public void setUp() { + mockRestServer = MockRestServiceServer.bindTo(restTemplate).build(); + basicHttpHeadersProvider = new BasicHttpHeadersProvider(); + cache = cacheServiceProvider.getCache(Constants.PACKAGE_MANAGEMENT_SUBSCRIPTION_CACHE); + cache.clear(); + } + + @After + public void tearDown() { + cache.clear(); + } + + @Test + public void testSubscriptionNotificationEndPoint_ReturnsNoContent() { + final ResponseEntity<?> response = sendHttpGet(NOTIFICATION_BASE_URL); + assertEquals(HttpStatus.NO_CONTENT, response.getStatusCode()); + } + + @Test + public void testOnboardingNotificationSentOnToVnfmCallbackUri_SubscriptionRequestInCache_Success() { + final PkgmSubscriptionRequest subscriptionRequest = + buildPkgmSubscriptionRequest(SubscriptionsAuthentication.AuthTypeEnum.BASIC); + cache.put(SUBSCRIPTION_ID, subscriptionRequest); + final PkgOnboardingNotification notification = buildPkgOnboardingNotification(); + final String notificationString = gson.toJson(notification); + + mockRestServer.expect(requestTo(CALLBACK_URI)).andExpect(method(HttpMethod.POST)) + .andExpect(jsonPath("$.id").value(NOTIFICATION_ID)) + .andExpect(jsonPath("$.notificationType") + .value(VnfPackageOnboardingNotification.NotificationTypeEnum.VNFPACKAGEONBOARDINGNOTIFICATION + .toString())) + .andExpect(jsonPath("$.subscriptionId").value(SUBSCRIPTION_ID)) + .andExpect(jsonPath("$.timeStamp").value(TIMESTAMP.toString())) + .andExpect(jsonPath("$.vnfPkgId").value(VNFPKG_ID.toString())) + .andExpect(jsonPath("$.vnfdId").value(VNFD_ID.toString())) + .andExpect(jsonPath("$._links").value(buildPkgmLinks())) + .andExpect(header("Authorization", EXPECTED_BASIC_AUTHORIZATION)).andRespond(withSuccess()); + + final ResponseEntity<?> response = sendHttpPost(notificationString); + + assertEquals(HttpStatus.NO_CONTENT, response.getStatusCode()); + } + + @Test + public void testOnboardingNotificationNotSentOnToVnfmCallbackUri_SubscriptionRequestNotInCache_Fail() { + final PkgOnboardingNotification notification = buildPkgOnboardingNotification(); + final String notificationString = gson.toJson(notification); + final ResponseEntity<?> response = sendHttpPost(notificationString); + + assertEquals(HttpStatus.INTERNAL_SERVER_ERROR, response.getStatusCode()); + assertTrue(response.getBody() instanceof ProblemDetails); + + final ProblemDetails problemDetails = (ProblemDetails) response.getBody(); + final String errorMessage = "No subscription found with subscriptionId " + SUBSCRIPTION_ID + + ". Unable to forward notification to subscriber."; + + assertEquals(errorMessage, problemDetails.getDetail()); + } + + @Test + public void testOnboardingNotificationSentOnToVnfmCallbackUri_BadRequestResponseFromCallbackUri_Fail() { + final PkgmSubscriptionRequest subscriptionRequest = + buildPkgmSubscriptionRequest(SubscriptionsAuthentication.AuthTypeEnum.BASIC); + cache.put(SUBSCRIPTION_ID, subscriptionRequest); + final PkgOnboardingNotification notification = buildPkgOnboardingNotification(); + final String notificationString = gson.toJson(notification); + + mockRestServer.expect(requestTo(CALLBACK_URI)).andExpect(method(HttpMethod.POST)) + .andRespond(withStatus(HttpStatus.BAD_REQUEST)); + + final ResponseEntity<?> response = sendHttpPost(notificationString); + + assertEquals(HttpStatus.INTERNAL_SERVER_ERROR, response.getStatusCode()); + assertTrue(response.getBody() instanceof ProblemDetails); + + final ProblemDetails problemDetails = (ProblemDetails) response.getBody(); + final String errorMessage = "An error occurred. Sending of notification to VNFM failed with response: " + + HttpStatus.BAD_REQUEST + ".\n" + "No result found for given url: " + CALLBACK_URI; + + assertEquals(errorMessage, problemDetails.getDetail()); + } + + @Test + public void testOnboardingNotificationSentOnToVnfmCallbackUri_301MovedPermanentlyResponseFromCallbackUri_Fail() { + final PkgmSubscriptionRequest subscriptionRequest = + buildPkgmSubscriptionRequest(SubscriptionsAuthentication.AuthTypeEnum.BASIC); + cache.put(SUBSCRIPTION_ID, subscriptionRequest); + final PkgOnboardingNotification notification = buildPkgOnboardingNotification(); + final String notificationString = gson.toJson(notification); + + mockRestServer.expect(requestTo(CALLBACK_URI)).andExpect(method(HttpMethod.POST)) + .andRespond(withStatus(HttpStatus.MOVED_PERMANENTLY)); + + final ResponseEntity<?> response = sendHttpPost(notificationString); + + assertEquals(HttpStatus.INTERNAL_SERVER_ERROR, response.getStatusCode()); + assertTrue(response.getBody() instanceof ProblemDetails); + + final ProblemDetails problemDetails = (ProblemDetails) response.getBody(); + final String errorMessage = "An error occurred. Sending of notification to VNFM failed."; + + assertEquals(errorMessage, problemDetails.getDetail()); + } + + @Test + public void testOnboardingNotificationSentOnToVnfmCallbackUri_NotFoundResponseFromCallbackUri_Fail() { + final PkgmSubscriptionRequest subscriptionRequest = + buildPkgmSubscriptionRequest(SubscriptionsAuthentication.AuthTypeEnum.BASIC); + cache.put(SUBSCRIPTION_ID, subscriptionRequest); + final PkgOnboardingNotification notification = buildPkgOnboardingNotification(); + final String notificationString = gson.toJson(notification); + + mockRestServer.expect(requestTo(CALLBACK_URI)).andExpect(method(HttpMethod.POST)) + .andRespond(withStatus(HttpStatus.NOT_FOUND)); + + final ResponseEntity<?> response = sendHttpPost(notificationString); + + assertEquals(HttpStatus.INTERNAL_SERVER_ERROR, response.getStatusCode()); + assertTrue(response.getBody() instanceof ProblemDetails); + + final ProblemDetails problemDetails = (ProblemDetails) response.getBody(); + final String errorMessage = "An error occurred. Sending of notification to VNFM failed with response: " + + HttpStatus.NOT_FOUND + ".\n" + "No result found for given url: " + CALLBACK_URI; + + assertEquals(errorMessage, problemDetails.getDetail()); + } + + @Test + public void testOnboardingNotificationSentOnToVnfmCallbackUri_InternalServerErrorResponseFromCallbackUri_Fail() { + final PkgmSubscriptionRequest subscriptionRequest = + buildPkgmSubscriptionRequest(SubscriptionsAuthentication.AuthTypeEnum.BASIC); + cache.put(SUBSCRIPTION_ID, subscriptionRequest); + final PkgOnboardingNotification notification = buildPkgOnboardingNotification(); + final String notificationString = gson.toJson(notification); + + mockRestServer.expect(requestTo(CALLBACK_URI)).andExpect(method(HttpMethod.POST)) + .andRespond(withStatus(HttpStatus.INTERNAL_SERVER_ERROR)); + + final ResponseEntity<?> response = sendHttpPost(notificationString); + + assertEquals(HttpStatus.INTERNAL_SERVER_ERROR, response.getStatusCode()); + assertTrue(response.getBody() instanceof ProblemDetails); + + final ProblemDetails problemDetails = (ProblemDetails) response.getBody(); + final String errorMessage = "An error occurred. Sending of notification to VNFM failed with response: " + + HttpStatus.INTERNAL_SERVER_ERROR.value() + ".\n" + "Unable to invoke HTTP POST using URL: " + + CALLBACK_URI; + + assertEquals(errorMessage, problemDetails.getDetail()); + } + + @Test + public void testChangeNotificationSentOnToVnfmCallbackUri_SubscriptionRequestInCache_Success() { + final PkgmSubscriptionRequest subscriptionRequest = + buildPkgmSubscriptionRequest(SubscriptionsAuthentication.AuthTypeEnum.BASIC); + cache.put(SUBSCRIPTION_ID, subscriptionRequest); + final PkgChangeNotification notification = buildPkgChangeNotification(); + final String notificationString = gson.toJson(notification); + + mockRestServer.expect(requestTo(CALLBACK_URI)).andExpect(method(HttpMethod.POST)) + .andExpect(jsonPath("$.id").value(NOTIFICATION_ID)) + .andExpect(jsonPath("$.notificationType").value( + VnfPackageChangeNotification.NotificationTypeEnum.VNFPACKAGECHANGENOTIFICATION.toString())) + .andExpect(jsonPath("$.subscriptionId").value(SUBSCRIPTION_ID)) + .andExpect(jsonPath("$.timeStamp").value(TIMESTAMP.toString())) + .andExpect(jsonPath("$.vnfPkgId").value(VNFPKG_ID.toString())) + .andExpect(jsonPath("$.vnfdId").value(VNFD_ID.toString())) + .andExpect( + jsonPath("$.changeType").value(PkgChangeNotification.ChangeTypeEnum.OP_STATE_CHANGE.toString())) + .andExpect(jsonPath("$.operationalState") + .value(PkgChangeNotification.OperationalStateEnum.ENABLED.toString())) + .andExpect(jsonPath("$._links").value(buildPkgmLinks())) + .andExpect(header("Authorization", EXPECTED_BASIC_AUTHORIZATION)).andRespond(withSuccess()); + + final ResponseEntity<?> response = sendHttpPost(notificationString); + + assertEquals(HttpStatus.NO_CONTENT, response.getStatusCode()); + } + + @Test + public void testChangeNotificationNotSentOnToVnfmCallbackUri_SubscriptionRequestNotInCache_Fail() { + final PkgChangeNotification notification = buildPkgChangeNotification(); + final String notificationString = gson.toJson(notification); + final ResponseEntity<?> response = sendHttpPost(notificationString); + + assertEquals(HttpStatus.INTERNAL_SERVER_ERROR, response.getStatusCode()); + assertTrue(response.getBody() instanceof ProblemDetails); + + final ProblemDetails problemDetails = (ProblemDetails) response.getBody(); + final String errorMessage = "No subscription found with subscriptionId " + SUBSCRIPTION_ID + + ". Unable to forward notification to subscriber."; + + assertEquals(errorMessage, problemDetails.getDetail()); + } + + @Test + public void testChangeNotificationSentOnToVnfmCallbackUri_BadRequestResponseFromCallbackUri_Fail() { + final PkgmSubscriptionRequest subscriptionRequest = + buildPkgmSubscriptionRequest(SubscriptionsAuthentication.AuthTypeEnum.BASIC); + cache.put(SUBSCRIPTION_ID, subscriptionRequest); + final PkgChangeNotification notification = buildPkgChangeNotification(); + final String notificationString = gson.toJson(notification); + + mockRestServer.expect(requestTo(CALLBACK_URI)).andExpect(method(HttpMethod.POST)) + .andRespond(withStatus(HttpStatus.BAD_REQUEST)); + + final ResponseEntity<?> response = sendHttpPost(notificationString); + + assertEquals(HttpStatus.INTERNAL_SERVER_ERROR, response.getStatusCode()); + assertTrue(response.getBody() instanceof ProblemDetails); + + final ProblemDetails problemDetails = (ProblemDetails) response.getBody(); + final String errorMessage = "An error occurred. Sending of notification to VNFM failed with response: " + + HttpStatus.BAD_REQUEST + ".\n" + "No result found for given url: " + CALLBACK_URI; + + assertEquals(errorMessage, problemDetails.getDetail()); + } + + @Test + public void testChangeNotificationSentOnToVnfmCallbackUri_NotFoundResponseFromCallbackUri_Fail() { + final PkgmSubscriptionRequest subscriptionRequest = + buildPkgmSubscriptionRequest(SubscriptionsAuthentication.AuthTypeEnum.BASIC); + cache.put(SUBSCRIPTION_ID, subscriptionRequest); + final PkgChangeNotification notification = buildPkgChangeNotification(); + final String notificationString = gson.toJson(notification); + + mockRestServer.expect(requestTo(CALLBACK_URI)).andExpect(method(HttpMethod.POST)) + .andRespond(withStatus(HttpStatus.NOT_FOUND)); + + final ResponseEntity<?> response = sendHttpPost(notificationString); + + assertEquals(HttpStatus.INTERNAL_SERVER_ERROR, response.getStatusCode()); + assertTrue(response.getBody() instanceof ProblemDetails); + + final ProblemDetails problemDetails = (ProblemDetails) response.getBody(); + final String errorMessage = "An error occurred. Sending of notification to VNFM failed with response: " + + HttpStatus.NOT_FOUND + ".\n" + "No result found for given url: " + CALLBACK_URI; + + assertEquals(errorMessage, problemDetails.getDetail()); + } + + @Test + public void testChangeNotificationSentOnToVnfmCallbackUri_InternalServerErrorResponseFromCallbackUri_Fail() { + final PkgmSubscriptionRequest subscriptionRequest = + buildPkgmSubscriptionRequest(SubscriptionsAuthentication.AuthTypeEnum.BASIC); + cache.put(SUBSCRIPTION_ID, subscriptionRequest); + final PkgChangeNotification notification = buildPkgChangeNotification(); + final String notificationString = gson.toJson(notification); + + mockRestServer.expect(requestTo(CALLBACK_URI)).andExpect(method(HttpMethod.POST)) + .andRespond(withStatus(HttpStatus.INTERNAL_SERVER_ERROR)); + + final ResponseEntity<?> response = sendHttpPost(notificationString); + + assertEquals(HttpStatus.INTERNAL_SERVER_ERROR, response.getStatusCode()); + assertTrue(response.getBody() instanceof ProblemDetails); + + final ProblemDetails problemDetails = (ProblemDetails) response.getBody(); + final String errorMessage = "An error occurred. Sending of notification to VNFM failed with response: " + + HttpStatus.INTERNAL_SERVER_ERROR.value() + ".\n" + "Unable to invoke HTTP POST using URL: " + + CALLBACK_URI; + + assertEquals(errorMessage, problemDetails.getDetail()); + } + + @Test + public void testNotificationSentOnToVnfm_BasicAuthUserPasswordAuthorized_Success() { + final PkgmSubscriptionRequest subscriptionRequest = + buildPkgmSubscriptionRequest(SubscriptionsAuthentication.AuthTypeEnum.BASIC); + cache.put(SUBSCRIPTION_ID, subscriptionRequest); + final PkgOnboardingNotification notification = buildPkgOnboardingNotification(); + final String notificationString = gson.toJson(notification); + + mockRestServer.expect(requestTo(CALLBACK_URI)).andExpect(method(HttpMethod.POST)) + .andExpect(jsonPath("$.id").value(NOTIFICATION_ID)) + .andExpect(jsonPath("$.notificationType") + .value(VnfPackageOnboardingNotification.NotificationTypeEnum.VNFPACKAGEONBOARDINGNOTIFICATION + .toString())) + .andExpect(jsonPath("$.subscriptionId").value(SUBSCRIPTION_ID)) + .andExpect(jsonPath("$.timeStamp").value(TIMESTAMP.toString())) + .andExpect(jsonPath("$.vnfPkgId").value(VNFPKG_ID.toString())) + .andExpect(jsonPath("$.vnfdId").value(VNFD_ID.toString())) + .andExpect(jsonPath("$._links").value(buildPkgmLinks())) + .andExpect(header("Authorization", EXPECTED_BASIC_AUTHORIZATION)).andRespond(withSuccess()); + + final ResponseEntity<?> response = sendHttpPost(notificationString); + + assertEquals(HttpStatus.NO_CONTENT, response.getStatusCode()); + } + + @Test + public void testNotificationSentOnToVnfm_BasicAuthUserPasswordNotAuthorized_Fail() { + final PkgmSubscriptionRequest subscriptionRequest = + buildPkgmSubscriptionRequest(SubscriptionsAuthentication.AuthTypeEnum.BASIC); + cache.put(SUBSCRIPTION_ID, subscriptionRequest); + final PkgChangeNotification notification = buildPkgChangeNotification(); + final String notificationString = gson.toJson(notification); + + mockRestServer.expect(requestTo(CALLBACK_URI)).andExpect(method(HttpMethod.POST)) + .andExpect(header("Authorization", EXPECTED_BASIC_AUTHORIZATION)) + .andRespond(withStatus(HttpStatus.UNAUTHORIZED)); + + final ResponseEntity<?> response = sendHttpPost(notificationString); + + assertEquals(HttpStatus.INTERNAL_SERVER_ERROR, response.getStatusCode()); + assertTrue(response.getBody() instanceof ProblemDetails); + + final ProblemDetails problemDetails = (ProblemDetails) response.getBody(); + final String errorMessage = "An error occurred. Sending of notification to VNFM failed with response: " + + HttpStatus.UNAUTHORIZED.value() + ".\n" + "Unable to invoke HTTP POST using URL: " + CALLBACK_URI; + + assertEquals(errorMessage, problemDetails.getDetail()); + } + + @Test + public void testNotificationSentOnToVnfm_OAuthAuthorized_Success() { + final PkgmSubscriptionRequest subscriptionRequest = + buildPkgmSubscriptionRequest(SubscriptionsAuthentication.AuthTypeEnum.OAUTH2_CLIENT_CREDENTIALS); + cache.put(SUBSCRIPTION_ID, subscriptionRequest); + final PkgChangeNotification notification = buildPkgChangeNotification(); + final String notificationString = gson.toJson(notification); + + mockRestServer.expect(requestTo(TOKEN_ENDPOINT)).andExpect(method(HttpMethod.POST)) + .andExpect(header("Authorization", EXPECTED_BASIC_AUTHORIZATION)) + .andRespond(withSuccess(JSON_TOKEN, MediaType.APPLICATION_JSON)); + + mockRestServer.expect(requestTo(CALLBACK_URI)).andExpect(method(HttpMethod.POST)) + .andExpect(header("Authorization", EXPECTED_OAUTH_AUTHORIZATION)) + .andExpect(jsonPath("$.id").value(NOTIFICATION_ID)) + .andExpect(jsonPath("$.notificationType").value( + VnfPackageChangeNotification.NotificationTypeEnum.VNFPACKAGECHANGENOTIFICATION.toString())) + .andExpect(jsonPath("$.subscriptionId").value(SUBSCRIPTION_ID)) + .andExpect(jsonPath("$.timeStamp").value(TIMESTAMP.toString())) + .andExpect(jsonPath("$.vnfPkgId").value(VNFPKG_ID.toString())) + .andExpect(jsonPath("$.vnfdId").value(VNFD_ID.toString())) + .andExpect( + jsonPath("$.changeType").value(PkgChangeNotification.ChangeTypeEnum.OP_STATE_CHANGE.toString())) + .andExpect(jsonPath("$.operationalState") + .value(PkgChangeNotification.OperationalStateEnum.ENABLED.toString())) + .andExpect(jsonPath("$._links").value(buildPkgmLinks())).andRespond(withSuccess()); + + final ResponseEntity<?> response = sendHttpPost(notificationString); + + assertEquals(HttpStatus.NO_CONTENT, response.getStatusCode()); + } + + @Test + public void testNotificationSentOnToVnfm_OAuthTokenNotReceived_Fail() { + final PkgmSubscriptionRequest subscriptionRequest = + buildPkgmSubscriptionRequest(SubscriptionsAuthentication.AuthTypeEnum.OAUTH2_CLIENT_CREDENTIALS); + cache.put(SUBSCRIPTION_ID, subscriptionRequest); + final PkgChangeNotification notification = buildPkgChangeNotification(); + final String notificationString = gson.toJson(notification); + + mockRestServer.expect(requestTo(TOKEN_ENDPOINT)).andExpect(method(HttpMethod.POST)) + .andExpect(header("Authorization", EXPECTED_BASIC_AUTHORIZATION)).andRespond(withSuccess()); + + final ResponseEntity<?> response = sendHttpPost(notificationString); + + assertEquals(HttpStatus.INTERNAL_SERVER_ERROR, response.getStatusCode()); + assertTrue(response.getBody() instanceof ProblemDetails); + + final ProblemDetails problemDetails = (ProblemDetails) response.getBody(); + final String errorMessage = "An error occurred. Unable to retrieve OAuth Token from VNFM for notification."; + + assertEquals(errorMessage, problemDetails.getDetail()); + } + + @Test + public void testNotificationSentOnToVnfm_TLSCertNotYetSupported_Fail() { + final PkgmSubscriptionRequest subscriptionRequest = + buildPkgmSubscriptionRequest(SubscriptionsAuthentication.AuthTypeEnum.TLS_CERT); + cache.put(SUBSCRIPTION_ID, subscriptionRequest); + final PkgChangeNotification notification = buildPkgChangeNotification(); + final String notificationString = gson.toJson(notification); + + final ResponseEntity<?> response = sendHttpPost(notificationString); + + assertEquals(HttpStatus.INTERNAL_SERVER_ERROR, response.getStatusCode()); + assertTrue(response.getBody() instanceof ProblemDetails); + + final ProblemDetails problemDetails = (ProblemDetails) response.getBody(); + final String errorMessage = "An error occurred. Authentication type " + + subscriptionRequest.getAuthentication().getAuthType().toString() + " not currently supported."; + + assertEquals(errorMessage, problemDetails.getDetail()); + } + + private PkgOnboardingNotification buildPkgOnboardingNotification() { + final PkgOnboardingNotification notification = new PkgOnboardingNotification(); + notification.setId(NOTIFICATION_ID); + notification + .setNotificationType(PkgOnboardingNotification.NotificationTypeEnum.VNFPACKAGEONBOARDINGNOTIFICATION); + notification.setSubscriptionId(SUBSCRIPTION_ID); + notification.setTimeStamp(TIMESTAMP); + notification.setVnfPkgId(VNFPKG_ID); + notification.setVnfdId(VNFD_ID); + notification.setLinks(buildPkgmLinks()); + return notification; + } + + private PkgChangeNotification buildPkgChangeNotification() { + final PkgChangeNotification notification = new PkgChangeNotification(); + notification.setId(NOTIFICATION_ID); + notification.setNotificationType(PkgChangeNotification.NotificationTypeEnum.VNFPACKAGECHANGENOTIFICATION); + notification.setSubscriptionId(SUBSCRIPTION_ID); + notification.setTimeStamp(TIMESTAMP); + notification.setVnfPkgId(VNFPKG_ID); + notification.setVnfdId(VNFD_ID); + notification.setChangeType(PkgChangeNotification.ChangeTypeEnum.OP_STATE_CHANGE); + notification.setOperationalState(PkgChangeNotification.OperationalStateEnum.ENABLED); + notification.setLinks(buildPkgmLinks()); + return notification; + } + + private PkgmLinks buildPkgmLinks() { + final PkgmLinks pkgmLinks = new PkgmLinks(); + + final NOTIFICATIONLINKSERIALIZER subscriptionLinkSerializer = new NOTIFICATIONLINKSERIALIZER(); + subscriptionLinkSerializer.setHref("subscription_href"); + pkgmLinks.setSubscription(subscriptionLinkSerializer); + + final NOTIFICATIONLINKSERIALIZER vnfPackageLinkSerializer = new NOTIFICATIONLINKSERIALIZER(); + vnfPackageLinkSerializer.setHref("vnf_package_href"); + pkgmLinks.setVnfPackage(vnfPackageLinkSerializer); + + return pkgmLinks; + } + + private PkgmSubscriptionRequest buildPkgmSubscriptionRequest( + final SubscriptionsAuthentication.AuthTypeEnum authTypeEnum) { + final PkgmSubscriptionRequest subscriptionRequest = new PkgmSubscriptionRequest(); + subscriptionRequest.setCallbackUri(CALLBACK_URI.toString()); + subscriptionRequest.setAuthentication(buildSubscriptionsAuthentication(authTypeEnum)); + return subscriptionRequest; + } + + // TODO update for auth types other than basicAuth + private SubscriptionsAuthentication buildSubscriptionsAuthentication( + final SubscriptionsAuthentication.AuthTypeEnum authTypeEnum) { + final SubscriptionsAuthentication subscriptionsAuthentication = new SubscriptionsAuthentication(); + final List<SubscriptionsAuthentication.AuthTypeEnum> authTypes = new ArrayList<>(); + authTypes.add(authTypeEnum); + subscriptionsAuthentication.setAuthType(authTypes); + if (authTypeEnum == SubscriptionsAuthentication.AuthTypeEnum.TLS_CERT) { + // TODO: remove basic params and code for TLS + final SubscriptionsAuthenticationParamsBasic basicParams = + new SubscriptionsAuthenticationParamsBasic().userName(USERNAME).password(PASSWORD); + subscriptionsAuthentication.setParamsBasic(basicParams); + } else if (authTypeEnum == SubscriptionsAuthentication.AuthTypeEnum.OAUTH2_CLIENT_CREDENTIALS) { + final SubscriptionsAuthenticationParamsOauth2ClientCredentials oathParams = + new SubscriptionsAuthenticationParamsOauth2ClientCredentials().clientId(USERNAME) + .clientPassword(PASSWORD).tokenEndpoint(TOKEN_ENDPOINT); + subscriptionsAuthentication.setParamsOauth2ClientCredentials(oathParams); + } else { + final SubscriptionsAuthenticationParamsBasic basicParams = + new SubscriptionsAuthenticationParamsBasic().userName(USERNAME).password(PASSWORD); + subscriptionsAuthentication.setParamsBasic(basicParams); + } + + return subscriptionsAuthentication; + } + + private <T> ResponseEntity<ProblemDetails> sendHttpPost(final T notification) { + final String testURL = LOCALHOST_URL + port + NOTIFICATION_BASE_URL; + final HttpEntity<?> request = new HttpEntity<>(notification, basicHttpHeadersProvider.getHttpHeaders()); + return testRestTemplate.withBasicAuth("test", "test").exchange(testURL, HttpMethod.POST, request, + ProblemDetails.class); + } + + private ResponseEntity<Void> sendHttpGet(final String url) { + final String testURL = LOCALHOST_URL + port + url; + final HttpEntity<?> request = new HttpEntity<>(basicHttpHeadersProvider.getHttpHeaders()); + return testRestTemplate.withBasicAuth("test", "test").exchange(testURL, HttpMethod.GET, request, Void.class); + } + +} diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/test/java/org/onap/so/adapters/vnfmadapter/rest/Sol003PackageManagementSubscriptionControllerTest.java b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/test/java/org/onap/so/adapters/vnfmadapter/rest/Sol003PackageManagementSubscriptionControllerTest.java index 3d26c33679..7466895d97 100644 --- a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/test/java/org/onap/so/adapters/vnfmadapter/rest/Sol003PackageManagementSubscriptionControllerTest.java +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/test/java/org/onap/so/adapters/vnfmadapter/rest/Sol003PackageManagementSubscriptionControllerTest.java @@ -20,29 +20,44 @@ package org.onap.so.adapters.vnfmadapter.rest; +import static org.hamcrest.Matchers.is; import static org.junit.Assert.assertEquals; import static org.junit.Assert.assertNotEquals; import static org.junit.Assert.assertNotNull; +import static org.junit.Assert.assertNull; import static org.junit.Assert.assertThat; +import static org.junit.Assert.assertTrue; import static org.onap.so.adapters.vnfmadapter.Constants.PACKAGE_MANAGEMENT_BASE_URL; import static org.onap.so.client.RestTemplateConfig.CONFIGURABLE_REST_TEMPLATE; +import static org.springframework.test.web.client.match.MockRestRequestMatchers.method; import static org.springframework.test.web.client.match.MockRestRequestMatchers.requestTo; -import java.security.GeneralSecurityException; +import static org.springframework.test.web.client.response.MockRestResponseCreators.withStatus; +import static org.springframework.test.web.client.response.MockRestResponseCreators.withSuccess; +import java.io.File; import java.net.URI; import java.net.URISyntaxException; +import java.nio.file.Files; +import java.nio.file.Paths; +import java.security.GeneralSecurityException; import java.util.ArrayList; import java.util.List; import java.util.Objects; import java.util.UUID; -import com.google.gson.Gson; +import org.junit.After; import org.junit.Before; import org.junit.Test; import org.junit.runner.RunWith; import org.onap.so.adapters.vnfmadapter.Constants; import org.onap.so.adapters.vnfmadapter.VnfmAdapterApplication; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.BasicAuth; import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.LinkSelf; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.NsdmSubscription; import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.PkgmNotificationsFilter; import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.PkgmSubscription; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.SubscriptionAuthentication; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.Version; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.VnfProducts; +import org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.VnfProductsProviders; import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.InlineResponse2002; import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.PkgmSubscriptionRequest; import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsAuthentication; @@ -51,60 +66,69 @@ import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model. import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsFilterVnfProductsFromProviders; import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.SubscriptionsLinks; import org.onap.so.adapters.vnfmadapter.extclients.vnfm.packagemanagement.model.VnfPackagesLinksSelf; -import org.onap.so.utils.CryptoUtils; import org.springframework.beans.factory.annotation.Autowired; import org.springframework.beans.factory.annotation.Qualifier; import org.springframework.boot.test.context.SpringBootTest; +import org.springframework.boot.test.web.client.TestRestTemplate; +import org.springframework.boot.web.server.LocalServerPort; import org.springframework.cache.Cache; import org.springframework.cache.CacheManager; import org.springframework.http.HttpHeaders; +import org.springframework.http.HttpMethod; import org.springframework.http.HttpStatus; import org.springframework.http.MediaType; import org.springframework.http.ResponseEntity; import org.springframework.test.context.ActiveProfiles; import org.springframework.test.context.junit4.SpringRunner; import org.springframework.test.web.client.MockRestServiceServer; +import org.springframework.test.web.client.match.MockRestRequestMatchers; import org.springframework.web.client.RestTemplate; -import org.springframework.http.HttpMethod; -import static org.springframework.test.web.client.match.MockRestRequestMatchers.method; -import static org.hamcrest.Matchers.is; -import static org.springframework.test.web.client.response.MockRestResponseCreators.withStatus; -import static org.springframework.test.web.client.response.MockRestResponseCreators.withSuccess; +import com.google.gson.Gson; /** * @author Ronan Kenny (ronan.kenny@est.tech) * @author Gareth Roper (gareth.roper@est.tech) - * */ @RunWith(SpringRunner.class) @SpringBootTest(classes = VnfmAdapterApplication.class, webEnvironment = SpringBootTest.WebEnvironment.RANDOM_PORT) @ActiveProfiles("test") -@SuppressWarnings("unchecked") public class Sol003PackageManagementSubscriptionControllerTest { - private static String subscriptionId; private final Gson gson = new Gson(); + private final URI msbEndpoint = URI.create("http://msb-iag.onap:80/api/vnfpkgm/v1/subscriptions"); + private static final String _NOTIFICATION_CALLBACK_URI = + "https://so-vnfm-adapter.onap:30406" + Constants.ETSI_SUBSCRIPTION_NOTIFICATION_BASE_URL; + private static final String LOCALHOST_URL = "http://localhost:"; @Autowired @Qualifier(CONFIGURABLE_REST_TEMPLATE) - private RestTemplate testRestTemplate; - - private MockRestServiceServer mockRestServer; - + private RestTemplate restTemplate; + private MockRestServiceServer mockRestServiceServer; @Autowired private CacheManager cacheServiceProvider; - private final URI msbEndpoint = URI.create("http://msb-iag.onap:80/api/vnfpkgm/v1/subscriptions"); - @Autowired private Sol003PackageManagementSubscriptionController sol003PackageManagementSubscriptionController; + @Autowired + private TestRestTemplate testRestTemplate; + + @LocalServerPort + private int port; + + private static final String ID = UUID.randomUUID().toString(); + @Before public void setUp() { - mockRestServer = MockRestServiceServer.bindTo(testRestTemplate).build(); + mockRestServiceServer = MockRestServiceServer.bindTo(restTemplate).build(); final Cache cache = cacheServiceProvider.getCache(Constants.PACKAGE_MANAGEMENT_SUBSCRIPTION_CACHE); cache.clear(); } + @After + public void after() { + mockRestServiceServer.reset(); + } + @Test public void testSuccessPostSubscription() throws GeneralSecurityException, URISyntaxException { final PkgmSubscriptionRequest pkgmSubscriptionRequest = postSubscriptionForTest(); @@ -114,8 +138,8 @@ public class Sol003PackageManagementSubscriptionControllerTest { final HttpHeaders headers = buildHttpHeaders(Objects.requireNonNull(response.getBody()).getCallbackUri()); - SubscriptionsLinks subscriptionsLinks = new SubscriptionsLinks(); - VnfPackagesLinksSelf vnfPackagesLinksSelf = new VnfPackagesLinksSelf(); + final SubscriptionsLinks subscriptionsLinks = new SubscriptionsLinks(); + final VnfPackagesLinksSelf vnfPackagesLinksSelf = new VnfPackagesLinksSelf(); vnfPackagesLinksSelf.setHref("https://so-vnfm-adapter.onap:30406" + PACKAGE_MANAGEMENT_BASE_URL + "/subscriptions/" + response.getBody().getId()); subscriptionsLinks.setSelf(vnfPackagesLinksSelf); @@ -135,7 +159,6 @@ public class Sol003PackageManagementSubscriptionControllerTest { final ResponseEntity<InlineResponse2002> response = (ResponseEntity<InlineResponse2002>) sol003PackageManagementSubscriptionController .postSubscriptionRequest(pkgmSubscriptionRequest); - subscriptionId = Objects.requireNonNull(response.getBody()).getId(); // Create duplicate entry final PkgmSubscriptionRequest pkgmSubscriptionRequest2 = buildPkgmSubscriptionRequest(); @@ -149,12 +172,18 @@ public class Sol003PackageManagementSubscriptionControllerTest { @Test public void testSuccessGetSubscriptionWithSubscriptionId() throws GeneralSecurityException, URISyntaxException { + final PkgmSubscriptionRequest pkgmSubscriptionRequest = postSubscriptionForTest(); + mockRestServiceServer.expect(requestTo(msbEndpoint + "/" + ID)).andExpect(method(HttpMethod.GET)) + .andRespond(withSuccess(gson.toJson(new NsdmSubscription().id(ID)), MediaType.APPLICATION_JSON)); + final ResponseEntity<InlineResponse2002> response = (ResponseEntity<InlineResponse2002>) sol003PackageManagementSubscriptionController .postSubscriptionRequest(pkgmSubscriptionRequest); - subscriptionId = Objects.requireNonNull(response.getBody()).getId(); + final String subscriptionId = response.getBody().getId(); + + final ResponseEntity<InlineResponse2002> response2002 = (ResponseEntity<InlineResponse2002>) sol003PackageManagementSubscriptionController @@ -162,9 +191,8 @@ public class Sol003PackageManagementSubscriptionControllerTest { final HttpHeaders headers = buildHttpHeaders(response.getBody().getCallbackUri()); - assertEquals(response.getBody().getFilter(), pkgmSubscriptionRequest.getFilter()); - assert (response.getHeaders().equals(headers)); + assertEquals(response.getHeaders(), headers); assertEquals(HttpStatus.OK, response2002.getStatusCode()); assertEquals(pkgmSubscriptionRequest.getFilter(), response.getBody().getFilter()); // Ensure CallBackUri is set to new URI @@ -173,9 +201,12 @@ public class Sol003PackageManagementSubscriptionControllerTest { @Test public void testFailGetSubscriptionWithInvalidSubscriptionId() { + final String invalidId = "invalidSubscriptionId"; + mockRestServiceServer.expect(requestTo(msbEndpoint + "/" + invalidId)).andExpect(method(HttpMethod.GET)) + .andRespond(withStatus(HttpStatus.NOT_FOUND)); final ResponseEntity<InlineResponse2002> response = (ResponseEntity<InlineResponse2002>) sol003PackageManagementSubscriptionController - .getSubscription("invalidSubscriptionId"); + .getSubscription(invalidId); assertEquals(HttpStatus.NOT_FOUND, response.getStatusCode()); } @@ -184,14 +215,16 @@ public class Sol003PackageManagementSubscriptionControllerTest { final PkgmSubscription pkgmSubscription = buildPkgmSubscription(); final PkgmSubscriptionRequest pkgmSubscriptionRequest = buildPkgmSubscriptionRequest(); - mockRestServer.expect(requestTo(msbEndpoint)).andExpect(method(HttpMethod.POST)) + mockRestServiceServer.expect(requestTo(msbEndpoint)).andExpect(method(HttpMethod.POST)) .andRespond(withSuccess(gson.toJson(pkgmSubscription), MediaType.APPLICATION_JSON)); + mockRestServiceServer.expect(requestTo(msbEndpoint + "/" + ID)).andExpect(method(HttpMethod.GET)) + .andRespond(withSuccess(gson.toJson(new NsdmSubscription().id(ID)), MediaType.APPLICATION_JSON)); sol003PackageManagementSubscriptionController.postSubscriptionRequest(pkgmSubscriptionRequest); - ResponseEntity<List<InlineResponse2002>> response = + final ResponseEntity<List<InlineResponse2002>> response = sol003PackageManagementSubscriptionController.getSubscriptions(); - List<InlineResponse2002> subscriptionsList = response.getBody(); + final List<InlineResponse2002> subscriptionsList = response.getBody(); assertEquals(Objects.requireNonNull(response.getBody()).get(0).getFilter(), pkgmSubscriptionRequest.getFilter()); @@ -206,16 +239,19 @@ public class Sol003PackageManagementSubscriptionControllerTest { final PkgmSubscription pkgmSubscription = buildPkgmSubscription(); final String subscriptionId = pkgmSubscription.getId(); - mockRestServer.expect(requestTo(msbEndpoint)).andExpect(method(HttpMethod.POST)) + mockRestServiceServer.expect(requestTo(msbEndpoint)).andExpect(method(HttpMethod.POST)) .andRespond(withSuccess(gson.toJson(pkgmSubscription), MediaType.APPLICATION_JSON)); - mockRestServer.expect(requestTo(msbEndpoint + "/" + subscriptionId)).andExpect(method(HttpMethod.DELETE)) + + mockRestServiceServer.expect(requestTo(msbEndpoint + "/" + subscriptionId)).andExpect(method(HttpMethod.DELETE)) .andRespond(withStatus(HttpStatus.NO_CONTENT)); + mockRestServiceServer.expect(requestTo(msbEndpoint + "/" + subscriptionId)).andExpect(method(HttpMethod.GET)) + .andRespond(withSuccess(gson.toJson(new NsdmSubscription().id(subscriptionId)), + MediaType.APPLICATION_JSON)); final ResponseEntity<InlineResponse2002> responsePost = (ResponseEntity<InlineResponse2002>) sol003PackageManagementSubscriptionController .postSubscriptionRequest(pkgmSubscriptionRequest); - final ResponseEntity responseDelete = sol003PackageManagementSubscriptionController.deleteSubscription(subscriptionId); @@ -229,12 +265,79 @@ public class Sol003PackageManagementSubscriptionControllerTest { } @Test + public void testDeleteSubscription_SubscripitonNotFoundInEtsiCatalogManager_SubscriptionDeletedFromLocalCache() + throws GeneralSecurityException { + final PkgmSubscriptionRequest pkgmSubscriptionRequest = buildPkgmSubscriptionRequest(); + final PkgmSubscription pkgmSubscription = buildPkgmSubscription(); + + mockRestServiceServer.expect(requestTo(msbEndpoint)).andExpect(method(HttpMethod.POST)) + .andRespond(withSuccess(gson.toJson(pkgmSubscription), MediaType.APPLICATION_JSON)); + + mockRestServiceServer.expect(requestTo(msbEndpoint + "/" + ID)).andExpect(method(HttpMethod.DELETE)) + .andRespond(withStatus(HttpStatus.NOT_FOUND)); + + final ResponseEntity<InlineResponse2002> responsePost = + (ResponseEntity<InlineResponse2002>) sol003PackageManagementSubscriptionController + .postSubscriptionRequest(pkgmSubscriptionRequest); + + final Cache cache = cacheServiceProvider.getCache(Constants.PACKAGE_MANAGEMENT_SUBSCRIPTION_CACHE); + assertNotNull(cache.get(ID)); + + final ResponseEntity responseDelete = sol003PackageManagementSubscriptionController.deleteSubscription(ID); + + assertEquals(HttpStatus.NO_CONTENT, responseDelete.getStatusCode()); + assertNull(cache.get(ID)); + + } + + @Test public void testFailDeleteSubscriptionWithInvalidSubscriptionId() throws URISyntaxException, InterruptedException { final ResponseEntity<Void> responseDelete = (ResponseEntity<Void>) sol003PackageManagementSubscriptionController .deleteSubscription("invalidSubscriptionId"); assertEquals(HttpStatus.NOT_FOUND, responseDelete.getStatusCode()); } + + @Test + public void testSuccessPostSubscriptionWithValidNotificationTypes() throws Exception { + + final String file = getAbsolutePath("src/test/resources/requests/SubscriptionRequest.json"); + final String json = new String(Files.readAllBytes(Paths.get(file))); + final PkgmSubscriptionRequest request = gson.fromJson(json, PkgmSubscriptionRequest.class); + + mockRestServiceServer.expect(requestTo(msbEndpoint)).andExpect(method(HttpMethod.POST)) + .andExpect(MockRestRequestMatchers.content().json(gson.toJson(getEtsiCatalogPkgmSubscriptionRequest()))) + .andRespond(withSuccess(gson.toJson(buildPkgmSubscription()), MediaType.APPLICATION_JSON)); + + + final ResponseEntity<InlineResponse2002> responseEntity = testRestTemplate.postForEntity( + LOCALHOST_URL + port + Constants.PACKAGE_MANAGEMENT_BASE_URL + "/subscriptions", request, + InlineResponse2002.class); + + assertEquals(HttpStatus.CREATED, responseEntity.getStatusCode()); + assertTrue(responseEntity.hasBody()); + final InlineResponse2002 actual = responseEntity.getBody(); + assertEquals(ID, actual.getId()); + + + } + + private org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.PkgmSubscriptionRequest getEtsiCatalogPkgmSubscriptionRequest() { + return new org.onap.so.adapters.vnfmadapter.extclients.etsicatalog.model.PkgmSubscriptionRequest() + .filters(new PkgmNotificationsFilter() + .addNotificationTypesItem( + PkgmNotificationsFilter.NotificationTypesEnum.VNFPACKAGEONBOARDINGNOTIFICATION) + .addVnfdIdItem("VNFDID").addVnfPkgIdItem("VNFPKGID") + .addOperationalStateItem(PkgmNotificationsFilter.OperationalStateEnum.ENABLED) + .addVnfProductsFromProvidersItem(new VnfProductsProviders().vnfProvider("EST") + .addVnfProductsItem(new VnfProducts().vnfProductName("VnfProducts") + .addVersionsItem(new Version().vnfSoftwareVersion("vnfSoftwareVersion") + .addVnfdVersionsItem("version1"))))) + .callbackUri(_NOTIFICATION_CALLBACK_URI).authentication( + new SubscriptionAuthentication().addAuthTypeItem(SubscriptionAuthentication.AuthTypeEnum.BASIC) + .paramsBasic(new BasicAuth().userName("vnfm").password("password1$"))); + } + private PkgmSubscriptionRequest buildPkgmSubscriptionRequest() { final PkgmSubscriptionRequest pkgmSubscriptionRequest = new PkgmSubscriptionRequest(); final SubscriptionsFilter sub = buildSubscriptionsFilter(); @@ -247,8 +350,8 @@ public class Sol003PackageManagementSubscriptionControllerTest { private SubscriptionsFilter buildSubscriptionsFilter() { final SubscriptionsFilter sub = new SubscriptionsFilter(); - final List<String> vnfdIdList = new ArrayList(); - final List<String> vnfPkgIdList = new ArrayList(); + final List<String> vnfdIdList = new ArrayList<>(); + final List<String> vnfPkgIdList = new ArrayList<>(); final List<NotificationTypesEnum> notificationTypes = new ArrayList<>(); final SubscriptionsFilterVnfProductsFromProviders subscriptionsFilterVnfProductsFromProviders = new SubscriptionsFilterVnfProductsFromProviders(); @@ -263,11 +366,11 @@ public class Sol003PackageManagementSubscriptionControllerTest { } private PkgmSubscription buildPkgmSubscription() { - PkgmSubscription pkgmSubscription = new PkgmSubscription(); - PkgmNotificationsFilter pkgmNotificationsFilter = new PkgmNotificationsFilter(); - LinkSelf linkSelf = new LinkSelf(); - String id = UUID.randomUUID().toString(); - pkgmSubscription.setId(id); + final PkgmSubscription pkgmSubscription = new PkgmSubscription(); + final PkgmNotificationsFilter pkgmNotificationsFilter = new PkgmNotificationsFilter(); + final LinkSelf linkSelf = new LinkSelf(); + + pkgmSubscription.setId(ID); pkgmSubscription.setCallbackUri(msbEndpoint + "/" + pkgmSubscription.getId().toString()); pkgmSubscription.setFilter(pkgmNotificationsFilter); pkgmSubscription.setLinks(linkSelf); @@ -278,16 +381,21 @@ public class Sol003PackageManagementSubscriptionControllerTest { final PkgmSubscriptionRequest pkgmSubscriptionRequest = buildPkgmSubscriptionRequest(); final PkgmSubscription pkgmSubscription = buildPkgmSubscription(); - mockRestServer.expect(requestTo(msbEndpoint)).andExpect(method(HttpMethod.POST)) + mockRestServiceServer.expect(requestTo(msbEndpoint)).andExpect(method(HttpMethod.POST)) .andRespond(withSuccess(gson.toJson(pkgmSubscription), MediaType.APPLICATION_JSON)); return pkgmSubscriptionRequest; } - private HttpHeaders buildHttpHeaders(String uri) throws URISyntaxException { + private HttpHeaders buildHttpHeaders(final String uri) throws URISyntaxException { final HttpHeaders headers = new HttpHeaders(); - URI myUri = new URI(uri); + final URI myUri = new URI(uri); headers.setLocation(myUri); return headers; } + private String getAbsolutePath(final String path) { + final File file = new File(path); + return file.getAbsolutePath(); + } + } diff --git a/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/test/resources/requests/SubscriptionRequest.json b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/test/resources/requests/SubscriptionRequest.json new file mode 100644 index 0000000000..85ffb99d8d --- /dev/null +++ b/adapters/mso-vnfm-adapter/mso-vnfm-etsi-adapter/src/test/resources/requests/SubscriptionRequest.json @@ -0,0 +1,45 @@ +{ + "filter": + { + "notificationTypes": [ + "VnfPackageOnboardingNotification" + ], + "vnfProductsFromProviders": [ + { + "vnfProvider": "EST", + "vnfProducts": [ + { + "vnfProductName": "VnfProducts", + "versions": [ + { + "vnfSoftwareVersion": "vnfSoftwareVersion", + "vnfdVersions": [ + "version1" + ] + } + ] + } + ] + } + ], + "vnfdId": [ + "VNFDID" + ], + "vnfPkgId": [ + "VNFPKGID" + ], + "operationalState": "ENABLED" + }, + "callbackUri": "http://so-vnfm-adapter:9093/api/vnfpkgm/v1/subscriptions", + "authentication": + { + "authType": [ + "BASIC" + ], + "paramsBasic": + { + "userName": "vnfm", + "password": "vnfm" + } + } +} diff --git a/adapters/mso-vnfm-adapter/pom.xml b/adapters/mso-vnfm-adapter/pom.xml index 962b3b4fb7..3e295aa184 100644 --- a/adapters/mso-vnfm-adapter/pom.xml +++ b/adapters/mso-vnfm-adapter/pom.xml @@ -5,7 +5,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>adapters</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <groupId>org.onap.so.adapters</groupId> <artifactId>mso-vnfm-adapter</artifactId> diff --git a/adapters/pom.xml b/adapters/pom.xml index b96c3744c3..5d382fd4dd 100644 --- a/adapters/pom.xml +++ b/adapters/pom.xml @@ -5,7 +5,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>so</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>adapters</artifactId> @@ -23,6 +23,7 @@ <module>mso-openstack-adapters</module> <module>mso-vnfm-adapter</module> <module>mso-ve-vnfm-adapter</module> + <module>mso-nssmf-adapter</module> <module>so-appc-orchestrator</module> </modules> diff --git a/adapters/so-appc-orchestrator/pom.xml b/adapters/so-appc-orchestrator/pom.xml index 717bcee3fc..e8e5808eca 100644 --- a/adapters/so-appc-orchestrator/pom.xml +++ b/adapters/so-appc-orchestrator/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>adapters</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <groupId>org.onap.so.adapters</groupId> diff --git a/asdc-controller/pom.xml b/asdc-controller/pom.xml index 6ae05896df..1059e89da9 100644 --- a/asdc-controller/pom.xml +++ b/asdc-controller/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>so</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <groupId>org.onap.so</groupId> diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/activity/ActivitySpecsActions.java b/asdc-controller/src/main/java/org/onap/so/asdc/activity/ActivitySpecsActions.java index 06887f1253..a48e1770f0 100644 --- a/asdc-controller/src/main/java/org/onap/so/asdc/activity/ActivitySpecsActions.java +++ b/asdc-controller/src/main/java/org/onap/so/asdc/activity/ActivitySpecsActions.java @@ -4,12 +4,15 @@ * ================================================================================ * Copyright (C) 2017 AT&T Intellectual Property. All rights reserved. * ================================================================================ + * Modifications Copyright (c) 2020 Nokia + * ================================================================================ + * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at - * + * * http://www.apache.org/licenses/LICENSE-2.0 - * + * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. @@ -29,7 +32,6 @@ import org.onap.so.asdc.activity.beans.ActivitySpec; import org.onap.so.asdc.activity.beans.ActivitySpecCreateResponse; import org.onap.so.client.HttpClient; import org.onap.so.client.HttpClientFactory; -import org.onap.so.logger.LoggingAnchor; import org.onap.logging.filter.base.ONAPComponents; import org.slf4j.Logger; import org.slf4j.LoggerFactory; @@ -53,8 +55,6 @@ public class ActivitySpecsActions { return null; } - String activitySpecId = null; - try { ObjectMapper mapper = new ObjectMapper(); mapper.setSerializationInclusion(Include.NON_NULL); @@ -71,30 +71,34 @@ public class ActivitySpecsActions { int statusCode = response.getStatus(); if (statusCode == HttpStatus.SC_UNPROCESSABLE_ENTITY) { logger.warn(LoggingAnchor.THREE, "ActivitySpec", activitySpec.getName(), "already exists in SDC"); - } else if (statusCode != HttpStatus.SC_OK && statusCode != HttpStatus.SC_CREATED) { + return null; + } + if (statusCode != HttpStatus.SC_OK && statusCode != HttpStatus.SC_CREATED) { logger.warn(LoggingAnchor.THREE, "Error creating activity spec", activitySpec.getName(), statusCode); - } else { - if (response.getEntity() != null) { - ActivitySpecCreateResponse activitySpecCreateResponse = - response.readEntity(ActivitySpecCreateResponse.class); - if (activitySpecCreateResponse != null) { - activitySpecId = activitySpecCreateResponse.getId(); - } else { - logger.warn(LoggingAnchor.TWO, "Unable to read activity spec", activitySpec.getName()); - } - } else { - logger.warn(LoggingAnchor.TWO, "No activity spec response returned", activitySpec.getName()); - } + return null; + } + + if (response.getEntity() == null) { + logger.warn(LoggingAnchor.TWO, "No activity spec response returned", activitySpec.getName()); + return null; } + ActivitySpecCreateResponse activitySpecCreateResponse = + response.readEntity(ActivitySpecCreateResponse.class); + if (activitySpecCreateResponse == null) { + logger.warn(LoggingAnchor.TWO, "Unable to read activity spec", activitySpec.getName()); + return null; + } + return activitySpecCreateResponse.getId(); + + } catch (Exception e) { logger.warn(LoggingAnchor.TWO, "Exception creating activitySpec", e); } - return activitySpecId; + return null; } public boolean certifyActivitySpec(String hostname, String activitySpecId) { - boolean certificationResult = false; if (activitySpecId == null) { return false; } @@ -114,16 +118,19 @@ public class ActivitySpecsActions { if (statusCode == HttpStatus.SC_UNPROCESSABLE_ENTITY) { logger.warn(LoggingAnchor.THREE, "ActivitySpec with id", activitySpecId, "is already certified in SDC"); - } else if (statusCode != HttpStatus.SC_OK) { + return false; + } + if (statusCode != HttpStatus.SC_OK) { logger.warn(LoggingAnchor.THREE, "Error certifying activity", activitySpecId, statusCode); - } else { - certificationResult = true; + return false; } + return true; + } catch (Exception e) { logger.warn(LoggingAnchor.TWO, "Exception certifying activitySpec", e); + return false; } - return certificationResult; } } diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/activity/DeployActivitySpecs.java b/asdc-controller/src/main/java/org/onap/so/asdc/activity/DeployActivitySpecs.java index e53b792a74..df8e828a16 100644 --- a/asdc-controller/src/main/java/org/onap/so/asdc/activity/DeployActivitySpecs.java +++ b/asdc-controller/src/main/java/org/onap/so/asdc/activity/DeployActivitySpecs.java @@ -4,12 +4,14 @@ * ================================================================================ * Copyright (C) 2017 AT&T Intellectual Property. All rights reserved. * ================================================================================ + * Modifications Copyright (c) 2020 Nokia + * ================================================================================ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at - * + * * http://www.apache.org/licenses/LICENSE-2.0 - * + * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. @@ -74,17 +76,19 @@ public class DeployActivitySpecs { logger.debug("{} {}", "Attempting to create activity ", activitySpecFromCatalog.getName()); ActivitySpec activitySpec = mapActivitySpecFromCatalogToSdc(activitySpecFromCatalog); String activitySpecId = activitySpecsActions.createActivitySpec(hostname, activitySpec); - if (activitySpecId != null) { - logger.info(LoggingAnchor.TWO, "Successfully created activitySpec", activitySpec.getName()); - boolean certificationResult = activitySpecsActions.certifyActivitySpec(hostname, activitySpecId); - if (certificationResult) { - logger.info(LoggingAnchor.TWO, "Successfully certified activitySpec", activitySpec.getName()); - } else { - logger.info(LoggingAnchor.TWO, "Failed to certify activitySpec", activitySpec.getName()); - } - } else { + if (activitySpecId == null) { logger.info(LoggingAnchor.TWO, "Failed to create activitySpec", activitySpec.getName()); + continue; + } + + logger.info(LoggingAnchor.TWO, "Successfully created activitySpec", activitySpec.getName()); + boolean certificationResult = activitySpecsActions.certifyActivitySpec(hostname, activitySpecId); + if (!certificationResult) { + logger.info(LoggingAnchor.TWO, "Failed to certify activitySpec", activitySpec.getName()); + continue; } + + logger.info(LoggingAnchor.TWO, "Successfully certified activitySpec", activitySpec.getName()); } } @@ -120,46 +124,41 @@ public class DeployActivitySpecs { List<Input> inputs = new ArrayList<>(); List<Output> outputs = new ArrayList<>(); for (ActivitySpecActivitySpecParameters activitySpecParam : activitySpecActivitySpecParameters) { - if (activitySpecParam != null) { - if (activitySpecParam.getActivitySpecParameters() != null) { - ActivitySpecParameters activitySpecParameters = activitySpecParam.getActivitySpecParameters(); - if (activitySpecParameters != null) { - if (activitySpecParameters.getDirection().equals(DIRECTION_INPUT)) { - Input input = new Input(); - input.setName(activitySpecParameters.getName()); - input.setType(activitySpecParameters.getType()); - inputs.add(input); - } else if (activitySpecParameters.getDirection().equals(DIRECTION_OUTPUT)) { - Output output = new Output(); - output.setName(activitySpecParameters.getName()); - output.setType(activitySpecParameters.getType()); - outputs.add(output); - } - } - } + if (activitySpecParam == null || activitySpecParam.getActivitySpecParameters() == null) { + continue; + } + ActivitySpecParameters activitySpecParameters = activitySpecParam.getActivitySpecParameters(); + + if (activitySpecParameters.getDirection().equals(DIRECTION_INPUT)) { + Input input = new Input(); + input.setName(activitySpecParameters.getName()); + input.setType(activitySpecParameters.getType()); + inputs.add(input); + continue; + } + if (activitySpecParameters.getDirection().equals(DIRECTION_OUTPUT)) { + Output output = new Output(); + output.setName(activitySpecParameters.getName()); + output.setType(activitySpecParameters.getType()); + outputs.add(output); } } activitySpec.setInputs(inputs); activitySpec.setOutputs(outputs); - return; } public boolean checkHttpServerUp(String host) { - URL url = null; - boolean isUp = false; - - int responseCode = 0; try { - url = new URL(host); + URL url = new URL(host); HttpURLConnection connection = (HttpURLConnection) url.openConnection(); connection.setConnectTimeout(5000); - responseCode = connection.getResponseCode(); + int responseCode = connection.getResponseCode(); + if (responseCode == HttpStatus.SC_OK || responseCode == HttpStatus.SC_NOT_FOUND) { + return true; + } } catch (Exception e) { logger.warn("Exception on connecting to SDC WFD endpoint: ", e); } - if (responseCode == HttpStatus.SC_OK || responseCode == HttpStatus.SC_NOT_FOUND) { - isUp = true; - } - return isUp; + return false; } } diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/client/ASDCController.java b/asdc-controller/src/main/java/org/onap/so/asdc/client/ASDCController.java index f64adfd760..e084cfec18 100644 --- a/asdc-controller/src/main/java/org/onap/so/asdc/client/ASDCController.java +++ b/asdc-controller/src/main/java/org/onap/so/asdc/client/ASDCController.java @@ -7,6 +7,8 @@ * ================================================================================ * Modifications Copyright (c) 2019 Samsung * ================================================================================ + * Modifications Copyright (c) 2020 Nokia + * ================================================================================ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at @@ -33,9 +35,13 @@ import java.io.File; import java.io.FileOutputStream; import java.io.IOException; import java.io.UnsupportedEncodingException; +import java.nio.charset.StandardCharsets; import java.nio.file.Paths; import java.util.List; import java.util.Optional; +import org.onap.sdc.tosca.parser.impl.SdcPropertyNames; +import org.onap.sdc.toscaparser.api.elements.Metadata; +import org.onap.so.asdc.util.ZipParser; import org.onap.so.logger.LoggingAnchor; import org.onap.logging.ref.slf4j.ONAPLogConstants; import org.onap.sdc.api.IDistributionClient; @@ -162,12 +168,7 @@ public class ASDCController { break; case IDLE: - if (this.nbOfNotificationsOngoing > 1) { - --this.nbOfNotificationsOngoing; - } else { - this.nbOfNotificationsOngoing = 0; - this.controllerStatus = newControllerStatus; - } + changeOnStatusIDLE(newControllerStatus); break; default: @@ -177,6 +178,15 @@ public class ASDCController { } } + private void changeOnStatusIDLE(ASDCControllerStatus newControllerStatus) { + if (this.nbOfNotificationsOngoing > 1) { + --this.nbOfNotificationsOngoing; + } else { + this.nbOfNotificationsOngoing = 0; + this.controllerStatus = newControllerStatus; + } + } + public ASDCControllerStatus getControllerStatus() { return this.controllerStatus; } @@ -296,13 +306,12 @@ public class ASDCController { protected void notifyErrorToAsdc(INotificationData iNotif, ToscaResourceStructure toscaResourceStructure, DistributionStatusEnum deployStatus, VfResourceStructure resourceStructure, String errorMessage) { // do csar lever first - this.sendCsarDeployNotification(iNotif, resourceStructure, toscaResourceStructure, deployStatus, errorMessage); + this.sendCsarDeployNotification(resourceStructure, toscaResourceStructure, deployStatus, errorMessage); // at resource level for (IResourceInstance resource : iNotif.getResources()) { resourceStructure = new VfResourceStructure(iNotif, resource); errorMessage = String.format("Resource with UUID: %s already exists", resource.getResourceUUID()); - this.sendCsarDeployNotification(iNotif, resourceStructure, toscaResourceStructure, deployStatus, - errorMessage); + this.sendCsarDeployNotification(resourceStructure, toscaResourceStructure, deployStatus, errorMessage); } } @@ -363,8 +372,7 @@ public class ASDCController { if (DistributionActionResultEnum.SUCCESS.equals(downloadResult.getDistributionActionResult())) { logger.info(LoggingAnchor.FOUR, MessageEnum.ASDC_ARTIFACT_DOWNLOAD_SUC.toString(), - artifact.getArtifactURL(), artifact.getArtifactUUID(), - String.valueOf(downloadResult.getArtifactPayload().length)); + artifact.getArtifactURL(), artifact.getArtifactUUID(), downloadResult.getArtifactPayload().length); } else { logger.error(LoggingAnchor.SEVEN, MessageEnum.ASDC_ARTIFACT_DOWNLOAD_FAIL.toString(), @@ -447,7 +455,7 @@ public class ASDCController { } } - protected void sendCsarDeployNotification(INotificationData iNotif, ResourceStructure resourceStructure, + protected void sendCsarDeployNotification(ResourceStructure resourceStructure, ToscaResourceStructure toscaResourceStructure, DistributionStatusEnum statusEnum, String errorReason) { IArtifactInfo csarArtifact = toscaResourceStructure.getToscaArtifact(); @@ -471,8 +479,8 @@ public class ASDCController { } catch (ArtifactInstallerException e) { logger.info(LoggingAnchor.SIX, MessageEnum.ASDC_ARTIFACT_DOWNLOAD_FAIL.toString(), resourceStructure.getResourceInstance().getResourceName(), - resourceStructure.getResourceInstance().getResourceUUID(), - String.valueOf(resourceStructure.getNumberOfResources()), "ASDC", "deployResourceStructure"); + resourceStructure.getResourceInstance().getResourceUUID(), resourceStructure.getNumberOfResources(), + "ASDC", "deployResourceStructure"); sendDeployNotificationsForResource(resourceStructure, DistributionStatusEnum.DEPLOY_ERROR, e.getMessage()); throw e; } @@ -480,8 +488,8 @@ public class ASDCController { if (resourceStructure.isDeployedSuccessfully() || toscaResourceStructure.isDeployedSuccessfully()) { logger.info(LoggingAnchor.SIX, MessageEnum.ASDC_ARTIFACT_DEPLOY_SUC.toString(), resourceStructure.getResourceInstance().getResourceName(), - resourceStructure.getResourceInstance().getResourceUUID(), - String.valueOf(resourceStructure.getNumberOfResources()), "ASDC", "deployResourceStructure"); + resourceStructure.getResourceInstance().getResourceUUID(), resourceStructure.getNumberOfResources(), + "ASDC", "deployResourceStructure"); sendDeployNotificationsForResource(resourceStructure, DistributionStatusEnum.DEPLOY_OK, null); } @@ -509,26 +517,10 @@ public class ASDCController { try { IDistributionStatusMessage message = new DistributionStatusMessage(artifactURL, consumerID, distributionID, status, timestamp); - - switch (notificationType) { - case DOWNLOAD: - if (errorReason != null) { - this.distributionClient.sendDownloadStatus(message, errorReason); - } else { - this.distributionClient.sendDownloadStatus(message); - } - - break; - case DEPLOY: - if (errorReason != null) { - this.distributionClient.sendDeploymentStatus(message, errorReason); - } else { - this.distributionClient.sendDeploymentStatus(message); - } - - break; - default: - break; + if (errorReason != null) { + sendNotificationWithMessageAndErrorReason(notificationType, errorReason, message); + } else { + sendNotificationWithMessage(notificationType, message); } } catch (RuntimeException e) { logger.warn(LoggingAnchor.FIVE, MessageEnum.ASDC_SEND_NOTIF_ASDC_EXEC.toString(), "ASDC", @@ -537,6 +529,33 @@ public class ASDCController { } } + private void sendNotificationWithMessage(NotificationType notificationType, IDistributionStatusMessage message) { + switch (notificationType) { + case DOWNLOAD: + this.distributionClient.sendDownloadStatus(message); + break; + case DEPLOY: + this.distributionClient.sendDeploymentStatus(message); + break; + default: + break; + } + } + + private void sendNotificationWithMessageAndErrorReason(NotificationType notificationType, String errorReason, + IDistributionStatusMessage message) { + switch (notificationType) { + case DOWNLOAD: + this.distributionClient.sendDownloadStatus(message, errorReason); + break; + case DEPLOY: + this.distributionClient.sendDeploymentStatus(message, errorReason); + break; + default: + break; + } + } + protected void sendFinalDistributionStatus(String distributionID, DistributionStatusEnum status, String errorReason) { @@ -587,8 +606,8 @@ public class ASDCController { for (IResourceInstance resource : iNotif.getResources()) { noOfArtifacts += resource.getArtifacts().size(); } - logger.info(LoggingAnchor.FOUR, MessageEnum.ASDC_RECEIVE_CALLBACK_NOTIF.toString(), - String.valueOf(noOfArtifacts), iNotif.getServiceUUID(), "ASDC"); + logger.info(LoggingAnchor.FOUR, MessageEnum.ASDC_RECEIVE_CALLBACK_NOTIF.toString(), noOfArtifacts, + iNotif.getServiceUUID(), "ASDC"); try { if (iNotif.getDistributionID() != null && !iNotif.getDistributionID().isEmpty()) { @@ -733,7 +752,8 @@ public class ASDCController { if (isCsarAlreadyDeployed(iNotif, toscaResourceStructure)) { return; } - + // process NsstResource + this.processNsstNotification(iNotif, toscaResourceStructure); for (IResourceInstance resource : iNotif.getResources()) { String resourceType = resource.getResourceType(); @@ -741,21 +761,11 @@ public class ASDCController { logger.info("Processing Resource Type: {}, Model UUID: {}", resourceType, resource.getResourceUUID()); - if ("VF".equals(resourceType)) { - resourceStructure = new VfResourceStructure(iNotif, resource); - } else if ("PNF".equals(resourceType)) { - resourceStructure = new PnfResourceStructure(iNotif, resource); - } else { - // There are cases where the Service has no VF resources, those are handled here - logger.info("No resources found for Service: {}", iNotif.getServiceUUID()); - resourceStructure = new VfResourceStructure(iNotif, new ResourceInstance()); - resourceStructure.setResourceType(ResourceType.OTHER); - } + resourceStructure = getResourceStructure(iNotif, resource, resourceType); try { if (!this.checkResourceAlreadyDeployed(resourceStructure, serviceDeployed)) { - logger.debug("Processing Resource Type: " + resourceType + " and Model UUID: " + resourceStructure.getResourceInstance().getResourceUUID()); @@ -765,25 +775,27 @@ public class ASDCController { for (IArtifactInfo artifact : resource.getArtifacts()) { IDistributionClientDownloadResult resultArtifact = this.downloadTheArtifact(artifact, iNotif.getDistributionID()); - if (resultArtifact != null) { - - if (ASDCConfiguration.VF_MODULES_METADATA.equals(artifact.getArtifactType())) { - logger.debug("VF_MODULE_ARTIFACT: " - + new String(resultArtifact.getArtifactPayload(), "UTF-8")); - logger.debug(ASDCNotificationLogging - .dumpVfModuleMetaDataList(((VfResourceStructure) resourceStructure) - .decodeVfModuleArtifact(resultArtifact.getArtifactPayload()))); - } - if (!ASDCConfiguration.WORKFLOW.equals(artifact.getArtifactType())) { - resourceStructure.addArtifactToStructure(distributionClient, artifact, - resultArtifact); - } else { - writeArtifactToFile(artifact, resultArtifact); - logger.debug( - "Adding workflow artifact to structure: " + artifact.getArtifactName()); - resourceStructure.addWorkflowArtifactToStructure(artifact, resultArtifact); - } + if (resultArtifact == null) { + continue; } + + if (ASDCConfiguration.VF_MODULES_METADATA.equals(artifact.getArtifactType())) { + logger.debug("VF_MODULE_ARTIFACT: " + + new String(resultArtifact.getArtifactPayload(), StandardCharsets.UTF_8)); + logger.debug(ASDCNotificationLogging + .dumpVfModuleMetaDataList(((VfResourceStructure) resourceStructure) + .decodeVfModuleArtifact(resultArtifact.getArtifactPayload()))); + } + if (!ASDCConfiguration.WORKFLOW.equals(artifact.getArtifactType())) { + resourceStructure.addArtifactToStructure(distributionClient, artifact, + resultArtifact); + } else { + writeArtifactToFile(artifact, resultArtifact); + logger.debug( + "Adding workflow artifact to structure: " + artifact.getArtifactName()); + resourceStructure.addWorkflowArtifactToStructure(artifact, resultArtifact); + } + } // Deploy VF resource and artifacts @@ -817,8 +829,7 @@ public class ASDCController { } } - this.sendCsarDeployNotification(iNotif, resourceStructure, toscaResourceStructure, deployStatus, - errorMessage); + this.sendCsarDeployNotification(resourceStructure, toscaResourceStructure, deployStatus, errorMessage); } catch (ASDCDownloadException | UnsupportedEncodingException e) { logger.error(LoggingAnchor.SIX, MessageEnum.ASDC_GENERAL_EXCEPTION_ARG.toString(), @@ -827,6 +838,20 @@ public class ASDCController { } } + private ResourceStructure getResourceStructure(INotificationData iNotif, IResourceInstance resource, + String resourceType) { + if ("VF".equals(resourceType)) { + return new VfResourceStructure(iNotif, resource); + } + if ("PNF".equals(resourceType)) { + return new PnfResourceStructure(iNotif, resource); + } + logger.info("No resources found for Service: {}", iNotif.getServiceUUID()); + ResourceStructure resourceStructure = new VfResourceStructure(iNotif, new ResourceInstance()); + resourceStructure.setResourceType(ResourceType.OTHER); + return resourceStructure; + } + private String getMsoConfigPath() { String msoConfigPath = System.getProperty("mso.config.path"); if (msoConfigPath == null) { @@ -893,6 +918,23 @@ public class ASDCController { "processCsarServiceArtifacts", ErrorCode.BusinessProcessError.getValue(), "Exception in processCsarServiceArtifacts", e); } + } else if (artifact.getArtifactType().equals(ASDCConfiguration.OTHER)) { + try { + IDistributionClientDownloadResult resultArtifact = + this.downloadTheArtifact(artifact, iNotif.getDistributionID()); + + writeArtifactToFile(artifact, resultArtifact); + + toscaResourceStructure.setToscaArtifact(artifact); + + toscaResourceStructure.setServiceVersion(iNotif.getServiceVersion()); + + } catch (ASDCDownloadException e) { + logger.error(LoggingAnchor.SIX, MessageEnum.ASDC_GENERAL_EXCEPTION_ARG.toString(), + "Exception caught during processCsarServiceArtifacts", "ASDC", + "processCsarServiceArtifacts", ErrorCode.BusinessProcessError.getValue(), + "Exception in processCsarServiceArtifacts", e); + } } @@ -900,7 +942,6 @@ public class ASDCController { } - /** * @return the address of the ASDC we are connected to. */ @@ -920,4 +961,38 @@ public class ASDCController { } return UNKNOWN; } + + private void processNsstNotification(INotificationData iNotif, ToscaResourceStructure toscaResourceStructure) { + Metadata serviceMetadata = toscaResourceStructure.getServiceMetadata(); + try { + if (serviceMetadata.getValue(SdcPropertyNames.PROPERTY_NAME_CATEGORY).equalsIgnoreCase("NSST")) { + + String artifactContent = null; + List<IArtifactInfo> serviceArtifacts = iNotif.getServiceArtifacts(); + Optional<IArtifactInfo> artifactOpt = serviceArtifacts.stream() + .filter(e -> e.getArtifactType().equalsIgnoreCase("OTHER")).findFirst(); + if (artifactOpt.isPresent()) { + IArtifactInfo artifactInfo = artifactOpt.get(); + logger.debug("Ready to parse this serviceArtifactUUID: " + artifactInfo.getArtifactUUID()); + String filePath = Paths.get(getMsoConfigPath(), "ASDC", artifactInfo.getArtifactVersion(), + artifactInfo.getArtifactName()).normalize().toString(); + ZipParser zipParserInstance = ZipParser.getInstance(); + artifactContent = zipParserInstance.parseJsonForZip(filePath); + logger.debug( + "serviceArtifact parsing success! serviceArtifactUUID: " + artifactInfo.getArtifactUUID()); + } else { + logger.debug("serviceArtifact is null"); + } + ResourceStructure resourceStructure = new VfResourceStructure(iNotif, new ResourceInstance()); + resourceStructure.setResourceType(ResourceType.OTHER); + toscaInstaller.installTheNsstService(toscaResourceStructure, (VfResourceStructure) resourceStructure, + artifactContent); + } + } catch (IOException e) { + logger.error("serviceArtifact parse failure for service uuid: " + + serviceMetadata.getValue(SdcPropertyNames.PROPERTY_NAME_CATEGORY)); + } catch (Exception e) { + logger.error("error NSST process resource failure ", e); + } + } } diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/ErrorCode.java b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/ErrorCode.java new file mode 100644 index 0000000000..1714e24a27 --- /dev/null +++ b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/ErrorCode.java @@ -0,0 +1,50 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.asdc.etsi.pkg.processor; + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * + */ +public enum ErrorCode { + + NORMAL("0"), PACKAGE_EXIST("1"), CATALOG_EXCEPTION("2"), SYSTEM_ERROR("3"), UNKNOWN("-1"); + + private String code; + + private ErrorCode(final String code) { + this.code = code; + } + + public String getCode() { + return code; + } + + public static ErrorCode getErrorCode(final String code) { + for (final ErrorCode errorCode : ErrorCode.values()) { + if (errorCode.getCode().equalsIgnoreCase(code)) { + return errorCode; + } + + } + return UNKNOWN; + } + +} diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiCatalogPackageOnboadingJobStatus.java b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiCatalogPackageOnboadingJobStatus.java new file mode 100644 index 0000000000..772f81a7fe --- /dev/null +++ b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiCatalogPackageOnboadingJobStatus.java @@ -0,0 +1,63 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.asdc.etsi.pkg.processor; + +import java.io.Serializable; +import javax.xml.bind.annotation.XmlElement; + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * + */ +public class EtsiCatalogPackageOnboadingJobStatus implements Serializable { + + private static final long serialVersionUID = 1L; + + @XmlElement(name = "jobId") + private String jobId; + + @XmlElement(name = "responseDescriptor") + private EtsiCatalogPackageOnboardingJobDescriptor responseDescriptor; + + public String getJobId() { + return jobId; + } + + public void setJobId(final String jobId) { + this.jobId = jobId; + } + + public EtsiCatalogPackageOnboardingJobDescriptor getResponseDescriptor() { + return responseDescriptor; + } + + public void setResponseDescriptor(final EtsiCatalogPackageOnboardingJobDescriptor responseDescriptor) { + this.responseDescriptor = responseDescriptor; + } + + @Override + public String toString() { + return "EtsiCatalogPackageOnboadingJobStatus [jobId=" + jobId + ", responseDescriptor=" + responseDescriptor + + "]"; + } + + + +} diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiCatalogPackageOnboardingJob.java b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiCatalogPackageOnboardingJob.java new file mode 100644 index 0000000000..0c7bba6751 --- /dev/null +++ b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiCatalogPackageOnboardingJob.java @@ -0,0 +1,49 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.asdc.etsi.pkg.processor; + +import java.io.Serializable; +import javax.xml.bind.annotation.XmlElement; + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * + */ +public class EtsiCatalogPackageOnboardingJob implements Serializable { + + private static final long serialVersionUID = 1L; + + @XmlElement(name = "jobId") + private String jobId; + + public String getJobId() { + return jobId; + } + + public void setJobId(final String jobId) { + this.jobId = jobId; + } + + @Override + public String toString() { + return "EtsiCatalogPackageOnboardingJob [jobId=" + jobId + "]"; + } + +} diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiCatalogPackageOnboardingJobDescriptor.java b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiCatalogPackageOnboardingJobDescriptor.java new file mode 100644 index 0000000000..b0c07d6f24 --- /dev/null +++ b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiCatalogPackageOnboardingJobDescriptor.java @@ -0,0 +1,74 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.asdc.etsi.pkg.processor; + +import java.io.Serializable; +import javax.xml.bind.annotation.XmlElement; + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * + */ +public class EtsiCatalogPackageOnboardingJobDescriptor implements Serializable { + + private static final long serialVersionUID = 1L; + + @XmlElement(name = "status") + private String status; + + @XmlElement(name = "statusDescription") + private String statusDescription; + + @XmlElement(name = "errorCode") + private String errorCode; + + public String getStatus() { + return status; + } + + public void setStatus(final String status) { + this.status = status; + } + + public String getStatusDescription() { + return statusDescription; + } + + public void setStatusDescription(final String statusDescription) { + this.statusDescription = statusDescription; + } + + public String getErrorCode() { + return errorCode; + } + + public void setErrorCode(final String errorCode) { + this.errorCode = errorCode; + } + + @Override + public String toString() { + return "EtsiCatalogPackageOnboardingJobDescriptor [status=" + status + ", statusDescription=" + + statusDescription + ", errorCode=" + errorCode + "]"; + } + + + +} diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiCatalogPackageOnboardingRequest.java b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiCatalogPackageOnboardingRequest.java new file mode 100644 index 0000000000..79fd1398a0 --- /dev/null +++ b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiCatalogPackageOnboardingRequest.java @@ -0,0 +1,54 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.asdc.etsi.pkg.processor; + +import java.io.Serializable; +import javax.xml.bind.annotation.XmlElement; + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * + */ +public class EtsiCatalogPackageOnboardingRequest implements Serializable { + + private static final long serialVersionUID = 1L; + + @XmlElement(name = "csarId") + private String csarId; + + public EtsiCatalogPackageOnboardingRequest csarId(final String csarId) { + this.csarId = csarId; + return this; + } + + public String getCsarId() { + return csarId; + } + + public void setCsarId(final String csarId) { + this.csarId = csarId; + } + + @Override + public String toString() { + return "EtsiCatalogPackageOnboardingRequest [csarId=" + csarId + "]"; + } + +} diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiCatalogServiceProvider.java b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiCatalogServiceProvider.java new file mode 100644 index 0000000000..f6a303291f --- /dev/null +++ b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiCatalogServiceProvider.java @@ -0,0 +1,112 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.asdc.etsi.pkg.processor; + +import static org.onap.so.asdc.etsi.pkg.processor.HttpRestServiceProviderConfiguration.ETSI_CATALOG_HTTP_REST_SERVICE_PROVIDER_BEAN; +import org.onap.so.asdc.etsi.pkg.processor.exceptions.EtsiCatalogManagerRequestFailureException; +import org.onap.so.rest.exceptions.InvalidRestRequestException; +import org.onap.so.rest.exceptions.RestProcessingException; +import org.onap.so.rest.service.HttpRestServiceProvider; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.beans.factory.annotation.Qualifier; +import org.springframework.beans.factory.annotation.Value; +import org.springframework.http.HttpHeaders; +import org.springframework.http.MediaType; +import org.springframework.http.ResponseEntity; +import org.springframework.stereotype.Service; + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * + */ +@Service +public class EtsiCatalogServiceProvider { + + private static final Logger LOGGER = LoggerFactory.getLogger(EtsiCatalogServiceProvider.class); + + private final HttpRestServiceProvider httpServiceProvider; + + @Value("${etsi-catalog-manager.endpoint:http://modeling-etsicatalog.onap:8806/api/catalog/v1}") + private String etsiCatalogManagerEndpoint; + + @Autowired + public EtsiCatalogServiceProvider( + @Qualifier(ETSI_CATALOG_HTTP_REST_SERVICE_PROVIDER_BEAN) final HttpRestServiceProvider httpServiceProvider) { + this.httpServiceProvider = httpServiceProvider; + } + + public EtsiCatalogPackageOnboardingJob onBoardResource( + final EtsiCatalogPackageOnboardingRequest packageOnboardingRequest) { + try { + final String url = etsiCatalogManagerEndpoint + "/vnfpackages"; + final ResponseEntity<EtsiCatalogPackageOnboardingJob> responseEntity = httpServiceProvider.postHttpRequest( + packageOnboardingRequest, url, getHeaders(), EtsiCatalogPackageOnboardingJob.class); + + if (responseEntity.getStatusCode().is2xxSuccessful()) { + if (responseEntity.hasBody()) { + return responseEntity.getBody(); + } + LOGGER.error("Received response without body"); + } + final String message = "Unexpected status code received " + responseEntity.getStatusCode(); + LOGGER.error(message); + throw new EtsiCatalogManagerRequestFailureException(message); + + } catch (final InvalidRestRequestException | RestProcessingException exception) { + final String message = "Unable to process onboarding request"; + LOGGER.error(message, exception); + throw new EtsiCatalogManagerRequestFailureException(message); + } + + } + + public EtsiCatalogPackageOnboadingJobStatus getJobStatus(final String jobId) { + try { + final String url = etsiCatalogManagerEndpoint + "/jobs/" + jobId; + + final ResponseEntity<EtsiCatalogPackageOnboadingJobStatus> responseEntity = + httpServiceProvider.getHttpResponse(url, getHeaders(), EtsiCatalogPackageOnboadingJobStatus.class); + + if (responseEntity.getStatusCode().is2xxSuccessful()) { + if (responseEntity.hasBody()) { + return responseEntity.getBody(); + } + LOGGER.error("Received response without body"); + } + final String message = + "Unexpected status code received while getting job status " + responseEntity.getStatusCode(); + LOGGER.error(message); + throw new EtsiCatalogManagerRequestFailureException(message); + } catch (final InvalidRestRequestException | RestProcessingException exception) { + final String message = "Unable to get job status"; + LOGGER.error(message, exception); + throw new EtsiCatalogManagerRequestFailureException(message); + } + + } + + private HttpHeaders getHeaders() { + final HttpHeaders headers = new HttpHeaders(); + headers.setContentType(MediaType.APPLICATION_JSON); + return headers; + } +} diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiResourcePackageProcessor.java b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiResourcePackageProcessor.java new file mode 100644 index 0000000000..bb7197b7a4 --- /dev/null +++ b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/EtsiResourcePackageProcessor.java @@ -0,0 +1,175 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.asdc.etsi.pkg.processor; + +import java.io.ByteArrayInputStream; +import java.io.IOException; +import java.time.Instant; +import java.util.Optional; +import java.util.concurrent.TimeUnit; +import java.util.zip.ZipEntry; +import java.util.zip.ZipInputStream; +import org.onap.so.asdc.etsi.pkg.processor.exceptions.SOL004ResourcePackageFailureException; +import org.onap.so.asdc.etsi.pkg.processor.exceptions.SOL004ResourcePackageProcessingException; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.beans.factory.annotation.Value; +import org.springframework.stereotype.Service; +import com.google.common.collect.ImmutableSet; + + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * + */ +@Service +public class EtsiResourcePackageProcessor { + + private final static Logger LOGGER = LoggerFactory.getLogger(EtsiResourcePackageProcessor.class); + private static final String ONBOARDED_PACKAGE_DIR_PATH = "Artifacts/Deployment/ONBOARDED_PACKAGE"; + private final SdcResourceProvider sdcResourceProvider; + private final EtsiCatalogServiceProvider catalogServiceProvider; + private static final int SLEEP_TIME_IN_SECONDS = 5; + + private static final ImmutableSet<JobStatus> JOB_FINISHED_STATES = + ImmutableSet.of(JobStatus.FINISHED, JobStatus.ERROR, JobStatus.TIMEOUT); + + @Value("${etsi-catalog-manager.rest.timeoutInSeconds:300}") + private int timeOutInSeconds; + + @Autowired + public EtsiResourcePackageProcessor(final SdcResourceProvider sdcResourceProvider, + final EtsiCatalogServiceProvider catalogServiceProvider) { + this.sdcResourceProvider = sdcResourceProvider; + this.catalogServiceProvider = catalogServiceProvider; + } + + public void processPackageIfExists(final String vnfUuid) { + LOGGER.debug("Processing vnf with UUID: {} ", vnfUuid); + try { + final Optional<byte[]> optional = sdcResourceProvider.getVnfResource(vnfUuid); + if (optional.isPresent()) { + final byte[] resourceContent = optional.get(); + + if (containsOnBoardedSol004Package(resourceContent)) { + final EtsiCatalogPackageOnboardingJob onboardingJob = catalogServiceProvider + .onBoardResource(new EtsiCatalogPackageOnboardingRequest().csarId(vnfUuid)); + LOGGER.debug("Successfully created job with id: {} to onboard vnf with UUID: {}", + onboardingJob.getJobId(), vnfUuid); + + if (onboardingJob.getJobId() == null) { + throw new SOL004ResourcePackageFailureException( + "Received invalid jobId " + onboardingJob.getJobId()); + } + + final Optional<EtsiCatalogPackageOnboadingJobStatus> jobStatusOptional = + waitForJobToFinish(onboardingJob); + + if (!jobStatusOptional.isPresent()) { + final String message = "Job status timeout reached failed to onboard vnf with UUID: " + vnfUuid; + LOGGER.debug(message, vnfUuid); + throw new SOL004ResourcePackageFailureException(message); + } + + final EtsiCatalogPackageOnboadingJobStatus onboadingJobStatus = jobStatusOptional.get(); + final JobStatus jobStatus = getJobStatus(onboadingJobStatus); + final ErrorCode errorCode = getErrorCode(onboadingJobStatus); + + LOGGER.debug("Final job status: {}, error code: {}", jobStatus, errorCode); + if (!JobStatus.FINISHED.equals(jobStatus) && !ErrorCode.PACKAGE_EXIST.equals(errorCode)) { + final String message = "Failed to onboard vnf with UUID: " + vnfUuid + " job status: " + + jobStatus + " errorCode: " + errorCode; + LOGGER.debug(message, vnfUuid); + throw new SOL004ResourcePackageFailureException(message); + } + LOGGER.debug("Successfully onboarded package in ETSI catalog .. "); + } + + } + } catch (final Exception exception) { + final String message = "Unable to process resource received from SDC"; + LOGGER.error(message, exception); + throw new SOL004ResourcePackageProcessingException(message, exception); + } + + } + + private Optional<EtsiCatalogPackageOnboadingJobStatus> waitForJobToFinish( + final EtsiCatalogPackageOnboardingJob onboardingJob) throws InterruptedException { + JobStatus currentJobStatus = null; + final long startTimeInMillis = System.currentTimeMillis(); + final long timeOutTime = startTimeInMillis + TimeUnit.SECONDS.toMillis(timeOutInSeconds); + + LOGGER.debug("Will wait till {} for {} job to finish", Instant.ofEpochMilli(timeOutTime).toString(), + onboardingJob.getJobId()); + + while (timeOutTime > System.currentTimeMillis()) { + + final EtsiCatalogPackageOnboadingJobStatus onboadingJobStatus = + catalogServiceProvider.getJobStatus(onboardingJob.getJobId()); + LOGGER.debug("Current job status {} ", onboadingJobStatus); + + currentJobStatus = getJobStatus(onboadingJobStatus); + if (JOB_FINISHED_STATES.contains(currentJobStatus)) { + return Optional.of(onboadingJobStatus); + } + + LOGGER.debug("Onboarding not finished yet, will try again in {} seconds", SLEEP_TIME_IN_SECONDS); + TimeUnit.SECONDS.sleep(SLEEP_TIME_IN_SECONDS); + + } + LOGGER.warn("Timeout current job status: {}", currentJobStatus); + return Optional.empty(); + } + + private boolean containsOnBoardedSol004Package(final byte[] resourceContent) throws IOException { + try (final ZipInputStream zipStream = new ZipInputStream(new ByteArrayInputStream(resourceContent))) { + ZipEntry entry; + while ((entry = zipStream.getNextEntry()) != null) { + if (entry.getName() != null && entry.getName().contains(ONBOARDED_PACKAGE_DIR_PATH)) { + LOGGER.debug("Found entry: {} that contains {} in name", entry.getName(), + ONBOARDED_PACKAGE_DIR_PATH); + return true; + } + } + + } + LOGGER.debug("Unable to find {} dir in downloaded package", ONBOARDED_PACKAGE_DIR_PATH); + return false; + } + + private JobStatus getJobStatus(final EtsiCatalogPackageOnboadingJobStatus onboadingJobStatus) { + if (onboadingJobStatus.getResponseDescriptor() != null) { + return JobStatus.getJobStatus(onboadingJobStatus.getResponseDescriptor().getStatus()); + } + LOGGER.warn("Found null ResponseDescriptor {}", onboadingJobStatus); + return JobStatus.UNKNOWN; + } + + private ErrorCode getErrorCode(final EtsiCatalogPackageOnboadingJobStatus onboadingJobStatus) { + if (onboadingJobStatus.getResponseDescriptor() != null) { + return ErrorCode.getErrorCode(onboadingJobStatus.getResponseDescriptor().getErrorCode()); + } + LOGGER.warn("Found null ResponseDescriptor {}", onboadingJobStatus); + return ErrorCode.UNKNOWN; + } + +} diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/HttpRestServiceProviderConfiguration.java b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/HttpRestServiceProviderConfiguration.java new file mode 100644 index 0000000000..1afda0d29f --- /dev/null +++ b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/HttpRestServiceProviderConfiguration.java @@ -0,0 +1,55 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.asdc.etsi.pkg.processor; + +import static org.onap.so.asdc.etsi.pkg.processor.SslBasedHttpClientConfiguration.SSL_BASED_CONFIGURABLE_REST_TEMPLATE; +import static org.onap.so.client.RestTemplateConfig.CONFIGURABLE_REST_TEMPLATE; +import org.onap.so.rest.service.HttpRestServiceProvider; +import org.onap.so.rest.service.HttpRestServiceProviderImpl; +import org.springframework.beans.factory.annotation.Qualifier; +import org.springframework.context.annotation.Bean; +import org.springframework.context.annotation.Configuration; +import org.springframework.web.client.RestTemplate; + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * + */ +@Configuration +public class HttpRestServiceProviderConfiguration { + + public static final String ETSI_CATALOG_HTTP_REST_SERVICE_PROVIDER_BEAN = "etsiCatalogHttpRestServiceProviderBean"; + public static final String SDC_HTTP_REST_SERVICE_PROVIDER_BEAN = "sdcHttpRestServiceProviderBean"; + + @Bean + @Qualifier(ETSI_CATALOG_HTTP_REST_SERVICE_PROVIDER_BEAN) + public HttpRestServiceProvider etsiCataloghttpRestServiceProvider( + @Qualifier(CONFIGURABLE_REST_TEMPLATE) final RestTemplate restTemplate) { + return new HttpRestServiceProviderImpl(restTemplate); + } + + @Bean + @Qualifier(SDC_HTTP_REST_SERVICE_PROVIDER_BEAN) + public HttpRestServiceProvider sdchttpRestServiceProvider( + @Qualifier(SSL_BASED_CONFIGURABLE_REST_TEMPLATE) final RestTemplate restTemplate) { + return new HttpRestServiceProviderImpl(restTemplate); + } + +} diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/JobStatus.java b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/JobStatus.java new file mode 100644 index 0000000000..cf09b15539 --- /dev/null +++ b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/JobStatus.java @@ -0,0 +1,60 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.asdc.etsi.pkg.processor; + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * + */ +public enum JobStatus { + + STARTED("started"), + TIMEOUT("timeout"), + FINISHED("finished"), + PARTLY_FINISHED("partly_finished"), + PROCESSING("processing"), + ERROR("error"), + UNKNOWN("unknown"); + + private String value; + + private JobStatus(final String value) { + this.value = value; + } + + public String getValue() { + return value; + } + + @Override + public String toString() { + return this.value; + } + + public static JobStatus getJobStatus(final String jobStatus) { + for (final JobStatus status : JobStatus.values()) { + if (status.getValue().equalsIgnoreCase(jobStatus)) { + return status; + } + } + return JobStatus.UNKNOWN; + } + +} diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/SdcBasicHttpConfigurationProvider.java b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/SdcBasicHttpConfigurationProvider.java new file mode 100644 index 0000000000..19375e265f --- /dev/null +++ b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/SdcBasicHttpConfigurationProvider.java @@ -0,0 +1,60 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.asdc.etsi.pkg.processor; + +import java.nio.charset.StandardCharsets; +import java.security.GeneralSecurityException; +import org.apache.commons.codec.binary.Base64; +import org.onap.so.utils.CryptoUtils; +import org.springframework.beans.factory.annotation.Value; +import org.springframework.context.annotation.Configuration; + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * + */ +@Configuration +public class SdcBasicHttpConfigurationProvider { + + @Value("${sdc.endpoint:https://sdc-be.onap:8443}") + private String endPoint; + + @Value("${sdc.username:mso}") + private String username; + + @Value(value = "${sdc.password:76966BDD3C7414A03F7037264FF2E6C8EEC6C28F2B67F2840A1ED857C0260FEE731D73F47F828E5527125D29FD25D3E0DE39EE44C058906BF1657DE77BF897EECA93BDC07FA64F}") + private String password; + + @Value(value = "${sdc.key:566B754875657232314F5548556D3665}") + private String key; + + + public String getBasicAuthorization() throws GeneralSecurityException { + final String auth = username + ":" + CryptoUtils.decrypt(password, key); + final byte[] encodedAuth = Base64.encodeBase64(auth.getBytes(StandardCharsets.ISO_8859_1)); + return "Basic " + new String(encodedAuth); + } + + public String getEndPoint() { + return endPoint; + } + + +} diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/SdcResourceProvider.java b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/SdcResourceProvider.java new file mode 100644 index 0000000000..0cd0aba9c3 --- /dev/null +++ b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/SdcResourceProvider.java @@ -0,0 +1,96 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.asdc.etsi.pkg.processor; + +import static org.onap.so.asdc.etsi.pkg.processor.HttpRestServiceProviderConfiguration.SDC_HTTP_REST_SERVICE_PROVIDER_BEAN; +import static org.springframework.http.HttpHeaders.ACCEPT; +import static org.springframework.http.MediaType.APPLICATION_OCTET_STREAM_VALUE; +import java.security.GeneralSecurityException; +import java.util.Optional; +import org.onap.so.rest.service.HttpRestServiceProvider; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.beans.factory.annotation.Qualifier; +import org.springframework.http.HttpHeaders; +import org.springframework.http.ResponseEntity; +import org.springframework.stereotype.Service; + + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * + */ +@Service +public class SdcResourceProvider { + private final static Logger LOGGER = LoggerFactory.getLogger(SdcResourceProvider.class); + + private static final String SERVICE_NAME = "SO-SDC-CONTROLLER"; + + private final HttpRestServiceProvider httpRestServiceProvider; + + private final SdcBasicHttpConfigurationProvider sdcBasicHttpConfigurationProvider; + + @Autowired + public SdcResourceProvider( + @Qualifier(SDC_HTTP_REST_SERVICE_PROVIDER_BEAN) final HttpRestServiceProvider httpRestServiceProvider, + final SdcBasicHttpConfigurationProvider sdcBasicHttpConfigurationProvider) { + this.httpRestServiceProvider = httpRestServiceProvider; + this.sdcBasicHttpConfigurationProvider = sdcBasicHttpConfigurationProvider; + } + + public Optional<byte[]> getVnfResource(final String resourceId) { + LOGGER.debug("Will get resource from SDC using resource id: {}", resourceId); + try { + final HttpHeaders headers = getHttpHeaders(); + headers.add(ACCEPT, APPLICATION_OCTET_STREAM_VALUE); + final String url = getSdcResourceEndPoint(resourceId); + LOGGER.debug("will invoke url: {} to get resource ", url); + final ResponseEntity<byte[]> responseEntity = + httpRestServiceProvider.getHttpResponse(url, headers, byte[].class); + + if (responseEntity.getStatusCode().is2xxSuccessful()) { + if (responseEntity.hasBody()) { + return Optional.of(responseEntity.getBody()); + } + LOGGER.error("Received response without body"); + } + LOGGER.error("Unexpected Status code received : {}", responseEntity.getStatusCode()); + return Optional.empty(); + } catch (final Exception exception) { + LOGGER.error("Unable to get {} resource from SDC", resourceId, exception); + return Optional.empty(); + } + } + + private String getSdcResourceEndPoint(final String resourceId) { + return sdcBasicHttpConfigurationProvider.getEndPoint() + "/sdc/v1/catalog/resources/" + resourceId + + "/toscaModel"; + } + + + private HttpHeaders getHttpHeaders() throws GeneralSecurityException { + final HttpHeaders headers = new HttpHeaders(); + headers.add(HttpHeaders.AUTHORIZATION, sdcBasicHttpConfigurationProvider.getBasicAuthorization()); + headers.add("X-ECOMP-InstanceID", SERVICE_NAME); + headers.add("X-FromAppId", SERVICE_NAME); + return headers; + } +} diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/SslBasedHttpClientConfiguration.java b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/SslBasedHttpClientConfiguration.java new file mode 100644 index 0000000000..88c21524e9 --- /dev/null +++ b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/SslBasedHttpClientConfiguration.java @@ -0,0 +1,93 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.asdc.etsi.pkg.processor; + +import java.security.NoSuchAlgorithmException; +import java.util.concurrent.TimeUnit; +import javax.net.ssl.SSLContext; +import org.apache.http.client.config.RequestConfig; +import org.apache.http.impl.client.HttpClientBuilder; +import org.apache.http.impl.conn.PoolingHttpClientConnectionManager; +import org.onap.logging.filter.spring.SpringClientPayloadFilter; +import org.onap.so.configuration.rest.HttpClientConnectionConfiguration; +import org.onap.so.logging.jaxrs.filter.SOSpringClientFilter; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.beans.factory.annotation.Qualifier; +import org.springframework.context.annotation.Bean; +import org.springframework.context.annotation.Configuration; +import org.springframework.http.client.BufferingClientHttpRequestFactory; +import org.springframework.http.client.HttpComponentsClientHttpRequestFactory; +import org.springframework.web.client.RestTemplate; + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * + */ +@Configuration +public class SslBasedHttpClientConfiguration { + private final static Logger LOGGER = LoggerFactory.getLogger(EtsiResourcePackageProcessor.class); + + + public static final String SSL_BASED_CONFIGURABLE_REST_TEMPLATE = "sslBasedConfigurableRestTemplate"; + private final HttpClientConnectionConfiguration clientConnectionConfiguration; + + @Autowired + public SslBasedHttpClientConfiguration(final HttpClientConnectionConfiguration clientConnectionConfiguration) { + this.clientConnectionConfiguration = clientConnectionConfiguration; + } + + @Bean + @Qualifier(SSL_BASED_CONFIGURABLE_REST_TEMPLATE) + public RestTemplate sslBasedConfigurableRestTemplate() { + final RestTemplate restTemplate = + new RestTemplate(new BufferingClientHttpRequestFactory(httpComponentsClientHttpRequestFactory())); + restTemplate.getInterceptors().add(new SOSpringClientFilter()); + restTemplate.getInterceptors().add((new SpringClientPayloadFilter())); + return restTemplate; + } + + private HttpComponentsClientHttpRequestFactory httpComponentsClientHttpRequestFactory() { + try { + LOGGER.debug("Setting up HttpComponentsClientHttpRequestFactory with default SSL Context"); + return new HttpComponentsClientHttpRequestFactory(HttpClientBuilder.create() + .setConnectionManager(getConnectionManager()) + .setMaxConnPerRoute(clientConnectionConfiguration.getMaxConnectionsPerRoute()) + .setMaxConnTotal(clientConnectionConfiguration.getMaxConnections()) + .setDefaultRequestConfig(getRequestConfig()).setSSLContext(SSLContext.getDefault()).build()); + + } catch (final NoSuchAlgorithmException exception) { + LOGGER.error("Failed to create HttpComponentsClientHttpRequestFactory with default SSL Context", exception); + throw new RuntimeException(exception); + } + } + + private PoolingHttpClientConnectionManager getConnectionManager() { + return new PoolingHttpClientConnectionManager(clientConnectionConfiguration.getTimeToLiveInMins(), + TimeUnit.MINUTES); + } + + private RequestConfig getRequestConfig() { + return RequestConfig.custom().setSocketTimeout(clientConnectionConfiguration.getSocketTimeOutInMiliSeconds()) + .setConnectTimeout(clientConnectionConfiguration.getConnectionTimeOutInMilliSeconds()).build(); + } + +} diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/exceptions/EtsiCatalogManagerRequestFailureException.java b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/exceptions/EtsiCatalogManagerRequestFailureException.java new file mode 100644 index 0000000000..4f2e5039d7 --- /dev/null +++ b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/exceptions/EtsiCatalogManagerRequestFailureException.java @@ -0,0 +1,40 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.asdc.etsi.pkg.processor.exceptions; + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * + */ +public class EtsiCatalogManagerRequestFailureException extends RuntimeException { + + private static final long serialVersionUID = 1L; + + public EtsiCatalogManagerRequestFailureException(final String message) { + super(message); + } + + @Override + public synchronized Throwable fillInStackTrace() { + return this; + } + + +} diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/exceptions/SOL004ResourcePackageFailureException.java b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/exceptions/SOL004ResourcePackageFailureException.java new file mode 100644 index 0000000000..8e05a50f32 --- /dev/null +++ b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/exceptions/SOL004ResourcePackageFailureException.java @@ -0,0 +1,40 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.asdc.etsi.pkg.processor.exceptions; + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * + */ +public class SOL004ResourcePackageFailureException extends RuntimeException { + + private static final long serialVersionUID = 5834657185124807797L; + + public SOL004ResourcePackageFailureException(final String message) { + super(message); + + } + + @Override + public synchronized Throwable fillInStackTrace() { + return this; + } + +} diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/exceptions/SOL004ResourcePackageProcessingException.java b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/exceptions/SOL004ResourcePackageProcessingException.java new file mode 100644 index 0000000000..0e9f1ea9dc --- /dev/null +++ b/asdc-controller/src/main/java/org/onap/so/asdc/etsi/pkg/processor/exceptions/SOL004ResourcePackageProcessingException.java @@ -0,0 +1,34 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.asdc.etsi.pkg.processor.exceptions; + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * + */ +public class SOL004ResourcePackageProcessingException extends RuntimeException { + + private static final long serialVersionUID = 4860501744379116092L; + + public SOL004ResourcePackageProcessingException(final String message, final Throwable cause) { + super(message, cause); + + } +} diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/installer/heat/ToscaResourceInstaller.java b/asdc-controller/src/main/java/org/onap/so/asdc/installer/heat/ToscaResourceInstaller.java index 240bb83862..3175839725 100644 --- a/asdc-controller/src/main/java/org/onap/so/asdc/installer/heat/ToscaResourceInstaller.java +++ b/asdc-controller/src/main/java/org/onap/so/asdc/installer/heat/ToscaResourceInstaller.java @@ -39,7 +39,6 @@ import java.util.Set; import java.util.regex.Matcher; import java.util.regex.Pattern; import java.util.stream.Collectors; -import org.onap.so.logger.LoggingAnchor; import org.hibernate.exception.ConstraintViolationException; import org.hibernate.exception.LockAcquisitionException; import org.onap.sdc.api.notification.IArtifactInfo; @@ -55,6 +54,7 @@ import org.onap.sdc.tosca.parser.enums.EntityTemplateType; import org.onap.sdc.tosca.parser.enums.SdcTypes; import org.onap.sdc.tosca.parser.impl.SdcPropertyNames; import org.onap.sdc.toscaparser.api.CapabilityAssignment; +import org.onap.sdc.toscaparser.api.NodeTemplate; import org.onap.sdc.toscaparser.api.Property; import org.onap.sdc.toscaparser.api.RequirementAssignment; import org.onap.sdc.toscaparser.api.elements.Metadata; @@ -63,6 +63,7 @@ import org.onap.sdc.toscaparser.api.parameters.Input; import org.onap.sdc.utils.DistributionStatusEnum; import org.onap.so.asdc.client.ASDCConfiguration; import org.onap.so.asdc.client.exceptions.ArtifactInstallerException; +import org.onap.so.asdc.etsi.pkg.processor.EtsiResourcePackageProcessor; import org.onap.so.asdc.installer.ASDCElementInfo; import org.onap.so.asdc.installer.BigDecimalVersion; import org.onap.so.asdc.installer.IVfModuleData; @@ -74,65 +75,8 @@ import org.onap.so.asdc.installer.VfModuleStructure; import org.onap.so.asdc.installer.VfResourceStructure; import org.onap.so.asdc.installer.bpmn.WorkflowResource; import org.onap.so.asdc.util.YamlEditor; -import org.onap.so.db.catalog.beans.AllottedResource; -import org.onap.so.db.catalog.beans.AllottedResourceCustomization; -import org.onap.so.db.catalog.beans.CollectionNetworkResourceCustomization; -import org.onap.so.db.catalog.beans.CollectionResource; -import org.onap.so.db.catalog.beans.CollectionResourceInstanceGroupCustomization; -import org.onap.so.db.catalog.beans.ConfigurationResource; -import org.onap.so.db.catalog.beans.ConfigurationResourceCustomization; -import org.onap.so.db.catalog.beans.CvnfcConfigurationCustomization; -import org.onap.so.db.catalog.beans.CvnfcCustomization; -import org.onap.so.db.catalog.beans.HeatEnvironment; -import org.onap.so.db.catalog.beans.HeatFiles; -import org.onap.so.db.catalog.beans.HeatTemplate; -import org.onap.so.db.catalog.beans.HeatTemplateParam; -import org.onap.so.db.catalog.beans.InstanceGroup; -import org.onap.so.db.catalog.beans.InstanceGroupType; -import org.onap.so.db.catalog.beans.NetworkCollectionResourceCustomization; -import org.onap.so.db.catalog.beans.NetworkInstanceGroup; -import org.onap.so.db.catalog.beans.NetworkResource; -import org.onap.so.db.catalog.beans.NetworkResourceCustomization; -import org.onap.so.db.catalog.beans.PnfResource; -import org.onap.so.db.catalog.beans.PnfResourceCustomization; -import org.onap.so.db.catalog.beans.Service; -import org.onap.so.db.catalog.beans.ServiceProxyResourceCustomization; -import org.onap.so.db.catalog.beans.SubType; -import org.onap.so.db.catalog.beans.TempNetworkHeatTemplateLookup; -import org.onap.so.db.catalog.beans.ToscaCsar; -import org.onap.so.db.catalog.beans.VFCInstanceGroup; -import org.onap.so.db.catalog.beans.VfModule; -import org.onap.so.db.catalog.beans.VfModuleCustomization; -import org.onap.so.db.catalog.beans.VnfResource; -import org.onap.so.db.catalog.beans.VnfResourceCustomization; -import org.onap.so.db.catalog.beans.VnfcCustomization; -import org.onap.so.db.catalog.beans.VnfcInstanceGroupCustomization; -import org.onap.so.db.catalog.data.repository.AllottedResourceCustomizationRepository; -import org.onap.so.db.catalog.data.repository.AllottedResourceRepository; -import org.onap.so.db.catalog.data.repository.CollectionResourceCustomizationRepository; -import org.onap.so.db.catalog.data.repository.CollectionResourceRepository; -import org.onap.so.db.catalog.data.repository.ConfigurationResourceCustomizationRepository; -import org.onap.so.db.catalog.data.repository.ConfigurationResourceRepository; -import org.onap.so.db.catalog.data.repository.CvnfcConfigurationCustomizationRepository; -import org.onap.so.db.catalog.data.repository.CvnfcCustomizationRepository; -import org.onap.so.db.catalog.data.repository.ExternalServiceToInternalServiceRepository; -import org.onap.so.db.catalog.data.repository.HeatEnvironmentRepository; -import org.onap.so.db.catalog.data.repository.HeatFilesRepository; -import org.onap.so.db.catalog.data.repository.HeatTemplateRepository; -import org.onap.so.db.catalog.data.repository.InstanceGroupRepository; -import org.onap.so.db.catalog.data.repository.NetworkResourceCustomizationRepository; -import org.onap.so.db.catalog.data.repository.NetworkResourceRepository; -import org.onap.so.db.catalog.data.repository.PnfCustomizationRepository; -import org.onap.so.db.catalog.data.repository.PnfResourceRepository; -import org.onap.so.db.catalog.data.repository.ServiceProxyResourceCustomizationRepository; -import org.onap.so.db.catalog.data.repository.ServiceRepository; -import org.onap.so.db.catalog.data.repository.TempNetworkHeatTemplateRepository; -import org.onap.so.db.catalog.data.repository.ToscaCsarRepository; -import org.onap.so.db.catalog.data.repository.VFModuleCustomizationRepository; -import org.onap.so.db.catalog.data.repository.VFModuleRepository; -import org.onap.so.db.catalog.data.repository.VnfResourceRepository; -import org.onap.so.db.catalog.data.repository.VnfcCustomizationRepository; -import org.onap.so.db.catalog.data.repository.VnfcInstanceGroupCustomizationRepository; +import org.onap.so.db.catalog.beans.*; +import org.onap.so.db.catalog.data.repository.*; import org.onap.so.db.request.beans.WatchdogComponentDistributionStatus; import org.onap.so.db.request.beans.WatchdogDistributionStatus; import org.onap.so.db.request.beans.WatchdogServiceModVerIdLookup; @@ -140,6 +84,7 @@ import org.onap.so.db.request.data.repository.WatchdogComponentDistributionStatu import org.onap.so.db.request.data.repository.WatchdogDistributionStatusRepository; import org.onap.so.db.request.data.repository.WatchdogServiceModVerIdLookupRepository; import org.onap.so.logger.ErrorCode; +import org.onap.so.logger.LoggingAnchor; import org.onap.so.logger.MessageEnum; import org.slf4j.Logger; import org.slf4j.LoggerFactory; @@ -147,9 +92,9 @@ import org.springframework.beans.factory.annotation.Autowired; import org.springframework.orm.ObjectOptimisticLockingFailureException; import org.springframework.stereotype.Component; import org.springframework.transaction.annotation.Transactional; +import org.springframework.util.CollectionUtils; import com.fasterxml.jackson.core.JsonProcessingException; import com.fasterxml.jackson.databind.ObjectMapper; -import org.springframework.util.CollectionUtils; @Component public class ToscaResourceInstaller { @@ -271,8 +216,14 @@ public class ToscaResourceInstaller { protected PnfCustomizationRepository pnfCustomizationRepository; @Autowired + protected ServiceInfoRepository serviceInfoRepository; + + @Autowired protected WorkflowResource workflowResource; + @Autowired + protected EtsiResourcePackageProcessor etsiResourcePackageProcessor; + protected static final Logger logger = LoggerFactory.getLogger(ToscaResourceInstaller.class); public boolean isCsarAlreadyDeployed(ToscaResourceStructure toscaResourceStructure) @@ -442,6 +393,7 @@ public class ToscaResourceInstaller { createToscaCsar(toscaResourceStruct); createService(toscaResourceStruct, vfResourceStruct); Service service = toscaResourceStruct.getCatalogService(); + ServiceInfo serviceInfo = createServiceInfo(toscaResourceStruct, service); List<IEntityDetails> vfEntityList = getEntityDetails(toscaResourceStruct, EntityQuery.newBuilder(SdcTypes.VF), TopologyTemplateQuery.newBuilder(SdcTypes.SERVICE), false); @@ -456,6 +408,8 @@ public class ToscaResourceInstaller { if (ALLOTTED_RESOURCE.equalsIgnoreCase(category)) { arEntityDetails.add(vfEntityDetails); } + final String vnfUuid = metadata.getValue(SdcPropertyNames.PROPERTY_NAME_UUID); + etsiResourcePackageProcessor.processPackageIfExists(vnfUuid); processVfModules(vfEntityDetails, toscaResourceStruct, vfResourceStructure, service, metadata); } @@ -469,8 +423,9 @@ public class ToscaResourceInstaller { processServiceProxyAndConfiguration(toscaResourceStruct, service); logger.info("Saving Service: {} ", service.getModelName()); - service = serviceRepo.save(service); - correlateConfigCustomResources(service); + ServiceInfo serviceResult = serviceInfoRepository.save(serviceInfo); + Service resultService = serviceResult.getService(); + correlateConfigCustomResources(resultService); workflowResource.processWorkflows(vfResourceStructure); @@ -2907,5 +2862,122 @@ public class ToscaResourceInstaller { return new Timestamp(new Date().getTime()); } + private String getServiceInput(ToscaResourceStructure toscaResourceStructure) { + String serviceInput = null; + + List<Object> serviceInputList; + ISdcCsarHelper sdcCsarHelper = toscaResourceStructure.getSdcCsarHelper(); + List<Input> serviceInputs = sdcCsarHelper.getServiceInputs(); + if (!serviceInputs.isEmpty()) { + serviceInputList = new ArrayList<>(); + serviceInputs.forEach(input -> { + Map<String, Object> serviceInputMap = new HashMap<>(); + serviceInputMap.put("name", input.getName()); + serviceInputMap.put("type", input.getType()); + serviceInputMap.put("default", input.getDefault() == null ? "" : input.getDefault()); + serviceInputMap.put("required", input.isRequired()); + serviceInputList.add(serviceInputMap); + + }); + ObjectMapper objectMapper = new ObjectMapper(); + try { + serviceInput = objectMapper.writeValueAsString(serviceInputList); + serviceInput = serviceInput.replace("\"", "\\\""); + } catch (JsonProcessingException e) { + logger.error("service input could not be deserialized for service uuid: " + + sdcCsarHelper.getServiceMetadata().getValue(SdcPropertyNames.PROPERTY_NAME_UUID)); + } + } else { + logger.debug("serviceInput is null"); + } + return serviceInput; + } + + @Transactional(rollbackFor = {ArtifactInstallerException.class}) + public void installTheNsstService(ToscaResourceStructure toscaResourceStruct, VfResourceStructure vfResourceStruct, + String artifactContent) { + createToscaCsar(toscaResourceStruct); + createService(toscaResourceStruct, vfResourceStruct); + Service service = toscaResourceStruct.getCatalogService(); + ServiceInfo serviceInfo = createServiceInfo(toscaResourceStruct, service); + createServiceArtifact(service, vfResourceStruct, artifactContent); + serviceInfoRepository.save(serviceInfo); + } + + private void createServiceArtifact(Service service, VfResourceStructure vfResourceStruct, String artifactContent) { + List<ServiceArtifact> serviceArtifactList = new ArrayList<>(); + ServiceArtifact serviceArtifact; + List<IArtifactInfo> artifactInfoList = vfResourceStruct.getNotification().getServiceArtifacts().stream() + .filter(artifact -> artifact.getArtifactType().equalsIgnoreCase("OTHER")).collect(Collectors.toList()); + for (IArtifactInfo artifactInfo : artifactInfoList) { + serviceArtifact = new ServiceArtifact(); + serviceArtifact.setArtifactUUID(artifactInfo.getArtifactUUID()); + serviceArtifact.setName(artifactInfo.getArtifactName()); + serviceArtifact.setType(artifactInfo.getArtifactType()); + serviceArtifact.setVersion(artifactInfo.getArtifactVersion()); + serviceArtifact.setDescription(artifactInfo.getArtifactDescription()); + serviceArtifact.setChecksum(artifactInfo.getArtifactChecksum()); + serviceArtifact.setContent(artifactContent); + serviceArtifact.setService(service); + serviceArtifactList.add(serviceArtifact); + } + service.setServiceArtifactList(serviceArtifactList); + } + + private ServiceInfo createServiceInfo(ToscaResourceStructure toscaResourceStruct, Service service) { + ServiceInfo serviceInfo = new ServiceInfo(); + String serviceInput = getServiceInput(toscaResourceStruct); + serviceInfo.setServiceInput(serviceInput); + + String serviceProperties = getServiceProperties(toscaResourceStruct); + serviceInfo.setServiceProperties(serviceProperties); + + serviceInfo.setService(service); + return serviceInfo; + } + + private String getServiceProperties(ToscaResourceStructure toscaResourceStruct) { + String propertiesJson = null; + ObjectMapper objectMapper = new ObjectMapper(); + ISdcCsarHelper helper = toscaResourceStruct.getSdcCsarHelper(); + String typeName = helper.getServiceSubstitutionMappingsTypeName(); + Optional<NodeTemplate> nodeTemplate = helper.getServiceNodeTemplates().stream().findAny(); + List<Object> serviceProperties = new ArrayList<>(); + Map<String, Object> servicePropertiesMap; + if (nodeTemplate.isPresent()) { + LinkedHashMap<String, Object> customDef = nodeTemplate.get().getCustomDef(); + Optional<String> machKey = + customDef.keySet().stream().filter(key -> key.equalsIgnoreCase(typeName)).findFirst(); + if (machKey.isPresent()) { + Object obj = customDef.get(machKey.get()); + try { + if (obj instanceof Map) { + Object properties = ((HashMap) obj).get("properties"); + if (null != properties) { + for (Object propertyName : ((Map) properties).keySet()) { + servicePropertiesMap = new HashMap<>(); + servicePropertiesMap.put("name", propertyName); + Object object = ((Map) properties).get(propertyName); + for (Object entry : ((Map) object).entrySet()) { + servicePropertiesMap.put((String) ((Map.Entry) entry).getKey(), + ((Map.Entry) entry).getValue()); + } + servicePropertiesMap.remove("description"); + serviceProperties.add(servicePropertiesMap); + } + propertiesJson = objectMapper.writeValueAsString(serviceProperties); + propertiesJson = propertiesJson.replace("\"", "\\\""); + } + } + } catch (JsonProcessingException e) { + logger.error("serviceProperties could not be deserialized for service uuid: " + + nodeTemplate.get().getMetaData().getValue(SdcPropertyNames.PROPERTY_NAME_UUID)); + } + } + } else { + logger.debug("ServiceNodeTemplates is null"); + } + return propertiesJson; + } } diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/util/ZipParser.java b/asdc-controller/src/main/java/org/onap/so/asdc/util/ZipParser.java new file mode 100644 index 0000000000..c2f04dca7b --- /dev/null +++ b/asdc-controller/src/main/java/org/onap/so/asdc/util/ZipParser.java @@ -0,0 +1,67 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (c) 2019, CMCC Technologies Co., Ltd. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.asdc.util; + +import java.io.*; +import java.nio.charset.Charset; +import java.util.zip.ZipEntry; +import java.util.zip.ZipFile; +import java.util.zip.ZipInputStream; + +public class ZipParser { + + private static volatile ZipParser instance; + + public static ZipParser getInstance() { + if (instance == null) { + synchronized (ZipParser.class) { + if (instance == null) { + instance = new ZipParser(); + } + } + } + return instance; + } + + public String parseJsonForZip(String path) throws IOException { + ZipFile zf = new ZipFile(path); + InputStream in = new BufferedInputStream(new FileInputStream(path)); + Charset cs = Charset.forName("utf-8"); + ZipInputStream zin = new ZipInputStream(in, cs); + ZipEntry ze; + String artifactContent = null; + while ((ze = zin.getNextEntry()) != null) { + if (ze.toString().endsWith("json")) { + StringBuilder jsonStr = new StringBuilder(); + BufferedReader br = new BufferedReader(new InputStreamReader(zf.getInputStream(ze))); + String line; + while ((line = br.readLine()) != null) { + jsonStr.append(line); + } + br.close(); + artifactContent = jsonStr.toString().replace("\"", "\\\"").replaceAll("\\s", ""); + } + } + zin.closeEntry(); + return artifactContent; + } + +} diff --git a/asdc-controller/src/main/resources/resource-examples/resource_Extvl.csar b/asdc-controller/src/main/resources/resource-examples/resource_Extvl.csar Binary files differindex bd35b0ab60..20ce62b8de 100644 --- a/asdc-controller/src/main/resources/resource-examples/resource_Extvl.csar +++ b/asdc-controller/src/main/resources/resource-examples/resource_Extvl.csar diff --git a/asdc-controller/src/main/resources/resource-examples/service-ServiceFdnt-csar-0904-2.csar b/asdc-controller/src/main/resources/resource-examples/service-ServiceFdnt-csar-0904-2.csar Binary files differindex 29d30f8023..dd0115b716 100644 --- a/asdc-controller/src/main/resources/resource-examples/service-ServiceFdnt-csar-0904-2.csar +++ b/asdc-controller/src/main/resources/resource-examples/service-ServiceFdnt-csar-0904-2.csar diff --git a/asdc-controller/src/test/java/org/onap/so/asdc/TestApplication.java b/asdc-controller/src/test/java/org/onap/so/asdc/TestApplication.java index e25de9c3d4..1a2e385121 100644 --- a/asdc-controller/src/test/java/org/onap/so/asdc/TestApplication.java +++ b/asdc-controller/src/test/java/org/onap/so/asdc/TestApplication.java @@ -31,12 +31,14 @@ import org.springframework.context.annotation.Profile; @SpringBootApplication @Profile("test") -@ComponentScan(basePackages = {"org.onap.so.asdc", "org.onap.so.security"}, +@ComponentScan( + basePackages = {"org.onap.so.asdc", "org.onap.so.security", "org.onap.so.rest.service", + "org.onap.so.configuration.rest", "org.onap.so.client"}, excludeFilters = {@Filter(type = FilterType.ANNOTATION, classes = SpringBootApplication.class), @Filter(type = FilterType.ASSIGNABLE_TYPE, classes = RequestsDBHelper.class), @Filter(type = FilterType.ASSIGNABLE_TYPE, classes = InfraActiveRequestsRepositoryImpl.class)}) public class TestApplication { - public static void main(String... args) { + public static void main(final String... args) { SpringApplication.run(TestApplication.class, args); System.getProperties().setProperty("mso.db", "MARIADB"); System.getProperties().setProperty("server.name", "Springboot"); diff --git a/asdc-controller/src/test/java/org/onap/so/asdc/client/SdcNotificationWithSol004PackageTest.java b/asdc-controller/src/test/java/org/onap/so/asdc/client/SdcNotificationWithSol004PackageTest.java new file mode 100644 index 0000000000..cb5bd0f51a --- /dev/null +++ b/asdc-controller/src/test/java/org/onap/so/asdc/client/SdcNotificationWithSol004PackageTest.java @@ -0,0 +1,358 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Ericsson. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.asdc.client; + +import static com.github.tomakehurst.wiremock.client.WireMock.aResponse; +import static com.github.tomakehurst.wiremock.client.WireMock.equalTo; +import static com.github.tomakehurst.wiremock.client.WireMock.equalToJson; +import static com.github.tomakehurst.wiremock.client.WireMock.get; +import static com.github.tomakehurst.wiremock.client.WireMock.getRequestedFor; +import static com.github.tomakehurst.wiremock.client.WireMock.ok; +import static com.github.tomakehurst.wiremock.client.WireMock.okJson; +import static com.github.tomakehurst.wiremock.client.WireMock.post; +import static com.github.tomakehurst.wiremock.client.WireMock.postRequestedFor; +import static com.github.tomakehurst.wiremock.client.WireMock.urlEqualTo; +import static com.github.tomakehurst.wiremock.client.WireMock.verify; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.assertNotNull; +import static org.junit.Assert.fail; +import static org.onap.sdc.utils.DistributionStatusEnum.COMPONENT_DONE_ERROR; +import static org.onap.sdc.utils.DistributionStatusEnum.COMPONENT_DONE_OK; +import static org.springframework.http.HttpHeaders.ACCEPT; +import static org.springframework.http.MediaType.APPLICATION_OCTET_STREAM_VALUE; +import java.io.File; +import java.io.IOException; +import java.nio.file.Files; +import java.nio.file.Path; +import java.nio.file.Paths; +import java.util.List; +import org.junit.After; +import org.junit.Before; +import org.junit.Test; +import org.onap.so.asdc.BaseTest; +import org.onap.so.asdc.client.exceptions.ASDCControllerException; +import org.onap.so.asdc.client.test.emulators.DistributionClientEmulator; +import org.onap.so.asdc.client.test.emulators.NotificationDataImpl; +import org.onap.so.db.catalog.data.repository.ServiceRepository; +import org.onap.so.db.request.beans.WatchdogComponentDistributionStatus; +import org.onap.so.db.request.beans.WatchdogComponentDistributionStatusId; +import org.onap.so.db.request.data.repository.WatchdogComponentDistributionStatusRepository; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.http.HttpStatus; +import com.google.gson.GsonBuilder; + +/** + * @author Waqas Ikram (waqas.ikram@est.tech) + * + */ +public class SdcNotificationWithSol004PackageTest extends BaseTest { + + private final static Logger LOGGER = LoggerFactory.getLogger(SdcNotificationWithSol004PackageTest.class); + private static final String ETSI_CATALOG_PACKAGE_ONBOARDING_URL = "/api/catalog/v1/vnfpackages"; + private static final String COMPONENT_NAME = "SO"; + private static final String CSAR_ID = "8f0b72e1-b6d6-42b6-a808-c60b17f04d7a"; + private static final String SDC_GET_RESOURCE_URL = "/sdc/v1/catalog/resources/" + CSAR_ID + "/toscaModel"; + private static final String ETSI_CATALOG_PACKAGE_ONBOARDING_REQUEST = "{\"csarId\": \"" + CSAR_ID + "\"}"; + private static final String DISTRIBUTION_ID = "35f20eb9-238a-4cc2-96dc-0a08f71bc209"; + private static final String VGW_RESOURCE_PATH = "src/test/resources/resource-examples/vgw"; + private static final String SERVICE_UUID = "e051ff77-fb79-451c-8457-1cbf94e4db8f"; + private static final String SERVICE_INVARIANT_UUID = "c2ce924f-0aa1-4777-9b42-c0fec006a883"; + private static final String JOB_ID = "57c13120-0a03-4d2e-837a-7c41d61e4a30"; + private static final String ETSI_CATALOG_PACKAGE_ONBOARDING_JOB_STATUS_URL = "/api/catalog/v1/jobs/" + JOB_ID; + private static final String ETSI_CATALOG_PACKAGE_ONBOARDING_JOB_RESPONSE = "{\"jobId\": \"" + JOB_ID + "\"}"; + + @Autowired + private ASDCController asdcController; + + private DistributionClientEmulator distributionClient; + + @Autowired + private WatchdogComponentDistributionStatusRepository watchdogComponentDistributionStatusRepository; + + @Autowired + protected ServiceRepository serviceRepository; + + @Before + public void setUp() { + distributionClient = new DistributionClientEmulator(); + distributionClient.setResourcePath(getAbsolutePath(VGW_RESOURCE_PATH)); + asdcController.setDistributionClient(distributionClient); + try { + asdcController.initASDC(); + } catch (final ASDCControllerException controllerException) { + LOGGER.error(controllerException.getMessage(), controllerException); + fail(controllerException.getMessage()); + } + } + + @After + public void shutDown() { + try { + if (serviceRepository.existsById(SERVICE_UUID)) { + LOGGER.debug("Deleting existing service using {} ", SERVICE_UUID); + serviceRepository.deleteById(SERVICE_UUID); + } + + final WatchdogComponentDistributionStatusId distributionId = new WatchdogComponentDistributionStatusId(); + distributionId.setDistributionId(DISTRIBUTION_ID); + distributionId.setComponentName(COMPONENT_NAME); + if (watchdogComponentDistributionStatusRepository.existsById(distributionId)) { + LOGGER.debug("Deleting existing WatchdogComponentDistributionStatus using {} ", distributionId); + watchdogComponentDistributionStatusRepository.deleteById(distributionId); + } + asdcController.closeASDC(); + } catch (final ASDCControllerException asdcControllerException) { + LOGGER.error(asdcControllerException.getMessage(), asdcControllerException); + fail(asdcControllerException.getMessage()); + } + } + + @Test + public void testTreatNotification_vgwServiceContainingSol004Package_successfullyOnboard() throws IOException { + initMockAaiServer(SERVICE_UUID, SERVICE_INVARIANT_UUID); + + wireMockServer.stubFor(get(SDC_GET_RESOURCE_URL) + .willReturn(aResponse().withBody(getFileContent( + Paths.get(getAbsolutePath(VGW_RESOURCE_PATH), "SDC_RESOURCE_CSAR", "vgw_sdc_resource.csar")))) + .withHeader(ACCEPT, equalTo(APPLICATION_OCTET_STREAM_VALUE))); + + wireMockServer.stubFor(post(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_URL)) + .willReturn(okJson(ETSI_CATALOG_PACKAGE_ONBOARDING_JOB_RESPONSE))); + + wireMockServer.stubFor(get(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_JOB_STATUS_URL)) + .willReturn(okJson(new String(getFileContent(Paths.get(getAbsolutePath(VGW_RESOURCE_PATH), + "etsi-catalog-package-onboading-job-status-successful.json")))))); + + asdcController.treatNotification(getNotificationDataImplObject()); + + final List<WatchdogComponentDistributionStatus> distributionList = + watchdogComponentDistributionStatusRepository.findByDistributionId(DISTRIBUTION_ID); + assertNotNull(distributionList); + assertEquals(1, distributionList.size()); + final WatchdogComponentDistributionStatus distributionStatus = distributionList.get(0); + assertEquals(COMPONENT_DONE_OK.toString(), distributionStatus.getComponentDistributionStatus()); + assertEquals(COMPONENT_NAME, distributionStatus.getComponentName()); + + verify(postRequestedFor(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_URL)) + .withRequestBody(equalToJson(ETSI_CATALOG_PACKAGE_ONBOARDING_REQUEST))); + + verify(getRequestedFor(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_JOB_STATUS_URL))); + } + + @Test + public void testTreatNotification_vgwServiceUnableToGeSdcResource_successfullyOnboard() throws IOException { + initMockAaiServer(SERVICE_UUID, SERVICE_INVARIANT_UUID); + + wireMockServer + .stubFor(get(SDC_GET_RESOURCE_URL).willReturn(aResponse().withStatus(HttpStatus.NOT_FOUND.value())) + .withHeader(ACCEPT, equalTo(APPLICATION_OCTET_STREAM_VALUE))); + + asdcController.treatNotification(getNotificationDataImplObject()); + + final List<WatchdogComponentDistributionStatus> distributionList = + watchdogComponentDistributionStatusRepository.findByDistributionId(DISTRIBUTION_ID); + assertNotNull(distributionList); + assertEquals(1, distributionList.size()); + final WatchdogComponentDistributionStatus distributionStatus = distributionList.get(0); + assertEquals(COMPONENT_DONE_OK.toString(), distributionStatus.getComponentDistributionStatus()); + assertEquals(COMPONENT_NAME, distributionStatus.getComponentName()); + } + + @Test + public void testTreatNotification_vgwServiceContainingNonEtsiSdcResource_successfullyOnboard() throws IOException { + + initMockAaiServer(SERVICE_UUID, SERVICE_INVARIANT_UUID); + + wireMockServer.stubFor(get(SDC_GET_RESOURCE_URL) + .willReturn(aResponse().withBody(getFileContent( + Paths.get(getAbsolutePath(VGW_RESOURCE_PATH), "service-Vgwservicev1-csar.csar")))) + .withHeader(ACCEPT, equalTo(APPLICATION_OCTET_STREAM_VALUE))); + + asdcController.treatNotification(getNotificationDataImplObject()); + + final List<WatchdogComponentDistributionStatus> distributionList = + watchdogComponentDistributionStatusRepository.findByDistributionId(DISTRIBUTION_ID); + assertNotNull(distributionList); + assertEquals(1, distributionList.size()); + final WatchdogComponentDistributionStatus distributionStatus = distributionList.get(0); + assertEquals(COMPONENT_DONE_OK.toString(), distributionStatus.getComponentDistributionStatus()); + assertEquals(COMPONENT_NAME, distributionStatus.getComponentName()); + + } + + @Test + public void testTreatNotification_vgwServiceContainingSol004Package_onnboardRequestToEtsiCatalogReturnsBadGatway_distributionStatusError() + throws IOException { + initMockAaiServer(SERVICE_UUID, SERVICE_INVARIANT_UUID); + + wireMockServer.stubFor(get(SDC_GET_RESOURCE_URL) + .willReturn(aResponse().withBody(getFileContent( + Paths.get(getAbsolutePath(VGW_RESOURCE_PATH), "SDC_RESOURCE_CSAR", "vgw_sdc_resource.csar")))) + .withHeader(ACCEPT, equalTo(APPLICATION_OCTET_STREAM_VALUE))); + + wireMockServer.stubFor(post(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_URL)) + .willReturn(aResponse().withStatus(HttpStatus.BAD_GATEWAY.value()))); + + asdcController.treatNotification(getNotificationDataImplObject()); + + final List<WatchdogComponentDistributionStatus> distributionList = + watchdogComponentDistributionStatusRepository.findByDistributionId(DISTRIBUTION_ID); + assertNotNull(distributionList); + assertEquals(1, distributionList.size()); + final WatchdogComponentDistributionStatus distributionStatus = distributionList.get(0); + assertEquals(COMPONENT_DONE_ERROR.toString(), distributionStatus.getComponentDistributionStatus()); + assertEquals(COMPONENT_NAME, distributionStatus.getComponentName()); + + verify(postRequestedFor(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_URL)) + .withRequestBody(equalToJson(ETSI_CATALOG_PACKAGE_ONBOARDING_REQUEST))); + + } + + @Test + public void testTreatNotification_vgwServiceContainingSol004Package_getJobStatusReturnsBadGatway_distributionStatusError() + throws IOException { + initMockAaiServer(SERVICE_UUID, SERVICE_INVARIANT_UUID); + + wireMockServer.stubFor(get(SDC_GET_RESOURCE_URL) + .willReturn(aResponse().withBody(getFileContent( + Paths.get(getAbsolutePath(VGW_RESOURCE_PATH), "SDC_RESOURCE_CSAR", "vgw_sdc_resource.csar")))) + .withHeader(ACCEPT, equalTo(APPLICATION_OCTET_STREAM_VALUE))); + + wireMockServer.stubFor(post(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_URL)) + .willReturn(okJson(ETSI_CATALOG_PACKAGE_ONBOARDING_JOB_RESPONSE))); + + wireMockServer.stubFor(get(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_JOB_STATUS_URL)) + .willReturn(aResponse().withStatus(HttpStatus.BAD_GATEWAY.value()))); + + asdcController.treatNotification(getNotificationDataImplObject()); + + final List<WatchdogComponentDistributionStatus> distributionList = + watchdogComponentDistributionStatusRepository.findByDistributionId(DISTRIBUTION_ID); + assertNotNull(distributionList); + assertEquals(1, distributionList.size()); + final WatchdogComponentDistributionStatus distributionStatus = distributionList.get(0); + assertEquals(COMPONENT_DONE_ERROR.toString(), distributionStatus.getComponentDistributionStatus()); + assertEquals(COMPONENT_NAME, distributionStatus.getComponentName()); + + verify(postRequestedFor(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_URL)) + .withRequestBody(equalToJson(ETSI_CATALOG_PACKAGE_ONBOARDING_REQUEST))); + + verify(getRequestedFor(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_JOB_STATUS_URL))); + + } + + @Test + public void testTreatNotification_vgwServiceContainingSol004Package_getJobStatusBodyWithStatusError_distributionStatusError() + throws IOException { + + initMockAaiServer(SERVICE_UUID, SERVICE_INVARIANT_UUID); + + wireMockServer.stubFor(get(SDC_GET_RESOURCE_URL) + .willReturn(aResponse().withBody(getFileContent( + Paths.get(getAbsolutePath(VGW_RESOURCE_PATH), "SDC_RESOURCE_CSAR", "vgw_sdc_resource.csar")))) + .withHeader(ACCEPT, equalTo(APPLICATION_OCTET_STREAM_VALUE))); + + wireMockServer.stubFor(post(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_URL)) + .willReturn(okJson(ETSI_CATALOG_PACKAGE_ONBOARDING_JOB_RESPONSE))); + + wireMockServer.stubFor(get(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_JOB_STATUS_URL)) + .willReturn(okJson(new String(getFileContent(Paths.get(getAbsolutePath(VGW_RESOURCE_PATH), + "etsi-catalog-package-onboading-job-status-error.json")))))); + + asdcController.treatNotification(getNotificationDataImplObject()); + + final List<WatchdogComponentDistributionStatus> distributionList = + watchdogComponentDistributionStatusRepository.findByDistributionId(DISTRIBUTION_ID); + assertNotNull(distributionList); + assertEquals(1, distributionList.size()); + final WatchdogComponentDistributionStatus distributionStatus = distributionList.get(0); + assertEquals(COMPONENT_DONE_ERROR.toString(), distributionStatus.getComponentDistributionStatus()); + assertEquals(COMPONENT_NAME, distributionStatus.getComponentName()); + + verify(postRequestedFor(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_URL)) + .withRequestBody(equalToJson(ETSI_CATALOG_PACKAGE_ONBOARDING_REQUEST))); + + verify(getRequestedFor(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_JOB_STATUS_URL))); + + + } + + @Test + public void testTreatNotification_vgwServiceContainingSol004PackageAndPackageAlreadyExistsInEtsiCatalog_successfullyOnboard() + throws IOException { + initMockAaiServer(SERVICE_UUID, SERVICE_INVARIANT_UUID); + + wireMockServer.stubFor(get(SDC_GET_RESOURCE_URL) + .willReturn(aResponse().withBody(getFileContent( + Paths.get(getAbsolutePath(VGW_RESOURCE_PATH), "SDC_RESOURCE_CSAR", "vgw_sdc_resource.csar")))) + .withHeader(ACCEPT, equalTo(APPLICATION_OCTET_STREAM_VALUE))); + + wireMockServer.stubFor(post(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_URL)) + .willReturn(okJson(ETSI_CATALOG_PACKAGE_ONBOARDING_JOB_RESPONSE))); + + wireMockServer.stubFor(get(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_JOB_STATUS_URL)) + .willReturn(okJson(new String(getFileContent(Paths.get(getAbsolutePath(VGW_RESOURCE_PATH), + "etsi-catalog-package-onboading-job-status-error-package-exists.json")))))); + + asdcController.treatNotification(getNotificationDataImplObject()); + + final List<WatchdogComponentDistributionStatus> distributionList = + watchdogComponentDistributionStatusRepository.findByDistributionId(DISTRIBUTION_ID); + assertNotNull(distributionList); + assertEquals(1, distributionList.size()); + final WatchdogComponentDistributionStatus distributionStatus = distributionList.get(0); + assertEquals(COMPONENT_DONE_OK.toString(), distributionStatus.getComponentDistributionStatus()); + assertEquals(COMPONENT_NAME, distributionStatus.getComponentName()); + + verify(postRequestedFor(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_URL)) + .withRequestBody(equalToJson(ETSI_CATALOG_PACKAGE_ONBOARDING_REQUEST))); + + verify(getRequestedFor(urlEqualTo(ETSI_CATALOG_PACKAGE_ONBOARDING_JOB_STATUS_URL))); + } + + + private byte[] getFileContent(final Path path) throws IOException { + return Files.readAllBytes(path); + } + + private NotificationDataImpl getNotificationDataImplObject() throws IOException { + final Path filePath = Paths.get(getAbsolutePath(VGW_RESOURCE_PATH), "dmaap-notification-message.json"); + final byte[] bytes = Files.readAllBytes(filePath); + + return new GsonBuilder().setPrettyPrinting().create().fromJson(new String(bytes), NotificationDataImpl.class); + } + + /** + * Mock the AAI using wireshark. + */ + private void initMockAaiServer(final String serviceUuid, final String serviceInvariantUuid) { + final String modelEndpoint = "/aai/v19/service-design-and-creation/models/model/" + serviceInvariantUuid + + "/model-vers/model-ver/" + serviceUuid + "?depth=0"; + + wireMockServer.stubFor(post(urlEqualTo(modelEndpoint)).willReturn(ok())); + } + + private String getAbsolutePath(final String path) { + final File file = new File(path); + return file.getAbsolutePath(); + } +} diff --git a/asdc-controller/src/test/java/org/onap/so/asdc/installer/heat/ToscaResourceInstallerTest.java b/asdc-controller/src/test/java/org/onap/so/asdc/installer/heat/ToscaResourceInstallerTest.java index c25c4c2828..b8a2d01b49 100644 --- a/asdc-controller/src/test/java/org/onap/so/asdc/installer/heat/ToscaResourceInstallerTest.java +++ b/asdc-controller/src/test/java/org/onap/so/asdc/installer/heat/ToscaResourceInstallerTest.java @@ -75,19 +75,8 @@ import org.onap.so.asdc.installer.ToscaResourceStructure; import org.onap.so.asdc.installer.VfModuleStructure; import org.onap.so.asdc.installer.VfResourceStructure; import org.onap.so.asdc.installer.bpmn.WorkflowResource; -import org.onap.so.db.catalog.beans.ConfigurationResource; -import org.onap.so.db.catalog.beans.ConfigurationResourceCustomization; -import org.onap.so.db.catalog.beans.Service; -import org.onap.so.db.catalog.beans.ServiceProxyResourceCustomization; -import org.onap.so.db.catalog.beans.ToscaCsar; -import org.onap.so.db.catalog.beans.VnfcInstanceGroupCustomization; -import org.onap.so.db.catalog.data.repository.ConfigurationResourceCustomizationRepository; -import org.onap.so.db.catalog.data.repository.InstanceGroupRepository; -import org.onap.so.db.catalog.data.repository.ServiceRepository; -import org.onap.so.db.catalog.data.repository.ToscaCsarRepository; -import org.onap.so.db.catalog.data.repository.VFModuleRepository; -import org.onap.so.db.catalog.data.repository.VnfResourceRepository; -import org.onap.so.db.catalog.data.repository.VnfcInstanceGroupCustomizationRepository; +import org.onap.so.db.catalog.beans.*; +import org.onap.so.db.catalog.data.repository.*; import org.onap.so.db.request.beans.WatchdogComponentDistributionStatus; import org.onap.so.db.request.data.repository.WatchdogComponentDistributionStatusRepository; import org.springframework.beans.factory.annotation.Autowired; @@ -325,8 +314,6 @@ public class ToscaResourceInstallerTest extends BaseTest { notificationData.setServiceUUID("serviceUUID1"); notificationData.setWorkloadContext("workloadContext1"); - - String serviceType = "test-type1"; String serviceRole = "test-role1"; String category = "Network L3+"; @@ -356,6 +343,7 @@ public class ToscaResourceInstallerTest extends BaseTest { doReturn(resourceCustomizationUUID).when(metadata).getValue("vfModuleModelCustomizationUUID"); ServiceRepository serviceRepo = spy(ServiceRepository.class); + ServiceInfoRepository serviceInfoRepo = spy(ServiceInfoRepository.class); VnfResourceRepository vnfRepo = spy(VnfResourceRepository.class); doReturn(null).when(vnfRepo).findResourceByModelUUID(uuid); @@ -366,6 +354,7 @@ public class ToscaResourceInstallerTest extends BaseTest { WorkflowResource workflowResource = spy(WorkflowResource.class); ReflectionTestUtils.setField(toscaInstaller, "serviceRepo", serviceRepo); + ReflectionTestUtils.setField(toscaInstaller, "serviceInfoRepository", serviceInfoRepo); ReflectionTestUtils.setField(toscaInstaller, "vnfRepo", vnfRepo); ReflectionTestUtils.setField(toscaInstaller, "vfModuleRepo", vfModuleRepo); ReflectionTestUtils.setField(toscaInstaller, "instanceGroupRepo", instanceGroupRepo); @@ -436,7 +425,10 @@ public class ToscaResourceInstallerTest extends BaseTest { assertNotNull(service); service.setModelVersion("1.0"); + ServiceInfo serviceInfo = new ServiceInfo(); + serviceInfo.setService(service); doReturn(service).when(serviceRepo).save(service); + doReturn(serviceInfo).when(serviceInfoRepo).save(any(ServiceInfo.class)); WatchdogComponentDistributionStatusRepository watchdogCDStatusRepository = spy(WatchdogComponentDistributionStatusRepository.class); diff --git a/asdc-controller/src/test/java/org/onap/so/asdc/utils/ASDCLoggingVisitorImpl.java b/asdc-controller/src/test/java/org/onap/so/asdc/utils/ASDCLoggingVisitorImpl.java index 53d163a5bc..02c0f2dbf7 100644 --- a/asdc-controller/src/test/java/org/onap/so/asdc/utils/ASDCLoggingVisitorImpl.java +++ b/asdc-controller/src/test/java/org/onap/so/asdc/utils/ASDCLoggingVisitorImpl.java @@ -7,9 +7,9 @@ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at - * + * * http://www.apache.org/licenses/LICENSE-2.0 - * + * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. diff --git a/asdc-controller/src/test/resources/application-test.yaml b/asdc-controller/src/test/resources/application-test.yaml index 9fa20550db..60cd2d9f2a 100644 --- a/asdc-controller/src/test/resources/application-test.yaml +++ b/asdc-controller/src/test/resources/application-test.yaml @@ -102,3 +102,11 @@ mso: endpoint: http://localhost:${wiremock.server.port} config: defaultpath: src/test/resources + +sdc: + endpoint: http://localhost:${wiremock.server.port} + +etsi-catalog-manager: + endpoint: http://localhost:${wiremock.server.port}/api/catalog/v1 + rest: + timeoutInSeconds: 5 diff --git a/asdc-controller/src/test/resources/resource-examples/WorkflowBpmn/service-VfZrdm5bpxmc02092017Service-csar.csar b/asdc-controller/src/test/resources/resource-examples/WorkflowBpmn/service-VfZrdm5bpxmc02092017Service-csar.csar Binary files differindex 4c906aba38..817b83135d 100644 --- a/asdc-controller/src/test/resources/resource-examples/WorkflowBpmn/service-VfZrdm5bpxmc02092017Service-csar.csar +++ b/asdc-controller/src/test/resources/resource-examples/WorkflowBpmn/service-VfZrdm5bpxmc02092017Service-csar.csar diff --git a/asdc-controller/src/test/resources/resource-examples/vgw/ONBOARDED_PACKAGE/VENDOR_LICENSE/vendor-license-model.xml b/asdc-controller/src/test/resources/resource-examples/vgw/ONBOARDED_PACKAGE/VENDOR_LICENSE/vendor-license-model.xml new file mode 100644 index 0000000000..6499a58fab --- /dev/null +++ b/asdc-controller/src/test/resources/resource-examples/vgw/ONBOARDED_PACKAGE/VENDOR_LICENSE/vendor-license-model.xml @@ -0,0 +1 @@ +<vendor-license-model xmlns="http://xmlns.openecomp.org/asdc/license-model/1.0"><vendor-name>VLM</vendor-name><entitlement-pool-list><entitlement-pool><entitlement-pool-invariant-uuid>d6dea4a3db6b415ba50f17cb3311d046</entitlement-pool-invariant-uuid><entitlement-pool-uuid>04B01ABDE6CA4A9FBA75ACC023C6FEDA</entitlement-pool-uuid><version>1.0</version><name>EP</name><description/><increments/><manufacturer-reference-number>2345</manufacturer-reference-number><operational-scope><value/></operational-scope><start-date/><expiry-date/><threshold-value><unit/><value/></threshold-value><sp-limits/><vendor-limits/></entitlement-pool></entitlement-pool-list><license-key-group-list><license-key-group><version>1.0</version><name>LKG</name><description/><type>Unique</type><increments/><manufacturerReferenceNumber/><license-key-group-invariant-uuid>55ddeb1a87be4fbb95a9bd74b4d745ca</license-key-group-invariant-uuid><license-key-group-uuid>81117C9B092C4C70AFF76833373CE7F4</license-key-group-uuid><operational-scope><value/></operational-scope><start-date/><expiry-date/><threshold-value><unit>Absolute</unit><value>23456789</value></threshold-value><sp-limits/><vendor-limits/></license-key-group></license-key-group-list></vendor-license-model>
\ No newline at end of file diff --git a/asdc-controller/src/test/resources/resource-examples/vgw/ONBOARDED_PACKAGE/VF_LICENSE/vf-license-model.xml b/asdc-controller/src/test/resources/resource-examples/vgw/ONBOARDED_PACKAGE/VF_LICENSE/vf-license-model.xml new file mode 100644 index 0000000000..581a3acb7f --- /dev/null +++ b/asdc-controller/src/test/resources/resource-examples/vgw/ONBOARDED_PACKAGE/VF_LICENSE/vf-license-model.xml @@ -0,0 +1 @@ +<vf-license-model xmlns="http://xmlns.openecomp.org/asdc/license-model/1.0"><vendor-name>VLM</vendor-name><vf-id>fa87b9536b704787981357393f36b3fc</vf-id><feature-group-list><feature-group><entitlement-pool-list><entitlement-pool><name>EP</name><description/><increments/><entitlement-pool-invariant-uuid>d6dea4a3db6b415ba50f17cb3311d046</entitlement-pool-invariant-uuid><entitlement-pool-uuid>04B01ABDE6CA4A9FBA75ACC023C6FEDA</entitlement-pool-uuid><manufacturer-reference-number>2345</manufacturer-reference-number><operational-scope><value/></operational-scope><start-date/><expiry-date/><threshold-value><unit/><value/></threshold-value><version>1.0</version><sp-limits/><vendor-limits/></entitlement-pool></entitlement-pool-list><license-key-group-list><license-key-group><name>LKG</name><description/><type>Unique</type><increments/><license-key-group-invariant-uuid>55ddeb1a87be4fbb95a9bd74b4d745ca</license-key-group-invariant-uuid><license-key-group-uuid>81117C9B092C4C70AFF76833373CE7F4</license-key-group-uuid><manufacturer-reference-number/><operational-scope><value/></operational-scope><start-date/><expiry-date/><threshold-value><unit>Absolute</unit><value>23456789</value></threshold-value><version>1.0</version><sp-limits/><vendor-limits/></license-key-group></license-key-group-list><name>FG</name><feature-group-uuid>2218d90f94944a94952be83354847631</feature-group-uuid><description/><part-number>234594</part-number></feature-group></feature-group-list></vf-license-model>
\ No newline at end of file diff --git a/asdc-controller/src/test/resources/resource-examples/vgw/ONBOARDED_PACKAGE/vgw6.csar b/asdc-controller/src/test/resources/resource-examples/vgw/ONBOARDED_PACKAGE/vgw6.csar Binary files differnew file mode 100644 index 0000000000..56dbb2bce0 --- /dev/null +++ b/asdc-controller/src/test/resources/resource-examples/vgw/ONBOARDED_PACKAGE/vgw6.csar diff --git a/asdc-controller/src/test/resources/resource-examples/vgw/SDC_RESOURCE_CSAR/vgw_sdc_resource.csar b/asdc-controller/src/test/resources/resource-examples/vgw/SDC_RESOURCE_CSAR/vgw_sdc_resource.csar Binary files differnew file mode 100644 index 0000000000..7ddfb6ef51 --- /dev/null +++ b/asdc-controller/src/test/resources/resource-examples/vgw/SDC_RESOURCE_CSAR/vgw_sdc_resource.csar diff --git a/asdc-controller/src/test/resources/resource-examples/vgw/VENDOR_LICENSE/vendor-license-model.xml b/asdc-controller/src/test/resources/resource-examples/vgw/VENDOR_LICENSE/vendor-license-model.xml new file mode 100644 index 0000000000..6499a58fab --- /dev/null +++ b/asdc-controller/src/test/resources/resource-examples/vgw/VENDOR_LICENSE/vendor-license-model.xml @@ -0,0 +1 @@ +<vendor-license-model xmlns="http://xmlns.openecomp.org/asdc/license-model/1.0"><vendor-name>VLM</vendor-name><entitlement-pool-list><entitlement-pool><entitlement-pool-invariant-uuid>d6dea4a3db6b415ba50f17cb3311d046</entitlement-pool-invariant-uuid><entitlement-pool-uuid>04B01ABDE6CA4A9FBA75ACC023C6FEDA</entitlement-pool-uuid><version>1.0</version><name>EP</name><description/><increments/><manufacturer-reference-number>2345</manufacturer-reference-number><operational-scope><value/></operational-scope><start-date/><expiry-date/><threshold-value><unit/><value/></threshold-value><sp-limits/><vendor-limits/></entitlement-pool></entitlement-pool-list><license-key-group-list><license-key-group><version>1.0</version><name>LKG</name><description/><type>Unique</type><increments/><manufacturerReferenceNumber/><license-key-group-invariant-uuid>55ddeb1a87be4fbb95a9bd74b4d745ca</license-key-group-invariant-uuid><license-key-group-uuid>81117C9B092C4C70AFF76833373CE7F4</license-key-group-uuid><operational-scope><value/></operational-scope><start-date/><expiry-date/><threshold-value><unit>Absolute</unit><value>23456789</value></threshold-value><sp-limits/><vendor-limits/></license-key-group></license-key-group-list></vendor-license-model>
\ No newline at end of file diff --git a/asdc-controller/src/test/resources/resource-examples/vgw/VF_LICENSE/vf-license-model.xml b/asdc-controller/src/test/resources/resource-examples/vgw/VF_LICENSE/vf-license-model.xml new file mode 100644 index 0000000000..581a3acb7f --- /dev/null +++ b/asdc-controller/src/test/resources/resource-examples/vgw/VF_LICENSE/vf-license-model.xml @@ -0,0 +1 @@ +<vf-license-model xmlns="http://xmlns.openecomp.org/asdc/license-model/1.0"><vendor-name>VLM</vendor-name><vf-id>fa87b9536b704787981357393f36b3fc</vf-id><feature-group-list><feature-group><entitlement-pool-list><entitlement-pool><name>EP</name><description/><increments/><entitlement-pool-invariant-uuid>d6dea4a3db6b415ba50f17cb3311d046</entitlement-pool-invariant-uuid><entitlement-pool-uuid>04B01ABDE6CA4A9FBA75ACC023C6FEDA</entitlement-pool-uuid><manufacturer-reference-number>2345</manufacturer-reference-number><operational-scope><value/></operational-scope><start-date/><expiry-date/><threshold-value><unit/><value/></threshold-value><version>1.0</version><sp-limits/><vendor-limits/></entitlement-pool></entitlement-pool-list><license-key-group-list><license-key-group><name>LKG</name><description/><type>Unique</type><increments/><license-key-group-invariant-uuid>55ddeb1a87be4fbb95a9bd74b4d745ca</license-key-group-invariant-uuid><license-key-group-uuid>81117C9B092C4C70AFF76833373CE7F4</license-key-group-uuid><manufacturer-reference-number/><operational-scope><value/></operational-scope><start-date/><expiry-date/><threshold-value><unit>Absolute</unit><value>23456789</value></threshold-value><version>1.0</version><sp-limits/><vendor-limits/></license-key-group></license-key-group-list><name>FG</name><feature-group-uuid>2218d90f94944a94952be83354847631</feature-group-uuid><description/><part-number>234594</part-number></feature-group></feature-group-list></vf-license-model>
\ No newline at end of file diff --git a/asdc-controller/src/test/resources/resource-examples/vgw/dmaap-notification-message.json b/asdc-controller/src/test/resources/resource-examples/vgw/dmaap-notification-message.json new file mode 100644 index 0000000000..d936cd1144 --- /dev/null +++ b/asdc-controller/src/test/resources/resource-examples/vgw/dmaap-notification-message.json @@ -0,0 +1,66 @@ +{ + "distributionID": "35f20eb9-238a-4cc2-96dc-0a08f71bc209", + "serviceName": "VgwServiceV1", + "serviceVersion": "1.0", + "serviceUUID": "e051ff77-fb79-451c-8457-1cbf94e4db8f", + "serviceDescription": "Test VGW Service", + "serviceInvariantUUID": "c2ce924f-0aa1-4777-9b42-c0fec006a883", + "resources": [ + { + "resourceInstanceName": "VgwVspV1 0", + "resourceName": "VgwVspV1", + "resourceVersion": "1.0", + "resourceType": "VF", + "resourceUUID": "655aa939-d589-4333-8cc6-8fcb15db858a", + "resourceInvariantUUID": "c53a0c91-35f6-40ff-bcda-f75030cfaf2d", + "resourceCustomizationUUID": "db1673e1-351a-4d04-8e2f-84b2b4c52cc7", + "category": "Generic", + "subcategory": "Network Service", + "artifacts": [ + { + "artifactName": "vf-license-model.xml", + "artifactType": "VF_LICENSE", + "artifactURL": "/VF_LICENSE/vf-license-model.xml", + "artifactChecksum": "NjMwZDc0YzhiNDRlZDAyYjIxMmFlM2M0MWRkZjFmNDA\u003d", + "artifactDescription": "VF license file", + "artifactTimeout": 120, + "artifactUUID": "8dda263d-90bb-4b3d-b8e0-0048222dc658", + "artifactVersion": "1" + }, + { + "artifactName": "vgw6.csar", + "artifactType": "ONBOARDED_PACKAGE", + "artifactURL": "/ONBOARDED_PACKAGE/vgw6.csar", + "artifactChecksum": "NjdmNGU3ZDlkODQ0YTUzMTU5NjZmOThiYjMxNTJiNGI\u003d", + "artifactDescription": "Artifact created from csar", + "artifactTimeout": 120, + "artifactUUID": "9e9930b8-898e-4b8b-999e-66c43e1611f4", + "artifactVersion": "1" + }, + { + "artifactName": "vendor-license-model.xml", + "artifactType": "VENDOR_LICENSE", + "artifactURL": "/VENDOR_LICENSE/vendor-license-model.xml", + "artifactChecksum": "NGNmNzU4MDhjN2FjMTJkNWIxMjNkZDZhOWQyYzU0ZjA\u003d", + "artifactDescription": " Vendor license file", + "artifactTimeout": 120, + "artifactUUID": "b3f7a4cf-6a35-4f66-b800-cd4a9a0e9719", + "artifactVersion": "1" + } + ] + } + ], + "serviceArtifacts": [ + { + "artifactName": "service-Vgwservicev1-csar.csar", + "artifactType": "TOSCA_CSAR", + "artifactURL": "/service-Vgwservicev1-csar.csar", + "artifactChecksum": "MzcxNTMwMDhmNGY0MjRkMjFkNzk1MDNjOTVhNjQzMmE\u003d", + "artifactDescription": "TOSCA definition package of the asset", + "artifactTimeout": 0, + "artifactUUID": "0cc70c6e-6ddc-4ecc-8052-d9f1433c14b8", + "artifactVersion": "1" + } + ], + "workloadContext": "Production" +} diff --git a/asdc-controller/src/test/resources/resource-examples/vgw/etsi-catalog-package-onboading-job-status-error-package-exists.json b/asdc-controller/src/test/resources/resource-examples/vgw/etsi-catalog-package-onboading-job-status-error-package-exists.json new file mode 100644 index 0000000000..8dc07b9613 --- /dev/null +++ b/asdc-controller/src/test/resources/resource-examples/vgw/etsi-catalog-package-onboading-job-status-error-package-exists.json @@ -0,0 +1,20 @@ +{ + "jobId": "57c13120-0a03-4d2e-837a-7c41d61e4a30", + "responseDescriptor": + { + "status": "error", + "progress": "255", + "statusDescription": "VNF package() already exists.", + "errorCode": "1", + "responseId": "2", + "responseHistoryList": [ + { + "status": "processing", + "progress": "5", + "statusDescription": "Start CSAR(8f0b72e1-b6d6-42b6-a808-c60b17f04d7a) distribute.", + "errorCode": "0", + "responseId": "1" + } + ] + } +} diff --git a/asdc-controller/src/test/resources/resource-examples/vgw/etsi-catalog-package-onboading-job-status-error.json b/asdc-controller/src/test/resources/resource-examples/vgw/etsi-catalog-package-onboading-job-status-error.json new file mode 100644 index 0000000000..13f346fb7a --- /dev/null +++ b/asdc-controller/src/test/resources/resource-examples/vgw/etsi-catalog-package-onboading-job-status-error.json @@ -0,0 +1,20 @@ +{ + "jobId": "57c13120-0a03-4d2e-837a-7c41d61e4a30", + "responseDescriptor": + { + "status": "error", + "progress": "255", + "statusDescription": "Failed to query artifacts(resources) from sdc.", + "errorCode": "0", + "responseId": "2", + "responseHistoryList": [ + { + "status": "processing", + "progress": "5", + "statusDescription": "Start CSAR(8f0b72e1-b6d6-42b6-a808-c60b17f04d7a) distribute.", + "errorCode": "0", + "responseId": "1" + } + ] + } +} diff --git a/asdc-controller/src/test/resources/resource-examples/vgw/etsi-catalog-package-onboading-job-status-successful.json b/asdc-controller/src/test/resources/resource-examples/vgw/etsi-catalog-package-onboading-job-status-successful.json new file mode 100644 index 0000000000..b5dc1fe4f2 --- /dev/null +++ b/asdc-controller/src/test/resources/resource-examples/vgw/etsi-catalog-package-onboading-job-status-successful.json @@ -0,0 +1,27 @@ +{ + "jobId": "57c13120-0a03-4d2e-837a-7c41d61e4a30", + "responseDescriptor": + { + "status": "finished", + "progress": "100", + "statusDescription": "CSAR(8f0b72e1-b6d6-42b6-a808-c60b17f04d7a) distribute successfully.", + "errorCode": "0", + "responseId": "3", + "responseHistoryList": [ + { + "status": "processing", + "progress": "30", + "statusDescription": "Save CSAR(8f0b72e1-b6d6-42b6-a808-c60b17f04d7a) to database.", + "errorCode": "0", + "responseId": "2" + }, + { + "status": "processing", + "progress": "5", + "statusDescription": "Start CSAR(8f0b72e1-b6d6-42b6-a808-c60b17f04d7a) distribute.", + "errorCode": "0", + "responseId": "1" + } + ] + } +} diff --git a/asdc-controller/src/test/resources/resource-examples/vgw/service-Vgwservicev1-csar.csar b/asdc-controller/src/test/resources/resource-examples/vgw/service-Vgwservicev1-csar.csar Binary files differnew file mode 100644 index 0000000000..51a9e19466 --- /dev/null +++ b/asdc-controller/src/test/resources/resource-examples/vgw/service-Vgwservicev1-csar.csar diff --git a/asdc-controller/src/test/resources/schema.sql b/asdc-controller/src/test/resources/schema.sql index 0821ebc97c..d051d1a56c 100644 --- a/asdc-controller/src/test/resources/schema.sql +++ b/asdc-controller/src/test/resources/schema.sql @@ -1378,6 +1378,34 @@ CREATE TABLE IF NOT EXISTS `activity_spec_to_user_parameters` ( ENGINE = InnoDB DEFAULT CHARACTER SET = latin1; +CREATE TABLE IF NOT EXISTS `service_info` ( + `ID` int (11) AUTO_INCREMENT, + `SERVICE_INPUT` varchar (5000), + `SERVICE_PROPERTIES` varchar (5000), + PRIMARY KEY (`ID`) +)ENGINE=InnoDB DEFAULT CHARSET=latin1; + +CREATE TABLE IF NOT EXISTS `service_artifact`( + `ARTIFACT_UUID` varchar (200) NOT NULL, + `TYPE` varchar (200) NOT NULL, + `NAME` varchar (200) NOT NULL, + `VERSION` varchar (200) NOT NULL, + `DESCRIPTION` varchar (200) DEFAULT NULL, + `CONTENT` LONGTEXT DEFAULT NULL, + `CHECKSUM` varchar (200) DEFAULT NULL, + `CREATION_TIMESTAMP` DATETIME DEFAULT CURRENT_TIMESTAMP, + `SERVICE_MODEL_UUID` varchar (200) NOT NULL, + PRIMARY KEY (`ARTIFACT_UUID`), + CONSTRAINT `fk_service_artifact_service_info1` FOREIGN KEY (`SERVICE_MODEL_UUID`) REFERENCES `service` (`MODEL_UUID`) ON DELETE CASCADE ON UPDATE CASCADE +)ENGINE=InnoDB DEFAULT CHARSET=latin1; + +CREATE TABLE IF NOT EXISTS `service_to_service_info` ( + `SERVICE_MODEL_UUID` varchar (200) NOT NULL, + `SERVICE_INFO_ID` INT (11) NOT NULL, + PRIMARY KEY (`SERVICE_MODEL_UUID`,`SERVICE_INFO_ID`), + CONSTRAINT `fk_service_to_service_info__service1` FOREIGN KEY (`SERVICE_MODEL_UUID`) REFERENCES `service` (`MODEL_UUID`) ON DELETE CASCADE ON UPDATE CASCADE, + CONSTRAINT `fk_service_to_service_info__service_info1` FOREIGN KEY (`SERVICE_INFO_ID`) REFERENCES `service_info` (`ID`) ON DELETE CASCADE ON UPDATE CASCADE +)ENGINE=InnoDB DEFAULT CHARSET=latin1; --------START Request DB SCHEMA -------- CREATE DATABASE requestdb; diff --git a/bpmn/MSOCommonBPMN/pom.xml b/bpmn/MSOCommonBPMN/pom.xml index e233e6a7c6..c817874fb6 100644 --- a/bpmn/MSOCommonBPMN/pom.xml +++ b/bpmn/MSOCommonBPMN/pom.xml @@ -5,7 +5,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>bpmn</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>MSOCommonBPMN</artifactId> <name>MSOCommonBPMN</name> diff --git a/bpmn/MSOCommonBPMN/src/main/groovy/org/onap/so/bpmn/common/scripts/RequestDBUtil.groovy b/bpmn/MSOCommonBPMN/src/main/groovy/org/onap/so/bpmn/common/scripts/RequestDBUtil.groovy new file mode 100644 index 0000000000..ce474fa713 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/groovy/org/onap/so/bpmn/common/scripts/RequestDBUtil.groovy @@ -0,0 +1,119 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + # Copyright (c) 2019, CMCC Technologies Co., Ltd. + # + # Licensed under the Apache License, Version 2.0 (the "License") + # you may not use this file except in compliance with the License. + # You may obtain a copy of the License at + # + # http://www.apache.org/licenses/LICENSE-2.0 + # + # Unless required by applicable law or agreed to in writing, software + # distributed under the License is distributed on an "AS IS" BASIS, + # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + # See the License for the specific language governing permissions and + # limitations under the License. + * ============LICENSE_END========================================================= + */ +package org.onap.so.bpmn.common.scripts + +import org.camunda.bpm.engine.delegate.DelegateExecution +import org.onap.so.bpmn.core.UrnPropertiesReader +import org.onap.so.db.request.beans.OperationStatus +import org.slf4j.Logger +import org.slf4j.LoggerFactory +import org.springframework.web.util.UriUtils + +class RequestDBUtil { + private static final Logger logger = LoggerFactory.getLogger( RequestDBUtil.class); + private ExceptionUtil exceptionUtil = new ExceptionUtil() + + /** + * update operation status in requestDB + * @param execution + * @param operationStatus + */ + void prepareUpdateOperationStatus(DelegateExecution execution, final OperationStatus operationStatus){ + logger.debug("start prepareUpdateOperationStatus") + try{ + def dbAdapterEndpoint = UrnPropertiesReader.getVariable("mso.adapters.openecomp.db.endpoint", execution) + execution.setVariable("dbAdapterEndpoint", dbAdapterEndpoint) + logger.debug("DB Adapter Endpoint is: " + dbAdapterEndpoint) + + String serviceId = operationStatus.getServiceId() + serviceId = UriUtils.encode(serviceId,"UTF-8") + String operationId = operationStatus.getOperationId() + String userId = operationStatus.getUserId() + String operationType = operationStatus.getOperation() + String result = operationStatus.getResult() + String progress = operationStatus.getProgress() + String operationContent = operationStatus.getOperationContent() + String reason = operationStatus.getReason() + + String payload = + """<soapenv:Envelope xmlns:soapenv="http://schemas.xmlsoap.org/soap/envelope/" + xmlns:ns="http://org.onap.so/requestsdb"> + <soapenv:Header/> + <soapenv:Body> + <ns:updateServiceOperationStatus xmlns:ns="http://org.onap.so/requestsdb"> + <serviceId>${MsoUtils.xmlEscape(serviceId)}</serviceId> + <operationId>${MsoUtils.xmlEscape(operationId)}</operationId> + <operationType>${MsoUtils.xmlEscape(operationType)}</operationType> + <userId>${MsoUtils.xmlEscape(userId)}</userId> + <result>${MsoUtils.xmlEscape(result)}</result> + <operationContent>${MsoUtils.xmlEscape(operationContent)}</operationContent> + <progress>${MsoUtils.xmlEscape(progress)}</progress> + <reason>${MsoUtils.xmlEscape(reason)}</reason> + </ns:updateServiceOperationStatus> + </soapenv:Body> + </soapenv:Envelope> + """ + execution.setVariable("updateOperationStatus", payload) + + }catch(any){ + String exceptionMessage = "Prepare update ServiceOperationStatus failed. cause - " + any.getMessage() + logger.debug(exceptionMessage) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, exceptionMessage) + } + logger.trace("finished update OperationStatus") + } + + + /** + * get operation status from requestDB by serviceId and operationId + * @param execution + * @param serviceId + * @param operationId + */ + void getOperationStatus(DelegateExecution execution, String serviceId, String operationId) { + logger.trace("start getOperationStatus") + try { + def dbAdapterEndpoint = UrnPropertiesReader.getVariable("mso.adapters.openecomp.db.endpoint", execution) + execution.setVariable("dbAdapterEndpoint", dbAdapterEndpoint) + logger.trace("DB Adapter Endpoint is: " + dbAdapterEndpoint) + + serviceId = UriUtils.encode(serviceId,"UTF-8") + operationId = UriUtils.encode(operationId,"UTF-8") + String payload = + """<soapenv:Envelope xmlns:soapenv="http://schemas.xmlsoap.org/soap/envelope/" + xmlns:ns="http://org.onap.so/requestsdb"> + <soapenv:Header/> + <soapenv:Body> + <ns:getServiceOperationStatus xmlns:ns="http://org.onap.so/requestsdb"> + <serviceId>${MsoUtils.xmlEscape(serviceId)}</serviceId> + <operationId>${MsoUtils.xmlEscape(operationId)}</operationId> + </ns:getServiceOperationStatus> + </soapenv:Body> + </soapenv:Envelope> + """ + execution.setVariable("getOperationStatus", payload) + + } catch(any){ + String exceptionMessage = "Get ServiceOperationStatus failed. cause - " + any.getMessage() + logger.error(exceptionMessage) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, exceptionMessage) + } + } +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/bpmn/servicedecomposition/tasks/BBInputSetupUtils.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/bpmn/servicedecomposition/tasks/BBInputSetupUtils.java index ec7b613727..e004e10cf0 100644 --- a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/bpmn/servicedecomposition/tasks/BBInputSetupUtils.java +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/bpmn/servicedecomposition/tasks/BBInputSetupUtils.java @@ -24,6 +24,7 @@ package org.onap.so.bpmn.servicedecomposition.tasks; import java.io.IOException; import java.util.ArrayList; +import java.util.Arrays; import java.util.List; import java.util.Map; import java.util.Optional; @@ -398,68 +399,37 @@ public class BBInputSetupUtils { } public Configuration getAAIConfiguration(String configurationId) { - return this.injectionHelper.getAaiClient() - .get(Configuration.class, - AAIUriFactory.createResourceUri(AAIObjectType.CONFIGURATION, configurationId).depth(Depth.ONE)) - .orElseGet(() -> { - logger.debug("No Configuration matched by id"); - return null; - }); + return this.getConcreteAAIResource(Configuration.class, AAIObjectType.CONFIGURATION, configurationId); } public GenericVnf getAAIGenericVnf(String vnfId) { - - return this.injectionHelper.getAaiClient() - .get(GenericVnf.class, - AAIUriFactory.createResourceUri(AAIObjectType.GENERIC_VNF, vnfId).depth(Depth.ONE)) - .orElseGet(() -> { - logger.debug("No Generic Vnf matched by id"); - return null; - }); + return getConcreteAAIResource(GenericVnf.class, AAIObjectType.GENERIC_VNF, vnfId); } public VpnBinding getAAIVpnBinding(String vpnBindingId) { - - return this.injectionHelper.getAaiClient() - .get(VpnBinding.class, - AAIUriFactory.createResourceUri(AAIObjectType.VPN_BINDING, vpnBindingId).depth(Depth.ONE)) - .orElseGet(() -> { - logger.debug("No VpnBinding matched by id"); - return null; - }); + return getConcreteAAIResource(VpnBinding.class, AAIObjectType.VPN_BINDING, vpnBindingId); } public VolumeGroup getAAIVolumeGroup(String cloudOwnerId, String cloudRegionId, String volumeGroupId) { - return this.injectionHelper.getAaiClient() - .get(VolumeGroup.class, AAIUriFactory - .createResourceUri(AAIObjectType.VOLUME_GROUP, cloudOwnerId, cloudRegionId, volumeGroupId) - .depth(Depth.ONE)) - .orElseGet(() -> { - logger.debug("No Generic Vnf matched by id"); - return null; - }); + return getConcreteAAIResource(VolumeGroup.class, AAIObjectType.VOLUME_GROUP, cloudOwnerId, cloudRegionId, + volumeGroupId); } public VfModule getAAIVfModule(String vnfId, String vfModuleId) { - return this.injectionHelper.getAaiClient() - .get(VfModule.class, - AAIUriFactory.createResourceUri(AAIObjectType.VF_MODULE, vnfId, vfModuleId).depth(Depth.ONE)) - .orElseGet(() -> { - logger.debug("No Generic Vnf matched by id"); - return null; - }); + return getConcreteAAIResource(VfModule.class, AAIObjectType.VF_MODULE, vnfId, vfModuleId); } public L3Network getAAIL3Network(String networkId) { + return getConcreteAAIResource(L3Network.class, AAIObjectType.L3_NETWORK, networkId); + } - return this.injectionHelper.getAaiClient() - .get(L3Network.class, - AAIUriFactory.createResourceUri(AAIObjectType.L3_NETWORK, networkId).depth(Depth.ONE)) - .orElseGet(() -> { - logger.debug("No Generic Vnf matched by id"); + private <T> T getConcreteAAIResource(Class<T> clazz, AAIObjectType objectType, Object... ids) { + return injectionHelper.getAaiClient() + .get(clazz, AAIUriFactory.createResourceUri(objectType, ids).depth(Depth.ONE)).orElseGet(() -> { + logger.debug("No resource of type: {} matched by ids: {}", objectType.typeName(), + Arrays.toString(ids)); return null; }); - } public Optional<ServiceInstance> getRelatedServiceInstanceFromInstanceGroup(String instanceGroupId) diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/AbstractCDSProcessingBBUtils.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/AbstractCDSProcessingBBUtils.java index 424a4f3ecc..51b1a218c8 100644 --- a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/AbstractCDSProcessingBBUtils.java +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/AbstractCDSProcessingBBUtils.java @@ -22,14 +22,18 @@ package org.onap.so.client.cds; -import java.util.concurrent.CountDownLatch; -import java.util.concurrent.TimeUnit; +import com.google.protobuf.InvalidProtocolBufferException; +import com.google.protobuf.Struct; +import com.google.protobuf.Struct.Builder; +import com.google.protobuf.util.JsonFormat; +import io.grpc.Status; import org.camunda.bpm.engine.delegate.DelegateExecution; import org.onap.ccsdk.cds.controllerblueprints.common.api.ActionIdentifiers; import org.onap.ccsdk.cds.controllerblueprints.common.api.CommonHeader; import org.onap.ccsdk.cds.controllerblueprints.common.api.EventType; import org.onap.ccsdk.cds.controllerblueprints.processing.api.ExecutionServiceInput; import org.onap.ccsdk.cds.controllerblueprints.processing.api.ExecutionServiceOutput; +import org.onap.so.bpmn.common.BuildingBlockExecution; import org.onap.so.client.PreconditionFailedException; import org.onap.so.client.RestPropertiesLoader; import org.onap.so.client.cds.beans.AbstractCDSPropertiesBean; @@ -39,15 +43,11 @@ import org.slf4j.Logger; import org.slf4j.LoggerFactory; import org.springframework.beans.factory.annotation.Autowired; import org.springframework.stereotype.Component; -import com.google.protobuf.InvalidProtocolBufferException; -import com.google.protobuf.Struct; -import com.google.protobuf.Struct.Builder; -import com.google.protobuf.util.JsonFormat; -import io.grpc.Status; +import java.util.concurrent.CountDownLatch; +import java.util.concurrent.TimeUnit; /** * Util class to support Call to CDS client - * */ @Component public class AbstractCDSProcessingBBUtils { @@ -58,13 +58,9 @@ public class AbstractCDSProcessingBBUtils { private static final String FAILED = "Failed"; private static final String PROCESSING = "Processing"; private static final String RESPONSE_PAYLOAD = "CDSResponsePayload"; - private static final String CDS_STATUS = "CDSStatus"; + private static final String CDS_STATUS = "ControllerStatus"; private static final String EXEC_INPUT = "executionServiceInput"; - - - /** - * indicate exception thrown. - */ + private static final String EXECUTION_OBJECT = "executionObject"; private static final String EXCEPTION = "Exception"; @Autowired @@ -76,34 +72,33 @@ public class AbstractCDSProcessingBBUtils { * @param execution DelegateExecution object */ public void constructExecutionServiceInputObject(DelegateExecution execution) { - logger.trace("Start AbstractCDSProcessingBBUtils.preProcessRequest "); + logger.trace("Start AbstractCDSProcessingBBUtils.preProcessRequest for DelegateExecution object."); try { AbstractCDSPropertiesBean executionObject = - (AbstractCDSPropertiesBean) execution.getVariable("executionObject"); - - String payload = executionObject.getRequestObject(); - - CommonHeader commonHeader = CommonHeader.newBuilder().setOriginatorId(executionObject.getOriginatorId()) - .setRequestId(executionObject.getRequestId()).setSubRequestId(executionObject.getSubRequestId()) - .build(); - ActionIdentifiers actionIdentifiers = - ActionIdentifiers.newBuilder().setBlueprintName(executionObject.getBlueprintName()) - .setBlueprintVersion(executionObject.getBlueprintVersion()) - .setActionName(executionObject.getActionName()).setMode(executionObject.getMode()).build(); - - Builder struct = Struct.newBuilder(); - try { - JsonFormat.parser().merge(payload, struct); - } catch (InvalidProtocolBufferException e) { - logger.error("Failed to parse received message. blueprint({}:{}) for action({}). {}", - executionObject.getBlueprintVersion(), executionObject.getBlueprintName(), - executionObject.getActionName(), e); - } + (AbstractCDSPropertiesBean) execution.getVariable(EXECUTION_OBJECT); + + ExecutionServiceInput executionServiceInput = prepareExecutionServiceInput(executionObject); + + execution.setVariable(EXEC_INPUT, executionServiceInput); + + } catch (Exception ex) { + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, ex); + } + } - ExecutionServiceInput executionServiceInput = - ExecutionServiceInput.newBuilder().setCommonHeader(commonHeader) - .setActionIdentifiers(actionIdentifiers).setPayload(struct.build()).build(); + /** + * Extracting data from execution object and building the ExecutionServiceInput Object + * + * @param execution BuildingBlockExecution object + */ + public void constructExecutionServiceInputObject(BuildingBlockExecution execution) { + logger.trace("Start AbstractCDSProcessingBBUtils.preProcessRequest for BuildingBlockExecution object."); + + try { + AbstractCDSPropertiesBean executionObject = execution.getVariable(EXECUTION_OBJECT); + + ExecutionServiceInput executionServiceInput = prepareExecutionServiceInput(executionObject); execution.setVariable(EXEC_INPUT, executionServiceInput); @@ -119,50 +114,98 @@ public class AbstractCDSProcessingBBUtils { */ public void sendRequestToCDSClient(DelegateExecution execution) { - logger.trace("Start AbstractCDSProcessingBBUtils.sendRequestToCDSClient "); + logger.trace("Start AbstractCDSProcessingBBUtils.sendRequestToCDSClient for DelegateExecution object."); try { - CDSProperties props = RestPropertiesLoader.getInstance().getNewImpl(CDSProperties.class); - if (props == null) { - throw new PreconditionFailedException( - "No RestProperty.CDSProperties implementation found on classpath, can't create client."); - } - ExecutionServiceInput executionServiceInput = (ExecutionServiceInput) execution.getVariable(EXEC_INPUT); + CDSResponse cdsResponse = getCdsResponse(executionServiceInput); + execution.setVariable(CDS_STATUS, cdsResponse.status); - CDSResponse cdsResponse = new CDSResponse(); - - try (CDSProcessingClient cdsClient = new CDSProcessingClient(new ResponseHandler(cdsResponse))) { - CountDownLatch countDownLatch = cdsClient.sendRequest(executionServiceInput); - countDownLatch.await(props.getTimeout(), TimeUnit.SECONDS); - } catch (InterruptedException ex) { - logger.error("Caught exception in sendRequestToCDSClient in AbstractCDSProcessingBBUtils : ", ex); - Thread.currentThread().interrupt(); + if (cdsResponse.payload != null) { + String payload = JsonFormat.printer().print(cdsResponse.payload); + execution.setVariable(RESPONSE_PAYLOAD, payload); } - String cdsResponseStatus = cdsResponse.status; + } catch (Exception ex) { + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, ex); + } + } - /** - * throw CDS failed exception. - */ - if (!cdsResponseStatus.equals(SUCCESS)) { - throw new BadResponseException("CDS call failed with status: " + cdsResponse.status - + " and errorMessage: " + cdsResponse.errorMessage); - } + /** + * get the executionServiceInput object from execution and send a request to CDS Client and wait for TIMEOUT period + * + * @param execution BuildingBlockExecution object + */ + public void sendRequestToCDSClient(BuildingBlockExecution execution) { - execution.setVariable(CDS_STATUS, cdsResponseStatus); + logger.trace("Start AbstractCDSProcessingBBUtils.sendRequestToCDSClient for BuildingBlockExecution object."); + try { + ExecutionServiceInput executionServiceInput = execution.getVariable(EXEC_INPUT); + CDSResponse cdsResponse = getCdsResponse(executionServiceInput); + execution.setVariable(CDS_STATUS, cdsResponse.status); if (cdsResponse.payload != null) { String payload = JsonFormat.printer().print(cdsResponse.payload); execution.setVariable(RESPONSE_PAYLOAD, payload); } - - } catch (Exception ex) { exceptionUtil.buildAndThrowWorkflowException(execution, 7000, ex); } } + private CDSResponse getCdsResponse(ExecutionServiceInput executionServiceInput) throws BadResponseException { + CDSProperties props = RestPropertiesLoader.getInstance().getNewImpl(CDSProperties.class); + if (props == null) { + throw new PreconditionFailedException( + "No RestProperty.CDSProperties implementation found on classpath, can't create client."); + } + + CDSResponse cdsResponse = new CDSResponse(); + + try (CDSProcessingClient cdsClient = new CDSProcessingClient(new ResponseHandler(cdsResponse))) { + CountDownLatch countDownLatch = cdsClient.sendRequest(executionServiceInput); + countDownLatch.await(props.getTimeout(), TimeUnit.SECONDS); + } catch (InterruptedException ex) { + logger.error("Caught exception in sendRequestToCDSClient in AbstractCDSProcessingBBUtils : ", ex); + Thread.currentThread().interrupt(); + } + + String cdsResponseStatus = cdsResponse.status; + + /** + * throw CDS failed exception. + */ + if (!cdsResponseStatus.equals(SUCCESS)) { + throw new BadResponseException("CDS call failed with status: " + cdsResponse.status + " and errorMessage: " + + cdsResponse.errorMessage); + } + return cdsResponse; + } + + private ExecutionServiceInput prepareExecutionServiceInput(AbstractCDSPropertiesBean executionObject) { + String payload = executionObject.getRequestObject(); + + CommonHeader commonHeader = CommonHeader.newBuilder().setOriginatorId(executionObject.getOriginatorId()) + .setRequestId(executionObject.getRequestId()).setSubRequestId(executionObject.getSubRequestId()) + .build(); + ActionIdentifiers actionIdentifiers = + ActionIdentifiers.newBuilder().setBlueprintName(executionObject.getBlueprintName()) + .setBlueprintVersion(executionObject.getBlueprintVersion()) + .setActionName(executionObject.getActionName()).setMode(executionObject.getMode()).build(); + + Builder struct = Struct.newBuilder(); + try { + JsonFormat.parser().merge(payload, struct); + } catch (InvalidProtocolBufferException e) { + logger.error("Failed to parse received message. blueprint({}:{}) for action({}). {}", + executionObject.getBlueprintVersion(), executionObject.getBlueprintName(), + executionObject.getActionName(), e); + } + + return ExecutionServiceInput.newBuilder().setCommonHeader(commonHeader).setActionIdentifiers(actionIdentifiers) + .setPayload(struct.build()).build(); + } + private class ResponseHandler implements CDSProcessingListener { private CDSResponse cdsResponse; diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/CDSRequestProvider.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/CDSRequestProvider.java new file mode 100644 index 0000000000..e01de69b74 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/CDSRequestProvider.java @@ -0,0 +1,76 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Bell Canada + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.cds; + +import com.google.gson.JsonObject; +import org.onap.so.client.exception.PayloadGenerationException; +import java.util.Optional; +import static org.onap.so.client.cds.PayloadConstants.REQUEST; +import static org.onap.so.client.cds.PayloadConstants.SEPARATOR; + +public interface CDSRequestProvider { + + /** + * Build entire payload for CDS. + * + * @param action - action could be assign/deploy/undeploy etc. + * @return "payload":{ "config-<action>-<scope>":{ // information about resolution key, property configuration and + * template prefix based on the scope and action} + * @throws PayloadGenerationException If fail to build the payload. + */ + Optional<String> buildRequestPayload(String action) throws PayloadGenerationException; + + /** + * Get the blueprint name for CDS payload + * + * @return blueprint name + */ + String getBlueprintName(); + + /** + * Get the blueprint version for CDS payload + * + * @return blueprint version + */ + String getBlueprintVersion(); + + /** + * Set the executionObject(BuildingBlockExecution or DelegateExecution for PNF) + * + * @param executionObject object could be BuildingBlockExecution or DelegateExecution. + */ + <T> void setExecutionObject(T executionObject); + + + /** + * Build Request payload for CDS + * + * @param cdsPropertyObject - Json Object + * @param action - action could be assign/deploy/undeploy etc. + * @return Request Payload + */ + default String buildRequestJsonObject(JsonObject cdsPropertyObject, String action) { + String requestBasedOnAction = action.concat(SEPARATOR).concat(REQUEST); + JsonObject requestObject = new JsonObject(); + requestObject.add(requestBasedOnAction, cdsPropertyObject); + return requestObject.toString(); + } +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/ConfigureInstanceParamsForVfModule.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/ConfigureInstanceParamsForVfModule.java new file mode 100644 index 0000000000..6f850fa898 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/ConfigureInstanceParamsForVfModule.java @@ -0,0 +1,79 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Bell Canada + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.cds; + +import com.google.gson.JsonObject; +import org.onap.so.client.cds.ExtractServiceFromUserParameters; +import org.onap.so.client.exception.PayloadGenerationException; +import org.onap.so.serviceinstancebeans.Service; +import org.onap.so.serviceinstancebeans.VfModules; +import org.onap.so.serviceinstancebeans.Vnfs; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.stereotype.Component; +import java.util.List; +import java.util.Map; + +@Component +public class ConfigureInstanceParamsForVfModule { + + @Autowired + private ExtractServiceFromUserParameters extractServiceFromUserParameters; + + /** + * Read instance parameters for VF-Module and put into JsonObject. + * + * @param jsonObject- JsonObject which will hold the payload to send to CDS. + * @param userParamsFromRequest - User parameters for a vf-module + * @param vnfCustomizationUuid - Unique ID for vnf. + * @param vfModuleCustomizationUuid - Unique ID for vf-module. + * @throws PayloadGenerationException- If it doesn't able to populate instance parameters from SO payload. + */ + public void populateInstanceParams(JsonObject jsonObject, List<Map<String, Object>> userParamsFromRequest, + String vnfCustomizationUuid, String vfModuleCustomizationUuid) throws PayloadGenerationException { + try { + Service service = extractServiceFromUserParameters.getServiceFromRequestUserParams(userParamsFromRequest); + + List<Map<String, String>> instanceParamsList = + getInstanceParams(service, vnfCustomizationUuid, vfModuleCustomizationUuid); + + instanceParamsList.stream().flatMap(instanceParamsMap -> instanceParamsMap.entrySet().stream()) + .forEachOrdered(entry -> jsonObject.addProperty(entry.getKey(), entry.getValue())); + } catch (Exception e) { + throw new PayloadGenerationException("Couldn't able to resolve instance parameters", e); + } + } + + private List<Map<String, String>> getInstanceParams(Service service, String vnfCustomizationUuid, + String vfModuleCustomizationUuid) throws PayloadGenerationException { + + Vnfs foundedVnf = service.getResources().getVnfs().stream() + .filter(vnfs -> vnfs.getModelInfo().getModelCustomizationId().equals(vnfCustomizationUuid)).findFirst() + .orElseThrow(() -> new PayloadGenerationException(String + .format("Can not find vnf for genericVnfModelCustomizationUuid: %s", vnfCustomizationUuid))); + + VfModules vfModule = foundedVnf.getVfModules().stream().filter( + vfModules -> vfModules.getModelInfo().getModelCustomizationId().equals(vfModuleCustomizationUuid)) + .findFirst().orElseThrow(() -> new PayloadGenerationException(String + .format("Can not find vnf for vfModuleCustomizationUuid: %s", vfModuleCustomizationUuid))); + + return vfModule.getInstanceParams(); + } +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/ConfigureInstanceParamsForVnf.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/ConfigureInstanceParamsForVnf.java new file mode 100644 index 0000000000..22c9a7bee4 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/ConfigureInstanceParamsForVnf.java @@ -0,0 +1,73 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Bell Canada + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.cds; + +import com.google.gson.JsonObject; +import org.onap.so.client.exception.PayloadGenerationException; +import org.onap.so.serviceinstancebeans.Service; +import org.onap.so.serviceinstancebeans.Vnfs; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.stereotype.Component; +import java.util.List; +import java.util.Map; +import java.util.Optional; + +@Component +public class ConfigureInstanceParamsForVnf { + + @Autowired + private ExtractServiceFromUserParameters extractServiceFromUserParameters; + + /** + * Read instance parameters for VNF and put into JsonObject. + * + * @param jsonObject - JsonObject which will hold the payload to send to CDS. + * @param userParamsFromRequest - User parameters. + * @param modelCustomizationUuid - Unique ID for Vnf. + * @throws PayloadGenerationException if it doesn't able to populate instance parameters from SO payload. + */ + public void populateInstanceParams(JsonObject jsonObject, List<Map<String, Object>> userParamsFromRequest, + String modelCustomizationUuid) throws PayloadGenerationException { + try { + Service service = extractServiceFromUserParameters.getServiceFromRequestUserParams(userParamsFromRequest); + List<Map<String, String>> instanceParamsList = getInstanceParamForVnf(service, modelCustomizationUuid); + + instanceParamsList.stream().flatMap(instanceParamsMap -> instanceParamsMap.entrySet().stream()) + .forEachOrdered(entry -> jsonObject.addProperty(entry.getKey(), entry.getValue())); + } catch (Exception e) { + throw new PayloadGenerationException("Couldn't able to resolve instance parameters", e); + } + } + + private List<Map<String, String>> getInstanceParamForVnf(Service service, String genericVnfModelCustomizationUuid) + throws PayloadGenerationException { + Optional<Vnfs> foundedVnf = service.getResources().getVnfs().stream() + .filter(vnfs -> vnfs.getModelInfo().getModelCustomizationId().equals(genericVnfModelCustomizationUuid)) + .findFirst(); + + if (foundedVnf.isPresent()) { + return foundedVnf.get().getInstanceParams(); + } else { + throw new PayloadGenerationException(String.format( + "Can not find vnf for genericVnfModelCustomizationUuid: %s", genericVnfModelCustomizationUuid)); + } + } +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/ExtractServiceFromUserParameters.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/ExtractServiceFromUserParameters.java new file mode 100644 index 0000000000..43fabd3253 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/ExtractServiceFromUserParameters.java @@ -0,0 +1,53 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Bell Canada + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ +package org.onap.so.client.cds; + +import com.fasterxml.jackson.databind.ObjectMapper; +import org.onap.so.client.exception.PayloadGenerationException; +import org.onap.so.serviceinstancebeans.Service; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.stereotype.Component; +import java.util.List; +import java.util.Map; + +@Component +public class ExtractServiceFromUserParameters { + + private static final String SERVICE_KEY = "service"; + + @Autowired + private ObjectMapper objectMapper; + + public Service getServiceFromRequestUserParams(List<Map<String, Object>> userParams) throws Exception { + Map<String, Object> serviceMap = userParams.stream().filter(key -> key.containsKey(SERVICE_KEY)).findFirst() + .orElseThrow(() -> new Exception("Can not find service in userParams section in generalBuildingBlock")); + return getServiceObjectFromServiceMap(serviceMap); + } + + private Service getServiceObjectFromServiceMap(Map<String, Object> serviceMap) throws PayloadGenerationException { + try { + String serviceFromJson = objectMapper.writeValueAsString(serviceMap.get(SERVICE_KEY)); + return objectMapper.readValue(serviceFromJson, Service.class); + } catch (Exception e) { + throw new PayloadGenerationException("An exception occurred while converting json object to Service object", + e); + } + } +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/GeneratePayloadForCds.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/GeneratePayloadForCds.java new file mode 100644 index 0000000000..fb79880572 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/GeneratePayloadForCds.java @@ -0,0 +1,153 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Bell Canada + * ================================================================================ + * Modifications Copyright (c) 2020 Nordix + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.cds; + +import org.camunda.bpm.engine.delegate.DelegateExecution; +import org.onap.so.bpmn.common.BuildingBlockExecution; +import org.onap.so.bpmn.servicedecomposition.entities.BuildingBlock; +import org.onap.so.bpmn.servicedecomposition.entities.ExecuteBuildingBlock; +import org.onap.so.bpmn.servicedecomposition.tasks.ExtractPojosForBB; +import org.onap.so.client.cds.beans.AbstractCDSPropertiesBean; +import org.onap.so.client.exception.PayloadGenerationException; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.stereotype.Component; +import java.util.UUID; + +@Component +public class GeneratePayloadForCds { + + private static final String ORIGINATOR_ID = "SO"; + private static final String BUILDING_BLOCK = "buildingBlock"; + private static final String DEFAULT_SYNC_MODE = "sync"; + private static final String MSO_REQUEST_ID = "msoRequestId"; + + @Autowired + private VnfCDSRequestProvider vnfCDSRequestProvider; + + @Autowired + private VfModuleCDSRequestProvider vfModuleCDSRequestProvider; + + @Autowired + private ServiceCDSRequestProvider serviceCDSRequestProvider; + + @Autowired + private ExtractPojosForBB extractPojosForBB; + + @Autowired + private PnfCDSRequestProvider pnfCDSRequestProvider; + + /** + * Build properties like (blueprint name, version, action etc..) along with the request payload for vnf, vf-module + * and service. + * + * @param execution - A building block execution object. + * @return AbstractCDSPropertiesBean - A POJO which contains CDS related information. + * @throws PayloadGenerationException - Throw an exception if it fails to build payload for CDS. + */ + public AbstractCDSPropertiesBean buildCdsPropertiesBean(BuildingBlockExecution execution) + throws PayloadGenerationException { + + ExecuteBuildingBlock executeBuildingBlock = execution.getVariable(BUILDING_BLOCK); + BuildingBlock buildingBlock = executeBuildingBlock.getBuildingBlock(); + final String requestId = execution.getGeneralBuildingBlock().getRequestContext().getMsoRequestId(); + final String scope = buildingBlock.getBpmnScope(); + final String action = buildingBlock.getBpmnAction(); + + + CDSRequestProvider requestProvider = getRequestProviderByScope(scope); + requestProvider.setExecutionObject(execution); + + final String requestPayload = requestProvider.buildRequestPayload(action) + .orElseThrow(() -> new PayloadGenerationException("Failed to build payload for CDS")); + + return prepareAndSetCdsPropertyBean(requestProvider, requestPayload, requestId, action, DEFAULT_SYNC_MODE); + } + + /** + * Build properties like (blueprint name, version, action etc..) along with the request payload for pnf. + * + * @param execution - A building block execution object. + * @return AbstractCDSPropertiesBean - A POJO which contains CDS related information. + * @throws PayloadGenerationException - Throw an exception if it fails to build payload for CDS. + */ + public AbstractCDSPropertiesBean buildCdsPropertiesBean(DelegateExecution execution) + throws PayloadGenerationException { + + final String scope = String.valueOf(execution.getVariable(PayloadConstants.SCOPE)); + final String action = String.valueOf(execution.getVariable(PayloadConstants.ACTION)); + final String requestId = String.valueOf(execution.getVariable(MSO_REQUEST_ID)); + final String mode = extractAndSetMode(execution); + + CDSRequestProvider requestProvider = getRequestProviderByScope(scope); + requestProvider.setExecutionObject(execution); + + final String requestPayload = requestProvider.buildRequestPayload(action) + .orElseThrow(() -> new PayloadGenerationException("Failed to build payload for CDS")); + + return prepareAndSetCdsPropertyBean(requestProvider, requestPayload, requestId, action, mode); + } + + private AbstractCDSPropertiesBean prepareAndSetCdsPropertyBean(CDSRequestProvider requestProvider, + String requestPayload, String requestId, String action, String mode) { + final AbstractCDSPropertiesBean cdsPropertiesBean = new AbstractCDSPropertiesBean(); + cdsPropertiesBean.setRequestObject(requestPayload); + cdsPropertiesBean.setBlueprintName(requestProvider.getBlueprintName()); + cdsPropertiesBean.setBlueprintVersion(requestProvider.getBlueprintVersion()); + cdsPropertiesBean.setRequestId(requestId); + cdsPropertiesBean.setOriginatorId(ORIGINATOR_ID); + cdsPropertiesBean.setSubRequestId(UUID.randomUUID().toString()); + cdsPropertiesBean.setActionName(action); + cdsPropertiesBean.setMode(mode); + return cdsPropertiesBean; + } + + private String extractAndSetMode(DelegateExecution execution) { + String mode = DEFAULT_SYNC_MODE; + Object obj = execution.getVariable(PayloadConstants.MODE); + if (obj != null && !String.valueOf(obj).isEmpty()) { + mode = String.valueOf(obj); + } + return mode; + } + + private CDSRequestProvider getRequestProviderByScope(String scope) throws PayloadGenerationException { + CDSRequestProvider requestProvider; + switch (scope) { + case PayloadConstants.VNF_SCOPE: + requestProvider = vnfCDSRequestProvider; + break; + case PayloadConstants.VF_MODULE_SCOPE: + requestProvider = vfModuleCDSRequestProvider; + break; + case PayloadConstants.SERVICE_SCOPE: + requestProvider = serviceCDSRequestProvider; + break; + case PayloadConstants.PNF_SCOPE: + requestProvider = pnfCDSRequestProvider; + break; + default: + throw new PayloadGenerationException("No scope defined with " + scope); + } + return requestProvider; + } +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/PayloadConstants.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/PayloadConstants.java new file mode 100644 index 0000000000..808d427d65 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/PayloadConstants.java @@ -0,0 +1,53 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Bell Canada + * ================================================================================ + * Modifications Copyright (C) 2020 Nordix + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.cds; + +public final class PayloadConstants { + + private PayloadConstants() { + + } + + public static final String REQUEST = "request"; + public static final String PROPERTIES = "properties"; + public static final String SCOPE = "scope"; + public static final String ACTION = "action"; + public static final String MODE = "mode"; + public static final String SEPARATOR = "-"; + public static final String PNF_SCOPE = "pnf"; + public static final String VNF_SCOPE = "vnf"; + public static final String VF_MODULE_SCOPE = "vfModule"; + public static final String SERVICE_SCOPE = "service"; + public static final String RESOLUTION_KEY = "resolution-key"; + public static final String CDS_ACTOR = "cds"; + + public static final String PRC_BLUEPRINT_NAME = "PRC_blueprintName"; + public static final String PRC_BLUEPRINT_VERSION = "PRC_blueprintVersion"; + public static final String PRC_CUSTOMIZATION_UUID = "PRC_customizationUuid"; + public static final String PRC_TARGET_SOFTWARE_VERSION = "targetSoftwareVersion"; + + public final static String PNF_CORRELATION_ID = "pnfCorrelationId"; + public final static String PNF_UUID = "pnfUuid"; + public final static String SERVICE_INSTANCE_ID = "serviceInstanceId"; + public final static String MODEL_UUID = "modelUuid"; +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/PnfCDSRequestProvider.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/PnfCDSRequestProvider.java new file mode 100644 index 0000000000..86bca755ed --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/PnfCDSRequestProvider.java @@ -0,0 +1,78 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.client.cds; + +import com.google.gson.JsonObject; +import org.camunda.bpm.engine.delegate.DelegateExecution; +import org.springframework.beans.factory.config.ConfigurableBeanFactory; +import org.springframework.context.annotation.Scope; +import org.springframework.stereotype.Component; +import java.util.Optional; +import static org.onap.so.client.cds.PayloadConstants.*; + +@Component +@Scope(value = ConfigurableBeanFactory.SCOPE_PROTOTYPE) +public class PnfCDSRequestProvider implements CDSRequestProvider { + private String blueprintName; + private String blueprintVersion; + private DelegateExecution execution; + + @Override + public String getBlueprintName() { + return blueprintName; + } + + @Override + public String getBlueprintVersion() { + return blueprintVersion; + } + + @Override + public <T> void setExecutionObject(T executionObject) { + execution = (DelegateExecution) executionObject; + } + + @Override + public Optional<String> buildRequestPayload(String action) { + + final JsonObject pnfObject = new JsonObject(); + final String resolutionKey = String.valueOf(execution.getVariable(PNF_CORRELATION_ID)); + blueprintName = String.valueOf(execution.getVariable(PRC_BLUEPRINT_NAME)); + blueprintVersion = String.valueOf(execution.getVariable(PRC_BLUEPRINT_VERSION)); + + extractAndSetExecutionVariable("service-instance-id", SERVICE_INSTANCE_ID, pnfObject); + extractAndSetExecutionVariable("service-model-uuid", MODEL_UUID, pnfObject); + extractAndSetExecutionVariable("pnf-id", PNF_UUID, pnfObject); + extractAndSetExecutionVariable("pnf-name", PNF_CORRELATION_ID, pnfObject); + extractAndSetExecutionVariable("pnf-customization-uuid", PRC_CUSTOMIZATION_UUID, pnfObject); + extractAndSetExecutionVariable("target-software-version", PRC_TARGET_SOFTWARE_VERSION, pnfObject); + + final JsonObject cdsPropertyObject = new JsonObject(); + cdsPropertyObject.addProperty(RESOLUTION_KEY, resolutionKey); + cdsPropertyObject.add(action + SEPARATOR + PROPERTIES, pnfObject); + + return Optional.of(buildRequestJsonObject(cdsPropertyObject, action)); + } + + private void extractAndSetExecutionVariable(String jsonProperty, String executionProperty, JsonObject pnfObject) { + if (execution.getVariable(executionProperty) != null) { + pnfObject.addProperty(jsonProperty, String.valueOf(execution.getVariable(executionProperty))); + } + } +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/ServiceCDSRequestProvider.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/ServiceCDSRequestProvider.java new file mode 100644 index 0000000000..12c841a2c6 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/ServiceCDSRequestProvider.java @@ -0,0 +1,89 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Bell Canada + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.cds; + +import com.google.gson.JsonObject; +import org.onap.so.bpmn.common.BuildingBlockExecution; +import org.onap.so.bpmn.servicedecomposition.bbobjects.ServiceInstance; +import org.onap.so.bpmn.servicedecomposition.entities.ResourceKey; +import org.onap.so.bpmn.servicedecomposition.tasks.ExtractPojosForBB; +import org.onap.so.client.exception.PayloadGenerationException; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.beans.factory.config.ConfigurableBeanFactory; +import org.springframework.context.annotation.Scope; +import org.springframework.stereotype.Component; +import java.util.Optional; +import static org.onap.so.client.cds.PayloadConstants.PROPERTIES; +import static org.onap.so.client.cds.PayloadConstants.SEPARATOR; + +@Component +@Scope(value = ConfigurableBeanFactory.SCOPE_PROTOTYPE) +public class ServiceCDSRequestProvider implements CDSRequestProvider { + + private static final String EMPTY_STRING = ""; + private String resolutionKey; + private BuildingBlockExecution execution; + + @Autowired + private ExtractPojosForBB extractPojosForBB; + + @Override + public String getBlueprintName() { + return EMPTY_STRING; + } + + @Override + public String getBlueprintVersion() { + return EMPTY_STRING; + } + + @Override + public <T> void setExecutionObject(T executionObject) { + execution = (BuildingBlockExecution) executionObject; + } + + @Override + public Optional<String> buildRequestPayload(String action) throws PayloadGenerationException { + JsonObject cdsPropertyObject = new JsonObject(); + JsonObject serviceObject = new JsonObject(); + try { + ServiceInstance serviceInstance = + extractPojosForBB.extractByKey(execution, ResourceKey.SERVICE_INSTANCE_ID); + + resolutionKey = serviceInstance.getServiceInstanceName(); + + // TODO Need to figure out how to populate blueprint name and version for service. + + serviceObject.addProperty("service-instance-id", serviceInstance.getServiceInstanceId()); + serviceObject.addProperty("service-model-uuid", + serviceInstance.getModelInfoServiceInstance().getModelUuid()); + + } catch (Exception e) { + throw new PayloadGenerationException("Failed to buildPropertyObjectForService", e); + } + + cdsPropertyObject.addProperty("resolution-key", resolutionKey); + cdsPropertyObject.add(action + SEPARATOR + PROPERTIES, serviceObject); + + return Optional.of(buildRequestJsonObject(cdsPropertyObject, action)); + } + +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/VfModuleCDSRequestProvider.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/VfModuleCDSRequestProvider.java new file mode 100644 index 0000000000..bba8925f21 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/VfModuleCDSRequestProvider.java @@ -0,0 +1,121 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Bell Canada + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.cds; + +import com.google.gson.JsonObject; +import org.onap.so.bpmn.common.BuildingBlockExecution; +import org.onap.so.bpmn.servicedecomposition.bbobjects.GenericVnf; +import org.onap.so.bpmn.servicedecomposition.bbobjects.ServiceInstance; +import org.onap.so.bpmn.servicedecomposition.bbobjects.VfModule; +import org.onap.so.bpmn.servicedecomposition.entities.GeneralBuildingBlock; +import org.onap.so.bpmn.servicedecomposition.entities.ResourceKey; +import org.onap.so.bpmn.servicedecomposition.tasks.ExtractPojosForBB; +import org.onap.so.client.exception.PayloadGenerationException; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.beans.factory.config.ConfigurableBeanFactory; +import org.springframework.context.annotation.Bean; +import org.springframework.context.annotation.Scope; +import org.springframework.stereotype.Component; +import java.util.List; +import java.util.Map; +import java.util.Optional; +import static org.onap.so.client.cds.PayloadConstants.PROPERTIES; +import static org.onap.so.client.cds.PayloadConstants.SEPARATOR; + +@Component +@Scope(value = ConfigurableBeanFactory.SCOPE_PROTOTYPE) +public class VfModuleCDSRequestProvider implements CDSRequestProvider { + private String blueprintName; + private String blueprintVersion; + private BuildingBlockExecution execution; + + @Autowired + private ExtractPojosForBB extractPojosForBB; + + @Autowired + private ConfigureInstanceParamsForVfModule configureInstanceParamsForVfModule; + + @Override + public String getBlueprintName() { + return blueprintName; + } + + @Override + public String getBlueprintVersion() { + return blueprintVersion; + } + + @Override + public <T> void setExecutionObject(T executionObject) { + execution = (BuildingBlockExecution) executionObject; + } + + @Override + public Optional<String> buildRequestPayload(String action) throws PayloadGenerationException { + JsonObject cdsPropertyObject = new JsonObject(); + JsonObject vfModuleObject = new JsonObject(); + String vfModuleName; + + try { + ServiceInstance serviceInstance = + extractPojosForBB.extractByKey(execution, ResourceKey.SERVICE_INSTANCE_ID); + GenericVnf genericVnf = extractPojosForBB.extractByKey(execution, ResourceKey.GENERIC_VNF_ID); + + final String modelCustomizationUuidForVnf = genericVnf.getModelInfoGenericVnf().getModelCustomizationUuid(); + + blueprintName = genericVnf.getBlueprintName(); + blueprintVersion = genericVnf.getBlueprintVersion(); + + VfModule vfModule = extractPojosForBB.extractByKey(execution, ResourceKey.VF_MODULE_ID); + vfModuleName = vfModule.getVfModuleName(); + + final String modelCustomizationUuidForVfModule = + vfModule.getModelInfoVfModule().getModelCustomizationUUID(); + + vfModuleObject.addProperty("service-instance-id", serviceInstance.getServiceInstanceId()); + vfModuleObject.addProperty("service-model-uuid", + serviceInstance.getModelInfoServiceInstance().getModelUuid()); + vfModuleObject.addProperty("vnf-id", genericVnf.getVnfId()); + vfModuleObject.addProperty("vnf-name", genericVnf.getVnfName()); + vfModuleObject.addProperty("vf-module-id", vfModule.getVfModuleId()); + vfModuleObject.addProperty("vf-module-name", vfModule.getVfModuleName()); + vfModuleObject.addProperty("vf-module-customization-uuid", + vfModule.getModelInfoVfModule().getModelCustomizationUUID()); + + final GeneralBuildingBlock buildingBlock = execution.getGeneralBuildingBlock(); + List<Map<String, Object>> userParamsFromRequest = + buildingBlock.getRequestContext().getRequestParameters().getUserParams(); + + configureInstanceParamsForVfModule.populateInstanceParams(vfModuleObject, userParamsFromRequest, + modelCustomizationUuidForVnf, modelCustomizationUuidForVfModule); + } catch (Exception e) { + throw new PayloadGenerationException("Failed to buildPropertyObject for VF-Module", e); + } + + // Not sure for resolutionKey should be same as vfModule name. + cdsPropertyObject.addProperty("resolution-key", vfModuleName); + cdsPropertyObject.addProperty("template-prefix", vfModuleName + action); + cdsPropertyObject.add(action + SEPARATOR + PROPERTIES, vfModuleObject); + + return Optional.of(buildRequestJsonObject(cdsPropertyObject, action)); + } + +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/VnfCDSRequestProvider.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/VnfCDSRequestProvider.java new file mode 100644 index 0000000000..d33976d229 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/cds/VnfCDSRequestProvider.java @@ -0,0 +1,106 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Bell Canada + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.cds; + +import com.google.gson.JsonObject; +import org.onap.so.bpmn.common.BuildingBlockExecution; +import org.onap.so.bpmn.servicedecomposition.bbobjects.GenericVnf; +import org.onap.so.bpmn.servicedecomposition.bbobjects.ServiceInstance; +import org.onap.so.bpmn.servicedecomposition.entities.GeneralBuildingBlock; +import org.onap.so.bpmn.servicedecomposition.entities.ResourceKey; +import org.onap.so.bpmn.servicedecomposition.tasks.ExtractPojosForBB; +import org.onap.so.client.exception.PayloadGenerationException; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.beans.factory.config.ConfigurableBeanFactory; +import org.springframework.context.annotation.Scope; +import org.springframework.stereotype.Component; +import java.util.List; +import java.util.Map; +import java.util.Optional; +import static org.onap.so.client.cds.PayloadConstants.PROPERTIES; +import static org.onap.so.client.cds.PayloadConstants.SEPARATOR; + +@Component +@Scope(value = ConfigurableBeanFactory.SCOPE_PROTOTYPE) +public class VnfCDSRequestProvider implements CDSRequestProvider { + private String blueprintName; + private String blueprintVersion; + private BuildingBlockExecution execution; + + @Autowired + private ExtractPojosForBB extractPojosForBB; + + @Autowired + private ConfigureInstanceParamsForVnf configureInstanceParamsForVnf; + + @Override + public String getBlueprintName() { + return blueprintName; + } + + @Override + public String getBlueprintVersion() { + return blueprintVersion; + } + + @Override + public <T> void setExecutionObject(T executionObject) { + execution = (BuildingBlockExecution) executionObject; + } + + @Override + public Optional<String> buildRequestPayload(String action) throws PayloadGenerationException { + JsonObject cdsPropertyObject = new JsonObject(); + JsonObject vnfObject = new JsonObject(); + String resolutionKey; + try { + ServiceInstance serviceInstance = + extractPojosForBB.extractByKey(execution, ResourceKey.SERVICE_INSTANCE_ID); + GenericVnf genericVnf = extractPojosForBB.extractByKey(execution, ResourceKey.GENERIC_VNF_ID); + + final String modelCustomizationUuid = genericVnf.getModelInfoGenericVnf().getModelCustomizationUuid(); + + resolutionKey = genericVnf.getVnfName(); + blueprintName = genericVnf.getBlueprintName(); + blueprintVersion = genericVnf.getBlueprintVersion(); + + vnfObject.addProperty("service-instance-id", serviceInstance.getServiceInstanceId()); + vnfObject.addProperty("service-model-uuid", serviceInstance.getModelInfoServiceInstance().getModelUuid()); + vnfObject.addProperty("vnf-id", genericVnf.getVnfId()); + vnfObject.addProperty("vnf-name", genericVnf.getVnfName()); + vnfObject.addProperty("vnf-customization-uuid", modelCustomizationUuid); + + final GeneralBuildingBlock buildingBlock = execution.getGeneralBuildingBlock(); + List<Map<String, Object>> userParamsFromRequest = + buildingBlock.getRequestContext().getRequestParameters().getUserParams(); + + configureInstanceParamsForVnf.populateInstanceParams(vnfObject, userParamsFromRequest, + modelCustomizationUuid); + } catch (Exception e) { + throw new PayloadGenerationException("Failed to buildPropertyObjectForVnf", e); + } + + cdsPropertyObject.addProperty("resolution-key", resolutionKey); + cdsPropertyObject.add(action + SEPARATOR + PROPERTIES, vnfObject); + + return Optional.of(buildRequestJsonObject(cdsPropertyObject, action)); + } +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/exception/PayloadGenerationException.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/exception/PayloadGenerationException.java new file mode 100644 index 0000000000..3c148a17a5 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/exception/PayloadGenerationException.java @@ -0,0 +1,39 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Bell Canada + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.exception; + +public class PayloadGenerationException extends Exception { + + /** + * @param message The message to dump + */ + public PayloadGenerationException(final String message) { + super(message); + } + + /** + * @param message The message to dump. + * @param cause The throwable cause object. + */ + public PayloadGenerationException(final String message, final Throwable cause) { + super(message, cause); + } +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/restproperties/SDNCLcmPropertiesImpl.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/restproperties/SDNCLcmPropertiesImpl.java new file mode 100644 index 0000000000..eb2567d47c --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/restproperties/SDNCLcmPropertiesImpl.java @@ -0,0 +1,117 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.restproperties; + +import java.net.MalformedURLException; +import java.net.URL; +import org.onap.so.bpmn.core.UrnPropertiesReader; +import org.onap.so.client.sdnc.common.SDNCConstants; +import org.onap.so.client.sdnc.lcm.SDNCLcmProperties; + +public class SDNCLcmPropertiesImpl implements SDNCLcmProperties { + + public static final String SDNC_HOST = "sdnc.host"; + public static final String SDNC_AUTH = "sdnc.auth"; + public static final String LCM_PATH = "sdnc.lcm.path"; + + public static final String DMAAP_HOST = "sdnc.dmaap.host"; + public static final String DMAAP_AUTH = "sdnc.dmaap.auth"; + public static final String DMAAP_PARTITION = "sdnc.dmaap.partition"; + public static final String DMAAP_TIMEOUT = "sdnc.dmaap.timeout"; + public static final String DMAAP_ENVIRONMENT = "sdnc.dmaap.environment"; + public static final String LCM_DMAAP_READ_TOPIC = "sdnc.lcm.dmapp.readTopic"; + public static final String LCM_DMAAP_WRITE_TOPIC = "sdnc.lcm.dmaap.writeTopic"; + + public static final String MSO_KEY = "mso.msoKey"; + + public SDNCLcmPropertiesImpl() {} + + @Override + public String getHost() { + return UrnPropertiesReader.getVariable(SDNC_HOST); + } + + @Override + public String getPath() { + String path = UrnPropertiesReader.getVariable(LCM_PATH); + return (path != null) ? path : SDNCConstants.LCM_API_BASE_PATH; + } + + @Override + public String getBasicAuth() { + return UrnPropertiesReader.getVariable(SDNC_AUTH); + } + + @Override + public String getDmaapHost() { + return UrnPropertiesReader.getVariable(DMAAP_HOST); + } + + @Override + public String getDmaapAuth() { + return UrnPropertiesReader.getVariable(DMAAP_AUTH); + } + + @Override + public String getDmaapPartition() { + String partition = UrnPropertiesReader.getVariable(DMAAP_PARTITION); + return (partition != null) ? partition : SDNCConstants.LCM_DMAAP_PARTITION; + } + + @Override + public String getDmaapTimeout() { + String timeout = UrnPropertiesReader.getVariable(DMAAP_TIMEOUT); + return (timeout != null) ? timeout : SDNCConstants.LCM_DMAAP_TIMEOUT; + } + + @Override + public String getDmaapEnvironment() { + String environment = UrnPropertiesReader.getVariable(DMAAP_ENVIRONMENT); + return (environment != null) ? environment : SDNCConstants.LCM_DMAAP_ENVIRONMENT; + } + + @Override + public String getDmaaPLcmReadTopic() { + String readTopic = UrnPropertiesReader.getVariable(LCM_DMAAP_READ_TOPIC); + return (readTopic != null) ? readTopic : SDNCConstants.LCM_DMAAP_READ_TOPIC; + } + + @Override + public String getDmaaPLcmWriteTopic() { + String writeTopic = UrnPropertiesReader.getVariable(LCM_DMAAP_WRITE_TOPIC); + return (writeTopic != null) ? writeTopic : SDNCConstants.LCM_DMAAP_WRITE_TOPIC; + } + + @Override + public String getKey() { + return UrnPropertiesReader.getVariable(MSO_KEY); + } + + @Override + public URL getEndpoint() throws MalformedURLException { + return new URL(getHost()); + } + + @Override + public String getSystemName() { + return SDNCConstants.SYSTEM_NAME; + } +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/common/SDNCConstants.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/common/SDNCConstants.java new file mode 100644 index 0000000000..fd9412e70e --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/common/SDNCConstants.java @@ -0,0 +1,49 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.common; + +public interface SDNCConstants { + String SYSTEM_NAME = "MSO"; + + String LCM_API_VER = "2.00"; + + String LCM_FLAGS_MODE_NORMAL = "NORMAL"; + String LCM_FLAGS_MODE_EXCLUSIVE = "EXCLUSIVE"; + + String LCM_FLAGS_FORCE_TRUE = "TRUE"; + String LCM_FLAGS_FORCE_FALSE = "FALSE"; + + int LCM_FLAGS_TTL = 65000; + + String LCM_API_BASE_PATH = "/restconf/operations/LCM:"; + + String LCM_DMAAP_MSG_VER = "1.0"; + String LCM_DMAAP_MSG_TYPE_REQUEST = "request"; + String LCM_DMAAP_MSG_TYPE_RESPONSE = "response"; + + String LCM_DMAAP_PARTITION = "MSOLCM"; + String LCM_DMAAP_TIMEOUT = "20000"; + String LCM_DMAAP_ENVIRONMENT = "TEST"; + String LCM_DMAAP_READ_TOPIC = "SDNC-LCM-WRITE"; + String LCM_DMAAP_WRITE_TOPIC = "SDNC-LCM-READ"; + + int LCM_TIMEOUT = 300; +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmClientBuilder.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmClientBuilder.java new file mode 100644 index 0000000000..5616db3577 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmClientBuilder.java @@ -0,0 +1,77 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm; + +import java.net.URI; +import org.onap.so.client.RestPropertiesLoader; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; + +public class SDNCLcmClientBuilder { + + private static Logger logger = LoggerFactory.getLogger(SDNCLcmClientBuilder.class); + + private final SDNCLcmProperties sdncLcmProperties; + + public SDNCLcmClientBuilder() { + sdncLcmProperties = RestPropertiesLoader.getInstance().getNewImpl(SDNCLcmProperties.class); + } + + public SDNCLcmClientBuilder(SDNCLcmProperties pros) { + sdncLcmProperties = pros; + } + + public SDNCLcmRestClient newSDNCLcmRestClient(String operation) throws SDNCLcmClientBuilderException { + URI pathUri; + try { + String path = sdncLcmProperties.getPath() + operation; + pathUri = new URI(path); + logger.debug("SDNC host: " + sdncLcmProperties.getHost()); + logger.debug("SDNC API path: " + pathUri.getPath()); + } catch (Exception e) { + String msg = "Error API path syntax: "; + logger.error(msg, e); + throw new SDNCLcmClientBuilderException(msg + e.toString()); + } + + try { + SDNCLcmRestClient sdncLcmRestClient = new SDNCLcmRestClient(sdncLcmProperties, pathUri); + logger.debug("Create SDNCLcmRestClient success"); + return sdncLcmRestClient; + } catch (Exception e) { + String msg = "Create SDNCLcmRestClient failure: "; + logger.error(msg, e); + throw new SDNCLcmClientBuilderException(msg + e.toString()); + } + } + + public SDNCLcmDmaapClient newSDNCLcmDmaapClient() throws SDNCLcmClientBuilderException { + try { + SDNCLcmDmaapClient sdncLcmDmaapClient = new SDNCLcmDmaapClient(sdncLcmProperties); + logger.debug("Create SDNCLcmDmaapClient success"); + return sdncLcmDmaapClient; + } catch (Exception e) { + String msg = "Create SDNCLcmDmaapClient failure: "; + logger.error(msg, e); + throw new SDNCLcmClientBuilderException(msg + e.toString()); + } + } +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmClientBuilderException.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmClientBuilderException.java new file mode 100644 index 0000000000..9160d4e352 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmClientBuilderException.java @@ -0,0 +1,30 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm; + +public class SDNCLcmClientBuilderException extends Exception { + + private static final long serialVersionUID = -1525705272349747712L; + + public SDNCLcmClientBuilderException(String message) { + super(message); + } +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmDmaapClient.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmDmaapClient.java new file mode 100644 index 0000000000..f6e4ffce59 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmDmaapClient.java @@ -0,0 +1,90 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm; + +import java.util.ArrayList; +import java.util.List; +import java.util.Properties; +import com.fasterxml.jackson.databind.ObjectMapper; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.onap.so.client.sdnc.lcm.beans.LcmDmaapRequest; +import org.onap.so.client.sdnc.lcm.beans.LcmDmaapResponse; +import org.onap.so.client.dmaap.rest.RestPublisher; +import org.onap.so.client.dmaap.rest.RestConsumer; + +public class SDNCLcmDmaapClient { + + private static Logger logger = LoggerFactory.getLogger(SDNCLcmDmaapClient.class); + + private RestPublisher dmaapPublisher; + private RestConsumer dmaapConsumer; + + public SDNCLcmDmaapClient(SDNCLcmProperties sdncLcmProperties) { + Properties properties = new Properties(); + + properties.put("host", sdncLcmProperties.getDmaapHost()); + if (sdncLcmProperties.getDmaapAuth() != null && sdncLcmProperties.getKey() != null) { + properties.put("auth", sdncLcmProperties.getDmaapAuth()); + properties.put("key", sdncLcmProperties.getKey()); + } + properties.put("partition", sdncLcmProperties.getDmaapPartition()); + properties.put("timeout", sdncLcmProperties.getDmaapTimeout()); + properties.put("environment", sdncLcmProperties.getDmaapEnvironment()); + + properties.put("topic", sdncLcmProperties.getDmaaPLcmWriteTopic()); + dmaapPublisher = new RestPublisher(properties); + + properties.put("topic", sdncLcmProperties.getDmaaPLcmReadTopic()); + dmaapConsumer = new RestConsumer(properties); + } + + public void sendRequest(LcmDmaapRequest lcmDmaapRequest) throws Exception { + ObjectMapper mapper = new ObjectMapper(); + String lcmRestRequestString = mapper.writeValueAsString(lcmDmaapRequest); + + dmaapPublisher.send(lcmRestRequestString); + } + + public Iterable<String> fetch() { + return dmaapConsumer.fetch(); + } + + public List<LcmDmaapResponse> getResponse() { + List<LcmDmaapResponse> responseList = new ArrayList<>(); + + ObjectMapper mapper = new ObjectMapper(); + Iterable<String> itrString = dmaapConsumer.fetch(); + for (String message : itrString) { + LcmDmaapResponse lcmDmaapResponse; + try { + lcmDmaapResponse = mapper.readValue(message, LcmDmaapResponse.class); + } catch (Exception e) { + logger.warn("Invalid SDNC LCM DMaaP response: " + message); + continue; + } + + responseList.add(lcmDmaapResponse); + } + + return responseList; + } +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmMessageBuilder.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmMessageBuilder.java new file mode 100644 index 0000000000..bf1229a310 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmMessageBuilder.java @@ -0,0 +1,87 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm; + +import java.time.Instant; +import org.onap.so.client.sdnc.common.SDNCConstants; +import org.onap.so.client.sdnc.lcm.beans.*; + +public class SDNCLcmMessageBuilder { + + public static LcmFlags getSDNCFlags() { + LcmFlags lcmFlags = new LcmFlags(); + + lcmFlags.setMode(SDNCConstants.LCM_FLAGS_MODE_NORMAL); + lcmFlags.setForce(SDNCConstants.LCM_FLAGS_FORCE_FALSE); + lcmFlags.setTtl(SDNCConstants.LCM_FLAGS_TTL); + + return lcmFlags; + } + + public static LcmCommonHeader buildLcmCommonHeader(String requestId, String subRequestId) { + LcmCommonHeader lcmCommonHeader = new LcmCommonHeader(); + + lcmCommonHeader.setApiVer(SDNCConstants.LCM_API_VER); + lcmCommonHeader.setOriginatorId(SDNCConstants.SYSTEM_NAME); + lcmCommonHeader.setRequestId(requestId); + lcmCommonHeader.setSubRequestId(subRequestId); + lcmCommonHeader.setFlags(getSDNCFlags()); + lcmCommonHeader.setTimestamp(Instant.now().toString()); + + return lcmCommonHeader; + } + + public static LcmInput buildLcmInputForPnf(String requestId, String subRequestId, String pnfName, String action, + String payload) { + LcmInput lcmInput = new LcmInput(); + + LcmCommonHeader lcmCommonHeader = buildLcmCommonHeader(requestId, subRequestId); + + LcmActionIdentifiers sdncActionIdentifiers = new LcmActionIdentifiers(); + sdncActionIdentifiers.setPnfName(pnfName); + + lcmInput.setCommonHeader(lcmCommonHeader); + lcmInput.setAction(action); + lcmInput.setActionIdentifiers(sdncActionIdentifiers); + lcmInput.setPayload(payload); + + return lcmInput; + } + + public static LcmDmaapRequest buildLcmDmaapRequest(String operation, LcmInput lcmInput) { + LcmDmaapRequest lcmDmaapRequest = new LcmDmaapRequest(); + + LcmRestRequest lcmRestRequest = new LcmRestRequest(); + lcmRestRequest.setInput(lcmInput); + + String correlationId = + lcmInput.getCommonHeader().getRequestId() + "-" + lcmInput.getCommonHeader().getSubRequestId(); + + lcmDmaapRequest.setVersion(SDNCConstants.LCM_DMAAP_MSG_VER); + lcmDmaapRequest.setType(SDNCConstants.LCM_DMAAP_MSG_TYPE_REQUEST); + lcmDmaapRequest.setCambriaPartition(SDNCConstants.SYSTEM_NAME); + lcmDmaapRequest.setCorrelationId(correlationId); + lcmDmaapRequest.setRpcName(operation); + lcmDmaapRequest.setBody(lcmRestRequest); + + return lcmDmaapRequest; + } +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmProperties.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmProperties.java new file mode 100644 index 0000000000..df5fb3be0b --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmProperties.java @@ -0,0 +1,47 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm; + +import org.onap.so.client.RestProperties; + +public interface SDNCLcmProperties extends RestProperties { + String getHost(); + + String getPath(); + + String getBasicAuth(); + + String getDmaapHost(); + + String getDmaapAuth(); + + String getDmaapPartition(); + + String getDmaapTimeout(); + + String getDmaapEnvironment(); + + String getDmaaPLcmReadTopic(); + + String getDmaaPLcmWriteTopic(); + + String getKey(); +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmRestClient.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmRestClient.java new file mode 100644 index 0000000000..3faf58ec28 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmRestClient.java @@ -0,0 +1,67 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm; + +import java.net.URI; +import java.util.Map; +import java.util.Optional; +import org.onap.so.client.RestClient; +import org.onap.logging.filter.base.ONAPComponents; +import org.onap.so.client.sdnc.lcm.beans.LcmInput; +import org.onap.so.client.sdnc.lcm.beans.LcmOutput; +import org.onap.so.client.sdnc.lcm.beans.LcmRestRequest; +import org.onap.so.client.sdnc.lcm.beans.LcmRestResponse; + +public class SDNCLcmRestClient extends RestClient { + + private final SDNCLcmProperties sdncLcmProperties; + + public SDNCLcmRestClient(SDNCLcmProperties props, URI path) { + this(props, path, "application/json", "application/json"); + } + + public SDNCLcmRestClient(SDNCLcmProperties props, URI path, String accept, String contentType) { + super(props, Optional.of(path), accept, contentType); + this.sdncLcmProperties = props; + } + + @Override + protected void initializeHeaderMap(Map<String, String> headerMap) { + headerMap.put("Authorization", sdncLcmProperties.getBasicAuth()); + } + + @Override + public ONAPComponents getTargetEntity() { + return ONAPComponents.SDNC; + } + + public LcmRestResponse sendRequest(LcmRestRequest lcmRestRequest) { + return post(lcmRestRequest, LcmRestResponse.class); + } + + public LcmOutput sendRequest(LcmInput lcmInput) { + LcmRestRequest lcmRestRequest = new LcmRestRequest(); + lcmRestRequest.setInput(lcmInput); + + LcmRestResponse lcmRestResponse = sendRequest(lcmRestRequest); + return lcmRestResponse.getOutput(); + } +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmActionIdentifiers.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmActionIdentifiers.java new file mode 100644 index 0000000000..883fd02c78 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmActionIdentifiers.java @@ -0,0 +1,97 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm.beans; + +import com.fasterxml.jackson.annotation.JsonInclude; +import com.fasterxml.jackson.annotation.JsonProperty; +import com.fasterxml.jackson.annotation.JsonPropertyOrder; + +@JsonInclude(JsonInclude.Include.NON_NULL) +@JsonPropertyOrder({"serviceInstanceId", "vnfId", "vfModuleId", "vnfcName", "vserverId", "pnfName"}) +public class LcmActionIdentifiers { + + @JsonProperty("service-instance-id") + private String serviceInstanceId; + + @JsonProperty("vnf-id") + private String vnfId; + + @JsonProperty("vf-module-id") + private String vfModuleId; + + @JsonProperty("vnfc-name") + private String vnfcName; + + @JsonProperty("vserver-id") + private String vserverId; + + @JsonProperty("pnf-name") + private String pnfName; + + public String getServiceInstanceId() { + return serviceInstanceId; + } + + public void setServiceInstanceId(String value) { + this.serviceInstanceId = value; + } + + public String getVnfId() { + return vnfId; + } + + public void setVnfId(String value) { + this.vnfId = value; + } + + public String getVfModuleId() { + return vfModuleId; + } + + public void setVfModuleId(String value) { + this.vfModuleId = value; + } + + public String getVnfcName() { + return vnfcName; + } + + public void setVnfcName(String value) { + this.vnfcName = value; + } + + public String getVserverId() { + return vserverId; + } + + public void setVserverId(String value) { + this.vserverId = value; + } + + public String getPnfName() { + return pnfName; + } + + public void setPnfName(String value) { + this.pnfName = value; + } + +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmCommonHeader.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmCommonHeader.java new file mode 100644 index 0000000000..f3fd2ca11d --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmCommonHeader.java @@ -0,0 +1,97 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm.beans; + +import com.fasterxml.jackson.annotation.JsonInclude; +import com.fasterxml.jackson.annotation.JsonProperty; +import com.fasterxml.jackson.annotation.JsonPropertyOrder; + +@JsonInclude(JsonInclude.Include.NON_NULL) +@JsonPropertyOrder({"apiVer", "flags", "originatorId", "requestId", "subRequestId", "timestamp"}) +public class LcmCommonHeader { + + @JsonProperty(value = "api-ver", required = true) + private String apiVer; + + @JsonProperty(value = "flags") + private LcmFlags flags; + + @JsonProperty(value = "originator-id", required = true) + private String originatorId; + + @JsonProperty(value = "request-id", required = true) + private String requestId; + + @JsonProperty(value = "sub-request-id") + private String subRequestId; + + @JsonProperty(value = "timestamp", required = true) + private String timestamp; + + public String getApiVer() { + return apiVer; + } + + public void setApiVer(String value) { + this.apiVer = value; + } + + public String getOriginatorId() { + return originatorId; + } + + public void setOriginatorId(String value) { + this.originatorId = value; + } + + public String getRequestId() { + return requestId; + } + + public void setRequestId(String value) { + this.requestId = value; + } + + public String getSubRequestId() { + return subRequestId; + } + + public void setSubRequestId(String value) { + this.subRequestId = value; + } + + public LcmFlags getFlags() { + return flags; + } + + public void setFlags(LcmFlags value) { + this.flags = value; + } + + public String getTimestamp() { + return timestamp; + } + + public void setTimestamp(String value) { + this.timestamp = value; + } + +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapRequest.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapRequest.java new file mode 100644 index 0000000000..db62e8b20b --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapRequest.java @@ -0,0 +1,97 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm.beans; + +import com.fasterxml.jackson.annotation.JsonInclude; +import com.fasterxml.jackson.annotation.JsonProperty; +import com.fasterxml.jackson.annotation.JsonPropertyOrder; + +@JsonInclude(JsonInclude.Include.NON_NULL) +@JsonPropertyOrder({"version", "type", "cambriaPartition", "correlationId", "rpcName", "body"}) +public class LcmDmaapRequest { + + @JsonProperty(value = "version", required = true) + private String version; + + @JsonProperty(value = "type", required = true) + private String type; + + @JsonProperty(value = "cambria.partition", required = true) + private String cambriaPartition; + + @JsonProperty(value = "correlation-id", required = true) + private String correlationId; + + @JsonProperty(value = "rpc-name", required = true) + private String rpcName; + + @JsonProperty(value = "body") + private LcmRestRequest body; + + public String getVersion() { + return version; + } + + public void setVersion(String value) { + this.version = value; + } + + public String getType() { + return type; + } + + public void setType(String value) { + this.type = value; + } + + public String getCambriaPartition() { + return cambriaPartition; + } + + public void setCambriaPartition(String value) { + this.cambriaPartition = value; + } + + public String getCorrelationId() { + return correlationId; + } + + public void setCorrelationId(String value) { + this.correlationId = value; + } + + public String getRpcName() { + return rpcName; + } + + public void setRpcName(String value) { + this.rpcName = value; + } + + public LcmRestRequest getBody() { + return body; + } + + public void setBody(LcmRestRequest value) { + this.body = value; + } + +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapResponse.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapResponse.java new file mode 100644 index 0000000000..35f4a26b17 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapResponse.java @@ -0,0 +1,97 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm.beans; + +import com.fasterxml.jackson.annotation.JsonInclude; +import com.fasterxml.jackson.annotation.JsonProperty; +import com.fasterxml.jackson.annotation.JsonPropertyOrder; + +@JsonInclude(JsonInclude.Include.NON_NULL) +@JsonPropertyOrder({"version", "type", "cambriaPartition", "correlationId", "rpcName", "body"}) +public class LcmDmaapResponse { + + @JsonProperty(value = "version", required = true) + private String version; + + @JsonProperty(value = "type", required = true) + private String type; + + @JsonProperty(value = "cambria.partition", required = true) + private String cambriaPartition; + + @JsonProperty(value = "correlation-id", required = true) + private String correlationId; + + @JsonProperty(value = "rpc-name", required = true) + private String rpcName; + + @JsonProperty(value = "body") + private LcmRestResponse body; + + public String getVersion() { + return version; + } + + public void setVersion(String value) { + this.version = value; + } + + public String getType() { + return type; + } + + public void setType(String value) { + this.type = value; + } + + public String getCambriaPartition() { + return cambriaPartition; + } + + public void setCambriaPartition(String value) { + this.cambriaPartition = value; + } + + public String getCorrelationId() { + return correlationId; + } + + public void setCorrelationId(String value) { + this.correlationId = value; + } + + public String getRpcName() { + return rpcName; + } + + public void setRpcName(String value) { + this.rpcName = value; + } + + public LcmRestResponse getBody() { + return body; + } + + public void setBody(LcmRestResponse value) { + this.body = value; + } + +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmFlags.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmFlags.java new file mode 100644 index 0000000000..36527ec887 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmFlags.java @@ -0,0 +1,64 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm.beans; + +import com.fasterxml.jackson.annotation.JsonInclude; +import com.fasterxml.jackson.annotation.JsonProperty; +import com.fasterxml.jackson.annotation.JsonPropertyOrder; + +@JsonInclude(JsonInclude.Include.NON_NULL) +@JsonPropertyOrder({"mode", "force", "ttl"}) +public class LcmFlags { + + @JsonProperty("mode") + private String mode; + + @JsonProperty("force") + private String force; + + @JsonProperty("ttl") + private int ttl; + + public String getMode() { + return mode; + } + + public void setMode(String value) { + this.mode = value; + } + + public String getForce() { + return force; + } + + public void setForce(String value) { + this.force = value; + } + + public Integer getTtl() { + return ttl; + } + + public void setTtl(Integer value) { + this.ttl = value; + } + +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmInput.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmInput.java new file mode 100644 index 0000000000..6634430bed --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmInput.java @@ -0,0 +1,75 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm.beans; + +import com.fasterxml.jackson.annotation.JsonInclude; +import com.fasterxml.jackson.annotation.JsonProperty; +import com.fasterxml.jackson.annotation.JsonPropertyOrder; + +@JsonInclude(JsonInclude.Include.NON_NULL) +@JsonPropertyOrder({"commonHeader", "action", "actionIdentifiers", "payload"}) +public class LcmInput { + + @JsonProperty(value = "common-header", required = true) + private LcmCommonHeader commonHeader; + + @JsonProperty(value = "action", required = true) + private String action; + + @JsonProperty(value = "action-identifiers", required = true) + private LcmActionIdentifiers actionIdentifiers; + + @JsonProperty(value = "payload") + private String payload; + + public LcmCommonHeader getCommonHeader() { + return commonHeader; + } + + public void setCommonHeader(LcmCommonHeader value) { + this.commonHeader = value; + } + + public String getAction() { + return action; + } + + public void setAction(String value) { + this.action = value; + } + + public LcmActionIdentifiers getActionIdentifiers() { + return actionIdentifiers; + } + + public void setActionIdentifiers(LcmActionIdentifiers value) { + this.actionIdentifiers = value; + } + + public String getPayload() { + return payload; + } + + public void setPayload(String value) { + this.payload = value; + } + +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmOutput.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmOutput.java new file mode 100644 index 0000000000..3741786671 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmOutput.java @@ -0,0 +1,64 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm.beans; + +import com.fasterxml.jackson.annotation.JsonInclude; +import com.fasterxml.jackson.annotation.JsonProperty; +import com.fasterxml.jackson.annotation.JsonPropertyOrder; + +@JsonInclude(JsonInclude.Include.NON_NULL) +@JsonPropertyOrder({"commonHeader", "status", "payload"}) +public class LcmOutput { + + @JsonProperty(value = "common-header", required = true) + private LcmCommonHeader commonHeader; + + @JsonProperty(value = "status", required = true) + private LcmStatus status; + + @JsonProperty(value = "payload") + private String payload; + + public LcmCommonHeader getCommonHeader() { + return commonHeader; + } + + public void setCommonHeader(LcmCommonHeader value) { + this.commonHeader = value; + } + + public LcmStatus getStatus() { + return status; + } + + public void setStatus(LcmStatus value) { + this.status = value; + } + + public String getPayload() { + return payload; + } + + public void setPayload(String value) { + this.payload = value; + } + +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmRestRequest.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmRestRequest.java new file mode 100644 index 0000000000..146eb8a4f6 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmRestRequest.java @@ -0,0 +1,42 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm.beans; + +import com.fasterxml.jackson.annotation.JsonInclude; +import com.fasterxml.jackson.annotation.JsonProperty; +import com.fasterxml.jackson.annotation.JsonPropertyOrder; + +@JsonInclude(JsonInclude.Include.NON_NULL) +@JsonPropertyOrder({"input"}) +public class LcmRestRequest { + + @JsonProperty(value = "input", required = true) + private LcmInput input; + + public LcmInput getInput() { + return input; + } + + public void setInput(LcmInput value) { + this.input = value; + } + +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmRestResponse.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmRestResponse.java new file mode 100644 index 0000000000..6920f95ce2 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmRestResponse.java @@ -0,0 +1,42 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm.beans; + +import com.fasterxml.jackson.annotation.JsonInclude; +import com.fasterxml.jackson.annotation.JsonProperty; +import com.fasterxml.jackson.annotation.JsonPropertyOrder; + +@JsonInclude(JsonInclude.Include.NON_NULL) +@JsonPropertyOrder({"output"}) +public class LcmRestResponse { + + @JsonProperty(value = "output", required = true) + private LcmOutput output; + + public LcmOutput getOutput() { + return output; + } + + public void setOutput(LcmOutput value) { + this.output = value; + } + +} diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmStatus.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmStatus.java new file mode 100644 index 0000000000..8a2a142792 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmStatus.java @@ -0,0 +1,53 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm.beans; + +import com.fasterxml.jackson.annotation.JsonInclude; +import com.fasterxml.jackson.annotation.JsonProperty; +import com.fasterxml.jackson.annotation.JsonPropertyOrder; + +@JsonInclude(JsonInclude.Include.NON_NULL) +@JsonPropertyOrder({"code", "message"}) +public class LcmStatus { + + @JsonProperty(value = "code", required = true) + private int code; + + @JsonProperty(value = "message", required = true) + private String message; + + public int getCode() { + return code; + } + + public void setCode(int value) { + this.code = value; + } + + public String getMessage() { + return message; + } + + public void setMessage(String value) { + this.message = value; + } + +} diff --git a/bpmn/MSOCommonBPMN/src/main/resources/META-INF/services/org.onap.so.client.RestProperties b/bpmn/MSOCommonBPMN/src/main/resources/META-INF/services/org.onap.so.client.RestProperties index 27da189456..147bc2ee95 100644 --- a/bpmn/MSOCommonBPMN/src/main/resources/META-INF/services/org.onap.so.client.RestProperties +++ b/bpmn/MSOCommonBPMN/src/main/resources/META-INF/services/org.onap.so.client.RestProperties @@ -1,3 +1,4 @@ org.onap.so.client.restproperties.AAIPropertiesImpl org.onap.so.client.restproperties.CDSPropertiesImpl -org.onap.so.client.restproperties.PolicyRestPropertiesImpl
\ No newline at end of file +org.onap.so.client.restproperties.PolicyRestPropertiesImpl +org.onap.so.client.restproperties.SDNCLcmPropertiesImpl diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/AbstractCDSProcessingBBUtilsTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/AbstractCDSProcessingBBUtilsTest.java index f558932d33..10844ec652 100644 --- a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/AbstractCDSProcessingBBUtilsTest.java +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/AbstractCDSProcessingBBUtilsTest.java @@ -34,6 +34,7 @@ import org.junit.runner.RunWith; import org.mockito.InjectMocks; import org.mockito.Mock; import org.mockito.junit.MockitoJUnitRunner; +import org.onap.so.bpmn.common.BuildingBlockExecution; import org.onap.so.client.cds.beans.AbstractCDSPropertiesBean; import org.onap.so.client.exception.ExceptionBuilder; @@ -69,7 +70,7 @@ public class AbstractCDSProcessingBBUtilsTest { } @Test - public void preProcessRequestTest() throws Exception { + public void preProcessRequestDETest() throws Exception { DelegateExecution execution = mock(DelegateExecution.class); when(execution.getVariable("executionObject")).thenReturn(abstractCDSPropertiesBean); @@ -80,7 +81,7 @@ public class AbstractCDSProcessingBBUtilsTest { } @Test - public void sendRequestToCDSClientTest() { + public void sendRequestToCDSClientDETest() { DelegateExecution execution = mock(DelegateExecution.class); when(execution.getVariable("executionServiceInput")).thenReturn(abstractCDSPropertiesBean); @@ -90,4 +91,26 @@ public class AbstractCDSProcessingBBUtilsTest { } + @Test + public void preProcessRequestBBTest() throws Exception { + + BuildingBlockExecution execution = mock(BuildingBlockExecution.class); + when(execution.getVariable("executionObject")).thenReturn(abstractCDSPropertiesBean); + + abstractCDSProcessingBBUtils.constructExecutionServiceInputObject(execution); + verify(exceptionUtil, times(0)).buildAndThrowWorkflowException(any(BuildingBlockExecution.class), anyInt(), + any(Exception.class)); + } + + @Test + public void sendRequestToCDSClientBBTest() { + + BuildingBlockExecution execution = mock(BuildingBlockExecution.class); + when(execution.getVariable("executionServiceInput")).thenReturn(abstractCDSPropertiesBean); + abstractCDSProcessingBBUtils.sendRequestToCDSClient(execution); + verify(exceptionUtil, times(1)).buildAndThrowWorkflowException(any(BuildingBlockExecution.class), anyInt(), + any(Exception.class)); + + } + } diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/AbstractVnfCDSRequestProviderTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/AbstractVnfCDSRequestProviderTest.java new file mode 100644 index 0000000000..9c3ce60400 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/AbstractVnfCDSRequestProviderTest.java @@ -0,0 +1,205 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.cds; + +import com.google.gson.JsonParser; +import org.camunda.bpm.engine.delegate.DelegateExecution; +import org.camunda.bpm.extension.mockito.delegate.DelegateExecutionFake; +import org.junit.Before; +import org.junit.runner.RunWith; +import org.mockito.Mock; +import org.mockito.junit.MockitoJUnitRunner; +import org.onap.so.bpmn.common.BuildingBlockExecution; +import org.onap.so.bpmn.common.DelegateExecutionImpl; +import org.onap.so.bpmn.servicedecomposition.bbobjects.GenericVnf; +import org.onap.so.bpmn.servicedecomposition.bbobjects.ServiceInstance; +import org.onap.so.bpmn.servicedecomposition.bbobjects.VfModule; +import org.onap.so.bpmn.servicedecomposition.entities.BuildingBlock; +import org.onap.so.bpmn.servicedecomposition.entities.ExecuteBuildingBlock; +import org.onap.so.bpmn.servicedecomposition.entities.GeneralBuildingBlock; +import org.onap.so.bpmn.servicedecomposition.generalobjects.RequestContext; +import org.onap.so.bpmn.servicedecomposition.generalobjects.RequestParameters; +import org.onap.so.bpmn.servicedecomposition.modelinfo.ModelInfoGenericVnf; +import org.onap.so.bpmn.servicedecomposition.modelinfo.ModelInfoServiceInstance; +import org.onap.so.bpmn.servicedecomposition.modelinfo.ModelInfoVfModule; +import org.onap.so.bpmn.servicedecomposition.tasks.ExtractPojosForBB; +import org.onap.so.serviceinstancebeans.*; +import java.util.ArrayList; +import java.util.HashMap; +import java.util.List; +import java.util.Map; + +@RunWith(MockitoJUnitRunner.Silent.class) +public abstract class AbstractVnfCDSRequestProviderTest { + + protected static final String GENERIC_VNF_ID = "vnfId_configVnfTest1"; + protected static final String VF_MODULE_ID = "vf-module-id-1"; + protected static final String VF_MODULE_NAME = "vf-module-name-1"; + protected static final String VF_MODULE_CUSTOMIZATION_UUID = "23ce9ac4-e5dd-11e9-81b4-2a2ae2dbcce1"; + protected static final String GENERIC_VNF_NAME = "vnf-name-1"; + protected static final String SERVICE_INSTANCE_ID = "serviceInst_configTest"; + protected static final String SERVICE_MODEL_UUID = "b45b5780-e5dd-11e9-81b4-2a2ae2dbcce4"; + protected static final String SERVICE_INSTANCE_NAME = "test-service-instance"; + protected static final String VNF_MODEL_CUSTOMIZATION_UUID = "23ce9ac4-e5dd-11e9-81b4-2a2ae2dbcce4"; + protected static final String GENERAL_BLOCK_EXECUTION_MAP_KEY = "gBBInput"; + protected static final String VNF_SCOPE = "vnf"; + protected static final String SERVICE_SCOPE = "service"; + protected static final String SERVICE_ACTION = "create"; + protected static final String VF_SCOPE = "vfModule"; + protected static final String ASSIGN_ACTION = "configAssign"; + protected static final String DEPLOY_ACTION = "configDeploy"; + protected static final String MSO_REQUEST_ID = "1234"; + protected static final String BUILDING_BLOCK = "buildingBlock"; + protected static final String PUBLIC_NET_ID = "public-net-id"; + protected static final String CLOUD_REGION = "acl-cloud-region"; + + @Mock + protected ExtractPojosForBB extractPojosForBB; + + protected BuildingBlockExecution buildingBlockExecution; + + protected ExecuteBuildingBlock executeBuildingBlock; + + + @Before + public void setUp() { + buildingBlockExecution = createBuildingBlockExecution(); + executeBuildingBlock = new ExecuteBuildingBlock(); + } + + protected BuildingBlockExecution createBuildingBlockExecution() { + DelegateExecution execution = new DelegateExecutionFake(); + execution.setVariable(GENERAL_BLOCK_EXECUTION_MAP_KEY, createGeneralBuildingBlock()); + return new DelegateExecutionImpl(execution); + } + + protected GeneralBuildingBlock createGeneralBuildingBlock() { + GeneralBuildingBlock generalBuildingBlock = new GeneralBuildingBlock(); + RequestContext requestContext = new RequestContext(); + RequestParameters requestParameters = new RequestParameters(); + requestParameters.setUserParams(createRequestUserParams()); + requestContext.setRequestParameters(requestParameters); + requestContext.setMsoRequestId(MSO_REQUEST_ID); + generalBuildingBlock.setRequestContext(requestContext); + return generalBuildingBlock; + } + + protected ServiceInstance createServiceInstance() { + ServiceInstance serviceInstance = new ServiceInstance(); + serviceInstance.setServiceInstanceName(SERVICE_INSTANCE_NAME); + serviceInstance.setServiceInstanceId(SERVICE_INSTANCE_ID); + ModelInfoServiceInstance modelInfoServiceInstance = new ModelInfoServiceInstance(); + modelInfoServiceInstance.setModelUuid(SERVICE_MODEL_UUID); + serviceInstance.setModelInfoServiceInstance(modelInfoServiceInstance); + return serviceInstance; + } + + protected GenericVnf createGenericVnf() { + GenericVnf genericVnf = new GenericVnf(); + genericVnf.setVnfId(GENERIC_VNF_ID); + genericVnf.setVnfName(GENERIC_VNF_NAME); + genericVnf.setBlueprintName("test"); + genericVnf.setBlueprintVersion("1.0.0"); + ModelInfoGenericVnf modelInfoGenericVnf = new ModelInfoGenericVnf(); + modelInfoGenericVnf.setModelCustomizationUuid(VNF_MODEL_CUSTOMIZATION_UUID); + genericVnf.setModelInfoGenericVnf(modelInfoGenericVnf); + return genericVnf; + } + + protected VfModule createVfModule() { + VfModule vfModule = new VfModule(); + vfModule.setVfModuleId(VF_MODULE_ID); + vfModule.setVfModuleName(VF_MODULE_NAME); + ModelInfoVfModule modelInfoVfModule = new ModelInfoVfModule(); + modelInfoVfModule.setModelCustomizationUUID(VF_MODULE_CUSTOMIZATION_UUID); + vfModule.setModelInfoVfModule(modelInfoVfModule); + return vfModule; + } + + protected List<Map<String, Object>> createRequestUserParams() { + List<Map<String, Object>> userParams = new ArrayList<>(); + Map<String, Object> userParamMap = new HashMap<>(); + userParamMap.put("service", getUserParams()); + userParams.add(userParamMap); + return userParams; + } + + protected Service getUserParams() { + Service service = new Service(); + Resources resources = new Resources(); + resources.setVnfs(createVnfList()); + service.setResources(resources); + return service; + } + + protected List<Vnfs> createVnfList() { + List<Map<String, String>> instanceParamsListSearchedVnf = new ArrayList<>(); + Map<String, String> instanceParam = new HashMap<>(); + instanceParam.put("public_net_id", PUBLIC_NET_ID); + instanceParam.put("acl-cloud-region", CLOUD_REGION); + instanceParamsListSearchedVnf.add(instanceParam); + Vnfs searchedVnf = createVnf(instanceParamsListSearchedVnf); + List<Vnfs> vnfList = new ArrayList<>(); + vnfList.add(searchedVnf); + return vnfList; + } + + protected Vnfs createVnf(List<Map<String, String>> instanceParamsList) { + Vnfs vnf = new Vnfs(); + ModelInfo modelInfo = new ModelInfo(); + modelInfo.setModelCustomizationId(VNF_MODEL_CUSTOMIZATION_UUID); + vnf.setModelInfo(modelInfo); + vnf.setInstanceParams(instanceParamsList); + + // Set instance parameters and modelinfo for vf-module + VfModules vfModule = new VfModules(); + ModelInfo modelInfoForVfModule = new ModelInfo(); + modelInfoForVfModule.setModelCustomizationId(VF_MODULE_CUSTOMIZATION_UUID); + vfModule.setModelInfo(modelInfoForVfModule); + + List<Map<String, String>> instanceParamsListSearchedVfModule = new ArrayList<>(); + Map<String, String> instanceParams = new HashMap<>(); + instanceParams.put("public-net-vf-module-id", PUBLIC_NET_ID); + instanceParams.put("aci-cloud-region-vf-module", CLOUD_REGION); + + instanceParamsListSearchedVfModule.add(instanceParams); + vfModule.setInstanceParams(instanceParamsListSearchedVfModule); + + List<VfModules> vfModules = new ArrayList<>(); + vfModules.add(vfModule); + + vnf.setVfModules(vfModules); + + return vnf; + } + + protected boolean verfiyJsonFromString(String payload) { + JsonParser parser = new JsonParser(); + return parser.parse(payload).isJsonObject(); + } + + protected void setScopeAndAction(String scope, String action) { + BuildingBlock buildingBlock = new BuildingBlock(); + buildingBlock.setBpmnScope(scope); + buildingBlock.setBpmnAction(action); + executeBuildingBlock.setBuildingBlock(buildingBlock); + buildingBlockExecution.setVariable(BUILDING_BLOCK, executeBuildingBlock); + } +} diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/ConfigureInstanceParamsForVfModuleTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/ConfigureInstanceParamsForVfModuleTest.java new file mode 100644 index 0000000000..9baf5dc5bf --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/ConfigureInstanceParamsForVfModuleTest.java @@ -0,0 +1,127 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Bell Canada + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.cds; + +import com.google.gson.JsonObject; +import org.junit.Test; +import org.junit.runner.RunWith; +import org.mockito.InjectMocks; +import org.mockito.Mock; +import org.mockito.junit.MockitoJUnitRunner; +import org.onap.so.bpmn.servicedecomposition.entities.ResourceKey; +import org.onap.so.serviceinstancebeans.ModelInfo; +import org.onap.so.serviceinstancebeans.Resources; +import org.onap.so.serviceinstancebeans.Service; +import org.onap.so.serviceinstancebeans.VfModules; +import org.onap.so.serviceinstancebeans.Vnfs; +import java.util.ArrayList; +import java.util.HashMap; +import java.util.List; +import java.util.Map; +import static org.junit.Assert.assertEquals; +import static org.mockito.ArgumentMatchers.anyList; +import static org.mockito.Mockito.doReturn; + +@RunWith(MockitoJUnitRunner.Silent.class) +public class ConfigureInstanceParamsForVfModuleTest { + + @InjectMocks + private ConfigureInstanceParamsForVfModule configureInstanceParamsForVfModule; + + @Mock + private ExtractServiceFromUserParameters extractServiceFromUserParameters; + + private static final String TEST_VNF_MODEL_CUSTOMIZATION_UUID = "23ce9ac4-e5dd-11e9-81b4-2a2ae2dbcce4"; + private static final String TEST_VF_MODULE_CUSTOMIZATION_UUID = "23ce9ac4-e5dd-11e9-81b4-2a2ae2dbcce2"; + private static final String TEST_INSTANCE_PARAM_VALUE_1 = "vf-module-1-value"; + private static final String TEST_INSTANCE_PARAM_VALUE_2 = "vf-module-2-value"; + private static final String TEST_INSTANCE_PARAM_KEY_1 = "instance-param-1"; + private static final String TEST_INSTANCE_PARAM_KEY_2 = "instance-param-2"; + + @Test + public void testInstanceParamsForVfModule() throws Exception { + // given + List<Map<String, Object>> userParamsFromRequest = createRequestParameters(); + JsonObject jsonObject = new JsonObject(); + doReturn(getUserParams()).when(extractServiceFromUserParameters).getServiceFromRequestUserParams(anyList()); + + // when + configureInstanceParamsForVfModule.populateInstanceParams(jsonObject, userParamsFromRequest, + TEST_VNF_MODEL_CUSTOMIZATION_UUID, TEST_VF_MODULE_CUSTOMIZATION_UUID); + + // verify + assertEquals(TEST_INSTANCE_PARAM_VALUE_1, jsonObject.get(TEST_INSTANCE_PARAM_KEY_1).getAsString()); + assertEquals(TEST_INSTANCE_PARAM_VALUE_2, jsonObject.get(TEST_INSTANCE_PARAM_KEY_2).getAsString()); + } + + private List<Map<String, Object>> createRequestParameters() { + List<Map<String, Object>> userParams = new ArrayList<>(); + Map<String, Object> userParamMap = new HashMap<>(); + userParamMap.put("service", getUserParams()); + userParams.add(userParamMap); + return userParams; + } + + private Service getUserParams() { + Service service = new Service(); + Resources resources = new Resources(); + resources.setVnfs(createVnfs()); + service.setResources(resources); + return service; + } + + private List<Vnfs> createVnfs() { + Vnfs searchedVnf = createVnf(); + List<Vnfs> vnfList = new ArrayList<>(); + vnfList.add(searchedVnf); + return vnfList; + } + + private Vnfs createVnf() { + Vnfs vnf = new Vnfs(); + ModelInfo modelInfoForVnf = new ModelInfo(); + modelInfoForVnf.setModelCustomizationId(TEST_VNF_MODEL_CUSTOMIZATION_UUID); + vnf.setModelInfo(modelInfoForVnf); + + VfModules vfModule = new VfModules(); + + ModelInfo modelInfoForVfModule = new ModelInfo(); + modelInfoForVfModule.setModelCustomizationId(TEST_VF_MODULE_CUSTOMIZATION_UUID); + + vfModule.setModelInfo(modelInfoForVfModule); + + // Set instance parameters. + List<Map<String, String>> instanceParamsListSearchedVfModule = new ArrayList<>(); + Map<String, String> instanceParams = new HashMap<>(); + instanceParams.put("instance-param-1", TEST_INSTANCE_PARAM_VALUE_1); + instanceParams.put("instance-param-2", TEST_INSTANCE_PARAM_VALUE_2); + + instanceParamsListSearchedVfModule.add(instanceParams); + vfModule.setInstanceParams(instanceParamsListSearchedVfModule); + + List<VfModules> vfModules = new ArrayList<>(); + vfModules.add(vfModule); + + vnf.setVfModules(vfModules); + + return vnf; + } +} diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/GeneratePayloadForCdsTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/GeneratePayloadForCdsTest.java new file mode 100644 index 0000000000..998976589c --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/GeneratePayloadForCdsTest.java @@ -0,0 +1,342 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Bell Canada. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ +package org.onap.so.client.cds; + +import org.camunda.bpm.engine.delegate.DelegateExecution; +import org.camunda.bpm.extension.mockito.delegate.DelegateExecutionFake; +import org.junit.Before; +import org.junit.Test; +import org.junit.runner.RunWith; +import org.mockito.InjectMocks; +import org.mockito.Mock; +import org.mockito.junit.MockitoJUnitRunner; +import org.onap.so.bpmn.common.BuildingBlockExecution; +import org.onap.so.bpmn.common.DelegateExecutionImpl; +import org.onap.so.bpmn.servicedecomposition.entities.BuildingBlock; +import org.onap.so.bpmn.servicedecomposition.entities.ExecuteBuildingBlock; +import org.onap.so.bpmn.servicedecomposition.entities.GeneralBuildingBlock; +import org.onap.so.bpmn.servicedecomposition.generalobjects.RequestContext; +import org.onap.so.bpmn.servicedecomposition.generalobjects.RequestParameters; +import org.onap.so.client.cds.beans.AbstractCDSPropertiesBean; +import org.onap.so.client.exception.PayloadGenerationException; +import org.onap.so.serviceinstancebeans.*; +import java.util.*; +import static org.assertj.core.api.Assertions.assertThat; +import static org.assertj.core.api.ThrowableAssert.catchThrowable; +import static org.junit.Assert.assertNotNull; +import static org.mockito.Mockito.doReturn; +import static org.mockito.Mockito.doThrow; + +@RunWith(MockitoJUnitRunner.Silent.class) +public class GeneratePayloadForCdsTest { + private static final String VF_MODULE_CUSTOMIZATION_UUID = "23ce9ac4-e5dd-11e9-81b4-2a2ae2dbcce1"; + private static final String VNF_MODEL_CUSTOMIZATION_UUID = "23ce9ac4-e5dd-11e9-81b4-2a2ae2dbcce4"; + private static final String GENERAL_BLOCK_EXECUTION_MAP_KEY = "gBBInput"; + private static final String VNF_SCOPE = "vnf"; + private static final String SERVICE_SCOPE = "service"; + private static final String SERVICE_ACTION = "create"; + private static final String VF_SCOPE = "vfModule"; + private static final String ASSIGN_ACTION = "configAssign"; + private static final String DEPLOY_ACTION = "configDeploy"; + private static final String DOWNLOAD_ACTION = "downloadNESw"; + private static final String MSO_REQUEST_ID = "1234"; + private static final String BUILDING_BLOCK = "buildingBlock"; + private static final String PUBLIC_NET_ID = "public-net-id"; + private static final String CLOUD_REGION = "acl-cloud-region"; + private static final String TEST_MODEL_UUID = "6bc0b04d-1873-4721-b53d-6615225b2a28"; + private static final String TEST_SERVICE_INSTANCE_ID = "test_service_id"; + private static final String TEST_PROCESS_KEY = "processKey1"; + private static final String TEST_PNF_RESOURCE_INSTANCE_NAME = "PNF_demo_resource"; + private static final String TEST_PNF_CORRELATION_ID = "PNFDemo"; + private static final String TEST_PNF_RESOURCE_CUSTOMIZATION_UUID = "9acb3a83-8a52-412c-9a45-901764938144"; + private static final String TEST_MSO_REQUEST_ID = "ff874603-4222-11e7-9252-005056850d2e"; + private static final String TEST_PNF_UUID = "5df8b6de-2083-11e7-93ae-92361f002671"; + private static final String TEST_SOFTWARE_VERSION = "demo-sw-ver2.0.0"; + private static final String PNF_CORRELATION_ID = "pnfCorrelationId"; + private static final String PNF_UUID = "pnfUuid"; + private static final String SERVICE_INSTANCE_ID = "serviceInstanceId"; + private static final String MODEL_UUID = "modelUuid"; + private static final String PRC_CUSTOMIZATION_UUID = "PRC_customizationUuid"; + private static final String PRC_INSTANCE_NAME = "PRC_instanceName"; + private static final String PRC_TARGET_SOFTWARE_VERSION = "targetSoftwareVersion"; + private static final String SCOPE = "scope"; + private static final String ACTION = "action"; + private static final String PROCESS_KEY = "testProcessKey"; + private static final String PRC_BLUEPRINT_NAME = "PRC_blueprintName"; + private static final String PRC_BLUEPRINT_VERSION = "PRC_blueprintVersion"; + private static final String TEST_PNF_RESOURCE_BLUEPRINT_NAME = "blueprintOnap"; + private static final String TEST_PNF_RESOURCE_BLUEPRINT_VERSION = "1.0.1"; + + private BuildingBlockExecution buildingBlockExecution; + private ExecuteBuildingBlock executeBuildingBlock; + + @InjectMocks + private GeneratePayloadForCds configurePayloadForCds; + + @Mock + private VnfCDSRequestProvider vnfCDSRequestProvider; + + @Mock + private VfModuleCDSRequestProvider vfModuleCDSRequestProvider; + + @Mock + private ServiceCDSRequestProvider serviceCDSRequestProvider; + + @Mock + private PnfCDSRequestProvider pnfCDSRequestProvider; + + + @Before + public void setup() { + buildingBlockExecution = createBuildingBlockExecution(); + executeBuildingBlock = new ExecuteBuildingBlock(); + } + + @Test + public void testBuildCdsPropertiesBeanAssignVnf() throws Exception { + // given + final String assignPayload = + "{\"configAssign-request\":{\"resolution-key\":\"vnf-name-1\",\"configAssign-properties\":{\"service-instance-id\":\"serviceInst_configTest\",\"service-model-uuid\":\"b45b5780-e5dd-11e9-81b4-2a2ae2dbcce4\",\"vnf-id\":\"vnfId_configVnfTest1\",\"vnf-name\":\"vnf-name-1\",\"vnf-customization-uuid\":\"23ce9ac4-e5dd-11e9-81b4-2a2ae2dbcce4\",\"acl-cloud-region\":\"acl-cloud-region\",\"public_net_id\":\"public-net-id\"}}}"; + setScopeAndAction(VNF_SCOPE, ASSIGN_ACTION); + doReturn(Optional.of(assignPayload)).when(vnfCDSRequestProvider).buildRequestPayload(ASSIGN_ACTION); + + // when + AbstractCDSPropertiesBean propertyBean = configurePayloadForCds.buildCdsPropertiesBean(buildingBlockExecution); + + // verify + assertNotNull(propertyBean); + String payload = propertyBean.getRequestObject(); + assertThat(assignPayload.equals(payload)); + assertThat(propertyBean.getRequestId().equals(MSO_REQUEST_ID)); + assertThat(propertyBean.getOriginatorId().equals("SO")); + assertNotNull(propertyBean.getSubRequestId()); + assertThat(propertyBean.getActionName().equals(ASSIGN_ACTION)); + assertThat(propertyBean.getMode().equalsIgnoreCase("sync")); + } + + @Test + public void testBuildCdsPropertiesBeanDeployVnf() throws Exception { + // given + final String deployPayload = + "{\"configDeploy-request\":{\"resolution-key\":\"vnf-name-1\",\"configDeploy-properties\":{\"service-instance-id\":\"serviceInst_configTest\",\"service-model-uuid\":\"b45b5780-e5dd-11e9-81b4-2a2ae2dbcce4\",\"vnf-id\":\"vnfId_configVnfTest1\",\"vnf-name\":\"vnf-name-1\",\"vnf-customization-uuid\":\"23ce9ac4-e5dd-11e9-81b4-2a2ae2dbcce4\",\"acl-cloud-region\":\"acl-cloud-region\",\"public_net_id\":\"public-net-id\"}}}"; + setScopeAndAction(VNF_SCOPE, DEPLOY_ACTION); + doReturn(Optional.of(deployPayload)).when(vnfCDSRequestProvider).buildRequestPayload(DEPLOY_ACTION); + + // when + AbstractCDSPropertiesBean propertyBean = configurePayloadForCds.buildCdsPropertiesBean(buildingBlockExecution); + + // verify + assertNotNull(propertyBean); + String payload = propertyBean.getRequestObject(); + assertThat(deployPayload.equals(payload)); + assertThat(propertyBean.getRequestId().equals(MSO_REQUEST_ID)); + assertThat(propertyBean.getOriginatorId().equals("SO")); + assertNotNull(propertyBean.getSubRequestId()); + assertThat(propertyBean.getActionName().equals(DEPLOY_ACTION)); + assertThat(propertyBean.getMode().equalsIgnoreCase("sync")); + } + + @Test + public void testBuildCdsPropertiesBeanCreateService() throws Exception { + // given + final String servicePayload = + "{\"create-request\":{\"resolution-key\":\"test-service-instance\",\"create-properties\":{\"service-instance-id\":\"serviceInst_configTest\",\"service-model-uuid\":\"b45b5780-e5dd-11e9-81b4-2a2ae2dbcce4\"}}}"; + setScopeAndAction(SERVICE_SCOPE, SERVICE_ACTION); + doReturn(Optional.of(servicePayload)).when(serviceCDSRequestProvider).buildRequestPayload(SERVICE_ACTION); + + // when + AbstractCDSPropertiesBean propertyBean = configurePayloadForCds.buildCdsPropertiesBean(buildingBlockExecution); + + // verify + assertNotNull(propertyBean); + String payload = propertyBean.getRequestObject(); + assertThat(servicePayload.equals(payload)); + assertThat(propertyBean.getRequestId().equals(MSO_REQUEST_ID)); + assertThat(propertyBean.getOriginatorId().equals("SO")); + assertNotNull(propertyBean.getSubRequestId()); + assertThat(propertyBean.getActionName().equals(SERVICE_ACTION)); + assertThat(propertyBean.getMode().equalsIgnoreCase("sync")); + } + + @Test + public void testBuildCdsPropertiesBeanConfigDeployVfModule() throws Exception { + // given + final String deployVfModulePayload = + "{\"configDeploy-request\":{\"resolution-key\":\"vf-module-name-1\",\"template-prefix\":\"vf-module-name-1configDeploy\",\"configDeploy-properties\":{\"service-instance-id\":\"serviceInst_configTest\",\"service-model-uuid\":\"b45b5780-e5dd-11e9-81b4-2a2ae2dbcce4\",\"vnf-id\":\"vnfId_configVnfTest1\",\"vnf-name\":\"vnf-name-1\",\"vf-module-id\":\"vf-module-id-1\",\"vf-module-name\":\"vf-module-name-1\",\"vf-module-customization-uuid\":\"23ce9ac4-e5dd-11e9-81b4-2a2ae2dbcce1\",\"aci-cloud-region-vf-module\":\"acl-cloud-region\",\"public-net-vf-module-id\":\"public-net-id\"}}}"; + setScopeAndAction(VF_SCOPE, DEPLOY_ACTION); + doReturn(Optional.of(deployVfModulePayload)).when(vfModuleCDSRequestProvider) + .buildRequestPayload(DEPLOY_ACTION); + + // when + AbstractCDSPropertiesBean propertyBean = configurePayloadForCds.buildCdsPropertiesBean(buildingBlockExecution); + + // verify + assertNotNull(propertyBean); + String payload = propertyBean.getRequestObject(); + assertThat(deployVfModulePayload.equals(payload)); + assertThat(propertyBean.getRequestId().equals(MSO_REQUEST_ID)); + assertThat(propertyBean.getOriginatorId().equals("SO")); + assertNotNull(propertyBean.getSubRequestId()); + assertThat(propertyBean.getActionName().equals(DEPLOY_ACTION)); + assertThat(propertyBean.getMode().equalsIgnoreCase("sync")); + } + + @Test + public void testBuildCdsPropertiesBeanDownloadPnf() throws Exception { + // given + final String downloadPayload = + "{\"downloadNeSw-request\":{\"resolution-key\":\"PNFDemo\",\"downloadNeSw-properties\":{\"service-instance-id\":\"test_service_id\",\"service-model-uuid\":\"6bc0b04d-1873-4721-b53d-6615225b2a28\",\"pnf-id\":\"5df8b6de-2083-11e7-93ae-92361f002671\",\"pnf-name\":\"PNFDemo\",\"pnf-customization-uuid\":\"9acb3a83-8a52-412c-9a45-901764938144\",\"target-software-version\":\"demo-sw-ver2.0.0\"}}}"; + DelegateExecution execution = prepareDelegateExecutionObj(PayloadConstants.PNF_SCOPE, DOWNLOAD_ACTION); + doReturn(Optional.of(downloadPayload)).when(pnfCDSRequestProvider).buildRequestPayload(DOWNLOAD_ACTION); + doReturn(TEST_PNF_RESOURCE_BLUEPRINT_NAME).when(pnfCDSRequestProvider).getBlueprintName(); + doReturn(TEST_PNF_RESOURCE_BLUEPRINT_VERSION).when(pnfCDSRequestProvider).getBlueprintVersion(); + + // when + AbstractCDSPropertiesBean propertyBean = configurePayloadForCds.buildCdsPropertiesBean(execution); + + // verify + assertNotNull(propertyBean); + String payload = propertyBean.getRequestObject(); + assertThat(downloadPayload.equals(payload)); + assertThat(propertyBean.getRequestId().equals(MSO_REQUEST_ID)); + assertThat(propertyBean.getOriginatorId().equals("SO")); + assertNotNull(propertyBean.getSubRequestId()); + assertThat(propertyBean.getActionName().equals(DOWNLOAD_ACTION)); + assertThat(propertyBean.getMode().equalsIgnoreCase("async")); + assertThat(propertyBean.getBlueprintName().equalsIgnoreCase(TEST_PNF_RESOURCE_BLUEPRINT_NAME)); + assertThat(propertyBean.getBlueprintVersion().equalsIgnoreCase(TEST_PNF_RESOURCE_BLUEPRINT_VERSION)); + } + + @Test + public void testFailureWhenServiceInstanceIsNotPresent() throws Exception { + // given + setScopeAndAction(VNF_SCOPE, ASSIGN_ACTION); + doThrow(PayloadGenerationException.class).when(serviceCDSRequestProvider).buildRequestPayload(ASSIGN_ACTION); + + // when + final Throwable throwable = + catchThrowable(() -> configurePayloadForCds.buildCdsPropertiesBean(buildingBlockExecution)); + + // verify + assertThat(throwable).isInstanceOf(PayloadGenerationException.class) + .hasMessage("Failed to build payload for CDS"); + } + + private BuildingBlockExecution createBuildingBlockExecution() { + DelegateExecution execution = new DelegateExecutionFake(); + execution.setVariable(GENERAL_BLOCK_EXECUTION_MAP_KEY, createGeneralBuildingBlock()); + return new DelegateExecutionImpl(execution); + } + + private GeneralBuildingBlock createGeneralBuildingBlock() { + GeneralBuildingBlock generalBuildingBlock = new GeneralBuildingBlock(); + RequestContext requestContext = new RequestContext(); + RequestParameters requestParameters = new RequestParameters(); + requestParameters.setUserParams(createRequestUserParams()); + requestContext.setRequestParameters(requestParameters); + requestContext.setMsoRequestId(MSO_REQUEST_ID); + generalBuildingBlock.setRequestContext(requestContext); + return generalBuildingBlock; + } + + private List<Map<String, Object>> createRequestUserParams() { + List<Map<String, Object>> userParams = new ArrayList<>(); + Map<String, Object> userParamMap = new HashMap<>(); + userParamMap.put("service", getUserParams()); + userParams.add(userParamMap); + return userParams; + } + + private Service getUserParams() { + Service service = new Service(); + Resources resources = new Resources(); + resources.setVnfs(createVnfList()); + service.setResources(resources); + return service; + } + + private List<Vnfs> createVnfList() { + List<Map<String, String>> instanceParamsListSearchedVnf = new ArrayList<>(); + Map<String, String> instanceParam = new HashMap<>(); + instanceParam.put("public_net_id", PUBLIC_NET_ID); + instanceParam.put("acl-cloud-region", CLOUD_REGION); + instanceParamsListSearchedVnf.add(instanceParam); + Vnfs searchedVnf = createVnf(instanceParamsListSearchedVnf); + List<Vnfs> vnfList = new ArrayList<>(); + vnfList.add(searchedVnf); + return vnfList; + } + + private Vnfs createVnf(List<Map<String, String>> instanceParamsList) { + Vnfs vnf = new Vnfs(); + ModelInfo modelInfo = new ModelInfo(); + modelInfo.setModelCustomizationId(VNF_MODEL_CUSTOMIZATION_UUID); + vnf.setModelInfo(modelInfo); + vnf.setInstanceParams(instanceParamsList); + + // Set instance parameters and modelinfo for vf-module + VfModules vfModule = new VfModules(); + ModelInfo modelInfoForVfModule = new ModelInfo(); + modelInfoForVfModule.setModelCustomizationId(VF_MODULE_CUSTOMIZATION_UUID); + vfModule.setModelInfo(modelInfoForVfModule); + + List<Map<String, String>> instanceParamsListSearchedVfModule = new ArrayList<>(); + Map<String, String> instanceParams = new HashMap<>(); + instanceParams.put("public-net-vf-module-id", PUBLIC_NET_ID); + instanceParams.put("aci-cloud-region-vf-module", CLOUD_REGION); + + instanceParamsListSearchedVfModule.add(instanceParams); + vfModule.setInstanceParams(instanceParamsListSearchedVfModule); + + List<VfModules> vfModules = new ArrayList<>(); + vfModules.add(vfModule); + + vnf.setVfModules(vfModules); + + return vnf; + } + + private void setScopeAndAction(String scope, String action) { + BuildingBlock buildingBlock = new BuildingBlock(); + buildingBlock.setBpmnScope(scope); + buildingBlock.setBpmnAction(action); + executeBuildingBlock.setBuildingBlock(buildingBlock); + buildingBlockExecution.setVariable(BUILDING_BLOCK, executeBuildingBlock); + } + + private DelegateExecution prepareDelegateExecutionObj(String scope, String action) { + DelegateExecution execution = new DelegateExecutionFake(); + execution.setVariable(PROCESS_KEY, TEST_PROCESS_KEY); + execution.setVariable(PNF_CORRELATION_ID, TEST_PNF_CORRELATION_ID); + execution.setVariable(MODEL_UUID, TEST_MODEL_UUID); + execution.setVariable(SERVICE_INSTANCE_ID, TEST_SERVICE_INSTANCE_ID); + execution.setVariable(MSO_REQUEST_ID, TEST_MSO_REQUEST_ID); + execution.setVariable(PNF_UUID, TEST_PNF_UUID); + execution.setVariable(PRC_INSTANCE_NAME, TEST_PNF_RESOURCE_INSTANCE_NAME); + execution.setVariable(PRC_CUSTOMIZATION_UUID, TEST_PNF_RESOURCE_CUSTOMIZATION_UUID); + execution.setVariable(PRC_TARGET_SOFTWARE_VERSION, TEST_SOFTWARE_VERSION); + execution.setVariable(PRC_BLUEPRINT_NAME, TEST_PNF_RESOURCE_BLUEPRINT_NAME); + execution.setVariable(PRC_BLUEPRINT_VERSION, TEST_PNF_RESOURCE_BLUEPRINT_VERSION); + execution.setVariable(SCOPE, scope); + execution.setVariable(ACTION, action); + execution.setVariable("mode", "async"); + return execution; + } +} diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/PnfCDSRequestProviderTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/PnfCDSRequestProviderTest.java new file mode 100644 index 0000000000..88559280b6 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/PnfCDSRequestProviderTest.java @@ -0,0 +1,139 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.cds; + + +import com.fasterxml.jackson.databind.JsonNode; +import com.fasterxml.jackson.databind.ObjectMapper; +import com.google.gson.JsonParser; +import org.camunda.bpm.engine.delegate.DelegateExecution; +import org.camunda.bpm.extension.mockito.delegate.DelegateExecutionFake; +import org.junit.Assert; +import org.junit.Test; +import org.junit.runner.RunWith; +import org.mockito.InjectMocks; +import org.mockito.junit.MockitoJUnitRunner; +import static org.assertj.core.api.Assertions.assertThat; +import static org.junit.Assert.assertNotNull; +import static org.junit.Assert.assertTrue; + +@RunWith(MockitoJUnitRunner.Silent.class) +public class PnfCDSRequestProviderTest { + + @InjectMocks + private PnfCDSRequestProvider pnfCDSRequestProvider; + + private static final String DOWNLOAD_ACTION = "downloadNESw"; + private static final String ACTIVATE_ACTION = "activateNESw"; + private static final String TEST_MODEL_UUID = "6bc0b04d-1873-4721-b53d-6615225b2a28"; + private static final String TEST_SERVICE_INSTANCE_ID = "test_service_id"; + private static final String TEST_PROCESS_KEY = "processKey1"; + private static final String TEST_PNF_RESOURCE_INSTANCE_NAME = "PNF_demo_resource"; + private static final String TEST_PNF_CORRELATION_ID = "PNFDemo"; + private static final String TEST_PNF_RESOURCE_CUSTOMIZATION_UUID = "9acb3a83-8a52-412c-9a45-901764938144"; + private static final String TEST_MSO_REQUEST_ID = "ff874603-4222-11e7-9252-005056850d2e"; + private static final String TEST_PNF_UUID = "5df8b6de-2083-11e7-93ae-92361f002671"; + private static final String TEST_SOFTWARE_VERSION = "demo-sw-ver2.0.0"; + private static final String PNF_CORRELATION_ID = "pnfCorrelationId"; + private static final String PNF_UUID = "pnfUuid"; + private static final String SERVICE_INSTANCE_ID = "serviceInstanceId"; + private static final String MSO_REQUEST_ID = "msoRequestId"; + private static final String MODEL_UUID = "modelUuid"; + private static final String PRC_CUSTOMIZATION_UUID = "PRC_customizationUuid"; + private static final String PRC_INSTANCE_NAME = "PRC_instanceName"; + private static final String PRC_TARGET_SOFTWARE_VERSION = "targetSoftwareVersion"; + private static final String SCOPE = "scope"; + private static final String ACTION = "action"; + private static final String PROCESS_KEY = "testProcessKey"; + private static final String PRC_BLUEPRINT_NAME = "PRC_blueprintName"; + private static final String PRC_BLUEPRINT_VERSION = "PRC_blueprintVersion"; + private static final String TEST_PNF_RESOURCE_BLUEPRINT_NAME = "blueprintOnap"; + private static final String TEST_PNF_RESOURCE_BLUEPRINT_VERSION = "1.0.1"; + + @Test + public void testBuildRequestPayloadDownloadActionPnf() { + try { + runTest(DOWNLOAD_ACTION); + } catch (Exception e) { + Assert.fail(e.getMessage()); + } + } + + @Test + public void testBuildRequestPayloadActivateActionPnf() { + try { + runTest(ACTIVATE_ACTION); + } catch (Exception e) { + Assert.fail(e.getMessage()); + } + } + + private void runTest(String action) throws Exception { + // given + DelegateExecution execution = prepareDelegateExecutionObj(PayloadConstants.PNF_SCOPE, action); + + // when + pnfCDSRequestProvider.setExecutionObject(execution); + String payload = pnfCDSRequestProvider.buildRequestPayload(action).get(); + System.out.println(payload); + + // verify + ObjectMapper mapper = new ObjectMapper(); + JsonNode payloadJson = mapper.readTree(payload); + JsonNode requestNode = payloadJson.findValue(action + "-request"); + JsonNode propertiesNode = payloadJson.findValue(action + "-properties"); + + assertNotNull(payload); + assertTrue(verfiyJsonFromString(payload)); + assertThat(requestNode.get("resolution-key").asText()).isEqualTo(TEST_PNF_CORRELATION_ID); + assertThat(propertiesNode.get("service-instance-id").asText()).isEqualTo(TEST_SERVICE_INSTANCE_ID); + assertThat(propertiesNode.get("service-model-uuid").asText()).isEqualTo(TEST_MODEL_UUID); + assertThat(propertiesNode.get("pnf-id").asText()).isEqualTo(TEST_PNF_UUID); + assertThat(propertiesNode.get("pnf-customization-uuid").asText()) + .isEqualTo(TEST_PNF_RESOURCE_CUSTOMIZATION_UUID); + assertThat(propertiesNode.get("target-software-version").asText()).isEqualTo(TEST_SOFTWARE_VERSION); + assertThat(pnfCDSRequestProvider.getBlueprintName().equals(TEST_PNF_RESOURCE_BLUEPRINT_NAME)); + assertThat(pnfCDSRequestProvider.getBlueprintVersion().equals(TEST_PNF_RESOURCE_BLUEPRINT_VERSION)); + } + + private DelegateExecution prepareDelegateExecutionObj(String scope, String action) { + DelegateExecution execution = new DelegateExecutionFake(); + execution.setVariable(PROCESS_KEY, TEST_PROCESS_KEY); + execution.setVariable(PNF_CORRELATION_ID, TEST_PNF_CORRELATION_ID); + execution.setVariable(MODEL_UUID, TEST_MODEL_UUID); + execution.setVariable(SERVICE_INSTANCE_ID, TEST_SERVICE_INSTANCE_ID); + execution.setVariable(MSO_REQUEST_ID, TEST_MSO_REQUEST_ID); + execution.setVariable(PNF_UUID, TEST_PNF_UUID); + execution.setVariable(PRC_INSTANCE_NAME, TEST_PNF_RESOURCE_INSTANCE_NAME); + execution.setVariable(PRC_CUSTOMIZATION_UUID, TEST_PNF_RESOURCE_CUSTOMIZATION_UUID); + execution.setVariable(PRC_TARGET_SOFTWARE_VERSION, TEST_SOFTWARE_VERSION); + execution.setVariable(SCOPE, scope); + execution.setVariable(ACTION, action); + execution.setVariable(PRC_BLUEPRINT_NAME, TEST_PNF_RESOURCE_BLUEPRINT_NAME); + execution.setVariable(PRC_BLUEPRINT_VERSION, TEST_PNF_RESOURCE_BLUEPRINT_VERSION); + return execution; + } + + private boolean verfiyJsonFromString(String payload) { + JsonParser parser = new JsonParser(); + return parser.parse(payload).isJsonObject(); + } + +} diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/ServiceCDSRequestProviderTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/ServiceCDSRequestProviderTest.java new file mode 100644 index 0000000000..70ce3a1eed --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/ServiceCDSRequestProviderTest.java @@ -0,0 +1,62 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.cds; + +import com.fasterxml.jackson.databind.JsonNode; +import com.fasterxml.jackson.databind.ObjectMapper; +import org.junit.Test; +import org.mockito.InjectMocks; +import org.onap.so.bpmn.servicedecomposition.bbobjects.ServiceInstance; +import org.onap.so.bpmn.servicedecomposition.entities.ResourceKey; +import static org.assertj.core.api.Assertions.assertThat; +import static org.junit.Assert.assertNotNull; +import static org.junit.Assert.assertTrue; +import static org.mockito.Mockito.*; + +public class ServiceCDSRequestProviderTest extends AbstractVnfCDSRequestProviderTest { + + @InjectMocks + private ServiceCDSRequestProvider serviceCDSRequestProvider; + + @Test + public void testRequestPayloadForCreateService() throws Exception { + // given + setScopeAndAction(SERVICE_SCOPE, SERVICE_ACTION); + ServiceInstance instance = createServiceInstance(); + doReturn(instance).when(extractPojosForBB).extractByKey(buildingBlockExecution, + ResourceKey.SERVICE_INSTANCE_ID); + + // when + serviceCDSRequestProvider.setExecutionObject(buildingBlockExecution); + String payload = serviceCDSRequestProvider.buildRequestPayload(SERVICE_ACTION).get(); + + // verify + ObjectMapper mapper = new ObjectMapper(); + JsonNode payloadJson = mapper.readTree(payload); + JsonNode requestNode = payloadJson.findValue("create-request"); + JsonNode propertiesNode = payloadJson.findValue("create-properties"); + + assertNotNull(payload); + assertTrue(verfiyJsonFromString(payload)); + assertThat(requestNode.get("resolution-key").asText()).isEqualTo(SERVICE_INSTANCE_NAME); + assertThat(propertiesNode.get("service-instance-id").asText()).isEqualTo(SERVICE_INSTANCE_ID); + assertThat(propertiesNode.get("service-model-uuid").asText()).isEqualTo(SERVICE_MODEL_UUID); + } +} diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/VfModuleCDSRequestProviderTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/VfModuleCDSRequestProviderTest.java new file mode 100644 index 0000000000..2ca09d9ab3 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/VfModuleCDSRequestProviderTest.java @@ -0,0 +1,80 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.cds; + + +import com.fasterxml.jackson.databind.JsonNode; +import com.fasterxml.jackson.databind.ObjectMapper; +import org.junit.Test; +import org.mockito.InjectMocks; +import org.mockito.Mock; +import org.onap.so.bpmn.servicedecomposition.bbobjects.ServiceInstance; +import org.onap.so.bpmn.servicedecomposition.entities.ResourceKey; +import static org.assertj.core.api.Assertions.assertThat; +import static org.junit.Assert.assertNotNull; +import static org.junit.Assert.assertTrue; +import static org.mockito.Mockito.*; + +public class VfModuleCDSRequestProviderTest extends AbstractVnfCDSRequestProviderTest { + + @InjectMocks + private VfModuleCDSRequestProvider vfModuleCDSRequestProvider; + + @Mock + protected ConfigureInstanceParamsForVfModule configureInstanceParamsForVfModule; + + @Test + public void testRequestPayloadForConfigDeployVfModule() throws Exception { + // given + setScopeAndAction(VF_SCOPE, DEPLOY_ACTION); + ServiceInstance serviceInstance = createServiceInstance(); + + doReturn(serviceInstance).when(extractPojosForBB).extractByKey(buildingBlockExecution, + ResourceKey.SERVICE_INSTANCE_ID); + doReturn(createGenericVnf()).when(extractPojosForBB).extractByKey(buildingBlockExecution, + ResourceKey.GENERIC_VNF_ID); + doReturn(createVfModule()).when(extractPojosForBB).extractByKey(buildingBlockExecution, + ResourceKey.VF_MODULE_ID); + doNothing().when(configureInstanceParamsForVfModule).populateInstanceParams(any(), any(), anyString(), + anyString()); + + // when + vfModuleCDSRequestProvider.setExecutionObject(buildingBlockExecution); + String payload = vfModuleCDSRequestProvider.buildRequestPayload(DEPLOY_ACTION).get(); + + // verify + ObjectMapper mapper = new ObjectMapper(); + JsonNode payloadJson = mapper.readTree(payload); + JsonNode requestNode = payloadJson.findValue("configDeploy-request"); + JsonNode propertiesNode = payloadJson.findValue("configDeploy-properties"); + + assertNotNull(payload); + assertTrue(verfiyJsonFromString(payload)); + assertThat(requestNode.get("resolution-key").asText()).isEqualTo(VF_MODULE_NAME); + assertThat(propertiesNode.get("service-instance-id").asText()).isEqualTo(SERVICE_INSTANCE_ID); + assertThat(propertiesNode.get("vf-module-id").asText()).isEqualTo(VF_MODULE_ID); + assertThat(propertiesNode.get("vf-module-name").asText()).isEqualTo(VF_MODULE_NAME); + assertThat(propertiesNode.get("vf-module-customization-uuid").asText()).isEqualTo(VF_MODULE_CUSTOMIZATION_UUID); + assertThat(propertiesNode.get("service-model-uuid").asText()).isEqualTo(SERVICE_MODEL_UUID); + assertThat(propertiesNode.get("vnf-id").asText()).isEqualTo(GENERIC_VNF_ID); + } + + +} diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/VnfCDSRequestProviderTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/VnfCDSRequestProviderTest.java new file mode 100644 index 0000000000..7aafd900d4 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/cds/VnfCDSRequestProviderTest.java @@ -0,0 +1,104 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.cds; + + +import com.fasterxml.jackson.databind.JsonNode; +import com.fasterxml.jackson.databind.ObjectMapper; +import org.junit.Test; +import org.mockito.InjectMocks; +import org.mockito.Mock; +import org.onap.so.bpmn.servicedecomposition.bbobjects.ServiceInstance; +import org.onap.so.bpmn.servicedecomposition.entities.ResourceKey; +import static org.assertj.core.api.Assertions.assertThat; +import static org.junit.Assert.assertNotNull; +import static org.junit.Assert.assertTrue; +import static org.mockito.Mockito.*; + +public class VnfCDSRequestProviderTest extends AbstractVnfCDSRequestProviderTest { + + @InjectMocks + private VnfCDSRequestProvider vnfCDSRequestProvider; + + @Mock + protected ConfigureInstanceParamsForVnf configureInstanceParamsForVnf; + + @Test + public void testBuildRequestPayloadAssignActionVnf() throws Exception { + // given + setScopeAndAction(VNF_SCOPE, ASSIGN_ACTION); + ServiceInstance instance = createServiceInstance(); + + doReturn(instance).when(extractPojosForBB).extractByKey(buildingBlockExecution, + ResourceKey.SERVICE_INSTANCE_ID); + doReturn(createGenericVnf()).when(extractPojosForBB).extractByKey(buildingBlockExecution, + ResourceKey.GENERIC_VNF_ID); + doNothing().when(configureInstanceParamsForVnf).populateInstanceParams(any(), any(), anyString()); + + // when + vnfCDSRequestProvider.setExecutionObject(buildingBlockExecution); + String payload = vnfCDSRequestProvider.buildRequestPayload(ASSIGN_ACTION).get(); + + // verify + ObjectMapper mapper = new ObjectMapper(); + JsonNode payloadJson = mapper.readTree(payload); + JsonNode requestNode = payloadJson.findValue("configAssign-request"); + JsonNode propertiesNode = payloadJson.findValue("configAssign-properties"); + + assertNotNull(payload); + assertTrue(verfiyJsonFromString(payload)); + assertThat(requestNode.get("resolution-key").asText()).isEqualTo(GENERIC_VNF_NAME); + assertThat(propertiesNode.get("service-instance-id").asText()).isEqualTo(SERVICE_INSTANCE_ID); + assertThat(propertiesNode.get("service-model-uuid").asText()).isEqualTo(SERVICE_MODEL_UUID); + assertThat(propertiesNode.get("vnf-id").asText()).isEqualTo(GENERIC_VNF_ID); + assertThat(propertiesNode.get("vnf-customization-uuid").asText()).isEqualTo(VNF_MODEL_CUSTOMIZATION_UUID); + } + + @Test + public void testBuildRequestPayloadDeployActionVnf() throws Exception { + // given + setScopeAndAction(VNF_SCOPE, DEPLOY_ACTION); + ServiceInstance instance = createServiceInstance(); + + doReturn(instance).when(extractPojosForBB).extractByKey(buildingBlockExecution, + ResourceKey.SERVICE_INSTANCE_ID); + doReturn(createGenericVnf()).when(extractPojosForBB).extractByKey(buildingBlockExecution, + ResourceKey.GENERIC_VNF_ID); + doNothing().when(configureInstanceParamsForVnf).populateInstanceParams(any(), any(), any()); + + // when + vnfCDSRequestProvider.setExecutionObject(buildingBlockExecution); + String payload = vnfCDSRequestProvider.buildRequestPayload(DEPLOY_ACTION).get(); + + // verify + ObjectMapper mapper = new ObjectMapper(); + JsonNode payloadJson = mapper.readTree(payload); + JsonNode requestNode = payloadJson.findValue("configDeploy-request"); + JsonNode propertiesNode = payloadJson.findValue("configDeploy-properties"); + + assertNotNull(payload); + assertTrue(verfiyJsonFromString(payload)); + assertThat(requestNode.get("resolution-key").asText()).isEqualTo(GENERIC_VNF_NAME); + assertThat(propertiesNode.get("service-instance-id").asText()).isEqualTo(SERVICE_INSTANCE_ID); + assertThat(propertiesNode.get("service-model-uuid").asText()).isEqualTo(SERVICE_MODEL_UUID); + assertThat(propertiesNode.get("vnf-id").asText()).isEqualTo(GENERIC_VNF_ID); + assertThat(propertiesNode.get("vnf-customization-uuid").asText()).isEqualTo(VNF_MODEL_CUSTOMIZATION_UUID); + } +} diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmDmaapClientTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmDmaapClientTest.java new file mode 100644 index 0000000000..5483792a84 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmDmaapClientTest.java @@ -0,0 +1,139 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm; + +import java.util.List; +import org.apache.http.HttpStatus; +import com.fasterxml.jackson.core.JsonProcessingException; +import org.junit.Test; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.assertNotEquals; +import static org.junit.Assert.fail; +import static com.github.tomakehurst.wiremock.client.WireMock.aResponse; +import static com.github.tomakehurst.wiremock.client.WireMock.post; +import static com.github.tomakehurst.wiremock.client.WireMock.get; +import static com.github.tomakehurst.wiremock.client.WireMock.urlPathEqualTo; +import org.onap.so.BaseTest; +import org.onap.so.client.restproperties.SDNCLcmPropertiesImpl; +import org.onap.so.client.sdnc.lcm.beans.*; + +public class SDNCLcmDmaapClientTest extends BaseTest { + + protected SDNCLcmMessageBuilderTest sdncLcmMessageBuilderTest = new SDNCLcmMessageBuilderTest(); + + protected static final String DMAAP_HOST_PROP = SDNCLcmPropertiesImpl.DMAAP_HOST; + protected static final String DMAAP_WRITE_TOPIC_PROP = SDNCLcmPropertiesImpl.LCM_DMAAP_WRITE_TOPIC; + protected static final String DMAAP_READ_TOPIC_PROP = SDNCLcmPropertiesImpl.LCM_DMAAP_READ_TOPIC; + protected static final String DMAAP_PARTITION_PROP = SDNCLcmPropertiesImpl.DMAAP_PARTITION; + + protected String testWriteTopic = "TEST-WRITE-TOPIC"; + protected String testReadTopic = "TEST-READ-TOPIC"; + protected String testPartition = "TESTMSO"; + protected final String defaultConsumerName = "consumer1"; + + private void clearSystemProperty() { + System.clearProperty(DMAAP_HOST_PROP); + System.clearProperty(DMAAP_WRITE_TOPIC_PROP); + System.clearProperty(DMAAP_READ_TOPIC_PROP); + System.clearProperty(DMAAP_PARTITION_PROP); + } + + public SDNCLcmDmaapClient buildSDNCLcmDmaapClient() { + String testHost = "http://localhost:" + wireMockPort; + + System.setProperty(DMAAP_HOST_PROP, testHost); + System.setProperty(DMAAP_WRITE_TOPIC_PROP, testWriteTopic); + System.setProperty(DMAAP_READ_TOPIC_PROP, testReadTopic); + System.setProperty(DMAAP_PARTITION_PROP, testPartition); + + SDNCLcmProperties sdncLcmProperties = new SDNCLcmPropertiesImpl(); + SDNCLcmClientBuilder sdncLcmClientBuilder = new SDNCLcmClientBuilder(sdncLcmProperties); + + try { + return sdncLcmClientBuilder.newSDNCLcmDmaapClient(); + } catch (Exception e) { + clearSystemProperty(); + fail("Create SDNCLcmDmaapClient error: " + e.toString()); + return null; + } + } + + @Test + public final void testSDNCLcmDmaapClientSendRequest() { + SDNCLcmDmaapClient sdncLcmDmaapClient = buildSDNCLcmDmaapClient(); + + assertNotEquals(null, sdncLcmDmaapClient); + + String testDmaapWritePath = "/events/" + testWriteTopic; + String expectedWriteResponse = "{\"serverTimeMs\":2,\"count\":1}"; + wireMockServer.stubFor(post(urlPathEqualTo(testDmaapWritePath)) + .willReturn(aResponse().withHeader("Content-Type", "application/json").withBody(expectedWriteResponse) + .withStatus(HttpStatus.SC_OK))); + + LcmInput lcmInput = sdncLcmMessageBuilderTest.buildLcmInputForPnf(); + LcmDmaapRequest lcmDmaapRequest = + SDNCLcmMessageBuilder.buildLcmDmaapRequest(sdncLcmMessageBuilderTest.getOperation(), lcmInput); + + try { + sdncLcmDmaapClient.sendRequest(lcmDmaapRequest); + } catch (Exception e) { + clearSystemProperty(); + fail("SDNCLcmDmaapClient sends request error: " + e.toString()); + return; + } + + String testDmaapReadPath = "/events/" + testReadTopic + "/" + testPartition + "/" + defaultConsumerName; + + String expectedLcmDmaapResponse = LcmDmaapResponseTest.getExpectedLcmDmaapResponse(); + String expectedResponseListItem; + try { + expectedResponseListItem = sdncLcmMessageBuilderTest.convertToSting(expectedLcmDmaapResponse); + } catch (JsonProcessingException e) { + clearSystemProperty(); + fail("Convert LcmDmaapResponse String to List item error: " + e.toString()); + return; + } + String expectedReadResponse = "[" + expectedResponseListItem + "]"; + wireMockServer.stubFor(get(urlPathEqualTo(testDmaapReadPath)) + .willReturn(aResponse().withHeader("Content-Type", "application/json").withBody(expectedReadResponse) + .withStatus(HttpStatus.SC_OK))); + + List<LcmDmaapResponse> LcmDmaapResponseList = sdncLcmDmaapClient.getResponse(); + + clearSystemProperty(); + + if (LcmDmaapResponseList.size() < 1) { + clearSystemProperty(); + fail("Can not get LcmDmaapResponse list"); + return; + } + + LcmOutput lcmOutput = LcmDmaapResponseList.get(0).getBody().getOutput(); + + String expectedLcmOutput = LcmOutputTest.getExpectedLcmOutput(); + try { + String lcmOutputString = sdncLcmMessageBuilderTest.convertToSting(lcmOutput); + assertEquals(expectedLcmOutput, lcmOutputString); + } catch (Exception e) { + fail("Convert LcmOutput to String error: " + e.toString()); + } + } +} diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmMessageBuilderTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmMessageBuilderTest.java new file mode 100644 index 0000000000..d930c6728c --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmMessageBuilderTest.java @@ -0,0 +1,53 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm; + +import org.junit.Test; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.fail; +import org.onap.so.client.sdnc.lcm.beans.LcmBeanTest; +import org.onap.so.client.sdnc.lcm.beans.LcmInput; +import org.onap.so.client.sdnc.lcm.beans.LcmInputTest; + +public class SDNCLcmMessageBuilderTest extends LcmBeanTest { + + public LcmInput buildLcmInputForPnf() { + LcmInput lcmInput = + SDNCLcmMessageBuilder.buildLcmInputForPnf(requestId, subRequestId, pnfName, action, inputPayload); + + lcmInput.getCommonHeader().setTimestamp(timestamp); + + return lcmInput; + } + + @Test + public final void testBuildLcmRestRequestForPnf() { + LcmInput lcmInput = buildLcmInputForPnf(); + + String expectedLcmInput = LcmInputTest.getExpectedLcmInput(); + try { + String lcmInputString = convertToSting(lcmInput); + assertEquals(expectedLcmInput, lcmInputString); + } catch (Exception e) { + fail("Convert LcmInput to String error: " + e.toString()); + } + } +} diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmRestClientTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmRestClientTest.java new file mode 100644 index 0000000000..04cfc6e3c8 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmRestClientTest.java @@ -0,0 +1,93 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm; + +import org.apache.http.HttpStatus; +import org.junit.Test; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.assertNotEquals; +import static org.junit.Assert.fail; +import static com.github.tomakehurst.wiremock.client.WireMock.aResponse; +import static com.github.tomakehurst.wiremock.client.WireMock.post; +import static com.github.tomakehurst.wiremock.client.WireMock.urlPathEqualTo; +import org.onap.logging.filter.base.ONAPComponents; +import org.onap.so.BaseTest; +import org.onap.so.client.restproperties.SDNCLcmPropertiesImpl; +import org.onap.so.client.sdnc.common.SDNCConstants; +import org.onap.so.client.sdnc.lcm.beans.*; + +public class SDNCLcmRestClientTest extends BaseTest { + + protected SDNCLcmMessageBuilderTest sdncLcmMessageBuilderTest = new SDNCLcmMessageBuilderTest(); + + protected static final String SDNC_HOST_PROP = SDNCLcmPropertiesImpl.SDNC_HOST; + protected static final String SDNC_PATH_PROP = SDNCLcmPropertiesImpl.LCM_PATH; + + private void clearSystemProperty() { + System.clearProperty(SDNC_HOST_PROP); + System.clearProperty(SDNC_PATH_PROP); + } + + public SDNCLcmRestClient buildSDNCLcmRestClient() { + String testHost = "http://localhost:" + wireMockPort; + + System.setProperty(SDNC_HOST_PROP, testHost); + System.setProperty(SDNC_PATH_PROP, SDNCConstants.LCM_API_BASE_PATH); + + SDNCLcmProperties sdncLcmProperties = new SDNCLcmPropertiesImpl(); + SDNCLcmClientBuilder sdncLcmClientBuilder = new SDNCLcmClientBuilder(sdncLcmProperties); + + try { + return sdncLcmClientBuilder.newSDNCLcmRestClient(sdncLcmMessageBuilderTest.getOperation()); + } catch (Exception e) { + clearSystemProperty(); + fail("Create SDNCLcmRestClient error: " + e.toString()); + return null; + } + } + + @Test + public final void testSDNCLcmRestClientSendRequest() { + SDNCLcmRestClient sdncLcmRestClient = buildSDNCLcmRestClient(); + + assertNotEquals(null, sdncLcmRestClient); + assertEquals(ONAPComponents.SDNC, sdncLcmRestClient.getTargetEntity()); + + String testLcmApiPath = SDNCConstants.LCM_API_BASE_PATH + sdncLcmMessageBuilderTest.getOperation(); + String expectedLcmRestResponse = LcmRestResponseTest.getExpectedLcmRestResponse(); + wireMockServer.stubFor(post(urlPathEqualTo(testLcmApiPath)) + .willReturn(aResponse().withHeader("Content-Type", "application/json").withBody(expectedLcmRestResponse) + .withStatus(HttpStatus.SC_OK))); + + LcmInput lcmInput = sdncLcmMessageBuilderTest.buildLcmInputForPnf(); + LcmOutput lcmOutput = sdncLcmRestClient.sendRequest(lcmInput); + + clearSystemProperty(); + + String expectedLcmOutput = LcmOutputTest.getExpectedLcmOutput(); + try { + String lcmOutputString = sdncLcmMessageBuilderTest.convertToSting(lcmOutput); + assertEquals(expectedLcmOutput, lcmOutputString); + } catch (Exception e) { + fail("Convert LcmOutput to String error: " + e.toString()); + } + } +} diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmBeanTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmBeanTest.java new file mode 100644 index 0000000000..5562444a46 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmBeanTest.java @@ -0,0 +1,78 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm.beans; + +import com.fasterxml.jackson.core.JsonProcessingException; +import com.fasterxml.jackson.databind.ObjectMapper; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.onap.so.client.sdnc.common.SDNCConstants; + +public class LcmBeanTest { + private static Logger logger = LoggerFactory.getLogger(LcmBeanTest.class); + + protected String requestId = "9f77f437-1515-44bd-a420-0aaf8a3c31a0"; + protected String subRequestId = "c197a4b5-18d9-48a2-ad2d-a3b56858501c"; + protected String timestamp = "2020-02-25T10:20:28.116Z"; + + protected String pnfName = "testpnf"; + protected String action = "TestAction"; + protected String operation = "test-operation"; + + protected String inputPayload = "{\"testPayload\": \"input test\"}"; + protected String outputPayload = "{\"testPayload\": \"output test\"}"; + + public String getOperation() { + return operation; + } + + public LcmFlags buildSDNCFlags() { + LcmFlags lcmFlags = new LcmFlags(); + + lcmFlags.setMode(SDNCConstants.LCM_FLAGS_MODE_NORMAL); + lcmFlags.setForce(SDNCConstants.LCM_FLAGS_FORCE_FALSE); + lcmFlags.setTtl(SDNCConstants.LCM_FLAGS_TTL); + + return lcmFlags; + } + + public LcmCommonHeader buildLcmCommonHeader() { + LcmCommonHeader lcmCommonHeader = new LcmCommonHeader(); + + lcmCommonHeader.setApiVer(SDNCConstants.LCM_API_VER); + lcmCommonHeader.setFlags(buildSDNCFlags()); + lcmCommonHeader.setOriginatorId(SDNCConstants.SYSTEM_NAME); + lcmCommonHeader.setRequestId(requestId); + lcmCommonHeader.setSubRequestId(subRequestId); + lcmCommonHeader.setTimestamp(timestamp); + + return lcmCommonHeader; + } + + public String convertToSting(Object msgObject) throws JsonProcessingException { + ObjectMapper mapper = new ObjectMapper(); + + String msgString = mapper.writeValueAsString(msgObject); + logger.debug(msgObject.getClass().getSimpleName() + "\n" + msgString); + + return msgString; + } +} diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapRequestTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapRequestTest.java new file mode 100644 index 0000000000..709a557937 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapRequestTest.java @@ -0,0 +1,67 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm.beans; + +import org.junit.Test; +import org.onap.so.client.sdnc.common.SDNCConstants; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.fail; + +public class LcmDmaapRequestTest extends LcmBeanTest { + private static String expectedLcmDmaapRequest = "{" + "\"version\":\"1.0\"," + "\"type\":\"request\"," + + "\"cambria.partition\":\"MSO\"," + + "\"correlation-id\":\"9f77f437-1515-44bd-a420-0aaf8a3c31a0-c197a4b5-18d9-48a2-ad2d-a3b56858501c\"," + + "\"rpc-name\":\"test-operation\"," + "\"body\":" + LcmRestRequestTest.getExpectedLcmRestRequest() + "}"; + + public LcmDmaapRequest buildLcmDmaapRequest() { + LcmDmaapRequest lcmDmaapRequest = new LcmDmaapRequest(); + + LcmRestRequestTest lcmRestRequestTest = new LcmRestRequestTest(); + LcmRestRequest lcmRestRequest = lcmRestRequestTest.buildLcmRestRequest(); + LcmCommonHeader lcmCommonHeader = lcmRestRequest.getInput().getCommonHeader(); + String correlationId = lcmCommonHeader.getRequestId() + "-" + lcmCommonHeader.getSubRequestId(); + + lcmDmaapRequest.setVersion(SDNCConstants.LCM_DMAAP_MSG_VER); + lcmDmaapRequest.setType(SDNCConstants.LCM_DMAAP_MSG_TYPE_REQUEST); + lcmDmaapRequest.setCambriaPartition(SDNCConstants.SYSTEM_NAME); + lcmDmaapRequest.setCorrelationId(correlationId); + lcmDmaapRequest.setRpcName(operation); + lcmDmaapRequest.setBody(lcmRestRequest); + + return lcmDmaapRequest; + } + + public static String getExpectedLcmDmaapRequest() { + return expectedLcmDmaapRequest; + } + + @Test + public final void testLcmDmaapRequest() { + LcmDmaapRequest lcmDmaapRequest = buildLcmDmaapRequest(); + + try { + String lcmDmaapRequestString = convertToSting(lcmDmaapRequest); + assertEquals(expectedLcmDmaapRequest, lcmDmaapRequestString); + } catch (Exception e) { + fail("Convert LcmDmaapRequest to String error: " + e.toString()); + } + } +} diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapResponseTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapResponseTest.java new file mode 100644 index 0000000000..0cdbeebb27 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapResponseTest.java @@ -0,0 +1,67 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm.beans; + +import org.junit.Test; +import org.onap.so.client.sdnc.common.SDNCConstants; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.fail; + +public class LcmDmaapResponseTest extends LcmBeanTest { + private static String expectedLcmDmaapResponse = "{" + "\"version\":\"1.0\"," + "\"type\":\"response\"," + + "\"cambria.partition\":\"MSO\"," + + "\"correlation-id\":\"9f77f437-1515-44bd-a420-0aaf8a3c31a0-c197a4b5-18d9-48a2-ad2d-a3b56858501c\"," + + "\"rpc-name\":\"test-operation\"," + "\"body\":" + LcmRestResponseTest.getExpectedLcmRestResponse() + "}"; + + public LcmDmaapResponse buildLcmDmaapResponse() { + LcmDmaapResponse lcmDmaapResponse = new LcmDmaapResponse(); + + LcmRestResponseTest lcmRestResponseTest = new LcmRestResponseTest(); + LcmRestResponse lcmRestResponse = lcmRestResponseTest.buildLcmRestResponse(); + LcmCommonHeader lcmCommonHeader = lcmRestResponse.getOutput().getCommonHeader(); + String correlationId = lcmCommonHeader.getRequestId() + "-" + lcmCommonHeader.getSubRequestId(); + + lcmDmaapResponse.setVersion(SDNCConstants.LCM_DMAAP_MSG_VER); + lcmDmaapResponse.setType(SDNCConstants.LCM_DMAAP_MSG_TYPE_RESPONSE); + lcmDmaapResponse.setCambriaPartition(SDNCConstants.SYSTEM_NAME); + lcmDmaapResponse.setCorrelationId(correlationId); + lcmDmaapResponse.setRpcName(operation); + lcmDmaapResponse.setBody(lcmRestResponse); + + return lcmDmaapResponse; + } + + public static String getExpectedLcmDmaapResponse() { + return expectedLcmDmaapResponse; + } + + @Test + public final void testLcmDmaapResponse() { + LcmDmaapResponse lcmDmaapResponse = buildLcmDmaapResponse(); + + try { + String lcmDmaapResponseString = convertToSting(lcmDmaapResponse); + assertEquals(expectedLcmDmaapResponse, lcmDmaapResponseString); + } catch (Exception e) { + fail("Convert LcmDmaapResponse to String error: " + e.toString()); + } + } +} diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmInputTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmInputTest.java new file mode 100644 index 0000000000..b8c34fcbc7 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmInputTest.java @@ -0,0 +1,67 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm.beans; + +import org.junit.Test; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.fail; + +public class LcmInputTest extends LcmBeanTest { + private static String expectedLcmInput = "{" + "\"common-header\":{" + "\"api-ver\":\"2.00\"," + + "\"flags\":{\"mode\":\"NORMAL\",\"force\":\"FALSE\",\"ttl\":65000}," + "\"originator-id\":\"MSO\"," + + "\"request-id\":\"9f77f437-1515-44bd-a420-0aaf8a3c31a0\"," + + "\"sub-request-id\":\"c197a4b5-18d9-48a2-ad2d-a3b56858501c\"," + + "\"timestamp\":\"2020-02-25T10:20:28.116Z\"" + "}," + "\"action\":\"TestAction\"," + + "\"action-identifiers\":{\"pnf-name\":\"testpnf\"}," + + "\"payload\":\"{\\\"testPayload\\\": \\\"input test\\\"}\"}"; + + public LcmInput buildLcmInput() { + LcmInput lcmInput = new LcmInput(); + + LcmCommonHeader lcmCommonHeader = buildLcmCommonHeader(); + + LcmActionIdentifiers lcmActionIdentifiers = new LcmActionIdentifiers(); + lcmActionIdentifiers.setPnfName(pnfName); + + lcmInput.setCommonHeader(lcmCommonHeader); + lcmInput.setAction(action); + lcmInput.setActionIdentifiers(lcmActionIdentifiers); + lcmInput.setPayload(inputPayload); + + return lcmInput; + } + + public static String getExpectedLcmInput() { + return expectedLcmInput; + } + + @Test + public final void testLcmInput() { + LcmInput lcmInput = buildLcmInput(); + + try { + String lcmInputString = convertToSting(lcmInput); + assertEquals(expectedLcmInput, lcmInputString); + } catch (Exception e) { + fail("Convert LcmInput to String error: " + e.toString()); + } + } +} diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmOutputTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmOutputTest.java new file mode 100644 index 0000000000..1530be38a7 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmOutputTest.java @@ -0,0 +1,84 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm.beans; + +import org.junit.Test; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.fail; +import org.onap.so.client.sdnc.common.SDNCConstants; + +public class LcmOutputTest extends LcmBeanTest { + private static String expectedLcmOutput = "{" + "\"common-header\":{" + "\"api-ver\":\"2.00\"," + + "\"originator-id\":\"MSO\"," + "\"request-id\":\"9f77f437-1515-44bd-a420-0aaf8a3c31a0\"," + + "\"sub-request-id\":\"c197a4b5-18d9-48a2-ad2d-a3b56858501c\"" + "}," + + "\"status\":{\"code\":400,\"message\":\"Test output message\"}," + + "\"payload\":\"{\\\"testPayload\\\": \\\"output test\\\"}\"}"; + + @Override + public LcmCommonHeader buildLcmCommonHeader() { + LcmCommonHeader lcmCommonHeader = new LcmCommonHeader(); + + lcmCommonHeader.setApiVer(SDNCConstants.LCM_API_VER); + lcmCommonHeader.setOriginatorId(SDNCConstants.SYSTEM_NAME); + lcmCommonHeader.setRequestId(requestId); + lcmCommonHeader.setSubRequestId(subRequestId); + + return lcmCommonHeader; + } + + public LcmStatus buildLcmStatus() { + LcmStatus lcmStatus = new LcmStatus(); + + lcmStatus.setCode(400); + lcmStatus.setMessage("Test output message"); + + return lcmStatus; + } + + public LcmOutput buildLcmOutput() { + LcmOutput lcmOutput = new LcmOutput(); + + LcmCommonHeader lcmCommonHeader = buildLcmCommonHeader(); + LcmStatus lcmStatus = buildLcmStatus(); + + lcmOutput.setCommonHeader(lcmCommonHeader); + lcmOutput.setStatus(lcmStatus); + lcmOutput.setPayload(outputPayload); + + return lcmOutput; + } + + public static String getExpectedLcmOutput() { + return expectedLcmOutput; + } + + @Test + public final void testLcmOutput() { + LcmOutput lcmOutput = buildLcmOutput(); + + try { + String lcmOutputString = convertToSting(lcmOutput); + assertEquals(expectedLcmOutput, lcmOutputString); + } catch (Exception e) { + fail("Convert LcmOutput to String error: " + e.toString()); + } + } +} diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmRestRequestTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmRestRequestTest.java new file mode 100644 index 0000000000..c078326c82 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmRestRequestTest.java @@ -0,0 +1,54 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm.beans; + +import org.junit.Test; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.fail; + +public class LcmRestRequestTest extends LcmBeanTest { + private static String expectedLcmRestRequest = "{" + "\"input\":" + LcmInputTest.getExpectedLcmInput() + "}"; + + public LcmRestRequest buildLcmRestRequest() { + LcmRestRequest lcmRestRequest = new LcmRestRequest(); + + LcmInputTest lcmInputTest = new LcmInputTest(); + lcmRestRequest.setInput(lcmInputTest.buildLcmInput()); + + return lcmRestRequest; + } + + public static String getExpectedLcmRestRequest() { + return expectedLcmRestRequest; + } + + @Test + public final void testLcmRestRequest() { + LcmRestRequest lcmRestRequest = buildLcmRestRequest(); + + try { + String lcmRestRequestString = convertToSting(lcmRestRequest); + assertEquals(expectedLcmRestRequest, lcmRestRequestString); + } catch (Exception e) { + fail("Convert LcmRestRequest to String error: " + e.toString()); + } + } +} diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmRestResponseTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmRestResponseTest.java new file mode 100644 index 0000000000..5867acb421 --- /dev/null +++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmRestResponseTest.java @@ -0,0 +1,54 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.client.sdnc.lcm.beans; + +import org.junit.Test; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.fail; + +public class LcmRestResponseTest extends LcmBeanTest { + private static String expectedLcmRestResponse = "{" + "\"output\":" + LcmOutputTest.getExpectedLcmOutput() + "}"; + + public LcmRestResponse buildLcmRestResponse() { + LcmRestResponse lcmRestResponse = new LcmRestResponse(); + + LcmOutputTest lcmOutputTest = new LcmOutputTest(); + lcmRestResponse.setOutput(lcmOutputTest.buildLcmOutput()); + + return lcmRestResponse; + } + + public static String getExpectedLcmRestResponse() { + return expectedLcmRestResponse; + } + + @Test + public final void testLcmRestResponse() { + LcmRestResponse lcmRestResponse = buildLcmRestResponse(); + + try { + String lcmRestResponseString = convertToSting(lcmRestResponse); + assertEquals(expectedLcmRestResponse, lcmRestResponseString); + } catch (Exception e) { + fail("Convert LcmRestResponse to String error: " + e.toString()); + } + } +} diff --git a/bpmn/MSOCoreBPMN/pom.xml b/bpmn/MSOCoreBPMN/pom.xml index fd239562e2..47254e75f2 100644 --- a/bpmn/MSOCoreBPMN/pom.xml +++ b/bpmn/MSOCoreBPMN/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>bpmn</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <modelVersion>4.0.0</modelVersion> <artifactId>MSOCoreBPMN</artifactId> diff --git a/bpmn/MSOCoreBPMN/src/main/java/org/onap/so/bpmn/core/domain/ServiceArtifact.java b/bpmn/MSOCoreBPMN/src/main/java/org/onap/so/bpmn/core/domain/ServiceArtifact.java new file mode 100644 index 0000000000..aefd70ff89 --- /dev/null +++ b/bpmn/MSOCoreBPMN/src/main/java/org/onap/so/bpmn/core/domain/ServiceArtifact.java @@ -0,0 +1,119 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + # Copyright (c) 2019, CMCC Technologies Co., Ltd. + # + # Licensed under the Apache License, Version 2.0 (the "License") + # you may not use this file except in compliance with the License. + # You may obtain a copy of the License at + # + # http://www.apache.org/licenses/LICENSE-2.0 + # + # Unless required by applicable law or agreed to in writing, software + # distributed under the License is distributed on an "AS IS" BASIS, + # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + # See the License for the specific language governing permissions and + # limitations under the License. + * ============LICENSE_END========================================================= + */ +package org.onap.so.bpmn.core.domain; + +import com.fasterxml.jackson.annotation.JsonInclude; +import com.fasterxml.jackson.annotation.JsonProperty; +import com.fasterxml.jackson.annotation.JsonPropertyOrder; +import com.fasterxml.jackson.annotation.JsonRootName; +import java.io.Serializable; + +@JsonInclude(JsonInclude.Include.NON_NULL) +@JsonPropertyOrder({"artifactUUID", "name", "version", "checksum", "type", "content", "description"}) +@JsonRootName("serviceArtifact") +public class ServiceArtifact extends JsonWrapper implements Serializable { + + private static final long serialVersionUID = 1L; + @JsonProperty("artifactUUID") + private String artifactUUID; + @JsonProperty("name") + private String name; + @JsonProperty("version") + private String version; + @JsonProperty("checksum") + private String checksum; + @JsonProperty("type") + private String type; + @JsonProperty("content") + private String content; + @JsonProperty("description") + private String description; + + @JsonProperty("artifactUUID") + public String getArtifactUUID() { + return artifactUUID; + } + + @JsonProperty("artifactUUID") + public void setArtifactUUID(String artifactUUID) { + this.artifactUUID = artifactUUID; + } + + @JsonProperty("name") + public String getName() { + return name; + } + + @JsonProperty("name") + public void setName(String name) { + this.name = name; + } + + @JsonProperty("version") + public String getVersion() { + return version; + } + + @JsonProperty("version") + public void setVersion(String version) { + this.version = version; + } + + @JsonProperty("checksum") + public String getChecksum() { + return checksum; + } + + @JsonProperty("checksum") + public void setChecksum(String checksum) { + this.checksum = checksum; + } + + @JsonProperty("type") + public String getType() { + return type; + } + + @JsonProperty("type") + public void setType(String type) { + this.type = type; + } + + @JsonProperty("content") + public String getContent() { + return content; + } + + @JsonProperty("content") + public void setContent(String content) { + this.content = content; + } + + @JsonProperty("description") + public String getDescription() { + return description; + } + + @JsonProperty("description") + public void setDescription(String description) { + this.description = description; + } + +} diff --git a/bpmn/mso-infrastructure-bpmn/pom.xml b/bpmn/mso-infrastructure-bpmn/pom.xml index c3c26ef5e7..04a291af8c 100644 --- a/bpmn/mso-infrastructure-bpmn/pom.xml +++ b/bpmn/mso-infrastructure-bpmn/pom.xml @@ -3,7 +3,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>bpmn</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <modelVersion>4.0.0</modelVersion> <artifactId>mso-infrastructure-bpmn</artifactId> diff --git a/bpmn/mso-infrastructure-bpmn/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/PnfManagementTestImpl.java b/bpmn/mso-infrastructure-bpmn/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/PnfManagementTestImpl.java index f9db93e3f7..80fd3eede4 100644 --- a/bpmn/mso-infrastructure-bpmn/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/PnfManagementTestImpl.java +++ b/bpmn/mso-infrastructure-bpmn/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/PnfManagementTestImpl.java @@ -58,6 +58,12 @@ public class PnfManagementTestImpl implements PnfManagement { serviceAndPnfRelationMap.put(serviceInstanceId, pnfName); } + @Override + public void updateEntry(String pnfCorrelationId, Pnf entry) { + created.put(pnfCorrelationId, entry); + } + + public Map<String, Pnf> getCreated() { return created; } diff --git a/bpmn/pom.xml b/bpmn/pom.xml index 65af2fd8d5..6b81bab4df 100644 --- a/bpmn/pom.xml +++ b/bpmn/pom.xml @@ -6,7 +6,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>so</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>bpmn</artifactId> diff --git a/bpmn/so-bpmn-building-blocks/pom.xml b/bpmn/so-bpmn-building-blocks/pom.xml index a867613890..52c5502b32 100644 --- a/bpmn/so-bpmn-building-blocks/pom.xml +++ b/bpmn/so-bpmn-building-blocks/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>bpmn</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <modelVersion>4.0.0</modelVersion> <artifactId>so-bpmn-building-blocks</artifactId> diff --git a/bpmn/so-bpmn-building-blocks/src/main/resources/subprocess/BuildingBlock/ConfigAssignVnfBB.bpmn b/bpmn/so-bpmn-building-blocks/src/main/resources/subprocess/BuildingBlock/ConfigAssignVnfBB.bpmn index 11d77bf97a..88e5eadef2 100644 --- a/bpmn/so-bpmn-building-blocks/src/main/resources/subprocess/BuildingBlock/ConfigAssignVnfBB.bpmn +++ b/bpmn/so-bpmn-building-blocks/src/main/resources/subprocess/BuildingBlock/ConfigAssignVnfBB.bpmn @@ -12,7 +12,7 @@ <bpmn:callActivity id="CallActivity_1gfzi2g" name="Abstract CDS (CDS Call) " calledElement="AbstractCDSProcessingBB"> <bpmn:extensionElements> <camunda:out source="WorkflowException" target="WorkflowException" /> - <camunda:out source="CDSStatus" target="CDSStatus" /> + <camunda:out source="ControllerStatus" target="ControllerStatus" /> <camunda:in source="executionObject" target="executionObject" /> </bpmn:extensionElements> <bpmn:incoming>SequenceFlow_05qembo</bpmn:incoming> @@ -34,7 +34,7 @@ </bpmn:exclusiveGateway> <bpmn:sequenceFlow id="SequenceFlow_0cvsnuu" sourceRef="CallActivity_1gfzi2g" targetRef="ExclusiveGateway_13q340y" /> <bpmn:sequenceFlow id="SequenceFlow_07tqu82" name="success" sourceRef="ExclusiveGateway_13q340y" targetRef="Task_1hs1mn0"> - <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression"><![CDATA[#{execution.getVariable("CDSStatus").equals("Success")}]]></bpmn:conditionExpression> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression"><![CDATA[#{execution.getVariable("ControllerStatus").equals("Success")}]]></bpmn:conditionExpression> </bpmn:sequenceFlow> <bpmn:endEvent id="EndEvent_0mnaj50"> <bpmn:incoming>SequenceFlow_15gxql1</bpmn:incoming> diff --git a/bpmn/so-bpmn-building-blocks/src/main/resources/subprocess/BuildingBlock/ConfigDeployVnfBB.bpmn b/bpmn/so-bpmn-building-blocks/src/main/resources/subprocess/BuildingBlock/ConfigDeployVnfBB.bpmn index 92ac5f9f5b..3993eca467 100644 --- a/bpmn/so-bpmn-building-blocks/src/main/resources/subprocess/BuildingBlock/ConfigDeployVnfBB.bpmn +++ b/bpmn/so-bpmn-building-blocks/src/main/resources/subprocess/BuildingBlock/ConfigDeployVnfBB.bpmn @@ -18,7 +18,7 @@ <bpmn:extensionElements> <camunda:out source="WorkflowException" target="WorkflowException" /> <camunda:in source="executionObject" target="executionObject" /> - <camunda:out source="CDSStatus" target="CDSStatus" /> + <camunda:out source="ControllerStatus" target="ControllerStatus" /> </bpmn:extensionElements> <bpmn:incoming>SequenceFlow_0kruy8t</bpmn:incoming> <bpmn:outgoing>SequenceFlow_03xbj4e</bpmn:outgoing> @@ -39,7 +39,7 @@ <bpmn:outgoing>SequenceFlow_0o50k2d</bpmn:outgoing> </bpmn:exclusiveGateway> <bpmn:sequenceFlow id="SequenceFlow_1tb7fs1" name="success" sourceRef="ExclusiveGateway_0duh80v" targetRef="UpdateAAIConfigured"> - <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("CDSStatus").equals("Success")}</bpmn:conditionExpression> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("ControllerStatus").equals("Success")}</bpmn:conditionExpression> </bpmn:sequenceFlow> <bpmn:sequenceFlow id="SequenceFlow_0o50k2d" sourceRef="ExclusiveGateway_0duh80v" targetRef="EndEvent_0wwnq4u" /> <bpmn:endEvent id="EndEvent_0wwnq4u"> diff --git a/bpmn/so-bpmn-building-blocks/src/main/resources/subprocess/BuildingBlock/ControllerExecutionBB.bpmn b/bpmn/so-bpmn-building-blocks/src/main/resources/subprocess/BuildingBlock/ControllerExecutionBB.bpmn new file mode 100644 index 0000000000..279fdc0983 --- /dev/null +++ b/bpmn/so-bpmn-building-blocks/src/main/resources/subprocess/BuildingBlock/ControllerExecutionBB.bpmn @@ -0,0 +1,241 @@ +<?xml version="1.0" encoding="UTF-8"?> +<bpmn:definitions xmlns:bpmn="http://www.omg.org/spec/BPMN/20100524/MODEL" xmlns:bpmndi="http://www.omg.org/spec/BPMN/20100524/DI" xmlns:di="http://www.omg.org/spec/DD/20100524/DI" xmlns:dc="http://www.omg.org/spec/DD/20100524/DC" xmlns:camunda="http://camunda.org/schema/1.0/bpmn" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" id="Definitions_1ahlzqg" targetNamespace="http://bpmn.io/schema/bpmn" exporter="Camunda Modeler" exporterVersion="1.14.0"> + <bpmn:process id="ControllerExecution" name="ControllerExecutionBB" isExecutable="true"> + <bpmn:startEvent id="StartEvent_1"> + <bpmn:outgoing>SequenceFlow_0gmfit3</bpmn:outgoing> + </bpmn:startEvent> + <bpmn:sequenceFlow id="SequenceFlow_0gmfit3" sourceRef="StartEvent_1" targetRef="ServiceTask_0inxg9l" /> + <bpmn:endEvent id="EndEvent_0lgvk82"> + <bpmn:incoming>SequenceFlow_1mkhog2</bpmn:incoming> + <bpmn:incoming>SequenceFlow_0no1qag</bpmn:incoming> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_1mkhog2" sourceRef="Task_1hs1mn0" targetRef="EndEvent_0lgvk82" /> + <bpmn:callActivity id="CallActivity_1gfzi2g" name="Abstract CDS (CDS Call) " calledElement="AbstractCDSProcessingBB"> + <bpmn:extensionElements> + <camunda:out source="WorkflowException" target="WorkflowException" /> + <camunda:out source="ControllerStatus" target="ControllerStatus" /> + <camunda:in source="executionObject" target="executionObject" /> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_05qembo</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0cvsnuu</bpmn:outgoing> + </bpmn:callActivity> + <bpmn:serviceTask id="Task_1hs1mn0" name="Update AAI" camunda:expression="${AAIUpdateTasks.updateOrchestrationStatus(InjectExecution.execute(execution, execution.getVariable("gBuildingBlockExecution")),InjectExecution.execute(execution, execution.getVariable("scope")),InjectExecution.execute(execution, execution.getVariable("action")))}"> + <bpmn:incoming>SequenceFlow_07tqu82</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1mkhog2</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:sequenceFlow id="SequenceFlow_05qembo" sourceRef="Task_0bhf6tp" targetRef="CallActivity_1gfzi2g" /> + <bpmn:serviceTask id="Task_0bhf6tp" name="PreProcess Abstract CDS Processing" camunda:expression="${GenericCDSProcessing.buildPayloadBasedOnScopeAndAction(InjectExecution.execute(execution, execution.getVariable("gBuildingBlockExecution")))}"> + <bpmn:incoming>SequenceFlow_0vzx2yr</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_05qembo</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:exclusiveGateway id="ExclusiveGateway_13q340y" default="SequenceFlow_15gxql1"> + <bpmn:incoming>SequenceFlow_0cvsnuu</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_07tqu82</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_15gxql1</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:sequenceFlow id="SequenceFlow_0cvsnuu" sourceRef="CallActivity_1gfzi2g" targetRef="ExclusiveGateway_13q340y" /> + <bpmn:sequenceFlow id="SequenceFlow_07tqu82" name="success" sourceRef="ExclusiveGateway_13q340y" targetRef="Task_1hs1mn0"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("ControllerStatus").equals("Success")}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:endEvent id="EndEvent_0mnaj50"> + <bpmn:incoming>SequenceFlow_15gxql1</bpmn:incoming> + <bpmn:errorEventDefinition id="ErrorEventDefinition_1s1hqgm" errorRef="Error_0aovtfv" /> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_15gxql1" sourceRef="ExclusiveGateway_13q340y" targetRef="EndEvent_0mnaj50" /> + <bpmn:serviceTask id="ServiceTask_0inxg9l" name="Set Actor, Scope and Action Params" camunda:expression="${ControllerExecution.setControllerActorScopeAction(InjectExecution.execute(execution, execution.getVariable("gBuildingBlockExecution")))}"> + <bpmn:incoming>SequenceFlow_0gmfit3</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_05j6hg6</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_1lspfyy</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:sequenceFlow id="SequenceFlow_05j6hg6" sourceRef="ServiceTask_0inxg9l" targetRef="ExclusiveGateway_0plxwkg" /> + <bpmn:exclusiveGateway id="ExclusiveGateway_0plxwkg" default="SequenceFlow_1t7hs4k"> + <bpmn:incoming>SequenceFlow_1lspfyy</bpmn:incoming> + <bpmn:incoming>SequenceFlow_05j6hg6</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1t7hs4k</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_0vzx2yr</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:sequenceFlow id="SequenceFlow_1lspfyy" sourceRef="ServiceTask_0inxg9l" targetRef="ExclusiveGateway_0plxwkg" /> + <bpmn:callActivity id="BBToExecute" name="BB to Execute " calledElement="${bbName}"> + <bpmn:extensionElements> + <camunda:out source="WorkflowException" target="WorkflowException" /> + <camunda:out source="WorkflowExceptionErrorMessage" target="WorkflowExceptionErrorMessage" /> + <camunda:in source="executionObject" target="executionObject" /> + <camunda:in source="mso-request-id" target="mso-request-id" /> + <camunda:in source="isRollback" target="isRollback" /> + <camunda:out source="StatusMessage" target="StatusMessage" /> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0fv03vt</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0no1qag</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_0op5irz</bpmn:outgoing> + </bpmn:callActivity> + <bpmn:sequenceFlow id="SequenceFlow_1t7hs4k" sourceRef="ExclusiveGateway_0plxwkg" targetRef="Task_1rc2j9" /> + <bpmn:sequenceFlow id="SequenceFlow_0no1qag" sourceRef="BBToExecute" targetRef="EndEvent_0lgvk82" /> + <bpmn:sequenceFlow id="SequenceFlow_0fv03vt" sourceRef="Task_1rc2j9" targetRef="BBToExecute" /> + <bpmn:serviceTask id="Task_1rc2j9" name="select BB " camunda:expression="${ControllerExecution.selectBB(InjectExecution.execute(execution, execution.getVariable("gBuildingBlockExecution")))}"> + <bpmn:incoming>SequenceFlow_1t7hs4k</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0fv03vt</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:endEvent id="EndEvent_1lxwuh2"> + <bpmn:incoming>SequenceFlow_0op5irz</bpmn:incoming> + <bpmn:errorEventDefinition id="ErrorEventDefinition_0z001cu" errorRef="Error_0aovtfv" /> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_0op5irz" sourceRef="BBToExecute" targetRef="EndEvent_1lxwuh2" /> + <bpmn:sequenceFlow id="SequenceFlow_0vzx2yr" name="Actor= CDS" sourceRef="ExclusiveGateway_0plxwkg" targetRef="Task_0bhf6tp"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">${execution.getVariable("controller_actor") == "CDS"}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + </bpmn:process> + <bpmn:error id="Error_0aovtfv" name="MSOWorkflowException" errorCode="MSOWorkflowException" /> + <bpmndi:BPMNDiagram id="BPMNDiagram_1"> + <bpmndi:BPMNPlane id="BPMNPlane_1" bpmnElement="ControllerExecution"> + <bpmndi:BPMNShape id="_BPMNShape_StartEvent_2" bpmnElement="StartEvent_1"> + <dc:Bounds x="160" y="323" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="-17" y="279" width="90" height="20" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0gmfit3_di" bpmnElement="SequenceFlow_0gmfit3"> + <di:waypoint x="196" y="341" /> + <di:waypoint x="259" y="341" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="32.5" y="236" width="90" height="20" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="EndEvent_0lgvk82_di" bpmnElement="EndEvent_0lgvk82"> + <dc:Bounds x="1129" y="323" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1025" y="251" width="90" height="20" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1mkhog2_di" bpmnElement="SequenceFlow_1mkhog2"> + <di:waypoint x="1079" y="462" /> + <di:waypoint x="1147" y="462" /> + <di:waypoint x="1147" y="359" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="918" y="357" width="90" height="20" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="CallActivity_1gfzi2g_di" bpmnElement="CallActivity_1gfzi2g"> + <dc:Bounds x="725" y="422" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_0404s6a_di" bpmnElement="Task_1hs1mn0"> + <dc:Bounds x="979" y="422" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_05qembo_di" bpmnElement="SequenceFlow_05qembo"> + <di:waypoint x="672" y="462" /> + <di:waypoint x="725" y="462" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="503.5" y="357" width="90" height="20" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ServiceTask_01mv1si_di" bpmnElement="Task_0bhf6tp"> + <dc:Bounds x="572" y="422" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ExclusiveGateway_13q340y_di" bpmnElement="ExclusiveGateway_13q340y" isMarkerVisible="true"> + <dc:Bounds x="868" y="437" width="50" height="50" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="698" y="327" width="90" height="20" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0cvsnuu_di" bpmnElement="SequenceFlow_0cvsnuu"> + <di:waypoint x="825" y="462" /> + <di:waypoint x="868" y="462" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="651.5" y="357" width="90" height="20" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_07tqu82_di" bpmnElement="SequenceFlow_07tqu82"> + <di:waypoint x="918" y="462" /> + <di:waypoint x="979" y="462" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="856" y="409" width="41" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="EndEvent_0mnaj50_di" bpmnElement="EndEvent_0mnaj50"> + <dc:Bounds x="875" y="565" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="698" y="531" width="90" height="20" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_15gxql1_di" bpmnElement="SequenceFlow_15gxql1"> + <di:waypoint x="893" y="487" /> + <di:waypoint x="893" y="565" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="713" y="436" width="90" height="20" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ServiceTask_0inxg9l_di" bpmnElement="ServiceTask_0inxg9l"> + <dc:Bounds x="259" y="301" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_05j6hg6_di" bpmnElement="SequenceFlow_05j6hg6"> + <di:waypoint x="359" y="341" /> + <di:waypoint x="399" y="341" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="184" y="240" width="90" height="12" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ExclusiveGateway_0plxwkg_di" bpmnElement="ExclusiveGateway_0plxwkg" isMarkerVisible="true"> + <dc:Bounds x="399" y="316" width="50" height="50" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="309" y="255" width="0" height="12" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1lspfyy_di" bpmnElement="SequenceFlow_1lspfyy"> + <di:waypoint x="359" y="341" /> + <di:waypoint x="399" y="341" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="229" y="240" width="0" height="12" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="CallActivity_01dem38_di" bpmnElement="BBToExecute"> + <dc:Bounds x="824" y="168" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1t7hs4k_di" bpmnElement="SequenceFlow_1t7hs4k"> + <di:waypoint x="424" y="316" /> + <di:waypoint x="424" y="208" /> + <di:waypoint x="572" y="208" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="271" y="89" width="83" height="36" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0no1qag_di" bpmnElement="SequenceFlow_0no1qag"> + <di:waypoint x="924" y="208" /> + <di:waypoint x="1147" y="208" /> + <di:waypoint x="1147" y="323" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="840.5" y="107" width="90" height="12" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0fv03vt_di" bpmnElement="SequenceFlow_0fv03vt"> + <di:waypoint x="672" y="208" /> + <di:waypoint x="824" y="208" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="598" y="107" width="0" height="12" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ServiceTask_0qd9p4w_di" bpmnElement="Task_1rc2j9"> + <dc:Bounds x="572" y="168" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_1lxwuh2_di" bpmnElement="EndEvent_1lxwuh2"> + <dc:Bounds x="856" y="84" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="679" y="50" width="0" height="12" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0op5irz_di" bpmnElement="SequenceFlow_0op5irz"> + <di:waypoint x="874" y="168" /> + <di:waypoint x="874" y="120" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="739" y="58" width="0" height="12" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0vzx2yr_di" bpmnElement="SequenceFlow_0vzx2yr"> + <di:waypoint x="424" y="366" /> + <di:waypoint x="424" y="462" /> + <di:waypoint x="572" y="462" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="455" y="436" width="60" height="12" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + </bpmndi:BPMNPlane> + </bpmndi:BPMNDiagram> +</bpmn:definitions>
\ No newline at end of file diff --git a/bpmn/so-bpmn-infrastructure-common/pom.xml b/bpmn/so-bpmn-infrastructure-common/pom.xml index 74df3a2c2e..0df3fbe704 100644 --- a/bpmn/so-bpmn-infrastructure-common/pom.xml +++ b/bpmn/so-bpmn-infrastructure-common/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>bpmn</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <modelVersion>4.0.0</modelVersion> <artifactId>so-bpmn-infrastructure-common</artifactId> diff --git a/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/ActivateCommunicationService.groovy b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/ActivateCommunicationService.groovy new file mode 100644 index 0000000000..dc33bc930a --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/ActivateCommunicationService.groovy @@ -0,0 +1,435 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + # Copyright (c) 2019, CMCC Technologies Co., Ltd. + # + # Licensed under the Apache License, Version 2.0 (the "License") + # you may not use this file except in compliance with the License. + # You may obtain a copy of the License at + # + # http://www.apache.org/licenses/LICENSE-2.0 + # + # Unless required by applicable law or agreed to in writing, software + # distributed under the License is distributed on an "AS IS" BASIS, + # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + # See the License for the specific language governing permissions and + # limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.bpmn.infrastructure.scripts + +import org.camunda.bpm.engine.delegate.BpmnError +import org.camunda.bpm.engine.delegate.DelegateExecution +import org.onap.aai.domain.yang.Relationship +import org.onap.aai.domain.yang.RelationshipData +import org.onap.aai.domain.yang.RelationshipList +import org.onap.aai.domain.yang.ServiceInstance +import org.onap.so.bpmn.common.scripts.AbstractServiceTaskProcessor +import org.onap.so.bpmn.common.scripts.ExceptionUtil +import org.onap.so.bpmn.common.scripts.MsoUtils +import org.onap.so.bpmn.common.scripts.RequestDBUtil +import org.onap.so.bpmn.core.UrnPropertiesReader +import org.onap.so.bpmn.core.WorkflowException +import org.onap.so.bpmn.core.json.JsonUtils +import org.onap.so.client.aai.AAIObjectType +import org.onap.so.client.aai.AAIResourcesClient +import org.onap.so.client.aai.entities.AAIResultWrapper +import org.onap.so.client.aai.entities.uri.AAIResourceUri +import org.onap.so.client.aai.entities.uri.AAIUriFactory +import org.onap.so.db.request.beans.OperationStatus +import org.slf4j.Logger +import org.slf4j.LoggerFactory + +import javax.ws.rs.NotFoundException + +import static org.apache.commons.lang3.StringUtils.isBlank + +class ActivateCommunicationService extends AbstractServiceTaskProcessor { + + String Prefix="ACS_" + + ExceptionUtil exceptionUtil = new ExceptionUtil() + + RequestDBUtil requestDBUtil = new RequestDBUtil() + + JsonUtils jsonUtil = new JsonUtils() + + AAIResourcesClient client = getAAIClient() + + private static final Logger logger = LoggerFactory.getLogger(ActivateCommunicationService.class) + + @Override + void preProcessRequest(DelegateExecution execution) { + logger.debug(Prefix + "preProcessRequest Start") + execution.setVariable("prefix", Prefix) + String msg + + try { + // check for incoming json message/input + String siRequest = execution.getVariable("bpmnRequest") + logger.debug(siRequest) + + String requestId = execution.getVariable("mso-request-id") + execution.setVariable("msoRequestId", requestId) + logger.info("Input Request:" + siRequest + " reqId:" + requestId) + + String serviceInstanceId = execution.getVariable("serviceInstanceId") + if (isBlank(serviceInstanceId)) { + msg = "Input serviceInstanceId' is null" + exceptionUtil.buildAndThrowWorkflowException(execution, 500, msg) + } + + String globalSubscriberId = jsonUtil.getJsonValue(siRequest, "globalSubscriberId") + if (isBlank(globalSubscriberId)) { + msg = "Input globalSubscriberId' is null" + logger.info(msg) + execution.setVariable("globalSubscriberId", "5GCustomer") + } else { + execution.setVariable("globalSubscriberId", globalSubscriberId) + } + + String subscriptionServiceType = jsonUtil.getJsonValue(siRequest, "serviceType") + if (isBlank(subscriptionServiceType)) { + msg = "Input subscriptionServiceType is null" + logger.debug(msg) + execution.setVariable("subscriptionServiceType", "5G") + } else { + execution.setVariable("subscriptionServiceType", subscriptionServiceType) + } + + String operationId = jsonUtil.getJsonValue(siRequest, "operationId") + execution.setVariable("operationId", operationId) + + } catch (BpmnError e) { + throw e + } catch (Exception ex) { + msg = "Exception in preProcessRequest " + ex.getMessage() + logger.info(msg) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg) + } + logger.debug(Prefix + "preProcessRequest Exit") + } + + + def checkAAIOrchStatus = { DelegateExecution execution -> + + logger.debug(Prefix + "checkAAIOrchStatus Start") + + String msg + String serviceInstanceId = execution.getVariable("serviceInstanceId") + String globalSubscriberId = execution.getVariable("globalSubscriberId") + String subscriptionServiceType = execution.getVariable("subscriptionServiceType") + String operationType = execution.getVariable("operationType") + + logger.debug("serviceInstanceId: " + serviceInstanceId) + + //check the cms status + try { + AAIResourceUri uri = AAIUriFactory.createResourceUri(AAIObjectType.SERVICE_INSTANCE, + globalSubscriberId, subscriptionServiceType, serviceInstanceId) + + if (!client.exists(uri)) { + exceptionUtil.buildAndThrowWorkflowException(execution, 2500, "Service Instance was not found in aai") + } + + AAIResultWrapper wrapper = client.get(uri, NotFoundException.class) + Optional<ServiceInstance> si = wrapper.asBean(ServiceInstance.class) + if(si.isPresent()) { + + if (si.get().getOrchestrationStatus().toLowerCase() == "activated" && + operationType == "deactivation") { + logger.info("Service is in active state") + execution.setVariable("serviceExpectStatus", "deactivated") + execution.setVariable("isContinue", "true") + execution.setVariable("requestParam", "deactivate") + + } else if (si.get().getOrchestrationStatus().toLowerCase() == "deactivated" && + operationType == "activation"){ + logger.info("Service is in de-activated state") + execution.setVariable("serviceExpectStatus", "activated") + execution.setVariable("isContinue", "true") + execution.setVariable("requestParam", "activate") + + } else { + execution.setVariable("isContinue", "false") + } + + RelationshipList relationshipList = si.get().getRelationshipList() + List<Relationship> relationship + if (relationshipList != null && (relationship = relationshipList.getRelationship()) != null + && relationship.size() > 0) { + List<RelationshipData> relationshipDatas = relationship.get(0).getRelationshipData() + + for (RelationshipData relationshipData : relationshipDatas) { + execution.setVariable("e2e_" + relationshipData.getRelationshipKey(), + relationshipData.getRelationshipValue()) + } + } else { + msg = "the communication service has no e2e service" + exceptionUtil.buildAndThrowWorkflowException(execution, 500, msg) + } + } + + } catch (BpmnError e) { + throw e + } catch (Exception ex) { + msg = "Exception in " + Prefix + "checkAAIOrchStatus: " + ex.getMessage() + logger.info( msg) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg) + } + + logger.debug(Prefix + "checkAAIOrchStatus Exit") + } + + + def prepareInitOperationStatus = { DelegateExecution execution -> + logger.debug(Prefix + "prepareInitOperationStatus Start") + + String serviceId = execution.getVariable("serviceInstanceId") + + // 生成 operationId + String operationId = execution.getVariable("operationId") + + String operationType = execution.getVariable("operationType") + + OperationStatus initStatus = new OperationStatus() + initStatus.setServiceId(serviceId) + initStatus.setOperationId(operationId) + initStatus.setOperation(operationType) + initStatus.setUserId(execution.getVariable("globalSubscriberId") as String) + initStatus.setResult("processing") + initStatus.setProgress("0") + initStatus.setReason("") + initStatus.setOperationContent("communication service active operation start") + + requestDBUtil.prepareUpdateOperationStatus(execution, initStatus) + + logger.debug(Prefix + "prepareInitOperationStatus Exit") + } + + + def sendSyncResponse = { DelegateExecution execution -> + logger.debug(Prefix + "sendSyncResponse Start") + try { + String operationId = execution.getVariable("operationId") + + String restRequest = """{"operationId":"${operationId}"}""".trim() + logger.debug(" sendSyncResponse to APIH:" + "\n" + restRequest) + + sendWorkflowResponse(execution, 202, restRequest) + execution.setVariable("sentSyncResponse", true) + } catch (Exception ex) { + String msg = "Exceptuion in sendSyncResponse:" + ex.getMessage() + logger.debug(msg) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg) + } + logger.debug(Prefix + "sendSyncResponse Exit") + } + + + def preRequestSend2NSMF = { DelegateExecution execution -> + logger.debug(Prefix + "preRequestSend2NSMF Start") + try { + + String e2eServiceInstanceId = execution.getVariable("e2e_service-instance.service-instance-id") + execution.setVariable("e2eServiceInstanceId", e2eServiceInstanceId) + + String requestParam = execution.getVariable("requestParam") + //String NSMF_endpoint = "/onap/so/infra/e2eServiceInstances/v3" + def NSMF_endpoint = UrnPropertiesReader.getVariable("mso.infra.endpoint.url", execution) + def url = NSMF_endpoint + "/e2eServiceInstances/v3/${e2eServiceInstanceId}/${requestParam}" + execution.setVariable("NSMF_endpoint", url) + + //get from model catalog inputs + String payload = """ + { + "globalSubscriberId": "${execution.getVariable("globalSubscriberId")}", + "serviceType": "${execution.getVariable("subscriptionServiceType")}" + } + """ + execution.setVariable("CSMF_NSMFRequest", payload.replaceAll("\\s+", "")) + + } catch (BpmnError e) { + throw e + } catch (Exception ex) { + String msg = "Exception in " + Prefix + "preRequestSend2NSMF. " + ex.getMessage() + logger.error(msg) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg) + } + + logger.debug(Prefix + "preRequestSend2NSMF Exit") + } + + + def processNSMFResponse = { DelegateExecution execution -> + logger.debug(Prefix + "processNSMFResponse Start") + //oof + try { + def CSMF_NSMFResponseCode = execution.getVariable("CSMF_NSMFResponseCode") as Integer + if (CSMF_NSMFResponseCode >= 200 && CSMF_NSMFResponseCode < 400) { + def CSMF_NSMFResponse = execution.getVariable("CSMF_NSMFResponse") as String + def e2eOperationId = jsonUtil.getJsonValue(CSMF_NSMFResponse, "operationId") + + execution.setVariable("e2eOperationId", e2eOperationId) + execution.setVariable("ProcessNsmfSuccess", "OK") + } else { + execution.setVariable("ProcessNsmfSuccess", "ERROR") + execution.setVariable("operationStatus", "error") + execution.setVariable("operationContent", + "communication service " + execution.getVariable("operationType") + + " operation error: nsmf response fail") + execution.setVariable("orchestrationStatus", "error") + } + + } catch (BpmnError e) { + throw e + } catch (Exception ex) { + String msg = "Exception in " + Prefix + "processOOFResponse. " + ex.getMessage() + logger.info(msg) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg) + } + logger.debug(Prefix + "processNSMFResponse Exit") + } + + + def prepareUpdateOperationStatus = { DelegateExecution execution -> + logger.debug(Prefix + "prepareUpdateOperationStatus Start") + // update status creating + OperationStatus status = new OperationStatus() + status.setServiceId(execution.getVariable("serviceInstanceId") as String) + status.setOperationId(execution.getVariable("operationId") as String) + status.setOperation(execution.getVariable("operationType") as String) + status.setResult("processing") + status.setProgress("20") + status.setOperationContent("communication service "+ execution.getVariable("operationType") + + " operation processing: waiting nsmf service create finished") + status.setUserId(execution.getVariable("globalSubscriberId") as String) + + requestDBUtil.prepareUpdateOperationStatus(execution, status) + logger.debug(Prefix + "prepareUpdateOperationStatus Exit") + } + + + //todo + def prepareCallCheckProcessStatus = { DelegateExecution execution -> + logger.debug(Prefix + "prepareCallCheckProcessStatus Start") + + def successConditions = new ArrayList<>() + successConditions.add("finished") + execution.setVariable("successConditions", successConditions) + + def errorConditions = new ArrayList<>() + errorConditions.add("error") + execution.setVariable("errorConditions", errorConditions) + + execution.setVariable("processServiceType", "communication service") + + execution.setVariable("timeOut", 3 * 60 * 60 * 1000) + + def successParamMap = new HashMap<String, Object>() + successParamMap.put("orchestrationStatus", execution.getVariable("serviceExpectStatus")) + + execution.setVariable("successParamMap", successParamMap) + + def errorParamMap = new HashMap<String, Object>() + errorParamMap.put("orchestrationStatus", "error") + + execution.setVariable("errorParamMap", errorParamMap) + + def timeOutParamMap = new HashMap<String, Object>() + timeOutParamMap.put("orchestrationStatus", "error") + + execution.setVariable("timeOutParamMap", timeOutParamMap) + + execution.setVariable("initProgress", 20) + execution.setVariable("endProgress", 90) + + logger.debug(Prefix + "prepareCallCheckProcessStatus Exit") + } + + + /** + * prepare update operation status to complete after NSMF process success + * @param execution + */ + def prepareCompleteStatus = { DelegateExecution execution -> + + logger.debug(Prefix + "prepareCompleteStatus Start") + String operationType = execution.getVariable("operationType") + OperationStatus status = new OperationStatus() + status.setServiceId(execution.getVariable("serviceInstanceId") as String) + status.setOperationId(execution.getVariable("operationId") as String) + status.setOperation(operationType) + status.setResult(execution.getVariable("operationStatus") as String) + status.setProgress("100") + status.setOperationContent(execution.getVariable("operationContent") as String) + status.setUserId(execution.getVariable("globalSubscriberId") as String) + + requestDBUtil.prepareUpdateOperationStatus(execution, status) + logger.debug("prepareCompleteStatus end, serviceInstanceId: " + execution.getVariable("serviceInstanceId") + + ", operationId: " + execution.getVariable("operationId")) + + logger.debug(Prefix + "prepareCompleteStatus Exit") + } + + + /** + * update NSMF complete status to AAI when the NSMF process finished + * @param execution + */ + def updateFinishStatusInAAI = { DelegateExecution execution -> + logger.debug(Prefix + "updateFinishStatusInAAI Start") + String msg + try { + + String serviceInstanceId = execution.getVariable("serviceInstanceId") + String subscriptionServiceType = execution.getVariable("subscriptionServiceType") + String globalSubscriberId = execution.getVariable("globalSubscriberId") + String orchestrationStatus = execution.getVariable("orchestrationStatus") + // create service + ServiceInstance csi = new ServiceInstance() + csi.setOrchestrationStatus(orchestrationStatus) + AAIResourceUri uri = AAIUriFactory.createResourceUri(AAIObjectType.SERVICE_INSTANCE, + globalSubscriberId, subscriptionServiceType, serviceInstanceId) + client.update(uri, csi) + + } catch (BpmnError e) { + throw e + } catch (Exception ex) { + msg = "Exception in complete communication service " + ex.getMessage() + logger.debug(msg) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg) + } + logger.debug(Prefix + "updateFinishStatusInAAI Exit") + } + + + public sendSyncError = { DelegateExecution execution -> + logger.debug("sendSyncError Start") + try { + String errorMessage + if (execution.getVariable("WorkflowException") instanceof WorkflowException) { + WorkflowException wfe = execution.getVariable("WorkflowException") as WorkflowException + errorMessage = wfe.getErrorMessage() + } else { + errorMessage = "Sending Sync Error." + } + + String buildWorkflowException = + """<aetgt:WorkflowException xmlns:aetgt="http://org.onap/so/workflow/schema/v1"> + <aetgt:ErrorMessage>${MsoUtils.xmlEscape(errorMessage)}</aetgt:ErrorMessage> + <aetgt:ErrorCode>7000</aetgt:ErrorCode> + </aetgt:WorkflowException>""" + + logger.debug(buildWorkflowException) + sendWorkflowResponse(execution, 500, buildWorkflowException) + + } catch (Exception ex) { + logger.debug("Sending Sync Error Activity Failed. " + "\n" + ex.getMessage()) + } + logger.debug(Prefix + "sendSyncError Exit") + } + +} diff --git a/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/CheckServiceProcessStatus.groovy b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/CheckServiceProcessStatus.groovy new file mode 100644 index 0000000000..3233bfff61 --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/CheckServiceProcessStatus.groovy @@ -0,0 +1,333 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + # Copyright (c) 2019, CMCC Technologies Co., Ltd. + # + # Licensed under the Apache License, Version 2.0 (the "License") + # you may not use this file except in compliance with the License. + # You may obtain a copy of the License at + # + # http://www.apache.org/licenses/LICENSE-2.0 + # + # Unless required by applicable law or agreed to in writing, software + # distributed under the License is distributed on an "AS IS" BASIS, + # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + # See the License for the specific language governing permissions and + # limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.bpmn.infrastructure.scripts + +import org.camunda.bpm.engine.delegate.BpmnError +import org.camunda.bpm.engine.delegate.DelegateExecution +import org.onap.so.bpmn.common.scripts.AbstractServiceTaskProcessor +import org.onap.so.bpmn.common.scripts.ExceptionUtil +import org.onap.so.bpmn.common.scripts.RequestDBUtil +import org.onap.so.bpmn.core.json.JsonUtils +import org.onap.so.client.aai.AAIResourcesClient +import org.onap.so.db.request.beans.OperationStatus +import org.slf4j.Logger +import org.slf4j.LoggerFactory + +import java.util.concurrent.TimeUnit + +import static org.apache.commons.lang3.StringUtils.isBlank + +class CheckServiceProcessStatus extends AbstractServiceTaskProcessor { + + + String Prefix="CSPS_" + + ExceptionUtil exceptionUtil = new ExceptionUtil() + + RequestDBUtil requestDBUtil = new RequestDBUtil() + + JsonUtils jsonUtil = new JsonUtils() + + AAIResourcesClient client = getAAIClient() + + private static final Logger logger = LoggerFactory.getLogger(CheckServiceProcessStatus.class) + + @Override + void preProcessRequest(DelegateExecution execution) { + logger.debug(Prefix + "CheckServiceProcessStatus preProcessRequest Start") + execution.setVariable("prefix", Prefix) + + String serviceInstanceId = execution.getVariable("serviceInstanceId") + String operationId = execution.getVariable("operationId") + String parentServiceInstanceId = execution.getVariable("parentServiceInstanceId") + String parentOperationId = execution.getVariable("parentOperationId") + + if (isBlank(serviceInstanceId) || isBlank(operationId)) { + String msg = "Exception in" + Prefix + "preProcessRequest: Input serviceInstanceId or operationId is null" + exceptionUtil.buildAndThrowWorkflowException(execution, 500, msg) + } + + if (isBlank(parentServiceInstanceId) || isBlank(parentOperationId)) { + execution.setVariable("isNeedUpdateParentStatus", false) + } + + String globalSubscriberId = execution.getVariable("globalSubscriberId") + if (isBlank(globalSubscriberId)) { + execution.setVariable("globalSubscriberId", "5GCustomer") + } + + // serviceType: type of service + String serviceType = execution.getVariable("processServiceType") + if (isBlank(serviceType)) { + execution.setVariable("processServiceType", "service") + } + + // operationType: type of service + String operationType = execution.getVariable("operationType") + if (isBlank(operationType)) { + execution.setVariable("operationType", "CREATE") + } + + //successConditions: processing end success conditions + List<String> successConditions = execution.getVariable("successConditions") as List + + //errorConditions: processing end error conditions + List<String> errorConditions = execution.getVariable("errorConditions") as List + + if ((successConditions == null || successConditions.size() < 1) + && (errorConditions == null || errorConditions.size() < 1)) { + String msg = "Exception in" + Prefix + "preProcessRequest: conditions is null" + exceptionUtil.buildAndThrowWorkflowException(execution, 500, msg) + } else { + for (int i = 0; i < successConditions.size(); i++) { + String condition = successConditions.get(i) + successConditions.set(i, condition.toLowerCase()) + } + for (int i = 0; i < errorConditions.size(); i++) { + String condition = errorConditions.get(i) + errorConditions.set(i, condition.toLowerCase()) + } + } + + execution.setVariable("startTime", System.currentTimeMillis()) + + String initProgress = execution.getVariable("initProgress") + + if (isBlank(initProgress)) { + execution.setVariable("initProgress", 0) + } + + String endProgress = execution.getVariable("endProgress") + + if (isBlank(endProgress)) { + execution.setVariable("endProgress", 100) + } + + execution.setVariable("progress", 0) + logger.debug(Prefix + "preProcessRequest Exit") + } + + + /** + * check service status through request operation id, update operation status + */ + def preCheckServiceStatusReq = { DelegateExecution execution -> + logger.trace(Prefix + "preCheckServiceStatusReq Start") + String serviceInstanceId = execution.getVariable("serviceInstanceId") as String + String operationId = execution.getVariable("operationId") as String + requestDBUtil.getOperationStatus(execution, serviceInstanceId, operationId) + logger.trace(Prefix + "preCheckServiceStatusReq Exit") + } + + + /** + * handle service status, if service status is finished or error, set the service status + * @param execution + */ + def handlerServiceStatusResp = { DelegateExecution execution -> + logger.trace(Prefix + "handlerServiceStatusResp Start") + String msg + try { + def dbResponseCode = execution.getVariable("dbResponseCode") as Integer + if (dbResponseCode >= 200 && dbResponseCode < 400) { + String dbResponse = execution.getVariable("dbResponse") + def dbResponseJson = jsonUtil.xml2json(dbResponse) as String + + String result = jsonUtil.getJsonValue(dbResponseJson, + "Envelope.Body.getServiceOperationStatusResponse.return.result") + + if (isSuccessCompleted(execution, result)) { + + handlerSuccess(execution, result) + execution.setVariable("isAllFinished", "true") + + logger.debug(Prefix + "handlerServiceStatusResp: service success finished, dbResponse_result: " + + result) + + } else if (isErrorCompleted(execution, result)) { + + handlerError(execution, result) + execution.setVariable("isAllFinished", "true") + + logger.debug(Prefix + "handlerServiceStatusResp: service error finished, dbResponse_result: " + + result) + + } else { + String progress = jsonUtil.getJsonValue(dbResponseJson, + "Envelope.Body.getServiceOperationStatusResponse.return.progress") + + String oldProgress = execution.getVariable("progress") + + if (progress == oldProgress) { + execution.setVariable("isNeedUpdateDB", false) + } else { + execution.setVariable("progress", progress) + execution.setVariable("isNeedUpdateDB", true) + } + execution.setVariable("isAllFinished", "false") + TimeUnit.SECONDS.sleep(10) + } + } else { + execution.setVariable("isAllFinished", "false") + //todo: retry + TimeUnit.MILLISECONDS.sleep(10) + } + + } catch (BpmnError e) { + throw e + } catch (Exception ex) { + msg = "Exception in " + Prefix + "handlerServiceStatusResp: " + ex.getMessage() + logger.debug(msg) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg) + } + + logger.trace(Prefix + "handlerServiceStatusResp Exit") + } + + + def timeWaitDelay = { DelegateExecution execution -> + + Long startTime = execution.getVariable("startTime") as Long + Long timeOut = execution.getVariable("timeOut") as Long + + timeOut = timeOut == null ? 3 * 60 * 60 * 1000 : timeOut + + if (System.currentTimeMillis() - startTime > timeOut) { + + handlerTimeOut(execution) + execution.setVariable("isTimeOut", "YES") + + } else { + execution.setVariable("isTimeOut", "NO") + } + } + + + private handlerTimeOut = { DelegateExecution execution -> + + Map<String, Object> paramMap = execution.getVariable("timeOutParamMap") as Map + + handlerProcess(execution, "error", paramMap, "error", "with timeout") + } + + + private handlerSuccess = { DelegateExecution execution, String result -> + + Map<String, Object> paramMap = execution.getVariable("successParamMap") as Map + + handlerProcess(execution, result, paramMap, "deactivated", "success") + } + + + private handlerError = { DelegateExecution execution, String result -> + + Map<String, Object> paramMap = execution.getVariable("errorParamMap") as Map + + handlerProcess(execution, result, paramMap, "error", "with error") + } + + + private handlerProcess = { DelegateExecution execution, String result, def paramMap, def status, def msg -> + + if (paramMap != null) { + for (Map.Entry<String, Object> entry : paramMap.entrySet()) { + execution.setVariable(entry.getKey(), entry.getValue()) + } + } + + + if (isBlank(execution.getVariable("operationStatus") as String)) { + execution.setVariable("operationStatus", result) + } + + + if (isBlank(execution.getVariable("operationContent") as String)) { + String operationContent = execution.getVariable("processServiceType") + " " + + execution.getVariable("operationType") + " operation finished " + msg + execution.setVariable("operationContent", operationContent) + } + + if (isBlank(execution.getVariable("orchestrationStatus") as String)) { + execution.setVariable("orchestrationStatus", status) + } + + } + + + /** + * judge if the service processing success finished + */ + private isSuccessCompleted = { DelegateExecution execution, String result -> + + //successConditions: processing end success conditions + List<String> successConditions = execution.getVariable("successConditions") as List + + result = result.toLowerCase() + if (successConditions.contains(result)) { + return true + } + return false + } + + + /** + * judge if the service processing error finished + */ + private isErrorCompleted = { DelegateExecution execution, String result -> + + //errorConditions: processing end error conditions + List<String> errorConditions = execution.getVariable("errorConditions") as List + + result = result.toLowerCase() + if (errorConditions.contains(result)) { + return true + } + return false + } + + + def preUpdateOperationProgress = { DelegateExecution execution -> + logger.trace(Prefix + "prepareUpdateOperationStatus Start") + + def progress = execution.getVariable("progress") as Integer + def initProgress = execution.getVariable("initProgress") as Integer + def endProgress = execution.getVariable("endProgress") as Integer + + def resProgress = (initProgress + (endProgress - initProgress) / 100 * progress) as Integer + + def operationType = execution.getVariable("operationType") + def operationContent = execution.getVariable("processServiceType") + " " + + operationType + " operation processing " + resProgress + + // update status creating + OperationStatus status = new OperationStatus() + status.setServiceId(execution.getVariable("parentServiceInstanceId") as String) + status.setOperationId(execution.getVariable("parentOperationId") as String) + status.setOperation(operationType as String) + status.setResult("processing") + status.setProgress(resProgress as String) + status.setOperationContent(operationContent as String) + status.setUserId(execution.getVariable("globalSubscriberId") as String) + + requestDBUtil.prepareUpdateOperationStatus(execution, status) + logger.trace(Prefix + "prepareUpdateOperationStatus Exit") + } +} diff --git a/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/CreateSDNCNetworkResource.groovy b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/CreateSDNCNetworkResource.groovy index 4b3c1aa7b4..3da4161953 100644 --- a/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/CreateSDNCNetworkResource.groovy +++ b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/CreateSDNCNetworkResource.groovy @@ -163,36 +163,20 @@ public class CreateSDNCNetworkResource extends AbstractServiceTaskProcessor { String serInput = jsonUtil.getJsonValue(resourceInputTmp, "requestsInputs") switch (modelName) { - case ~/[\w\s\W]*OLT[\w\s\W]*/ : + case ~/[\w\s\W]*OLT[\w\s\W]*/ : // for backward compatibilty only, this case will be deprecated + case ~/[\w\s\W]*AccessConnectivity[\w\s\W]*/ : // get the required properties and update in resource input def resourceInput = resourceInputObj.getResourceParameters() String incomingRequest = resourceInputObj.getRequestsInputs() String serviceParameters = JsonUtils.getJsonValue(incomingRequest, "service.parameters") String requestInputs = JsonUtils.getJsonValue(serviceParameters, "requestInputs") - String cvlan - String svlan - String remoteId - - List<Metadatum> metadatum = getMetaDatum(resourceInputObj.getGlobalSubscriberId(), - resourceInputObj.getServiceType(), - resourceInputObj.getServiceInstanceId()) - for(Metadatum datum: metadatum) { - if (datum.getMetaname().equalsIgnoreCase("cvlan")) { - cvlan = datum.getMetaval() - } - - if (datum.getMetaname().equalsIgnoreCase("svlan")) { - svlan = datum.getMetaval() - } - - if (datum.getMetaname().equalsIgnoreCase("remoteId")) { - remoteId = datum.getMetaval() - } - } - - logger.debug("cvlan: "+cvlan+" | svlan: "+svlan+" | remoteId: "+remoteId) - + String cvlan = jsonUtil.getJsonValue(serInput, + "service.parameters.requestInputs.cvlan") + String svlan = jsonUtil.getJsonValue(serInput, + "service.parameters.requestInputs.svlan") + String remoteId = jsonUtil.getJsonValue(serInput, + "service.parameters.requestInputs.edgeinternetprofile_ip_remote_id") String manufacturer = jsonUtil.getJsonValue(serInput, "service.parameters.requestInputs.ont_ont_manufacturer") String ontsn = jsonUtil.getJsonValue(serInput, @@ -209,7 +193,8 @@ public class CreateSDNCNetworkResource extends AbstractServiceTaskProcessor { logger.debug("new resource Input :" + resourceInputObj.toString()) break - case ~/[\w\s\W]*EdgeInternetProfile[\w\s\W]*/ : + case ~/[\w\s\W]*EdgeInternetProfile[\w\s\W]*/ : // for backward compatibilty only, this case will be deprecated + case ~/[\w\s\W]*InternetProfile[\w\s\W]*/ : // get the required properties and update in resource input def resourceInput = resourceInputObj.getResourceParameters() String incomingRequest = resourceInputObj.getRequestsInputs() @@ -217,37 +202,34 @@ public class CreateSDNCNetworkResource extends AbstractServiceTaskProcessor { String requestInputs = JsonUtils.getJsonValue(serviceParameters, "requestInputs") JSONObject inputParameters = new JSONObject(requestInputs) - String cvlan - String svlan - String remoteId + String cvlan = jsonUtil.getJsonValue(serInput, + "service.parameters.requestInputs.cvlan") + String svlan = jsonUtil.getJsonValue(serInput, + "service.parameters.requestInputs.svlan") String manufacturer = jsonUtil.getJsonValue(serInput, "service.parameters.requestInputs.ont_ont_manufacturer") - + String remoteId = jsonUtil.getJsonValue(serInput, + "service.parameters.requestInputs.edgeinternetprofile_ip_remote_id") String ontsn = jsonUtil.getJsonValue(serInput, "service.parameters.requestInputs.ont_ont_serial_num") - - List<Metadatum> metadatum = getMetaDatum(resourceInputObj.getGlobalSubscriberId(), - resourceInputObj.getServiceType(), - resourceInputObj.getServiceInstanceId()) - for(Metadatum datum: metadatum) { - if (datum.getMetaname().equalsIgnoreCase("cvlan")) { - cvlan = datum.getMetaval() - } - - if (datum.getMetaname().equalsIgnoreCase("svlan")) { - svlan = datum.getMetaval() - } - - if (datum.getMetaname().equalsIgnoreCase("remoteId")) { - remoteId = datum.getMetaval() - } - } + String serviceType = jsonUtil.getJsonValue(serInput, + "service.parameters.requestInputs.edgeinternetprofile_ip_service_type") + String macAddr = jsonUtil.getJsonValue(serInput, + "service.parameters.requestInputs.edgeinternetprofile_ip_rg_mac_addr") + String upStream = jsonUtil.getJsonValue(serInput, + "service.parameters.requestInputs.edgeinternetprofile_ip_upstream_speed") + String downStream = jsonUtil.getJsonValue(serInput, + "service.parameters.requestInputs.edgeinternetprofile_ip_downstream_speed") String uResourceInput = jsonUtil.addJsonValue(resourceInput, "requestInputs.c_vlan", cvlan) uResourceInput = jsonUtil.addJsonValue(uResourceInput, "requestInputs.s_vlan", svlan) uResourceInput = jsonUtil.addJsonValue(uResourceInput, "requestInputs.manufacturer", manufacturer) - uResourceInput = jsonUtil.addJsonValue(uResourceInput, "requestInputs.ip_access_id", remoteId) + uResourceInput = jsonUtil.addJsonValue(uResourceInput, "requestInputs.ip_remote_id", remoteId) uResourceInput = jsonUtil.addJsonValue(uResourceInput, "requestInputs.ont_sn", ontsn) + uResourceInput = jsonUtil.addJsonValue(uResourceInput, "requestInputs.ip_service_type", serviceType) + uResourceInput = jsonUtil.addJsonValue(uResourceInput, "requestInputs.ip_rg_mac_addr", macAddr) + uResourceInput = jsonUtil.addJsonValue(uResourceInput, "requestInputs.ip_upstream_speed", upStream) + uResourceInput = jsonUtil.addJsonValue(uResourceInput, "requestInputs.ip_downstream_speed", downStream) logger.debug("old resource input:" + resourceInputObj.toString()) resourceInputObj.setResourceParameters(uResourceInput) execution.setVariable(Prefix + "resourceInput", resourceInputObj.toString()) diff --git a/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DeleteCommunicationService.groovy b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DeleteCommunicationService.groovy new file mode 100644 index 0000000000..00b0b37b18 --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DeleteCommunicationService.groovy @@ -0,0 +1,429 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + # Copyright (c) 2019, CMCC Technologies Co., Ltd. + # + # Licensed under the Apache License, Version 2.0 (the "License") + # you may not use this file except in compliance with the License. + # You may obtain a copy of the License at + # + # http://www.apache.org/licenses/LICENSE-2.0 + # + # Unless required by applicable law or agreed to in writing, software + # distributed under the License is distributed on an "AS IS" BASIS, + # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + # See the License for the specific language governing permissions and + # limitations under the License. + * ============LICENSE_END========================================================= + */ +package org.onap.so.bpmn.infrastructure.scripts + + +import org.camunda.bpm.engine.delegate.BpmnError +import org.camunda.bpm.engine.delegate.DelegateExecution +import org.onap.aai.domain.yang.Relationship +import org.onap.aai.domain.yang.ServiceInstance +import org.onap.aai.domain.yang.CommunicationServiceProfile +import org.onap.aai.domain.yang.CommunicationServiceProfiles +import org.onap.logging.filter.base.ONAPComponents +import org.onap.so.bpmn.common.scripts.AbstractServiceTaskProcessor +import org.onap.so.bpmn.common.scripts.ExceptionUtil +import org.onap.so.bpmn.common.scripts.MsoUtils +import org.onap.so.bpmn.common.scripts.RequestDBUtil +import org.onap.so.bpmn.core.UrnPropertiesReader +import org.onap.so.bpmn.core.WorkflowException +import org.onap.so.bpmn.core.json.JsonUtils +import org.onap.so.client.HttpClient +import org.onap.so.client.HttpClientFactory +import org.onap.so.client.aai.AAIObjectType +import org.onap.so.client.aai.AAIResourcesClient +import org.onap.so.client.aai.entities.AAIResultWrapper +import org.onap.so.client.aai.entities.uri.AAIResourceUri +import org.onap.so.client.aai.entities.uri.AAIUriFactory +import org.onap.so.db.request.beans.OperationStatus +import org.slf4j.Logger +import org.slf4j.LoggerFactory + +import javax.ws.rs.NotFoundException +import javax.ws.rs.core.Response + +import static org.apache.commons.lang3.StringUtils.isBlank + +class DeleteCommunicationService extends AbstractServiceTaskProcessor { + private final String PREFIX ="DeleteCommunicationService" + private final Long TIMEOUT = 60 * 60 * 1000 + + ExceptionUtil exceptionUtil = new ExceptionUtil() + JsonUtils jsonUtil = new JsonUtils() + private RequestDBUtil requestDBUtil = new RequestDBUtil() + private static final Logger LOGGER = LoggerFactory.getLogger(DeleteCommunicationService.class) + + @Override + void preProcessRequest(DelegateExecution execution) { + execution.setVariable("prefix",PREFIX) + String msg = "" + + LOGGER.trace("Starting preProcessRequest") + + try { + // check for incoming json message/input + String siRequest = execution.getVariable("bpmnRequest") + String requestId = execution.getVariable("mso-request-id") + execution.setVariable("msoRequestId", requestId) + execution.setVariable("operationType", "DELETE") + + //communication service id + String serviceInstanceId = execution.getVariable("serviceInstanceId") + if (isBlank(serviceInstanceId)) { + msg = "communication-service id is null" + exceptionUtil.buildAndThrowWorkflowException(execution, 500, msg) + } + + LOGGER.info("Input Request: ${siRequest}, reqId: ${requestId}, serviceInstanceId: ${serviceInstanceId}") + + //requestParameters + checkAndSetRequestParam(siRequest,"globalSubscriberId",false,execution) + checkAndSetRequestParam(siRequest,"serviceType",false,execution) + checkAndSetRequestParam(siRequest,"operationId",false,execution) + + } catch (BpmnError e) { + throw e + } catch (any) { + msg = "Exception in preProcessRequest " + any.getCause() + LOGGER.debug(msg) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg) + } + LOGGER.trace("Exit preProcessRequest") + } + + + /** + * prepare update operation status + * @param execution + */ + void preInitUpdateOperationStatus(DelegateExecution execution){ + LOGGER.trace(" ======== STARTED initUpdateOperationStatus Process ======== ") + try{ + execution.setVariable("result","processing") + execution.setVariable("progress","0") + execution.setVariable("operationContent","delete communication service operation start") + setOperationStatus(execution) + + }catch(Exception e){ + LOGGER.error("Exception Occured Processing initUpdateOperationStatus. Exception is:\n" + e) + execution.setVariable("CVFMI_ErrorResponse", "Error Occurred during initUpdateOperationStatus Method:\n" + e.getMessage()) + } + LOGGER.trace("======== COMPLETED initUpdateOperationStatus Process ======== ") + } + + /** + * send sync response + * @param execution + */ + void sendSyncResponse(DelegateExecution execution) { + LOGGER.debug("Begin sendSyncResponse") + + try { + String operationId = execution.getVariable("operationId") + String syncResponse = """{"operationId":"${operationId}"}""".trim() + sendWorkflowResponse(execution, 202, syncResponse) + + } catch (Exception ex) { + String msg = "Exception in sendSyncResponse: " + ex.getMessage() + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg) + } + LOGGER.debug("Exit sendSyncResponse") + } + + /** + * query CommunicationSerive from AAI + * save e2eslice-service instance id and service name + * @param execution + */ + private void queryCommunicationSeriveFromAAI(DelegateExecution execution) + { + LOGGER.trace(" ***** begin queryCommunicationSeriveFromAAI *****") + String serviceInstanceId = execution.getVariable("serviceInstanceId") + + String errorMsg = "query communication service from aai failed" + AAIResultWrapper wrapper = queryAAI(execution, AAIObjectType.SERVICE_INSTANCE, serviceInstanceId, errorMsg) + Optional<ServiceInstance> si = wrapper.asBean(ServiceInstance.class) + if(si.isPresent()) + { + String serviceInstName = si.get()?.getServiceInstanceName() + String e2eSliceServiceInstId + if(si.isPresent()) + { + List<Relationship> relationshipList = si.get().getRelationshipList()?.getRelationship() + for (Relationship relationship : relationshipList) + { + String relatedTo = relationship.getRelatedTo() + if (relatedTo == "service-instance") + { + String relatedLink = relationship.getRelatedLink()?:"" + e2eSliceServiceInstId = relatedLink ? relatedLink.substring(relatedLink.lastIndexOf("/") + 1,relatedLink.length()) : "" + break + } + } + } + execution.setVariable("e2eSliceServiceInstanceId", e2eSliceServiceInstId) + execution.setVariable("serviceInstanceName", serviceInstName ?: "") + LOGGER.info("communication-service Id: ${serviceInstanceId}, e2eslice-service Id: ${e2eSliceServiceInstId}, serviceName: ${serviceInstName}") + } + LOGGER.debug(" ***** Exit queryCommunicationSeriveFromAAI *****") + } + + /** + * query AAI + * @param execution + * @param aaiObjectType + * @param instanceId + * @return AAIResultWrapper + */ + private AAIResultWrapper queryAAI(DelegateExecution execution, AAIObjectType aaiObjectType, String instanceId, String errorMsg) + { + String globalSubscriberId = execution.getVariable("globalSubscriberId") + String serviceType = execution.getVariable("serviceType") + + AAIResourcesClient resourceClient = new AAIResourcesClient() + AAIResourceUri resourceUri = AAIUriFactory.createResourceUri(aaiObjectType, globalSubscriberId, serviceType, instanceId) + if (!resourceClient.exists(resourceUri)) { + exceptionUtil.buildAndThrowWorkflowException(execution, 2500, errorMsg) + } + AAIResultWrapper wrapper = resourceClient.get(resourceUri, NotFoundException.class) + return wrapper + } + + + /** + * 再次调用deleteE2EServiceInstance接口，然后获取到operationid, + */ + void sendRequest2NSMFWF(DelegateExecution execution) { + LOGGER.trace("begin preRequestSend2NSMF") + try { + //url:/onap/so/infra/e2eServiceInstances/v3/{serviceInstanceId}" + def NSMF_endpoint = UrnPropertiesReader.getVariable("mso.infra.endpoint.url", execution) + String url = "${NSMF_endpoint}/e2eServiceInstances/v3/${execution.getVariable("e2eSliceServiceInstanceId")}" + + String requestBody = """ + { + "globalSubscriberId": "${execution.getVariable("globalSubscriberId")}", + "serviceType": "${execution.getVariable("serviceType")}" + } + """ + requestBody.replaceAll("\\s+", "") + + String basicAuthValue = UrnPropertiesReader.getVariable("mso.infra.endpoint.auth", execution) + HttpClient httpClient = new HttpClientFactory().newJsonClient(new URL(url), ONAPComponents.SO) + httpClient.addAdditionalHeader("Authorization", basicAuthValue) + httpClient.addAdditionalHeader("Accept", "application/json") + Response httpResponse = httpClient.delete(requestBody) + handleNSSMFWFResponse(httpResponse, execution) + + } catch (BpmnError e) { + throw e + } catch (any) { + String msg = "Exception in DeleteCommunicationService.preRequestSend2NSMF. " + any.getCause() + LOGGER.error(msg) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg) + } + + LOGGER.trace("exit preRequestSend2NSMF") + } + + /** + * prepare to call sub process + * @param execution + */ + void prepareCallCheckProcessStatus(DelegateExecution execution) + { + LOGGER.debug(PREFIX + "prepareCallCheckProcessStatus Start") + + def successConditions = new ArrayList<>() + successConditions.add("finished") + execution.setVariable("successConditions", successConditions) + + def errorConditions = new ArrayList<>() + errorConditions.add("error") + execution.setVariable("errorConditions", errorConditions) + + execution.setVariable("processServiceType", "communication service") + execution.setVariable("subOperationType", "DELETE") + execution.setVariable("initProgress", 20) + execution.setVariable("endProgress",90) + + execution.setVariable("timeOut", TIMEOUT) + + LOGGER.debug(PREFIX + "prepareCallCheckProcessStatus Exit") + } + + /** + * delete communication profile from AAI + * @param execution + */ + void delCSProfileFromAAI(DelegateExecution execution) + { + LOGGER.debug("start delete communication service profile from AAI") + String globalSubscriberId = execution.getVariable("globalSubscriberId") + String serviceType = execution.getVariable("serviceType") + String serviceInstanceId = execution.getVariable("serviceInstanceId") + + String profileId + try + { + AAIResourcesClient resourceClient = new AAIResourcesClient() + AAIResourceUri resourceUri = AAIUriFactory.createResourceUri(AAIObjectType.COMMUNICATION_PROFILE_ALL, globalSubscriberId, serviceType, serviceInstanceId) + AAIResultWrapper wrapper = resourceClient.get(resourceUri, NotFoundException.class) + Optional<CommunicationServiceProfiles> csProfilesOpt = wrapper.asBean(CommunicationServiceProfiles.class) + if(csProfilesOpt.isPresent()){ + CommunicationServiceProfiles csProf + iles = csProfilesOpt.get() + CommunicationServiceProfile csProfile = csProfiles.getCommunicationServiceProfile().get(0) + profileId = csProfile ? csProfile.getProfileId() : "" + } + resourceUri = AAIUriFactory.createResourceUri(AAIObjectType.COMMUNICATION_SERVICE_PROFILE, globalSubscriberId, serviceType, serviceInstanceId, profileId) + if (!resourceClient.exists(resourceUri)) { + exceptionUtil.buildAndThrowWorkflowException(execution, 2500, "communication service profile was not found in aai") + } + + resourceClient.delete(resourceUri) + LOGGER.debug("end delete communication service profile from AAI") + } + catch (any) + { + String msg = "delete communication service profile from aai failed! cause-"+any.getCause() + LOGGER.error(any.printStackTrace()) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg); + } + + } + + /** + * delete communication service from AAI + * @param execution + */ + void delCSFromAAI(DelegateExecution execution) + { + try + { + LOGGER.debug("start delete communication service from AAI") + AAIResourcesClient resourceClient = new AAIResourcesClient() + AAIResourceUri serviceInstanceUri = AAIUriFactory.createResourceUri(AAIObjectType.SERVICE_INSTANCE, execution.getVariable("globalSubscriberId"), execution.getVariable("serviceType"), execution.getVariable("serviceInstanceId")) + resourceClient.delete(serviceInstanceUri) + + execution.setVariable("progress", "100") + execution.setVariable("result", "finished") + execution.setVariable("operationContent", "CSMF completes service terminated.") + setOperationStatus(execution) + LOGGER.debug("end delete communication service from AAI") + } + catch (any) + { + LOGGER.error("Error occured within delCSFromAAI method, cause: ${any.getCause()} ") + exceptionUtil.buildAndThrowWorkflowException(execution, 2500, "Error occured during delete communication service from aai") + } + } + + void sendSyncError(DelegateExecution execution) + { + LOGGER.debug("Starting sendSyncError") + + try { + String errorMessage + if (execution.getVariable("WorkflowException") instanceof WorkflowException) { + WorkflowException wfe = execution.getVariable("WorkflowException") + errorMessage = wfe.getErrorMessage() + } else { + errorMessage = "Sending Sync Error." + } + + String buildworkflowException = + """<aetgt:WorkflowException xmlns:aetgt="http://org.onap/so/workflow/schema/v1"> + <aetgt:ErrorMessage>${MsoUtils.xmlEscape(errorMessage)}</aetgt:ErrorMessage> + <aetgt:ErrorCode>7000</aetgt:ErrorCode> + </aetgt:WorkflowException>""" + + LOGGER.debug(buildworkflowException) + sendWorkflowResponse(execution, 500, buildworkflowException) + + } catch (Exception ex) { + LOGGER.error("Sending Sync Error Activity Failed. " + "\n" + ex.getMessage()) + } + } + + /** + * prepare update operation status + * @param execution + */ + void preFailedOperationStatus(DelegateExecution execution) + { + LOGGER.debug(" ======== STARTED preFailedOperationStatus Process ======== ") + + execution.setVariable("progress", "100") + execution.setVariable("result", "error") + execution.setVariable("operationContent", "terminate service failure") + + WorkflowException wfex = execution.getVariable("WorkflowException") as WorkflowException + String errorMessage = wfex.getErrorMessage() + errorMessage = errorMessage.length() > 200 ? errorMessage.substring(0,200) + "......" : errorMessage + execution.setVariable("reason", errorMessage) + setOperationStatus(execution) + + LOGGER.debug("======== COMPLETED prepareEndOperationStatus Process ======== ") + } + + /** + * prepare Operation status + * @param execution + * @param operationType + */ + private void setOperationStatus(DelegateExecution execution) + { + OperationStatus operationStatus = new OperationStatus() + operationStatus.setServiceId(execution.getVariable("serviceInstanceId")) + operationStatus.setOperationId(execution.getVariable("operationId")) + operationStatus.setUserId(execution.getVariable("globalSubscriberId")) + //interface not support update + operationStatus.setServiceName(execution.getVariable("serviceInstanceName")) + operationStatus.setResult(execution.getVariable("result")) + operationStatus.setProgress(execution.getVariable("progress")) + operationStatus.setOperationContent(execution.getVariable("operationContent")) + operationStatus.setReason(execution.getVariable("reason")?:"") + operationStatus.setOperation("DELETE") + + requestDBUtil.prepareUpdateOperationStatus(execution, operationStatus) + } + + void prepareFailureStatus(DelegateExecution execution) + { + execution.setVariable("progress", "100") + execution.setVariable("operationContent", "terminate service failure.") + setOperationStatus(execution) + LOGGER.debug("${PREFIX}-prepareFailureStatus,result:${execution.getVariable("result")}, reason: ${execution.getVariable("reason")}") + } + + /** + * check request json and save parameter to execution + * @param siRequest + * @param paraName + * @param isErrorException + * @param execution + */ + private void checkAndSetRequestParam(String siRequest, String paraName, boolean isErrorException, DelegateExecution execution) + { + String msg = "" + String paramValue = jsonUtil.getJsonValue(siRequest, paraName) + if (isBlank(paramValue)) { + msg = "Input ${paraName} is null" + LOGGER.error(msg) + if(isErrorException) + { + exceptionUtil.buildAndThrowWorkflowException(execution, 500, msg) + } + + } else { + execution.setVariable(paraName, paramValue) + } + } +} diff --git a/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DeleteSliceService.groovy b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DeleteSliceService.groovy new file mode 100644 index 0000000000..f0d43cf8d7 --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DeleteSliceService.groovy @@ -0,0 +1,263 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (c) 2019, CMCC Technologies Co., Ltd. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.bpmn.infrastructure.scripts + +import org.camunda.bpm.engine.delegate.BpmnError +import org.camunda.bpm.engine.delegate.DelegateExecution +import org.onap.aai.domain.yang.ServiceProfile +import org.onap.aai.domain.yang.ServiceProfiles +import org.onap.so.bpmn.common.scripts.AbstractServiceTaskProcessor +import org.onap.so.bpmn.common.scripts.ExceptionUtil +import org.onap.so.bpmn.common.scripts.MsoUtils +import org.onap.so.bpmn.common.scripts.RequestDBUtil +import org.onap.so.bpmn.core.WorkflowException +import org.onap.so.bpmn.core.json.JsonUtils +import org.onap.so.client.aai.AAIObjectType +import org.onap.so.client.aai.AAIResourcesClient +import org.onap.so.client.aai.entities.AAIResultWrapper +import org.onap.so.client.aai.entities.uri.AAIResourceUri +import org.onap.so.client.aai.entities.uri.AAIUriFactory +import org.onap.so.db.request.beans.OperationStatus +import org.slf4j.Logger +import org.slf4j.LoggerFactory + +import javax.ws.rs.NotFoundException + +import static org.apache.commons.lang3.StringUtils.isBlank + +class DeleteSliceService extends AbstractServiceTaskProcessor { + + String Prefix="DELSS_" + ExceptionUtil exceptionUtil = new ExceptionUtil() + JsonUtils jsonUtil = new JsonUtils() + private RequestDBUtil requestDBUtil = new RequestDBUtil() + + private static final Logger logger = LoggerFactory.getLogger( DeleteSliceService.class) + + @Override + void preProcessRequest(DelegateExecution execution) { + execution.setVariable("prefix", Prefix) + String msg = "" + + logger.trace("Starting preProcessRequest") + + try { + // check for incoming json message/input + String siRequest = execution.getVariable("bpmnRequest") + String requestId = execution.getVariable("mso-request-id") + execution.setVariable("msoRequestId", requestId) + + //e2eslice-service instance id + String serviceInstanceId = execution.getVariable("serviceInstanceId") + if (isBlank(serviceInstanceId)) { + msg = "e2eslice-service id is null" + exceptionUtil.buildAndThrowWorkflowException(execution, 500, msg) + } + logger.info("Input Request: ${siRequest}, reqId: ${requestId}, e2eslice-service: ${serviceInstanceId}") + + //subscriberInfo + checkAndSetRequestParam(siRequest,"globalSubscriberId",false, execution) + checkAndSetRequestParam(siRequest,"serviceType",false, execution) + checkAndSetRequestParam(siRequest,"operationId",false, execution) + + //prepare init operation status + execution.setVariable("progress", "0") + execution.setVariable("result", "processing") + execution.setVariable("operationType", "DELETE") + execution.setVariable("operationContent", "Prepare init service") + updateServiceOperationStatus(execution) + + } catch (BpmnError e) { + throw e + } catch (Exception ex) { + msg = "Exception in preProcessRequest " + ex.getMessage() + logger.debug(msg) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg) + } + logger.trace("Exit preProcessRequest") + } + + /** + * send asynchronous response + * @param execution + */ + void sendAsyncResponse(DelegateExecution execution) { + logger.trace("Staring sendSyncResponse") + + try { + String operationId = execution.getVariable("operationId") + String syncResponse = """{"operationId":"${operationId}"}""".trim() + logger.info("sendSynchResponse: xmlSyncResponse - " + "\n" + syncResponse) + sendWorkflowResponse(execution, 202, syncResponse) + + } catch (Exception ex) { + String msg = "Exception in sendSyncResponse: " + ex.getMessage() + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg) + } + logger.trace("Exit sendSyncResponse") + } + + /** + * Deletes the slice service instance in aai + */ + void deleteSliceServiceInstance(DelegateExecution execution) { + logger.trace("Entered deleteSliceServiceInstance") + try { + + AAIResourcesClient resourceClient = new AAIResourcesClient() + AAIResourceUri serviceInstanceUri = AAIUriFactory.createResourceUri(AAIObjectType.SERVICE_INSTANCE, execution.getVariable("globalSubscriberId"), execution.getVariable("serviceType"), execution.getVariable("serviceInstanceId")) + resourceClient.delete(serviceInstanceUri) + + execution.setVariable("progress", "100") + execution.setVariable("result", "finished") + execution.setVariable("operationContent", "NSMF completes slicing service termination.") + updateServiceOperationStatus(execution) + + logger.trace("Exited deleteSliceServiceInstance") + }catch(Exception e){ + logger.debug("Error occured within deleteSliceServiceInstance method: " + e) + exceptionUtil.buildAndThrowWorkflowException(execution, 2500, "Error occured during deleteSliceServiceInstance from aai") + } + } + + /** + * update operation status + * @param execution + */ + private void updateServiceOperationStatus(DelegateExecution execution){ + + OperationStatus operationStatus = new OperationStatus() + operationStatus.setServiceId(execution.getVariable("serviceInstanceId")) + operationStatus.setOperationId(execution.getVariable("operationId")) + operationStatus.setUserId(execution.getVariable("globalSubscriberId")) + operationStatus.setResult(execution.getVariable("result")) + operationStatus.setProgress(execution.getVariable("progress")) + operationStatus.setOperationContent(execution.getVariable("operationContent")) + operationStatus.setReason(execution.getVariable("reason")) + operationStatus.setOperation(execution.getVariable("operationType")) + + requestDBUtil.prepareUpdateOperationStatus(execution, operationStatus) + } + + /** + * delete service profile from aai + * @param execution + */ + private void delServiceProfileFromAAI(DelegateExecution execution) + { + String globalSubscriberId = execution.getVariable("globalSubscriberId") + String serviceType = execution.getVariable("serviceType") + String serviceInstanceId = execution.getVariable("serviceInstanceId") + String profileId = "" + + try + { + AAIResourcesClient resourceClient = new AAIResourcesClient() + AAIResourceUri resourceUri = AAIUriFactory.createResourceUri(AAIObjectType.SERVICE_PROFILE_ALL, globalSubscriberId, serviceType, serviceInstanceId) + AAIResultWrapper wrapper = resourceClient.get(resourceUri, NotFoundException.class) + Optional<ServiceProfiles> serviceProfilesOpt =wrapper.asBean(ServiceProfiles.class) + if(serviceProfilesOpt.isPresent()){ + ServiceProfiles serviceProfiles = serviceProfilesOpt.get() + ServiceProfile serviceProfile = serviceProfiles.getServiceProfile().get(0) + profileId = serviceProfile ? serviceProfile.getProfileId() : "" + } + resourceUri = AAIUriFactory.createResourceUri(AAIObjectType.SERVICE_PROFILE, globalSubscriberId, serviceType, serviceInstanceId, profileId) + if (!resourceClient.exists(resourceUri)) { + exceptionUtil.buildAndThrowWorkflowException(execution, 2500, "Service Instance was not found in aai") + } + resourceClient.delete(resourceUri) + } + catch (any) + { + String msg = "delete service profile from aai failed! cause-"+any.getCause() + logger.error(any.printStackTrace()) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg); + } + } + + void sendSyncError(DelegateExecution execution) { + logger.info("Starting sendSyncError") + + try { + String errorMessage + if (execution.getVariable("WorkflowException") instanceof WorkflowException) { + WorkflowException wfe = execution.getVariable("WorkflowException") + errorMessage = wfe.getErrorMessage() + } else { + errorMessage = "Sending Sync Error." + } + + String buildworkflowException = + """<aetgt:WorkflowException xmlns:aetgt="http://org.onap/so/workflow/schema/v1"> + <aetgt:ErrorMessage>${MsoUtils.xmlEscape(errorMessage)}</aetgt:ErrorMessage> + <aetgt:ErrorCode>7000</aetgt:ErrorCode> + </aetgt:WorkflowException>""" + + logger.debug(buildworkflowException) + sendWorkflowResponse(execution, 500, buildworkflowException) + + } catch (Exception ex) { + logger.error("Sending Sync Error Activity Failed. " + "\n" + ex.getMessage()) + } + + } + + void prepareEndOperationStatus(DelegateExecution execution){ + logger.debug(" ======== STARTED prepareEndOperationStatus Process ======== ") + + execution.setVariable("progress", "100") + execution.setVariable("result", "error") + execution.setVariable("operationContent", "NSSMF Terminate service failure") + + WorkflowException wfex = execution.getVariable("WorkflowException") as WorkflowException + String errorMessage = wfex.getErrorMessage() + errorMessage = errorMessage.length() > 200 ? errorMessage.substring(0,200) + "......" : errorMessage + execution.setVariable("reason",errorMessage) + updateServiceOperationStatus(execution) + + logger.debug("======== COMPLETED prepareEndOperationStatus Process ======== ") + } + + /** + * check parameters from request body + * set to execution + * @param siRequest + * @param paraName + * @param isErrorException + * @param execution + */ + private void checkAndSetRequestParam(String siRequest, String paraName, boolean isErrorException, DelegateExecution execution) + { + String msg = "" + String paramValue = jsonUtil.getJsonValue(siRequest, paraName) + if (isBlank(paramValue)) { + msg = "Input ${paraName} is null" + logger.error(msg) + if(isErrorException) + { + exceptionUtil.buildAndThrowWorkflowException(execution, 500, msg) + } + + } else { + execution.setVariable(paraName, paramValue) + } + } +} diff --git a/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DoDeallocateNSSI.groovy b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DoDeallocateNSSI.groovy new file mode 100644 index 0000000000..d8897a2468 --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DoDeallocateNSSI.groovy @@ -0,0 +1,309 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + # Copyright (c) 2019, CMCC Technologies Co., Ltd. + # + # Licensed under the Apache License, Version 2.0 (the "License") + # you may not use this file except in compliance with the License. + # You may obtain a copy of the License at + # + # http://www.apache.org/licenses/LICENSE-2.0 + # + # Unless required by applicable law or agreed to in writing, software + # distributed under the License is distributed on an "AS IS" BASIS, + # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + # See the License for the specific language governing permissions and + # limitations under the License. + * ============LICENSE_END========================================================= + */ +package org.onap.so.bpmn.infrastructure.scripts + +import com.fasterxml.jackson.databind.ObjectMapper +import org.camunda.bpm.engine.delegate.DelegateExecution +import org.onap.logging.filter.base.ONAPComponents +import org.onap.so.beans.nsmf.DeAllocateNssi +import org.onap.so.beans.nsmf.EsrInfo +import org.onap.so.beans.nsmf.JobStatusRequest +import org.onap.so.beans.nsmf.JobStatusResponse +import org.onap.so.beans.nsmf.NetworkType +import org.onap.so.beans.nsmf.NssiDeAllocateRequest +import org.onap.so.beans.nsmf.NssiResponse +import org.onap.so.bpmn.common.scripts.AbstractServiceTaskProcessor +import org.onap.so.bpmn.common.scripts.ExceptionUtil +import org.onap.so.bpmn.common.scripts.RequestDBUtil +import org.onap.so.bpmn.core.UrnPropertiesReader +import org.onap.so.bpmn.core.domain.ServiceArtifact +import org.onap.so.bpmn.core.domain.ServiceDecomposition +import org.onap.so.bpmn.core.json.JsonUtils +import org.onap.so.client.HttpClient +import org.onap.so.client.HttpClientFactory +import org.onap.so.client.aai.AAIObjectType +import org.onap.so.client.aai.AAIResourcesClient +import org.onap.so.client.aai.entities.uri.AAIResourceUri +import org.onap.so.client.aai.entities.uri.AAIUriFactory +import org.onap.so.db.request.beans.OperationStatus +import org.slf4j.Logger +import org.slf4j.LoggerFactory + +import javax.ws.rs.core.Response + + +class DoDeallocateNSSI extends AbstractServiceTaskProcessor +{ + private final String PREFIX ="DoDeallocateNSSI" + + private ExceptionUtil exceptionUtil = new ExceptionUtil() + private JsonUtils jsonUtil = new JsonUtils() + private RequestDBUtil requestDBUtil = new RequestDBUtil() + private static final Logger LOGGER = LoggerFactory.getLogger( DoDeallocateNSSI.class) + + @Override + void preProcessRequest(DelegateExecution execution) { + LOGGER.trace(" ***** ${PREFIX} Start preProcessRequest *****") + + def currentNSSI = execution.getVariable("currentNSSI") + if (!currentNSSI) { + String msg = "currentNSSI is null" + LOGGER.error(msg) + exceptionUtil.buildAndThrowWorkflowException(execution, 500, msg) + } + + LOGGER.trace("***** ${PREFIX} Exit preProcessRequest *****") + } + + /** + * + * @param execution + */ + private void prepareDecomposeService(DelegateExecution execution) + { + LOGGER.trace(" *****${PREFIX} Start prepareDecomposeService *****") + try + { + def currentNSSI = execution.getVariable("currentNSSI") + String modelInvariantUuid = currentNSSI['modelInvariantId'] + String modelVersionId = currentNSSI['modelVersionId'] + String serviceModelInfo = """{ + "modelInvariantUuid":"${modelInvariantUuid}", + "modelUuid":"${modelVersionId}", + "modelVersion":"" + }""" + execution.setVariable("serviceModelInfo", serviceModelInfo) + } + catch (any) + { + String exceptionMessage = "Bpmn error encountered in deallocate nssi. Unexpected Error from method prepareDecomposeService() - " + any.getMessage() + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, exceptionMessage) + } + LOGGER.debug(" ***** ${PREFIX} Exit prepareDecomposeService *****") + } + + /** + * get vendor Info + * @param execution + */ + private void processDecomposition(DelegateExecution execution) { + LOGGER.debug("*****${PREFIX} start processDecomposition *****") + + try { + ServiceDecomposition serviceDecomposition = execution.getVariable("serviceDecomposition") as ServiceDecomposition + ServiceArtifact serviceArtifact = serviceDecomposition ?.getServiceInfo()?.getServiceArtifact()?.get(0) + String content = serviceArtifact.getContent() + String vendor = jsonUtil.getJsonValue(content, "metadata.vendor") + String domainType = jsonUtil.getJsonValue(content, "metadata.domainType") + + def currentNSSI = execution.getVariable("currentNSSI") + currentNSSI['vendor'] = vendor + currentNSSI['domainType'] = domainType + LOGGER.info("processDecomposition, current vendor-domainType:" +String.join("-", vendor, domainType)) + + } catch (any) { + String exceptionMessage = "Bpmn error encountered in deallocate nssi. processDecomposition() - " + any.getMessage() + LOGGER.debug(exceptionMessage) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, exceptionMessage) + } + LOGGER.debug("*****${PREFIX} Exit processDecomposition *****") + } + + /** + * send deallocate request to nssmf + * @param execution + */ + private void sendRequestToNSSMF(DelegateExecution execution) + { + LOGGER.debug("*****${PREFIX} start sendRequestToNSSMF *****") + def currentNSSI = execution.getVariable("currentNSSI") + String snssai= currentNSSI['snssai'] + String profileId = currentNSSI['profileId'] + String nssiId = currentNSSI['nssiServiceInstanceId'] + String nsiId = currentNSSI['nsiServiceInstanceId'] + + DeAllocateNssi deAllocateNssi = new DeAllocateNssi() + deAllocateNssi.setNsiId(nsiId) + deAllocateNssi.setNssiId(nssiId) + deAllocateNssi.setTerminateNssiOption(0) + deAllocateNssi.setSnssaiList(Arrays.asList(snssai)) + + NssiDeAllocateRequest deAllocateRequest = new NssiDeAllocateRequest() + deAllocateRequest.setDeAllocateNssi(deAllocateNssi) + deAllocateRequest.setEsrInfo(getEsrInfo(currentNSSI)) + + ObjectMapper mapper = new ObjectMapper() + String json = mapper.writeValueAsString(deAllocateRequest) + + //Prepare auth for NSSMF - Begin + String nssmfRequest = UrnPropertiesReader.getVariable("mso.adapters.nssmf.endpoint", execution) + nssmfRequest = nssmfRequest + String.format("/api/rest/provMns/v1/NSS/SliceProfiles/%s",profileId) + //nssmfRequest = nssmfRequest + String.format(NssmfAdapterUtil.NSSMI_DEALLOCATE_URL,profileId) + //send request to active NSSI TN option + URL url = new URL(nssmfRequest) + LOGGER.info("deallocate nssmfRequest:${nssmfRequest}, reqBody: ${json}") + + HttpClient httpClient = new HttpClientFactory().newJsonClient(url, ONAPComponents.EXTERNAL) + Response httpResponse = httpClient.post(json) + checkNssmfResponse(httpResponse, execution) + + NssiResponse nssmfResponse = httpResponse.readEntity(NssiResponse.class) + currentNSSI['jobId']= nssmfResponse.getJobId() ?: "" + currentNSSI['jobProgress'] = 0 + execution.setVariable("currentNSSI", currentNSSI) + + LOGGER.debug("*****${PREFIX} Exit sendRequestToNSSMF *****") + } + + /** + * send to nssmf query progress + * @param execution + */ + private void getJobStatus(DelegateExecution execution) + { + def currentNSSI = execution.getVariable("currentNSSI") + String jobId = currentNSSI['jobId'] + String nssiId = currentNSSI['nssiServiceInstanceId'] + String nsiId = currentNSSI['nsiServiceInstanceId'] + + JobStatusRequest jobStatusRequest = new JobStatusRequest() + jobStatusRequest.setNssiId(nssiId) + jobStatusRequest.setNsiId(nsiId) + jobStatusRequest.setEsrInfo(getEsrInfo(currentNSSI)) + + ObjectMapper mapper = new ObjectMapper() + String json = mapper.writeValueAsString(jobStatusRequest) + + //Prepare auth for NSSMF - Begin + String nssmfRequest = UrnPropertiesReader.getVariable("mso.adapters.nssmf.endpoint", execution) + nssmfRequest = nssmfRequest + String.format("/api/rest/provMns/v1/NSS/jobs/%s",jobId) + //send request to active NSSI TN option + URL url = new URL(nssmfRequest) + LOGGER.info("get deallocate job status, nssmfRequest:${nssmfRequest}, requestBody: ${json}") + + HttpClient httpClient = new HttpClientFactory().newJsonClient(url, ONAPComponents.EXTERNAL) + Response httpResponse = httpClient.post(json) + checkNssmfResponse(httpResponse, execution) + + JobStatusResponse jobStatusResponse = httpResponse.readEntity(JobStatusResponse.class) + def progress = jobStatusResponse?.getResponseDescriptor()?.getProgress() + if(!progress) + { + LOGGER.error("job progress is null or empty!") + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, "Received a Bad Job progress from NSSMF.") + } + int oldProgress = currentNSSI['jobProgress'] + int currentProgress = progress + + execution.setVariable("isNSSIDeAllocated", (currentProgress == 100)) + execution.setVariable("isNeedUpdateDB", (oldProgress != currentProgress)) + currentNSSI['jobProgress'] = currentProgress + + def statusDescription = jobStatusResponse?.getResponseDescriptor()?.getStatusDescription() + currentNSSI['statusDescription'] = statusDescription + + LOGGER.debug("job status result: nsiId = ${nsiId}, nssiId=${nssiId}, oldProgress=${oldProgress}, progress = ${currentProgress}" ) + } + + private void checkNssmfResponse(Response httpResponse, DelegateExecution execution) { + int responseCode = httpResponse.getStatus() + LOGGER.debug("NSSMF response code is: " + responseCode) + + if ( responseCode < 200 || responseCode > 204 || !httpResponse.hasEntity()) { + exceptionUtil.buildAndThrowWorkflowException(execution, responseCode, "Received a Bad Response from NSSMF.") + } + } + + + private EsrInfo getEsrInfo(def currentNSSI) + { + String domaintype = currentNSSI['domainType'] + String vendor = currentNSSI['vendor'] + + EsrInfo info = new EsrInfo() + info.setNetworkType(NetworkType.fromString(domaintype)) + info.setVendor(vendor) + return info + } + + /** + * handle job status + * prepare update requestdb + * @param execution + */ + private void handleJobStatus(DelegateExecution execution) + { + def currentNSSI = execution.getVariable("currentNSSI") + int currentProgress = currentNSSI["jobProgress"] + def proportion = currentNSSI['proportion'] + def statusDes = currentNSSI["statusDescription"] + int progress = (currentProgress as int) == 0 ? 0 : (currentProgress as int) / 100 * (proportion as int) + + OperationStatus operationStatus = new OperationStatus() + operationStatus.setServiceId(currentNSSI['e2eServiceInstanceId'] as String) + operationStatus.setOperationId(currentNSSI['operationId'] as String) + operationStatus.setOperation("DELETE") + operationStatus.setResult("processing") + operationStatus.setProgress(progress as String) + operationStatus.setOperationContent(statusDes as String) + requestDBUtil.prepareUpdateOperationStatus(execution, operationStatus) + LOGGER.debug("update operation, currentProgress=${currentProgress}, proportion=${proportion}, progress = ${progress}" ) + } + + private void timeDelay(DelegateExecution execution) { + try { + Thread.sleep(10000); + } catch(InterruptedException e) { + LOGGER.error("Time Delay exception" + e) + } + } + + /** + * delete slice profile from aai + * @param execution + */ + private void delSliceProfileFromAAI(DelegateExecution execution) + { + LOGGER.debug("*****${PREFIX} start delSliceProfileFromAAI *****") + def currentNSSI = execution.getVariable("currentNSSI") + String nssiServiceInstanceId = currentNSSI['nssiServiceInstanceId'] + String profileId = currentNSSI['profileId'] + String globalSubscriberId = currentNSSI["globalSubscriberId"] + String serviceType = currentNSSI["serviceType"] + + try + { + LOGGER.debug("delete nssiServiceInstanceId:${nssiServiceInstanceId}, profileId:${profileId}") + AAIResourcesClient resourceClient = new AAIResourcesClient() + AAIResourceUri resourceUri = AAIUriFactory.createResourceUri(AAIObjectType.SLICE_PROFILE, globalSubscriberId, serviceType, nssiServiceInstanceId, profileId) + if (!resourceClient.exists(resourceUri)) { + exceptionUtil.buildAndThrowWorkflowException(execution, 2500, "Service Instance was not found in aai") + } + resourceClient.delete(resourceUri) + } + catch (any) + { + String msg = "delete slice profile from aai failed! cause-"+any.getCause() + LOGGER.error(any.printStackTrace()) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg) + } + LOGGER.debug("*****${PREFIX} Exist delSliceProfileFromAAI *****") + } +} diff --git a/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DoDeleteSliceService.groovy b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DoDeleteSliceService.groovy new file mode 100644 index 0000000000..7c2a2be6ac --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DoDeleteSliceService.groovy @@ -0,0 +1,322 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + # Copyright (c) 2019, CMCC Technologies Co., Ltd. + # + # Licensed under the Apache License, Version 2.0 (the "License") + # you may not use this file except in compliance with the License. + # You may obtain a copy of the License at + # + # http://www.apache.org/licenses/LICENSE-2.0 + # + # Unless required by applicable law or agreed to in writing, software + # distributed under the License is distributed on an "AS IS" BASIS, + # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + # See the License for the specific language governing permissions and + # limitations under the License. + * ============LICENSE_END========================================================= + */ +package org.onap.so.bpmn.infrastructure.scripts + +import org.camunda.bpm.engine.delegate.BpmnError +import org.camunda.bpm.engine.delegate.DelegateExecution +import org.onap.aai.domain.yang.AllottedResource +import org.onap.aai.domain.yang.AllottedResources +import org.onap.aai.domain.yang.Relationship +import org.onap.aai.domain.yang.ServiceInstance +import org.onap.aai.domain.yang.SliceProfiles +import org.onap.so.bpmn.common.scripts.AbstractServiceTaskProcessor +import org.onap.so.bpmn.common.scripts.ExceptionUtil +import org.onap.so.client.aai.AAIObjectType +import org.onap.so.client.aai.AAIResourcesClient +import org.onap.so.client.aai.entities.AAIResultWrapper +import org.onap.so.client.aai.entities.uri.AAIResourceUri +import org.onap.so.client.aai.entities.uri.AAIUriFactory +import org.slf4j.Logger +import org.slf4j.LoggerFactory + +import javax.ws.rs.NotFoundException + +import static org.apache.commons.lang3.StringUtils.isBlank + +/** + * This groovy class supports the <class>DoDeleteSliceService.bpmn</class> process. + * + * Inputs: + * @param - msoRequestId + * @param - globalSubscriberId - O + * @param - subscriptionServiceType - O + * @param - serviceInstanceId + * + */ +class DoDeleteSliceService extends AbstractServiceTaskProcessor { + private final String PREFIX ="DoDeleteSliceService" + ExceptionUtil exceptionUtil = new ExceptionUtil() + private static final Logger LOGGER = LoggerFactory.getLogger( DoDeleteSliceService.class) + + @Override + void preProcessRequest(DelegateExecution execution) { + LOGGER.debug(" *****${PREFIX} preProcessRequest *****") + String msg = "" + + try { + //String requestId = execution.getVariable("msoRequestId") + execution.setVariable("prefix",PREFIX) + + //Inputs + //requestDetails.subscriberInfo. for AAI GET & PUT + execution.getVariable("globalSubscriberId") ?: execution.setVariable("globalSubscriberId", "") + + //requestDetails.requestParameters. for AAI PUT + execution.getVariable("serviceType") ?: execution.setVariable("serviceType", "") + + //Generated in parent for AAI PUT + String serviceInstanceId = execution.getVariable("serviceInstanceId") + if (isBlank(serviceInstanceId)){ + msg = "Input serviceInstanceId is null" + LOGGER.info(msg) + exceptionUtil.buildAndThrowWorkflowException(execution, 500, msg) + } + } catch (BpmnError e) { + throw e + } catch (Exception ex){ + msg = "Exception in preProcessRequest " + ex.getMessage() + LOGGER.error(msg) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg) + } + LOGGER.debug("*****${PREFIX} Exit preProcessRequest *****") + } + + /** + * query E2ESliceService from AAI + * save snssai + * @param execution + */ + void queryE2ESliceSeriveFromAAI(DelegateExecution execution) + { + LOGGER.trace(" *****${PREFIX} Start queryE2ESliceSeriveFromAAI *****") + String serviceInstanceId = execution.getVariable("serviceInstanceId") + + String errorMsg = "query e2e slice service from aai failed" + AAIResultWrapper wrapper = queryAAI(execution, AAIObjectType.SERVICE_INSTANCE, serviceInstanceId, errorMsg) + Optional<ServiceInstance> si =wrapper.asBean(ServiceInstance.class) + if(si.isPresent()) + { + String snssai = si.get()?.getEnvironmentContext() + execution.setVariable("snssai", snssai ?: "") + LOGGER.info("serviceInstanceId: ${serviceInstanceId}, snssai: ${snssai}") + } + LOGGER.trace(" *****${PREFIX} Exit queryE2ESliceSeriveFromAAI *****") + } + + /** + * get allotted resource from AAI + * save nsi id + * @param execution + */ + void getAllottedResFromAAI(DelegateExecution execution) + { + LOGGER.trace(" *****${PREFIX} Start getAllottedResFromAAI *****") + String serviceInstanceId = execution.getVariable("serviceInstanceId") + try + { + String errorMsg = "query allotted resource from aai failed." + AAIResultWrapper wrapper = queryAAI(execution, AAIObjectType.ALLOTTED_RESOURCE_ALL, serviceInstanceId, errorMsg) + Optional<AllottedResources> ars = wrapper?.asBean(AllottedResources.class) + if(ars.isPresent() && ars.get().getAllottedResource()) + { + List<AllottedResource> allottedResourceList = ars.get().getAllottedResource() + AllottedResource ar = allottedResourceList.first() + String relatedLink = ar?.getRelationshipList()?.getRelationship()?.first()?.getRelatedLink() + String nsiId = relatedLink ? relatedLink.substring(relatedLink.lastIndexOf("/") + 1,relatedLink.length()) : "" + execution.setVariable("nsiId", nsiId) + LOGGER.info("serviceInstanceId: ${serviceInstanceId}, nsiId:${nsiId}") + } + } + catch(BpmnError e){ + throw e + } + catch (Exception ex){ + String msg = "Exception in getAllottedResFromAAI " + ex.getMessage() + LOGGER.error(msg) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg) + } + LOGGER.trace(" *****${PREFIX} Exit getAllottedResFromAAI *****") + } + + /** + * get nsi service instance from aai + * save nssi id + * @param execution + */ + void getNSIFromAAI(DelegateExecution execution) + { + LOGGER.trace(" *****${PREFIX} Start getNSIFromAAI *****") + String nsiId = execution.getVariable("nsiId") + try + { + String errorMsg = "query nsi from aai failed." + AAIResultWrapper wrapper = queryAAI(execution, AAIObjectType.SERVICE_INSTANCE, nsiId, errorMsg) + Optional<ServiceInstance> si =wrapper.asBean(ServiceInstance.class) + List<String> nssiIdList = [] + String msg = "nsiId:${nsiId},nssiIdList:" + if(si.isPresent()) + { + List<Relationship> relationshipList = si.get().getRelationshipList()?.getRelationship() + for (Relationship relationship : relationshipList) + { + String relatedTo = relationship.getRelatedTo() + if (relatedTo == "service-instance") + { + String relatedLink = relationship.getRelatedLink()?:"" + String nssiId = relatedLink ? relatedLink.substring(relatedLink.lastIndexOf("/") + 1,relatedLink.length()) : "" + nssiIdList.add(nssiId) + msg+="${nssiId}, " + } + } + } + LOGGER.info(msg) + execution.setVariable("nssiIdList", nssiIdList) + } + catch(BpmnError e){ + throw e + } + catch (Exception ex){ + String msg = "Exception in getNSIFromAAI " + ex.getMessage() + LOGGER.error(msg) + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg) + } + LOGGER.trace(" *****${PREFIX} Exit getNSIFromAAI *****") + } + + /** + * get nssi service from AAI + * prepare list + * @param execution + */ + void getNSSIListFromAAI(DelegateExecution execution) + { + LOGGER.trace("*****${PREFIX} Start getNSSIListFromAAI *****") + List<String> nssiIdList = execution.getVariable("nssiIdList") + List<ServiceInstance> nssiInstanceList = [] + String errorMsg = "query nssi list from aai failed" + for(String nssiId : nssiIdList) + { + AAIResultWrapper wrapper = queryAAI(execution, AAIObjectType.SERVICE_INSTANCE, nssiId, errorMsg) + Optional<ServiceInstance> si =wrapper.asBean(ServiceInstance.class) + if(si.isPresent()) + { + nssiInstanceList.add(si.get()) + } + } + int size = nssiInstanceList.size() + int proportion = size >0 ?((90/size) as int) : 90 + execution.setVariable("nssiInstanceList", nssiInstanceList) + execution.setVariable("currentNSSIIndex", 0) + execution.setVariable("proportion", proportion) + String msg ="nssiInstanceList size: ${nssiInstanceList.size()}, proportion:${proportion}" + LOGGER.info(msg) + LOGGER.trace(" *****${PREFIX} Exit getNSSIListFromAAI *****") + } + + /** + * get current NSSI + * @param execution + */ + void getCurrentNSSI(DelegateExecution execution) + { + LOGGER.trace(" *****${PREFIX} Start getCurrentNSSI *****") + List<ServiceInstance> nssiInstanceList = execution.getVariable("nssiInstanceList") + int currentIndex = execution.getVariable("currentNSSIIndex") as int + ServiceInstance nssi = nssiInstanceList?.get(currentIndex) + def currentNSSI = [:] + currentNSSI['nssiServiceInstanceId'] = nssi?.getServiceInstanceId() + currentNSSI['modelInvariantId'] = nssi?.getModelInvariantId() + currentNSSI['modelVersionId'] = nssi?.getModelVersionId() + currentNSSI['snssai'] = execution.getVariable("snssai") ?: "" + currentNSSI['nsiServiceInstanceId'] = execution.getVariable("nsiId") ?: "" + currentNSSI['operationId'] = execution.getVariable("operationId") ?: "" + currentNSSI['e2eServiceInstanceId'] = execution.getVariable("serviceInstanceId") ?: "" + currentNSSI['msoRequestId'] = execution.getVariable("msoRequestId") ?: "" + currentNSSI['globalSubscriberId'] = execution.getVariable("globalSubscriberId") ?: "" + currentNSSI['serviceType'] = execution.getVariable("serviceType") ?: "" + currentNSSI['serviceModelInfo'] = execution.getVariable("serviceModelInfo") ?: "" + currentNSSI['proportion'] = (execution.getVariable("proportion") as int)*(currentIndex+1) + execution.setVariable("currentNSSI", currentNSSI) + String msg = "Now we deal with nssiServiceInstanceId: ${currentNSSI['nssiServiceInstanceId']}, current Index: ${currentIndex}, current proportion:${currentNSSI['proportion']}" + LOGGER.info(msg) + LOGGER.trace(" *****${PREFIX} Exit getCurrentNSSI *****") + } + + /** + * parse next nssi + * @param execution + */ + void parseNextNSSI(DelegateExecution execution) + { + LOGGER.trace(" *****${PREFIX} Start parseNextNSSI *****") + if(execution.getVariable("WorkflowException") != null){ + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, "current job failure!") + } + def currentIndex = execution.getVariable("currentNSSIIndex") + List<ServiceInstance> nssiInstanceList = execution.getVariable("nssiInstanceList") + def nextIndex = ++currentIndex + LOGGER.info("nextIndex: ${nextIndex}") + if(nextIndex >= nssiInstanceList.size()){ + execution.setVariable("isAllNSSIFinished", "true") + }else{ + execution.setVariable("isAllNSSIFinished", "false") + execution.setVariable("currentNSSIIndex", nextIndex) + } + LOGGER.trace(" *****${PREFIX} Exit parseNextNSSI *****") + } + + + /** + * query sliceProfile from AAI + * save profileId + * @param execution + */ + void querySliceProfileFromAAI(DelegateExecution execution) + { + LOGGER.trace(" *****${PREFIX} Start querySliceProfileFromAAI *****") + def currentNSSI = execution.getVariable("currentNSSI") + String nssiId = currentNSSI['nssiServiceInstanceId'] + String errorMsg = "query slice profile failed" + AAIResultWrapper wrapper = queryAAI(execution, AAIObjectType.SLICE_PROFILE_ALL, nssiId, errorMsg) + Optional<SliceProfiles> sliceProfiles =wrapper.asBean(SliceProfiles.class) + if(sliceProfiles.isPresent()) + { + String profileId = sliceProfiles.get().getSliceProfile()?.get(0)?.getProfileId() + currentNSSI['profileId'] = profileId ?: "" + LOGGER.info("nssiId: ${nssiId}, profileId: ${profileId}") + } + execution.setVariable("currentNSSI", currentNSSI) + LOGGER.trace(" *****${PREFIX} Exit querySliceProfileFromAAI *****") + } + + /** + * query AAI + * @param execution + * @param aaiObjectType + * @param instanceId + * @return AAIResultWrapper + */ + private AAIResultWrapper queryAAI(DelegateExecution execution, AAIObjectType aaiObjectType, String instanceId, String errorMsg) + { + LOGGER.trace(" *****${PREFIX} Start queryAAI *****") + String globalSubscriberId = execution.getVariable("globalSubscriberId") + String serviceType = execution.getVariable("serviceType") + + AAIResourcesClient resourceClient = new AAIResourcesClient() + AAIResourceUri resourceUri = AAIUriFactory.createResourceUri(aaiObjectType, globalSubscriberId, serviceType, instanceId) + if (!resourceClient.exists(resourceUri)) { + exceptionUtil.buildAndThrowWorkflowException(execution, 2500, errorMsg) + } + AAIResultWrapper wrapper = resourceClient.get(resourceUri, NotFoundException.class) + LOGGER.trace(" *****${PREFIX} Exit queryAAI *****") + return wrapper + } + +} diff --git a/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/aai/groovyflows/AAIDeleteServiceInstance.java b/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/aai/groovyflows/AAIDeleteServiceInstance.java index fb95ae3993..11707c4149 100644 --- a/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/aai/groovyflows/AAIDeleteServiceInstance.java +++ b/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/aai/groovyflows/AAIDeleteServiceInstance.java @@ -7,9 +7,9 @@ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at - * + * * http://www.apache.org/licenses/LICENSE-2.0 - * + * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. @@ -27,9 +27,15 @@ import org.onap.so.client.aai.AAIObjectType; import org.onap.so.client.aai.AAIResourcesClient; import org.onap.so.client.aai.entities.uri.AAIResourceUri; import org.onap.so.client.aai.entities.uri.AAIUriFactory; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; public class AAIDeleteServiceInstance implements JavaDelegate { + private static final Logger logger = LoggerFactory.getLogger(AAIDeleteServiceInstance.class); + private static final String ERROR_MESSAGE = + "Exception in Delete Serivce Instance. Service Instance could not be deleted in AAI."; + ExceptionUtil exceptionUtil = new ExceptionUtil(); public void execute(DelegateExecution execution) throws Exception { @@ -41,8 +47,8 @@ public class AAIDeleteServiceInstance implements JavaDelegate { aaiRC.delete(serviceInstanceURI); execution.setVariable("GENDS_SuccessIndicator", true); } catch (Exception ex) { - String msg = "Exception in Delete Serivce Instance. Service Instance could not be deleted in AAI." - + ex.getMessage(); + logger.debug(ERROR_MESSAGE, ex); + String msg = ERROR_MESSAGE + ex.getMessage(); exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg); } diff --git a/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/aai/groovyflows/AAIServiceInstance.java b/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/aai/groovyflows/AAIServiceInstance.java index 2d69351744..f7b0c662db 100644 --- a/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/aai/groovyflows/AAIServiceInstance.java +++ b/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/aai/groovyflows/AAIServiceInstance.java @@ -7,9 +7,9 @@ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at - * + * * http://www.apache.org/licenses/LICENSE-2.0 - * + * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. @@ -30,17 +30,70 @@ public class AAIServiceInstance { String environmentContext; String workloadContext; - public AAIServiceInstance(String serviceInstanceName, String serviceType, String serviceRole, - String orchestrationStatus, String modelInvariantUuid, String modelVersionId, String environmentContext, - String workloadContext) { - this.serviceInstanceName = serviceInstanceName; - this.serviceType = serviceType; - this.serviceRole = serviceRole; - this.orchestrationStatus = orchestrationStatus; - this.modelInvariantUuid = modelInvariantUuid; - this.modelVersionId = modelVersionId; - this.environmentContext = environmentContext; - this.workloadContext = workloadContext; + public class AAIServiceInstanceBuilder { + private String serviceInstanceName; + private String serviceType; + private String serviceRole; + private String orchestrationStatus; + private String modelInvariantUuid; + private String modelVersionId; + private String environmentContext; + private String workloadContext; + + public AAIServiceInstanceBuilder setServiceInstanceName(String serviceInstanceName) { + this.serviceInstanceName = serviceInstanceName; + return this; + } + + public AAIServiceInstanceBuilder setServiceType(String serviceType) { + this.serviceType = serviceType; + return this; + } + + public AAIServiceInstanceBuilder setServiceRole(String serviceRole) { + this.serviceRole = serviceRole; + return this; + } + + public AAIServiceInstanceBuilder setOrchestrationStatus(String orchestrationStatus) { + this.orchestrationStatus = orchestrationStatus; + return this; + } + + public AAIServiceInstanceBuilder setModelInvariantUuid(String modelInvariantUuid) { + this.modelInvariantUuid = modelInvariantUuid; + return this; + } + + public AAIServiceInstanceBuilder setModelVersionId(String modelVersionId) { + this.modelVersionId = modelVersionId; + return this; + } + + public AAIServiceInstanceBuilder setEnvironmentContext(String environmentContext) { + this.environmentContext = environmentContext; + return this; + } + + public AAIServiceInstanceBuilder setWorkloadContext(String workloadContext) { + this.workloadContext = workloadContext; + return this; + } + + public AAIServiceInstance createAAIServiceInstance() { + return new AAIServiceInstance(this); + } + } + + public AAIServiceInstance(AAIServiceInstanceBuilder aaiServiceInstanceBuilder) { + this.serviceInstanceName = aaiServiceInstanceBuilder.serviceInstanceName; + this.serviceType = aaiServiceInstanceBuilder.serviceType; + this.serviceRole = aaiServiceInstanceBuilder.serviceRole; + this.orchestrationStatus = aaiServiceInstanceBuilder.orchestrationStatus; + this.modelInvariantUuid = aaiServiceInstanceBuilder.modelInvariantUuid; + this.modelVersionId = aaiServiceInstanceBuilder.modelVersionId; + this.environmentContext = aaiServiceInstanceBuilder.environmentContext; + this.workloadContext = aaiServiceInstanceBuilder.workloadContext; } public String getServiceInstanceName() { diff --git a/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/pnf/delegate/NfSoftwareUpgradeDispatcher.java b/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/pnf/delegate/NfSoftwareUpgradeDispatcher.java new file mode 100644 index 0000000000..4482d2a327 --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/pnf/delegate/NfSoftwareUpgradeDispatcher.java @@ -0,0 +1,165 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix Foundation. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ + +package org.onap.so.bpmn.infrastructure.pnf.delegate; + +import com.fasterxml.jackson.databind.ObjectMapper; +import org.camunda.bpm.engine.delegate.DelegateExecution; +import org.camunda.bpm.engine.delegate.JavaDelegate; +import org.onap.aai.domain.yang.Pnf; +import org.onap.so.bpmn.core.json.JsonUtils; +import org.onap.so.bpmn.infrastructure.pnf.management.PnfManagement; +import org.onap.so.client.exception.ExceptionBuilder; +import org.onap.so.db.catalog.beans.PnfResourceCustomization; +import org.onap.so.db.catalog.client.CatalogDbClient; +import org.onap.so.serviceinstancebeans.RequestDetails; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.stereotype.Component; +import java.io.IOException; +import java.util.List; +import java.util.Map; +import java.util.Optional; +import static org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames.*; + +/** + * This implementation of {@link JavaDelegate} is used to populate the execution object for pnf software upgrade + */ +@Component +public class NfSoftwareUpgradeDispatcher implements JavaDelegate { + + private final Logger logger = LoggerFactory.getLogger(getClass()); + private static final String SERVICE_INSTANCE_NAME = "serviceInstanceName"; + private static final String BPMN_REQUEST = "bpmnRequest"; + private static final String RESOURCE_CUSTOMIZATION_UUID_PARAM = "resource_customization_uuid"; + private static final String PNF_NAME = "pnfName"; + + // ERROR CODE for variable not found in the delegation Context + private static final int ERROR_CODE = 601; + + @Autowired + private PnfManagement pnfManagement; + + @Autowired + private ExceptionBuilder exceptionUtil; + + @Autowired + private CatalogDbClient catalogDbClient; + + @Autowired + private ObjectMapper mapper; + + @Override + public void execute(DelegateExecution delegateExecution) throws Exception { + logger.debug("Running execute block for activity id:{}, name:{}", delegateExecution.getCurrentActivityId(), + delegateExecution.getCurrentActivityName()); + + RequestDetails bpmnRequestDetails = requestVerification(delegateExecution); + + final String serviceInstanceName = bpmnRequestDetails.getRequestInfo().getInstanceName(); + final String pnfName = bpmnRequestDetails.getRequestParameters().getUserParamValue(PNF_NAME); + final String serviceModelUuid = bpmnRequestDetails.getModelInfo().getModelUuid(); + final List<Map<String, Object>> userParams = bpmnRequestDetails.getRequestParameters().getUserParams(); + final Pnf pnf = getPnfByPnfName(delegateExecution, pnfName); + final List<PnfResourceCustomization> pnfCustomizations = + getPnfResourceCustomizations(delegateExecution, serviceModelUuid); + final PnfResourceCustomization pnfResourceCustomization = pnfCustomizations.get(0); + + populateExecution(delegateExecution, bpmnRequestDetails, pnfResourceCustomization, pnf, serviceInstanceName, + pnfName, serviceModelUuid, userParams); + + logger.trace("Completed preProcessRequest PnfSoftwareUpgradeServiceRequest Request "); + } + + private RequestDetails requestVerification(DelegateExecution delegateExecution) throws IOException { + RequestDetails bpmnRequestDetails = mapper.readValue( + JsonUtils.getJsonValue(String.valueOf(delegateExecution.getVariable(BPMN_REQUEST)), "requestDetails"), + RequestDetails.class); + + throwIfNull(delegateExecution, bpmnRequestDetails.getModelInfo(), SERVICE_MODEL_INFO); + throwIfNull(delegateExecution, bpmnRequestDetails.getRequestInfo(), "RequestInfo"); + throwIfNull(delegateExecution, bpmnRequestDetails.getRequestParameters(), "RequestParameters"); + throwIfNull(delegateExecution, bpmnRequestDetails.getRequestParameters().getUserParams(), "UserParams"); + + return bpmnRequestDetails; + } + + private void populateExecution(DelegateExecution delegateExecution, RequestDetails bpmnRequestDetails, + PnfResourceCustomization pnfResourceCustomization, Pnf pnf, String serviceInstanceName, String pnfName, + String serviceModelUuid, List<Map<String, Object>> userParams) { + + delegateExecution.setVariable(SERVICE_MODEL_INFO, bpmnRequestDetails.getModelInfo()); + delegateExecution.setVariable(SERVICE_INSTANCE_NAME, serviceInstanceName); + delegateExecution.setVariable(PNF_CORRELATION_ID, pnfName); + delegateExecution.setVariable(MODEL_UUID, serviceModelUuid); + delegateExecution.setVariable(PNF_UUID, pnf.getPnfId()); + delegateExecution.setVariable(PRC_BLUEPRINT_NAME, pnfResourceCustomization.getBlueprintName()); + delegateExecution.setVariable(PRC_BLUEPRINT_VERSION, pnfResourceCustomization.getBlueprintVersion()); + delegateExecution.setVariable(PRC_CUSTOMIZATION_UUID, pnfResourceCustomization.getModelCustomizationUUID()); + delegateExecution.setVariable(RESOURCE_CUSTOMIZATION_UUID_PARAM, + pnfResourceCustomization.getModelCustomizationUUID()); + delegateExecution.setVariable(PRC_INSTANCE_NAME, pnfResourceCustomization.getModelInstanceName()); + delegateExecution.setVariable(PRC_CONTROLLER_ACTOR, pnfResourceCustomization.getControllerActor()); + + for (Map<String, Object> param : userParams) { + if (param.containsKey("name") && param.containsKey("value")) { + delegateExecution.setVariable(param.get("name").toString(), param.get("value").toString()); + } + } + } + + private Pnf getPnfByPnfName(DelegateExecution delegateExecution, String pnfName) { + Optional<Pnf> pnfOptional = null; + try { + pnfOptional = pnfManagement.getEntryFor(pnfName); + } catch (IOException e) { + logger.warn(e.getMessage(), e); + exceptionUtil.buildAndThrowWorkflowException(delegateExecution, ERROR_CODE, + "Unable to fetch from AAI" + e.getMessage()); + } + if (pnfOptional == null || !pnfOptional.isPresent()) { + exceptionUtil.buildAndThrowWorkflowException(delegateExecution, ERROR_CODE, + "AAI entry for PNF: " + pnfName + " does not exist"); + } + return pnfOptional.get(); + } + + private List<PnfResourceCustomization> getPnfResourceCustomizations(DelegateExecution delegateExecution, + String serviceModelUuid) { + List<PnfResourceCustomization> pnfCustomizations = + catalogDbClient.getPnfResourceCustomizationByModelUuid(serviceModelUuid); + + if (pnfCustomizations == null || pnfCustomizations.isEmpty()) { + logger.warn("Unable to find the PNF resource customizations of model service UUID: {}", serviceModelUuid); + exceptionUtil.buildAndThrowWorkflowException(delegateExecution, ERROR_CODE, + "Unable to find the PNF resource customizations of model service UUID: " + serviceModelUuid); + } + return pnfCustomizations; + } + + private void throwIfNull(DelegateExecution delegateExecution, Object obj, String param) { + if (obj == null) { + logger.warn("Unable to find the parameter: {} in the execution context", param); + exceptionUtil.buildAndThrowWorkflowException(delegateExecution, ERROR_CODE, + "Unable to find parameter " + param); + } + } +} diff --git a/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/pnf/delegate/UpdatePnfEntryInAai.java b/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/pnf/delegate/UpdatePnfEntryInAai.java new file mode 100644 index 0000000000..f85be8aab7 --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/pnf/delegate/UpdatePnfEntryInAai.java @@ -0,0 +1,65 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix Foundation. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.bpmn.infrastructure.pnf.delegate; + +import org.camunda.bpm.engine.delegate.DelegateExecution; +import org.camunda.bpm.engine.delegate.JavaDelegate; +import org.onap.aai.domain.yang.Pnf; +import org.onap.so.bpmn.infrastructure.pnf.management.PnfManagement; +import org.onap.so.client.exception.ExceptionBuilder; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.stereotype.Component; +import java.util.Optional; +import static org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames.PNF_CORRELATION_ID; +import static org.onap.so.client.cds.PayloadConstants.PRC_TARGET_SOFTWARE_VERSION; + + +@Component +public class UpdatePnfEntryInAai implements JavaDelegate { + + private final Logger logger = LoggerFactory.getLogger(UpdatePnfEntryInAai.class); + + @Autowired + private PnfManagement pnfManagement; + + @Autowired + private ExceptionBuilder exceptionUtil; + + @Override + public void execute(DelegateExecution execution) throws Exception { + String pnfCorrelationId = String.valueOf(execution.getVariable(PNF_CORRELATION_ID)); + Optional<Pnf> pnfAaiEntry = pnfManagement.getEntryFor(pnfCorrelationId); + + if (!pnfAaiEntry.isPresent()) { + exceptionUtil.buildAndThrowWorkflowException(execution, 404, + "AAI entry for PNF: " + PNF_CORRELATION_ID + " does not exist"); + } + + Pnf pnf = pnfAaiEntry.get(); + String pnfSoftwareVersion = String.valueOf(execution.getVariable(PRC_TARGET_SOFTWARE_VERSION)); + pnf.setSwVersion(pnfSoftwareVersion); + + pnfManagement.updateEntry(pnfCorrelationId, pnf); + logger.debug("AAI entry is updated for pnf correlation id: {}, pnf uuid: {} with swVersion: {}", + pnf.getPnfName(), pnfCorrelationId, pnfSoftwareVersion); + } +} diff --git a/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/pnf/management/PnfManagement.java b/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/pnf/management/PnfManagement.java index 9e720fe0a4..46937d0d8c 100644 --- a/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/pnf/management/PnfManagement.java +++ b/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/pnf/management/PnfManagement.java @@ -30,5 +30,7 @@ public interface PnfManagement { void createEntry(String pnfCorrelationId, Pnf entry) throws IOException; + void updateEntry(String pnfCorrelationId, Pnf entry) throws IOException; + void createRelation(String serviceInstanceId, String pnfName) throws IOException; } diff --git a/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/pnf/management/PnfManagementImpl.java b/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/pnf/management/PnfManagementImpl.java index b1af8b1e0b..e6df8070a3 100644 --- a/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/pnf/management/PnfManagementImpl.java +++ b/bpmn/so-bpmn-infrastructure-common/src/main/java/org/onap/so/bpmn/infrastructure/pnf/management/PnfManagementImpl.java @@ -44,6 +44,11 @@ public class PnfManagementImpl implements PnfManagement { restClient.createPnf(pnfCorrelationId, entry); } + public void updateEntry(String pnfCorrelationId, Pnf entry) { + AAIRestClientImpl restClient = new AAIRestClientImpl(); + restClient.updatePnf(pnfCorrelationId, entry); + } + @Override public void createRelation(String serviceInstanceId, String pnfName) { AAIResourceUri serviceInstanceURI = diff --git a/bpmn/so-bpmn-infrastructure-common/src/test/groovy/org/onap/so/bpmn/infrastructure/scripts/CheckServiceProcessStatusTest.groovy b/bpmn/so-bpmn-infrastructure-common/src/test/groovy/org/onap/so/bpmn/infrastructure/scripts/CheckServiceProcessStatusTest.groovy new file mode 100644 index 0000000000..f066f9e878 --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-common/src/test/groovy/org/onap/so/bpmn/infrastructure/scripts/CheckServiceProcessStatusTest.groovy @@ -0,0 +1,344 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + # Copyright (c) 2019, CMCC Technologies Co., Ltd. + # + # Licensed under the Apache License, Version 2.0 (the "License") + # you may not use this file except in compliance with the License. + # You may obtain a copy of the License at + # + # http://www.apache.org/licenses/LICENSE-2.0 + # + # Unless required by applicable law or agreed to in writing, software + # distributed under the License is distributed on an "AS IS" BASIS, + # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + # See the License for the specific language governing permissions and + # limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.bpmn.infrastructure.scripts + +import org.camunda.bpm.engine.impl.persistence.entity.ExecutionEntity +import org.junit.Before +import org.junit.Test +import org.mockito.ArgumentCaptor +import org.mockito.Captor +import org.mockito.Mockito +import org.onap.so.bpmn.common.scripts.MsoGroovyTest + +import static org.junit.Assert.assertEquals +import static org.mockito.ArgumentMatchers.eq +import static org.mockito.Mockito.times +import static org.mockito.Mockito.when + +class CheckServiceProcessStatusTest extends MsoGroovyTest { + @Before + void init() throws IOException { + super.init("CheckServiceProcessStatus") + } + + @Captor + static ArgumentCaptor<ExecutionEntity> captor = ArgumentCaptor.forClass(ExecutionEntity.class) + + + @Test + void testPreProcessRequest () { + when(mockExecution.getVariable("serviceInstanceId")).thenReturn("12345") + when(mockExecution.getVariable("operationId")).thenReturn("54321") + + def successConditions = new ArrayList<>() + successConditions.add("finished") + successConditions.add("completed") + + def errorConditions = new ArrayList<>() + errorConditions.add("error") + errorConditions.add("failed") + + when(mockExecution.getVariable("successConditions")).thenReturn(successConditions) + when(mockExecution.getVariable("errorConditions")).thenReturn(errorConditions) + + + CheckServiceProcessStatus serviceProcessStatus = new CheckServiceProcessStatus() + serviceProcessStatus.preProcessRequest(mockExecution) + Mockito.verify(mockExecution, times(9)).setVariable(captor.capture(), captor.capture()) + } + + + @Test + void testPreCheckServiceStatusReq() { + when(mockExecution.getVariable("serviceInstanceId")).thenReturn("12345") + when(mockExecution.getVariable("operationId")).thenReturn("54321") + + CheckServiceProcessStatus serviceProcessStatus = new CheckServiceProcessStatus() + + serviceProcessStatus.preCheckServiceStatusReq(mockExecution) + Mockito.verify(mockExecution, times(1)).setVariable(eq("getOperationStatus"), captor.capture()) + String res = captor.getValue() + String expect = + """<soapenv:Envelope xmlns:soapenv="http://schemas.xmlsoap.org/soap/envelope/" + xmlns:ns="http://org.onap.so/requestsdb"> + <soapenv:Header/> + <soapenv:Body> + <ns:getServiceOperationStatus xmlns:ns="http://org.onap.so/requestsdb"> + <serviceId>12345</serviceId> + <operationId>54321</operationId> + </ns:getServiceOperationStatus> + </soapenv:Body> + </soapenv:Envelope> + """ + assertEquals(expect.replaceAll("\\s+", ""), res.replaceAll("\\s+", "")) + } + + + @Test + void testHandlerServiceStatusRespSuccess() { + mockData() + when(mockExecution.getVariable("dbResponseCode")).thenReturn(200) + when(mockExecution.getVariable("dbResponse")).thenReturn(getDBResponse("finished")) + def successConditions = new ArrayList<>() + successConditions.add("finished") + successConditions.add("completed") + + when(mockExecution.getVariable("successConditions")).thenReturn(successConditions) + + CheckServiceProcessStatus serviceProcessStatus = new CheckServiceProcessStatus() + serviceProcessStatus.handlerServiceStatusResp(mockExecution) + + Mockito.verify(mockExecution, times(4)).setVariable(captor.capture(), captor.capture()) + def resultSuccess = captor.getAllValues() + + def expect = new ArrayList<>() + expect.add("operationStatus") + expect.add("finished") + expect.add("operationContent") + expect.add("communication service create operation finished success") + expect.add("orchestrationStatus") + expect.add("deactivated") + expect.add("isAllFinished") + expect.add("true") + + assertEquals(expect, resultSuccess) + } + + + @Test + void testHandlerServiceStatusRespError() { + mockData() + when(mockExecution.getVariable("dbResponseCode")).thenReturn(200) + when(mockExecution.getVariable("dbResponse")).thenReturn(getDBResponse("error")) + + def successConditions = new ArrayList<>() + successConditions.add("finished") + successConditions.add("completed") + + def errorConditions = new ArrayList<>() + errorConditions.add("error") + errorConditions.add("failed") + + when(mockExecution.getVariable("successConditions")).thenReturn(successConditions) + when(mockExecution.getVariable("errorConditions")).thenReturn(errorConditions) + + CheckServiceProcessStatus serviceProcessStatus = new CheckServiceProcessStatus() + serviceProcessStatus.handlerServiceStatusResp(mockExecution) + + Mockito.verify(mockExecution, times(4)).setVariable(captor.capture(), captor.capture()) + def resultSuccess = captor.getAllValues() + + def expect = new ArrayList<>() + expect.add("operationStatus") + expect.add("error") + expect.add("operationContent") + expect.add("communication service create operation finished with error") + expect.add("orchestrationStatus") + expect.add("error") + expect.add("isAllFinished") + expect.add("true") + + assertEquals(expect, resultSuccess) + } + + + @Test + void testHandlerServiceStatusRespProcessingNo() { + mockData() + when(mockExecution.getVariable("dbResponseCode")).thenReturn(200) + when(mockExecution.getVariable("dbResponse")).thenReturn(getDBResponse("processing")) + when(mockExecution.getVariable("progress")).thenReturn(50) + + def successConditions = new ArrayList<>() + successConditions.add("finished") + successConditions.add("completed") + + def errorConditions = new ArrayList<>() + errorConditions.add("error") + errorConditions.add("failed") + + when(mockExecution.getVariable("successConditions")).thenReturn(successConditions) + when(mockExecution.getVariable("errorConditions")).thenReturn(errorConditions) + + CheckServiceProcessStatus serviceProcessStatus = new CheckServiceProcessStatus() + serviceProcessStatus.handlerServiceStatusResp(mockExecution) + + Mockito.verify(mockExecution, times(2)).setVariable(captor.capture(), captor.capture()) + def resultSuccess = captor.getAllValues() + + def expect = new ArrayList<>() + expect.add("isNeedUpdateDB") + expect.add("false") + expect.add("isAllFinished") + expect.add("false") + + assertEquals(expect as String, resultSuccess as String) + } + + + @Test + void testHandlerServiceStatusRespProcessingYes() { + mockData() + when(mockExecution.getVariable("dbResponseCode")).thenReturn(200) + when(mockExecution.getVariable("dbResponse")).thenReturn(getDBResponse("processing")) + when(mockExecution.getVariable("progress")).thenReturn(60) + + def successConditions = new ArrayList<>() + successConditions.add("finished") + successConditions.add("completed") + + def errorConditions = new ArrayList<>() + errorConditions.add("error") + errorConditions.add("failed") + + when(mockExecution.getVariable("successConditions")).thenReturn(successConditions) + when(mockExecution.getVariable("errorConditions")).thenReturn(errorConditions) + + CheckServiceProcessStatus serviceProcessStatus = new CheckServiceProcessStatus() + serviceProcessStatus.handlerServiceStatusResp(mockExecution) + + Mockito.verify(mockExecution, times(3)).setVariable(captor.capture(), captor.capture()) + def resultSuccess = captor.getAllValues() + + def expect = new ArrayList<>() + expect.add("progress") + expect.add("50") + expect.add("isNeedUpdateDB") + expect.add("true") + expect.add("isAllFinished") + expect.add("false") + + assertEquals(expect as String, resultSuccess as String) + } + + + @Test + void testTimeWaitDelayNo() { + mockData() + when(mockExecution.getVariable("startTime")).thenReturn(System.currentTimeMillis()) + CheckServiceProcessStatus serviceProcessStatus = new CheckServiceProcessStatus() + + serviceProcessStatus.timeWaitDelay(mockExecution) + Mockito.verify(mockExecution, times(1)).setVariable(eq("isTimeOut"), captor.capture()) + def res = captor.getValue() + + assertEquals("NO", res) + } + + + @Test + void testTimeWaitDelayYes() { + mockData() + when(mockExecution.getVariable("startTime")).thenReturn(1000000) + CheckServiceProcessStatus serviceProcessStatus = new CheckServiceProcessStatus() + + serviceProcessStatus.timeWaitDelay(mockExecution) + Mockito.verify(mockExecution, times(4)).setVariable(captor.capture(), captor.capture()) + def res = captor.getAllValues() + def expect = new ArrayList<>() + expect.add("operationStatus") + expect.add("error") + expect.add("operationContent") + expect.add("communication service create operation finished with timeout") + expect.add("orchestrationStatus") + expect.add("error") + expect.add("isTimeOut") + expect.add("YES") + + assertEquals(expect, res) + } + + + @Test + void testPreUpdateOperationProgress() { + mockData() + when(mockExecution.getVariable("progress")).thenReturn(50) + when(mockExecution.getVariable("initProgress")).thenReturn(20) + when(mockExecution.getVariable("endProgress")).thenReturn(90) + when(mockExecution.getVariable("operationType")).thenReturn("CREATE") + when(mockExecution.getVariable("processServiceType")).thenReturn("communication service") + when(mockExecution.getVariable("parentServiceInstanceId")).thenReturn("12345") + when(mockExecution.getVariable("parentOperationId")).thenReturn("54321") + when(mockExecution.getVariable("globalSubscriberId")).thenReturn("11111") + + CheckServiceProcessStatus serviceProcessStatus = new CheckServiceProcessStatus() + serviceProcessStatus.preUpdateOperationProgress(mockExecution) + Mockito.verify(mockExecution, times(1)).setVariable(eq("updateOperationStatus"), captor.capture()) + String res = captor.getValue() + + String expect = getExpectPayload("55", + "communication service CREATE operation processing 55") + + assertEquals(expect.replaceAll("\\s+", ""), res.replaceAll("\\s+", "")) + + + } + + + private static String getExpectPayload(String progress, String operationContent) { + String expect = + """<soapenv:Envelope xmlns:soapenv="http://schemas.xmlsoap.org/soap/envelope/" + xmlns:ns="http://org.onap.so/requestsdb"> + <soapenv:Header/> + <soapenv:Body> + <ns:updateServiceOperationStatus xmlns:ns="http://org.onap.so/requestsdb"> + <serviceId>12345</serviceId> + <operationId>54321</operationId> + <operationType>CREATE</operationType> + <userId>11111</userId> + <result>processing</result> + <operationContent>${operationContent}</operationContent> + <progress>${progress}</progress> + <reason></reason> + </ns:updateServiceOperationStatus> + </soapenv:Body> + </soapenv:Envelope> + """ + return expect + } + + + private static String getDBResponse(String result) { + String response = + """<soap:Envelope xmlns:soap="http://schemas.xmlsoap.org/soap/envelope/"> + <soap:Body> + <ns2:getServiceOperationStatusResponse xmlns:ns2="http://org.onap.so/requestsdb"> + <return><operation>CREATE</operation> + <operationContent>Prepare service creation</operationContent> + <operationId>077995e3-eb32-44ae-b35d-491fc6983a44</operationId> + <progress>50</progress> + <reason></reason> + <result>${result}</result> + <serviceId>3324f117-696d-4518-b8b5-b01fcc127a03</serviceId> + <userId>5GCustomer</userId> + </return></ns2:getServiceOperationStatusResponse> + </soap:Body> + </soap:Envelope> + """ + return response + } + + + private mockData() { + when(mockExecution.getVariable("processServiceType")).thenReturn("communication service") + when(mockExecution.getVariable("operationType")).thenReturn("create") + } +} diff --git a/bpmn/so-bpmn-infrastructure-common/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/NfSoftwareUpgradeDispatcherTest.java b/bpmn/so-bpmn-infrastructure-common/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/NfSoftwareUpgradeDispatcherTest.java new file mode 100644 index 0000000000..3c568ffc83 --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-common/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/NfSoftwareUpgradeDispatcherTest.java @@ -0,0 +1,182 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix Foundation. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ + +package org.onap.so.bpmn.infrastructure.pnf.delegate; + +import com.fasterxml.jackson.databind.ObjectMapper; +import org.camunda.bpm.engine.delegate.DelegateExecution; +import org.camunda.bpm.extension.mockito.delegate.DelegateExecutionFake; +import org.junit.Before; +import org.junit.Test; +import org.junit.runner.RunWith; +import org.mockito.InjectMocks; +import org.mockito.Mock; +import org.onap.aai.domain.yang.Pnf; +import org.onap.so.bpmn.core.json.JsonUtils; +import org.onap.so.bpmn.infrastructure.pnf.management.PnfManagement; +import org.onap.so.db.catalog.beans.PnfResourceCustomization; +import org.onap.so.db.catalog.client.CatalogDbClient; +import org.onap.so.serviceinstancebeans.ModelInfo; +import org.onap.so.serviceinstancebeans.RequestDetails; +import org.onap.so.serviceinstancebeans.RequestInfo; +import org.onap.so.serviceinstancebeans.RequestParameters; +import org.springframework.test.context.junit4.SpringJUnit4ClassRunner; +import java.io.IOException; +import java.util.*; +import static org.assertj.core.api.Assertions.assertThat; +import static org.assertj.core.api.Assertions.fail; +import static org.mockito.BDDMockito.given; +import static org.mockito.Mockito.doReturn; +import static org.mockito.Mockito.when; +import static org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames.*; +import static org.onap.so.client.cds.PayloadConstants.PRC_TARGET_SOFTWARE_VERSION; + + +@RunWith(SpringJUnit4ClassRunner.class) +public class NfSoftwareUpgradeDispatcherTest { + + private static final String TEST_PROCESS_KEY = "processKey1"; + private static final String PROCESS_KEY = "testProcessKey"; + private static final String TEST_PNF_RESOURCE_INSTANCE_NAME = "PNF_demo_resource"; + private static final String TEST_PNF_RESOURCE_BLUEPRINT_NAME = "blueprintOnap"; + private static final String TEST_PNF_RESOURCE_BLUEPRINT_VERSION = "1.0.1"; + private static final String TEST_PNF_RESOURCE_CUSTOMIZATION_UUID = "9acb3a83-8a52-412c-9a45-901764938144"; + private static final String TEST_PNF_CORRELATION_ID = "PNFDemo"; + private static final String TEST_PNF_UUID = "FakeID"; + private static final String TEST_PRC_CONTROLLER_ACTOR = "cds"; + private static final String TEST_TARGET_SOFTWARE_VERSION = "demo-sw-ver2.0.0"; + + private static final String TEST_BPMN_REQUEST = "{\"requestDetails\":{" + "\"requestInfo\":{" + + "\"source\":\"VID\"," + "\"suppressRollback\":false," + "\"requestorId\":\"demo\"," + + "\"productFamilyId\":\"SWUPid\"}," + "\"modelInfo\":{" + + "\"modelType\":\"service\",\"modelInvariantUuid\":\"439b7a2f-9524-4dbf-9eee-f2e05521df3f\"," + + "\"modelInvariantId\":\"439b7a2f-9524-4dbf-9eee-f2e05521df3f\"," + + "\"modelUuid\":\"42daaac6-5017-4e1e-96c8-6a27dfbe1421\",\"modelName\":\"PNF_int_service_2\"," + + "\"modelVersion\":\"1.0\"},\"requestParameters\":{\"userParams\":[{\"name\":\"aic_zone\"," + + "\"value\":\"nova\"},{\"name\":\"pnfId\",\"value\":\"PNFDemo\"},{\"name\":\"targetSoftwareVersion\",\"value\":\"demo-sw-ver2.0.0\"}]," + + "\"subscriptionServiceType\":\"SWUP\",\"aLaCarte\":false,\"pnfCorrelationId\":\"PNFDemo\"}," + + "\"cloudConfiguration\":{\"lcpCloudRegionId\":\"regionOne\",\"tenantId\":\"09a63533072f4a579d5c99c3b8fe94c6\"}," + + "\"subscriberInfo\":{\"globalSubscriberId\":\"ADemoCustomerInEric\"},\"project\":{\"projectName\":\"Project-Demonstration\"}," + + "\"owningEntity\":{\"owningEntityId\":\"5eae949c-1c50-4780-b8b5-7cbeb08856b4\",\"owningEntityName\":\"OE-Demonstration\"}}}"; + /** + * Testing model UUID, should be the same as specified in the TEST_SERVICE_MODEL_INFO. + */ + private static final String TEST_MODEL_UUID = "42daaac6-5017-4e1e-96c8-6a27dfbe1421"; + + @InjectMocks + private NfSoftwareUpgradeDispatcher nfSoftwareUpgradeDispatcher; + + @Mock + private PnfManagement pnfManagement; + + @Mock + private CatalogDbClient catalogDbClient; + + @Mock + private ObjectMapper mapper; + + private DelegateExecution execution = new DelegateExecutionFake(); + + @Before + public void setUp() throws IOException { + List<PnfResourceCustomization> pnfResourceCustomizations = new ArrayList<>(); + pnfResourceCustomizations.add(buildPnfResourceCustomization()); + given(catalogDbClient.getPnfResourceCustomizationByModelUuid(TEST_MODEL_UUID)) + .willReturn(pnfResourceCustomizations); + execution.setVariable(PROCESS_KEY, TEST_PROCESS_KEY); + execution.setVariable("bpmnRequest", TEST_BPMN_REQUEST); + mockMapper(); + mockAai(); + + } + + + @Test + public void testExecution_validCatalogDb_skipVariableSet() { + try { + nfSoftwareUpgradeDispatcher.execute(execution); + assertThat(execution.getVariable(MODEL_UUID)).isEqualTo(TEST_MODEL_UUID); + assertThat(execution.getVariable(PRC_TARGET_SOFTWARE_VERSION)).isEqualTo(TEST_TARGET_SOFTWARE_VERSION); + assertThat(execution.getVariable(PRC_BLUEPRINT_NAME)).isEqualTo(TEST_PNF_RESOURCE_BLUEPRINT_NAME); + assertThat(execution.getVariable(PRC_BLUEPRINT_VERSION)).isEqualTo(TEST_PNF_RESOURCE_BLUEPRINT_VERSION); + assertThat(execution.getVariable(PRC_CUSTOMIZATION_UUID)).isEqualTo(TEST_PNF_RESOURCE_CUSTOMIZATION_UUID); + assertThat(execution.getVariable(PRC_INSTANCE_NAME)).isEqualTo(TEST_PNF_RESOURCE_INSTANCE_NAME); + assertThat(execution.getVariable(PNF_CORRELATION_ID)).isEqualTo(TEST_PNF_CORRELATION_ID); + assertThat(execution.getVariable(PNF_UUID)).isEqualTo(TEST_PNF_UUID); + assertThat(execution.getVariable(PRC_CONTROLLER_ACTOR)).isEqualTo(TEST_PRC_CONTROLLER_ACTOR); + } catch (Exception e) { + e.printStackTrace(); + fail("Exception thrown" + e.getMessage()); + } + } + + private void mockAai() throws IOException { + Pnf pnf = new Pnf(); + pnf.setPnfId(TEST_PNF_UUID); + when(pnfManagement.getEntryFor(TEST_PNF_CORRELATION_ID)).thenReturn(Optional.of(pnf)); + } + + private PnfResourceCustomization buildPnfResourceCustomization() { + PnfResourceCustomization pnfResourceCustomization = new PnfResourceCustomization(); + pnfResourceCustomization.setSkipPostInstConf(true); + pnfResourceCustomization.setBlueprintName(TEST_PNF_RESOURCE_BLUEPRINT_NAME); + pnfResourceCustomization.setBlueprintVersion(TEST_PNF_RESOURCE_BLUEPRINT_VERSION); + pnfResourceCustomization.setModelInstanceName(TEST_PNF_RESOURCE_INSTANCE_NAME); + pnfResourceCustomization.setModelCustomizationUUID(TEST_PNF_RESOURCE_CUSTOMIZATION_UUID); + pnfResourceCustomization.setControllerActor(TEST_PRC_CONTROLLER_ACTOR); + return pnfResourceCustomization; + } + + private void mockMapper() throws IOException { + RequestDetails bpmnRequestDetails = new RequestDetails(); + + RequestInfo requestInfo = new RequestInfo(); + requestInfo.setInstanceName("demo"); + bpmnRequestDetails.setRequestInfo(requestInfo); + + RequestParameters requestParameters = new RequestParameters(); + List<Map<String, Object>> userParams = new ArrayList<>(); + Map<String, Object> map = new HashMap<>(); + map.put("name", "targetSoftwareVersion"); + map.put("value", TEST_TARGET_SOFTWARE_VERSION); + userParams.add(map); + map = new HashMap<>(); + map.put("name", "pnfName"); + map.put("value", "PNFDemo"); + userParams.add(map); + requestParameters.setUserParams(userParams); + + bpmnRequestDetails.setRequestParameters(requestParameters); + + ModelInfo modelInfo = new ModelInfo(); + modelInfo.setModelInvariantUuid("439b7a2f-9524-4dbf-9eee-f2e05521df3f"); + modelInfo.setModelInvariantId("439b7a2f-9524-4dbf-9eee-f2e05521df3f"); + modelInfo.setModelUuid("42daaac6-5017-4e1e-96c8-6a27dfbe1421"); + modelInfo.setModelName("PNF_int_service_2"); + modelInfo.setModelVersion("1.0"); + + bpmnRequestDetails.setModelInfo(modelInfo); + + + doReturn(bpmnRequestDetails).when(mapper).readValue( + JsonUtils.getJsonValue(String.valueOf(execution.getVariable("bpmnRequest")), "requestDetails"), + RequestDetails.class); + } +} diff --git a/bpmn/so-bpmn-infrastructure-common/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/PnfManagementTestImpl.java b/bpmn/so-bpmn-infrastructure-common/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/PnfManagementTestImpl.java index 8577d9555b..b93902d9f7 100644 --- a/bpmn/so-bpmn-infrastructure-common/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/PnfManagementTestImpl.java +++ b/bpmn/so-bpmn-infrastructure-common/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/PnfManagementTestImpl.java @@ -50,6 +50,11 @@ public class PnfManagementTestImpl implements PnfManagement { } @Override + public void updateEntry(String pnfCorrelationId, Pnf entry) throws IOException { + created.put(pnfCorrelationId, entry); + } + + @Override public void createRelation(String serviceInstanceId, String pnfName) {} public Map<String, Pnf> getCreated() { diff --git a/bpmn/so-bpmn-infrastructure-common/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/PnfManagementThrowingException.java b/bpmn/so-bpmn-infrastructure-common/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/PnfManagementThrowingException.java index f9b467c650..77377db9d9 100644 --- a/bpmn/so-bpmn-infrastructure-common/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/PnfManagementThrowingException.java +++ b/bpmn/so-bpmn-infrastructure-common/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/PnfManagementThrowingException.java @@ -38,6 +38,11 @@ public class PnfManagementThrowingException implements PnfManagement { } @Override + public void updateEntry(String pnfCorrelationId, Pnf entry) throws IOException { + throw new IOException(); + } + + @Override public void createRelation(String serviceInstanceId, String pnfName) throws IOException { throw new IOException(); } diff --git a/bpmn/so-bpmn-infrastructure-common/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/UpdatePnfEntryInAaiTest.java b/bpmn/so-bpmn-infrastructure-common/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/UpdatePnfEntryInAaiTest.java new file mode 100644 index 0000000000..bddfe5b180 --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-common/src/test/java/org/onap/so/bpmn/infrastructure/pnf/delegate/UpdatePnfEntryInAaiTest.java @@ -0,0 +1,91 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix Foundation. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.bpmn.infrastructure.pnf.delegate; + +import org.camunda.bpm.engine.delegate.DelegateExecution; +import org.junit.Test; +import org.junit.runner.RunWith; +import org.mockito.InjectMocks; +import org.mockito.Mock; +import org.onap.aai.domain.yang.Pnf; +import org.onap.so.bpmn.infrastructure.pnf.management.PnfManagement; +import org.springframework.test.context.junit4.SpringJUnit4ClassRunner; +import static org.junit.Assert.*; +import java.io.IOException; +import java.util.Optional; +import static org.assertj.core.api.Assertions.assertThat; +import static org.mockito.ArgumentMatchers.anyString; +import static org.mockito.ArgumentMatchers.eq; +import static org.mockito.BDDMockito.given; +import static org.mockito.Mockito.*; +import static org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames.PNF_CORRELATION_ID; +import static org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames.PNF_UUID; +import static org.onap.so.client.cds.PayloadConstants.PRC_TARGET_SOFTWARE_VERSION; + +@RunWith(SpringJUnit4ClassRunner.class) +public class UpdatePnfEntryInAaiTest { + + @InjectMocks + private UpdatePnfEntryInAai updatePnfEntryInAai; + + @Mock + private PnfManagement pnfManagementTest; + + private DelegateExecution execution; + + + + @Test + public void shouldSetSwVersion() throws Exception { + // given + setupPnf(); + setupExecution(); + + // when + updatePnfEntryInAai.execute(execution); + + // verify + Optional<Pnf> modifiedEntry = pnfManagementTest.getEntryFor("testPnfCorrelationId"); + assertNotNull(modifiedEntry.get()); + assertThat(modifiedEntry.get().getPnfId()).isEqualTo("testtest"); + assertThat(modifiedEntry.get().getPnfName()).isEqualTo("testPnfCorrelationId"); + assertThat(modifiedEntry.get().getSwVersion()).isEqualTo("demo-1.2"); + verify(pnfManagementTest, times(2)).getEntryFor(anyString()); + } + + private void setupPnf() { + try { + Pnf pnf = new Pnf(); + pnf.setSwVersion("1"); + pnf.setPnfId("testtest"); + pnf.setPnfName("testPnfCorrelationId"); + doReturn(Optional.of(pnf)).when(pnfManagementTest).getEntryFor(anyString()); + } catch (IOException e) { + e.printStackTrace(); + } + } + + private void setupExecution() { + execution = mock(DelegateExecution.class); + given(execution.getVariable(eq(PNF_CORRELATION_ID))).willReturn("testPnfCorrelationId"); + given(execution.getVariable(eq(PNF_UUID))).willReturn("testtest"); + given(execution.getVariable(eq(PRC_TARGET_SOFTWARE_VERSION))).willReturn("demo-1.2"); + } +} diff --git a/bpmn/so-bpmn-infrastructure-flows/pom.xml b/bpmn/so-bpmn-infrastructure-flows/pom.xml index d0c16fc1cc..c7d4f3f894 100644 --- a/bpmn/so-bpmn-infrastructure-flows/pom.xml +++ b/bpmn/so-bpmn-infrastructure-flows/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>bpmn</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <modelVersion>4.0.0</modelVersion> <artifactId>so-bpmn-infrastructure-flows</artifactId> diff --git a/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/ActivateCommunicationService.bpmn b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/ActivateCommunicationService.bpmn new file mode 100644 index 0000000000..92fd5ef52b --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/ActivateCommunicationService.bpmn @@ -0,0 +1,486 @@ +<?xml version="1.0" encoding="UTF-8"?> +<bpmn:definitions xmlns:bpmn="http://www.omg.org/spec/BPMN/20100524/MODEL" xmlns:bpmndi="http://www.omg.org/spec/BPMN/20100524/DI" xmlns:dc="http://www.omg.org/spec/DD/20100524/DC" xmlns:camunda="http://camunda.org/schema/1.0/bpmn" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xmlns:di="http://www.omg.org/spec/DD/20100524/DI" id="Definitions_1gtu09b" targetNamespace="http://bpmn.io/schema/bpmn" exporter="Camunda Modeler" exporterVersion="3.4.1"> + <bpmn:process id="ActivateCommunicationService" name="ActivateCommunicationService" isExecutable="true"> + <bpmn:startEvent id="StartEvent_1"> + <bpmn:outgoing>SequenceFlow_199lc2s</bpmn:outgoing> + </bpmn:startEvent> + <bpmn:scriptTask id="ScriptTask_08alvv7" name="Pre Process Incoming Request" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_199lc2s</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0rl5u9x</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def act= new ActivateCommunicationService() +act.preProcessRequest(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_199lc2s" sourceRef="StartEvent_1" targetRef="ScriptTask_08alvv7" /> + <bpmn:scriptTask id="ScriptTask_0t2aizp" name="Init Service Operation Status" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0cg4k4f</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0xunetn</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def act= new ActivateCommunicationService() +act.prepareInitOperationStatus(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:serviceTask id="ServiceTask_1h8uywz" name="Init Service Operation Status"> + <bpmn:extensionElements> + <camunda:connector> + <camunda:inputOutput> + <camunda:inputParameter name="url">${dbAdapterEndpoint}</camunda:inputParameter> + <camunda:inputParameter name="headers"> + <camunda:map> + <camunda:entry key="content-type">application/soap+xml</camunda:entry> + <camunda:entry key="Authorization">Basic YnBlbDpwYXNzd29yZDEk</camunda:entry> + </camunda:map> + </camunda:inputParameter> + <camunda:inputParameter name="payload">${updateOperationStatus}</camunda:inputParameter> + <camunda:inputParameter name="method">POST</camunda:inputParameter> + <camunda:outputParameter name="ACS_init_dbResponseCode">${statusCode}</camunda:outputParameter> + <camunda:outputParameter name="ACS_init_dbResponse">${response}</camunda:outputParameter> + </camunda:inputOutput> + <camunda:connectorId>http-connector</camunda:connectorId> + </camunda:connector> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0xunetn</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_07brvnu</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:sequenceFlow id="SequenceFlow_0xunetn" sourceRef="ScriptTask_0t2aizp" targetRef="ServiceTask_1h8uywz" /> + <bpmn:scriptTask id="ScriptTask_1rshcew" name="Send Sync Ack Response" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_07brvnu</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0c01147</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def act= new ActivateCommunicationService() +act.sendSyncResponse(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:scriptTask id="ScriptTask_0soxu97" name="check AAI Orch Status of cs" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0rl5u9x</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0337wg2</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def act= new ActivateCommunicationService() +act.checkAAIOrchStatus(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_0rl5u9x" sourceRef="ScriptTask_08alvv7" targetRef="ScriptTask_0soxu97" /> + <bpmn:sequenceFlow id="SequenceFlow_07brvnu" sourceRef="ServiceTask_1h8uywz" targetRef="ScriptTask_1rshcew" /> + <bpmn:intermediateThrowEvent id="IntermediateThrowEvent_1twqa76" name="Goto Call Active Slice"> + <bpmn:incoming>SequenceFlow_0c01147</bpmn:incoming> + <bpmn:linkEventDefinition name="CallActiveSlice" /> + </bpmn:intermediateThrowEvent> + <bpmn:intermediateCatchEvent id="IntermediateThrowEvent_15alt6m" name="CallActiveSlice"> + <bpmn:outgoing>SequenceFlow_1om5m6o</bpmn:outgoing> + <bpmn:linkEventDefinition id="LinkEventDefinition_0zbmuty" name="CallActiveSlice" /> + </bpmn:intermediateCatchEvent> + <bpmn:sequenceFlow id="SequenceFlow_1om5m6o" sourceRef="IntermediateThrowEvent_15alt6m" targetRef="ScriptTask_0oun39f" /> + <bpmn:exclusiveGateway id="ExclusiveGateway_1j8khf8" name="Is call activate slice Successful?"> + <bpmn:incoming>SequenceFlow_1i6cshg</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_176pwpd</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_1r6lo31</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:scriptTask id="ScriptTask_0fbubvu" name="Update Finish Status In AAI " scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1w1h5vl</bpmn:incoming> + <bpmn:incoming>SequenceFlow_1r6lo31</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1b8q7l5</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def act= new ActivateCommunicationService() +act.updateFinishStatusInAAI(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:scriptTask id="ScriptTask_1seqo87" name="Prepare Complete Status in requestDB" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1b8q7l5</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_103y3rz</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def act= new ActivateCommunicationService() +act.prepareCompleteStatus(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:serviceTask id="ServiceTask_10gsfd1" name="Update Service Operation Status Completed"> + <bpmn:extensionElements> + <camunda:connector> + <camunda:inputOutput> + <camunda:inputParameter name="url">${dbAdapterEndpoint}</camunda:inputParameter> + <camunda:inputParameter name="headers"> + <camunda:map> + <camunda:entry key="content-type">application/soap+xml</camunda:entry> + <camunda:entry key="Authorization">Basic YnBlbDpwYXNzd29yZDEk</camunda:entry> + </camunda:map> + </camunda:inputParameter> + <camunda:inputParameter name="payload">${updateOperationStatus}</camunda:inputParameter> + <camunda:inputParameter name="method">POST</camunda:inputParameter> + <camunda:outputParameter name="ACS_complete_dbResponseCode">${statusCode}</camunda:outputParameter> + <camunda:outputParameter name="ACS_complete_dbResponse">${response}</camunda:outputParameter> + </camunda:inputOutput> + <camunda:connectorId>http-connector</camunda:connectorId> + </camunda:connector> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_103y3rz</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_15dmqcp</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:sequenceFlow id="SequenceFlow_1b8q7l5" sourceRef="ScriptTask_0fbubvu" targetRef="ScriptTask_1seqo87" /> + <bpmn:sequenceFlow id="SequenceFlow_103y3rz" sourceRef="ScriptTask_1seqo87" targetRef="ServiceTask_10gsfd1" /> + <bpmn:sequenceFlow id="SequenceFlow_176pwpd" name="yes" sourceRef="ExclusiveGateway_1j8khf8" targetRef="ScriptTask_0zqkikf"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("ProcessNsmfSuccess") == "OK"}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:endEvent id="EndEvent_0z07q3n"> + <bpmn:incoming>SequenceFlow_15dmqcp</bpmn:incoming> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_15dmqcp" sourceRef="ServiceTask_10gsfd1" targetRef="EndEvent_0z07q3n" /> + <bpmn:exclusiveGateway id="ExclusiveGateway_1g73afb" name="Is orchstatus vaild?" default="SequenceFlow_0hpybf9"> + <bpmn:incoming>SequenceFlow_0337wg2</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0cg4k4f</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_0hpybf9</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:sequenceFlow id="SequenceFlow_0cg4k4f" name="yes" sourceRef="ExclusiveGateway_1g73afb" targetRef="ScriptTask_0t2aizp"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("isContinue") == "true"}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:sequenceFlow id="SequenceFlow_0337wg2" sourceRef="ScriptTask_0soxu97" targetRef="ExclusiveGateway_1g73afb" /> + <bpmn:sequenceFlow id="SequenceFlow_0hpybf9" name="no" sourceRef="ExclusiveGateway_1g73afb" targetRef="EndEvent_02rugcv" /> + <bpmn:endEvent id="EndEvent_02rugcv"> + <bpmn:incoming>SequenceFlow_0hpybf9</bpmn:incoming> + <bpmn:errorEventDefinition errorRef="Error_1ld8i6u" /> + </bpmn:endEvent> + <bpmn:subProcess id="SubProcess_1i9i3h1" name="Sub-process for FalloutHandler and Rollback" triggeredByEvent="true"> + <bpmn:startEvent id="StartEvent_1f90rxc"> + <bpmn:outgoing>SequenceFlow_1dkviys</bpmn:outgoing> + <bpmn:errorEventDefinition id="ErrorEventDefinition_0iyy5ka" /> + </bpmn:startEvent> + <bpmn:endEvent id="EndEvent_1m9nsoo"> + <bpmn:incoming>SequenceFlow_18sqlo7</bpmn:incoming> + </bpmn:endEvent> + <bpmn:scriptTask id="ScriptTask_003nbzc" name="Send Error Response" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1dkviys</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_18sqlo7</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def act= new ActivateCommunicationService() +act.sendSyncError(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_1dkviys" sourceRef="StartEvent_1f90rxc" targetRef="ScriptTask_003nbzc" /> + <bpmn:sequenceFlow id="SequenceFlow_18sqlo7" sourceRef="ScriptTask_003nbzc" targetRef="EndEvent_1m9nsoo" /> + </bpmn:subProcess> + <bpmn:scriptTask id="ScriptTask_0zqkikf" name="Prepare Update Operation Status" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_176pwpd</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0mruwcs</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def act= new ActivateCommunicationService() +act.prepareUpdateOperationStatus(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:serviceTask id="ServiceTask_11v60ns" name="Update Service Operation Status processing"> + <bpmn:extensionElements> + <camunda:connector> + <camunda:inputOutput> + <camunda:inputParameter name="url">${dbAdapterEndpoint}</camunda:inputParameter> + <camunda:inputParameter name="headers"> + <camunda:map> + <camunda:entry key="content-type">application/soap+xml</camunda:entry> + <camunda:entry key="Authorization">Basic YnBlbDpwYXNzd29yZDEk</camunda:entry> + </camunda:map> + </camunda:inputParameter> + <camunda:inputParameter name="payload">${updateOperationStatus}</camunda:inputParameter> + <camunda:inputParameter name="method">POST</camunda:inputParameter> + <camunda:outputParameter name="ACS_processing_dbResponseCode">${statusCode}</camunda:outputParameter> + <camunda:outputParameter name="ACS_processing_dbResponse">${response}</camunda:outputParameter> + </camunda:inputOutput> + <camunda:connectorId>http-connector</camunda:connectorId> + </camunda:connector> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0mruwcs</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0f57hgr</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:sequenceFlow id="SequenceFlow_0mruwcs" sourceRef="ScriptTask_0zqkikf" targetRef="ServiceTask_11v60ns" /> + <bpmn:scriptTask id="ScriptTask_0oun39f" name="Pre Request Send To NSMF" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1om5m6o</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_12ax52p</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def act= new ActivateCommunicationService() +act.preRequestSend2NSMF(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:serviceTask id="ServiceTask_1pbp58s" name="Send Request To NSMF"> + <bpmn:extensionElements> + <camunda:connector> + <camunda:inputOutput> + <camunda:inputParameter name="url">${NSMF_endpoint}</camunda:inputParameter> + <camunda:inputParameter name="headers"> + <camunda:map> + <camunda:entry key="content-type">application/json</camunda:entry> + <camunda:entry key="Authorization">Basic SW5mcmFQb3J0YWxDbGllbnQ6cGFzc3dvcmQxJA==</camunda:entry> + </camunda:map> + </camunda:inputParameter> + <camunda:inputParameter name="payload">${CSMF_NSMFRequest}</camunda:inputParameter> + <camunda:inputParameter name="method">POST</camunda:inputParameter> + <camunda:outputParameter name="CSMF_NSMFResponseCode">${statusCode}</camunda:outputParameter> + <camunda:outputParameter name="CSMF_NSMFResponse">${response}</camunda:outputParameter> + </camunda:inputOutput> + <camunda:connectorId>http-connector</camunda:connectorId> + </camunda:connector> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_12ax52p</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1e9r8tc</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:scriptTask id="ScriptTask_167kv01" name="Process NSMF response" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1e9r8tc</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1i6cshg</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def act= new ActivateCommunicationService() +act.processNSMFResponse(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_12ax52p" sourceRef="ScriptTask_0oun39f" targetRef="ServiceTask_1pbp58s" /> + <bpmn:sequenceFlow id="SequenceFlow_1e9r8tc" sourceRef="ServiceTask_1pbp58s" targetRef="ScriptTask_167kv01" /> + <bpmn:sequenceFlow id="SequenceFlow_1i6cshg" sourceRef="ScriptTask_167kv01" targetRef="ExclusiveGateway_1j8khf8" /> + <bpmn:scriptTask id="ScriptTask_0iubb84" name="Prepare Call CheckServiceProcessStatus" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1hsbli0</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_102nqyb</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def act= new ActivateCommunicationService() +act.prepareCallCheckProcessStatus(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_102nqyb" sourceRef="ScriptTask_0iubb84" targetRef="CallActivity_12eufsa" /> + <bpmn:sequenceFlow id="SequenceFlow_0f57hgr" sourceRef="ServiceTask_11v60ns" targetRef="IntermediateThrowEvent_1u9a1t0" /> + <bpmn:intermediateThrowEvent id="IntermediateThrowEvent_1u9a1t0" name="Goto check processing status"> + <bpmn:incoming>SequenceFlow_0f57hgr</bpmn:incoming> + <bpmn:linkEventDefinition name="CheckProcessingStatus" /> + </bpmn:intermediateThrowEvent> + <bpmn:sequenceFlow id="SequenceFlow_1hsbli0" sourceRef="IntermediateThrowEvent_1lcnqle" targetRef="ScriptTask_0iubb84" /> + <bpmn:intermediateCatchEvent id="IntermediateThrowEvent_1lcnqle" name="CheckProcessingStatus"> + <bpmn:outgoing>SequenceFlow_1hsbli0</bpmn:outgoing> + <bpmn:linkEventDefinition name="CheckProcessingStatus" /> + </bpmn:intermediateCatchEvent> + <bpmn:callActivity id="CallActivity_12eufsa" name="CallCheckServiceProcessStatus" calledElement="CheckServiceProcessStatus"> + <bpmn:extensionElements> + <camunda:in source="e2eServiceInstanceId" target="serviceInstanceId" /> + <camunda:in source="e2eOperationId" target="operationId" /> + <camunda:in source="successConditions" target="successConditions" /> + <camunda:in source="processServiceType" target="processServiceType" /> + <camunda:in source="errorConditions" target="errorConditions" /> + <camunda:in source="timeOut" target="timeOut" /> + <camunda:in source="successParamMap" target="successParamMap" /> + <camunda:in source="errorParamMap" target="errorParamMap" /> + <camunda:out source="orchestrationStatus" target="orchestrationStatus" /> + <camunda:out source="operationStatus" target="operationStatus" /> + <camunda:out source="operationContent" target="operationContent" /> + <camunda:out source="WorkflowException" target="WorkflowException" /> + <camunda:in source="timeOutParamMap" target="timeOutParamMap" /> + <camunda:in source="globalSubscriberId" target="globalSubscriberId" /> + <camunda:in source="operationType" target="operationType" /> + <camunda:in source="initProgress" target="initProgress" /> + <camunda:in source="endProgress" target="endProgress" /> + <camunda:in source="serviceInstanceId" target="parentServiceInstanceId" /> + <camunda:in source="operationId" target="parentOperationId" /> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_102nqyb</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1w1h5vl</bpmn:outgoing> + </bpmn:callActivity> + <bpmn:sequenceFlow id="SequenceFlow_1w1h5vl" sourceRef="CallActivity_12eufsa" targetRef="ScriptTask_0fbubvu" /> + <bpmn:sequenceFlow id="SequenceFlow_1r6lo31" name="No" sourceRef="ExclusiveGateway_1j8khf8" targetRef="ScriptTask_0fbubvu"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("ProcessNsmfSuccess") == "ERROR"}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:sequenceFlow id="SequenceFlow_0c01147" sourceRef="ScriptTask_1rshcew" targetRef="IntermediateThrowEvent_1twqa76" /> + </bpmn:process> + <bpmn:error id="Error_1ld8i6u" name="MSOWorkflowException" errorCode="MSOWorkflowException" /> + <bpmndi:BPMNDiagram id="BPMNDiagram_1"> + <bpmndi:BPMNPlane id="BPMNPlane_1" bpmnElement="ActivateCommunicationService"> + <bpmndi:BPMNShape id="_BPMNShape_StartEvent_2" bpmnElement="StartEvent_1"> + <dc:Bounds x="179" y="159" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_08alvv7_di" bpmnElement="ScriptTask_08alvv7"> + <dc:Bounds x="310" y="137" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_199lc2s_di" bpmnElement="SequenceFlow_199lc2s"> + <di:waypoint x="215" y="177" /> + <di:waypoint x="310" y="177" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_0t2aizp_di" bpmnElement="ScriptTask_0t2aizp"> + <dc:Bounds x="760" y="137" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_1h8uywz_di" bpmnElement="ServiceTask_1h8uywz"> + <dc:Bounds x="960" y="137" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0xunetn_di" bpmnElement="SequenceFlow_0xunetn"> + <di:waypoint x="860" y="177" /> + <di:waypoint x="960" y="177" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_1rshcew_di" bpmnElement="ScriptTask_1rshcew"> + <dc:Bounds x="1140" y="137" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_0soxu97_di" bpmnElement="ScriptTask_0soxu97"> + <dc:Bounds x="480" y="137" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0rl5u9x_di" bpmnElement="SequenceFlow_0rl5u9x"> + <di:waypoint x="410" y="177" /> + <di:waypoint x="480" y="177" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_07brvnu_di" bpmnElement="SequenceFlow_07brvnu"> + <di:waypoint x="1060" y="177" /> + <di:waypoint x="1140" y="177" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="IntermediateThrowEvent_0bgd82x_di" bpmnElement="IntermediateThrowEvent_1twqa76"> + <dc:Bounds x="1332" y="159" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1314" y="202" width="79" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="IntermediateCatchEvent_0qbtq4z_di" bpmnElement="IntermediateThrowEvent_15alt6m"> + <dc:Bounds x="179" y="402" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="161" y="445" width="73" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1om5m6o_di" bpmnElement="SequenceFlow_1om5m6o"> + <di:waypoint x="215" y="420" /> + <di:waypoint x="310" y="420" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ExclusiveGateway_1j8khf8_di" bpmnElement="ExclusiveGateway_1j8khf8" isMarkerVisible="true"> + <dc:Bounds x="815" y="395" width="50" height="50" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="799" y="358" width="85" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_0fbubvu_di" bpmnElement="ScriptTask_0fbubvu"> + <dc:Bounds x="790" y="560" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_1seqo87_di" bpmnElement="ScriptTask_1seqo87"> + <dc:Bounds x="960" y="560" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_10gsfd1_di" bpmnElement="ServiceTask_10gsfd1"> + <dc:Bounds x="1140" y="560" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1b8q7l5_di" bpmnElement="SequenceFlow_1b8q7l5"> + <di:waypoint x="890" y="600" /> + <di:waypoint x="960" y="600" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_103y3rz_di" bpmnElement="SequenceFlow_103y3rz"> + <di:waypoint x="1060" y="600" /> + <di:waypoint x="1140" y="600" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_176pwpd_di" bpmnElement="SequenceFlow_176pwpd"> + <di:waypoint x="865" y="420" /> + <di:waypoint x="960" y="420" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="904" y="402" width="17" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="EndEvent_0z07q3n_di" bpmnElement="EndEvent_0z07q3n"> + <dc:Bounds x="1332" y="582" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_15dmqcp_di" bpmnElement="SequenceFlow_15dmqcp"> + <di:waypoint x="1240" y="600" /> + <di:waypoint x="1332" y="600" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ExclusiveGateway_1g73afb_di" bpmnElement="ExclusiveGateway_1g73afb" isMarkerVisible="true"> + <dc:Bounds x="645" y="152" width="50" height="50" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="648" y="116" width="63" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0cg4k4f_di" bpmnElement="SequenceFlow_0cg4k4f"> + <di:waypoint x="695" y="177" /> + <di:waypoint x="760" y="177" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="719" y="159" width="17" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0337wg2_di" bpmnElement="SequenceFlow_0337wg2"> + <di:waypoint x="580" y="177" /> + <di:waypoint x="645" y="177" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0hpybf9_di" bpmnElement="SequenceFlow_0hpybf9"> + <di:waypoint x="670" y="202" /> + <di:waypoint x="670" y="262" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="679" y="229" width="13" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="EndEvent_118l531_di" bpmnElement="EndEvent_02rugcv"> + <dc:Bounds x="652" y="262" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="SubProcess_1i9i3h1_di" bpmnElement="SubProcess_1i9i3h1" isExpanded="true"> + <dc:Bounds x="340" y="730" width="781" height="196" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="StartEvent_1f90rxc_di" bpmnElement="StartEvent_1f90rxc"> + <dc:Bounds x="382" y="816" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_1m9nsoo_di" bpmnElement="EndEvent_1m9nsoo"> + <dc:Bounds x="1052" y="816" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_003nbzc_di" bpmnElement="ScriptTask_003nbzc"> + <dc:Bounds x="670" y="794" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1dkviys_di" bpmnElement="SequenceFlow_1dkviys"> + <di:waypoint x="418" y="834" /> + <di:waypoint x="670" y="834" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_18sqlo7_di" bpmnElement="SequenceFlow_18sqlo7"> + <di:waypoint x="770" y="834" /> + <di:waypoint x="1052" y="834" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_0zqkikf_di" bpmnElement="ScriptTask_0zqkikf"> + <dc:Bounds x="960" y="380" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_11v60ns_di" bpmnElement="ServiceTask_11v60ns"> + <dc:Bounds x="1140" y="380" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0mruwcs_di" bpmnElement="SequenceFlow_0mruwcs"> + <di:waypoint x="1060" y="420" /> + <di:waypoint x="1140" y="420" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_0oun39f_di" bpmnElement="ScriptTask_0oun39f"> + <dc:Bounds x="310" y="380" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_1pbp58s_di" bpmnElement="ServiceTask_1pbp58s"> + <dc:Bounds x="480" y="380" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_167kv01_di" bpmnElement="ScriptTask_167kv01"> + <dc:Bounds x="640" y="380" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_12ax52p_di" bpmnElement="SequenceFlow_12ax52p"> + <di:waypoint x="410" y="420" /> + <di:waypoint x="480" y="420" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1e9r8tc_di" bpmnElement="SequenceFlow_1e9r8tc"> + <di:waypoint x="580" y="420" /> + <di:waypoint x="640" y="420" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1i6cshg_di" bpmnElement="SequenceFlow_1i6cshg"> + <di:waypoint x="740" y="420" /> + <di:waypoint x="815" y="420" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_0iubb84_di" bpmnElement="ScriptTask_0iubb84"> + <dc:Bounds x="310" y="560" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_102nqyb_di" bpmnElement="SequenceFlow_102nqyb"> + <di:waypoint x="410" y="600" /> + <di:waypoint x="540" y="600" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0f57hgr_di" bpmnElement="SequenceFlow_0f57hgr"> + <di:waypoint x="1240" y="420" /> + <di:waypoint x="1332" y="420" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="IntermediateThrowEvent_1wqbbwo_di" bpmnElement="IntermediateThrowEvent_1u9a1t0"> + <dc:Bounds x="1332" y="402" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1308" y="445" width="87" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1hsbli0_di" bpmnElement="SequenceFlow_1hsbli0"> + <di:waypoint x="215" y="600" /> + <di:waypoint x="310" y="600" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="IntermediateCatchEvent_13yvtam_di" bpmnElement="IntermediateThrowEvent_1lcnqle"> + <dc:Bounds x="179" y="582" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="155" y="625" width="86" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="CallActivity_12eufsa_di" bpmnElement="CallActivity_12eufsa"> + <dc:Bounds x="540" y="560" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1w1h5vl_di" bpmnElement="SequenceFlow_1w1h5vl"> + <di:waypoint x="640" y="600" /> + <di:waypoint x="790" y="600" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1r6lo31_di" bpmnElement="SequenceFlow_1r6lo31"> + <di:waypoint x="840" y="445" /> + <di:waypoint x="840" y="560" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="868" y="463" width="15" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0c01147_di" bpmnElement="SequenceFlow_0c01147"> + <di:waypoint x="1240" y="177" /> + <di:waypoint x="1332" y="177" /> + </bpmndi:BPMNEdge> + </bpmndi:BPMNPlane> + </bpmndi:BPMNDiagram> +</bpmn:definitions> diff --git a/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/ConfigurePnfResource.bpmn b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/ConfigurePnfResource.bpmn index 6d5b2a2f28..234c744e4a 100644 --- a/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/ConfigurePnfResource.bpmn +++ b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/ConfigurePnfResource.bpmn @@ -1,5 +1,5 @@ <?xml version="1.0" encoding="UTF-8"?> -<bpmn:definitions xmlns:bpmn="http://www.omg.org/spec/BPMN/20100524/MODEL" xmlns:bpmndi="http://www.omg.org/spec/BPMN/20100524/DI" xmlns:di="http://www.omg.org/spec/DD/20100524/DI" xmlns:dc="http://www.omg.org/spec/DD/20100524/DC" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xmlns:camunda="http://camunda.org/schema/1.0/bpmn" id="Definitions_13i2vsn" targetNamespace="http://bpmn.io/schema/bpmn" exporter="Camunda Modeler" exporterVersion="2.2.4"> +<bpmn:definitions xmlns:bpmn="http://www.omg.org/spec/BPMN/20100524/MODEL" xmlns:bpmndi="http://www.omg.org/spec/BPMN/20100524/DI" xmlns:di="http://www.omg.org/spec/DD/20100524/DI" xmlns:dc="http://www.omg.org/spec/DD/20100524/DC" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xmlns:camunda="http://camunda.org/schema/1.0/bpmn" id="Definitions_13i2vsn" targetNamespace="http://bpmn.io/schema/bpmn" exporter="Camunda Modeler" exporterVersion="3.3.5"> <bpmn:process id="ConfigurePnfResource" name="ConfigurePnfResource" isExecutable="true"> <bpmn:startEvent id="ConfigurePnfResource_StartEvent"> <bpmn:outgoing>SequenceFlow_069mxkg</bpmn:outgoing> @@ -22,7 +22,7 @@ <bpmn:outgoing>SequenceFlow_1w4p9f7</bpmn:outgoing> </bpmn:exclusiveGateway> <bpmn:sequenceFlow id="SequenceFlow_1owbpsy" name="Success" sourceRef="ExclusiveGateway_0vtv1wi" targetRef="Task_14cwhgk"> - <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("CDSStatus").equals("Success")}</bpmn:conditionExpression> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("ControllerStatus").equals("Success")}</bpmn:conditionExpression> </bpmn:sequenceFlow> <bpmn:exclusiveGateway id="ExclusiveGateway_01jwwmc" default="SequenceFlow_0d24h26"> <bpmn:incoming>SequenceFlow_02919fh</bpmn:incoming> @@ -30,7 +30,7 @@ <bpmn:outgoing>SequenceFlow_0d24h26</bpmn:outgoing> </bpmn:exclusiveGateway> <bpmn:sequenceFlow id="SequenceFlow_1n080up" name="Success" sourceRef="ExclusiveGateway_01jwwmc" targetRef="EndEvent_0xky46v"> - <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("CDSStatus").equals("Success")}</bpmn:conditionExpression> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("ControllerStatus").equals("Success")}</bpmn:conditionExpression> </bpmn:sequenceFlow> <bpmn:sequenceFlow id="SequenceFlow_1w4p9f7" name="Failure" sourceRef="ExclusiveGateway_0vtv1wi" targetRef="EndEvent_16620h9" /> <bpmn:endEvent id="EndEvent_16620h9"> @@ -57,6 +57,7 @@ <camunda:inputOutput> <camunda:inputParameter name="action">config-assign</camunda:inputParameter> <camunda:inputParameter name="scope">pnf</camunda:inputParameter> + <camunda:inputParameter name="mode">sync</camunda:inputParameter> </camunda:inputOutput> </bpmn:extensionElements> <bpmn:incoming>SequenceFlow_0j3pm2g</bpmn:incoming> @@ -68,6 +69,7 @@ <camunda:inputOutput> <camunda:inputParameter name="action">config-deploy</camunda:inputParameter> <camunda:inputParameter name="scope">pnf</camunda:inputParameter> + <camunda:inputParameter name="mode">async</camunda:inputParameter> </camunda:inputOutput> </bpmn:extensionElements> <bpmn:incoming>SequenceFlow_1owbpsy</bpmn:incoming> diff --git a/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/CreateSliceService.bpmn b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/CreateSliceService.bpmn new file mode 100644 index 0000000000..3e1c1179bf --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/CreateSliceService.bpmn @@ -0,0 +1,808 @@ +<?xml version="1.0" encoding="UTF-8"?> +<bpmn:definitions xmlns:bpmn="http://www.omg.org/spec/BPMN/20100524/MODEL" xmlns:bpmndi="http://www.omg.org/spec/BPMN/20100524/DI" xmlns:dc="http://www.omg.org/spec/DD/20100524/DC" xmlns:camunda="http://camunda.org/schema/1.0/bpmn" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xmlns:di="http://www.omg.org/spec/DD/20100524/DI" id="Definitions_1wio50w" targetNamespace="http://bpmn.io/schema/bpmn" exporter="Camunda Modeler" exporterVersion="3.1.2"> + <bpmn:process id="Process_0r5eb97" isExecutable="true"> + <bpmn:startEvent id="StartEvent_1nbljfd" name="Create Slice Service Creation Flow"> + <bpmn:outgoing>SequenceFlow_03s744c</bpmn:outgoing> + </bpmn:startEvent> + <bpmn:intermediateCatchEvent id="IntermediateCatchEvent_0vilb24" name="Waiting for confirmation"> + <bpmn:outgoing>SequenceFlow_1fk37v7</bpmn:outgoing> + <bpmn:linkEventDefinition id="LinkEventDefinition_197u5pe" name="WaitingForConfirmation" /> + </bpmn:intermediateCatchEvent> + <bpmn:scriptTask id="ScriptTask_1tc44ge" name="PreProcess Incoming Request" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_03s744c</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_07e12rt</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def css= new CreateSliceService() +css.preProcessRequest(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:scriptTask id="ScriptTask_1jgtb0y" name="Process User Options" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1cv0wop</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_197cm2e</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def css = new CreateSliceService() +css.processUserOptions(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:exclusiveGateway id="ExclusiveGateway_0elbczl" name="Continue Slice?" default="SequenceFlow_038lb9m"> + <bpmn:incoming>SequenceFlow_197cm2e</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_12t5exy</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_038lb9m</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:scriptTask id="ScriptTask_0l3d1ai" name="Process Decomposition" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1t19ips</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0jrclmc</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def css = new CreateSliceService() +css.processDecomposition(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:scriptTask id="ScriptTask_1eo3m4q" name="Get NST Selection" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_046irye</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1o23s0i</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def css = new CreateSliceService() +css.getNSTSelection(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:callActivity id="CallActivity_139l55g" name="Call DoCreateSliceServiceInstance " calledElement="DoCreateSliceServiceInstance"> + <bpmn:extensionElements> + <camunda:in source="msoRequestId" target="msoRequestId" /> + <camunda:in source="serviceInstanceId" target="serviceInstanceId" /> + <camunda:in source="serviceInstanceName" target="serviceInstanceName" /> + <camunda:in source="serviceModelInfo" target="serviceModelInfo" /> + <camunda:in source="productFamilyId" target="productFamilyId" /> + <camunda:in source="serviceInputParams" target="serviceInputParams" /> + <camunda:in source="globalSubscriberId" target="globalSubscriberId" /> + <camunda:in source="subscriptionServiceType" target="subscriptionServiceType" /> + <camunda:in source="serviceType" target="serviceType" /> + <camunda:in source="uuiRequest" target="uuiRequest" /> + <camunda:in source="requestAction" target="operationType" /> + <camunda:in source="operationId" target="operationId" /> + <camunda:in source="serviceProfile" target="serviceProfile" /> + <camunda:in source="sliceProfileTn" target="sliceProfileTn" /> + <camunda:in source="sliceProfileCn" target="sliceProfileCn" /> + <camunda:in source="sliceProfileAn" target="sliceProfileAn" /> + <camunda:in source="sliceServiceDecomposition" target="sliceServiceDecomposition" /> + <camunda:out source="WorkflowException" target="WorkflowException" /> + <camunda:out source="rollbackData" target="rollbackData" /> + <camunda:out source="rolledBack" target="rolledBack" /> + <camunda:out source="allottedResourceId" target="allottedResourceId" /> + <camunda:out source="serviceInstanceData" target="serviceInstanceData" /> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_1p8vxo5</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1g8m7tq</bpmn:outgoing> + </bpmn:callActivity> + <bpmn:intermediateThrowEvent id="IntermediateThrowEvent_1v96asi" name="Goto Waiting for Confirmation"> + <bpmn:incoming>SequenceFlow_0it2g9j</bpmn:incoming> + <bpmn:linkEventDefinition id="LinkEventDefinition_0uj34dx" name="WaitingForConfirmation" /> + </bpmn:intermediateThrowEvent> + <bpmn:scriptTask id="ScriptTask_0gb975b" name="Prepare Update Orchestration Task" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1aaozcg</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_18kur12</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +execution.setVariable("taskStatus", "WaitingToConfirm") +def css = new CreateSliceService() +css.prepareUpdateOrchestrationTask(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:exclusiveGateway id="ExclusiveGateway_18eld2o" name="Is Slice Successful?" default="SequenceFlow_1c6ka9h"> + <bpmn:incoming>SequenceFlow_0mlrlbv</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1c6ka9h</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_0n4xku8</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:endEvent id="EndEvent_0x406rw"> + <bpmn:incoming>SequenceFlow_1c6ka9h</bpmn:incoming> + <bpmn:errorEventDefinition id="ErrorEventDefinition_0mlneuw" errorRef="Error_03akl5v" /> + </bpmn:endEvent> + <bpmn:subProcess id="SubProcess_1yv9i68" name="Sub-process for FalloutHandler and Rollback" triggeredByEvent="true"> + <bpmn:startEvent id="StartEvent_1omdx56"> + <bpmn:outgoing>SequenceFlow_1w67v6s</bpmn:outgoing> + <bpmn:errorEventDefinition id="ErrorEventDefinition_06xcioh" /> + </bpmn:startEvent> + <bpmn:endEvent id="EndEvent_1jx3026"> + <bpmn:incoming>SequenceFlow_08mlzwz</bpmn:incoming> + </bpmn:endEvent> + <bpmn:scriptTask id="ScriptTask_1swzdpw" name="Handle Unexpected Error" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1w67v6s</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_08mlzwz</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.common.scripts.* +ExceptionUtil ex = new ExceptionUtil() +ex.processJavaException(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_1w67v6s" sourceRef="StartEvent_1omdx56" targetRef="ScriptTask_1swzdpw" /> + <bpmn:sequenceFlow id="SequenceFlow_08mlzwz" sourceRef="ScriptTask_1swzdpw" targetRef="EndEvent_1jx3026" /> + </bpmn:subProcess> + <bpmn:scriptTask id="ScriptTask_1ef3voz" name="Prepare Update Orchestration Task" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0kixzdj</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0klb3ey</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +execution.setVariable("taskStatus", "Completed") +def css = new CreateSliceService() +css.prepareUpdateOrchestrationTask(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:endEvent id="EndEvent_05h01gx" name="End"> + <bpmn:incoming>SequenceFlow_11rbv41</bpmn:incoming> + </bpmn:endEvent> + <bpmn:scriptTask id="ScriptTask_1xxag1o" name="Init Service Operation Status" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_07e12rt</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0t094g7</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def css = new CreateSliceService() +css.prepareInitServiceOperationStatus(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:intermediateThrowEvent id="IntermediateThrowEvent_1ex8ke9" name="Goto Create Slice Service"> + <bpmn:incoming>SequenceFlow_0jrclmc</bpmn:incoming> + <bpmn:linkEventDefinition id="LinkEventDefinition_0de65en" name="CreateSliceService" /> + </bpmn:intermediateThrowEvent> + <bpmn:intermediateCatchEvent id="IntermediateCatchEvent_1wii8im" name="Create Slice Service"> + <bpmn:outgoing>SequenceFlow_1o1tu0f</bpmn:outgoing> + <bpmn:linkEventDefinition id="LinkEventDefinition_1krpcdk" name="CreateSliceService" /> + </bpmn:intermediateCatchEvent> + <bpmn:scriptTask id="ScriptTask_1ssh2l9" name="Prepare Update Service Oper Status((finish)" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0lbdfmt</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1qv8qw1</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +execution.setVariable("operationProgress", "100") +execution.setVariable("operationResult", "finished") +execution.setVariable("operationReason", "Slice completed") +def css = new CreateSliceService() +css.prepareUpdateServiceOperationStatus(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:serviceTask id="ServiceTask_0kd6p6p" name="Update Service Operation Status"> + <bpmn:extensionElements> + <camunda:connector> + <camunda:inputOutput> + <camunda:inputParameter name="url">${CSSOS_dbAdapterEndpoint}</camunda:inputParameter> + <camunda:inputParameter name="headers"> + <camunda:script scriptFormat="groovy">execution.getVariable("CSSOS_headerMap")</camunda:script> + </camunda:inputParameter> + <camunda:inputParameter name="payload">${CSSOS_updateServiceOperStatusRequest}</camunda:inputParameter> + <camunda:inputParameter name="method">POST</camunda:inputParameter> + <camunda:outputParameter name="CSSOS_dbResponseCode">${statusCode}</camunda:outputParameter> + <camunda:outputParameter name="CSSOS_dbResponse">${response}</camunda:outputParameter> + </camunda:inputOutput> + <camunda:connectorId>http-connector</camunda:connectorId> + </camunda:connector> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0t094g7</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_046irye</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:callActivity id="CallActivity_1bnkmaz" name="Call Decompose Service" calledElement="DecomposeService"> + <bpmn:extensionElements> + <camunda:in source="msoRequestId" target="msoRequestId" /> + <camunda:in source="serviceInstanceId" target="serviceInstanceId" /> + <camunda:in source="serviceModelInfo" target="serviceModelInfo" /> + <camunda:in source="isDebugLogEnabled" target="isDebugLogEnabled" /> + <camunda:out source="serviceDecomposition" target="sliceServiceDecomposition" /> + <camunda:out source="WorkflowException" target="WorkflowException" /> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0q7yc2c</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1t19ips</bpmn:outgoing> + </bpmn:callActivity> + <bpmn:scriptTask id="ScriptTask_0o2r07o" name="Prepare Decompose Service " scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1o23s0i</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0q7yc2c</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dcsi= new CreateSliceService() +dcsi.prepareDecomposeService(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:scriptTask id="ScriptTask_0b7senu" name="Prepare Create OrchestrationTask" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1o1tu0f</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1sq6kp6</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def css= new CreateSliceService() +css.prepareCreateOrchestrationTask(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:callActivity id="CallActivity_0h88mep" name="Call HandleOrchestrationTask" calledElement="HandleOrchestrationTask"> + <bpmn:extensionElements> + <camunda:out source="statusCode" target="CSSOT_dbResponseCode" /> + <camunda:out source="response" target="CSSOT_dbResponse" /> + <camunda:in source="CSSOT_taskId" target="taskId" /> + <camunda:in source="msoRequestId" target="requestId" /> + <camunda:in source="CSSOT_name" target="taskName" /> + <camunda:in source="CSSOT_status" target="taskStatus" /> + <camunda:in source="CSSOT_isManual" target="isManual" /> + <camunda:in source="CSSOT_paramJson" target="paramJson" /> + <camunda:in source="CSSOT_requestMethod" target="method" /> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_1sq6kp6</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1p8vxo5</bpmn:outgoing> + </bpmn:callActivity> + <bpmn:callActivity id="CallActivity_0n47zoh" name="Call HandleOrchestrationTask" calledElement="HandleOrchestrationTask"> + <bpmn:extensionElements> + <camunda:out source="statusCode" target="CSSOT_dbResponseCode" /> + <camunda:out source="response" target="CSSOT_dbResponse" /> + <camunda:in source="CSSOT_taskId" target="taskId" /> + <camunda:in source="msoRequestId" target="requestId" /> + <camunda:in source="CSSOT_name" target="taskName" /> + <camunda:in source="CSSOT_status" target="taskStatus" /> + <camunda:in source="CSSOT_isManual" target="isManual" /> + <camunda:in source="CSSOT_paramJson" target="paramJson" /> + <camunda:in source="CSSOT_requestMethod" target="method" /> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_18kur12</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0it2g9j</bpmn:outgoing> + </bpmn:callActivity> + <bpmn:scriptTask id="ScriptTask_12h8542" name="Prepare Update Orchestration Task" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_12t5exy</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0thd6ny</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +execution.setVariable("taskStatus", "Creating") +def css = new CreateSliceService() +css.prepareUpdateOrchestrationTask(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:callActivity id="CallActivity_0o89wmf" name="Call HandleOrchestrationTask" calledElement="HandleOrchestrationTask"> + <bpmn:extensionElements> + <camunda:out source="statusCode" target="CSSOT_dbResponseCode" /> + <camunda:out source="response" target="CSSOT_dbResponse" /> + <camunda:in source="CSSOT_taskId" target="taskId" /> + <camunda:in source="msoRequestId" target="requestId" /> + <camunda:in source="CSSOT_name" target="taskName" /> + <camunda:in source="CSSOT_status" target="taskStatus" /> + <camunda:in source="CSSOT_isManual" target="isManual" /> + <camunda:in source="CSSOT_paramJson" target="paramJson" /> + <camunda:in source="CSSOT_requestMethod" target="method" /> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0thd6ny</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0477975</bpmn:outgoing> + </bpmn:callActivity> + <bpmn:callActivity id="CallActivity_0g98b71" name="Call HandleOrchestrationTask" calledElement="HandleOrchestrationTask"> + <bpmn:extensionElements> + <camunda:out source="statusCode" target="CSSOT_dbResponseCode" /> + <camunda:out source="response" target="CSSOT_dbResponse" /> + <camunda:in source="CSSOT_taskId" target="taskId" /> + <camunda:in source="msoRequestId" target="requestId" /> + <camunda:in source="CSSOT_name" target="taskName" /> + <camunda:in source="CSSOT_status" target="taskStatus" /> + <camunda:in source="CSSOT_isManual" target="isManual" /> + <camunda:in source="CSSOT_paramJson" target="paramJson" /> + <camunda:in source="CSSOT_requestMethod" target="method" /> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0h2oree</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1cv0wop</bpmn:outgoing> + </bpmn:callActivity> + <bpmn:scriptTask id="ScriptTask_08wim95" name="Prepare Get User Options" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_16uz2t9</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0h2oree</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def css = new CreateSliceService() +css.prepareGetUserOptions(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:callActivity id="CallActivity_0jdzpem" name="Call HandleOrchestrationTask" calledElement="HandleOrchestrationTask"> + <bpmn:extensionElements> + <camunda:out source="statusCode" target="CSSOT_dbResponseCode" /> + <camunda:out source="response" target="CSSOT_dbResponse" /> + <camunda:in source="CSSOT_taskId" target="taskId" /> + <camunda:in source="msoRequestId" target="requestId" /> + <camunda:in source="CSSOT_name" target="taskName" /> + <camunda:in source="CSSOT_status" target="taskStatus" /> + <camunda:in source="CSSOT_isManual" target="isManual" /> + <camunda:in source="CSSOT_paramJson" target="paramJson" /> + <camunda:in source="CSSOT_requestMethod" target="method" /> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_19lsayh</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_10ng1vx</bpmn:outgoing> + </bpmn:callActivity> + <bpmn:scriptTask id="ScriptTask_1mscu5w" name="Prepare Update Orchestration Task" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_038lb9m</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_19lsayh</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +execution.setVariable("taskStatus", "Aborted") +def css = new CreateSliceService() +css.prepareUpdateOrchestrationTask(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:intermediateCatchEvent id="IntermediateCatchEvent_0pkvfun" name="Allocate Slice"> + <bpmn:outgoing>SequenceFlow_1bevt3a</bpmn:outgoing> + <bpmn:linkEventDefinition id="LinkEventDefinition_1vlfclx" name="AllocateSlice" /> + </bpmn:intermediateCatchEvent> + <bpmn:intermediateThrowEvent id="IntermediateThrowEvent_0ktwpki" name="Goto Allocate Slice"> + <bpmn:incoming>SequenceFlow_0477975</bpmn:incoming> + <bpmn:linkEventDefinition id="LinkEventDefinition_16f2ri9" name="AllocateSlice" /> + </bpmn:intermediateThrowEvent> + <bpmn:callActivity id="CallActivity_15pl4ld" name="Call HandleOrchestrationTask" calledElement="HandleOrchestrationTask"> + <bpmn:extensionElements> + <camunda:out source="statusCode" target="CSSOT_dbResponseCode" /> + <camunda:out source="response" target="CSSOT_dbResponse" /> + <camunda:in source="CSSOT_taskId" target="taskId" /> + <camunda:in source="msoRequestId" target="requestId" /> + <camunda:in source="CSSOT_name" target="taskName" /> + <camunda:in source="CSSOT_status" target="taskStatus" /> + <camunda:in source="CSSOT_isManual" target="isManual" /> + <camunda:in source="CSSOT_paramJson" target="paramJson" /> + <camunda:in source="CSSOT_requestMethod" target="method" /> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0klb3ey</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0lbdfmt</bpmn:outgoing> + </bpmn:callActivity> + <bpmn:endEvent id="EndEvent_1oouvuh" name="End"> + <bpmn:incoming>SequenceFlow_10ng1vx</bpmn:incoming> + </bpmn:endEvent> + <bpmn:serviceTask id="ServiceTask_0esr949" name="Update Service Operation Status"> + <bpmn:extensionElements> + <camunda:connector> + <camunda:inputOutput> + <camunda:inputParameter name="url">${CSSOS_dbAdapterEndpoint}</camunda:inputParameter> + <camunda:inputParameter name="headers"> + <camunda:script scriptFormat="groovy">execution.getVariable("CSSOS_headerMap")</camunda:script> + </camunda:inputParameter> + <camunda:inputParameter name="payload">${CSSOS_updateServiceOperStatusRequest}</camunda:inputParameter> + <camunda:inputParameter name="method">POST</camunda:inputParameter> + <camunda:outputParameter name="CSSOS_dbResponseCode">${statusCode}</camunda:outputParameter> + <camunda:outputParameter name="CSSOS_dbResponse">${response}</camunda:outputParameter> + </camunda:inputOutput> + <camunda:connectorId>http-connector</camunda:connectorId> + </camunda:connector> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_1qv8qw1</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_11rbv41</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:scriptTask id="ScriptTask_1jj846g" name="Send Sync Ack Response" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1g8m7tq</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1ey6m1e</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def css = new CreateSliceService() +css.sendSyncResponse(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:callActivity id="CallActivity_0cxst1i" name="Call DoAllocateNSIandNSSI " calledElement="DoAllocateNSIandNSSI"> + <bpmn:extensionElements> + <camunda:in source="msoRequestId" target="msoRequestId" /> + <camunda:in source="serviceInstanceId" target="sliceServiceInstanceId" /> + <camunda:in source="serviceInstanceName" target="sliceServiceInstanceName" /> + <camunda:in source="serviceModelInfo" target="serviceModelInfo" /> + <camunda:in source="productFamilyId" target="productFamilyId" /> + <camunda:in source="disableRollback" target="disableRollback" /> + <camunda:in source="serviceInputParams" target="serviceInputParams" /> + <camunda:in source="globalSubscriberId" target="globalSubscriberId" /> + <camunda:in source="subscriptionServiceType" target="subscriptionServiceType" /> + <camunda:in source="serviceType" target="serviceType" /> + <camunda:in source="uuiRequest" target="uuiRequest" /> + <camunda:in source="requestAction" target="operationType" /> + <camunda:in source="operationId" target="operationId" /> + <camunda:in source="serviceProfile" target="serviceProfile" /> + <camunda:in source="sliceProfileTn" target="sliceProfileTn" /> + <camunda:in source="sliceProfileCn" target="sliceProfileCn" /> + <camunda:in source="sliceProfileAn" target="sliceProfileAn" /> + <camunda:in source="sliceTaskParams" target="sliceTaskParams" /> + <camunda:in source="CSSOT_taskId" target="taskId" /> + <camunda:in source="CSSOT_name" target="taskName" /> + <camunda:in source="CSSOT_status" target="taskStatus" /> + <camunda:in source="CSSOT_isManual" target="isManual" /> + <camunda:in source="resourceSharingLevel" target="resourceSharingLevel" /> + <camunda:in source="globalSubscriberId" target="globalSubscriberId" /> + <camunda:out source="WorkflowException" target="WorkflowException" /> + <camunda:out source="rollbackData" target="rollbackData" /> + <camunda:out source="rolledBack" target="rolledBack" /> + <camunda:in source="allottedResourceId" target="allottedResourceId" /> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_1bevt3a</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0mlrlbv</bpmn:outgoing> + </bpmn:callActivity> + <bpmn:endEvent id="EndEvent_0bh0kwx"> + <bpmn:incoming>SequenceFlow_12qt5ci</bpmn:incoming> + <bpmn:errorEventDefinition id="ErrorEventDefinition_1xa66sx" errorRef="Error_0p2naox" /> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_03s744c" sourceRef="StartEvent_1nbljfd" targetRef="ScriptTask_1tc44ge" /> + <bpmn:sequenceFlow id="SequenceFlow_07e12rt" sourceRef="ScriptTask_1tc44ge" targetRef="ScriptTask_1xxag1o" /> + <bpmn:sequenceFlow id="SequenceFlow_1cv0wop" sourceRef="CallActivity_0g98b71" targetRef="ScriptTask_1jgtb0y" /> + <bpmn:sequenceFlow id="SequenceFlow_197cm2e" sourceRef="ScriptTask_1jgtb0y" targetRef="ExclusiveGateway_0elbczl" /> + <bpmn:sequenceFlow id="SequenceFlow_12t5exy" name="continue" sourceRef="ExclusiveGateway_0elbczl" targetRef="ScriptTask_12h8542"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("taskAction") == "commit"}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:sequenceFlow id="SequenceFlow_038lb9m" name="abort" sourceRef="ExclusiveGateway_0elbczl" targetRef="ScriptTask_1mscu5w" /> + <bpmn:sequenceFlow id="SequenceFlow_1t19ips" sourceRef="CallActivity_1bnkmaz" targetRef="ScriptTask_0l3d1ai" /> + <bpmn:sequenceFlow id="SequenceFlow_1p8vxo5" sourceRef="CallActivity_0h88mep" targetRef="CallActivity_139l55g" /> + <bpmn:sequenceFlow id="SequenceFlow_1g8m7tq" sourceRef="CallActivity_139l55g" targetRef="ScriptTask_1jj846g" /> + <bpmn:sequenceFlow id="SequenceFlow_0it2g9j" sourceRef="CallActivity_0n47zoh" targetRef="IntermediateThrowEvent_1v96asi" /> + <bpmn:sequenceFlow id="SequenceFlow_18kur12" sourceRef="ScriptTask_0gb975b" targetRef="CallActivity_0n47zoh" /> + <bpmn:sequenceFlow id="SequenceFlow_0mlrlbv" sourceRef="CallActivity_0cxst1i" targetRef="ExclusiveGateway_18eld2o" /> + <bpmn:sequenceFlow id="SequenceFlow_1c6ka9h" name="No" sourceRef="ExclusiveGateway_18eld2o" targetRef="EndEvent_0x406rw" /> + <bpmn:sequenceFlow id="SequenceFlow_0n4xku8" name="Yes" sourceRef="ExclusiveGateway_18eld2o" targetRef="ScriptTask_19uxoi8"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("WorkflowException") == null}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:sequenceFlow id="SequenceFlow_0klb3ey" sourceRef="ScriptTask_1ef3voz" targetRef="CallActivity_15pl4ld" /> + <bpmn:sequenceFlow id="SequenceFlow_11rbv41" sourceRef="ServiceTask_0esr949" targetRef="EndEvent_05h01gx" /> + <bpmn:sequenceFlow id="SequenceFlow_0t094g7" sourceRef="ScriptTask_1xxag1o" targetRef="ServiceTask_0kd6p6p" /> + <bpmn:sequenceFlow id="SequenceFlow_1o1tu0f" sourceRef="IntermediateCatchEvent_1wii8im" targetRef="ScriptTask_0b7senu" /> + <bpmn:sequenceFlow id="SequenceFlow_0lbdfmt" sourceRef="CallActivity_15pl4ld" targetRef="ScriptTask_1ssh2l9" /> + <bpmn:sequenceFlow id="SequenceFlow_1qv8qw1" sourceRef="ScriptTask_1ssh2l9" targetRef="ServiceTask_0esr949" /> + <bpmn:sequenceFlow id="SequenceFlow_0q7yc2c" sourceRef="ScriptTask_0o2r07o" targetRef="CallActivity_1bnkmaz" /> + <bpmn:sequenceFlow id="SequenceFlow_1sq6kp6" sourceRef="ScriptTask_0b7senu" targetRef="CallActivity_0h88mep" /> + <bpmn:sequenceFlow id="SequenceFlow_0thd6ny" sourceRef="ScriptTask_12h8542" targetRef="CallActivity_0o89wmf" /> + <bpmn:sequenceFlow id="SequenceFlow_0477975" sourceRef="CallActivity_0o89wmf" targetRef="IntermediateThrowEvent_0ktwpki" /> + <bpmn:sequenceFlow id="SequenceFlow_0h2oree" sourceRef="ScriptTask_08wim95" targetRef="CallActivity_0g98b71" /> + <bpmn:sequenceFlow id="SequenceFlow_19lsayh" sourceRef="ScriptTask_1mscu5w" targetRef="CallActivity_0jdzpem" /> + <bpmn:sequenceFlow id="SequenceFlow_10ng1vx" sourceRef="CallActivity_0jdzpem" targetRef="EndEvent_1oouvuh" /> + <bpmn:sequenceFlow id="SequenceFlow_1bevt3a" sourceRef="IntermediateCatchEvent_0pkvfun" targetRef="CallActivity_0cxst1i" /> + <bpmn:sequenceFlow id="SequenceFlow_1ey6m1e" sourceRef="ScriptTask_1jj846g" targetRef="CallActivity_0v4mw2x" /> + <bpmn:receiveTask id="Task_1b5t88h" name="Waiting for confirmation" messageRef="Message_0c4b2r5"> + <bpmn:incoming>SequenceFlow_1fk37v7</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_16uz2t9</bpmn:outgoing> + </bpmn:receiveTask> + <bpmn:sequenceFlow id="SequenceFlow_1fk37v7" sourceRef="IntermediateCatchEvent_0vilb24" targetRef="Task_1b5t88h" /> + <bpmn:sequenceFlow id="SequenceFlow_16uz2t9" sourceRef="Task_1b5t88h" targetRef="ScriptTask_08wim95" /> + <bpmn:boundaryEvent id="BoundaryEvent_0clo9pv" attachedToRef="Task_1b5t88h"> + <bpmn:outgoing>SequenceFlow_12qt5ci</bpmn:outgoing> + <bpmn:timerEventDefinition> + <bpmn:timeDuration xsi:type="bpmn:tFormalExpression">PT2H</bpmn:timeDuration> + </bpmn:timerEventDefinition> + </bpmn:boundaryEvent> + <bpmn:sequenceFlow id="SequenceFlow_12qt5ci" sourceRef="BoundaryEvent_0clo9pv" targetRef="EndEvent_0bh0kwx" /> + <bpmn:callActivity id="CallActivity_0v4mw2x" name="Call DoCreateSliceServiceOption " calledElement="DoCreateSliceServiceOption"> + <bpmn:extensionElements> + <camunda:in source="nstModelUuid" target="nstModelUuid" /> + <camunda:in source="nstModelInvariantUuid" target="nstModelInvariantUuid" /> + <camunda:in source="serviceProfile" target="serviceProfile" /> + <camunda:in source="sliceProfileTn" target="sliceProfileTn" /> + <camunda:in source="msoRequestId" target="msoRequestId" /> + <camunda:in source="sliceProfileCn" target="sliceProfileCn" /> + <camunda:in source="sliceProfileAn" target="sliceProfileAn" /> + <camunda:in source="sliceTaskParams" target="sliceTaskParams" /> + <camunda:in source="resourceSharingLevel" target="resourceSharingLevel" /> + <camunda:out source="sliceTaskParams" target="sliceTaskParams" /> + <camunda:in source="globalSubscriberId" target="globalSubscriberId" /> + <camunda:in source="subscriptionServiceType" target="subscriptionServiceType" /> + <camunda:in source="serviceType" target="serviceType" /> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_1ey6m1e</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1aaozcg</bpmn:outgoing> + </bpmn:callActivity> + <bpmn:sequenceFlow id="SequenceFlow_1aaozcg" sourceRef="CallActivity_0v4mw2x" targetRef="ScriptTask_0gb975b" /> + <bpmn:sequenceFlow id="SequenceFlow_046irye" sourceRef="ServiceTask_0kd6p6p" targetRef="ScriptTask_1eo3m4q" /> + <bpmn:sequenceFlow id="SequenceFlow_1o23s0i" sourceRef="ScriptTask_1eo3m4q" targetRef="ScriptTask_0o2r07o" /> + <bpmn:sequenceFlow id="SequenceFlow_0jrclmc" sourceRef="ScriptTask_0l3d1ai" targetRef="IntermediateThrowEvent_1ex8ke9" /> + <bpmn:scriptTask id="ScriptTask_19uxoi8" name="Update AAI Status" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0n4xku8</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0kixzdj</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +execution.setVariable("orchestrationStatus", "deactivated") +def css = new CreateSliceService() +css.updateAAIOrchStatus(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_0kixzdj" sourceRef="ScriptTask_19uxoi8" targetRef="ScriptTask_1ef3voz" /> + </bpmn:process> + <bpmn:message id="Message_0c4b2r5" name="SliceServiceTask" /> + <bpmn:error id="Error_03akl5v" name="MSOWorkflowException" errorCode="MSOWorkflowException" /> + <bpmn:error id="Error_0p2naox" name="MSOWorkflowException" errorCode="MSOWorkflowException" /> + <bpmndi:BPMNDiagram id="BPMNDiagram_1"> + <bpmndi:BPMNPlane id="BPMNPlane_1" bpmnElement="Process_0r5eb97"> + <bpmndi:BPMNShape id="StartEvent_1nbljfd_di" bpmnElement="StartEvent_1nbljfd"> + <dc:Bounds x="178" y="103" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="156" y="146" width="82" height="40" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="IntermediateCatchEvent_0vilb24_di" bpmnElement="IntermediateCatchEvent_0vilb24"> + <dc:Bounds x="178" y="438" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="168" y="481" width="60" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_1tc44ge_di" bpmnElement="ScriptTask_1tc44ge"> + <dc:Bounds x="285" y="81" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_1jgtb0y_di" bpmnElement="ScriptTask_1jgtb0y"> + <dc:Bounds x="830" y="416" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ExclusiveGateway_0elbczl_di" bpmnElement="ExclusiveGateway_0elbczl" isMarkerVisible="true"> + <dc:Bounds x="1040" y="431" width="50" height="50" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1027" y="413" width="78" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_0l3d1ai_di" bpmnElement="ScriptTask_0l3d1ai"> + <dc:Bounds x="1370" y="81" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_1eo3m4q_di" bpmnElement="ScriptTask_1eo3m4q"> + <dc:Bounds x="830" y="81" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="CallActivity_139l55g_di" bpmnElement="CallActivity_139l55g"> + <dc:Bounds x="645" y="249" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="IntermediateThrowEvent_1v96asi_di" bpmnElement="IntermediateThrowEvent_1v96asi"> + <dc:Bounds x="1584" y="271" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1567" y="312" width="81" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_0gb975b_di" bpmnElement="ScriptTask_0gb975b"> + <dc:Bounds x="1193" y="249" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ExclusiveGateway_18eld2o_di" bpmnElement="ExclusiveGateway_18eld2o" isMarkerVisible="true"> + <dc:Bounds x="488" y="776" width="50" height="50" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="483" y="746" width="60" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_0x406rw_di" bpmnElement="EndEvent_0x406rw"> + <dc:Bounds x="495" y="926" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="SubProcess_1yv9i68_di" bpmnElement="SubProcess_1yv9i68" isExpanded="true"> + <dc:Bounds x="685" y="1080" width="781" height="196" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_1ef3voz_di" bpmnElement="ScriptTask_1ef3voz"> + <dc:Bounds x="823" y="761" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_05h01gx_di" bpmnElement="EndEvent_05h01gx"> + <dc:Bounds x="1585" y="783" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1593" y="826" width="20" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_1xxag1o_di" bpmnElement="ScriptTask_1xxag1o"> + <dc:Bounds x="468" y="81" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="IntermediateThrowEvent_1ex8ke9_di" bpmnElement="IntermediateThrowEvent_1ex8ke9"> + <dc:Bounds x="1584" y="103" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1564" y="144" width="87" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="IntermediateCatchEvent_1wii8im_di" bpmnElement="IntermediateCatchEvent_1wii8im"> + <dc:Bounds x="178" y="271" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="171" y="314" width="60" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_1ssh2l9_di" bpmnElement="ScriptTask_1ssh2l9"> + <dc:Bounds x="1197" y="761" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_0kd6p6p_di" bpmnElement="ServiceTask_0kd6p6p"> + <dc:Bounds x="645" y="81" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="CallActivity_1bnkmaz_di" bpmnElement="CallActivity_1bnkmaz"> + <dc:Bounds x="1193" y="81" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_0o2r07o_di" bpmnElement="ScriptTask_0o2r07o"> + <dc:Bounds x="1015" y="81" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_0b7senu_di" bpmnElement="ScriptTask_0b7senu"> + <dc:Bounds x="285" y="249" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="CallActivity_0h88mep_di" bpmnElement="CallActivity_0h88mep"> + <dc:Bounds x="467" y="249" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="CallActivity_0n47zoh_di" bpmnElement="CallActivity_0n47zoh"> + <dc:Bounds x="1371" y="249" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_12h8542_di" bpmnElement="ScriptTask_12h8542"> + <dc:Bounds x="1193" y="416" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="CallActivity_0o89wmf_di" bpmnElement="CallActivity_0o89wmf"> + <dc:Bounds x="1371" y="416" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="CallActivity_0g98b71_di" bpmnElement="CallActivity_0g98b71"> + <dc:Bounds x="645" y="416" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_08wim95_di" bpmnElement="ScriptTask_08wim95"> + <dc:Bounds x="467" y="416" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="CallActivity_0jdzpem_di" bpmnElement="CallActivity_0jdzpem"> + <dc:Bounds x="1371" y="605" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_1mscu5w_di" bpmnElement="ScriptTask_1mscu5w"> + <dc:Bounds x="1193" y="605" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="IntermediateCatchEvent_0pkvfun_di" bpmnElement="IntermediateCatchEvent_0pkvfun"> + <dc:Bounds x="178" y="783" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="168" y="826" width="66" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="IntermediateThrowEvent_0ktwpki_di" bpmnElement="IntermediateThrowEvent_0ktwpki"> + <dc:Bounds x="1584" y="438" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1577" y="479" width="67" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="CallActivity_15pl4ld_di" bpmnElement="CallActivity_15pl4ld"> + <dc:Bounds x="1005" y="761" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_1oouvuh_di" bpmnElement="EndEvent_1oouvuh"> + <dc:Bounds x="1584" y="627" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1592" y="670" width="20" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_0esr949_di" bpmnElement="ServiceTask_0esr949"> + <dc:Bounds x="1375" y="761" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_1jj846g_di" bpmnElement="ScriptTask_1jj846g"> + <dc:Bounds x="830" y="249" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="CallActivity_0cxst1i_di" bpmnElement="CallActivity_0cxst1i"> + <dc:Bounds x="285" y="761" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_0bh0kwx_di" bpmnElement="EndEvent_0bh0kwx"> + <dc:Bounds x="317" y="593" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_03s744c_di" bpmnElement="SequenceFlow_03s744c"> + <di:waypoint x="214" y="121" /> + <di:waypoint x="285" y="121" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_07e12rt_di" bpmnElement="SequenceFlow_07e12rt"> + <di:waypoint x="385" y="121" /> + <di:waypoint x="468" y="121" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1cv0wop_di" bpmnElement="SequenceFlow_1cv0wop"> + <di:waypoint x="745" y="456" /> + <di:waypoint x="830" y="456" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_197cm2e_di" bpmnElement="SequenceFlow_197cm2e"> + <di:waypoint x="930" y="456" /> + <di:waypoint x="1040" y="456" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_12t5exy_di" bpmnElement="SequenceFlow_12t5exy"> + <di:waypoint x="1090" y="456" /> + <di:waypoint x="1193" y="456" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1121.5" y="438" width="42" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_038lb9m_di" bpmnElement="SequenceFlow_038lb9m"> + <di:waypoint x="1065" y="481" /> + <di:waypoint x="1065" y="645" /> + <di:waypoint x="1193" y="645" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1067" y="560" width="27" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1t19ips_di" bpmnElement="SequenceFlow_1t19ips"> + <di:waypoint x="1293" y="121" /> + <di:waypoint x="1370" y="121" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1p8vxo5_di" bpmnElement="SequenceFlow_1p8vxo5"> + <di:waypoint x="567" y="289" /> + <di:waypoint x="645" y="289" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1g8m7tq_di" bpmnElement="SequenceFlow_1g8m7tq"> + <di:waypoint x="745" y="289" /> + <di:waypoint x="830" y="289" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0it2g9j_di" bpmnElement="SequenceFlow_0it2g9j"> + <di:waypoint x="1471" y="289" /> + <di:waypoint x="1584" y="289" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_18kur12_di" bpmnElement="SequenceFlow_18kur12"> + <di:waypoint x="1293" y="289" /> + <di:waypoint x="1371" y="289" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0mlrlbv_di" bpmnElement="SequenceFlow_0mlrlbv"> + <di:waypoint x="385" y="801" /> + <di:waypoint x="488" y="801" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1c6ka9h_di" bpmnElement="SequenceFlow_1c6ka9h"> + <di:waypoint x="513" y="826" /> + <di:waypoint x="513" y="926" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="521" y="832" width="15" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0n4xku8_di" bpmnElement="SequenceFlow_0n4xku8"> + <di:waypoint x="538" y="801" /> + <di:waypoint x="645" y="801" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="584" y="783" width="18" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0klb3ey_di" bpmnElement="SequenceFlow_0klb3ey"> + <di:waypoint x="923" y="801" /> + <di:waypoint x="1005" y="801" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_11rbv41_di" bpmnElement="SequenceFlow_11rbv41"> + <di:waypoint x="1475" y="801" /> + <di:waypoint x="1585" y="801" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0t094g7_di" bpmnElement="SequenceFlow_0t094g7"> + <di:waypoint x="568" y="121" /> + <di:waypoint x="645" y="121" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1o1tu0f_di" bpmnElement="SequenceFlow_1o1tu0f"> + <di:waypoint x="214" y="289" /> + <di:waypoint x="285" y="289" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0lbdfmt_di" bpmnElement="SequenceFlow_0lbdfmt"> + <di:waypoint x="1105" y="801" /> + <di:waypoint x="1197" y="801" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1qv8qw1_di" bpmnElement="SequenceFlow_1qv8qw1"> + <di:waypoint x="1297" y="801" /> + <di:waypoint x="1375" y="801" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0q7yc2c_di" bpmnElement="SequenceFlow_0q7yc2c"> + <di:waypoint x="1115" y="121" /> + <di:waypoint x="1193" y="121" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1sq6kp6_di" bpmnElement="SequenceFlow_1sq6kp6"> + <di:waypoint x="385" y="289" /> + <di:waypoint x="467" y="289" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0thd6ny_di" bpmnElement="SequenceFlow_0thd6ny"> + <di:waypoint x="1293" y="456" /> + <di:waypoint x="1371" y="456" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0477975_di" bpmnElement="SequenceFlow_0477975"> + <di:waypoint x="1471" y="456" /> + <di:waypoint x="1584" y="456" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0h2oree_di" bpmnElement="SequenceFlow_0h2oree"> + <di:waypoint x="567" y="456" /> + <di:waypoint x="645" y="456" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_19lsayh_di" bpmnElement="SequenceFlow_19lsayh"> + <di:waypoint x="1293" y="645" /> + <di:waypoint x="1371" y="645" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_10ng1vx_di" bpmnElement="SequenceFlow_10ng1vx"> + <di:waypoint x="1471" y="645" /> + <di:waypoint x="1584" y="645" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1bevt3a_di" bpmnElement="SequenceFlow_1bevt3a"> + <di:waypoint x="214" y="801" /> + <di:waypoint x="285" y="801" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1ey6m1e_di" bpmnElement="SequenceFlow_1ey6m1e"> + <di:waypoint x="930" y="289" /> + <di:waypoint x="1015" y="289" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="StartEvent_1omdx56_di" bpmnElement="StartEvent_1omdx56"> + <dc:Bounds x="715" y="1166" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_1jx3026_di" bpmnElement="EndEvent_1jx3026"> + <dc:Bounds x="1353" y="1166" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_1swzdpw_di" bpmnElement="ScriptTask_1swzdpw"> + <dc:Bounds x="979" y="1144" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1w67v6s_di" bpmnElement="SequenceFlow_1w67v6s"> + <di:waypoint x="751" y="1184" /> + <di:waypoint x="979" y="1184" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_08mlzwz_di" bpmnElement="SequenceFlow_08mlzwz"> + <di:waypoint x="1079" y="1184" /> + <di:waypoint x="1353" y="1184" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ReceiveTask_0zkpdpa_di" bpmnElement="Task_1b5t88h"> + <dc:Bounds x="285" y="416" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1fk37v7_di" bpmnElement="SequenceFlow_1fk37v7"> + <di:waypoint x="214" y="456" /> + <di:waypoint x="285" y="456" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_16uz2t9_di" bpmnElement="SequenceFlow_16uz2t9"> + <di:waypoint x="385" y="456" /> + <di:waypoint x="467" y="456" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="BoundaryEvent_15igwk2_di" bpmnElement="BoundaryEvent_0clo9pv"> + <dc:Bounds x="317" y="478" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_12qt5ci_di" bpmnElement="SequenceFlow_12qt5ci"> + <di:waypoint x="335" y="514" /> + <di:waypoint x="335" y="611" /> + <di:waypoint x="335" y="593" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="CallActivity_0v4mw2x_di" bpmnElement="CallActivity_0v4mw2x"> + <dc:Bounds x="1015" y="249" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1aaozcg_di" bpmnElement="SequenceFlow_1aaozcg"> + <di:waypoint x="1115" y="289" /> + <di:waypoint x="1193" y="289" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_046irye_di" bpmnElement="SequenceFlow_046irye"> + <di:waypoint x="745" y="121" /> + <di:waypoint x="830" y="121" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1o23s0i_di" bpmnElement="SequenceFlow_1o23s0i"> + <di:waypoint x="930" y="121" /> + <di:waypoint x="1015" y="121" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0jrclmc_di" bpmnElement="SequenceFlow_0jrclmc"> + <di:waypoint x="1470" y="121" /> + <di:waypoint x="1584" y="121" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_19uxoi8_di" bpmnElement="ScriptTask_19uxoi8"> + <dc:Bounds x="645" y="761" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0kixzdj_di" bpmnElement="SequenceFlow_0kixzdj"> + <di:waypoint x="745" y="801" /> + <di:waypoint x="823" y="801" /> + </bpmndi:BPMNEdge> + </bpmndi:BPMNPlane> + </bpmndi:BPMNDiagram> +</bpmn:definitions> + diff --git a/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/DeleteCommunicationService.bpmn b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/DeleteCommunicationService.bpmn new file mode 100644 index 0000000000..58a69621d3 --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/DeleteCommunicationService.bpmn @@ -0,0 +1,523 @@ +<?xml version="1.0" encoding="UTF-8"?> +<bpmn:definitions xmlns:bpmn="http://www.omg.org/spec/BPMN/20100524/MODEL" xmlns:bpmndi="http://www.omg.org/spec/BPMN/20100524/DI" xmlns:dc="http://www.omg.org/spec/DD/20100524/DC" xmlns:di="http://www.omg.org/spec/DD/20100524/DI" xmlns:camunda="http://camunda.org/schema/1.0/bpmn" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" id="Definitions_1nvjixd" targetNamespace="http://bpmn.io/schema/bpmn" exporter="Camunda Modeler" exporterVersion="3.4.1"> + <bpmn:process id="DeleteCommunicationService" name="DeleteCommunicationService" isExecutable="true"> + <bpmn:startEvent id="StartEvent_1" name="start"> + <bpmn:outgoing>SequenceFlow_1kjqnil</bpmn:outgoing> + </bpmn:startEvent> + <bpmn:sequenceFlow id="SequenceFlow_1kjqnil" sourceRef="StartEvent_1" targetRef="Task_1mqm4nb" /> + <bpmn:sequenceFlow id="SequenceFlow_0ogievs" sourceRef="Task_1mqm4nb" targetRef="Task_0q2v7qe" /> + <bpmn:sequenceFlow id="SequenceFlow_192yyii" sourceRef="Task_0q2v7qe" targetRef="Task_0zaekmn" /> + <bpmn:serviceTask id="Task_0zaekmn" name="Init Service Operation Status"> + <bpmn:extensionElements> + <camunda:connector> + <camunda:inputOutput> + <camunda:inputParameter name="url">${dbAdapterEndpoint}</camunda:inputParameter> + <camunda:inputParameter name="headers"> + <camunda:map> + <camunda:entry key="content-type">application/soap+xml</camunda:entry> + <camunda:entry key="Authorization">Basic YnBlbDpwYXNzd29yZDEk</camunda:entry> + </camunda:map> + </camunda:inputParameter> + <camunda:inputParameter name="payload">${updateOperationStatus}</camunda:inputParameter> + <camunda:inputParameter name="method">POST</camunda:inputParameter> + <camunda:outputParameter name="CSMF_dbResponseCode">${statusCode}</camunda:outputParameter> + <camunda:outputParameter name="CSMF_dbResponse">${response}</camunda:outputParameter> + </camunda:inputOutput> + <camunda:connectorId>http-connector</camunda:connectorId> + </camunda:connector> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_192yyii</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0xvoume</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:scriptTask id="Task_0q2v7qe" name="Init Service Operation Status" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0ogievs</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_192yyii</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dcs= new DeleteCommunicationService() +dcs.preInitUpdateOperationStatus(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:scriptTask id="Task_1mqm4nb" name="PreProcessRequest" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1kjqnil</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0ogievs</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dcs= new DeleteCommunicationService() +dcs.preProcessRequest(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:scriptTask id="ScriptTask_1k5stey" name="Send Sync Ack Response" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0xvoume</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_017qgen</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dcs = new DeleteCommunicationService() +dcs.sendSyncResponse(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_0xvoume" sourceRef="Task_0zaekmn" targetRef="ScriptTask_1k5stey" /> + <bpmn:sequenceFlow id="SequenceFlow_017qgen" sourceRef="ScriptTask_1k5stey" targetRef="Task_0ux5uk1" /> + <bpmn:serviceTask id="Task_1kizznk" name="Update Service Operation Status"> + <bpmn:extensionElements> + <camunda:connector> + <camunda:inputOutput> + <camunda:inputParameter name="url">${dbAdapterEndpoint}</camunda:inputParameter> + <camunda:inputParameter name="headers"> + <camunda:map> + <camunda:entry key="content-type">application/soap+xml</camunda:entry> + <camunda:entry key="Authorization">Basic YnBlbDpwYXNzd29yZDEk</camunda:entry> + </camunda:map> + </camunda:inputParameter> + <camunda:inputParameter name="payload">${updateOperationStatus}</camunda:inputParameter> + <camunda:inputParameter name="method">POST</camunda:inputParameter> + <camunda:outputParameter name="CSMF_dbResponseCode">${statusCode}</camunda:outputParameter> + <camunda:outputParameter name="CSMF_dbResponse">${response}</camunda:outputParameter> + </camunda:inputOutput> + <camunda:connectorId>http-connector</camunda:connectorId> + </camunda:connector> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0jrbkau</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1ssiyug</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:serviceTask id="Task_0xwjycr" name="update operation status completed"> + <bpmn:extensionElements> + <camunda:connector> + <camunda:inputOutput> + <camunda:inputParameter name="url">${dbAdapterEndpoint}</camunda:inputParameter> + <camunda:inputParameter name="headers"> + <camunda:map> + <camunda:entry key="content-type">application/json</camunda:entry> + <camunda:entry key="Authorization">Basic YnBlbDpwYXNzd29yZDEk</camunda:entry> + </camunda:map> + </camunda:inputParameter> + <camunda:inputParameter name="payload">${updateOperationStatus}</camunda:inputParameter> + <camunda:inputParameter name="method">POST</camunda:inputParameter> + <camunda:outputParameter name="CSMF_dbResponseCode">${statusCode}</camunda:outputParameter> + <camunda:outputParameter name="CSMF_dbResponse">${response}</camunda:outputParameter> + </camunda:inputOutput> + <camunda:connectorId>http-connector</camunda:connectorId> + </camunda:connector> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_00g94pg</bpmn:incoming> + <bpmn:incoming>SequenceFlow_16ewagx</bpmn:incoming> + <bpmn:incoming>SequenceFlow_1amyd7h</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_10g2pnj</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:endEvent id="EndEvent_0ixagvk" name="end"> + <bpmn:incoming>SequenceFlow_10g2pnj</bpmn:incoming> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_10g2pnj" sourceRef="Task_0xwjycr" targetRef="EndEvent_0ixagvk" /> + <bpmn:scriptTask id="Task_0ux5uk1" name="Query CommunicationSerive From AAI" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_017qgen</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1j0e2po</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dcs = new DeleteCommunicationService() +dcs.queryCommunicationSeriveFromAAI(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:intermediateThrowEvent id="IntermediateThrowEvent_0ce724z" name="Go to Query delete progress"> + <bpmn:incoming>SequenceFlow_0bmtfxq</bpmn:incoming> + <bpmn:linkEventDefinition name="QueryDeleteProgress" /> + </bpmn:intermediateThrowEvent> + <bpmn:intermediateCatchEvent id="IntermediateThrowEvent_11i33ob" name="QueryDeleteProgress"> + <bpmn:outgoing>SequenceFlow_1tcgzv0</bpmn:outgoing> + <bpmn:linkEventDefinition name="QueryDeleteProgress" /> + </bpmn:intermediateCatchEvent> + <bpmn:scriptTask id="Task_0qg5gn6" name="send request to NSMF WF" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_12xn3kz</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0bmtfxq</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dcs = new DeleteCommunicationService() +dcs.sendRequest2NSMFWF(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_0bmtfxq" sourceRef="Task_0qg5gn6" targetRef="IntermediateThrowEvent_0ce724z" /> + <bpmn:scriptTask id="Task_0qvxmnh" name="Delete CS Profile From AAI" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0s7s7zk</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0arvpzv</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dcs = new DeleteCommunicationService() +dcs.delCSProfileFromAAI(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_0arvpzv" sourceRef="Task_0qvxmnh" targetRef="Task_0b5j6rg" /> + <bpmn:scriptTask id="Task_0b5j6rg" name="Delete CS From AAI" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0arvpzv</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_00g94pg</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dcs = new DeleteCommunicationService() +dcs.delCSFromAAI(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:subProcess id="SubProcess_0p6namq" name="Exception Handling Sub-Process" triggeredByEvent="true"> + <bpmn:startEvent id="StartEvent_1843894"> + <bpmn:outgoing>SequenceFlow_1u5ko4h</bpmn:outgoing> + <bpmn:errorEventDefinition /> + </bpmn:startEvent> + <bpmn:sequenceFlow id="SequenceFlow_1u5ko4h" sourceRef="StartEvent_1843894" targetRef="Task_1spbb2x" /> + <bpmn:scriptTask id="Task_1spbb2x" name="Send Error Response" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1u5ko4h</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_05yfw7t</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dcs = new DeleteCommunicationService() +dcs.sendSyncError(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_05yfw7t" sourceRef="Task_1spbb2x" targetRef="Task_0yqtfvh" /> + <bpmn:scriptTask id="Task_0yqtfvh" name="Pre update Failed Operation Status" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_05yfw7t</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0c0btia</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dcs = new DeleteCommunicationService() +dcs.preFailedOperationStatus(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_0c0btia" sourceRef="Task_0yqtfvh" targetRef="Task_1s3l3fc" /> + <bpmn:serviceTask id="Task_1s3l3fc" name="Update Service Operation Status"> + <bpmn:extensionElements> + <camunda:connector> + <camunda:inputOutput> + <camunda:inputParameter name="url">${dbAdapterEndpoint}</camunda:inputParameter> + <camunda:inputParameter name="headers"> + <camunda:map> + <camunda:entry key="content-type">application/soap+xml</camunda:entry> + <camunda:entry key="Authorization">Basic YnBlbDpwYXNzd29yZDEk</camunda:entry> + </camunda:map> + </camunda:inputParameter> + <camunda:inputParameter name="payload">${updateOperationStatus}</camunda:inputParameter> + <camunda:inputParameter name="method">POST</camunda:inputParameter> + <camunda:outputParameter name="CSMF_dbResponseCode">${statusCode}</camunda:outputParameter> + <camunda:outputParameter name="CSMF_dbResponse">${response}</camunda:outputParameter> + </camunda:inputOutput> + <camunda:connectorId>http-connector</camunda:connectorId> + </camunda:connector> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0c0btia</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1w55zo7</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:endEvent id="EndEvent_1fsful5"> + <bpmn:incoming>SequenceFlow_1w55zo7</bpmn:incoming> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_1w55zo7" sourceRef="Task_1s3l3fc" targetRef="EndEvent_1fsful5" /> + </bpmn:subProcess> + <bpmn:sequenceFlow id="SequenceFlow_1tcgzv0" sourceRef="IntermediateThrowEvent_11i33ob" targetRef="ExclusiveGateway_16tdrty" /> + <bpmn:subProcess id="SubProcess_1l7gd5k" name="Sub-process for UnexpectedErrors" triggeredByEvent="true"> + <bpmn:startEvent id="StartEvent_0zc2hnn"> + <bpmn:outgoing>SequenceFlow_0mifi3x</bpmn:outgoing> + <bpmn:errorEventDefinition /> + </bpmn:startEvent> + <bpmn:sequenceFlow id="SequenceFlow_0mifi3x" sourceRef="StartEvent_0zc2hnn" targetRef="Task_01va9ms" /> + <bpmn:endEvent id="EndEvent_052gdjz"> + <bpmn:incoming>SequenceFlow_073yxs4</bpmn:incoming> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_073yxs4" sourceRef="Task_01va9ms" targetRef="EndEvent_052gdjz" /> + <bpmn:scriptTask id="Task_01va9ms" name="Handle Unexpected Error" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0mifi3x</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_073yxs4</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.common.scripts.* +ExceptionUtil ex = new ExceptionUtil() +ex.processJavaException(execution)</bpmn:script> + </bpmn:scriptTask> + </bpmn:subProcess> + <bpmn:exclusiveGateway id="ExclusiveGateway_1lyw619" name="Is NSMF timeout？" default="SequenceFlow_0s7s7zk"> + <bpmn:incoming>SequenceFlow_0xipbpr</bpmn:incoming> + <bpmn:incoming>SequenceFlow_1sah9so</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0s7s7zk</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_0bqfbxf</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:sequenceFlow id="SequenceFlow_0s7s7zk" sourceRef="ExclusiveGateway_1lyw619" targetRef="Task_0qvxmnh" /> + <bpmn:sequenceFlow id="SequenceFlow_00g94pg" sourceRef="Task_0b5j6rg" targetRef="Task_0xwjycr" /> + <bpmn:sequenceFlow id="SequenceFlow_0bqfbxf" name="yes" sourceRef="ExclusiveGateway_1lyw619" targetRef="Task_1ovewjr"> + <bpmn:documentation>#{(execution.getVariable("isTimeOut") == "YES")}</bpmn:documentation> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{(execution.getVariable("isTimeOut") == "YES")}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:exclusiveGateway id="ExclusiveGateway_16tdrty" name="is NSMF Async Succeed?" default="SequenceFlow_0jrbkau"> + <bpmn:incoming>SequenceFlow_1tcgzv0</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0jrbkau</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_16ewagx</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:sequenceFlow id="SequenceFlow_0jrbkau" sourceRef="ExclusiveGateway_16tdrty" targetRef="Task_1kizznk" /> + <bpmn:sequenceFlow id="SequenceFlow_16ewagx" name="no" sourceRef="ExclusiveGateway_16tdrty" targetRef="Task_0xwjycr"> + <bpmn:documentation>#{(execution.getVariable("isNSMFWFRspSucceed" ) == "no")}</bpmn:documentation> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{(execution.getVariable("isNSMFWFRspSucceed" ) == "no")}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:exclusiveGateway id="ExclusiveGateway_0icj4go" name="Is E2E Slice Service Instance Id Exist？" default="SequenceFlow_12xn3kz"> + <bpmn:incoming>SequenceFlow_1j0e2po</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_12xn3kz</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_0xipbpr</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:sequenceFlow id="SequenceFlow_1j0e2po" sourceRef="Task_0ux5uk1" targetRef="ExclusiveGateway_0icj4go" /> + <bpmn:sequenceFlow id="SequenceFlow_12xn3kz" sourceRef="ExclusiveGateway_0icj4go" targetRef="Task_0qg5gn6" /> + <bpmn:sequenceFlow id="SequenceFlow_0xipbpr" name="no" sourceRef="ExclusiveGateway_0icj4go" targetRef="ExclusiveGateway_1lyw619"> + <bpmn:documentation>#{(execution.getVariable("e2eSliceServiceInstanceId") == null)}</bpmn:documentation> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{(execution.getVariable("e2eSliceServiceInstanceId") == null)}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:callActivity id="Task_1ff6flk" name="CallCheckServiceProcessStatus" calledElement="CheckServiceProcessStatus"> + <bpmn:extensionElements> + <camunda:in source="e2eSliceServiceInstanceId" target="serviceInstanceId" /> + <camunda:in source="e2eOperationId" target="operationId" /> + <camunda:in source="successConditions" target="successConditions" /> + <camunda:in source="errorConditions" target="errorConditions" /> + <camunda:in source="processServiceType" target="processServiceType" /> + <camunda:in source="timeOut" target="timeOut" /> + <camunda:out source="operationStatus" target="result" /> + <camunda:out source="operationContent" target="reason" /> + <camunda:out source="WorkflowException" target="WorkflowException" /> + <camunda:out source="isTimeOut" target="isTimeOut" /> + <camunda:in source="subOperationType" target="operationType" /> + <camunda:in source="initProgress" target="initProgress" /> + <camunda:in source="endProgress" target="endProgress" /> + <camunda:in source="serviceInstanceId" target="parentServiceInstanceId" /> + <camunda:in source="globalSubscriberId" target="globalSubscriberId" /> + <camunda:in source="operationId" target="parentOperationId" /> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0thr8dc</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1sah9so</bpmn:outgoing> + </bpmn:callActivity> + <bpmn:scriptTask id="Task_1ovewjr" name="Prepare update operation status error" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0bqfbxf</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1amyd7h</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dcs = new DeleteCommunicationService() +dcs.prepareFailureStatus(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_1amyd7h" sourceRef="Task_1ovewjr" targetRef="Task_0xwjycr" /> + <bpmn:sequenceFlow id="SequenceFlow_1sah9so" sourceRef="Task_1ff6flk" targetRef="ExclusiveGateway_1lyw619" /> + <bpmn:sequenceFlow id="SequenceFlow_1ssiyug" sourceRef="Task_1kizznk" targetRef="Task_0y1n9ls" /> + <bpmn:sequenceFlow id="SequenceFlow_0thr8dc" sourceRef="Task_0y1n9ls" targetRef="Task_1ff6flk" /> + <bpmn:scriptTask id="Task_0y1n9ls" name="Prepare Call CheckServiceProcessStatus" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1ssiyug</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0thr8dc</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dcs = new DeleteCommunicationService() +dcs.prepareCallCheckProcessStatus(execution)</bpmn:script> + </bpmn:scriptTask> + </bpmn:process> + <bpmndi:BPMNDiagram id="BPMNDiagram_1"> + <bpmndi:BPMNPlane id="BPMNPlane_1" bpmnElement="DeleteCommunicationService"> + <bpmndi:BPMNShape id="_BPMNShape_StartEvent_2" bpmnElement="StartEvent_1"> + <dc:Bounds x="152" y="102" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="159" y="145" width="23" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1kjqnil_di" bpmnElement="SequenceFlow_1kjqnil"> + <di:waypoint x="188" y="120" /> + <di:waypoint x="240" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0ogievs_di" bpmnElement="SequenceFlow_0ogievs"> + <di:waypoint x="340" y="120" /> + <di:waypoint x="390" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_192yyii_di" bpmnElement="SequenceFlow_192yyii"> + <di:waypoint x="490" y="120" /> + <di:waypoint x="560" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ServiceTask_104igd7_di" bpmnElement="Task_0zaekmn"> + <dc:Bounds x="560" y="80" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_0tqibrd_di" bpmnElement="Task_0q2v7qe"> + <dc:Bounds x="390" y="80" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_18pflck_di" bpmnElement="Task_1mqm4nb"> + <dc:Bounds x="240" y="80" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_1k5stey_di" bpmnElement="ScriptTask_1k5stey"> + <dc:Bounds x="740" y="80" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0xvoume_di" bpmnElement="SequenceFlow_0xvoume"> + <di:waypoint x="660" y="120" /> + <di:waypoint x="740" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_017qgen_di" bpmnElement="SequenceFlow_017qgen"> + <di:waypoint x="840" y="120" /> + <di:waypoint x="910" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ServiceTask_17pxrcl_di" bpmnElement="Task_1kizznk"> + <dc:Bounds x="330" y="310" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_0ucwm85_di" bpmnElement="Task_0xwjycr"> + <dc:Bounds x="1250" y="310" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_0ixagvk_di" bpmnElement="EndEvent_0ixagvk"> + <dc:Bounds x="1432" y="332" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1441" y="375" width="19" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_10g2pnj_di" bpmnElement="SequenceFlow_10g2pnj"> + <di:waypoint x="1350" y="350" /> + <di:waypoint x="1432" y="350" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_05zxl7j_di" bpmnElement="Task_0ux5uk1"> + <dc:Bounds x="910" y="80" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="IntermediateThrowEvent_1go0jt1_di" bpmnElement="IntermediateThrowEvent_0ce724z"> + <dc:Bounds x="1432" y="102" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1417" y="145" width="76" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="IntermediateCatchEvent_09w3u1d_di" bpmnElement="IntermediateThrowEvent_11i33ob"> + <dc:Bounds x="152" y="332" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="127" y="375" width="86" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_0me3crz_di" bpmnElement="Task_0qg5gn6"> + <dc:Bounds x="1220" y="80" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0bmtfxq_di" bpmnElement="SequenceFlow_0bmtfxq"> + <di:waypoint x="1320" y="120" /> + <di:waypoint x="1432" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_14svlaf_di" bpmnElement="Task_0qvxmnh"> + <dc:Bounds x="900" y="310" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0arvpzv_di" bpmnElement="SequenceFlow_0arvpzv"> + <di:waypoint x="1000" y="350" /> + <di:waypoint x="1060" y="350" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_0q6s59r_di" bpmnElement="Task_0b5j6rg"> + <dc:Bounds x="1060" y="310" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="SubProcess_04znyto_di" bpmnElement="SubProcess_0p6namq" isExpanded="true"> + <dc:Bounds x="480" y="650" width="730" height="210" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="StartEvent_1qti4dg_di" bpmnElement="StartEvent_1843894"> + <dc:Bounds x="520" y="742" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1u5ko4h_di" bpmnElement="SequenceFlow_1u5ko4h"> + <di:waypoint x="556" y="760" /> + <di:waypoint x="610" y="760" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_0xdbw5d_di" bpmnElement="Task_1spbb2x"> + <dc:Bounds x="610" y="720" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_05yfw7t_di" bpmnElement="SequenceFlow_05yfw7t"> + <di:waypoint x="710" y="760" /> + <di:waypoint x="770" y="760" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_0hmczex_di" bpmnElement="Task_0yqtfvh"> + <dc:Bounds x="770" y="720" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0c0btia_di" bpmnElement="SequenceFlow_0c0btia"> + <di:waypoint x="870" y="760" /> + <di:waypoint x="930" y="760" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ServiceTask_0ra7dbt_di" bpmnElement="Task_1s3l3fc"> + <dc:Bounds x="930" y="720" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_1fsful5_di" bpmnElement="EndEvent_1fsful5"> + <dc:Bounds x="1092" y="742" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1w55zo7_di" bpmnElement="SequenceFlow_1w55zo7"> + <di:waypoint x="1030" y="760" /> + <di:waypoint x="1092" y="760" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1tcgzv0_di" bpmnElement="SequenceFlow_1tcgzv0"> + <di:waypoint x="188" y="350" /> + <di:waypoint x="235" y="350" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="SubProcess_0dwywjh_di" bpmnElement="SubProcess_1l7gd5k" isExpanded="true"> + <dc:Bounds x="660" y="950" width="350" height="200" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="StartEvent_18u3hph_di" bpmnElement="StartEvent_0zc2hnn"> + <dc:Bounds x="700" y="1032" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0mifi3x_di" bpmnElement="SequenceFlow_0mifi3x"> + <di:waypoint x="736" y="1050" /> + <di:waypoint x="790" y="1050" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="EndEvent_052gdjz_di" bpmnElement="EndEvent_052gdjz"> + <dc:Bounds x="952" y="1032" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_073yxs4_di" bpmnElement="SequenceFlow_073yxs4"> + <di:waypoint x="890" y="1050" /> + <di:waypoint x="952" y="1050" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_0lzly9f_di" bpmnElement="Task_01va9ms"> + <dc:Bounds x="790" y="1010" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ExclusiveGateway_1lyw619_di" bpmnElement="ExclusiveGateway_1lyw619" isMarkerVisible="true"> + <dc:Bounds x="785" y="325" width="50" height="50" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="786.5" y="384.5" width="47" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0s7s7zk_di" bpmnElement="SequenceFlow_0s7s7zk"> + <di:waypoint x="835" y="350" /> + <di:waypoint x="900" y="350" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_00g94pg_di" bpmnElement="SequenceFlow_00g94pg"> + <di:waypoint x="1160" y="350" /> + <di:waypoint x="1250" y="350" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0bqfbxf_di" bpmnElement="SequenceFlow_0bqfbxf"> + <di:waypoint x="810" y="325" /> + <di:waypoint x="810" y="250" /> + <di:waypoint x="900" y="250" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="846" y="232" width="17" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ExclusiveGateway_16tdrty_di" bpmnElement="ExclusiveGateway_16tdrty" isMarkerVisible="true"> + <dc:Bounds x="235" y="325" width="50" height="50" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="226" y="295" width="77" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0jrbkau_di" bpmnElement="SequenceFlow_0jrbkau"> + <di:waypoint x="285" y="350" /> + <di:waypoint x="330" y="350" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_16ewagx_di" bpmnElement="SequenceFlow_16ewagx"> + <di:waypoint x="260" y="375" /> + <di:waypoint x="260" y="500" /> + <di:waypoint x="1300" y="500" /> + <di:waypoint x="1300" y="390" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="774" y="482" width="13" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ExclusiveGateway_0icj4go_di" bpmnElement="ExclusiveGateway_0icj4go" isMarkerVisible="true"> + <dc:Bounds x="1085" y="95" width="50" height="50" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1069" y="50" width="82" height="40" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1j0e2po_di" bpmnElement="SequenceFlow_1j0e2po"> + <di:waypoint x="1010" y="120" /> + <di:waypoint x="1085" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_12xn3kz_di" bpmnElement="SequenceFlow_12xn3kz"> + <di:waypoint x="1135" y="120" /> + <di:waypoint x="1220" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0xipbpr_di" bpmnElement="SequenceFlow_0xipbpr"> + <di:waypoint x="1110" y="145" /> + <di:waypoint x="1110" y="190" /> + <di:waypoint x="810" y="190" /> + <di:waypoint x="810" y="325" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="946" y="172" width="13" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="CallActivity_1knnc2k_di" bpmnElement="Task_1ff6flk"> + <dc:Bounds x="630" y="310" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_1r84j75_di" bpmnElement="Task_1ovewjr"> + <dc:Bounds x="900" y="210" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1amyd7h_di" bpmnElement="SequenceFlow_1amyd7h"> + <di:waypoint x="1000" y="250" /> + <di:waypoint x="1300" y="250" /> + <di:waypoint x="1300" y="310" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1sah9so_di" bpmnElement="SequenceFlow_1sah9so"> + <di:waypoint x="730" y="350" /> + <di:waypoint x="785" y="350" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1ssiyug_di" bpmnElement="SequenceFlow_1ssiyug"> + <di:waypoint x="430" y="350" /> + <di:waypoint x="480" y="350" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0thr8dc_di" bpmnElement="SequenceFlow_0thr8dc"> + <di:waypoint x="580" y="350" /> + <di:waypoint x="630" y="350" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_0r8ad9j_di" bpmnElement="Task_0y1n9ls"> + <dc:Bounds x="480" y="310" width="100" height="80" /> + </bpmndi:BPMNShape> + </bpmndi:BPMNPlane> + </bpmndi:BPMNDiagram> +</bpmn:definitions> diff --git a/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/DeleteSliceService.bpmn b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/DeleteSliceService.bpmn new file mode 100644 index 0000000000..6d9df5240d --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/DeleteSliceService.bpmn @@ -0,0 +1,332 @@ +<?xml version="1.0" encoding="UTF-8"?> +<bpmn:definitions xmlns:bpmn="http://www.omg.org/spec/BPMN/20100524/MODEL" xmlns:bpmndi="http://www.omg.org/spec/BPMN/20100524/DI" xmlns:dc="http://www.omg.org/spec/DD/20100524/DC" xmlns:di="http://www.omg.org/spec/DD/20100524/DI" xmlns:camunda="http://camunda.org/schema/1.0/bpmn" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" id="Definitions_0prw6yo" targetNamespace="http://bpmn.io/schema/bpmn" exporter="Camunda Modeler" exporterVersion="3.4.1"> + <bpmn:process id="DeleteSliceService" name="DeleteSliceService" isExecutable="true"> + <bpmn:startEvent id="StartEvent_1" name="start"> + <bpmn:outgoing>SequenceFlow_1ti9sxe</bpmn:outgoing> + </bpmn:startEvent> + <bpmn:sequenceFlow id="SequenceFlow_0xmiev9" sourceRef="Task_1f3k0gq" targetRef="Task_0gsr9fu" /> + <bpmn:sequenceFlow id="SequenceFlow_1ti9sxe" sourceRef="StartEvent_1" targetRef="Task_1f3k0gq" /> + <bpmn:scriptTask id="Task_1f3k0gq" name="PreProcess Incoming Request" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1ti9sxe</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0xmiev9</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dss= new DeleteSliceService() +dss.preProcessRequest(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:serviceTask id="Task_0gsr9fu" name="Init Service Operation Status"> + <bpmn:extensionElements> + <camunda:connector> + <camunda:inputOutput> + <camunda:inputParameter name="url">${dbAdapterEndpoint}</camunda:inputParameter> + <camunda:inputParameter name="headers"> + <camunda:map> + <camunda:entry key="content-type">application/soap+xml</camunda:entry> + <camunda:entry key="Authorization">Basic YnBlbDpwYXNzd29yZDEk</camunda:entry> + </camunda:map> + </camunda:inputParameter> + <camunda:inputParameter name="payload">${updateOperationStatus}</camunda:inputParameter> + <camunda:inputParameter name="method">POST</camunda:inputParameter> + <camunda:outputParameter name="NSMF_dbResponseCode">${statusCode}</camunda:outputParameter> + <camunda:outputParameter name="NSMF_dbResponse">${response}</camunda:outputParameter> + </camunda:inputOutput> + <camunda:connectorId>http-connector</camunda:connectorId> + </camunda:connector> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0xmiev9</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0uehx9h</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:sequenceFlow id="SequenceFlow_0uehx9h" sourceRef="Task_0gsr9fu" targetRef="Task_0walqr6" /> + <bpmn:scriptTask id="Task_0walqr6" name="Send Async Ack Response" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0uehx9h</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_16lh6o6</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dss= new DeleteSliceService() +dss.sendAsyncResponse(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_16lh6o6" sourceRef="Task_0walqr6" targetRef="Task_04n2tl9" /> + <bpmn:exclusiveGateway id="ExclusiveGateway_1mcgr3m" name="success?"> + <bpmn:incoming>SequenceFlow_0nl4kfh</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0wel7ie</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_0eqx2y2</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:sequenceFlow id="SequenceFlow_0nl4kfh" sourceRef="Task_04n2tl9" targetRef="ExclusiveGateway_1mcgr3m" /> + <bpmn:sequenceFlow id="SequenceFlow_0wel7ie" name="yes" sourceRef="ExclusiveGateway_1mcgr3m" targetRef="Task_01siwzc"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("WorkflowException") == null}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:sequenceFlow id="SequenceFlow_0eqx2y2" name="no" sourceRef="ExclusiveGateway_1mcgr3m" targetRef="EndEvent_02ix4tc" /> + <bpmn:endEvent id="EndEvent_02ix4tc"> + <bpmn:incoming>SequenceFlow_0eqx2y2</bpmn:incoming> + <bpmn:errorEventDefinition errorRef="Error_1jz8wj7" /> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_18oizb2" sourceRef="Task_0k1pi3g" targetRef="Task_1vklzip" /> + <bpmn:scriptTask id="Task_0k1pi3g" name="Delete slice service From AAI" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0wel7ie</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_18oizb2</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dss= new DeleteSliceService() +dss.deleteSliceServiceInstance(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:serviceTask id="Task_1vklzip" name="Update Service Operation Status to Success"> + <bpmn:extensionElements> + <camunda:connector> + <camunda:inputOutput> + <camunda:inputParameter name="url">${dbAdapterEndpoint}</camunda:inputParameter> + <camunda:inputParameter name="headers"> + <camunda:map> + <camunda:entry key="content-type">application/soap+xml</camunda:entry> + <camunda:entry key="Authorization">${UrnPropertiesReader.getVariable("mso.adapters.requestDb.auth", execution)}</camunda:entry> + </camunda:map> + </camunda:inputParameter> + <camunda:inputParameter name="payload">${updateOperationStatus}</camunda:inputParameter> + <camunda:inputParameter name="method">POST</camunda:inputParameter> + <camunda:outputParameter name="CVFMI_dbResponseCode">${statusCode}</camunda:outputParameter> + <camunda:outputParameter name="CVFMI_dbResponse">${response}</camunda:outputParameter> + </camunda:inputOutput> + <camunda:connectorId>http-connector</camunda:connectorId> + </camunda:connector> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_18oizb2</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1oxmm7d</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:endEvent id="EndEvent_0tyqdpw" name="End"> + <bpmn:incoming>SequenceFlow_1oxmm7d</bpmn:incoming> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_1oxmm7d" sourceRef="Task_1vklzip" targetRef="EndEvent_0tyqdpw" /> + <bpmn:callActivity id="Task_04n2tl9" name="Do Delete SliceServiceV1" calledElement="DoDeleteSliceServiceV1"> + <bpmn:extensionElements> + <camunda:in source="msoRequestId" target="msoRequestId" /> + <camunda:in source="serviceInstanceId" target="serviceInstanceId" /> + <camunda:in source="serviceModelInfo" target="serviceModelInfo" /> + <camunda:in source="globalSubscriberId" target="globalSubscriberId" /> + <camunda:in source="serviceType" target="serviceType" /> + <camunda:in source="operationId" target="operationId" /> + <camunda:in source="operationType" target="operationType" /> + <camunda:out source="WorkflowException" target="WorkflowException" /> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_16lh6o6</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0nl4kfh</bpmn:outgoing> + </bpmn:callActivity> + <bpmn:scriptTask id="Task_01siwzc" name="Delete Service Profile From AAI" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0wel7ie</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_142j1q2</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dss= new DeleteSliceService() +dss.delServiceProfileFromAAI(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_142j1q2" sourceRef="Task_01siwzc" targetRef="Task_0k1pi3g" /> + <bpmn:subProcess id="SubProcess_07kf25g" name="Java Exception Handling Sub Process" triggeredByEvent="true"> + <bpmn:startEvent id="StartEvent_1qskwib"> + <bpmn:outgoing>SequenceFlow_0x8msq9</bpmn:outgoing> + <bpmn:errorEventDefinition id="ErrorEventDefinition_1mmlos4" /> + </bpmn:startEvent> + <bpmn:endEvent id="EndEvent_086jahv"> + <bpmn:incoming>SequenceFlow_10lwgo7</bpmn:incoming> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_0x8msq9" sourceRef="StartEvent_1qskwib" targetRef="ScriptTask_19sjlk2" /> + <bpmn:scriptTask id="ScriptTask_19sjlk2" name="Send Error Response" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0x8msq9</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1ihiv5k</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dss = new DeleteCustomE2EServiceInstance() +dss.sendSyncError(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_1ihiv5k" sourceRef="ScriptTask_19sjlk2" targetRef="Task_1fxg7am" /> + <bpmn:sequenceFlow id="SequenceFlow_0zvzs12" sourceRef="Task_1fxg7am" targetRef="ServiceTask_17jq3cx" /> + <bpmn:scriptTask id="Task_1fxg7am" name="Termination Service Operation Status" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1ihiv5k</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0zvzs12</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dss = new DeleteSliceService() +dss.prepareEndOperationStatus(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:serviceTask id="ServiceTask_17jq3cx" name="Update Service Operation Status To Terminate"> + <bpmn:extensionElements> + <camunda:connector> + <camunda:inputOutput> + <camunda:inputParameter name="url">${CVFMI_dbAdapterEndpoint}</camunda:inputParameter> + <camunda:inputParameter name="headers"> + <camunda:map> + <camunda:entry key="content-type">application/soap+xml</camunda:entry> + <camunda:entry key="Authorization">Basic YnBlbDpwYXNzd29yZDEk</camunda:entry> + </camunda:map> + </camunda:inputParameter> + <camunda:inputParameter name="payload">${CVFMI_updateServiceOperStatusRequest}</camunda:inputParameter> + <camunda:inputParameter name="method">POST</camunda:inputParameter> + <camunda:outputParameter name="CVFMI_dbResponseCode">${statusCode}</camunda:outputParameter> + <camunda:outputParameter name="CVFMI_dbResponse">${response}</camunda:outputParameter> + </camunda:inputOutput> + <camunda:connectorId>http-connector</camunda:connectorId> + </camunda:connector> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0zvzs12</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_10lwgo7</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:sequenceFlow id="SequenceFlow_10lwgo7" sourceRef="ServiceTask_17jq3cx" targetRef="EndEvent_086jahv" /> + </bpmn:subProcess> + <bpmn:subProcess id="SubProcess_0so7l00" name="Sub-process for UnexpectedErrors" triggeredByEvent="true"> + <bpmn:startEvent id="StartEvent_1jknl5k"> + <bpmn:outgoing>SequenceFlow_0rasmiu</bpmn:outgoing> + <bpmn:errorEventDefinition /> + </bpmn:startEvent> + <bpmn:sequenceFlow id="SequenceFlow_0rasmiu" sourceRef="StartEvent_1jknl5k" targetRef="Task_0c422xd" /> + <bpmn:endEvent id="EndEvent_1vr9nc9"> + <bpmn:incoming>SequenceFlow_1jipldf</bpmn:incoming> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_1jipldf" sourceRef="Task_0c422xd" targetRef="EndEvent_1vr9nc9" /> + <bpmn:scriptTask id="Task_0c422xd" name="Handle Unexpected Error" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0rasmiu</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1jipldf</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.common.scripts.* +ExceptionUtil ex = new ExceptionUtil() +ex.processJavaException(execution)</bpmn:script> + </bpmn:scriptTask> + </bpmn:subProcess> + </bpmn:process> + <bpmn:error id="Error_1jz8wj7" name="MSO Workflow Exception" errorCode="MSOWorkflowException" /> + <bpmndi:BPMNDiagram id="BPMNDiagram_1"> + <bpmndi:BPMNPlane id="BPMNPlane_1" bpmnElement="DeleteSliceService"> + <bpmndi:BPMNEdge id="SequenceFlow_1ti9sxe_di" bpmnElement="SequenceFlow_1ti9sxe"> + <di:waypoint x="188" y="117" /> + <di:waypoint x="290" y="117" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0xmiev9_di" bpmnElement="SequenceFlow_0xmiev9"> + <di:waypoint x="390" y="117" /> + <di:waypoint x="480" y="117" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="_BPMNShape_StartEvent_2" bpmnElement="StartEvent_1"> + <dc:Bounds x="152" y="99" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="159" y="142" width="23" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_0aqhg4z_di" bpmnElement="Task_1f3k0gq"> + <dc:Bounds x="290" y="77" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_1n9ja9t_di" bpmnElement="Task_0gsr9fu"> + <dc:Bounds x="480" y="77" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0uehx9h_di" bpmnElement="SequenceFlow_0uehx9h"> + <di:waypoint x="580" y="117" /> + <di:waypoint x="660" y="117" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_13qpvgg_di" bpmnElement="Task_0walqr6"> + <dc:Bounds x="660" y="77" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_16lh6o6_di" bpmnElement="SequenceFlow_16lh6o6"> + <di:waypoint x="760" y="117" /> + <di:waypoint x="840" y="117" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ExclusiveGateway_1mcgr3m_di" bpmnElement="ExclusiveGateway_1mcgr3m" isMarkerVisible="true"> + <dc:Bounds x="1025" y="92" width="50" height="50" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1026" y="73" width="47" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0nl4kfh_di" bpmnElement="SequenceFlow_0nl4kfh"> + <di:waypoint x="940" y="117" /> + <di:waypoint x="1025" y="117" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0wel7ie_di" bpmnElement="SequenceFlow_0wel7ie"> + <di:waypoint x="1075" y="117" /> + <di:waypoint x="1164" y="117" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1100" y="98" width="17" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0eqx2y2_di" bpmnElement="SequenceFlow_0eqx2y2"> + <di:waypoint x="1050" y="142" /> + <di:waypoint x="1050" y="202" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1059" y="169" width="13" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="EndEvent_169jlln_di" bpmnElement="EndEvent_02ix4tc"> + <dc:Bounds x="1032" y="202" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_18oizb2_di" bpmnElement="SequenceFlow_18oizb2"> + <di:waypoint x="1440" y="117" /> + <di:waypoint x="1530" y="117" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_10g3cz7_di" bpmnElement="Task_0k1pi3g"> + <dc:Bounds x="1340" y="77" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_0pct2ne_di" bpmnElement="Task_1vklzip"> + <dc:Bounds x="1530" y="77" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_0tyqdpw_di" bpmnElement="EndEvent_0tyqdpw"> + <dc:Bounds x="1562" y="202" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1570" y="245" width="20" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1oxmm7d_di" bpmnElement="SequenceFlow_1oxmm7d"> + <di:waypoint x="1580" y="157" /> + <di:waypoint x="1580" y="202" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="CallActivity_1igxzig_di" bpmnElement="Task_04n2tl9"> + <dc:Bounds x="840" y="77" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_0qqsp7x_di" bpmnElement="Task_01siwzc"> + <dc:Bounds x="1164" y="77" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_142j1q2_di" bpmnElement="SequenceFlow_142j1q2"> + <di:waypoint x="1264" y="117" /> + <di:waypoint x="1340" y="117" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="SubProcess_07kf25g_di" bpmnElement="SubProcess_07kf25g" isExpanded="true"> + <dc:Bounds x="340" y="430" width="637" height="162" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="StartEvent_1qskwib_di" bpmnElement="StartEvent_1qskwib"> + <dc:Bounds x="377" y="497" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_086jahv_di" bpmnElement="EndEvent_086jahv"> + <dc:Bounds x="902" y="497" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0x8msq9_di" bpmnElement="SequenceFlow_0x8msq9"> + <di:waypoint x="413" y="515" /> + <di:waypoint x="456" y="515" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_19sjlk2_di" bpmnElement="ScriptTask_19sjlk2"> + <dc:Bounds x="456" y="475" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1ihiv5k_di" bpmnElement="SequenceFlow_1ihiv5k"> + <di:waypoint x="556" y="515" /> + <di:waypoint x="615" y="515" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0zvzs12_di" bpmnElement="SequenceFlow_0zvzs12"> + <di:waypoint x="715" y="515" /> + <di:waypoint x="765" y="515" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_0bjcnd3_di" bpmnElement="Task_1fxg7am"> + <dc:Bounds x="615" y="475" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_17jq3cx_di" bpmnElement="ServiceTask_17jq3cx"> + <dc:Bounds x="765" y="475" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_10lwgo7_di" bpmnElement="SequenceFlow_10lwgo7"> + <di:waypoint x="865" y="515" /> + <di:waypoint x="902" y="515" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="SubProcess_1dd77tu_di" bpmnElement="SubProcess_0so7l00" isExpanded="true"> + <dc:Bounds x="470" y="650" width="350" height="200" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="StartEvent_14mwxm0_di" bpmnElement="StartEvent_1jknl5k"> + <dc:Bounds x="510" y="732" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0rasmiu_di" bpmnElement="SequenceFlow_0rasmiu"> + <di:waypoint x="546" y="750" /> + <di:waypoint x="600" y="750" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="EndEvent_1vr9nc9_di" bpmnElement="EndEvent_1vr9nc9"> + <dc:Bounds x="762" y="732" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1jipldf_di" bpmnElement="SequenceFlow_1jipldf"> + <di:waypoint x="700" y="750" /> + <di:waypoint x="762" y="750" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_0vb5d51_di" bpmnElement="Task_0c422xd"> + <dc:Bounds x="600" y="710" width="100" height="80" /> + </bpmndi:BPMNShape> + </bpmndi:BPMNPlane> + </bpmndi:BPMNDiagram> +</bpmn:definitions> diff --git a/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/PNFSWUPDownload.bpmn b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/PNFSWUPDownload.bpmn new file mode 100644 index 0000000000..24ca7104a7 --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/PNFSWUPDownload.bpmn @@ -0,0 +1,202 @@ +<?xml version="1.0" encoding="UTF-8"?> +<bpmn:definitions xmlns:bpmn="http://www.omg.org/spec/BPMN/20100524/MODEL" xmlns:bpmndi="http://www.omg.org/spec/BPMN/20100524/DI" xmlns:dc="http://www.omg.org/spec/DD/20100524/DC" xmlns:camunda="http://camunda.org/schema/1.0/bpmn" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xmlns:di="http://www.omg.org/spec/DD/20100524/DI" id="Definitions_0474hns" targetNamespace="http://bpmn.io/schema/bpmn" exporter="Camunda Modeler" exporterVersion="3.3.4"> + <bpmn:process id="PNFSWUPDownload" name="PNFSWUPDownload" isExecutable="true"> + <bpmn:startEvent id="download_StartEvent" name="Start Flow"> + <bpmn:outgoing>SequenceFlow_1fdclh0</bpmn:outgoing> + </bpmn:startEvent> + <bpmn:serviceTask id="ServiceTask_1mpt2eq" name="NF Download Dispatcher" camunda:delegateExpression="${NfSoftwareUpgradeDispatcher}"> + <bpmn:incoming>SequenceFlow_1fdclh0</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_12155q6</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:endEvent id="download_EndEvent" name="End"> + <bpmn:incoming>SequenceFlow_1d2rfyx</bpmn:incoming> + <bpmn:terminateEventDefinition id="TerminateEventDefinition_1kiurmf" /> + </bpmn:endEvent> + <bpmn:exclusiveGateway id="ExclusiveGateway_1ja7grm" default="SequenceFlow_078xmlz"> + <bpmn:incoming>SequenceFlow_0o6b6a8</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_078xmlz</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_0qznt4u</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:endEvent id="EndEvent_1j64ij1"> + <bpmn:incoming>SequenceFlow_078xmlz</bpmn:incoming> + <bpmn:errorEventDefinition id="ErrorEventDefinition_0b3kbjs" errorRef="Error_1q14dnd" /> + </bpmn:endEvent> + <bpmn:exclusiveGateway id="ExclusiveGateway_1rj84ne" default="SequenceFlow_1tfbzn1"> + <bpmn:incoming>SequenceFlow_1ccldpp</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0s6i4o9</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_1tfbzn1</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:endEvent id="EndEvent_1ubpef4"> + <bpmn:incoming>SequenceFlow_1tfbzn1</bpmn:incoming> + <bpmn:errorEventDefinition id="ErrorEventDefinition_0wevx6s" errorRef="Error_1q14dnd" /> + </bpmn:endEvent> + <bpmn:exclusiveGateway id="ExclusiveGateway_08lusga" default="SequenceFlow_1gawssm"> + <bpmn:incoming>SequenceFlow_1kaikh5</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1d2rfyx</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_1gawssm</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:endEvent id="EndEvent_11hee4g"> + <bpmn:incoming>SequenceFlow_1gawssm</bpmn:incoming> + <bpmn:errorEventDefinition id="ErrorEventDefinition_12tyzwb" errorRef="Error_1q14dnd" /> + </bpmn:endEvent> + <bpmn:serviceTask id="ServiceTask_0yavde3" name="Download" camunda:delegateExpression="${ControllerExecutionDE}"> + <bpmn:extensionElements> + <camunda:inputOutput> + <camunda:inputParameter name="action">downloadNESw</camunda:inputParameter> + <camunda:inputParameter name="scope">pnf</camunda:inputParameter> + <camunda:inputParameter name="mode">async</camunda:inputParameter> + </camunda:inputOutput> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0s6i4o9</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0o6b6a8</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:serviceTask id="ServiceTask_1wxo7xz" name="Post check" camunda:delegateExpression="${ControllerExecutionDE}"> + <bpmn:extensionElements> + <camunda:inputOutput> + <camunda:inputParameter name="action">postCheck</camunda:inputParameter> + <camunda:inputParameter name="scope">pnf</camunda:inputParameter> + <camunda:inputParameter name="mode">async</camunda:inputParameter> + </camunda:inputOutput> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0qznt4u</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1kaikh5</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:serviceTask id="ServiceTask_1nl90ao" name="Pre check" camunda:delegateExpression="${ControllerExecutionDE}"> + <bpmn:extensionElements> + <camunda:inputOutput> + <camunda:inputParameter name="action">preCheck</camunda:inputParameter> + <camunda:inputParameter name="scope">pnf</camunda:inputParameter> + <camunda:inputParameter name="mode">async</camunda:inputParameter> + </camunda:inputOutput> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_12155q6</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1ccldpp</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:sequenceFlow id="SequenceFlow_1fdclh0" sourceRef="download_StartEvent" targetRef="ServiceTask_1mpt2eq" /> + <bpmn:sequenceFlow id="SequenceFlow_12155q6" sourceRef="ServiceTask_1mpt2eq" targetRef="ServiceTask_1nl90ao" /> + <bpmn:sequenceFlow id="SequenceFlow_1d2rfyx" name="Success" sourceRef="ExclusiveGateway_08lusga" targetRef="download_EndEvent"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("ControllerStatus").equals("Success")}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:sequenceFlow id="SequenceFlow_0o6b6a8" sourceRef="ServiceTask_0yavde3" targetRef="ExclusiveGateway_1ja7grm" /> + <bpmn:sequenceFlow id="SequenceFlow_078xmlz" name="Failure" sourceRef="ExclusiveGateway_1ja7grm" targetRef="EndEvent_1j64ij1" /> + <bpmn:sequenceFlow id="SequenceFlow_1ccldpp" sourceRef="ServiceTask_1nl90ao" targetRef="ExclusiveGateway_1rj84ne" /> + <bpmn:sequenceFlow id="SequenceFlow_0s6i4o9" name="Success" sourceRef="ExclusiveGateway_1rj84ne" targetRef="ServiceTask_0yavde3"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("ControllerStatus").equals("Success")}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:sequenceFlow id="SequenceFlow_1tfbzn1" name="Failure" sourceRef="ExclusiveGateway_1rj84ne" targetRef="EndEvent_1ubpef4" /> + <bpmn:sequenceFlow id="SequenceFlow_1kaikh5" sourceRef="ServiceTask_1wxo7xz" targetRef="ExclusiveGateway_08lusga" /> + <bpmn:sequenceFlow id="SequenceFlow_1gawssm" name="Failure" sourceRef="ExclusiveGateway_08lusga" targetRef="EndEvent_11hee4g" /> + <bpmn:sequenceFlow id="SequenceFlow_0qznt4u" name="Success" sourceRef="ExclusiveGateway_1ja7grm" targetRef="ServiceTask_1wxo7xz"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("ControllerStatus").equals("Success")}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + </bpmn:process> + <bpmn:error id="Error_1q14dnd" name="MSOWorkflowException" errorCode="MSOWorkflowException" /> + <bpmndi:BPMNDiagram id="BPMNDiagram_1"> + <bpmndi:BPMNPlane id="BPMNPlane_1" bpmnElement="PNFSWUPDownload"> + <bpmndi:BPMNShape id="StartEvent_1k8gssq_di" bpmnElement="download_StartEvent"> + <dc:Bounds x="162" y="102" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="157" y="145" width="50" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_1mpt2eq_di" bpmnElement="ServiceTask_1mpt2eq"> + <dc:Bounds x="280" y="80" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_1e4dq7w_di" bpmnElement="download_EndEvent"> + <dc:Bounds x="1312" y="102" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1321" y="145" width="20" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ExclusiveGateway_1ja7grm_di" bpmnElement="ExclusiveGateway_1ja7grm" isMarkerVisible="true"> + <dc:Bounds x="895" y="95" width="50" height="50" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_1j64ij1_di" bpmnElement="EndEvent_1j64ij1"> + <dc:Bounds x="902" y="252" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ExclusiveGateway_1rj84ne_di" bpmnElement="ExclusiveGateway_1rj84ne" isMarkerVisible="true"> + <dc:Bounds x="635" y="95" width="50" height="50" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_1ubpef4_di" bpmnElement="EndEvent_1ubpef4"> + <dc:Bounds x="642" y="252" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ExclusiveGateway_08lusga_di" bpmnElement="ExclusiveGateway_08lusga" isMarkerVisible="true"> + <dc:Bounds x="1155" y="95" width="50" height="50" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_11hee4g_di" bpmnElement="EndEvent_11hee4g"> + <dc:Bounds x="1162" y="252" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_0yavde3_di" bpmnElement="ServiceTask_0yavde3"> + <dc:Bounds x="760" y="80" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_1wxo7xz_di" bpmnElement="ServiceTask_1wxo7xz"> + <dc:Bounds x="1000" y="80" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_1nl90ao_di" bpmnElement="ServiceTask_1nl90ao"> + <dc:Bounds x="480" y="80" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1fdclh0_di" bpmnElement="SequenceFlow_1fdclh0"> + <di:waypoint x="198" y="120" /> + <di:waypoint x="280" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_12155q6_di" bpmnElement="SequenceFlow_12155q6"> + <di:waypoint x="380" y="120" /> + <di:waypoint x="480" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1d2rfyx_di" bpmnElement="SequenceFlow_1d2rfyx"> + <di:waypoint x="1205" y="120" /> + <di:waypoint x="1312" y="120" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1214" y="102" width="43" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0o6b6a8_di" bpmnElement="SequenceFlow_0o6b6a8"> + <di:waypoint x="860" y="120" /> + <di:waypoint x="895" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_078xmlz_di" bpmnElement="SequenceFlow_078xmlz"> + <di:waypoint x="920" y="145" /> + <di:waypoint x="920" y="252" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="918" y="217" width="34" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1ccldpp_di" bpmnElement="SequenceFlow_1ccldpp"> + <di:waypoint x="580" y="120" /> + <di:waypoint x="635" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0s6i4o9_di" bpmnElement="SequenceFlow_0s6i4o9"> + <di:waypoint x="685" y="120" /> + <di:waypoint x="760" y="120" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="678" y="102" width="43" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1tfbzn1_di" bpmnElement="SequenceFlow_1tfbzn1"> + <di:waypoint x="660" y="145" /> + <di:waypoint x="660" y="252" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="658" y="217" width="34" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1kaikh5_di" bpmnElement="SequenceFlow_1kaikh5"> + <di:waypoint x="1100" y="120" /> + <di:waypoint x="1155" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1gawssm_di" bpmnElement="SequenceFlow_1gawssm"> + <di:waypoint x="1180" y="145" /> + <di:waypoint x="1180" y="252" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1178" y="172" width="34" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0qznt4u_di" bpmnElement="SequenceFlow_0qznt4u"> + <di:waypoint x="945" y="120" /> + <di:waypoint x="1000" y="120" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="951" y="102" width="43" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + </bpmndi:BPMNPlane> + </bpmndi:BPMNDiagram> +</bpmn:definitions> diff --git a/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/PNFSoftwareUpgrade.bpmn b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/PNFSoftwareUpgrade.bpmn new file mode 100644 index 0000000000..8d59dac8ac --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/PNFSoftwareUpgrade.bpmn @@ -0,0 +1,273 @@ +<?xml version="1.0" encoding="UTF-8"?> +<bpmn:definitions xmlns:bpmn="http://www.omg.org/spec/BPMN/20100524/MODEL" xmlns:bpmndi="http://www.omg.org/spec/BPMN/20100524/DI" xmlns:dc="http://www.omg.org/spec/DD/20100524/DC" xmlns:camunda="http://camunda.org/schema/1.0/bpmn" xmlns:di="http://www.omg.org/spec/DD/20100524/DI" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" id="Definitions_1yd8m0g" targetNamespace="http://bpmn.io/schema/bpmn" exporter="Camunda Modeler" exporterVersion="3.3.4"> + <bpmn:process id="PNFSoftwareUpgrade" name="PNFSoftwareUpgrade" isExecutable="true"> + <bpmn:startEvent id="softwareUpgrade_startEvent" name="Start Flow"> + <bpmn:outgoing>SequenceFlow_1ng4b6l</bpmn:outgoing> + </bpmn:startEvent> + <bpmn:serviceTask id="ServiceTask_042uz7n" name="NF Upgrade Dispatcher" camunda:delegateExpression="${NfSoftwareUpgradeDispatcher}"> + <bpmn:incoming>SequenceFlow_1ng4b6l</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_12ejx4m</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:sequenceFlow id="SequenceFlow_12ejx4m" sourceRef="ServiceTask_042uz7n" targetRef="ServiceTask_0slpahe" /> + <bpmn:endEvent id="softwareUpgrade_endEvent" name="End"> + <bpmn:incoming>SequenceFlow_1atiydu</bpmn:incoming> + <bpmn:terminateEventDefinition /> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_1ng4b6l" sourceRef="softwareUpgrade_startEvent" targetRef="ServiceTask_042uz7n" /> + <bpmn:exclusiveGateway id="ExclusiveGateway_0v3l3wv" default="SequenceFlow_1lr7vgu"> + <bpmn:incoming>SequenceFlow_0cchgih</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1lr7vgu</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_1eljvek</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:endEvent id="EndEvent_0bnbfds"> + <bpmn:incoming>SequenceFlow_1lr7vgu</bpmn:incoming> + <bpmn:errorEventDefinition id="ErrorEventDefinition_1sjbsm2" errorRef="Error_12cpov5" /> + </bpmn:endEvent> + <bpmn:exclusiveGateway id="ExclusiveGateway_0x6h0ni" default="SequenceFlow_0piri91"> + <bpmn:incoming>SequenceFlow_0j26xlx</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1nsmyr5</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_0piri91</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:sequenceFlow id="SequenceFlow_1nsmyr5" name="Success" sourceRef="ExclusiveGateway_0x6h0ni" targetRef="ServiceTask_0x5cje8"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("ControllerStatus").equals("Success")}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:endEvent id="EndEvent_180lm4y"> + <bpmn:incoming>SequenceFlow_0piri91</bpmn:incoming> + <bpmn:errorEventDefinition id="ErrorEventDefinition_0fm5he7" errorRef="Error_12cpov5" /> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_0piri91" name="Failure" sourceRef="ExclusiveGateway_0x6h0ni" targetRef="EndEvent_180lm4y" /> + <bpmn:sequenceFlow id="SequenceFlow_1lr7vgu" name="Failure" sourceRef="ExclusiveGateway_0v3l3wv" targetRef="EndEvent_0bnbfds" /> + <bpmn:exclusiveGateway id="ExclusiveGateway_0ch3fef" default="SequenceFlow_0dqnb6c"> + <bpmn:incoming>SequenceFlow_015y785</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0dqnb6c</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_0eiif6e</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:endEvent id="EndEvent_1ms4wdz"> + <bpmn:incoming>SequenceFlow_0dqnb6c</bpmn:incoming> + <bpmn:errorEventDefinition id="ErrorEventDefinition_15s8fgk" errorRef="Error_12cpov5" /> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_0dqnb6c" name="Failure" sourceRef="ExclusiveGateway_0ch3fef" targetRef="EndEvent_1ms4wdz" /> + <bpmn:exclusiveGateway id="ExclusiveGateway_1ny9b1z" default="SequenceFlow_1p0axph"> + <bpmn:incoming>SequenceFlow_0g3qcd0</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1p0axph</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_1atiydu</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:endEvent id="EndEvent_0l6n6x5"> + <bpmn:incoming>SequenceFlow_1p0axph</bpmn:incoming> + <bpmn:errorEventDefinition id="ErrorEventDefinition_1l0gsy0" errorRef="Error_12cpov5" /> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_1p0axph" name="Failure" sourceRef="ExclusiveGateway_1ny9b1z" targetRef="EndEvent_0l6n6x5" /> + <bpmn:sequenceFlow id="SequenceFlow_1eljvek" name="Success" sourceRef="ExclusiveGateway_0v3l3wv" targetRef="ServiceTask_02lxf48"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("ControllerStatus").equals("Success")}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:sequenceFlow id="SequenceFlow_1atiydu" name="Success" sourceRef="ExclusiveGateway_1ny9b1z" targetRef="softwareUpgrade_endEvent"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("ControllerStatus").equals("Success")}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:sequenceFlow id="SequenceFlow_0eiif6e" name="Success" sourceRef="ExclusiveGateway_0ch3fef" targetRef="ServiceTask_1jo8vn7"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("ControllerStatus").equals("Success")}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:serviceTask id="ServiceTask_0x5cje8" name="Download" camunda:delegateExpression="${ControllerExecutionDE}"> + <bpmn:extensionElements> + <camunda:inputOutput> + <camunda:inputParameter name="action">downloadNESw</camunda:inputParameter> + <camunda:inputParameter name="scope">pnf</camunda:inputParameter> + <camunda:inputParameter name="mode">async</camunda:inputParameter> + </camunda:inputOutput> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_1nsmyr5</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0cchgih</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:sequenceFlow id="SequenceFlow_0cchgih" sourceRef="ServiceTask_0x5cje8" targetRef="ExclusiveGateway_0v3l3wv" /> + <bpmn:serviceTask id="ServiceTask_02lxf48" name="Activate" camunda:delegateExpression="${ControllerExecutionDE}"> + <bpmn:extensionElements> + <camunda:inputOutput> + <camunda:inputParameter name="action">activateNESw</camunda:inputParameter> + <camunda:inputParameter name="scope">pnf</camunda:inputParameter> + <camunda:inputParameter name="mode">async</camunda:inputParameter> + </camunda:inputOutput> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_1eljvek</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_015y785</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:sequenceFlow id="SequenceFlow_015y785" sourceRef="ServiceTask_02lxf48" targetRef="ExclusiveGateway_0ch3fef" /> + <bpmn:serviceTask id="ServiceTask_0y2uysu" name="Post check" camunda:delegateExpression="${ControllerExecutionDE}"> + <bpmn:extensionElements> + <camunda:inputOutput> + <camunda:inputParameter name="action">postCheck</camunda:inputParameter> + <camunda:inputParameter name="scope">pnf</camunda:inputParameter> + <camunda:inputParameter name="mode">async</camunda:inputParameter> + </camunda:inputOutput> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_084orr1</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0g3qcd0</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:sequenceFlow id="SequenceFlow_0g3qcd0" sourceRef="ServiceTask_0y2uysu" targetRef="ExclusiveGateway_1ny9b1z" /> + <bpmn:serviceTask id="ServiceTask_0slpahe" name="Pre check" camunda:delegateExpression="${ControllerExecutionDE}"> + <bpmn:extensionElements> + <camunda:inputOutput> + <camunda:inputParameter name="action">preCheck</camunda:inputParameter> + <camunda:inputParameter name="scope">pnf</camunda:inputParameter> + <camunda:inputParameter name="mode">async</camunda:inputParameter> + </camunda:inputOutput> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_12ejx4m</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0j26xlx</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:sequenceFlow id="SequenceFlow_0j26xlx" sourceRef="ServiceTask_0slpahe" targetRef="ExclusiveGateway_0x6h0ni" /> + <bpmn:serviceTask id="ServiceTask_1jo8vn7" name="Update Pnf in AAI" camunda:delegateExpression="${UpdatePnfEntryInAai}"> + <bpmn:incoming>SequenceFlow_0eiif6e</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_084orr1</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:sequenceFlow id="SequenceFlow_084orr1" sourceRef="ServiceTask_1jo8vn7" targetRef="ServiceTask_0y2uysu" /> + </bpmn:process> + <bpmn:error id="Error_12cpov5" name="MSOWorkflowException" errorCode="MSOWorkflowException" /> + <bpmn:error id="Error_0nmskzh" name="MSOWorkflowException" errorCode="MSOWorkflowException" /> + <bpmndi:BPMNDiagram id="BPMNDiagram_1"> + <bpmndi:BPMNPlane id="BPMNPlane_1" bpmnElement="PNFSoftwareUpgrade"> + <bpmndi:BPMNShape id="_BPMNShape_StartEvent_2" bpmnElement="softwareUpgrade_startEvent"> + <dc:Bounds x="162" y="102" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="157" y="145" width="50" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_042uz7n_di" bpmnElement="ServiceTask_042uz7n"> + <dc:Bounds x="280" y="80" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_12ejx4m_di" bpmnElement="SequenceFlow_12ejx4m"> + <di:waypoint x="380" y="120" /> + <di:waypoint x="480" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="EndEvent_1w3jv30_di" bpmnElement="softwareUpgrade_endEvent"> + <dc:Bounds x="1662" y="102" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1671" y="145" width="20" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1ng4b6l_di" bpmnElement="SequenceFlow_1ng4b6l"> + <di:waypoint x="198" y="120" /> + <di:waypoint x="280" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ExclusiveGateway_0v3l3wv_di" bpmnElement="ExclusiveGateway_0v3l3wv" isMarkerVisible="true"> + <dc:Bounds x="895" y="95" width="50" height="50" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1040" y="65" width="43" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_0bnbfds_di" bpmnElement="EndEvent_0bnbfds"> + <dc:Bounds x="902" y="252" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1044" y="295" width="34" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ExclusiveGateway_0x6h0ni_di" bpmnElement="ExclusiveGateway_0x6h0ni" isMarkerVisible="true"> + <dc:Bounds x="635" y="95" width="50" height="50" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1nsmyr5_di" bpmnElement="SequenceFlow_1nsmyr5"> + <di:waypoint x="685" y="120" /> + <di:waypoint x="760" y="120" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="678" y="102" width="43" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="EndEvent_180lm4y_di" bpmnElement="EndEvent_180lm4y"> + <dc:Bounds x="642" y="252" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0piri91_di" bpmnElement="SequenceFlow_0piri91"> + <di:waypoint x="660" y="145" /> + <di:waypoint x="660" y="252" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="658" y="217" width="34" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1lr7vgu_di" bpmnElement="SequenceFlow_1lr7vgu"> + <di:waypoint x="920" y="145" /> + <di:waypoint x="920" y="252" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="918" y="217" width="34" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ExclusiveGateway_0ch3fef_di" bpmnElement="ExclusiveGateway_0ch3fef" isMarkerVisible="true"> + <dc:Bounds x="1125" y="95" width="50" height="50" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_1ms4wdz_di" bpmnElement="EndEvent_1ms4wdz"> + <dc:Bounds x="1132" y="252" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0dqnb6c_di" bpmnElement="SequenceFlow_0dqnb6c"> + <di:waypoint x="1150" y="145" /> + <di:waypoint x="1150" y="252" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1148" y="230" width="34" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ExclusiveGateway_1ny9b1z_di" bpmnElement="ExclusiveGateway_1ny9b1z" isMarkerVisible="true"> + <dc:Bounds x="1505" y="95" width="50" height="50" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_0l6n6x5_di" bpmnElement="EndEvent_0l6n6x5"> + <dc:Bounds x="1512" y="252" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1p0axph_di" bpmnElement="SequenceFlow_1p0axph"> + <di:waypoint x="1530" y="145" /> + <di:waypoint x="1530" y="252" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1528" y="172" width="34" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1eljvek_di" bpmnElement="SequenceFlow_1eljvek"> + <di:waypoint x="945" y="120" /> + <di:waypoint x="1010" y="120" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="938" y="102" width="43" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1atiydu_di" bpmnElement="SequenceFlow_1atiydu"> + <di:waypoint x="1555" y="120" /> + <di:waypoint x="1662" y="120" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1564" y="102" width="43" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0eiif6e_di" bpmnElement="SequenceFlow_0eiif6e"> + <di:waypoint x="1175" y="120" /> + <di:waypoint x="1210" y="120" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1169" y="102" width="43" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ServiceTask_0x5cje8_di" bpmnElement="ServiceTask_0x5cje8"> + <dc:Bounds x="760" y="80" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0cchgih_di" bpmnElement="SequenceFlow_0cchgih"> + <di:waypoint x="860" y="120" /> + <di:waypoint x="895" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ServiceTask_02lxf48_di" bpmnElement="ServiceTask_02lxf48"> + <dc:Bounds x="1010" y="80" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_015y785_di" bpmnElement="SequenceFlow_015y785"> + <di:waypoint x="1110" y="120" /> + <di:waypoint x="1125" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ServiceTask_0y2uysu_di" bpmnElement="ServiceTask_0y2uysu"> + <dc:Bounds x="1370" y="80" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0g3qcd0_di" bpmnElement="SequenceFlow_0g3qcd0"> + <di:waypoint x="1470" y="120" /> + <di:waypoint x="1505" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ServiceTask_0slpahe_di" bpmnElement="ServiceTask_0slpahe"> + <dc:Bounds x="480" y="80" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0j26xlx_di" bpmnElement="SequenceFlow_0j26xlx"> + <di:waypoint x="580" y="120" /> + <di:waypoint x="635" y="120" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ServiceTask_1jo8vn7_di" bpmnElement="ServiceTask_1jo8vn7"> + <dc:Bounds x="1210" y="80" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_084orr1_di" bpmnElement="SequenceFlow_084orr1"> + <di:waypoint x="1310" y="120" /> + <di:waypoint x="1370" y="120" /> + </bpmndi:BPMNEdge> + </bpmndi:BPMNPlane> + </bpmndi:BPMNDiagram> +</bpmn:definitions> diff --git a/bpmn/so-bpmn-infrastructure-flows/src/main/resources/subprocess/CheckServiceProcessStatus.bpmn b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/subprocess/CheckServiceProcessStatus.bpmn new file mode 100644 index 0000000000..279dd2a4ad --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/subprocess/CheckServiceProcessStatus.bpmn @@ -0,0 +1,225 @@ +<?xml version="1.0" encoding="UTF-8"?> +<bpmn:definitions xmlns:bpmn="http://www.omg.org/spec/BPMN/20100524/MODEL" xmlns:bpmndi="http://www.omg.org/spec/BPMN/20100524/DI" xmlns:dc="http://www.omg.org/spec/DD/20100524/DC" xmlns:camunda="http://camunda.org/schema/1.0/bpmn" xmlns:di="http://www.omg.org/spec/DD/20100524/DI" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" id="Definitions_0lf96js" targetNamespace="http://bpmn.io/schema/bpmn" exporter="Camunda Modeler" exporterVersion="3.4.1"> + <bpmn:process id="CheckServiceProcessStatus" name="CheckServiceProcessStatus" isExecutable="true"> + <bpmn:startEvent id="StartEvent_1" name="start check processing status"> + <bpmn:outgoing>SequenceFlow_1g4lx01</bpmn:outgoing> + </bpmn:startEvent> + <bpmn:scriptTask id="ScriptTask_1mlave2" name="Prepare service Check Process status Req " scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0e29y0f</bpmn:incoming> + <bpmn:incoming>SequenceFlow_1n5nl53</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0r1x26k</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def csi= new CheckServiceProcessStatus() +csi.preCheckServiceStatusReq(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:serviceTask id="ServiceTask_0w5fmqn" name="get service Operation Status "> + <bpmn:extensionElements> + <camunda:connector> + <camunda:inputOutput> + <camunda:inputParameter name="url">${dbAdapterEndpoint}</camunda:inputParameter> + <camunda:inputParameter name="headers"> + <camunda:map> + <camunda:entry key="content-type">application/soap+xml</camunda:entry> + <camunda:entry key="Authorization">Basic YnBlbDpwYXNzd29yZDEk</camunda:entry> + </camunda:map> + </camunda:inputParameter> + <camunda:inputParameter name="payload">${getOperationStatus}</camunda:inputParameter> + <camunda:inputParameter name="method">POST</camunda:inputParameter> + <camunda:outputParameter name="dbResponseCode">${statusCode}</camunda:outputParameter> + <camunda:outputParameter name="dbResponse">${response}</camunda:outputParameter> + </camunda:inputOutput> + <camunda:connectorId>http-connector</camunda:connectorId> + </camunda:connector> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0r1x26k</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_009p8v1</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:scriptTask id="ScriptTask_0z37e29" name="handler service status Response " scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_009p8v1</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0yws8fh</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def csi= new CheckServiceProcessStatus() +csi.handlerServiceStatusResp(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:exclusiveGateway id="ExclusiveGateway_0gk7p3l" name="Is service process finished? " default="SequenceFlow_01o92x6"> + <bpmn:incoming>SequenceFlow_0yws8fh</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_18jgpa8</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_01o92x6</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:scriptTask id="ScriptTask_1ao91w3" name="Time Delay" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1pxnqsp</bpmn:incoming> + <bpmn:incoming>SequenceFlow_1ktr440</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0e29y0f</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def csi= new CheckServiceProcessStatus() +csi.timeWaitDelay(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_0e29y0f" sourceRef="ScriptTask_1ao91w3" targetRef="ScriptTask_1mlave2" /> + <bpmn:sequenceFlow id="SequenceFlow_0r1x26k" sourceRef="ScriptTask_1mlave2" targetRef="ServiceTask_0w5fmqn" /> + <bpmn:sequenceFlow id="SequenceFlow_009p8v1" sourceRef="ServiceTask_0w5fmqn" targetRef="ScriptTask_0z37e29" /> + <bpmn:sequenceFlow id="SequenceFlow_0yws8fh" sourceRef="ScriptTask_0z37e29" targetRef="ExclusiveGateway_0gk7p3l" /> + <bpmn:sequenceFlow id="SequenceFlow_18jgpa8" name="yes" sourceRef="ExclusiveGateway_0gk7p3l" targetRef="EndEvent_0a3w3xw"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{(execution.getVariable("isAllFinished") == "true") || (execution.getVariable("isTimeOut") == "YES")}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:endEvent id="EndEvent_0a3w3xw"> + <bpmn:incoming>SequenceFlow_18jgpa8</bpmn:incoming> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_1g4lx01" sourceRef="StartEvent_1" targetRef="Task_1djj44q" /> + <bpmn:sequenceFlow id="SequenceFlow_1n5nl53" sourceRef="Task_1djj44q" targetRef="ScriptTask_1mlave2" /> + <bpmn:scriptTask id="Task_1djj44q" name="Prepare request" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1g4lx01</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1n5nl53</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def csi= new CheckServiceProcessStatus() +csi.preProcessRequest(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:scriptTask id="ScriptTask_0oic8cv" name="prepare Update Service Operation progress" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0591ght</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1q8dls4</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def csi= new CheckServiceProcessStatus() +csi.preUpdateOperationProgress(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_1q8dls4" sourceRef="ScriptTask_0oic8cv" targetRef="ServiceTask_1b60rre" /> + <bpmn:serviceTask id="ServiceTask_1b60rre" name="Update Service Operation Status"> + <bpmn:extensionElements> + <camunda:connector> + <camunda:inputOutput> + <camunda:inputParameter name="url">${dbAdapterEndpoint}</camunda:inputParameter> + <camunda:inputParameter name="headers"> + <camunda:map> + <camunda:entry key="content-type">application/soap+xml</camunda:entry> + <camunda:entry key="Authorization">Basic YnBlbDpwYXNzd29yZDEk</camunda:entry> + </camunda:map> + </camunda:inputParameter> + <camunda:inputParameter name="payload">${updateOperationStatus}</camunda:inputParameter> + <camunda:inputParameter name="method">POST</camunda:inputParameter> + <camunda:outputParameter name="CSMF_dbResponseCode">${statusCode}</camunda:outputParameter> + <camunda:outputParameter name="CSMF_dbResponse">${response}</camunda:outputParameter> + </camunda:inputOutput> + <camunda:connectorId>http-connector</camunda:connectorId> + </camunda:connector> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_1q8dls4</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1pxnqsp</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:sequenceFlow id="SequenceFlow_1pxnqsp" sourceRef="ServiceTask_1b60rre" targetRef="ScriptTask_1ao91w3" /> + <bpmn:sequenceFlow id="SequenceFlow_01o92x6" sourceRef="ExclusiveGateway_0gk7p3l" targetRef="ExclusiveGateway_1pdfjh4" /> + <bpmn:exclusiveGateway id="ExclusiveGateway_1pdfjh4" name="isNeedUpdateDB? " default="SequenceFlow_1ktr440"> + <bpmn:incoming>SequenceFlow_01o92x6</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0591ght</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_1ktr440</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:sequenceFlow id="SequenceFlow_0591ght" name="yes" sourceRef="ExclusiveGateway_1pdfjh4" targetRef="ScriptTask_0oic8cv"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{(execution.getVariable("isNeedUpdateDB" ) == true)}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:sequenceFlow id="SequenceFlow_1ktr440" name="no" sourceRef="ExclusiveGateway_1pdfjh4" targetRef="ScriptTask_1ao91w3" /> + </bpmn:process> + <bpmndi:BPMNDiagram id="BPMNDiagram_1"> + <bpmndi:BPMNPlane id="BPMNPlane_1" bpmnElement="CheckServiceProcessStatus"> + <bpmndi:BPMNShape id="_BPMNShape_StartEvent_2" bpmnElement="StartEvent_1"> + <dc:Bounds x="179" y="159" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="156" y="202" width="87" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_1mlave2_di" bpmnElement="ScriptTask_1mlave2"> + <dc:Bounds x="460" y="137" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_0w5fmqn_di" bpmnElement="ServiceTask_0w5fmqn"> + <dc:Bounds x="610" y="137" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_0z37e29_di" bpmnElement="ScriptTask_0z37e29"> + <dc:Bounds x="770" y="137" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ExclusiveGateway_0gk7p3l_di" bpmnElement="ExclusiveGateway_0gk7p3l" isMarkerVisible="true"> + <dc:Bounds x="955" y="152" width="50" height="50" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="944" y="122" width="89" height="40" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_1ao91w3_di" bpmnElement="ScriptTask_1ao91w3"> + <dc:Bounds x="460" y="290" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0e29y0f_di" bpmnElement="SequenceFlow_0e29y0f"> + <di:waypoint x="510" y="290" /> + <di:waypoint x="510" y="217" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0r1x26k_di" bpmnElement="SequenceFlow_0r1x26k"> + <di:waypoint x="560" y="177" /> + <di:waypoint x="610" y="177" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_009p8v1_di" bpmnElement="SequenceFlow_009p8v1"> + <di:waypoint x="710" y="177" /> + <di:waypoint x="770" y="177" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0yws8fh_di" bpmnElement="SequenceFlow_0yws8fh"> + <di:waypoint x="870" y="177" /> + <di:waypoint x="955" y="177" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_18jgpa8_di" bpmnElement="SequenceFlow_18jgpa8"> + <di:waypoint x="1005" y="177" /> + <di:waypoint x="1132" y="177" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1024" y="159" width="17" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="EndEvent_0a3w3xw_di" bpmnElement="EndEvent_0a3w3xw"> + <dc:Bounds x="1132" y="159" width="36" height="36" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1g4lx01_di" bpmnElement="SequenceFlow_1g4lx01"> + <di:waypoint x="215" y="177" /> + <di:waypoint x="270" y="177" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1n5nl53_di" bpmnElement="SequenceFlow_1n5nl53"> + <di:waypoint x="370" y="177" /> + <di:waypoint x="460" y="177" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_1di7x3h_di" bpmnElement="Task_1djj44q"> + <dc:Bounds x="270" y="137" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_0oic8cv_di" bpmnElement="ScriptTask_0oic8cv"> + <dc:Bounds x="930" y="430" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1q8dls4_di" bpmnElement="SequenceFlow_1q8dls4"> + <di:waypoint x="930" y="470" /> + <di:waypoint x="780" y="470" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ServiceTask_1b60rre_di" bpmnElement="ServiceTask_1b60rre"> + <dc:Bounds x="680" y="430" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1pxnqsp_di" bpmnElement="SequenceFlow_1pxnqsp"> + <di:waypoint x="680" y="470" /> + <di:waypoint x="510" y="470" /> + <di:waypoint x="510" y="370" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_01o92x6_di" bpmnElement="SequenceFlow_01o92x6"> + <di:waypoint x="980" y="202" /> + <di:waypoint x="980" y="305" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="964" y="243" width="13" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ExclusiveGateway_1pdfjh4_di" bpmnElement="ExclusiveGateway_1pdfjh4" isMarkerVisible="true"> + <dc:Bounds x="955" y="305" width="50" height="50" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1007" y="310" width="86" height="40" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0591ght_di" bpmnElement="SequenceFlow_0591ght"> + <di:waypoint x="980" y="355" /> + <di:waypoint x="980" y="430" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="987" y="390" width="17" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1ktr440_di" bpmnElement="SequenceFlow_1ktr440"> + <di:waypoint x="955" y="330" /> + <di:waypoint x="560" y="330" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="751" y="312" width="13" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + </bpmndi:BPMNPlane> + </bpmndi:BPMNDiagram> +</bpmn:definitions> diff --git a/bpmn/so-bpmn-infrastructure-flows/src/main/resources/subprocess/DoDeallocateNSSI.bpmn b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/subprocess/DoDeallocateNSSI.bpmn new file mode 100644 index 0000000000..db805ecb92 --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/subprocess/DoDeallocateNSSI.bpmn @@ -0,0 +1,254 @@ +<?xml version="1.0" encoding="UTF-8"?> +<bpmn:definitions xmlns:bpmn="http://www.omg.org/spec/BPMN/20100524/MODEL" xmlns:bpmndi="http://www.omg.org/spec/BPMN/20100524/DI" xmlns:dc="http://www.omg.org/spec/DD/20100524/DC" xmlns:di="http://www.omg.org/spec/DD/20100524/DI" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xmlns:camunda="http://camunda.org/schema/1.0/bpmn" id="Definitions_0884541" targetNamespace="http://bpmn.io/schema/bpmn" exporter="Camunda Modeler" exporterVersion="3.4.1"> + <bpmn:process id="DoDeallocateNSSIV1" name="DoDeallocateNSSIV1" isExecutable="true"> + <bpmn:startEvent id="StartEvent_1" name="start"> + <bpmn:outgoing>SequenceFlow_05jfhy6</bpmn:outgoing> + </bpmn:startEvent> + <bpmn:sequenceFlow id="SequenceFlow_05jfhy6" sourceRef="StartEvent_1" targetRef="Task_1vste9s" /> + <bpmn:scriptTask id="Task_1m8upus" name="Prepare Decompose Service" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0eug5nv</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0wlyy5i</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dnssi= new DoDeallocateNSSI() +dnssi.prepareDecomposeService(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_0wlyy5i" sourceRef="Task_1m8upus" targetRef="Task_1giechg" /> + <bpmn:callActivity id="Task_1giechg" name="Call Decompose Service" calledElement="DecomposeService"> + <bpmn:extensionElements> + <camunda:in source="msoRequestId" target="msoRequestId" /> + <camunda:in source="serviceInstanceId" target="serviceInstanceId" /> + <camunda:in source="serviceModelInfo" target="serviceModelInfo" /> + <camunda:out source="serviceDecomposition" target="serviceDecomposition" /> + <camunda:out source="serviceDecompositionString" target="serviceDecompositionString" /> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0wlyy5i</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1e451y9</bpmn:outgoing> + </bpmn:callActivity> + <bpmn:sequenceFlow id="SequenceFlow_1e451y9" sourceRef="Task_1giechg" targetRef="Task_15ut397" /> + <bpmn:scriptTask id="Task_15ut397" name="processDecomposition" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1e451y9</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1e7o57n</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dnssi= new DoDeallocateNSSI() +dnssi.processDecomposition(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_1e7o57n" sourceRef="Task_15ut397" targetRef="Task_0vi4ijv" /> + <bpmn:scriptTask id="Task_0vi4ijv" name="Send deallocate request to NSSMF" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1e7o57n</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_03b0822</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dnssi= new DoDeallocateNSSI() +dnssi.sendRequestToNSSMF(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_03b0822" sourceRef="Task_0vi4ijv" targetRef="Task_0kl6lcq" /> + <bpmn:scriptTask id="Task_0kl6lcq" name="Query Job Status" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_03b0822</bpmn:incoming> + <bpmn:incoming>SequenceFlow_1anlirk</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1jj0p5q</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dnssi= new DoDeallocateNSSI() +dnssi.getJobStatus(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_1jj0p5q" sourceRef="Task_0kl6lcq" targetRef="ExclusiveGateway_0nhfsui" /> + <bpmn:exclusiveGateway id="ExclusiveGateway_0nhfsui" name="Is deallocate finish?" default="SequenceFlow_0sfh52b"> + <bpmn:incoming>SequenceFlow_1jj0p5q</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0xq380j</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_0sfh52b</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:scriptTask id="Task_13vaezk" name="Delete Slice Profile From AAI" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0xq380j</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1ii5002</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dnssi= new DoDeallocateNSSI() +dnssi.delSliceProfileFromAAI(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:endEvent id="EndEvent_1f579t4" name="end"> + <bpmn:incoming>SequenceFlow_1ii5002</bpmn:incoming> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_1ii5002" sourceRef="Task_13vaezk" targetRef="EndEvent_1f579t4" /> + <bpmn:sequenceFlow id="SequenceFlow_0xq380j" name="yes" sourceRef="ExclusiveGateway_0nhfsui" targetRef="Task_13vaezk"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{(execution.getVariable("isNSSIDeAllocated" ) == true)}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:sequenceFlow id="SequenceFlow_0eug5nv" sourceRef="Task_1vste9s" targetRef="Task_1m8upus" /> + <bpmn:scriptTask id="Task_1vste9s" name="PreProcess Incoming Request" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_05jfhy6</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0eug5nv</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dnssi= new DoDeallocateNSSI() +dnssi.preProcessRequest(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_1anlirk" sourceRef="Task_0fxuz4i" targetRef="Task_0kl6lcq" /> + <bpmn:scriptTask id="Task_0fxuz4i" name="TimeDelay" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1ugva41</bpmn:incoming> + <bpmn:incoming>SequenceFlow_1u66wjs</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1anlirk</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dnssi= new DoDeallocateNSSI() +dnssi.timeDelay(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:serviceTask id="Task_0amt4hu" name="Update Service Operation Status"> + <bpmn:extensionElements> + <camunda:connector> + <camunda:inputOutput> + <camunda:inputParameter name="url">${dbAdapterEndpoint}</camunda:inputParameter> + <camunda:inputParameter name="headers"> + <camunda:map> + <camunda:entry key="content-type">application/soap+xml</camunda:entry> + <camunda:entry key="Authorization">Basic YnBlbDpwYXNzd29yZDEk</camunda:entry> + </camunda:map> + </camunda:inputParameter> + <camunda:inputParameter name="payload">${updateOperationStatus}</camunda:inputParameter> + <camunda:inputParameter name="method">POST</camunda:inputParameter> + <camunda:outputParameter name="DeNSSI_dbResponseCode">${statusCode}</camunda:outputParameter> + <camunda:outputParameter name="DeNSSI_dbResponse">${response}</camunda:outputParameter> + </camunda:inputOutput> + <camunda:connectorId>http-connector</camunda:connectorId> + </camunda:connector> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_04vg0c2</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1ugva41</bpmn:outgoing> + </bpmn:serviceTask> + <bpmn:exclusiveGateway id="ExclusiveGateway_0y0w592" name="IsNeedUpdateDB?" default="SequenceFlow_1u66wjs"> + <bpmn:incoming>SequenceFlow_0sfh52b</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0r95j9m</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_1u66wjs</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:sequenceFlow id="SequenceFlow_0sfh52b" sourceRef="ExclusiveGateway_0nhfsui" targetRef="ExclusiveGateway_0y0w592" /> + <bpmn:sequenceFlow id="SequenceFlow_0r95j9m" sourceRef="ExclusiveGateway_0y0w592" targetRef="Task_1renmzf"> + <bpmn:documentation>#{(execution.getVariable("isNeedUpdateDB" ) == true)}</bpmn:documentation> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{(execution.getVariable("isNeedUpdateDB" ) == true)}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:sequenceFlow id="SequenceFlow_04vg0c2" sourceRef="Task_1renmzf" targetRef="Task_0amt4hu" /> + <bpmn:sequenceFlow id="SequenceFlow_1ugva41" sourceRef="Task_0amt4hu" targetRef="Task_0fxuz4i" /> + <bpmn:sequenceFlow id="SequenceFlow_1u66wjs" sourceRef="ExclusiveGateway_0y0w592" targetRef="Task_0fxuz4i" /> + <bpmn:scriptTask id="Task_1renmzf" name="Prepare Update Operation Status" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0r95j9m</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_04vg0c2</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def dnssi= new DoDeallocateNSSI() +dnssi.handleJobStatus(execution)</bpmn:script> + </bpmn:scriptTask> + </bpmn:process> + <bpmndi:BPMNDiagram id="BPMNDiagram_1"> + <bpmndi:BPMNPlane id="BPMNPlane_1" bpmnElement="DoDeallocateNSSIV1"> + <bpmndi:BPMNShape id="_BPMNShape_StartEvent_2" bpmnElement="StartEvent_1"> + <dc:Bounds x="192" y="112" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="199" y="155" width="22" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_05jfhy6_di" bpmnElement="SequenceFlow_05jfhy6"> + <di:waypoint x="228" y="130" /> + <di:waypoint x="310" y="130" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_159g5ey_di" bpmnElement="Task_1m8upus"> + <dc:Bounds x="490" y="90" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0wlyy5i_di" bpmnElement="SequenceFlow_0wlyy5i"> + <di:waypoint x="590" y="130" /> + <di:waypoint x="660" y="130" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="CallActivity_1ep4ama_di" bpmnElement="Task_1giechg"> + <dc:Bounds x="660" y="90" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1e451y9_di" bpmnElement="SequenceFlow_1e451y9"> + <di:waypoint x="760" y="130" /> + <di:waypoint x="820" y="130" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_1yt5s46_di" bpmnElement="Task_15ut397"> + <dc:Bounds x="820" y="90" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1e7o57n_di" bpmnElement="SequenceFlow_1e7o57n"> + <di:waypoint x="920" y="130" /> + <di:waypoint x="970" y="130" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_16dxpvz_di" bpmnElement="Task_0vi4ijv"> + <dc:Bounds x="970" y="90" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_03b0822_di" bpmnElement="SequenceFlow_03b0822"> + <di:waypoint x="1070" y="130" /> + <di:waypoint x="1120" y="130" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_0arl3j9_di" bpmnElement="Task_0kl6lcq"> + <dc:Bounds x="1120" y="90" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1jj0p5q_di" bpmnElement="SequenceFlow_1jj0p5q"> + <di:waypoint x="1220" y="130" /> + <di:waypoint x="1505" y="130" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ExclusiveGateway_0nhfsui_di" bpmnElement="ExclusiveGateway_0nhfsui" isMarkerVisible="true"> + <dc:Bounds x="1505" y="105" width="50" height="50" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1501" y="75" width="63" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_1rfdrw3_di" bpmnElement="Task_13vaezk"> + <dc:Bounds x="1690" y="90" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_1f579t4_di" bpmnElement="EndEvent_1f579t4"> + <dc:Bounds x="1862" y="112" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1871" y="155" width="19" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1ii5002_di" bpmnElement="SequenceFlow_1ii5002"> + <di:waypoint x="1790" y="130" /> + <di:waypoint x="1862" y="130" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0xq380j_di" bpmnElement="SequenceFlow_0xq380j"> + <di:waypoint x="1555" y="130" /> + <di:waypoint x="1690" y="130" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1614" y="112" width="17" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0eug5nv_di" bpmnElement="SequenceFlow_0eug5nv"> + <di:waypoint x="410" y="130" /> + <di:waypoint x="490" y="130" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_1dytya8_di" bpmnElement="Task_1vste9s"> + <dc:Bounds x="310" y="90" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1anlirk_di" bpmnElement="SequenceFlow_1anlirk"> + <di:waypoint x="1170" y="190" /> + <di:waypoint x="1170" y="170" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_0a4zalz_di" bpmnElement="Task_0fxuz4i"> + <dc:Bounds x="1120" y="190" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ServiceTask_0vegqix_di" bpmnElement="Task_0amt4hu"> + <dc:Bounds x="1280" y="300" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ExclusiveGateway_0y0w592_di" bpmnElement="ExclusiveGateway_0y0w592" isMarkerVisible="true"> + <dc:Bounds x="1505" y="205" width="50" height="50" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1567" y="216" width="86" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0sfh52b_di" bpmnElement="SequenceFlow_0sfh52b"> + <di:waypoint x="1530" y="155" /> + <di:waypoint x="1530" y="205" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0r95j9m_di" bpmnElement="SequenceFlow_0r95j9m"> + <di:waypoint x="1530" y="255" /> + <di:waypoint x="1530" y="300" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_04vg0c2_di" bpmnElement="SequenceFlow_04vg0c2"> + <di:waypoint x="1480" y="340" /> + <di:waypoint x="1380" y="340" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1ugva41_di" bpmnElement="SequenceFlow_1ugva41"> + <di:waypoint x="1280" y="340" /> + <di:waypoint x="1170" y="340" /> + <di:waypoint x="1170" y="270" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1u66wjs_di" bpmnElement="SequenceFlow_1u66wjs"> + <di:waypoint x="1505" y="230" /> + <di:waypoint x="1220" y="230" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_10pw6ot_di" bpmnElement="Task_1renmzf"> + <dc:Bounds x="1480" y="300" width="100" height="80" /> + </bpmndi:BPMNShape> + </bpmndi:BPMNPlane> + </bpmndi:BPMNDiagram> +</bpmn:definitions> diff --git a/bpmn/so-bpmn-infrastructure-flows/src/main/resources/subprocess/DoDeleteSliceService.bpmn b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/subprocess/DoDeleteSliceService.bpmn new file mode 100644 index 0000000000..5f4816e78f --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/subprocess/DoDeleteSliceService.bpmn @@ -0,0 +1,205 @@ +<?xml version="1.0" encoding="UTF-8"?> +<bpmn:definitions xmlns:bpmn="http://www.omg.org/spec/BPMN/20100524/MODEL" xmlns:bpmndi="http://www.omg.org/spec/BPMN/20100524/DI" xmlns:dc="http://www.omg.org/spec/DD/20100524/DC" xmlns:di="http://www.omg.org/spec/DD/20100524/DI" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xmlns:camunda="http://camunda.org/schema/1.0/bpmn" id="Definitions_1p1suc9" targetNamespace="http://bpmn.io/schema/bpmn" exporter="Camunda Modeler" exporterVersion="3.4.1"> + <bpmn:process id="DoDeleteSliceServiceV1" name="DoDeleteSliceServiceV1" isExecutable="true"> + <bpmn:startEvent id="StartEvent_1" name="start"> + <bpmn:outgoing>SequenceFlow_0ep5het</bpmn:outgoing> + </bpmn:startEvent> + <bpmn:sequenceFlow id="SequenceFlow_0ep5het" sourceRef="StartEvent_1" targetRef="Task_0etki1p" /> + <bpmn:sequenceFlow id="SequenceFlow_1qkgvvu" sourceRef="Task_1ujnqtj" targetRef="Task_1fqiyb4" /> + <bpmn:sequenceFlow id="SequenceFlow_1rgfzzy" sourceRef="Task_1fqiyb4" targetRef="Task_1u755sr" /> + <bpmn:scriptTask id="Task_1ujnqtj" name="Query Allotted Resource From AAI" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_029u1wr</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1qkgvvu</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def ddss= new DoDeleteSliceService() +ddss.getAllottedResFromAAI(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:scriptTask id="Task_1fqiyb4" name="Query NSI From AAI" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1qkgvvu</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1rgfzzy</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def ddss= new DoDeleteSliceService() +ddss.getNSIFromAAI(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:scriptTask id="Task_1u755sr" name="Query NSSI List From AAI" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_1rgfzzy</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_05si1me</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def ddss= new DoDeleteSliceService() +ddss.getNSSIListFromAAI(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_05si1me" sourceRef="Task_1u755sr" targetRef="Task_1iomfas" /> + <bpmn:exclusiveGateway id="ExclusiveGateway_1ogbunu" name="Is all NSSI finished?"> + <bpmn:incoming>SequenceFlow_15z9iio</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_1c4fjbv</bpmn:outgoing> + <bpmn:outgoing>SequenceFlow_0926ghe</bpmn:outgoing> + </bpmn:exclusiveGateway> + <bpmn:endEvent id="EndEvent_0jaitqv" name="End"> + <bpmn:incoming>SequenceFlow_1c4fjbv</bpmn:incoming> + </bpmn:endEvent> + <bpmn:sequenceFlow id="SequenceFlow_1c4fjbv" name="yes" sourceRef="ExclusiveGateway_1ogbunu" targetRef="EndEvent_0jaitqv"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{(execution.getVariable("isAllNSSIFinished" ) == true)}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:sequenceFlow id="SequenceFlow_01o2qpv" sourceRef="Task_1iomfas" targetRef="Task_1qqljvu" /> + <bpmn:sequenceFlow id="SequenceFlow_0c58sw3" sourceRef="Task_1rc7mcw" targetRef="ScriptTask_159855t" /> + <bpmn:sequenceFlow id="SequenceFlow_0926ghe" name="no" sourceRef="ExclusiveGateway_1ogbunu" targetRef="Task_1iomfas"> + <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{(execution.getVariable("isAllNSSIFinished" ) == false)}</bpmn:conditionExpression> + </bpmn:sequenceFlow> + <bpmn:scriptTask id="Task_0etki1p" name="PreProcess Incoming Request" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0ep5het</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0npmman</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def ddss= new DoDeleteSliceService() +ddss.preProcessRequest(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_0npmman" sourceRef="Task_0etki1p" targetRef="Task_13k9usx" /> + <bpmn:scriptTask id="Task_1iomfas" name="Get Current NSSI" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0926ghe</bpmn:incoming> + <bpmn:incoming>SequenceFlow_05si1me</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_01o2qpv</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def ddss= new DoDeleteSliceService() +ddss.getCurrentNSSI(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:scriptTask id="ScriptTask_159855t" name="Parse Next NSSI" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0c58sw3</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_15z9iio</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def ddss= new DoDeleteSliceService() +ddss.parseNextNSSI(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_15z9iio" sourceRef="ScriptTask_159855t" targetRef="ExclusiveGateway_1ogbunu" /> + <bpmn:sequenceFlow id="SequenceFlow_0q83qg3" sourceRef="Task_1qqljvu" targetRef="Task_1rc7mcw" /> + <bpmn:scriptTask id="Task_1qqljvu" name="Query Slice Profile From AAI" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_01o2qpv</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0q83qg3</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def ddss= new DoDeleteSliceService() +ddss.querySliceProfileFromAAI(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:sequenceFlow id="SequenceFlow_029u1wr" sourceRef="Task_13k9usx" targetRef="Task_1ujnqtj" /> + <bpmn:scriptTask id="Task_13k9usx" name="Query E2ESlice Serive From AAI" scriptFormat="groovy"> + <bpmn:incoming>SequenceFlow_0npmman</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_029u1wr</bpmn:outgoing> + <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.* +def ddss= new DoDeleteSliceService() +ddss.queryE2ESliceSeriveFromAAI(execution)</bpmn:script> + </bpmn:scriptTask> + <bpmn:callActivity id="Task_1rc7mcw" name="Do Deallocate NSSI " calledElement="DoDeallocateNSSIV1"> + <bpmn:extensionElements> + <camunda:in source="currentNSSI" target="currentNSSI" /> + <camunda:in source="msoRequestId" target="msoRequestId" /> + <camunda:in source="serviceModelInfo" target="serviceModelInfo" /> + <camunda:in source="serviceInstanceId" target="serviceInstanceId" /> + <camunda:out source="WorkflowException" target="WorkflowException" /> + </bpmn:extensionElements> + <bpmn:incoming>SequenceFlow_0q83qg3</bpmn:incoming> + <bpmn:outgoing>SequenceFlow_0c58sw3</bpmn:outgoing> + </bpmn:callActivity> + </bpmn:process> + <bpmndi:BPMNDiagram id="BPMNDiagram_1"> + <bpmndi:BPMNPlane id="BPMNPlane_1" bpmnElement="DoDeleteSliceServiceV1"> + <bpmndi:BPMNShape id="_BPMNShape_StartEvent_2" bpmnElement="StartEvent_1"> + <dc:Bounds x="152" y="122" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="159" y="165" width="22" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0ep5het_di" bpmnElement="SequenceFlow_0ep5het"> + <di:waypoint x="188" y="140" /> + <di:waypoint x="270" y="140" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1qkgvvu_di" bpmnElement="SequenceFlow_1qkgvvu"> + <di:waypoint x="700" y="140" /> + <di:waypoint x="750" y="140" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_1rgfzzy_di" bpmnElement="SequenceFlow_1rgfzzy"> + <di:waypoint x="850" y="140" /> + <di:waypoint x="900" y="140" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_1bj6tw4_di" bpmnElement="Task_1ujnqtj"> + <dc:Bounds x="600" y="100" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_0xgmbqj_di" bpmnElement="Task_1fqiyb4"> + <dc:Bounds x="750" y="100" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_01fp1vt_di" bpmnElement="Task_1u755sr"> + <dc:Bounds x="900" y="100" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_05si1me_di" bpmnElement="SequenceFlow_05si1me"> + <di:waypoint x="1000" y="140" /> + <di:waypoint x="1040" y="140" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ExclusiveGateway_1ogbunu_di" bpmnElement="ExclusiveGateway_1ogbunu" isMarkerVisible="true"> + <dc:Bounds x="1555" y="115" width="50" height="50" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1560" y="85" width="52" height="27" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="EndEvent_0jaitqv_di" bpmnElement="EndEvent_0jaitqv"> + <dc:Bounds x="1692" y="122" width="36" height="36" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1700" y="168" width="20" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_1c4fjbv_di" bpmnElement="SequenceFlow_1c4fjbv"> + <di:waypoint x="1605" y="140" /> + <di:waypoint x="1692" y="140" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1630" y="118" width="17" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_01o2qpv_di" bpmnElement="SequenceFlow_01o2qpv"> + <di:waypoint x="1140" y="140" /> + <di:waypoint x="1170" y="140" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0c58sw3_di" bpmnElement="SequenceFlow_0c58sw3"> + <di:waypoint x="1400" y="140" /> + <di:waypoint x="1420" y="140" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0926ghe_di" bpmnElement="SequenceFlow_0926ghe"> + <di:waypoint x="1580" y="165" /> + <di:waypoint x="1580" y="260" /> + <di:waypoint x="1090" y="260" /> + <di:waypoint x="1090" y="180" /> + <bpmndi:BPMNLabel> + <dc:Bounds x="1329" y="242" width="13" height="14" /> + </bpmndi:BPMNLabel> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_0icszw6_di" bpmnElement="Task_0etki1p"> + <dc:Bounds x="270" y="100" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_0npmman_di" bpmnElement="SequenceFlow_0npmman"> + <di:waypoint x="370" y="140" /> + <di:waypoint x="430" y="140" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_1obnwrr_di" bpmnElement="Task_1iomfas"> + <dc:Bounds x="1040" y="100" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="ScriptTask_159855t_di" bpmnElement="ScriptTask_159855t"> + <dc:Bounds x="1420" y="100" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_15z9iio_di" bpmnElement="SequenceFlow_15z9iio"> + <di:waypoint x="1520" y="140" /> + <di:waypoint x="1555" y="140" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNEdge id="SequenceFlow_0q83qg3_di" bpmnElement="SequenceFlow_0q83qg3"> + <di:waypoint x="1270" y="140" /> + <di:waypoint x="1300" y="140" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_0y9ppnc_di" bpmnElement="Task_1qqljvu"> + <dc:Bounds x="1170" y="100" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNEdge id="SequenceFlow_029u1wr_di" bpmnElement="SequenceFlow_029u1wr"> + <di:waypoint x="530" y="140" /> + <di:waypoint x="600" y="140" /> + </bpmndi:BPMNEdge> + <bpmndi:BPMNShape id="ScriptTask_0f9rjq4_di" bpmnElement="Task_13k9usx"> + <dc:Bounds x="430" y="100" width="100" height="80" /> + </bpmndi:BPMNShape> + <bpmndi:BPMNShape id="CallActivity_18qkiat_di" bpmnElement="Task_1rc7mcw"> + <dc:Bounds x="1300" y="100" width="100" height="80" /> + </bpmndi:BPMNShape> + </bpmndi:BPMNPlane> + </bpmndi:BPMNDiagram> +</bpmn:definitions> diff --git a/bpmn/so-bpmn-infrastructure-flows/src/test/java/org/onap/so/bpmn/infrastructure/process/CreateVcpeResCustServiceSimplifiedTest.java b/bpmn/so-bpmn-infrastructure-flows/src/test/java/org/onap/so/bpmn/infrastructure/process/CreateVcpeResCustServiceSimplifiedTest.java index aea06b5fc9..d426dc3f66 100644 --- a/bpmn/so-bpmn-infrastructure-flows/src/test/java/org/onap/so/bpmn/infrastructure/process/CreateVcpeResCustServiceSimplifiedTest.java +++ b/bpmn/so-bpmn-infrastructure-flows/src/test/java/org/onap/so/bpmn/infrastructure/process/CreateVcpeResCustServiceSimplifiedTest.java @@ -20,22 +20,9 @@ package org.onap.so.bpmn.infrastructure.process; -import static com.github.tomakehurst.wiremock.client.WireMock.get; -import static com.github.tomakehurst.wiremock.client.WireMock.ok; -import static com.github.tomakehurst.wiremock.client.WireMock.okJson; -import static com.github.tomakehurst.wiremock.client.WireMock.post; -import static com.github.tomakehurst.wiremock.client.WireMock.put; -import static com.github.tomakehurst.wiremock.client.WireMock.urlEqualTo; -import static com.github.tomakehurst.wiremock.client.WireMock.urlPathMatching; -import static org.assertj.core.api.Assertions.assertThat; -import static org.assertj.core.api.Assertions.fail; -import static org.camunda.bpm.engine.test.assertions.bpmn.BpmnAwareAssertions.assertThat; -import java.io.IOException; -import java.util.List; -import java.util.UUID; +import com.google.protobuf.Struct; import org.camunda.bpm.engine.runtime.ProcessInstance; import org.junit.Before; -import org.junit.Ignore; import org.junit.Test; import org.onap.ccsdk.cds.controllerblueprints.common.api.ActionIdentifiers; import org.onap.ccsdk.cds.controllerblueprints.common.api.CommonHeader; @@ -47,7 +34,21 @@ import org.onap.so.client.aai.AAIVersion; import org.slf4j.Logger; import org.slf4j.LoggerFactory; import org.springframework.beans.factory.annotation.Autowired; -import com.google.protobuf.Struct; +import java.io.IOException; +import java.util.HashMap; +import java.util.List; +import java.util.Map; +import java.util.UUID; +import static com.github.tomakehurst.wiremock.client.WireMock.okJson; +import static com.github.tomakehurst.wiremock.client.WireMock.get; +import static com.github.tomakehurst.wiremock.client.WireMock.put; +import static com.github.tomakehurst.wiremock.client.WireMock.post; +import static com.github.tomakehurst.wiremock.client.WireMock.urlEqualTo; +import static com.github.tomakehurst.wiremock.client.WireMock.ok; +import static com.github.tomakehurst.wiremock.client.WireMock.urlPathMatching; +import static org.assertj.core.api.Assertions.assertThat; +import static org.assertj.core.api.Assertions.fail; +import static org.camunda.bpm.engine.test.assertions.bpmn.BpmnAwareAssertions.assertThat; /** @@ -62,10 +63,10 @@ public class CreateVcpeResCustServiceSimplifiedTest extends BaseBPMNTest { private static final String TEST_PROCESSINSTANCE_KEY = "CreateVcpeResCustService_simplified"; private static final AAIVersion VERSION = AAIVersion.LATEST; + private static final Map<String, Object> executionVariables = new HashMap(); private String testBusinessKey; private String requestObject; private String responseObject; - private String msoRequestId; @Autowired private GrpcNettyServer grpcNettyServer; @@ -76,25 +77,25 @@ public class CreateVcpeResCustServiceSimplifiedTest extends BaseBPMNTest { requestObject = FileUtil.readResourceFile("request/" + getClass().getSimpleName() + ".json"); responseObject = FileUtil.readResourceFile("response/" + getClass().getSimpleName() + ".json"); - variables.put("bpmnRequest", requestObject); + executionVariables.clear(); + + executionVariables.put("bpmnRequest", requestObject); /** * This variable indicates that the flow was invoked asynchronously. It's injected by {@link WorkflowProcessor}. */ - variables.put("isAsyncProcess", "true"); + executionVariables.put("isAsyncProcess", "true"); /** * Temporary solution to add pnfCorrelationId to context. this value is getting from the request to SO api * handler and then convert to CamudaInput */ - variables.put("pnfCorrelationId", "PNFDemo"); + executionVariables.put("pnfCorrelationId", "PNFDemo"); /** * Create mso-request-id. */ - msoRequestId = UUID.randomUUID().toString(); - variables.put("mso-request-id", msoRequestId); /** * Create Business key for the process instance @@ -113,8 +114,11 @@ public class CreateVcpeResCustServiceSimplifiedTest extends BaseBPMNTest { mockAai(); mockDmaapForPnf(); + final String msoRequestId = UUID.randomUUID().toString(); + executionVariables.put("mso-request-id", msoRequestId); + ProcessInstance pi = - runtimeService.startProcessInstanceByKey(TEST_PROCESSINSTANCE_KEY, testBusinessKey, variables); + runtimeService.startProcessInstanceByKey(TEST_PROCESSINSTANCE_KEY, testBusinessKey, executionVariables); int waitCount = 10; while (!isProcessInstanceEnded() && waitCount >= 0) { @@ -129,14 +133,24 @@ public class CreateVcpeResCustServiceSimplifiedTest extends BaseBPMNTest { "callCompleteMsoProcess_CallActivity", "ScriptTask_2", "CreateVCPE_EndEvent"); List<ExecutionServiceInput> detailedMessages = grpcNettyServer.getDetailedMessages(); - assertThat(detailedMessages).hasSize(2); + assertThat(detailedMessages.size() == 2); + int count = 0; try { - checkConfigAssign(detailedMessages.get(0)); - checkConfigDeploy(detailedMessages.get(1)); + for (ExecutionServiceInput eSI : detailedMessages) { + if ("config-assign".equals(eSI.getActionIdentifiers().getActionName())) { + checkConfigAssign(eSI, msoRequestId); + count++; + } + if ("config-deploy".equals(eSI.getActionIdentifiers().getActionName())) { + checkConfigDeploy(eSI, msoRequestId); + count++; + } + } } catch (Exception e) { e.printStackTrace(); fail("ConfigAssign/deploy request exception", e); } + assertThat(count == 2); } private boolean isProcessInstanceEnded() { @@ -144,7 +158,7 @@ public class CreateVcpeResCustServiceSimplifiedTest extends BaseBPMNTest { .singleResult() == null; } - private void checkConfigAssign(ExecutionServiceInput executionServiceInput) { + private void checkConfigAssign(ExecutionServiceInput executionServiceInput, String msoRequestId) { logger.info("Checking the configAssign request"); ActionIdentifiers actionIdentifiers = executionServiceInput.getActionIdentifiers(); @@ -175,7 +189,7 @@ public class CreateVcpeResCustServiceSimplifiedTest extends BaseBPMNTest { .isEqualTo("68dc9a92-214c-11e7-93ae-92361f002680"); } - private void checkConfigDeploy(ExecutionServiceInput executionServiceInput) { + private void checkConfigDeploy(ExecutionServiceInput executionServiceInput, String msoRequestId) { logger.info("Checking the configDeploy request"); ActionIdentifiers actionIdentifiers = executionServiceInput.getActionIdentifiers(); diff --git a/bpmn/so-bpmn-infrastructure-flows/src/test/java/org/onap/so/bpmn/infrastructure/process/PNFSWUPDownloadTest.java b/bpmn/so-bpmn-infrastructure-flows/src/test/java/org/onap/so/bpmn/infrastructure/process/PNFSWUPDownloadTest.java new file mode 100644 index 0000000000..065d2a54a8 --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-flows/src/test/java/org/onap/so/bpmn/infrastructure/process/PNFSWUPDownloadTest.java @@ -0,0 +1,230 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix Foundation. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ + +package org.onap.so.bpmn.infrastructure.process; + +import com.google.protobuf.Struct; +import org.assertj.core.api.Assertions; +import org.camunda.bpm.engine.runtime.ProcessInstance; +import org.junit.Before; +import org.junit.Test; +import org.onap.ccsdk.cds.controllerblueprints.common.api.ActionIdentifiers; +import org.onap.ccsdk.cds.controllerblueprints.common.api.CommonHeader; +import org.onap.ccsdk.cds.controllerblueprints.processing.api.ExecutionServiceInput; +import org.onap.so.BaseBPMNTest; +import org.onap.so.GrpcNettyServer; +import org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames; +import org.onap.so.bpmn.mock.FileUtil; +import org.onap.so.client.aai.AAIVersion; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import java.io.IOException; +import java.util.HashMap; +import java.util.List; +import java.util.Map; +import java.util.UUID; +import static com.github.tomakehurst.wiremock.client.WireMock.okJson; +import static com.github.tomakehurst.wiremock.client.WireMock.get; +import static com.github.tomakehurst.wiremock.client.WireMock.put; +import static com.github.tomakehurst.wiremock.client.WireMock.urlEqualTo; +import static org.assertj.core.api.Assertions.fail; +import static org.camunda.bpm.engine.test.assertions.bpmn.BpmnAwareAssertions.assertThat; + +/** + * Basic Integration test for PNFSWUPDownloadTest.bpmn workflow. + */ +public class PNFSWUPDownloadTest extends BaseBPMNTest { + + private final Logger logger = LoggerFactory.getLogger(getClass()); + + private static final long WORKFLOW_WAIT_TIME = 1000L; + + private static final String TEST_PROCESSINSTANCE_KEY = "PNFSWUPDownload"; + private static final AAIVersion VERSION = AAIVersion.LATEST; + private static final Map<String, Object> executionVariables = new HashMap(); + private final String[] actionNames = new String[3]; + private String responseObject; + private String requestObject; + + @Autowired + private GrpcNettyServer grpcNettyServer; + + @Before + public void setUp() throws IOException { + + actionNames[0] = "preCheck"; + actionNames[1] = "downloadNESw"; + actionNames[2] = "postCheck"; + + executionVariables.clear(); + + requestObject = FileUtil.readResourceFile("request/PNFSoftwareUpgradeTest.json"); + responseObject = FileUtil.readResourceFile("response/PNFSoftwareUpgradeTest.json"); + + executionVariables.put("bpmnRequest", requestObject); + + /** + * This variable indicates that the flow was invoked asynchronously. It's injected by {@link WorkflowProcessor}. + */ + executionVariables.put("isAsyncProcess", "true"); + executionVariables.put(ExecutionVariableNames.PRC_CUSTOMIZATION_UUID, "38dc9a92-214c-11e7-93ae-92361f002680"); + + /** + * Temporary solution to add pnfCorrelationId to context. this value is getting from the request to SO api + * handler and then convert to CamudaInput + */ + executionVariables.put(ExecutionVariableNames.PNF_CORRELATION_ID, "PNFDemo"); + } + + + @Test + public void workflow_validInput_expectedOutput() throws InterruptedException { + + mockCatalogDb(); + mockAai(); + + final String msoRequestId = UUID.randomUUID().toString(); + executionVariables.put(ExecutionVariableNames.MSO_REQUEST_ID, msoRequestId); + + final String testBusinessKey = UUID.randomUUID().toString(); + logger.info("Test the process instance: {} with business key: {}", TEST_PROCESSINSTANCE_KEY, testBusinessKey); + + ProcessInstance pi = + runtimeService.startProcessInstanceByKey(TEST_PROCESSINSTANCE_KEY, testBusinessKey, executionVariables); + + int waitCount = 10; + while (!isProcessInstanceEnded() && waitCount >= 0) { + Thread.sleep(WORKFLOW_WAIT_TIME); + waitCount--; + } + + // Layout is to reflect the bpmn visual layout + assertThat(pi).isEnded().hasPassedInOrder("download_StartEvent", "ServiceTask_1mpt2eq", "ServiceTask_1nl90ao", + "ExclusiveGateway_1rj84ne", "ServiceTask_0yavde3", "ExclusiveGateway_1ja7grm", "ServiceTask_1wxo7xz", + "ExclusiveGateway_08lusga", "download_EndEvent"); + + List<ExecutionServiceInput> detailedMessages = grpcNettyServer.getDetailedMessages(); + assertThat(detailedMessages.size() == 3); + int count = 0; + try { + for (ExecutionServiceInput eSI : detailedMessages) { + for (String action : actionNames) { + if (action.equals(eSI.getActionIdentifiers().getActionName()) + && eSI.getCommonHeader().getRequestId().equals(msoRequestId)) { + checkWithActionName(eSI, action, msoRequestId); + count++; + } + } + } + } catch (Exception e) { + e.printStackTrace(); + fail("PNFSWUPDownload request exception", e); + } + assertThat(count == actionNames.length); + } + + private boolean isProcessInstanceEnded() { + return runtimeService.createProcessInstanceQuery().processDefinitionKey(TEST_PROCESSINSTANCE_KEY) + .singleResult() == null; + } + + private void checkWithActionName(ExecutionServiceInput executionServiceInput, String action, String msoRequestId) { + + logger.info("Checking the " + action + " request"); + ActionIdentifiers actionIdentifiers = executionServiceInput.getActionIdentifiers(); + + /** + * the fields of actionIdentifiers should match the one in the response/PNFSoftwareUpgrade_catalogdb.json. + */ + Assertions.assertThat(actionIdentifiers.getBlueprintName()).isEqualTo("test_pnf_software_upgrade_restconf"); + Assertions.assertThat(actionIdentifiers.getBlueprintVersion()).isEqualTo("1.0.0"); + Assertions.assertThat(actionIdentifiers.getActionName()).isEqualTo(action); + Assertions.assertThat(actionIdentifiers.getMode()).isEqualTo("async"); + + CommonHeader commonHeader = executionServiceInput.getCommonHeader(); + Assertions.assertThat(commonHeader.getOriginatorId()).isEqualTo("SO"); + Assertions.assertThat(commonHeader.getRequestId()).isEqualTo(msoRequestId); + + Struct payload = executionServiceInput.getPayload(); + Struct requeststruct = payload.getFieldsOrThrow(action + "-request").getStructValue(); + + Assertions.assertThat(requeststruct.getFieldsOrThrow("resolution-key").getStringValue()).isEqualTo("PNFDemo"); + Struct propertiesStruct = requeststruct.getFieldsOrThrow(action + "-properties").getStructValue(); + + Assertions.assertThat(propertiesStruct.getFieldsOrThrow("pnf-name").getStringValue()).isEqualTo("PNFDemo"); + Assertions.assertThat(propertiesStruct.getFieldsOrThrow("service-model-uuid").getStringValue()) + .isEqualTo("32daaac6-5017-4e1e-96c8-6a27dfbe1421"); + Assertions.assertThat(propertiesStruct.getFieldsOrThrow("pnf-customization-uuid").getStringValue()) + .isEqualTo("38dc9a92-214c-11e7-93ae-92361f002680"); + Assertions.assertThat(propertiesStruct.getFieldsOrThrow("target-software-version").getStringValue()) + .isEqualTo("demo-sw-ver2.0.0"); + } + + private void mockAai() { + + String aaiPnfEntry = + "{ \n" + " \"pnf-name\":\"PNFDemo\",\n" + " \"pnf-id\":\"testtest\",\n" + " \"in-maint\":true,\n" + + " \"resource-version\":\"1541720264047\",\n" + " \"swVersion\":\"demo-1.1\",\n" + + " \"ipaddress-v4-oam\":\"1.1.1.1\",\n" + " \"ipaddress-v6-oam\":\"::/128\"\n" + "}"; + + /** + * PUT the PNF correlation ID to AAI. + */ + wireMockServer.stubFor(put(urlEqualTo("/aai/" + VERSION + "/network/pnfs/pnf/PNFDemo"))); + + /** + * Get the PNF entry from AAI. + */ + wireMockServer.stubFor( + get(urlEqualTo("/aai/" + VERSION + "/network/pnfs/pnf/PNFDemo")).willReturn(okJson(aaiPnfEntry))); + } + + /** + * Mock the catalobdb rest interface. + */ + private void mockCatalogDb() { + + String catalogdbClientResponse = FileUtil.readResourceFile("response/PNFSoftwareUpgradeTest_catalogdb.json"); + + + /** + * Return valid json for the model UUID in the request file. + */ + wireMockServer + .stubFor(get(urlEqualTo("/v2/serviceResources?serviceModelUuid=32daaac6-5017-4e1e-96c8-6a27dfbe1421")) + .willReturn(okJson(responseObject))); + + /** + * Return valid json for the service model InvariantUUID as specified in the request file. + */ + wireMockServer.stubFor( + get(urlEqualTo("/v2/serviceResources?serviceModelInvariantUuid=339b7a2f-9524-4dbf-9eee-f2e05521df3f")) + .willReturn(okJson(responseObject))); + + /** + * Return valid spring data rest json for the service model UUID as specified in the request file. + */ + wireMockServer.stubFor(get(urlEqualTo( + "/pnfResourceCustomization/search/findPnfResourceCustomizationByModelUuid?SERVICE_MODEL_UUID=32daaac6-5017-4e1e-96c8-6a27dfbe1421")) + .willReturn(okJson(catalogdbClientResponse))); + } + +} diff --git a/bpmn/so-bpmn-infrastructure-flows/src/test/java/org/onap/so/bpmn/infrastructure/process/PNFSoftwareUpgradeTest.java b/bpmn/so-bpmn-infrastructure-flows/src/test/java/org/onap/so/bpmn/infrastructure/process/PNFSoftwareUpgradeTest.java new file mode 100644 index 0000000000..a9bf4352bf --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-flows/src/test/java/org/onap/so/bpmn/infrastructure/process/PNFSoftwareUpgradeTest.java @@ -0,0 +1,236 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix Foundation. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ + +package org.onap.so.bpmn.infrastructure.process; + +import com.google.protobuf.Struct; +import org.camunda.bpm.engine.runtime.ProcessInstance; +import org.junit.Before; +import org.junit.Test; +import org.onap.ccsdk.cds.controllerblueprints.common.api.ActionIdentifiers; +import org.onap.ccsdk.cds.controllerblueprints.common.api.CommonHeader; +import org.onap.ccsdk.cds.controllerblueprints.processing.api.ExecutionServiceInput; +import org.onap.so.BaseBPMNTest; +import org.onap.so.GrpcNettyServer; +import org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames; +import org.onap.so.bpmn.mock.FileUtil; +import org.onap.so.client.aai.AAIVersion; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import java.io.IOException; +import java.util.HashMap; +import java.util.List; +import java.util.Map; +import java.util.UUID; +import static com.github.tomakehurst.wiremock.client.WireMock.okJson; +import static com.github.tomakehurst.wiremock.client.WireMock.get; +import static com.github.tomakehurst.wiremock.client.WireMock.put; +import static com.github.tomakehurst.wiremock.client.WireMock.post; +import static com.github.tomakehurst.wiremock.client.WireMock.urlEqualTo; +import static org.assertj.core.api.Assertions.fail; +import static org.camunda.bpm.engine.test.assertions.bpmn.BpmnAwareAssertions.assertThat; + +/** + * Basic Integration test for PNFSoftwareUpgrade.bpmn workflow. + */ +public class PNFSoftwareUpgradeTest extends BaseBPMNTest { + + private final Logger logger = LoggerFactory.getLogger(getClass()); + + private static final long WORKFLOW_WAIT_TIME = 1000L; + + private static final String TEST_PROCESSINSTANCE_KEY = "PNFSoftwareUpgrade"; + private static final AAIVersion VERSION = AAIVersion.LATEST; + private static final Map<String, Object> executionVariables = new HashMap(); + private final String[] actionNames = new String[4]; + private String requestObject; + private String responseObject; + + @Autowired + private GrpcNettyServer grpcNettyServer; + + @Before + public void setUp() throws IOException { + actionNames[0] = "preCheck"; + actionNames[1] = "downloadNESw"; + actionNames[2] = "activateNESw"; + actionNames[3] = "postCheck"; + + executionVariables.clear(); + + requestObject = FileUtil.readResourceFile("request/" + getClass().getSimpleName() + ".json"); + responseObject = FileUtil.readResourceFile("response/" + getClass().getSimpleName() + ".json"); + + executionVariables.put("bpmnRequest", requestObject); + + /** + * This variable indicates that the flow was invoked asynchronously. It's injected by {@link WorkflowProcessor}. + */ + executionVariables.put("isAsyncProcess", "true"); + executionVariables.put(ExecutionVariableNames.PRC_CUSTOMIZATION_UUID, "38dc9a92-214c-11e7-93ae-92361f002680"); + + /** + * Temporary solution to add pnfCorrelationId to context. this value is getting from the request to SO api + * handler and then convert to CamudaInput + */ + executionVariables.put(ExecutionVariableNames.PNF_CORRELATION_ID, "PNFDemo"); + } + + + @Test + public void workflow_validInput_expectedOutput() throws InterruptedException { + + mockCatalogDb(); + mockAai(); + + final String msoRequestId = UUID.randomUUID().toString(); + executionVariables.put(ExecutionVariableNames.MSO_REQUEST_ID, msoRequestId); + + final String testBusinessKey = UUID.randomUUID().toString(); + logger.info("Test the process instance: {} with business key: {}", TEST_PROCESSINSTANCE_KEY, testBusinessKey); + + ProcessInstance pi = + runtimeService.startProcessInstanceByKey(TEST_PROCESSINSTANCE_KEY, testBusinessKey, executionVariables); + + int waitCount = 10; + while (!isProcessInstanceEnded() && waitCount >= 0) { + Thread.sleep(WORKFLOW_WAIT_TIME); + waitCount--; + } + + // Layout is to reflect the bpmn visual layout + assertThat(pi).isEnded().hasPassedInOrder("softwareUpgrade_startEvent", "ServiceTask_042uz7n", + "ServiceTask_0slpahe", "ExclusiveGateway_0x6h0ni", "ServiceTask_0x5cje8", "ExclusiveGateway_0v3l3wv", + "ServiceTask_02lxf48", "ExclusiveGateway_0ch3fef", "ServiceTask_0y2uysu", "ExclusiveGateway_1ny9b1z", + "softwareUpgrade_endEvent"); + + List<ExecutionServiceInput> detailedMessages = grpcNettyServer.getDetailedMessages(); + assertThat(detailedMessages.size() == 4); + int count = 0; + try { + for (ExecutionServiceInput eSI : detailedMessages) { + for (String action : actionNames) { + if (action.equals(eSI.getActionIdentifiers().getActionName()) + && eSI.getCommonHeader().getRequestId().equals(msoRequestId)) { + checkWithActionName(eSI, action); + count++; + } + } + } + } catch (Exception e) { + e.printStackTrace(); + fail("PNFSoftwareUpgrade request exception", e); + } + assertThat(count == actionNames.length); + } + + private boolean isProcessInstanceEnded() { + return runtimeService.createProcessInstanceQuery().processDefinitionKey(TEST_PROCESSINSTANCE_KEY) + .singleResult() == null; + } + + private void checkWithActionName(ExecutionServiceInput executionServiceInput, String action) { + + logger.info("Checking the " + action + " request"); + ActionIdentifiers actionIdentifiers = executionServiceInput.getActionIdentifiers(); + + /** + * the fields of actionIdentifiers should match the one in the response/PNFSoftwareUpgrade_catalogdb.json. + */ + assertThat(actionIdentifiers.getBlueprintName()).isEqualTo("test_pnf_software_upgrade_restconf"); + assertThat(actionIdentifiers.getBlueprintVersion()).isEqualTo("1.0.0"); + assertThat(actionIdentifiers.getActionName()).isEqualTo(action); + assertThat(actionIdentifiers.getMode()).isEqualTo("async"); + + CommonHeader commonHeader = executionServiceInput.getCommonHeader(); + assertThat(commonHeader.getOriginatorId()).isEqualTo("SO"); + + Struct payload = executionServiceInput.getPayload(); + Struct requeststruct = payload.getFieldsOrThrow(action + "-request").getStructValue(); + + assertThat(requeststruct.getFieldsOrThrow("resolution-key").getStringValue()).isEqualTo("PNFDemo"); + Struct propertiesStruct = requeststruct.getFieldsOrThrow(action + "-properties").getStructValue(); + + assertThat(propertiesStruct.getFieldsOrThrow("pnf-name").getStringValue()).isEqualTo("PNFDemo"); + assertThat(propertiesStruct.getFieldsOrThrow("service-model-uuid").getStringValue()) + .isEqualTo("32daaac6-5017-4e1e-96c8-6a27dfbe1421"); + assertThat(propertiesStruct.getFieldsOrThrow("pnf-customization-uuid").getStringValue()) + .isEqualTo("38dc9a92-214c-11e7-93ae-92361f002680"); + assertThat(propertiesStruct.getFieldsOrThrow("target-software-version").getStringValue()) + .isEqualTo("demo-sw-ver2.0.0"); + } + + private void mockAai() { + + String aaiPnfEntry = + "{ \n" + " \"pnf-name\":\"PNFDemo\",\n" + " \"pnf-id\":\"testtest\",\n" + " \"in-maint\":true,\n" + + " \"resource-version\":\"1541720264047\",\n" + " \"swVersion\":\"demo-1.1\",\n" + + " \"ipaddress-v4-oam\":\"1.1.1.1\",\n" + " \"ipaddress-v6-oam\":\"::/128\"\n" + "}"; + + /** + * PUT the PNF correlation ID to AAI. + */ + wireMockServer.stubFor(put(urlEqualTo("/aai/" + VERSION + "/network/pnfs/pnf/PNFDemo"))); + + /** + * Get the PNF entry from AAI. + */ + wireMockServer.stubFor( + get(urlEqualTo("/aai/" + VERSION + "/network/pnfs/pnf/PNFDemo")).willReturn(okJson(aaiPnfEntry))); + + /* + * Post the pnf to AAI + */ + wireMockServer.stubFor(post(urlEqualTo("/aai/" + VERSION + "/network/pnfs/pnf/PNFDemo"))); + } + + /** + * Mock the catalobdb rest interface. + */ + private void mockCatalogDb() { + + String catalogdbClientResponse = + FileUtil.readResourceFile("response/" + getClass().getSimpleName() + "_catalogdb.json"); + + + /** + * Return valid json for the model UUID in the request file. + */ + wireMockServer + .stubFor(get(urlEqualTo("/v2/serviceResources?serviceModelUuid=32daaac6-5017-4e1e-96c8-6a27dfbe1421")) + .willReturn(okJson(responseObject))); + + /** + * Return valid json for the service model InvariantUUID as specified in the request file. + */ + wireMockServer.stubFor( + get(urlEqualTo("/v2/serviceResources?serviceModelInvariantUuid=339b7a2f-9524-4dbf-9eee-f2e05521df3f")) + .willReturn(okJson(responseObject))); + + /** + * Return valid spring data rest json for the service model UUID as specified in the request file. + */ + wireMockServer.stubFor(get(urlEqualTo( + "/pnfResourceCustomization/search/findPnfResourceCustomizationByModelUuid?SERVICE_MODEL_UUID=32daaac6-5017-4e1e-96c8-6a27dfbe1421")) + .willReturn(okJson(catalogdbClientResponse))); + } + +} diff --git a/bpmn/so-bpmn-infrastructure-flows/src/test/resources/request/PNFSoftwareUpgradeTest.json b/bpmn/so-bpmn-infrastructure-flows/src/test/resources/request/PNFSoftwareUpgradeTest.json new file mode 100644 index 0000000000..a101118623 --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-flows/src/test/resources/request/PNFSoftwareUpgradeTest.json @@ -0,0 +1,54 @@ +{ + "requestDetails":{ + "requestInfo":{ + "source":"VID", + "suppressRollback":false, + "requestorId":"demo", + "productFamilyId":"SWUPid" + }, + "modelInfo":{ + "modelType":"service", + "modelInvariantUuid":"339b7a2f-9524-4dbf-9eee-f2e05521df3f", + "modelInvariantId":"339b7a2f-9524-4dbf-9eee-f2e05521df3f", + "modelUuid":"32daaac6-5017-4e1e-96c8-6a27dfbe1421", + "modelName":"PNF_int_service_2", + "modelVersion":"1.0" + }, + "requestParameters":{ + "userParams":[ + { + "name":"aic_zone", + "value":"nova" + }, + { + "name":"pnfId", + "value":"PNFDemo" + }, + { + "name":"targetSoftwareVersion", + "value":"demo-sw-ver2.0.0" + }, + { + "name":"pnfName", + "value":"PNFDemo" + } + ], + "subscriptionServiceType":"SWUP", + "aLaCarte":false + }, + "cloudConfiguration":{ + "lcpCloudRegionId":"regionOne", + "tenantId":"09a63533072f4a579d5c99c3b8fe94c6" + }, + "subscriberInfo":{ + "globalSubscriberId":"ADemoCustomerInEric" + }, + "project":{ + "projectName":"Project-Demonstration" + }, + "owningEntity":{ + "owningEntityId":"5eae949c-1c50-4780-b8b5-7cbeb08856b4", + "owningEntityName":"OE-Demonstration" + } + } +}
\ No newline at end of file diff --git a/bpmn/so-bpmn-infrastructure-flows/src/test/resources/response/PNFSoftwareUpgradeTest.json b/bpmn/so-bpmn-infrastructure-flows/src/test/resources/response/PNFSoftwareUpgradeTest.json new file mode 100644 index 0000000000..32539844ba --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-flows/src/test/resources/response/PNFSoftwareUpgradeTest.json @@ -0,0 +1,26 @@ +{ + "serviceResources":{ + "modelInfo":{ + "modelInvariantId":"439b7a2f-9524-4dbf-9eee-f2e05521df3f", + "modelUuid":"42daaac6-5017-4e1e-96c8-6a27dfbe1421", + "modelName":"PNF_int_service_2", + "modelVersion":"1.0" + }, + "serviceType":"NA", + "environmentContext":"Luna", + "serviceRole":"NA", + "workloadContext":"Oxygen", + "serviceVnfs":[ + + ], + "serviceNetworks":[ + + ], + "serviceAllottedResources":[ + + ], + "configResource":[ + + ] + } +}
\ No newline at end of file diff --git a/bpmn/so-bpmn-infrastructure-flows/src/test/resources/response/PNFSoftwareUpgradeTest_catalogdb.json b/bpmn/so-bpmn-infrastructure-flows/src/test/resources/response/PNFSoftwareUpgradeTest_catalogdb.json new file mode 100644 index 0000000000..faec947fec --- /dev/null +++ b/bpmn/so-bpmn-infrastructure-flows/src/test/resources/response/PNFSoftwareUpgradeTest_catalogdb.json @@ -0,0 +1,39 @@ +{ + "_embedded": { + "pnfResourceCustomization": [ + { + "modelCustomizationUUID": "38dc9a92-214c-11e7-93ae-92361f002680", + "modelInstanceName": "PNF routing", + "created": "2019-03-08 12:00:29.000", + "nfFunction": "routing", + "nfType": "routing", + "nfRole": "routing", + "nfNamingCode": "routing", + "multiStageDesign": null, + "resourceInput": null, + "blueprintName": "test_pnf_software_upgrade_restconf", + "blueprintVersion": "1.0.0", + "skipPostInstConf": false, + "softwareVersion": "1.0.0", + "creationTimestamp": "2019-03-08T12:00:29.000+0000", + "controllerActor": "cds", + "_links": { + "self": { + "href": "http://localhost:41023/pnfResourceCustomization/38dc9a92-214c-11e7-93ae-92361f002680" + }, + "pnfResourceCustomization": { + "href": "http://localhost:41023/pnfResourceCustomization/38dc9a92-214c-11e7-93ae-92361f002680" + }, + "pnfResources": { + "href": "http://localhost:41023/pnfResourceCustomization/38dc9a92-214c-11e7-93ae-92361f002680/pnfResources" + } + } + } + ] + }, + "_links": { + "self": { + "href": "http://localhost:41023/pnfResourceCustomization/search/findPnfResourceCustomizationByModelUuid?SERVICE_MODEL_UUID=4df8b6de-2083-11e7-93ae-92361f002676" + } + } +}
\ No newline at end of file diff --git a/bpmn/so-bpmn-tasks/pom.xml b/bpmn/so-bpmn-tasks/pom.xml index d37120b452..14081960e6 100644 --- a/bpmn/so-bpmn-tasks/pom.xml +++ b/bpmn/so-bpmn-tasks/pom.xml @@ -3,7 +3,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>bpmn</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <modelVersion>4.0.0</modelVersion> <artifactId>so-bpmn-tasks</artifactId> diff --git a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/aai/tasks/AAIUpdateTasks.java b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/aai/tasks/AAIUpdateTasks.java index 4d5494d18c..33b60a9ed3 100644 --- a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/aai/tasks/AAIUpdateTasks.java +++ b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/aai/tasks/AAIUpdateTasks.java @@ -5,13 +5,15 @@ * Copyright (C) 2017 AT&T Intellectual Property. All rights reserved. * ================================================================================ * Modifications Copyright (c) 2019 Samsung + * Modifications Copyright (c) 2019 Bell Canada. + * Modifications Copyright (c) 2020 Nokia * ================================================================================ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at - * + * * http://www.apache.org/licenses/LICENSE-2.0 - * + * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. @@ -22,39 +24,23 @@ package org.onap.so.bpmn.infrastructure.aai.tasks; -import java.util.List; -import java.util.Map; import org.onap.so.adapters.nwrest.CreateNetworkResponse; import org.onap.so.adapters.nwrest.UpdateNetworkResponse; import org.onap.so.bpmn.common.BuildingBlockExecution; -import org.onap.so.bpmn.servicedecomposition.bbobjects.CloudRegion; -import org.onap.so.bpmn.servicedecomposition.bbobjects.Collection; -import org.onap.so.bpmn.servicedecomposition.bbobjects.Configuration; -import org.onap.so.bpmn.servicedecomposition.bbobjects.GenericVnf; -import org.onap.so.bpmn.servicedecomposition.bbobjects.L3Network; -import org.onap.so.bpmn.servicedecomposition.bbobjects.Pnf; -import org.onap.so.bpmn.servicedecomposition.bbobjects.ServiceInstance; -import org.onap.so.bpmn.servicedecomposition.bbobjects.Subnet; -import org.onap.so.bpmn.servicedecomposition.bbobjects.VfModule; -import org.onap.so.bpmn.servicedecomposition.bbobjects.VolumeGroup; +import org.onap.so.bpmn.servicedecomposition.bbobjects.*; import org.onap.so.bpmn.servicedecomposition.entities.GeneralBuildingBlock; import org.onap.so.bpmn.servicedecomposition.entities.ResourceKey; import org.onap.so.bpmn.servicedecomposition.tasks.ExtractPojosForBB; import org.onap.so.client.exception.BBObjectNotFoundException; import org.onap.so.client.exception.ExceptionBuilder; -import org.onap.so.client.orchestration.AAICollectionResources; -import org.onap.so.client.orchestration.AAIConfigurationResources; -import org.onap.so.client.orchestration.AAINetworkResources; -import org.onap.so.client.orchestration.AAIPnfResources; -import org.onap.so.client.orchestration.AAIServiceInstanceResources; -import org.onap.so.client.orchestration.AAIVfModuleResources; -import org.onap.so.client.orchestration.AAIVnfResources; -import org.onap.so.client.orchestration.AAIVolumeGroupResources; +import org.onap.so.client.orchestration.*; import org.onap.so.db.catalog.beans.OrchestrationStatus; import org.slf4j.Logger; import org.slf4j.LoggerFactory; import org.springframework.beans.factory.annotation.Autowired; import org.springframework.stereotype.Component; +import java.util.List; +import java.util.Map; @Component public class AAIUpdateTasks { @@ -85,43 +71,21 @@ public class AAIUpdateTasks { /** * BPMN access method to update the status of Service to Assigned in AAI - * - * @param execution */ public void updateOrchestrationStatusAssignedService(BuildingBlockExecution execution) { - try { - ServiceInstance serviceInstance = - extractPojosForBB.extractByKey(execution, ResourceKey.SERVICE_INSTANCE_ID); - aaiServiceInstanceResources.updateOrchestrationStatusServiceInstance(serviceInstance, - OrchestrationStatus.ASSIGNED); - execution.setVariable("aaiServiceInstanceRollback", true); - } catch (Exception ex) { - logger.error("Exception occurred in AAIUpdateTasks updateOrchestrationStatusAssignedService", ex); - exceptionUtil.buildAndThrowWorkflowException(execution, 7000, ex); - } + updateOrchestrationStatusForService(execution, OrchestrationStatus.ASSIGNED); + execution.setVariable("aaiServiceInstanceRollback", true); } /** * BPMN access method to update status of Service to Active in AAI - * - * @param execution */ public void updateOrchestrationStatusActiveService(BuildingBlockExecution execution) { - try { - ServiceInstance serviceInstance = - extractPojosForBB.extractByKey(execution, ResourceKey.SERVICE_INSTANCE_ID); - aaiServiceInstanceResources.updateOrchestrationStatusServiceInstance(serviceInstance, - OrchestrationStatus.ACTIVE); - } catch (Exception ex) { - logger.error("Exception occurred in AAIUpdateTasks updateOrchestrationStatusActiveService", ex); - exceptionUtil.buildAndThrowWorkflowException(execution, 7000, ex); - } + updateOrchestrationStatusForService(execution, OrchestrationStatus.ACTIVE); } /** * BPMN access method to update status of Pnf to Assigned in AAI - * - * @param execution */ public void updateOrchestrationStatusAssignedPnf(BuildingBlockExecution execution) { updateOrchestrationStatusForPnf(execution, OrchestrationStatus.ASSIGNED); @@ -129,8 +93,6 @@ public class AAIUpdateTasks { /** * BPMN access method to update status of Pnf to Active in AAI - * - * @param execution */ public void updateOrchestrationStatusActivePnf(BuildingBlockExecution execution) { updateOrchestrationStatusForPnf(execution, OrchestrationStatus.ACTIVE); @@ -150,44 +112,18 @@ public class AAIUpdateTasks { updateOrchestrationStatusForPnf(execution, OrchestrationStatus.REGISTERED); } - private void updateOrchestrationStatusForPnf(BuildingBlockExecution execution, OrchestrationStatus status) { - try { - Pnf pnf = extractPojosForBB.extractByKey(execution, ResourceKey.PNF); - aaiPnfResources.updateOrchestrationStatusPnf(pnf, status); - } catch (Exception ex) { - logger.error("Exception occurred in AAIUpdateTasks during update Orchestration Status to {}", status, ex); - exceptionUtil.buildAndThrowWorkflowException(execution, 7000, ex); - } - } - /** * BPMN access method to update status of Vnf to Assigned in AAI - * - * @param execution */ public void updateOrchestrationStatusAssignedVnf(BuildingBlockExecution execution) { - try { - GenericVnf vnf = extractPojosForBB.extractByKey(execution, ResourceKey.GENERIC_VNF_ID); - aaiVnfResources.updateOrchestrationStatusVnf(vnf, OrchestrationStatus.ASSIGNED); - } catch (Exception ex) { - logger.error("Exception occurred in AAIUpdateTasks updateOrchestrationStatusAssignedVnf", ex); - exceptionUtil.buildAndThrowWorkflowException(execution, 7000, ex); - } + updateOrchestrationStatusForVnf(execution, OrchestrationStatus.ASSIGNED); } /** * BPMN access method to update status of Vnf to Active in AAI - * - * @param execution */ public void updateOrchestrationStatusActiveVnf(BuildingBlockExecution execution) { - try { - GenericVnf vnf = extractPojosForBB.extractByKey(execution, ResourceKey.GENERIC_VNF_ID); - aaiVnfResources.updateOrchestrationStatusVnf(vnf, OrchestrationStatus.ACTIVE); - } catch (Exception ex) { - logger.error("Exception occurred in AAIUpdateTasks updateOrchestrationStatusActiveVnf", ex); - exceptionUtil.buildAndThrowWorkflowException(execution, 7000, ex); - } + updateOrchestrationStatusForVnf(execution, OrchestrationStatus.ACTIVE); } /** @@ -340,7 +276,6 @@ public class AAIUpdateTasks { * BPMN access method to update status of VfModule to Created in AAI * * @param execution - * */ public void updateOrchestrationStatusCreatedVfModule(BuildingBlockExecution execution) { try { @@ -357,7 +292,6 @@ public class AAIUpdateTasks { * BPMN access method to update aaiDeactivateVfModuleRollback to true for deactivating the VfModule * * @param execution - * @throws buildAndThrowWorkflowException */ public void updateOrchestrationStatusDeactivateVfModule(BuildingBlockExecution execution) { execution.setVariable("aaiDeactivateVfModuleRollback", false); @@ -794,7 +728,6 @@ public class AAIUpdateTasks { logger.error("Exception occurred in AAIUpdateTasks updateOrchestrationStatusConfigDeployConfigureVnf", ex); exceptionUtil.buildAndThrowWorkflowException(execution, 7000, ex); } - } /** @@ -806,11 +739,89 @@ public class AAIUpdateTasks { try { GenericVnf vnf = extractPojosForBB.extractByKey(execution, ResourceKey.GENERIC_VNF_ID); aaiVnfResources.updateOrchestrationStatusVnf(vnf, OrchestrationStatus.CONFIGURED); - } catch (Exception ex) { logger.error("Exception occurred in AAIUpdateTasks updateOrchestrationStatusConfigDeployConfiguredVnf", ex); exceptionUtil.buildAndThrowWorkflowException(execution, 7000, ex); } + } + + /** + * BPMN access method to update status of VNF/VF-Module based on SO scope and action. + * + * @param execution - BuildingBlockExecution + * @param scope - SO scope (vnf/vfModule) + * @param action - action (configAssign/configDeploy/configUndeploy etc..) + */ + public void updateOrchestrationStatusForCds(BuildingBlockExecution execution, String scope, String action) { + try { + GenericVnf vnf = extractPojosForBB.extractByKey(execution, ResourceKey.GENERIC_VNF_ID); + OrchestrationStatus status = getOrchestrationStatus(action); + switch (scope) { + case "vnf": + aaiVnfResources.updateOrchestrationStatusVnf(vnf, status); + break; + case "vfModule": + VfModule vfModule = extractPojosForBB.extractByKey(execution, ResourceKey.VF_MODULE_ID); + aaiVfModuleResources.updateOrchestrationStatusVfModule(vfModule, vnf, status); + break; + default: + throw new IllegalArgumentException( + "Invalid scope to update orchestration status for CDS : " + action); + } + } catch (Exception ex) { + logger.error("Exception occurred in AAIUpdateTasks updateOrchestrationStatusForCds", ex); + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, ex); + } + } + + private OrchestrationStatus getOrchestrationStatus(String action) { + /** + * At this state, OrcherstationStatus enum associated with configAssign and configDeploy. I am not sure which is + * the correct approach. 1. Are we going to map each specific action to OrchestrationStauts ? 2. We will have + * only one generic status for all actions ? + */ + + switch (action) { + case "configAssign": + return OrchestrationStatus.ASSIGNED; + case "configDeploy": + return OrchestrationStatus.CONFIGURED; + default: + throw new IllegalArgumentException("Invalid action to set Orchestration status: " + action); + } + } + + private void updateOrchestrationStatusForService(BuildingBlockExecution execution, OrchestrationStatus status) { + try { + ServiceInstance serviceInstance = + extractPojosForBB.extractByKey(execution, ResourceKey.SERVICE_INSTANCE_ID); + aaiServiceInstanceResources.updateOrchestrationStatusServiceInstance(serviceInstance, status); + } catch (Exception ex) { + logger.error("Exception occurred in AAIUpdateTasks during update orchestration status to {} for service", + status, ex); + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, ex); + } + } + private void updateOrchestrationStatusForPnf(BuildingBlockExecution execution, OrchestrationStatus status) { + try { + Pnf pnf = extractPojosForBB.extractByKey(execution, ResourceKey.PNF); + aaiPnfResources.updateOrchestrationStatusPnf(pnf, status); + } catch (Exception ex) { + logger.error("Exception occurred in AAIUpdateTasks during update Orchestration Status to {}", status, ex); + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, ex); + } } + + private void updateOrchestrationStatusForVnf(BuildingBlockExecution execution, OrchestrationStatus status) { + try { + GenericVnf vnf = extractPojosForBB.extractByKey(execution, ResourceKey.GENERIC_VNF_ID); + aaiVnfResources.updateOrchestrationStatusVnf(vnf, status); + } catch (Exception ex) { + logger.error("Exception occurred in AAIUpdateTasks during update orchestration status to {} for vnf", + status, ex); + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, ex); + } + } + } diff --git a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/adapter/vnf/tasks/VnfAdapterCreateTasks.java b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/adapter/vnf/tasks/VnfAdapterCreateTasks.java index 4285e9aa84..663b097b78 100644 --- a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/adapter/vnf/tasks/VnfAdapterCreateTasks.java +++ b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/adapter/vnf/tasks/VnfAdapterCreateTasks.java @@ -121,7 +121,7 @@ public class VnfAdapterCreateTasks { try { volumeGroup = extractPojosForBB.extractByKey(execution, ResourceKey.VOLUME_GROUP_ID); } catch (BBObjectNotFoundException bbException) { - logger.error("Exception occurred if bb objrct not found in VnfAdapterCreateTasks createVfModule ", + logger.error("Exception occurred if bb object not found in VnfAdapterCreateTasks createVfModule ", bbException); } CloudRegion cloudRegion = gBBInput.getCloudRegion(); diff --git a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/appc/tasks/AppcRunTasks.java b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/appc/tasks/AppcRunTasks.java index 79ccd9216f..00d0fdc01d 100644 --- a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/appc/tasks/AppcRunTasks.java +++ b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/appc/tasks/AppcRunTasks.java @@ -6,12 +6,14 @@ * ================================================================================ * Modifications Copyright (c) 2019 Samsung * ================================================================================ + * Modifications Copyright (c) 2020 Nokia + * ================================================================================ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at - * + * * http://www.apache.org/licenses/LICENSE-2.0 - * + * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. @@ -29,7 +31,6 @@ import java.util.Optional; import org.onap.so.logger.LoggingAnchor; import org.json.JSONArray; import org.json.JSONObject; -import org.onap.aai.domain.yang.Vserver; import org.onap.appc.client.lcm.model.Action; import org.onap.so.bpmn.common.BuildingBlockExecution; import org.onap.so.bpmn.core.json.JsonUtils; @@ -143,7 +144,7 @@ public class AppcRunTasks { ControllerSelectionReference controllerSelectionReference = catalogDbClient .getControllerSelectionReferenceByVnfTypeAndActionCategory(vnfType, action.toString()); - String controllerType = null; + String controllerType; if (controllerSelectionReference != null) { controllerType = controllerSelectionReference.getControllerName(); } else { @@ -191,13 +192,13 @@ public class AppcRunTasks { logger.error("Error Message: {}", appcMessage); logger.error("ERROR CODE: {}", appcCode); logger.trace("End of runAppCommand "); - if (appcCode != null && !appcCode.equals("0")) { + if (appcCode != null && !"0".equals(appcCode)) { exceptionUtil.buildAndThrowWorkflowException(execution, Integer.parseInt(appcCode), appcMessage); } } protected void mapRollbackVariables(BuildingBlockExecution execution, Action action, String appcCode) { - if (appcCode != null && appcCode.equals("0") && action != null) { + if ("0".equals(appcCode) && action != null) { if (action.equals(Action.Lock)) { execution.setVariable(ROLLBACK_VNF_LOCK, true); } else if (action.equals(Action.Unlock)) { @@ -216,7 +217,7 @@ public class AppcRunTasks { private HashMap<String, String> buildPayloadInfo(String vnfName, String aicIdentity, String vnfHostIpAddress, String vmIdList, String vserverIdList, String identityUrl, String vfModuleId) { - HashMap<String, String> payloadInfo = new HashMap<String, String>(); + HashMap<String, String> payloadInfo = new HashMap<>(); payloadInfo.put("vnfName", vnfName); payloadInfo.put("aicIdentity", aicIdentity); payloadInfo.put("vnfHostIpAddress", vnfHostIpAddress); @@ -242,44 +243,39 @@ public class AppcRunTasks { return payload; } - protected void getVserversForAppc(BuildingBlockExecution execution, GenericVnf vnf) throws Exception { + protected void getVserversForAppc(BuildingBlockExecution execution, GenericVnf vnf) throws RuntimeException { AAIResultWrapper aaiRW = aaiVnfResources.queryVnfWrapperById(vnf); - if (aaiRW != null && aaiRW.getRelationships() != null && aaiRW.getRelationships().isPresent()) { - Relationships relationships = aaiRW.getRelationships().get(); - if (relationships != null) { - List<AAIResourceUri> vserverUris = relationships.getRelatedAAIUris(AAIObjectType.VSERVER); - JSONArray vserverIds = new JSONArray(); - JSONArray vserverSelfLinks = new JSONArray(); - if (vserverUris != null) { - for (AAIResourceUri j : vserverUris) { - if (j != null) { - if (j.getURIKeys() != null) { - String vserverId = j.getURIKeys().get("vserver-id"); - vserverIds.put(vserverId); - } - Optional<Vserver> oVserver = aaiVnfResources.getVserver(j); - if (oVserver.isPresent()) { - Vserver vserver = oVserver.get(); - if (vserver != null) { - String vserverSelfLink = vserver.getVserverSelflink(); - vserverSelfLinks.put(vserverSelfLink); - } - } - } + if (aaiRW == null || aaiRW.getRelationships() == null || !aaiRW.getRelationships().isPresent()) { + return; + } + Relationships relationships = aaiRW.getRelationships().get(); + List<AAIResourceUri> vserverUris = relationships.getRelatedAAIUris(AAIObjectType.VSERVER); + JSONArray vserverIds = new JSONArray(); + JSONArray vserverSelfLinks = new JSONArray(); + if (vserverUris != null) { + for (AAIResourceUri j : vserverUris) { + if (j != null) { + if (j.getURIKeys() != null) { + String vserverId = j.getURIKeys().get("vserver-id"); + vserverIds.put(vserverId); } + aaiVnfResources.getVserver(j).ifPresent((vserver) -> { + String vserverSelfLink = vserver.getVserverSelflink(); + vserverSelfLinks.put(vserverSelfLink); + }); } - - JSONObject vmidsArray = new JSONObject(); - JSONObject vserveridsArray = new JSONObject(); - vmidsArray.put("vmIds", vserverSelfLinks.toString()); - vserveridsArray.put("vserverIds", vserverIds.toString()); - logger.debug("vmidsArray is: {}", vmidsArray.toString()); - logger.debug("vserveridsArray is: {}", vserveridsArray.toString()); - - execution.setVariable("vmIdList", vmidsArray.toString()); - execution.setVariable("vserverIdList", vserveridsArray.toString()); } } + + JSONObject vmidsArray = new JSONObject(); + JSONObject vserveridsArray = new JSONObject(); + vmidsArray.put("vmIds", vserverSelfLinks.toString()); + vserveridsArray.put("vserverIds", vserverIds.toString()); + logger.debug("vmidsArray is: {}", vmidsArray.toString()); + logger.debug("vserveridsArray is: {}", vserveridsArray.toString()); + + execution.setVariable("vmIdList", vmidsArray.toString()); + execution.setVariable("vserverIdList", vserveridsArray.toString()); } } diff --git a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/decisionpoint/impl/camunda/controller/cds/CdsControllerDE.java b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/decisionpoint/impl/camunda/controller/cds/PnfConfigCdsControllerDE.java index 6b0cbc0396..ffd49e6b84 100644 --- a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/decisionpoint/impl/camunda/controller/cds/CdsControllerDE.java +++ b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/decisionpoint/impl/camunda/controller/cds/PnfConfigCdsControllerDE.java @@ -24,6 +24,7 @@ import org.onap.so.bpmn.infrastructure.decisionpoint.api.ControllerContext; import org.onap.so.bpmn.infrastructure.decisionpoint.api.ControllerRunnable; import org.onap.so.bpmn.infrastructure.decisionpoint.api.controller.ControllerPreparable; import org.onap.so.client.cds.AbstractCDSProcessingBBUtils; +import org.onap.so.client.cds.PayloadConstants; import org.springframework.beans.factory.annotation.Autowired; import org.springframework.stereotype.Component; @@ -31,14 +32,23 @@ import org.springframework.stereotype.Component; * This implementation of {@ref ControllerRunnable} is used for Self service, i.e, blueprint based Controller. */ @Component -public class CdsControllerDE extends AbstractCDSProcessingBBUtils implements ControllerRunnable<DelegateExecution> { +public class PnfConfigCdsControllerDE implements ControllerRunnable<DelegateExecution> { + + private static final String ASSIGN_ACTION = "config-assign"; + private static final String DEPLOY_ACTION = "config-deploy"; @Autowired(required = false) private List<ControllerPreparable<DelegateExecution>> prepareList; + @Autowired + private AbstractCDSProcessingBBUtils cdsDispatcher; + @Override public Boolean understand(ControllerContext<DelegateExecution> context) { - return context.getControllerActor().equalsIgnoreCase("cds"); + return PayloadConstants.CDS_ACTOR.equalsIgnoreCase(context.getControllerActor()) + && PayloadConstants.PNF_SCOPE.equalsIgnoreCase(context.getControllerScope()) + && (ASSIGN_ACTION.equalsIgnoreCase(context.getControllerAction()) + || DEPLOY_ACTION.equalsIgnoreCase(context.getControllerAction())); // legacy behavior } @Override @@ -55,7 +65,7 @@ public class CdsControllerDE extends AbstractCDSProcessingBBUtils implements Con @Override public void run(ControllerContext<DelegateExecution> context) { DelegateExecution execution = context.getExecution(); - constructExecutionServiceInputObject(execution); - sendRequestToCDSClient(execution); + cdsDispatcher.constructExecutionServiceInputObject(execution); + cdsDispatcher.sendRequestToCDSClient(execution); } } diff --git a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/ControllerExecution.java b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/ControllerExecution.java new file mode 100644 index 0000000000..86d56005f6 --- /dev/null +++ b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/ControllerExecution.java @@ -0,0 +1,109 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Tech Mahindra + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.bpmn.infrastructure.flowspecific.tasks; + +import java.util.Optional; +import org.onap.so.bpmn.common.BuildingBlockExecution; +import org.onap.so.bpmn.servicedecomposition.bbobjects.GenericVnf; +import org.onap.so.bpmn.servicedecomposition.entities.BuildingBlock; +import org.onap.so.bpmn.servicedecomposition.entities.ExecuteBuildingBlock; +import org.onap.so.bpmn.servicedecomposition.entities.ResourceKey; +import org.onap.so.bpmn.servicedecomposition.tasks.ExtractPojosForBB; +import org.onap.so.client.exception.ExceptionBuilder; +import org.onap.so.db.catalog.beans.BBNameSelectionReference; +import org.onap.so.db.catalog.beans.VnfResourceCustomization; +import org.onap.so.db.catalog.client.CatalogDbClient; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.stereotype.Component; + +@Component +public class ControllerExecution { + private static final Logger logger = LoggerFactory.getLogger(ControllerExecution.class); + private static final String CONTROLLER_ACTOR = "controllerActor"; + private static final String BUILDING_BLOCK = "buildingBlock"; + private static final String SCOPE = "scope"; + private static final String ACTION = "action"; + private static final String BBNAME = "bbName"; + @Autowired + private ExceptionBuilder exceptionUtil; + @Autowired + private CatalogDbClient catalogDbClient; + @Autowired + private ExtractPojosForBB extractPojosForBB; + + /** + * Setting Controller Actor, Scope and Action Variables in BuildingBlockExecution object + * + * @param execution - BuildingBlockExecution object + */ + public void setControllerActorScopeAction(BuildingBlockExecution execution) { + try { + GenericVnf genericVnf = extractPojosForBB.extractByKey(execution, ResourceKey.GENERIC_VNF_ID); + String modleUuid = genericVnf.getModelInfoGenericVnf().getModelCustomizationUuid(); + VnfResourceCustomization vnfResourceCustomization = + catalogDbClient.getVnfResourceCustomizationByModelCustomizationUUID(modleUuid); + + // Fetching Controller Actor at VNF level if null then Controller Actor is set as "APPC" + String controllerActor = Optional.ofNullable(vnfResourceCustomization.getControllerActor()).orElse("APPC"); + ExecuteBuildingBlock executeBuildingBlock = execution.getVariable(BUILDING_BLOCK); + BuildingBlock buildingBlock = executeBuildingBlock.getBuildingBlock(); + String scope = Optional.ofNullable(buildingBlock.getBpmnScope()).orElseThrow( + () -> new NullPointerException("BPMN Scope is NULL in the orchestration_flow_reference table ")); + String action = Optional.ofNullable(buildingBlock.getBpmnAction()).orElseThrow( + () -> new NullPointerException("BPMN Action is NULL in the orchestration_flow_reference table ")); + execution.setVariable(SCOPE, scope); + execution.setVariable(ACTION, action); + execution.setVariable(CONTROLLER_ACTOR, controllerActor); + logger.debug("Executing Controller Execution for ControllerActor: {}, Scope: {} , Action: {}", + controllerActor, scope, action); + + } catch (Exception ex) { + logger.error("An exception occurred while fetching Controller Actor,Scope and Action ", ex); + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, ex); + } + } + + /** + * Selecting bbName from BBNameSelectionReference and setting the value in a variable of BuildingBlockExecution + * + * @param execution - BuildingBlockExecution object + */ + public void selectBB(BuildingBlockExecution execution) { + try { + + String controllerActor = execution.getVariable(CONTROLLER_ACTOR); + String action = Optional.of((String) execution.getVariable(ACTION)).get(); + String scope = Optional.of((String) execution.getVariable(SCOPE)).get(); + BBNameSelectionReference bbNameSelectionReference = + catalogDbClient.getBBNameSelectionReference(controllerActor, scope, action); + String bbName = bbNameSelectionReference.getBbName(); + execution.setVariable(BBNAME, bbName); + logger.debug(" Executing {} BPMN", bbName); + } catch (Exception ex) { + logger.error("An exception occurred while getting bbname from catalogdb ", ex); + exceptionUtil.buildAndThrowWorkflowException(execution, 7000, ex); + + } + + } +} diff --git a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/GenericCDSProcessingBB.java b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/GenericCDSProcessingBB.java new file mode 100644 index 0000000000..f568026aa5 --- /dev/null +++ b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/GenericCDSProcessingBB.java @@ -0,0 +1,92 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Bell Canada + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.bpmn.infrastructure.flowspecific.tasks; + +import org.onap.so.bpmn.common.BuildingBlockExecution; +import org.onap.so.bpmn.infrastructure.decisionpoint.api.ControllerContext; +import org.onap.so.bpmn.infrastructure.decisionpoint.api.ControllerRunnable; +import org.onap.so.bpmn.servicedecomposition.tasks.ExtractPojosForBB; +import org.onap.so.client.cds.AbstractCDSProcessingBBUtils; +import org.onap.so.client.cds.GeneratePayloadForCds; +import org.onap.so.client.cds.beans.AbstractCDSPropertiesBean; +import org.onap.so.client.exception.ExceptionBuilder; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.stereotype.Component; + +/** + * For Vnf/Vf-Module/Service BuildingBlockExecution is being used. + * + * @param - BuildingBlockExecution + */ +@Component +public class GenericCDSProcessingBB implements ControllerRunnable<BuildingBlockExecution> { + private static final Logger logger = LoggerFactory.getLogger(GenericCDSProcessingBB.class); + private static final String EXECUTION_OBJECT = "executionObject"; + public static final String CDS_ACTOR = "cds"; + public static final String VNF_SCOPE = "vnf"; + public static final String VF_MODULE_SCOPE = "vf-module"; + + @Autowired + private ExceptionBuilder exceptionBuilder; + + @Autowired + private ExtractPojosForBB extractPojosForBB; + + @Autowired + private AbstractCDSProcessingBBUtils cdsDispather; + + @Autowired + private GeneratePayloadForCds generatePayloadForCds; + + @Override + public Boolean understand(ControllerContext<BuildingBlockExecution> context) { + String scope = context.getControllerScope(); + return CDS_ACTOR.equalsIgnoreCase(context.getControllerActor()) + && (VNF_SCOPE.equalsIgnoreCase(scope) || VF_MODULE_SCOPE.equalsIgnoreCase(scope)); + } + + @Override + public Boolean ready(ControllerContext<BuildingBlockExecution> context) { + return true; + } + + @Override + public void prepare(ControllerContext<BuildingBlockExecution> context) { + BuildingBlockExecution buildingBlockExecution = context.getExecution(); + try { + AbstractCDSPropertiesBean abstractCDSPropertiesBean = + generatePayloadForCds.buildCdsPropertiesBean(buildingBlockExecution); + buildingBlockExecution.setVariable(EXECUTION_OBJECT, abstractCDSPropertiesBean); + } catch (Exception ex) { + logger.error("An exception occurred when creating payload for CDS request", ex); + exceptionBuilder.buildAndThrowWorkflowException(buildingBlockExecution, 7000, ex); + } + } + + @Override + public void run(ControllerContext<BuildingBlockExecution> context) { + BuildingBlockExecution obj = context.getExecution(); + cdsDispather.constructExecutionServiceInputObject(obj); + cdsDispather.sendRequestToCDSClient(obj); + } +} diff --git a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/GenericPnfCDSProcessingDE.java b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/GenericPnfCDSProcessingDE.java new file mode 100644 index 0000000000..d5423b2ff7 --- /dev/null +++ b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/GenericPnfCDSProcessingDE.java @@ -0,0 +1,92 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ + +package org.onap.so.bpmn.infrastructure.flowspecific.tasks; + +import org.camunda.bpm.engine.delegate.DelegateExecution; +import org.onap.so.bpmn.infrastructure.decisionpoint.api.ControllerContext; +import org.onap.so.bpmn.infrastructure.decisionpoint.api.ControllerRunnable; +import org.onap.so.bpmn.servicedecomposition.tasks.ExtractPojosForBB; +import org.onap.so.client.cds.AbstractCDSProcessingBBUtils; +import org.onap.so.client.cds.GeneratePayloadForCds; +import org.onap.so.client.cds.PayloadConstants; +import org.onap.so.client.cds.beans.AbstractCDSPropertiesBean; +import org.onap.so.client.exception.ExceptionBuilder; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.stereotype.Component; + +/** + * For pnf, DelegateExecution is being used. + * + * @param - DelegateExecution + */ +@Component +public class GenericPnfCDSProcessingDE implements ControllerRunnable<DelegateExecution> { + private static final Logger logger = LoggerFactory.getLogger(GenericPnfCDSProcessingDE.class); + private static final String EXECUTION_OBJECT = "executionObject"; + private static final String ASSIGN_ACTION = "config-assign"; + private static final String DEPLOY_ACTION = "config-deploy"; + + @Autowired + private ExceptionBuilder exceptionBuilder; + + @Autowired + private AbstractCDSProcessingBBUtils cdsDispather; + + @Autowired + private GeneratePayloadForCds generatePayloadForCds; + + @Override + public Boolean understand(ControllerContext<DelegateExecution> context) { + final String scope = context.getControllerScope(); + return PayloadConstants.CDS_ACTOR.equalsIgnoreCase(context.getControllerActor()) + && PayloadConstants.PNF_SCOPE.equalsIgnoreCase(scope) + && !(ASSIGN_ACTION.equalsIgnoreCase(context.getControllerAction()) + || DEPLOY_ACTION.equalsIgnoreCase(context.getControllerAction())); + } + + @Override + public Boolean ready(ControllerContext<DelegateExecution> context) { + return true; + } + + @Override + public void prepare(ControllerContext<DelegateExecution> context) { + DelegateExecution delegateExecution = context.getExecution(); + try { + AbstractCDSPropertiesBean abstractCDSPropertiesBean = + generatePayloadForCds.buildCdsPropertiesBean(delegateExecution); + + delegateExecution.setVariable(EXECUTION_OBJECT, abstractCDSPropertiesBean); + + } catch (Exception ex) { + logger.error("An exception occurred when creating payload for CDS request", ex); + exceptionBuilder.buildAndThrowWorkflowException(delegateExecution, 7000, ex); + } + } + + @Override + public void run(ControllerContext<DelegateExecution> context) { + DelegateExecution obj = context.getExecution(); + cdsDispather.constructExecutionServiceInputObject(obj); + cdsDispather.sendRequestToCDSClient(obj); + } +} diff --git a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/workflow/tasks/OrchestrationStatusValidator.java b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/workflow/tasks/OrchestrationStatusValidator.java index 64f0072991..1cde9fb8f6 100644 --- a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/workflow/tasks/OrchestrationStatusValidator.java +++ b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/workflow/tasks/OrchestrationStatusValidator.java @@ -6,6 +6,8 @@ * ================================================================================ * Modifications Copyright (c) 2019 Samsung * ================================================================================ + * Modifications Copyright (c) 2020 Nokia + * ================================================================================ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at @@ -29,11 +31,9 @@ import org.onap.so.client.exception.BBObjectNotFoundException; import org.onap.so.client.exception.ExceptionBuilder; import org.onap.so.client.exception.OrchestrationStatusValidationException; import org.onap.so.db.catalog.beans.BuildingBlockDetail; -import org.onap.so.db.catalog.beans.OrchestrationAction; import org.onap.so.db.catalog.beans.OrchestrationStatus; import org.onap.so.db.catalog.beans.OrchestrationStatusStateTransitionDirective; import org.onap.so.db.catalog.beans.OrchestrationStatusValidationDirective; -import org.onap.so.db.catalog.beans.ResourceType; import org.onap.so.db.catalog.client.CatalogDbClient; import org.slf4j.Logger; import org.slf4j.LoggerFactory; @@ -52,8 +52,6 @@ public class OrchestrationStatusValidator { "Orchestration Status Validation failed. ResourceType=(%s), TargetAction=(%s), OrchestrationStatus=(%s)"; private static final String ORCHESTRATION_STATUS_VALIDATION_RESULT = "orchestrationStatusValidationResult"; private static final String ALACARTE = "aLaCarte"; - private static final String MULTI_STAGE_DESIGN_OFF = "false"; - private static final String MULTI_STAGE_DESIGN_ON = "true"; @Autowired private ExtractPojosForBB extractPojosForBB; @@ -86,7 +84,7 @@ public class OrchestrationStatusValidator { String.format(BUILDING_BLOCK_DETAIL_NOT_FOUND, buildingBlockFlowName)); } - OrchestrationStatus orchestrationStatus = null; + OrchestrationStatus orchestrationStatus; switch (buildingBlockDetail.getResourceType()) { case SERVICE: diff --git a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/workflow/tasks/WorkflowAction.java b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/workflow/tasks/WorkflowAction.java index 80c6f0b969..f8a4d910f4 100644 --- a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/workflow/tasks/WorkflowAction.java +++ b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/workflow/tasks/WorkflowAction.java @@ -47,6 +47,7 @@ import org.onap.aai.domain.yang.Vnfc; import org.onap.aai.domain.yang.VolumeGroup; import org.onap.aai.domain.yang.VpnBinding; import org.onap.so.bpmn.common.BBConstants; +import org.onap.so.bpmn.infrastructure.workflow.tasks.utils.WorkflowResourceIdsUtils; import org.onap.so.bpmn.servicedecomposition.bbobjects.Configuration; import org.onap.so.bpmn.servicedecomposition.bbobjects.VfModule; import org.onap.so.bpmn.servicedecomposition.entities.BuildingBlock; @@ -94,6 +95,7 @@ import org.springframework.core.env.Environment; import org.springframework.stereotype.Component; import com.fasterxml.jackson.core.JsonProcessingException; import com.fasterxml.jackson.databind.ObjectMapper; +import org.springframework.util.CollectionUtils; @Component public class WorkflowAction { @@ -184,7 +186,7 @@ public class WorkflowAction { List<ExecuteBuildingBlock> flowsToExecute = new ArrayList<>(); WorkflowResourceIds workflowResourceIds = populateResourceIdsFromApiHandler(execution); List<Pair<WorkflowType, String>> aaiResourceIds = new ArrayList<>(); - List<Resource> resourceCounter = new ArrayList<>(); + List<Resource> resourceList = new ArrayList<>(); execution.setVariable("sentSyncResponse", false); execution.setVariable("homing", false); execution.setVariable("calledHoming", false); @@ -303,7 +305,7 @@ public class WorkflowAction { } } if (containsService) { - traverseUserParamsService(execution, resourceCounter, sIRequest, requestAction); + traverseUserParamsService(execution, resourceList, sIRequest, requestAction); } } else { buildAndThrowException(execution, @@ -326,11 +328,10 @@ public class WorkflowAction { } } if (containsService) { - foundRelated = - traverseUserParamsService(execution, resourceCounter, sIRequest, requestAction); + foundRelated = traverseUserParamsService(execution, resourceList, sIRequest, requestAction); } if (!foundRelated) { - traverseCatalogDbService(execution, sIRequest, resourceCounter, aaiResourceIds); + traverseCatalogDbService(execution, sIRequest, resourceList, aaiResourceIds); } } else if (resourceType == WorkflowType.SERVICE && ("activateInstance".equalsIgnoreCase(requestAction) @@ -341,20 +342,20 @@ public class WorkflowAction { // SERVICE-MACRO-DELETE // Will never get user params with service, macro will have // to query the SI in AAI to find related instances. - traverseAAIService(execution, resourceCounter, resourceId, aaiResourceIds); + traverseAAIService(execution, resourceList, resourceId, aaiResourceIds); } else if (resourceType == WorkflowType.SERVICE && "deactivateInstance".equalsIgnoreCase(requestAction)) { - resourceCounter.add(new Resource(WorkflowType.SERVICE, "", false)); + resourceList.add(new Resource(WorkflowType.SERVICE, "", false)); } else if (resourceType == WorkflowType.VNF && ("replaceInstance".equalsIgnoreCase(requestAction) || ("recreateInstance".equalsIgnoreCase(requestAction)))) { - traverseAAIVnf(execution, resourceCounter, workflowResourceIds.getServiceInstanceId(), + traverseAAIVnf(execution, resourceList, workflowResourceIds.getServiceInstanceId(), workflowResourceIds.getVnfId(), aaiResourceIds); } else { buildAndThrowException(execution, "Current Macro Request is not supported"); } String foundObjects = ""; for (WorkflowType type : WorkflowType.values()) { - foundObjects = foundObjects + type + " - " + resourceCounter.stream() + foundObjects = foundObjects + type + " - " + resourceList.stream() .filter(x -> type.equals(x.getResourceType())).collect(Collectors.toList()).size() + " "; } @@ -369,9 +370,9 @@ public class WorkflowAction { || "replaceInstanceRetainAssignments".equalsIgnoreCase(requestAction))) { vnfReplace = true; } - flowsToExecute = buildExecuteBuildingBlockList(orchFlows, resourceCounter, requestId, apiVersion, + flowsToExecute = buildExecuteBuildingBlockList(orchFlows, resourceList, requestId, apiVersion, resourceId, requestAction, vnfType, workflowResourceIds, requestDetails, vnfReplace); - if (!resourceCounter.stream().filter(x -> WorkflowType.NETWORKCOLLECTION == x.getResourceType()) + if (!resourceList.stream().filter(x -> WorkflowType.NETWORKCOLLECTION == x.getResourceType()) .collect(Collectors.toList()).isEmpty()) { logger.info("Sorting for Vlan Tagging"); flowsToExecute = sortExecutionPathByObjectForVlanTagging(flowsToExecute, requestAction); @@ -379,16 +380,16 @@ public class WorkflowAction { // By default, enable homing at VNF level for CREATEINSTANCE and ASSIGNINSTANCE if (resourceType == WorkflowType.SERVICE && (requestAction.equals(CREATEINSTANCE) || requestAction.equals(ASSIGNINSTANCE)) - && !resourceCounter.stream().filter(x -> WorkflowType.VNF.equals(x.getResourceType())) + && !resourceList.stream().filter(x -> WorkflowType.VNF.equals(x.getResourceType())) .collect(Collectors.toList()).isEmpty()) { execution.setVariable("homing", true); execution.setVariable("calledHoming", false); } if (resourceType == WorkflowType.SERVICE && (requestAction.equalsIgnoreCase(ASSIGNINSTANCE) || requestAction.equalsIgnoreCase(CREATEINSTANCE))) { - generateResourceIds(flowsToExecute, resourceCounter, serviceInstanceId); + generateResourceIds(flowsToExecute, resourceList, serviceInstanceId); } else { - updateResourceIdsFromAAITraversal(flowsToExecute, resourceCounter, aaiResourceIds, + updateResourceIdsFromAAITraversal(flowsToExecute, resourceList, aaiResourceIds, serviceInstanceId); } } @@ -410,15 +411,17 @@ public class WorkflowAction { } } - if (flowsToExecute == null || flowsToExecute.isEmpty()) { + if (CollectionUtils.isEmpty(flowsToExecute)) { throw new IllegalStateException("Macro did not come up with a valid execution path."); } + List<String> flowNames = new ArrayList<>(); logger.info("List of BuildingBlocks to execute:"); - for (ExecuteBuildingBlock ebb : flowsToExecute) { + + flowsToExecute.forEach(ebb -> { logger.info(ebb.getBuildingBlock().getBpmnFlowName()); flowNames.add(ebb.getBuildingBlock().getBpmnFlowName()); - } + }); if (!isResume) { bbInputSetupUtils.persistFlowExecutionPath(requestId, flowsToExecute); @@ -431,7 +434,12 @@ public class WorkflowAction { execution.setVariable("isRollbackComplete", false); } catch (Exception ex) { - buildAndThrowException(execution, "Exception while setting execution list. ", ex); + if (!(execution.hasVariable("WorkflowException") + || execution.hasVariable("WorkflowExceptionExceptionMessage"))) { + buildAndThrowException(execution, "Exception while setting execution list. ", ex); + } else { + throw ex; + } } } @@ -463,9 +471,7 @@ public class WorkflowAction { List<AAIResultWrapper> vnfcResultWrappers = relationships.getByType(type); for (AAIResultWrapper vnfcResultWrapper : vnfcResultWrappers) { Optional<T> vnfcOp = vnfcResultWrapper.asBean(resultClass); - if (vnfcOp.isPresent()) { - vnfcs.add(vnfcOp.get()); - } + vnfcOp.ifPresent(vnfcs::add); } } return vnfcs; @@ -485,9 +491,7 @@ public class WorkflowAction { this.getResultWrappersFromRelationships(relationships, type); for (AAIResultWrapper configurationResultWrapper : configurationResultWrappers) { Optional<T> configurationOp = configurationResultWrapper.asBean(resultClass); - if (configurationOp.isPresent()) { - configurations.add(configurationOp.get()); - } + configurationOp.ifPresent(configurations::add); } } return configurations; @@ -537,7 +541,7 @@ public class WorkflowAction { if (configurations.size() > 1) { String multipleRelationshipsError = "Multiple relationships exist from VNFC " + vnfc.getVnfcName() + " to Configurations"; - buildAndThrowException(dataObj.getExecution(), multipleRelationshipsError, + buildAndThrowException(dataObj.getExecution(), "Exception in getConfigBuildingBlock: ", new Exception(multipleRelationshipsError)); } for (org.onap.aai.domain.yang.Configuration configuration : configurations) { @@ -566,8 +570,6 @@ public class WorkflowAction { protected List<OrchestrationFlow> getVfModuleReplaceBuildingBlocks(ConfigBuildingBlocksDataObject dataObj) throws Exception { - List<ExecuteBuildingBlock> flowsToExecuteConfigs = new ArrayList<>(); - String vnfId = dataObj.getWorkflowResourceIds().getVnfId(); String vfModuleId = dataObj.getWorkflowResourceIds().getVfModuleId(); @@ -631,19 +633,15 @@ public class WorkflowAction { if (!relationshipsOp.isPresent()) { logger.debug("No relationships were found for Configuration in AAI"); return null; - } else { - Relationships relationships = relationshipsOp.get(); - List<AAIResultWrapper> vnfcResultWrappers = relationships.getByType(AAIObjectType.VNFC); - if (vnfcResultWrappers.size() > 1 || vnfcResultWrappers.isEmpty()) { - logger.debug("Too many vnfcs or no vnfc found that are related to configuration"); - } - Optional<Vnfc> vnfcOp = vnfcResultWrappers.get(0).asBean(Vnfc.class); - if (vnfcOp.isPresent()) { - return vnfcOp.get().getVnfcName(); - } else { - return null; - } } + Relationships relationships = relationshipsOp.get(); + List<AAIResultWrapper> vnfcResultWrappers = relationships.getByType(AAIObjectType.VNFC); + if (vnfcResultWrappers.size() > 1 || vnfcResultWrappers.isEmpty()) { + logger.debug("Too many vnfcs or no vnfc found that are related to configuration"); + } + Optional<Vnfc> vnfcOp = vnfcResultWrappers.get(0).asBean(Vnfc.class); + return vnfcOp.map(Vnfc::getVnfcName).orElse(null); + } protected List<Resource> sortVfModulesByBaseFirst(List<Resource> vfModuleResources) { @@ -671,18 +669,15 @@ public class WorkflowAction { } private void updateResourceIdsFromAAITraversal(List<ExecuteBuildingBlock> flowsToExecute, - List<Resource> resourceCounter, List<Pair<WorkflowType, String>> aaiResourceIds, String serviceInstanceId) { + List<Resource> resourceList, List<Pair<WorkflowType, String>> aaiResourceIds, String serviceInstanceId) { for (Pair<WorkflowType, String> pair : aaiResourceIds) { logger.debug(pair.getValue0() + ", " + pair.getValue1()); } Arrays.stream(WorkflowType.values()).filter(type -> !type.equals(WorkflowType.SERVICE)).forEach(type -> { - List<Resource> resources = - resourceCounter.stream().filter(x -> type.equals(x.getResourceType())).collect(Collectors.toList()); - for (int i = 0; i < resources.size(); i++) { - updateWorkflowResourceIds(flowsToExecute, type, resources.get(i).getResourceId(), - retrieveAAIResourceId(aaiResourceIds, type), null, serviceInstanceId); - } + resourceList.stream().filter(resource -> type.equals(resource.getResourceType())) + .forEach(resource -> updateWorkflowResourceIds(flowsToExecute, type, resource.getResourceId(), + retrieveAAIResourceId(aaiResourceIds, type), null, serviceInstanceId)); }); } @@ -698,21 +693,16 @@ public class WorkflowAction { return id; } - private void generateResourceIds(List<ExecuteBuildingBlock> flowsToExecute, List<Resource> resourceCounter, + private void generateResourceIds(List<ExecuteBuildingBlock> flowsToExecute, List<Resource> resourceList, String serviceInstanceId) { Arrays.stream(WorkflowType.values()).filter(type -> !type.equals(WorkflowType.SERVICE)).forEach(type -> { - List<Resource> resources = - resourceCounter.stream().filter(x -> type.equals(x.getResourceType())).collect(Collectors.toList()); - for (int i = 0; i < resources.size(); i++) { - Resource resource = resourceCounter.stream().filter(x -> type.equals(x.getResourceType())) - .collect(Collectors.toList()).get(i); - updateWorkflowResourceIds(flowsToExecute, type, resource.getResourceId(), null, - resource.getVirtualLinkKey(), serviceInstanceId); - } + resourceList.stream().filter(resource -> type.equals(resource.getResourceType())) + .forEach(resource -> updateWorkflowResourceIds(flowsToExecute, type, resource.getResourceId(), null, + resource.getVirtualLinkKey(), serviceInstanceId)); }); } - protected void updateWorkflowResourceIds(List<ExecuteBuildingBlock> flowsToExecute, WorkflowType resource, + protected void updateWorkflowResourceIds(List<ExecuteBuildingBlock> flowsToExecute, WorkflowType resourceType, String key, String id, String virtualLinkKey, String serviceInstanceId) { String resourceId = id; if (resourceId == null) { @@ -720,24 +710,10 @@ public class WorkflowAction { } for (ExecuteBuildingBlock ebb : flowsToExecute) { if (key != null && key.equalsIgnoreCase(ebb.getBuildingBlock().getKey()) - && ebb.getBuildingBlock().getBpmnFlowName().contains(resource.toString())) { + && ebb.getBuildingBlock().getBpmnFlowName().contains(resourceType.toString())) { WorkflowResourceIds workflowResourceIds = new WorkflowResourceIds(); workflowResourceIds.setServiceInstanceId(serviceInstanceId); - if (resource == WorkflowType.VNF) { - workflowResourceIds.setVnfId(resourceId); - } else if (resource == WorkflowType.PNF) { - workflowResourceIds.setPnfId(resourceId); - } else if (resource == WorkflowType.VFMODULE) { - workflowResourceIds.setVfModuleId(resourceId); - } else if (resource == WorkflowType.VOLUMEGROUP) { - workflowResourceIds.setVolumeGroupId(resourceId); - } else if (resource == WorkflowType.NETWORK) { - workflowResourceIds.setNetworkId(resourceId); - } else if (resource == WorkflowType.NETWORKCOLLECTION) { - workflowResourceIds.setNetworkCollectionId(resourceId); - } else if (resource == WorkflowType.CONFIGURATION) { - workflowResourceIds.setConfigurationId(resourceId); - } + WorkflowResourceIdsUtils.setResourceIdByWorkflowType(workflowResourceIds, resourceType, resourceId); ebb.setWorkflowResourceIds(workflowResourceIds); } if (virtualLinkKey != null && ebb.getBuildingBlock().isVirtualLink() @@ -771,29 +747,28 @@ public class WorkflowAction { } protected void traverseCatalogDbService(DelegateExecution execution, ServiceInstancesRequest sIRequest, - List<Resource> resourceCounter, List<Pair<WorkflowType, String>> aaiResourceIds) + List<Resource> resourceList, List<Pair<WorkflowType, String>> aaiResourceIds) throws JsonProcessingException, VrfBondingServiceException { String modelUUID = sIRequest.getRequestDetails().getModelInfo().getModelVersionId(); org.onap.so.db.catalog.beans.Service service = catalogDbClient.getServiceByID(modelUUID); if (service == null) { buildAndThrowException(execution, "Could not find the service model in catalog db."); } else { - resourceCounter.add(new Resource(WorkflowType.SERVICE, service.getModelUUID(), false)); + resourceList.add(new Resource(WorkflowType.SERVICE, service.getModelUUID(), false)); RelatedInstance relatedVpnBinding = bbInputSetupUtils.getRelatedInstanceByType(sIRequest.getRequestDetails(), ModelType.vpnBinding); RelatedInstance relatedLocalNetwork = bbInputSetupUtils.getRelatedInstanceByType(sIRequest.getRequestDetails(), ModelType.network); if (relatedVpnBinding != null && relatedLocalNetwork != null) { - traverseVrfConfiguration(aaiResourceIds, resourceCounter, service, relatedVpnBinding, - relatedLocalNetwork); + traverseVrfConfiguration(aaiResourceIds, resourceList, service, relatedVpnBinding, relatedLocalNetwork); } else { - traverseNetworkCollection(execution, resourceCounter, service); + traverseNetworkCollection(execution, resourceList, service); } } } protected void traverseVrfConfiguration(List<Pair<WorkflowType, String>> aaiResourceIds, - List<Resource> resourceCounter, org.onap.so.db.catalog.beans.Service service, + List<Resource> resourceList, org.onap.so.db.catalog.beans.Service service, RelatedInstance relatedVpnBinding, RelatedInstance relatedLocalNetwork) throws VrfBondingServiceException, JsonProcessingException { org.onap.aai.domain.yang.L3Network aaiLocalNetwork = @@ -808,9 +783,9 @@ public class WorkflowAction { vrfValidation.aaiRouteTargetValidation(aaiLocalNetwork); String existingAAIVrfConfiguration = getExistingAAIVrfConfiguration(relatedVpnBinding, aaiLocalNetwork); if (existingAAIVrfConfiguration != null) { - aaiResourceIds.add(new Pair<WorkflowType, String>(WorkflowType.CONFIGURATION, existingAAIVrfConfiguration)); + aaiResourceIds.add(new Pair<>(WorkflowType.CONFIGURATION, existingAAIVrfConfiguration)); } - resourceCounter.add(new Resource(WorkflowType.CONFIGURATION, + resourceList.add(new Resource(WorkflowType.CONFIGURATION, service.getConfigurationCustomizations().get(0).getModelCustomizationUUID(), false)); } @@ -861,7 +836,7 @@ public class WorkflowAction { return false; } - protected void traverseNetworkCollection(DelegateExecution execution, List<Resource> resourceCounter, + protected void traverseNetworkCollection(DelegateExecution execution, List<Resource> resourceList, org.onap.so.db.catalog.beans.Service service) { if (service.getVnfCustomizations() == null || service.getVnfCustomizations().isEmpty()) { List<CollectionResourceCustomization> customizations = service.getCollectionResourceCustomizations(); @@ -871,7 +846,7 @@ public class WorkflowAction { CollectionResourceCustomization collectionResourceCustomization = findCatalogNetworkCollection(execution, service); if (collectionResourceCustomization != null) { - resourceCounter.add(new Resource(WorkflowType.NETWORKCOLLECTION, + resourceList.add(new Resource(WorkflowType.NETWORKCOLLECTION, collectionResourceCustomization.getModelCustomizationUUID(), false)); logger.debug("Found a network collection"); if (collectionResourceCustomization.getCollectionResource() != null) { @@ -913,7 +888,7 @@ public class WorkflowAction { Resource resource = new Resource(WorkflowType.VIRTUAL_LINK, collectionNetworkResourceCust.getModelCustomizationUUID(), false); resource.setVirtualLinkKey(Integer.toString(i)); - resourceCounter.add(resource); + resourceList.add(resource); } } } else { @@ -930,13 +905,13 @@ public class WorkflowAction { logger.debug("No Network Collection Customization found"); } } - if (resourceCounter.stream().filter(x -> WorkflowType.NETWORKCOLLECTION == x.getResourceType()) + if (resourceList.stream().filter(x -> WorkflowType.NETWORKCOLLECTION == x.getResourceType()) .collect(Collectors.toList()).isEmpty()) { if (service.getNetworkCustomizations() == null) { logger.debug("No networks were found on this service model"); } else { for (int i = 0; i < service.getNetworkCustomizations().size(); i++) { - resourceCounter.add(new Resource(WorkflowType.NETWORK, + resourceList.add(new Resource(WorkflowType.NETWORK, service.getNetworkCustomizations().get(i).getModelCustomizationUUID(), false)); } } @@ -947,32 +922,30 @@ public class WorkflowAction { } } - protected void traverseAAIService(DelegateExecution execution, List<Resource> resourceCounter, String resourceId, + protected void traverseAAIService(DelegateExecution execution, List<Resource> resourceList, String resourceId, List<Pair<WorkflowType, String>> aaiResourceIds) { try { ServiceInstance serviceInstanceAAI = bbInputSetupUtils.getAAIServiceInstanceById(resourceId); org.onap.so.bpmn.servicedecomposition.bbobjects.ServiceInstance serviceInstanceMSO = bbInputSetup.getExistingServiceInstance(serviceInstanceAAI); - resourceCounter.add(new Resource(WorkflowType.SERVICE, serviceInstanceMSO.getServiceInstanceId(), false)); + resourceList.add(new Resource(WorkflowType.SERVICE, serviceInstanceMSO.getServiceInstanceId(), false)); if (serviceInstanceMSO.getVnfs() != null) { for (org.onap.so.bpmn.servicedecomposition.bbobjects.GenericVnf vnf : serviceInstanceMSO.getVnfs()) { - aaiResourceIds.add(new Pair<WorkflowType, String>(WorkflowType.VNF, vnf.getVnfId())); - resourceCounter.add(new Resource(WorkflowType.VNF, vnf.getVnfId(), false)); + aaiResourceIds.add(new Pair<>(WorkflowType.VNF, vnf.getVnfId())); + resourceList.add(new Resource(WorkflowType.VNF, vnf.getVnfId(), false)); if (vnf.getVfModules() != null) { for (VfModule vfModule : vnf.getVfModules()) { - aaiResourceIds.add( - new Pair<WorkflowType, String>(WorkflowType.VFMODULE, vfModule.getVfModuleId())); + aaiResourceIds.add(new Pair<>(WorkflowType.VFMODULE, vfModule.getVfModuleId())); Resource resource = new Resource(WorkflowType.VFMODULE, vfModule.getVfModuleId(), false); resource.setBaseVfModule(vfModule.getModelInfoVfModule().getIsBaseBoolean()); - resourceCounter.add(resource); + resourceList.add(resource); } } if (vnf.getVolumeGroups() != null) { for (org.onap.so.bpmn.servicedecomposition.bbobjects.VolumeGroup volumeGroup : vnf .getVolumeGroups()) { - aaiResourceIds.add(new Pair<WorkflowType, String>(WorkflowType.VOLUMEGROUP, - volumeGroup.getVolumeGroupId())); - resourceCounter + aaiResourceIds.add(new Pair<>(WorkflowType.VOLUMEGROUP, volumeGroup.getVolumeGroupId())); + resourceList .add(new Resource(WorkflowType.VOLUMEGROUP, volumeGroup.getVolumeGroupId(), false)); } } @@ -981,15 +954,15 @@ public class WorkflowAction { if (serviceInstanceMSO.getNetworks() != null) { for (org.onap.so.bpmn.servicedecomposition.bbobjects.L3Network network : serviceInstanceMSO .getNetworks()) { - aaiResourceIds.add(new Pair<WorkflowType, String>(WorkflowType.NETWORK, network.getNetworkId())); - resourceCounter.add(new Resource(WorkflowType.NETWORK, network.getNetworkId(), false)); + aaiResourceIds.add(new Pair<>(WorkflowType.NETWORK, network.getNetworkId())); + resourceList.add(new Resource(WorkflowType.NETWORK, network.getNetworkId(), false)); } } if (serviceInstanceMSO.getCollection() != null) { logger.debug("found networkcollection"); - aaiResourceIds.add(new Pair<WorkflowType, String>(WorkflowType.NETWORKCOLLECTION, - serviceInstanceMSO.getCollection().getId())); - resourceCounter.add(new Resource(WorkflowType.NETWORKCOLLECTION, + aaiResourceIds + .add(new Pair<>(WorkflowType.NETWORKCOLLECTION, serviceInstanceMSO.getCollection().getId())); + resourceList.add(new Resource(WorkflowType.NETWORKCOLLECTION, serviceInstanceMSO.getCollection().getId(), false)); } if (serviceInstanceMSO.getConfigurations() != null) { @@ -1000,9 +973,8 @@ public class WorkflowAction { for (Relationship relationship : aaiConfig.get().getRelationshipList().getRelationship()) { if (relationship.getRelatedTo().contains("vnfc") || relationship.getRelatedTo().contains("vpn-binding")) { - aaiResourceIds.add(new Pair<WorkflowType, String>(WorkflowType.CONFIGURATION, - config.getConfigurationId())); - resourceCounter.add( + aaiResourceIds.add(new Pair<>(WorkflowType.CONFIGURATION, config.getConfigurationId())); + resourceList.add( new Resource(WorkflowType.CONFIGURATION, config.getConfigurationId(), false)); break; } @@ -1017,34 +989,32 @@ public class WorkflowAction { } } - private void traverseAAIVnf(DelegateExecution execution, List<Resource> resourceCounter, String serviceId, + private void traverseAAIVnf(DelegateExecution execution, List<Resource> resourceList, String serviceId, String vnfId, List<Pair<WorkflowType, String>> aaiResourceIds) { try { ServiceInstance serviceInstanceAAI = bbInputSetupUtils.getAAIServiceInstanceById(serviceId); org.onap.so.bpmn.servicedecomposition.bbobjects.ServiceInstance serviceInstanceMSO = bbInputSetup.getExistingServiceInstance(serviceInstanceAAI); - resourceCounter.add(new Resource(WorkflowType.SERVICE, serviceInstanceMSO.getServiceInstanceId(), false)); + resourceList.add(new Resource(WorkflowType.SERVICE, serviceInstanceMSO.getServiceInstanceId(), false)); if (serviceInstanceMSO.getVnfs() != null) { for (org.onap.so.bpmn.servicedecomposition.bbobjects.GenericVnf vnf : serviceInstanceMSO.getVnfs()) { if (vnf.getVnfId().equals(vnfId)) { - aaiResourceIds.add(new Pair<WorkflowType, String>(WorkflowType.VNF, vnf.getVnfId())); - resourceCounter.add(new Resource(WorkflowType.VNF, vnf.getVnfId(), false)); + aaiResourceIds.add(new Pair<>(WorkflowType.VNF, vnf.getVnfId())); + resourceList.add(new Resource(WorkflowType.VNF, vnf.getVnfId(), false)); if (vnf.getVfModules() != null) { for (VfModule vfModule : vnf.getVfModules()) { - aaiResourceIds.add(new Pair<WorkflowType, String>(WorkflowType.VFMODULE, - vfModule.getVfModuleId())); - resourceCounter - .add(new Resource(WorkflowType.VFMODULE, vfModule.getVfModuleId(), false)); + aaiResourceIds.add(new Pair<>(WorkflowType.VFMODULE, vfModule.getVfModuleId())); + resourceList.add(new Resource(WorkflowType.VFMODULE, vfModule.getVfModuleId(), false)); findConfigurationsInsideVfModule(execution, vnf.getVnfId(), vfModule.getVfModuleId(), - resourceCounter, aaiResourceIds); + resourceList, aaiResourceIds); } } if (vnf.getVolumeGroups() != null) { for (org.onap.so.bpmn.servicedecomposition.bbobjects.VolumeGroup volumeGroup : vnf .getVolumeGroups()) { - aaiResourceIds.add(new Pair<WorkflowType, String>(WorkflowType.VOLUMEGROUP, - volumeGroup.getVolumeGroupId())); - resourceCounter.add( + aaiResourceIds + .add(new Pair<>(WorkflowType.VOLUMEGROUP, volumeGroup.getVolumeGroupId())); + resourceList.add( new Resource(WorkflowType.VOLUMEGROUP, volumeGroup.getVolumeGroupId(), false)); } } @@ -1060,7 +1030,7 @@ public class WorkflowAction { } private void findConfigurationsInsideVfModule(DelegateExecution execution, String vnfId, String vfModuleId, - List<Resource> resourceCounter, List<Pair<WorkflowType, String>> aaiResourceIds) { + List<Resource> resourceList, List<Pair<WorkflowType, String>> aaiResourceIds) { try { org.onap.aai.domain.yang.VfModule aaiVfModule = bbInputSetupUtils.getAAIVfModule(vnfId, vfModuleId); AAIResultWrapper vfModuleWrapper = new AAIResultWrapper( @@ -1073,9 +1043,8 @@ public class WorkflowAction { Optional<Configuration> config = workflowActionUtils.extractRelationshipsConfiguration(relationshipsOp.get()); if (config.isPresent()) { - aaiResourceIds.add(new Pair<WorkflowType, String>(WorkflowType.CONFIGURATION, - config.get().getConfigurationId())); - resourceCounter.add( + aaiResourceIds.add(new Pair<>(WorkflowType.CONFIGURATION, config.get().getConfigurationId())); + resourceList.add( new Resource(WorkflowType.CONFIGURATION, config.get().getConfigurationId(), false)); } } @@ -1086,7 +1055,7 @@ public class WorkflowAction { } } - protected boolean traverseUserParamsService(DelegateExecution execution, List<Resource> resourceCounter, + protected boolean traverseUserParamsService(DelegateExecution execution, List<Resource> resourceList, ServiceInstancesRequest sIRequest, String requestAction) throws IOException { boolean foundRelated = false; boolean foundVfModuleOrVG = false; @@ -1099,11 +1068,11 @@ public class WorkflowAction { ObjectMapper obj = new ObjectMapper(); String input = obj.writeValueAsString(params.get(USERPARAMSERVICE)); Service validate = obj.readValue(input, Service.class); - resourceCounter.add( + resourceList.add( new Resource(WorkflowType.SERVICE, validate.getModelInfo().getModelVersionId(), false)); if (validate.getResources().getVnfs() != null) { for (Vnfs vnf : validate.getResources().getVnfs()) { - resourceCounter.add(new Resource(WorkflowType.VNF, + resourceList.add(new Resource(WorkflowType.VNF, vnf.getModelInfo().getModelCustomizationId(), false)); foundRelated = true; if (vnf.getModelInfo() != null && vnf.getModelInfo().getModelCustomizationUuid() != null) { @@ -1119,7 +1088,7 @@ public class WorkflowAction { if (vfModuleCustomization.getVfModule() != null && vfModuleCustomization.getVfModule().getVolumeHeatTemplate() != null && vfModuleCustomization.getVolumeHeatEnv() != null) { - resourceCounter.add(new Resource(WorkflowType.VOLUMEGROUP, + resourceList.add(new Resource(WorkflowType.VOLUMEGROUP, vfModuleCustomization.getModelCustomizationUUID(), false)); foundRelated = true; foundVfModuleOrVG = true; @@ -1138,7 +1107,7 @@ public class WorkflowAction { } else { resource.setBaseVfModule(false); } - resourceCounter.add(resource); + resourceList.add(resource); if (vfModule.getModelInfo() != null && vfModule.getModelInfo().getModelCustomizationUuid() != null) { vfModuleCustomizationUUID = @@ -1157,7 +1126,7 @@ public class WorkflowAction { vnf.getModelInfo().getModelCustomizationId()); resource.setVfModuleCustomizationId( vfModule.getModelInfo().getModelCustomizationId()); - resourceCounter.add(configResource); + resourceList.add(configResource); } } } @@ -1172,22 +1141,21 @@ public class WorkflowAction { } if (validate.getResources().getPnfs() != null) { for (Pnfs pnf : validate.getResources().getPnfs()) { - resourceCounter.add(new Resource(WorkflowType.PNF, + resourceList.add(new Resource(WorkflowType.PNF, pnf.getModelInfo().getModelCustomizationId(), false)); foundRelated = true; } } if (validate.getResources().getNetworks() != null) { for (Networks network : validate.getResources().getNetworks()) { - resourceCounter.add(new Resource(WorkflowType.NETWORK, + resourceList.add(new Resource(WorkflowType.NETWORK, network.getModelInfo().getModelCustomizationId(), false)); foundRelated = true; } if (requestAction.equals(CREATEINSTANCE)) { String networkColCustId = queryCatalogDBforNetworkCollection(execution, sIRequest); if (networkColCustId != null) { - resourceCounter - .add(new Resource(WorkflowType.NETWORKCOLLECTION, networkColCustId, false)); + resourceList.add(new Resource(WorkflowType.NETWORKCOLLECTION, networkColCustId, false)); foundRelated = true; } } @@ -1234,21 +1202,14 @@ public class WorkflowAction { } protected WorkflowResourceIds populateResourceIdsFromApiHandler(DelegateExecution execution) { - WorkflowResourceIds workflowResourceIds = new WorkflowResourceIds(); - workflowResourceIds.setServiceInstanceId((String) execution.getVariable("serviceInstanceId")); - workflowResourceIds.setNetworkId((String) execution.getVariable("networkId")); - workflowResourceIds.setVfModuleId((String) execution.getVariable("vfModuleId")); - workflowResourceIds.setVnfId((String) execution.getVariable("vnfId")); - workflowResourceIds.setVolumeGroupId((String) execution.getVariable("volumeGroupId")); - workflowResourceIds.setInstanceGroupId((String) execution.getVariable("instanceGroupId")); - return workflowResourceIds; + return WorkflowResourceIdsUtils.getWorkflowResourceIdsFromExecution(execution); } protected Resource extractResourceIdAndTypeFromUri(String uri) { Pattern patt = Pattern.compile("[vV]\\d+.*?(?:(?:/(?<type>" + SUPPORTEDTYPES + ")(?:/(?<id>[^/]+))?)(?:/(?<action>[^/]+))?(?:/resume)?)?$"); Matcher m = patt.matcher(uri); - Boolean generated = false; + boolean generated = false; if (m.find()) { logger.debug("found match on {} : {} ", uri, m); @@ -1358,7 +1319,7 @@ public class WorkflowAction { } else if (ebb.getBuildingBlock().getBpmnFlowName().equals(CREATENETWORKBB) || ebb.getBuildingBlock().getBpmnFlowName().equals(ACTIVATENETWORKBB)) { continue; - } else if (!ebb.getBuildingBlock().getBpmnFlowName().equals("")) { + } else if (!"".equals(ebb.getBuildingBlock().getBpmnFlowName())) { sortedOrchFlows.add(ebb); } } @@ -1397,11 +1358,10 @@ public class WorkflowAction { String resourceId, String requestAction, String vnfType, WorkflowResourceIds workflowResourceIds, RequestDetails requestDetails, boolean isVirtualLink, boolean isConfiguration) { - List<Resource> serviceResources = resourceList.stream() - .filter(resource -> resource.getResourceType().equals(workflowType)).collect(Collectors.toList()); - serviceResources.forEach(resource -> flowsToExecute.add(buildExecuteBuildingBlock(orchFlow, requestId, resource, - apiVersion, resourceId, requestAction, false, vnfType, workflowResourceIds, requestDetails, - isVirtualLink, resource.getVirtualLinkKey(), null, isConfiguration))); + resourceList.stream().filter(resource -> resource.getResourceType().equals(workflowType)) + .forEach(resource -> flowsToExecute.add(buildExecuteBuildingBlock(orchFlow, requestId, resource, + apiVersion, resourceId, requestAction, false, vnfType, workflowResourceIds, requestDetails, + isVirtualLink, resource.getVirtualLinkKey(), null, isConfiguration))); } protected List<ExecuteBuildingBlock> buildExecuteBuildingBlockList(List<OrchestrationFlow> orchFlows, @@ -1531,13 +1491,8 @@ public class WorkflowAction { requestAction, resourceName.toString(), aLaCarte, CLOUD_OWNER); } if (northBoundRequest == null) { - if (aLaCarte) { - buildAndThrowException(execution, - "The request: ALaCarte " + resourceName + " " + requestAction + " is not supported by GR_API."); - } else { - buildAndThrowException(execution, - "The request: Macro " + resourceName + " " + requestAction + " is not supported by GR_API."); - } + buildAndThrowException(execution, String.format("The request: %s %s %s is not supported by GR_API.", + (aLaCarte ? "AlaCarte" : "Macro"), resourceName, requestAction)); } else { if (northBoundRequest.getIsToplevelflow() != null) { execution.setVariable(BBConstants.G_ISTOPLEVELFLOW, northBoundRequest.getIsToplevelflow()); @@ -1549,9 +1504,7 @@ public class WorkflowAction { if (!flow.getFlowName().contains("BB") && !flow.getFlowName().contains("Activity")) { List<OrchestrationFlow> macroQueryFlows = catalogDbClient.getOrchestrationFlowByAction(flow.getFlowName()); - for (OrchestrationFlow macroFlow : macroQueryFlows) { - listToExecute.add(macroFlow); - } + listToExecute.addAll(macroQueryFlows); } else { listToExecute.add(flow); } @@ -1574,11 +1527,11 @@ public class WorkflowAction { public void handleRuntimeException(DelegateExecution execution) { StringBuilder wfeExpMsg = new StringBuilder("Runtime error "); - String runtimeErrorMessage = null; + String runtimeErrorMessage; try { String javaExpMsg = (String) execution.getVariable("BPMN_javaExpMsg"); if (javaExpMsg != null && !javaExpMsg.isEmpty()) { - wfeExpMsg = wfeExpMsg.append(": ").append(javaExpMsg); + wfeExpMsg.append(": ").append(javaExpMsg); } runtimeErrorMessage = wfeExpMsg.toString(); logger.error(runtimeErrorMessage); diff --git a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/workflow/tasks/listeners/SkipCDSBuildingBlockListener.java b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/workflow/tasks/listeners/SkipCDSBuildingBlockListener.java new file mode 100644 index 0000000000..682a0471ee --- /dev/null +++ b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/workflow/tasks/listeners/SkipCDSBuildingBlockListener.java @@ -0,0 +1,116 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Tech Mahindra + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.bpmn.infrastructure.workflow.tasks.listeners; + +import java.util.Arrays; +import java.util.HashSet; +import java.util.List; +import java.util.Set; +import org.apache.logging.log4j.util.Strings; +import org.onap.so.bpmn.common.BBConstants; +import org.onap.so.bpmn.common.BuildingBlockExecution; +import org.onap.so.bpmn.common.listener.flowmanipulator.FlowManipulator; +import org.onap.so.bpmn.servicedecomposition.entities.ExecuteBuildingBlock; +import org.onap.so.db.catalog.beans.VfModuleCustomization; +import org.onap.so.db.catalog.beans.VnfResourceCustomization; +import org.onap.so.db.catalog.client.CatalogDbClient; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.stereotype.Component; +import org.springframework.util.CollectionUtils; + +@Component +public class SkipCDSBuildingBlockListener implements FlowManipulator { + + @Autowired + private CatalogDbClient catalogDbClient; + + private Set<String> vnfActions = + new HashSet<String>(Arrays.asList("config-assign", "config-deploy", "VnfConfigAssign", "VnfConfigDeploy")); + + private Set<String> vFModuleAction = + new HashSet<String>(Arrays.asList("VfModuleConfigAssign", "VfModuleConfigDeploy")); + + @Override + public boolean shouldRunFor(String currentBBName, boolean isFirst, BuildingBlockExecution execution) { + + return "ControllerExecutionBB".equals(currentBBName); + } + + /** + * Skip the CDS Building block according to the Skip Flag. + * + * @param flowsToExecute - List of ExecuteBuildingBlock object. + * @param execution - BuildingBlockExecution object + * @param currentBB - ExecuteBuildingBlock object + * + */ + @Override + public void run(List<ExecuteBuildingBlock> flowsToExecute, ExecuteBuildingBlock currentBB, + BuildingBlockExecution execution) { + String customizationUUID = currentBB.getBuildingBlock().getKey(); + + if (Strings.isEmpty(customizationUUID)) { + return; + } + + if (currentBB.getBuildingBlock().getBpmnScope().equalsIgnoreCase("VNF") + && containsIgnoreCaseAction(currentBB, vnfActions)) { + List<VnfResourceCustomization> vnfResourceCustomizations = + catalogDbClient.getVnfResourceCustomizationByModelUuid( + currentBB.getRequestDetails().getModelInfo().getModelUuid()); + if (!CollectionUtils.isEmpty(vnfResourceCustomizations)) { + VnfResourceCustomization vrc = catalogDbClient.findVnfResourceCustomizationInList(customizationUUID, + vnfResourceCustomizations); + if (null != vrc) { + boolean skipConfigVNF = vrc.isSkipPostInstConf(); + currentSequenceSkipCheck(execution, skipConfigVNF); + } + + } + } else if (currentBB.getBuildingBlock().getBpmnScope().equalsIgnoreCase("VFModule") + && containsIgnoreCaseAction(currentBB, vFModuleAction)) { + + VfModuleCustomization vfc = + catalogDbClient.getVfModuleCustomizationByModelCuztomizationUUID(customizationUUID); + + if (null != vfc) { + boolean skipVfModule = vfc.isSkipPostInstConf(); + currentSequenceSkipCheck(execution, skipVfModule); + } + } + + + } + + private boolean containsIgnoreCaseAction(ExecuteBuildingBlock currentBB, Set<String> actions) { + return actions.stream().filter(action -> action.equalsIgnoreCase(currentBB.getBuildingBlock().getBpmnAction())) + .findFirst().isPresent(); + } + + + private void currentSequenceSkipCheck(BuildingBlockExecution execution, boolean skipModule) { + if (skipModule) { + int currentSequence = execution.getVariable(BBConstants.G_CURRENT_SEQUENCE); + execution.setVariable(BBConstants.G_CURRENT_SEQUENCE, currentSequence + 1); + } + } + +} diff --git a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/workflow/tasks/utils/WorkflowResourceIdsUtils.java b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/workflow/tasks/utils/WorkflowResourceIdsUtils.java new file mode 100644 index 0000000000..d16eac147e --- /dev/null +++ b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/bpmn/infrastructure/workflow/tasks/utils/WorkflowResourceIdsUtils.java @@ -0,0 +1,77 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Nokia Intellectual Property. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.bpmn.infrastructure.workflow.tasks.utils; + +import org.camunda.bpm.engine.delegate.DelegateExecution; +import org.onap.so.bpmn.infrastructure.workflow.tasks.WorkflowType; +import org.onap.so.bpmn.servicedecomposition.entities.WorkflowResourceIds; + +public final class WorkflowResourceIdsUtils { + + private WorkflowResourceIdsUtils() { + throw new IllegalStateException("Utility class"); + } + + public static void setResourceIdByWorkflowType(WorkflowResourceIds workflowResourceIds, WorkflowType resourceType, + String resourceId) { + switch (resourceType) { + case SERVICE: + workflowResourceIds.setServiceInstanceId(resourceId); + break; + case VNF: + workflowResourceIds.setVnfId(resourceId); + break; + case PNF: + workflowResourceIds.setPnfId(resourceId); + break; + case VFMODULE: + workflowResourceIds.setVfModuleId(resourceId); + break; + case VOLUMEGROUP: + workflowResourceIds.setVolumeGroupId(resourceId); + break; + case NETWORK: + workflowResourceIds.setNetworkId(resourceId); + break; + case NETWORKCOLLECTION: + workflowResourceIds.setNetworkCollectionId(resourceId); + break; + case CONFIGURATION: + workflowResourceIds.setConfigurationId(resourceId); + break; + case INSTANCE_GROUP: + workflowResourceIds.setInstanceGroupId(resourceId); + break; + } + } + + public static WorkflowResourceIds getWorkflowResourceIdsFromExecution(DelegateExecution execution) { + WorkflowResourceIds workflowResourceIds = new WorkflowResourceIds(); + workflowResourceIds.setServiceInstanceId((String) execution.getVariable("serviceInstanceId")); + workflowResourceIds.setNetworkId((String) execution.getVariable("networkId")); + workflowResourceIds.setVfModuleId((String) execution.getVariable("vfModuleId")); + workflowResourceIds.setVnfId((String) execution.getVariable("vnfId")); + workflowResourceIds.setVolumeGroupId((String) execution.getVariable("volumeGroupId")); + workflowResourceIds.setInstanceGroupId((String) execution.getVariable("instanceGroupId")); + return workflowResourceIds; + } + +} diff --git a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/client/adapter/network/mapper/NetworkAdapterObjectMapper.java b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/client/adapter/network/mapper/NetworkAdapterObjectMapper.java index d78fa69680..3f81e432e1 100644 --- a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/client/adapter/network/mapper/NetworkAdapterObjectMapper.java +++ b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/client/adapter/network/mapper/NetworkAdapterObjectMapper.java @@ -4,12 +4,14 @@ * ================================================================================ * Copyright (C) 2017 AT&T Intellectual Property. All rights reserved. * ================================================================================ + * Modifications Copyright (c) 2020 Nokia + * ================================================================================ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at - * + * * http://www.apache.org/licenses/LICENSE-2.0 - * + * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. @@ -52,6 +54,7 @@ import org.onap.so.entity.MsoRequest; import org.onap.so.openstack.beans.NetworkRollback; import org.onap.so.openstack.beans.RouteTarget; import org.onap.so.openstack.beans.Subnet; +import org.onap.so.bpmn.servicedecomposition.bbobjects.SegmentationAssignment; import org.slf4j.Logger; import org.slf4j.LoggerFactory; import org.springframework.stereotype.Component; @@ -65,8 +68,7 @@ public class NetworkAdapterObjectMapper { public CreateNetworkRequest createNetworkRequestMapper(RequestContext requestContext, CloudRegion cloudRegion, OrchestrationContext orchestrationContext, ServiceInstance serviceInstance, L3Network l3Network, - Map<String, String> userInput, String cloudRegionPo, Customer customer) - throws UnsupportedEncodingException { + Map<String, String> userInput, String cloudRegionPo, Customer customer) { CreateNetworkRequest createNetworkRequest = new CreateNetworkRequest(); // set cloudSiteId as determined for cloud region PO instead of cloudRegion.getLcpCloudRegionId() @@ -119,7 +121,7 @@ public class NetworkAdapterObjectMapper { } public DeleteNetworkRequest deleteNetworkRequestMapper(RequestContext requestContext, CloudRegion cloudRegion, - ServiceInstance serviceInstance, L3Network l3Network) throws UnsupportedEncodingException { + ServiceInstance serviceInstance, L3Network l3Network) { DeleteNetworkRequest deleteNetworkRequest = new DeleteNetworkRequest(); deleteNetworkRequest.setCloudSiteId(cloudRegion.getLcpCloudRegionId()); @@ -150,14 +152,14 @@ public class NetworkAdapterObjectMapper { /** * Access method to build Rollback Network Request - * + * * @return * @throws UnsupportedEncodingException */ public RollbackNetworkRequest createNetworkRollbackRequestMapper(RequestContext requestContext, CloudRegion cloudRegion, OrchestrationContext orchestrationContext, ServiceInstance serviceInstance, L3Network l3Network, Map<String, String> userInput, String cloudRegionPo, - CreateNetworkResponse createNetworkResponse) throws UnsupportedEncodingException { + CreateNetworkResponse createNetworkResponse) { RollbackNetworkRequest rollbackNetworkRequest = new RollbackNetworkRequest(); rollbackNetworkRequest = setCommonRollbackRequestFields(rollbackNetworkRequest, requestContext); @@ -171,7 +173,7 @@ public class NetworkAdapterObjectMapper { public UpdateNetworkRequest createNetworkUpdateRequestMapper(RequestContext requestContext, CloudRegion cloudRegion, OrchestrationContext orchestrationContext, ServiceInstance serviceInstance, L3Network l3Network, - Map<String, String> userInput, Customer customer) throws UnsupportedEncodingException { + Map<String, String> userInput, Customer customer) { UpdateNetworkRequest updateNetworkRequest = new UpdateNetworkRequest(); updateNetworkRequest.setCloudSiteId(cloudRegion.getLcpCloudRegionId()); @@ -198,11 +200,10 @@ public class NetworkAdapterObjectMapper { } private RollbackNetworkRequest setCommonRollbackRequestFields(RollbackNetworkRequest request, - RequestContext requestContext) throws UnsupportedEncodingException { + RequestContext requestContext) { request.setSkipAAI(true); String messageId = requestContext.getMsoRequestId(); request.setMessageId(messageId); - // request.setNotificationUrl(createCallbackUrl("NetworkAResponse", messageId)); return request; } @@ -240,7 +241,7 @@ public class NetworkAdapterObjectMapper { return UUID.randomUUID().toString(); } - protected String createCallbackUrl(String messageType, String correlator) throws UnsupportedEncodingException { + protected String createCallbackUrl(String messageType, String correlator) { String endpoint = this.getEndpoint(); while (endpoint.endsWith("/")) { @@ -256,14 +257,14 @@ public class NetworkAdapterObjectMapper { /** * Use BB L3Network object to build subnets list of type org.onap.so.openstack.beans.Subnet - * + * * @param L3Network * @return List<org.onap.so.openstack.beans.Subnet> */ protected List<Subnet> buildOpenstackSubnetList(L3Network l3Network) { List<org.onap.so.bpmn.servicedecomposition.bbobjects.Subnet> subnets = l3Network.getSubnets(); - List<org.onap.so.openstack.beans.Subnet> subnetList = new ArrayList<org.onap.so.openstack.beans.Subnet>(); + List<org.onap.so.openstack.beans.Subnet> subnetList = new ArrayList<>(); // create mapper from onap Subnet to openstack bean Subnet if (modelMapper.getTypeMap(org.onap.so.bpmn.servicedecomposition.bbobjects.Subnet.class, org.onap.so.openstack.beans.Subnet.class) == null) { @@ -292,7 +293,7 @@ public class NetworkAdapterObjectMapper { .setCidr(subnet.getNetworkStartAddress().concat(FORWARD_SLASH).concat(subnet.getCidrMask())); List<org.onap.so.bpmn.servicedecomposition.bbobjects.HostRoute> hostRouteList = subnet.getHostRoutes(); List<org.onap.so.openstack.beans.HostRoute> openstackHostRouteList = new ArrayList<>(); - org.onap.so.openstack.beans.HostRoute openstackHostRoute = null; + org.onap.so.openstack.beans.HostRoute openstackHostRoute; // TODO only 2 fields available on openstack object. Confirm it is sufficient or add as needed for (org.onap.so.bpmn.servicedecomposition.bbobjects.HostRoute hostRoute : hostRouteList) { openstackHostRoute = new org.onap.so.openstack.beans.HostRoute(); @@ -319,10 +320,9 @@ public class NetworkAdapterObjectMapper { private ProviderVlanNetwork buildProviderVlanNetwork(L3Network l3Network) { ProviderVlanNetwork providerVlanNetwork = new ProviderVlanNetwork(); providerVlanNetwork.setPhysicalNetworkName(l3Network.getPhysicalNetworkName()); - List<Integer> vlans = new ArrayList<Integer>(); - List<org.onap.so.bpmn.servicedecomposition.bbobjects.SegmentationAssignment> segmentationAssignments = - l3Network.getSegmentationAssignments(); - for (org.onap.so.bpmn.servicedecomposition.bbobjects.SegmentationAssignment assignment : segmentationAssignments) { + List<Integer> vlans = new ArrayList<>(); + List<SegmentationAssignment> segmentationAssignments = l3Network.getSegmentationAssignments(); + for (SegmentationAssignment assignment : segmentationAssignments) { vlans.add(Integer.valueOf(assignment.getSegmentationId())); } providerVlanNetwork.setVlans(vlans); @@ -401,7 +401,7 @@ public class NetworkAdapterObjectMapper { private Map<String, String> addSharedAndExternal(Map<String, String> userInput, L3Network l3Network) { if (userInput == null) - userInput = new HashMap<String, String>(); + userInput = new HashMap<>(); if (!userInput.containsKey("shared")) { userInput.put("shared", Optional.ofNullable(l3Network.isIsSharedNetwork()).orElse(false).toString()); } diff --git a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/client/namingservice/NamingRequestObject.java b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/client/namingservice/NamingRequestObject.java index 3d3058da0b..362f64d720 100644 --- a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/client/namingservice/NamingRequestObject.java +++ b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/client/namingservice/NamingRequestObject.java @@ -4,6 +4,8 @@ * ================================================================================ * Copyright (C) 2017 - 2019 AT&T Intellectual Property. All rights reserved. * ================================================================================ + * Modifications Copyright (c) 2020 Nokia + * ================================================================================ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at @@ -24,7 +26,7 @@ import java.util.HashMap; public class NamingRequestObject { - private HashMap<String, String> namingRequestMap = new HashMap<String, String>(); + private HashMap<String, String> namingRequestMap = new HashMap<>(); public HashMap<String, String> getNamingRequestObjectMap() { return this.namingRequestMap; diff --git a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/client/orchestration/AAIServiceInstanceResources.java b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/client/orchestration/AAIServiceInstanceResources.java index fc1528526c..9b104f3250 100644 --- a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/client/orchestration/AAIServiceInstanceResources.java +++ b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/client/orchestration/AAIServiceInstanceResources.java @@ -6,6 +6,8 @@ * ================================================================================ * Modifications Copyright (c) 2019 Samsung * ================================================================================ + * Modifications Copyright (c) 2020 Nokia + * ================================================================================ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at @@ -37,14 +39,11 @@ import org.onap.so.client.aai.entities.uri.AAIResourceUri; import org.onap.so.client.aai.entities.uri.AAIUriFactory; import org.onap.so.client.aai.mapper.AAIObjectMapper; import org.onap.so.db.catalog.beans.OrchestrationStatus; -import org.slf4j.Logger; -import org.slf4j.LoggerFactory; import org.springframework.beans.factory.annotation.Autowired; import org.springframework.stereotype.Component; @Component public class AAIServiceInstanceResources { - private static final Logger logger = LoggerFactory.getLogger(AAIServiceInstanceResources.class); @Autowired private InjectionHelper injectionHelper; diff --git a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/client/orchestration/NamingServiceResources.java b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/client/orchestration/NamingServiceResources.java index 5513122560..dba1693e5d 100644 --- a/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/client/orchestration/NamingServiceResources.java +++ b/bpmn/so-bpmn-tasks/src/main/java/org/onap/so/client/orchestration/NamingServiceResources.java @@ -6,6 +6,8 @@ * ================================================================================ * Modifications Copyright (c) 2019 Samsung * ================================================================================ + * Modifications Copyright (c) 2020 Nokia + * ================================================================================ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at @@ -33,14 +35,11 @@ import org.onap.so.client.exception.BadResponseException; import org.onap.so.client.namingservice.NamingClient; import org.onap.so.client.namingservice.NamingRequestObject; import org.onap.so.client.namingservice.NamingRequestObjectBuilder; -import org.slf4j.Logger; -import org.slf4j.LoggerFactory; import org.springframework.beans.factory.annotation.Autowired; import org.springframework.stereotype.Component; @Component public class NamingServiceResources { - private static final Logger logger = LoggerFactory.getLogger(NamingServiceResources.class); private static final String NAMING_TYPE = "instanceGroup"; @Autowired @@ -53,14 +52,14 @@ public class NamingServiceResources { throws BadResponseException, IOException { Element element = namingRequestObjectBuilder.elementMapper(instanceGroup.getId(), policyInstanceName, NAMING_TYPE, nfNamingCode, instanceGroup.getInstanceGroupName()); - List<Element> elements = new ArrayList<Element>(); + List<Element> elements = new ArrayList<>(); elements.add(element); return (namingClient.postNameGenRequest(namingRequestObjectBuilder.nameGenRequestMapper(elements))); } public String deleteInstanceGroupName(InstanceGroup instanceGroup) throws BadResponseException, IOException { Deleteelement deleteElement = namingRequestObjectBuilder.deleteElementMapper(instanceGroup.getId()); - List<Deleteelement> deleteElements = new ArrayList<Deleteelement>(); + List<Deleteelement> deleteElements = new ArrayList<>(); deleteElements.add(deleteElement); return (namingClient .deleteNameGenRequest(namingRequestObjectBuilder.nameGenDeleteRequestMapper(deleteElements))); @@ -70,8 +69,8 @@ public class NamingServiceResources { throws BadResponseException, IOException { HashMap<String, String> nsRequestObject = namingRequestObject.getNamingRequestObjectMap(); Element element = new Element(); - nsRequestObject.forEach((k, v) -> element.put(k, v)); - List<Element> elements = new ArrayList<Element>(); + nsRequestObject.forEach(element::put); + List<Element> elements = new ArrayList<>(); elements.add(element); return (namingClient.postNameGenRequest(namingRequestObjectBuilder.nameGenRequestMapper(elements))); } @@ -81,7 +80,7 @@ public class NamingServiceResources { HashMap<String, String> nsRequestObject = namingRequestObject.getNamingRequestObjectMap(); Deleteelement delElement = new Deleteelement(); nsRequestObject.forEach((k, v) -> delElement.setExternalKey(v)); - List<Deleteelement> delElements = new ArrayList<Deleteelement>(); + List<Deleteelement> delElements = new ArrayList<>(); delElements.add(delElement); return (namingClient.deleteNameGenRequest(namingRequestObjectBuilder.nameGenDeleteRequestMapper(delElements))); } diff --git a/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/decisionpoint/impl/camunda/ControllerExecutionDETestIT.java b/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/decisionpoint/impl/camunda/ControllerExecutionDETestIT.java index 860780a2fc..d2f52dac4c 100644 --- a/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/decisionpoint/impl/camunda/ControllerExecutionDETestIT.java +++ b/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/decisionpoint/impl/camunda/ControllerExecutionDETestIT.java @@ -19,50 +19,63 @@ package org.onap.so.bpmn.infrastructure.decisionpoint.impl.camunda; -import static org.assertj.core.api.Assertions.assertThat; -import static org.assertj.core.api.AssertionsForClassTypes.fail; -import static org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames.MODEL_UUID; -import static org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames.MSO_REQUEST_ID; -import static org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames.PNF_CORRELATION_ID; -import static org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames.PNF_UUID; -import static org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames.PRC_BLUEPRINT_NAME; -import static org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames.PRC_BLUEPRINT_VERSION; -import static org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames.PRC_CUSTOMIZATION_UUID; -import static org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames.PRC_INSTANCE_NAME; -import static org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames.SERVICE_INSTANCE_ID; import com.google.protobuf.Struct; -import java.util.List; import org.junit.Before; +import org.junit.ClassRule; +import org.junit.Rule; import org.junit.Test; +import org.junit.runner.RunWith; +import org.junit.runners.Parameterized; import org.onap.ccsdk.cds.controllerblueprints.common.api.ActionIdentifiers; import org.onap.ccsdk.cds.controllerblueprints.common.api.CommonHeader; import org.onap.ccsdk.cds.controllerblueprints.processing.api.ExecutionServiceInput; import org.onap.so.BaseIntegrationTest; import org.onap.so.GrpcNettyServer; -import org.onap.so.bpmn.servicedecomposition.bbobjects.GenericVnf; +import org.onap.so.client.aai.AAIVersion; import org.slf4j.Logger; import org.slf4j.LoggerFactory; import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.test.context.junit4.rules.SpringClassRule; +import org.springframework.test.context.junit4.rules.SpringMethodRule; +import java.util.Arrays; +import java.util.Collection; +import java.util.List; +import static com.github.tomakehurst.wiremock.client.WireMock.*; +import static org.assertj.core.api.Assertions.assertThat; +import static org.assertj.core.api.AssertionsForClassTypes.fail; +import static org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames.*; +@RunWith(Parameterized.class) public class ControllerExecutionDETestIT extends BaseIntegrationTest { private Logger logger = LoggerFactory.getLogger(this.getClass()); + @ClassRule + public static final SpringClassRule springClassRule = new SpringClassRule(); + + @Rule + public final SpringMethodRule smr = new SpringMethodRule(); + + private static final String DOWNLOAD_ACTION = "downloadNESw"; + private static final String ACTIVATE_ACTION = "activateNESw"; + private static final String PRECHECK_ACTION = "precheck"; + private static final String POSTCHECK_ACTION = "postcheck"; + private static final String ASSIGN_ACTION = "config-assign"; + private static final String DEPLOY_ACTION = "config-deploy"; + private static final String CDS_ACTOR = "cds"; + @Autowired private ControllerExecutionDE controllerExecutionDE; @Autowired private GrpcNettyServer grpcNettyServer; - private GenericVnf genericVnf; - private static String TEST_MODEL_UUID = "6bc0b04d-1873-4721-b53d-6615225b2a28"; private static String TEST_SERVICE_INSTANCE_ID = "test_service_id"; private static String TEST_PROCESS_KEY = "processKey1"; private static String TEST_MSO_REQUEST_ID = "ff874603-4222-11e7-9252-005056850d2e"; - private static String TEST_CDS_ACTION = "config-assign"; - private static String TEST_APPC_ACTION = "HealthCheck"; + private static final AAIVersion VERSION = AAIVersion.LATEST; private static String TEST_PNF_RESOURCE_INSTANCE_NAME = "PNF_demo_resource"; private static String TEST_PNF_CORRELATION_ID = "PNFDemo"; @@ -70,75 +83,112 @@ public class ControllerExecutionDETestIT extends BaseIntegrationTest { private static String TEST_PNF_RESOURCE_BLUEPRINT_VERSION = "1.0.1"; private static String TEST_PNF_RESOURCE_CUSTOMIZATION_UUID = "9acb3a83-8a52-412c-9a45-901764938144"; private static String TEST_PNF_UUID = "5df8b6de-2083-11e7-93ae-92361f002671"; + private static String TEST_SOFTWARE_VERSION = "demo-sw-ver2.0.0"; + + private String description; + private String action; + private String scope; + + public ControllerExecutionDETestIT(String desc, String action, String scope) { + this.description = desc; + this.action = action; + this.scope = scope; + + } + + @Parameterized.Parameters(name = "index {0}") + public static Collection<String[]> data() { + return Arrays.asList( + new String[][] {{"Test JSON for action:" + ACTIVATE_ACTION + " scope:pnf", ACTIVATE_ACTION, "pnf"}, + {"Test JSON for action:" + DOWNLOAD_ACTION + " scope:pnf", DOWNLOAD_ACTION, "pnf"}, + {"Test JSON for action:" + ASSIGN_ACTION + " scope:pnf", ASSIGN_ACTION, "pnf"}, + {"Test JSON for action:" + DEPLOY_ACTION + " scope:pnf", DEPLOY_ACTION, "pnf"}, + {"Test JSON for action:" + PRECHECK_ACTION + " scope:pnf", PRECHECK_ACTION, "pnf"}, + {"Test JSON for action:" + POSTCHECK_ACTION + " scope:pnf", POSTCHECK_ACTION, "pnf"}}); + } @Before public void setUp() { + delegateExecution.setVariable("testProcessKey", TEST_PROCESS_KEY); + delegateExecution.setVariable(PNF_CORRELATION_ID, TEST_PNF_CORRELATION_ID); delegateExecution.setVariable(MODEL_UUID, TEST_MODEL_UUID); delegateExecution.setVariable(SERVICE_INSTANCE_ID, TEST_SERVICE_INSTANCE_ID); delegateExecution.setVariable(MSO_REQUEST_ID, TEST_MSO_REQUEST_ID); - delegateExecution.setVariable("testProcessKey", TEST_PROCESS_KEY); + delegateExecution.setVariable(PNF_UUID, TEST_PNF_UUID); + delegateExecution.setVariable(PRC_INSTANCE_NAME, TEST_PNF_RESOURCE_INSTANCE_NAME); + delegateExecution.setVariable(PRC_CUSTOMIZATION_UUID, TEST_PNF_RESOURCE_CUSTOMIZATION_UUID); + delegateExecution.setVariable(PRC_BLUEPRINT_NAME, TEST_PNF_RESOURCE_BLUEPRINT_NAME); + delegateExecution.setVariable(PRC_BLUEPRINT_VERSION, TEST_PNF_RESOURCE_BLUEPRINT_VERSION); + delegateExecution.setVariable("targetSoftwareVersion", TEST_SOFTWARE_VERSION); + + delegateExecution.setVariable("actor", CDS_ACTOR); + delegateExecution.setVariable("action", this.action); + delegateExecution.setVariable("scope", this.scope); + + + /** + * Get the PNF entry from AAI. + */ + if (action.equalsIgnoreCase(DEPLOY_ACTION)) { + final String aaiPnfEntry = "{ \n" + " \"pnf-name\":\"PNFDemo\",\n" + " \"pnf-id\":\"testtest\",\n" + + " \"in-maint\":true,\n" + " \"resource-version\":\"1541720264047\",\n" + + " \"ipaddress-v4-oam\":\"1.1.1.1\",\n" + " \"ipaddress-v6-oam\":\"::/128\"\n" + "}"; + wireMockServer.stubFor( + get(urlEqualTo("/aai/" + VERSION + "/network/pnfs/pnf/PNFDemo")).willReturn(okJson(aaiPnfEntry))); + } grpcNettyServer.cleanMessage(); } @Test - public void testExecution_cdsConfigAssign_actionExecuted() { - - configureCdsConfigAssign(); + public void testExecution_cds_actions() { controllerExecutionDE.execute(delegateExecution); List<ExecutionServiceInput> detailedMessages = grpcNettyServer.getDetailedMessages(); assertThat(detailedMessages).hasSize(1); try { - checkConfigAssign(detailedMessages.get(0)); + verifyRequestContentForAction(detailedMessages.get(0)); } catch (Exception e) { e.printStackTrace(); - fail("ConfigAssign request exception", e); + fail(this.action + " request exception", e); } } - private void configureCdsConfigAssign() { - delegateExecution.setVariable("actor", "cds"); - delegateExecution.setVariable("action", TEST_CDS_ACTION); - delegateExecution.setVariable("scope", "pnf"); + private void verifyRequestContentForAction(ExecutionServiceInput executionServiceInput) { - delegateExecution.setVariable(PNF_CORRELATION_ID, TEST_PNF_CORRELATION_ID); - delegateExecution.setVariable(PNF_UUID, TEST_PNF_UUID); - delegateExecution.setVariable(PRC_INSTANCE_NAME, TEST_PNF_RESOURCE_INSTANCE_NAME); - delegateExecution.setVariable(PRC_CUSTOMIZATION_UUID, TEST_PNF_RESOURCE_CUSTOMIZATION_UUID); - delegateExecution.setVariable(PRC_BLUEPRINT_NAME, TEST_PNF_RESOURCE_BLUEPRINT_NAME); - delegateExecution.setVariable(PRC_BLUEPRINT_VERSION, TEST_PNF_RESOURCE_BLUEPRINT_VERSION); - } - - private void checkConfigAssign(ExecutionServiceInput executionServiceInput) { - - logger.info("Checking the configAssign request"); + logger.info("Checking the " + this.action + " request"); ActionIdentifiers actionIdentifiers = executionServiceInput.getActionIdentifiers(); - /** - * the fields of actionIdentifiers should match the one in the - * response/createVcpeResCustServiceSimplifiedTest_catalogdb.json. - */ assertThat(actionIdentifiers.getBlueprintName()).isEqualTo(TEST_PNF_RESOURCE_BLUEPRINT_NAME); assertThat(actionIdentifiers.getBlueprintVersion()).isEqualTo(TEST_PNF_RESOURCE_BLUEPRINT_VERSION); - assertThat(actionIdentifiers.getActionName()).isEqualTo(TEST_CDS_ACTION); - assertThat(actionIdentifiers.getMode()).isEqualTo("sync"); + assertThat(actionIdentifiers.getActionName()).isEqualTo(this.action); CommonHeader commonHeader = executionServiceInput.getCommonHeader(); assertThat(commonHeader.getOriginatorId()).isEqualTo("SO"); assertThat(commonHeader.getRequestId()).isEqualTo(TEST_MSO_REQUEST_ID); Struct payload = executionServiceInput.getPayload(); - Struct requeststruct = payload.getFieldsOrThrow("config-assign-request").getStructValue(); + Struct requeststruct = payload.getFieldsOrThrow(this.action + "-request").getStructValue(); assertThat(requeststruct.getFieldsOrThrow("resolution-key").getStringValue()) .isEqualTo(TEST_PNF_CORRELATION_ID); - Struct propertiesStruct = requeststruct.getFieldsOrThrow("config-assign-properties").getStructValue(); + Struct propertiesStruct = requeststruct.getFieldsOrThrow(this.action + "-properties").getStructValue(); assertThat(propertiesStruct.getFieldsOrThrow("pnf-name").getStringValue()).isEqualTo(TEST_PNF_CORRELATION_ID); assertThat(propertiesStruct.getFieldsOrThrow("service-model-uuid").getStringValue()).isEqualTo(TEST_MODEL_UUID); assertThat(propertiesStruct.getFieldsOrThrow("pnf-customization-uuid").getStringValue()) .isEqualTo(TEST_PNF_RESOURCE_CUSTOMIZATION_UUID); + if (action.equalsIgnoreCase(DEPLOY_ACTION)) { + assertThat(actionIdentifiers.getMode()).isEqualTo("async"); + assertThat(propertiesStruct.getFieldsOrThrow("pnf-ipv4-address").getStringValue()).isEqualTo("1.1.1.1"); + assertThat(propertiesStruct.getFieldsOrThrow("pnf-ipv6-address").getStringValue()).isEqualTo("::/128"); + } else if (!action.equalsIgnoreCase(ASSIGN_ACTION)) { + assertThat(actionIdentifiers.getMode()).isEqualTo("sync"); + assertThat(propertiesStruct.getFieldsOrThrow("target-software-version").getStringValue()) + .isEqualTo(TEST_SOFTWARE_VERSION); + } else { + assertThat(actionIdentifiers.getMode()).isEqualTo("sync"); + } } } diff --git a/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/decisionpoint/impl/camunda/controller/cds/CdsControllerDETest.java b/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/decisionpoint/impl/camunda/controller/cds/PnfConfigCdsControllerDETest.java index 79bce8a1f4..d8f607f6d9 100644 --- a/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/decisionpoint/impl/camunda/controller/cds/CdsControllerDETest.java +++ b/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/decisionpoint/impl/camunda/controller/cds/PnfConfigCdsControllerDETest.java @@ -26,8 +26,10 @@ import org.camunda.bpm.engine.delegate.DelegateExecution; import org.junit.Before; import org.junit.Test; import org.junit.runner.RunWith; +import org.mockito.Mock; import org.onap.so.bpmn.infrastructure.decisionpoint.api.ControllerContext; import org.onap.so.bpmn.infrastructure.decisionpoint.api.controller.ControllerPreparable; +import org.onap.so.client.cds.AbstractCDSProcessingBBUtils; import org.onap.so.client.exception.ExceptionBuilder; import org.springframework.beans.factory.annotation.Autowired; import org.springframework.boot.test.mock.mockito.MockBean; @@ -35,11 +37,12 @@ import org.springframework.test.context.ContextConfiguration; import org.springframework.test.context.junit4.SpringJUnit4ClassRunner; @RunWith(SpringJUnit4ClassRunner.class) -@ContextConfiguration(classes = {CdsControllerDE.class, ExceptionBuilder.class}) -public class CdsControllerDETest { +@ContextConfiguration( + classes = {PnfConfigCdsControllerDE.class, ExceptionBuilder.class, AbstractCDSProcessingBBUtils.class}) +public class PnfConfigCdsControllerDETest { @Autowired - private CdsControllerDE cdsControllerDE; + private PnfConfigCdsControllerDE pnfConfigCdsControllerDE; @MockBean private ControllerContext controllerContext; @@ -47,20 +50,49 @@ public class CdsControllerDETest { @MockBean private ControllerPreparable<DelegateExecution> preparable; - @Before - public void setUp() { + @Mock + private AbstractCDSProcessingBBUtils abstractCDSProcessingBBUtils; + + @Test + public void testUnderstand_action_assign_TrueReturned() { + // when when(controllerContext.getControllerActor()).thenReturn("cds"); + when(controllerContext.getControllerScope()).thenReturn("pnf"); + when(controllerContext.getControllerAction()).thenReturn("config-assign"); + + // verify + assertTrue(pnfConfigCdsControllerDE.understand(controllerContext)); } @Test - public void testUnderstand_validContext_TrueReturned() { - assertTrue(cdsControllerDE.understand(controllerContext)); + public void testUnderstand_action_deploy_TrueReturned() { + // when + when(controllerContext.getControllerActor()).thenReturn("cds"); + when(controllerContext.getControllerScope()).thenReturn("pnf"); + when(controllerContext.getControllerAction()).thenReturn("config-deploy"); + + // verify + assertTrue(pnfConfigCdsControllerDE.understand(controllerContext)); + } + + @Test + public void testUnderstand_action_any_FalseReturned() { + // when + when(controllerContext.getControllerActor()).thenReturn("cds"); + when(controllerContext.getControllerScope()).thenReturn("pnf"); + when(controllerContext.getControllerAction()).thenReturn("any-action"); + + // verify + assertFalse(pnfConfigCdsControllerDE.understand(controllerContext)); } @Test public void testUnderstand_invalidContext_FalseReturned() { + // when when(controllerContext.getControllerActor()).thenReturn("appc"); - assertFalse(cdsControllerDE.understand(controllerContext)); + + // verify + assertFalse(pnfConfigCdsControllerDE.understand(controllerContext)); } } diff --git a/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/ControllerExecutionTest.java b/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/ControllerExecutionTest.java new file mode 100644 index 0000000000..72a987c395 --- /dev/null +++ b/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/ControllerExecutionTest.java @@ -0,0 +1,127 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Tech Mahindra + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.bpmn.infrastructure.flowspecific.tasks; + + +import static org.junit.Assert.assertEquals; +import static org.mockito.ArgumentMatchers.any; +import static org.mockito.ArgumentMatchers.eq; +import static org.mockito.Mockito.doReturn; +import static org.mockito.Mockito.doThrow; +import static org.mockito.Mockito.when; +import java.util.UUID; +import org.camunda.bpm.engine.delegate.BpmnError; +import org.junit.Before; +import org.junit.Test; +import org.mockito.ArgumentMatchers; +import org.mockito.InjectMocks; +import org.onap.so.bpmn.BaseTaskTest; +import org.onap.so.bpmn.common.BuildingBlockExecution; +import org.onap.so.bpmn.servicedecomposition.bbobjects.GenericVnf; +import org.onap.so.bpmn.servicedecomposition.bbobjects.ServiceInstance; +import org.onap.so.bpmn.servicedecomposition.entities.BuildingBlock; +import org.onap.so.bpmn.servicedecomposition.entities.ExecuteBuildingBlock; +import org.onap.so.bpmn.servicedecomposition.entities.ResourceKey; +import org.onap.so.bpmn.servicedecomposition.generalobjects.RequestContext; +import org.onap.so.client.exception.BBObjectNotFoundException; +import org.onap.so.db.catalog.beans.BBNameSelectionReference; +import org.onap.so.db.catalog.beans.VnfResourceCustomization; + + +public class ControllerExecutionTest extends BaseTaskTest { + + @InjectMocks + private ControllerExecution controllerExecution = new ControllerExecution(); + + private static final String TEST_SCOPE = "vfModule"; + private static final String TEST_BBNAME = "ConfigurationScaleOut"; + private static final String TEST_ACTION = "configScaleOut"; + private static final String TEST_CONTROLLER_ACTOR = "APPC"; + + private BuildingBlock buildingBlock = new BuildingBlock(); + VnfResourceCustomization vnfResourceCustomization = new VnfResourceCustomization(); + private ExecuteBuildingBlock executeBuildingBlock = new ExecuteBuildingBlock(); + private GenericVnf genericVnf; + private ServiceInstance serviceInstance; + private RequestContext requestContext; + private String msoRequestId; + + + @Before + public void before() throws BBObjectNotFoundException { + + genericVnf = setGenericVnf(); + serviceInstance = setServiceInstance(); + msoRequestId = UUID.randomUUID().toString(); + requestContext = setRequestContext(); + requestContext.setMsoRequestId(msoRequestId); + gBBInput.setRequestContext(requestContext); + buildingBlock.setBpmnAction(TEST_ACTION); + buildingBlock.setBpmnScope(TEST_SCOPE); + executeBuildingBlock.setBuildingBlock(buildingBlock); + execution.setVariable("buildingBlock", executeBuildingBlock); + + doThrow(new BpmnError("BPMN Error")).when(exceptionUtil) + .buildAndThrowWorkflowException(any(BuildingBlockExecution.class), eq(7000), any(Exception.class)); + + when(extractPojosForBB.extractByKey(any(), ArgumentMatchers.eq(ResourceKey.GENERIC_VNF_ID))) + .thenReturn(genericVnf); + when(extractPojosForBB.extractByKey(any(), ArgumentMatchers.eq(ResourceKey.SERVICE_INSTANCE_ID))) + .thenReturn(serviceInstance); + + + } + + @Test + public void testSetControllerActorScopeAction() throws Exception { + + + doReturn(vnfResourceCustomization).when(catalogDbClient).getVnfResourceCustomizationByModelCustomizationUUID( + genericVnf.getModelInfoGenericVnf().getModelCustomizationUuid()); + controllerExecution.setControllerActorScopeAction(execution); + assertEquals(TEST_SCOPE, execution.getVariable("scope")); + assertEquals(TEST_ACTION, execution.getVariable("action")); + assertEquals(TEST_CONTROLLER_ACTOR, execution.getVariable("controllerActor")); + + } + + + @Test + public void testSelectBB() throws Exception { + // given + BBNameSelectionReference bbNameSelectionReference = new BBNameSelectionReference(); + bbNameSelectionReference.setBbName(TEST_BBNAME); + bbNameSelectionReference.setAction(TEST_ACTION); + bbNameSelectionReference.setControllerActor(TEST_CONTROLLER_ACTOR); + bbNameSelectionReference.setScope(TEST_SCOPE); + doReturn(bbNameSelectionReference).when(catalogDbClient).getBBNameSelectionReference(TEST_CONTROLLER_ACTOR, + TEST_SCOPE, TEST_ACTION); + execution.setVariable("controllerActor", TEST_CONTROLLER_ACTOR); + execution.setVariable("scope", TEST_SCOPE); + execution.setVariable("action", TEST_ACTION); + + // when + controllerExecution.selectBB(execution); + // verify + assertEquals(TEST_BBNAME, execution.getVariable("bbName")); + } + +} diff --git a/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/GenericCDSProcessingBBTest.java b/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/GenericCDSProcessingBBTest.java new file mode 100644 index 0000000000..24bbc78afb --- /dev/null +++ b/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/GenericCDSProcessingBBTest.java @@ -0,0 +1,197 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Bell Canada. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ +package org.onap.so.bpmn.infrastructure.flowspecific.tasks; + +import org.camunda.bpm.engine.delegate.DelegateExecution; +import org.camunda.bpm.extension.mockito.delegate.DelegateExecutionFake; +import org.junit.Before; +import org.junit.Test; +import org.mockito.InjectMocks; +import org.mockito.Mock; +import org.onap.so.bpmn.BaseTaskTest; +import org.onap.so.bpmn.common.BuildingBlockExecution; +import org.onap.so.bpmn.common.DelegateExecutionImpl; +import org.onap.so.bpmn.infrastructure.decisionpoint.api.ControllerContext; +import org.onap.so.bpmn.infrastructure.decisionpoint.api.ControllerRunnable; +import org.onap.so.bpmn.servicedecomposition.bbobjects.GenericVnf; +import org.onap.so.bpmn.servicedecomposition.bbobjects.ServiceInstance; +import org.onap.so.bpmn.servicedecomposition.bbobjects.VfModule; +import org.onap.so.bpmn.servicedecomposition.entities.BuildingBlock; +import org.onap.so.bpmn.servicedecomposition.entities.ExecuteBuildingBlock; +import org.onap.so.bpmn.servicedecomposition.entities.GeneralBuildingBlock; +import org.onap.so.bpmn.servicedecomposition.entities.ResourceKey; +import org.onap.so.bpmn.servicedecomposition.generalobjects.RequestContext; +import org.onap.so.bpmn.servicedecomposition.generalobjects.RequestParameters; +import org.onap.so.bpmn.servicedecomposition.modelinfo.ModelInfoGenericVnf; +import org.onap.so.bpmn.servicedecomposition.modelinfo.ModelInfoServiceInstance; +import org.onap.so.bpmn.servicedecomposition.modelinfo.ModelInfoVfModule; +import org.onap.so.bpmn.servicedecomposition.tasks.ExtractPojosForBB; +import org.onap.so.client.cds.*; +import org.onap.so.client.cds.beans.AbstractCDSPropertiesBean; +import org.onap.so.client.exception.ExceptionBuilder; +import org.onap.so.serviceinstancebeans.ModelInfo; +import org.onap.so.serviceinstancebeans.Resources; +import org.onap.so.serviceinstancebeans.Service; +import org.onap.so.serviceinstancebeans.Vnfs; +import org.springframework.beans.factory.annotation.Autowired; +import java.util.ArrayList; +import java.util.HashMap; +import java.util.List; +import java.util.Map; +import static org.assertj.core.api.Assertions.assertThat; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.assertNotNull; +import static org.mockito.Mockito.*; + +public class GenericCDSProcessingBBTest extends BaseTaskTest { + + private static final String VNF_SCOPE = "vnf"; + private static final String TEST_VNF_MODEL_CUSTOMIZATION_UUID = "23ce9ac4-e5dd-11e9-81b4-2a2ae2dbcce4"; + private static final String DEPLOY_ACTION_FOR_CDS = "configDeploy"; + private static final String GENERAL_BLOCK_EXECUTION_MAP_KEY = "gBBInput"; + private static final String BUILDING_BLOCK = "buildingBlock"; + private static final String TEST_MSO_REQUEST_ID = "ff874603-4222-11e7-9252-005056850d2e"; + private static final String EXECUTION_OBJECT = "executionObject"; + private static final String BLUEPRINT_NAME = "test"; + private static final String BLUEPRINT_VERSION = "1.0.0"; + + @InjectMocks + private GenericCDSProcessingBB controllerRunnable; + + @Mock + private AbstractCDSProcessingBBUtils cdsDispather; + + @Mock + private GeneratePayloadForCds generatePayloadForCds; + + private BuildingBlockExecution buildingBlockExecution; + + private ExecuteBuildingBlock executeBuildingBlock; + + @Before + public void setUp() { + buildingBlockExecution = createBuildingBlockExecution(); + executeBuildingBlock = new ExecuteBuildingBlock(); + } + + @Test + public void testExecutionObjectCreationForVnf() throws Exception { + // given + ControllerContext<BuildingBlockExecution> controllerContext = new ControllerContext<>(); + controllerContext.setExecution(buildingBlockExecution); + controllerContext.setControllerActor("CDS"); + controllerContext.setControllerScope("vnf"); + setScopeAndAction(VNF_SCOPE, DEPLOY_ACTION_FOR_CDS); + AbstractCDSPropertiesBean cdsBean = prepareCDSBean(); + + doReturn(cdsBean).when(generatePayloadForCds).buildCdsPropertiesBean(buildingBlockExecution); + doNothing().when(cdsDispather).constructExecutionServiceInputObject(buildingBlockExecution); + doNothing().when(cdsDispather).sendRequestToCDSClient(buildingBlockExecution); + + // when + Boolean isUnderstandable = controllerRunnable.understand(controllerContext); + Boolean isReady = controllerRunnable.ready(controllerContext); + controllerRunnable.prepare(controllerContext); + controllerRunnable.run(controllerContext); + + // verify + assertEquals(isUnderstandable, true); + assertEquals(isReady, true); + AbstractCDSPropertiesBean executionObject = buildingBlockExecution.getVariable(EXECUTION_OBJECT); + assertNotNull(executionObject); + assertThat(executionObject).isInstanceOf(AbstractCDSPropertiesBean.class); + assertEquals(BLUEPRINT_NAME, executionObject.getBlueprintName()); + assertEquals(BLUEPRINT_VERSION, executionObject.getBlueprintVersion()); + assertEquals(TEST_MSO_REQUEST_ID, executionObject.getRequestId()); + assertNotNull(executionObject.getRequestObject()); + } + + private AbstractCDSPropertiesBean prepareCDSBean() { + AbstractCDSPropertiesBean cdsBean = new AbstractCDSPropertiesBean(); + cdsBean.setBlueprintName(BLUEPRINT_NAME); + cdsBean.setBlueprintVersion(BLUEPRINT_VERSION); + cdsBean.setRequestId(TEST_MSO_REQUEST_ID); + cdsBean.setRequestObject("requestObject"); + + return cdsBean; + } + + private GeneralBuildingBlock createGeneralBuildingBlock() { + GeneralBuildingBlock generalBuildingBlock = new GeneralBuildingBlock(); + RequestContext requestContext = new RequestContext(); + RequestParameters requestParameters = new RequestParameters(); + requestParameters.setUserParams(createRequestParameters()); + requestContext.setRequestParameters(requestParameters); + requestContext.setMsoRequestId(TEST_MSO_REQUEST_ID); + generalBuildingBlock.setRequestContext(requestContext); + return generalBuildingBlock; + } + + private List<Map<String, Object>> createRequestParameters() { + List<Map<String, Object>> userParams = new ArrayList<>(); + Map<String, Object> userParamMap = new HashMap<>(); + userParamMap.put("service", getUserParams()); + userParams.add(userParamMap); + return userParams; + } + + private Service getUserParams() { + Service service = new Service(); + Resources resources = new Resources(); + resources.setVnfs(createVnfList()); + service.setResources(resources); + return service; + } + + private List<Vnfs> createVnfList() { + List<Map<String, String>> instanceParamsListSearchedVnf = new ArrayList<>(); + Map<String, String> instanceParam = new HashMap<>(); + instanceParam.put("sec_group", "sec_group"); + instanceParam.put("net_id", "acl-cloud-region"); + instanceParamsListSearchedVnf.add(instanceParam); + Vnfs searchedVnf = createVnf(instanceParamsListSearchedVnf); + List<Vnfs> vnfList = new ArrayList<>(); + vnfList.add(searchedVnf); + return vnfList; + } + + private Vnfs createVnf(List<Map<String, String>> instanceParamsList) { + Vnfs vnf = new Vnfs(); + ModelInfo modelInfo = new ModelInfo(); + modelInfo.setModelCustomizationId(TEST_VNF_MODEL_CUSTOMIZATION_UUID); + vnf.setModelInfo(modelInfo); + vnf.setInstanceParams(instanceParamsList); + return vnf; + } + + private BuildingBlockExecution createBuildingBlockExecution() { + DelegateExecution execution = new DelegateExecutionFake(); + execution.setVariable(GENERAL_BLOCK_EXECUTION_MAP_KEY, createGeneralBuildingBlock()); + return new DelegateExecutionImpl(execution); + } + + private void setScopeAndAction(String scope, String action) { + BuildingBlock buildingBlock = new BuildingBlock(); + buildingBlock.setBpmnScope(scope); + buildingBlock.setBpmnAction(action); + executeBuildingBlock.setBuildingBlock(buildingBlock); + buildingBlockExecution.setVariable(BUILDING_BLOCK, executeBuildingBlock); + } +} diff --git a/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/GenericPnfCDSProcessingDETest.java b/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/GenericPnfCDSProcessingDETest.java new file mode 100644 index 0000000000..583e139edd --- /dev/null +++ b/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/flowspecific/tasks/GenericPnfCDSProcessingDETest.java @@ -0,0 +1,143 @@ +/*- + * ============LICENSE_START======================================================= + * Copyright (C) 2020 Nordix + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + * SPDX-License-Identifier: Apache-2.0 + * ============LICENSE_END========================================================= + */ +package org.onap.so.bpmn.infrastructure.flowspecific.tasks; + +import org.camunda.bpm.engine.delegate.DelegateExecution; +import org.camunda.bpm.extension.mockito.delegate.DelegateExecutionFake; +import org.junit.Before; +import org.junit.ClassRule; +import org.junit.Rule; +import org.junit.Test; +import org.junit.runner.RunWith; +import org.junit.runners.Parameterized; +import org.mockito.InjectMocks; +import org.mockito.Mock; +import org.onap.so.bpmn.BaseTaskTest; +import org.onap.so.bpmn.infrastructure.decisionpoint.api.ControllerContext; +import org.onap.so.client.cds.AbstractCDSProcessingBBUtils; +import org.onap.so.client.cds.GeneratePayloadForCds; +import org.onap.so.client.cds.beans.AbstractCDSPropertiesBean; +import org.onap.so.client.exception.ExceptionBuilder; +import org.skyscreamer.jsonassert.JSONAssert; +import org.springframework.test.context.ContextConfiguration; +import org.springframework.test.context.junit4.rules.SpringClassRule; +import org.springframework.test.context.junit4.rules.SpringMethodRule; +import java.util.Arrays; +import java.util.Collection; +import static org.assertj.core.api.Assertions.assertThat; +import static org.assertj.core.api.Assertions.fail; +import static org.junit.Assert.assertEquals; +import static org.mockito.Mockito.doNothing; +import static org.mockito.Mockito.doReturn; +import static org.onap.so.bpmn.infrastructure.pnf.delegate.ExecutionVariableNames.*; + +@RunWith(Parameterized.class) +public class GenericPnfCDSProcessingDETest extends BaseTaskTest { + + @ClassRule + public static final SpringClassRule springClassRule = new SpringClassRule(); + + @Rule + public final SpringMethodRule smr = new SpringMethodRule(); + + @InjectMocks + private GenericPnfCDSProcessingDE controllerRunnable; + + @Mock + private GeneratePayloadForCds generatePayloadForCds; + + @Mock + private AbstractCDSProcessingBBUtils cdsDispather; + + private static final String PRECHECK_ACTION = "precheck"; + private static final String DOWNLOAD_ACTION = "downloadNESw"; + private static final String ACTIVATE_ACTION = "activateNESw"; + private static final String POSTCHECK_ACTION = "postcheck"; + + private String description; + private String action; + private String scope; + private String expectedJson; + + public GenericPnfCDSProcessingDETest(String desc, String action, String scope, String expectedJson) { + this.description = desc; + this.action = action; + this.scope = scope; + this.expectedJson = expectedJson; + + } + + @Parameterized.Parameters(name = "index {0}") + public static Collection<String[]> data() { + return Arrays.asList(new String[][] { + {"Test JSON for action:" + PRECHECK_ACTION + " scope:pnf", PRECHECK_ACTION, "pnf", + buildExpectedJson(PRECHECK_ACTION, "pnf")}, + {"Test JSON for action:" + DOWNLOAD_ACTION + " scope:pnf", DOWNLOAD_ACTION, "pnf", + buildExpectedJson(DOWNLOAD_ACTION, "pnf")}, + {"Test JSON for action:" + ACTIVATE_ACTION + " scope:pnf", ACTIVATE_ACTION, "pnf", + buildExpectedJson(ACTIVATE_ACTION, "pnf")}, + {"Test JSON for action:" + POSTCHECK_ACTION + " scope:pnf", POSTCHECK_ACTION, "pnf", + buildExpectedJson(POSTCHECK_ACTION, "pnf")},}); + } + + private static String buildExpectedJson(String action, String scope) { + return "{\"" + action + "-request\":" + "{\"" + action + "-" + "properties\":" + + "{\"service-instance-id\":\"test_service_id\"," + + "\"pnf-customization-uuid\":\"9acb3a83-8a52-412c-9a45-901764938144\"," + + "\"pnf-id\":\"5df8b6de-2083-11e7-93ae-92361f002671\"," + + "\"target-software-version\":\"demo-sw-ver2.0.0\"," + "\"pnf-name\":\"PNFDemo\"," + + "\"service-model-uuid\":\"6bc0b04d-1873-4721-b53d-6615225b2a28\"}," + "\"resolution-key\":\"PNFDemo\"" + + "}" + "}"; + } + + private DelegateExecution execution = new DelegateExecutionFake(); + + @Test + public void testExecution_validPnf_action_executionObjectCreated() { + try { + + // given + ControllerContext controllerContext = new ControllerContext(); + controllerContext.setExecution(execution); + controllerContext.setControllerActor("cds"); + controllerContext.setControllerAction(this.action); + controllerContext.setControllerScope(this.scope); + AbstractCDSPropertiesBean bean = new AbstractCDSPropertiesBean(); + doNothing().when(cdsDispather).constructExecutionServiceInputObject(execution); + doNothing().when(cdsDispather).sendRequestToCDSClient(execution); + doReturn(bean).when(generatePayloadForCds).buildCdsPropertiesBean(execution); + + // when + Boolean isUnderstandable = controllerRunnable.understand(controllerContext); + Boolean isReady = controllerRunnable.ready(controllerContext); + controllerRunnable.prepare(controllerContext); + controllerRunnable.run(controllerContext); + + // verify + assertEquals(isUnderstandable, true); + assertEquals(isReady, true); + Object executionObject = execution.getVariable(EXECUTION_OBJECT); + assertThat(executionObject).isNotNull(); + assertThat(executionObject).isInstanceOf(AbstractCDSPropertiesBean.class); + } catch (Exception e) { + e.printStackTrace(); + fail("Exception thrown" + e.getMessage()); + } + } +} diff --git a/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/workflow/tasks/WorkflowActionTest.java b/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/workflow/tasks/WorkflowActionTest.java index 8e47c34cb0..4fdd97d95a 100644 --- a/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/workflow/tasks/WorkflowActionTest.java +++ b/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/workflow/tasks/WorkflowActionTest.java @@ -41,6 +41,7 @@ import static org.mockito.ArgumentMatchers.eq; import static org.mockito.ArgumentMatchers.isA; import static org.mockito.Mockito.doReturn; import static org.mockito.Mockito.doThrow; +import static org.mockito.Mockito.doAnswer; import static org.mockito.Mockito.when; import com.fasterxml.jackson.databind.ObjectMapper; import java.io.IOException; @@ -228,6 +229,77 @@ public class WorkflowActionTest extends BaseTaskTest { } @Test + public void selectExecutionListExceptionAlreadyBuiltTest() throws Exception { + DelegateExecution delegateExecution = new DelegateExecutionFake(); + String gAction = "deleteInstance"; + String resource = "VfModule"; + delegateExecution.setVariable("mso-request-id", "00f704ca-c5e5-4f95-a72c-6889db7b0688"); + delegateExecution.setVariable("requestAction", gAction); + String bpmnRequest = + new String(Files.readAllBytes(Paths.get("src/test/resources/__files/VfModuleCreateWithFabric.json"))); + delegateExecution.setVariable("bpmnRequest", bpmnRequest); + delegateExecution.setVariable("aLaCarte", true); + delegateExecution.setVariable("apiVersion", "7"); + delegateExecution.setVariable("requestUri", + "v7/serviceInstances/f647e3ef-6d2e-4cd3-bff4-8df4634208de/vnfs/b80b16a5-f80d-4ffa-91c8-bd47c7438a3d/vfModules"); + + NorthBoundRequest northBoundRequest = new NorthBoundRequest(); + List<OrchestrationFlow> orchFlows = createFlowList("DeactivateVfModuleBB", "DeleteVfModuleBB", + "UnassignVfModuleBB", "DeactivateFabricConfigurationBB", "UnassignFabricConfigurationBB"); + northBoundRequest.setOrchestrationFlowList(orchFlows); + + when(catalogDbClient.getNorthBoundRequestByActionAndIsALaCarteAndRequestScopeAndCloudOwner(gAction, resource, + true, "my-custom-cloud-owner")).thenReturn(northBoundRequest); + + doAnswer(invocation -> { + DelegateExecutionFake execution = invocation.getArgument(0); + execution.setVariable("WorkflowException", "exception"); + execution.setVariable("WorkflowExceptionErrorMessage", "errorMessage"); + throw new BpmnError("WorkflowException"); + }).when(exceptionUtil).buildAndThrowWorkflowException(delegateExecution, 7000, + "Exception in getConfigBuildingBlock: Multiple relationships exist from VNFC testVnfcName to Configurations"); + + + org.onap.aai.domain.yang.GenericVnf vnf = new org.onap.aai.domain.yang.GenericVnf(); + vnf.setVnfId("vnf0"); + vnf.setModelCustomizationId("modelCustomizationId"); + when(bbSetupUtils.getAAIGenericVnf(any())).thenReturn(vnf); + + org.onap.aai.domain.yang.VfModule vfModule = new org.onap.aai.domain.yang.VfModule(); + vfModule.setModelCustomizationId("modelCustomizationId"); + when(bbSetupUtils.getAAIVfModule(any(), any())).thenReturn(vfModule); + + List<org.onap.aai.domain.yang.Vnfc> vnfcs = new ArrayList<org.onap.aai.domain.yang.Vnfc>(); + org.onap.aai.domain.yang.Vnfc vnfc = new org.onap.aai.domain.yang.Vnfc(); + vnfc.setModelInvariantId("modelInvariantId"); + vnfc.setVnfcName("testVnfcName"); + vnfcs.add(vnfc); + doReturn(vnfcs).when(SPY_workflowAction).getRelatedResourcesInVfModule(any(), any(), any(), any()); + + List<org.onap.aai.domain.yang.Configuration> configurations = + new ArrayList<org.onap.aai.domain.yang.Configuration>(); + org.onap.aai.domain.yang.Configuration configuration = new org.onap.aai.domain.yang.Configuration(); + configuration.setConfigurationId("configurationId"); + configuration.setModelCustomizationId("modelCustimizationId"); + configuration.setConfigurationName("testConfigurationName"); + configurations.add(configuration); + org.onap.aai.domain.yang.Configuration configuration1 = new org.onap.aai.domain.yang.Configuration(); + configuration1.setConfigurationId("configurationId"); + configuration1.setModelCustomizationId("modelCustimizationId"); + configuration1.setConfigurationName("testConfigurationName"); + configurations.add(configuration1); + doReturn(configurations).when(SPY_workflowAction).getRelatedResourcesInVnfc(any(), any(), any()); + + doReturn("testName").when(SPY_workflowAction).getVnfcNameForConfiguration(any()); + + thrown.expect(BpmnError.class); + SPY_workflowAction.selectExecutionList(delegateExecution); + assertEquals( + "Exception in getConfigBuildingBlock: Multiple relationships exist from VNFC testVnfcName to Configurations", + delegateExecution.getVariable("WorkflowException")); + } + + @Test public void selectExecutionListDuplicateNameExceptionTest() throws Exception { String gAction = "createInstance"; execution.setVariable("mso-request-id", "00f704ca-c5e5-4f95-a72c-6889db7b0688"); diff --git a/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/workflow/tasks/listeners/SkipCDSBuildingBlockListenerTest.java b/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/workflow/tasks/listeners/SkipCDSBuildingBlockListenerTest.java new file mode 100644 index 0000000000..fb162f857b --- /dev/null +++ b/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/workflow/tasks/listeners/SkipCDSBuildingBlockListenerTest.java @@ -0,0 +1,202 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Tech Mahindra + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.bpmn.infrastructure.workflow.tasks.listeners; + +import static org.junit.Assert.assertEquals; +import static org.mockito.Mockito.when; +import java.util.ArrayList; +import java.util.List; +import org.camunda.bpm.extension.mockito.delegate.DelegateExecutionFake; +import org.junit.Before; +import org.junit.Test; +import org.junit.runner.RunWith; +import org.mockito.InjectMocks; +import org.mockito.Mock; +import org.mockito.junit.MockitoJUnitRunner; +import org.onap.so.bpmn.common.BBConstants; +import org.onap.so.bpmn.common.BuildingBlockExecution; +import org.onap.so.bpmn.common.DelegateExecutionImpl; +import org.onap.so.bpmn.servicedecomposition.entities.BuildingBlock; +import org.onap.so.bpmn.servicedecomposition.entities.ExecuteBuildingBlock; +import org.onap.so.db.catalog.beans.VfModuleCustomization; +import org.onap.so.db.catalog.beans.VnfResourceCustomization; +import org.onap.so.db.catalog.client.CatalogDbClient; +import org.onap.so.serviceinstancebeans.ModelInfo; +import org.onap.so.serviceinstancebeans.RequestDetails; + +@RunWith(MockitoJUnitRunner.Silent.class) +public class SkipCDSBuildingBlockListenerTest { + + private static final String VNF_SCOPE = "VNF"; + private static final String VF_SCOPE = "VFModule"; + private static final String TEST_MODELUUID = "123456789"; + private static final String VNF_TEST_ACTION = "VnfConfigAssign"; + private static final String VFModule_TEST_ACTION = "VfModuleConfigAssign"; + private static final String MODELCUSTOMIZATIONUUID = "123456789"; + private static final String BBNAME = "ControllerExecutionBB"; + private static final boolean ISFIRST = true; + + private int actual; + private List<ExecuteBuildingBlock> flowsToExecute = new ArrayList<>(); + private List<VnfResourceCustomization> vnfResourceCustomization; + private List<VfModuleCustomization> vfModuleCustomization; + private ExecuteBuildingBlock executeBuildingBlock = new ExecuteBuildingBlock(); + private RequestDetails reqDetail = new RequestDetails(); + private BuildingBlockExecution buildingBlockExecution = new DelegateExecutionImpl(new DelegateExecutionFake()); + private VnfResourceCustomization vnfCust = new VnfResourceCustomization(); + private VfModuleCustomization vfCust = new VfModuleCustomization(); + private BuildingBlock buildingBlock = new BuildingBlock(); + + @InjectMocks + private SkipCDSBuildingBlockListener skipCDSBuildingBlockListener; + @Mock + private CatalogDbClient catalogDbClient; + + @Before + public void before() { + ModelInfo model = new ModelInfo(); + model.setModelUuid(TEST_MODELUUID); + reqDetail.setModelInfo(model); + executeBuildingBlock.setRequestDetails(reqDetail); + } + + @Test + public void testTrigger() { + BuildingBlockExecution execution = new DelegateExecutionImpl(new DelegateExecutionFake()); + skipCDSBuildingBlockListener.shouldRunFor(BBNAME, ISFIRST, execution); + assertEquals("ControllerExecutionBB", BBNAME); + } + + @Test + public void testProcessForVNFToSkipCDSBB() { + // given + setBuildingBlockAndCurrentSequence(VNF_SCOPE, VNF_TEST_ACTION, 0); + vnfResourceCustomization = getVnfResourceCustomizationList(true); + + when(catalogDbClient.getVnfResourceCustomizationByModelUuid( + executeBuildingBlock.getRequestDetails().getModelInfo().getModelUuid())) + .thenReturn(vnfResourceCustomization); + when(catalogDbClient.findVnfResourceCustomizationInList(executeBuildingBlock.getBuildingBlock().getKey(), + vnfResourceCustomization)).thenReturn(vnfCust); + + // when + skipCDSBuildingBlockListener.run(flowsToExecute, executeBuildingBlock, buildingBlockExecution); + + // then + actual = buildingBlockExecution.getVariable(BBConstants.G_CURRENT_SEQUENCE); + assertEquals(1, actual); + + } + + @Test + public void testProcessForVNFNotToSkipCDSBB() { + // given + setBuildingBlockAndCurrentSequence(VNF_SCOPE, VNF_TEST_ACTION, 0); + vnfResourceCustomization = getVnfResourceCustomizationList(false); + + when(catalogDbClient.getVnfResourceCustomizationByModelUuid( + executeBuildingBlock.getRequestDetails().getModelInfo().getModelUuid())) + .thenReturn(vnfResourceCustomization); + when(catalogDbClient.findVnfResourceCustomizationInList(executeBuildingBlock.getBuildingBlock().getKey(), + vnfResourceCustomization)).thenReturn(vnfCust); + + // when + skipCDSBuildingBlockListener.run(flowsToExecute, executeBuildingBlock, buildingBlockExecution); + + // then + actual = buildingBlockExecution.getVariable(BBConstants.G_CURRENT_SEQUENCE); + assertEquals(0, actual); + + } + + + @Test + public void testProcessForVFToSkipCDSBB() { + // given + setBuildingBlockAndCurrentSequence(VF_SCOPE, VFModule_TEST_ACTION, 0); + vfModuleCustomization = getVfModuleCustomizationList(true); + + when(catalogDbClient + .getVfModuleCustomizationByModelCuztomizationUUID(executeBuildingBlock.getBuildingBlock().getKey())) + .thenReturn(vfCust); + + // when + skipCDSBuildingBlockListener.run(flowsToExecute, executeBuildingBlock, buildingBlockExecution); + + // then + actual = buildingBlockExecution.getVariable(BBConstants.G_CURRENT_SEQUENCE); + assertEquals(1, actual); + + } + + @Test + public void testProcessForVFNotToSkipCDSBB() { + // given + setBuildingBlockAndCurrentSequence(VF_SCOPE, VFModule_TEST_ACTION, 0); + vfModuleCustomization = getVfModuleCustomizationList(false); + + when(catalogDbClient + .getVfModuleCustomizationByModelCuztomizationUUID(executeBuildingBlock.getBuildingBlock().getKey())) + .thenReturn(vfCust); + + // when + skipCDSBuildingBlockListener.run(flowsToExecute, executeBuildingBlock, buildingBlockExecution); + + // then + actual = buildingBlockExecution.getVariable(BBConstants.G_CURRENT_SEQUENCE); + assertEquals(0, actual); + + } + + /** + * setting scope action in buildingBlock and BB current sequence in BuildingBlockExecution + * + * @param scope + * @param action + * @param squence + */ + private void setBuildingBlockAndCurrentSequence(String scope, String action, int sequence) { + buildingBlock.setBpmnScope(scope); + buildingBlock.setBpmnAction(action); + buildingBlock.setBpmnFlowName("ControllerExecutionBB"); + buildingBlock.setKey(MODELCUSTOMIZATIONUUID); + executeBuildingBlock.setBuildingBlock(buildingBlock); + buildingBlockExecution.setVariable(BBConstants.G_CURRENT_SEQUENCE, sequence); + + } + + private List<VnfResourceCustomization> getVnfResourceCustomizationList(boolean setSkippost) { + List<VnfResourceCustomization> vnfResourceCustomizations = new ArrayList<>(); + vnfCust.setModelCustomizationUUID(MODELCUSTOMIZATIONUUID); + vnfCust.setSkipPostInstConf(setSkippost); + vnfResourceCustomizations.add(vnfCust); + return vnfResourceCustomizations; + } + + private List<VfModuleCustomization> getVfModuleCustomizationList(boolean setSkippost) { + List<VfModuleCustomization> vfModuleCustomizations = new ArrayList<>(); + vfCust.setModelCustomizationUUID(MODELCUSTOMIZATIONUUID); + vfCust.setSkipPostInstConf(setSkippost); + vfModuleCustomizations.add(vfCust); + return vfModuleCustomizations; + } + +} diff --git a/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/workflow/tasks/utils/WorkflowResourceIdsUtilsTest.java b/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/workflow/tasks/utils/WorkflowResourceIdsUtilsTest.java new file mode 100644 index 0000000000..0d68cf362b --- /dev/null +++ b/bpmn/so-bpmn-tasks/src/test/java/org/onap/so/bpmn/infrastructure/workflow/tasks/utils/WorkflowResourceIdsUtilsTest.java @@ -0,0 +1,124 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Nokia Intellectual Property. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.bpmn.infrastructure.workflow.tasks.utils; + +import org.camunda.bpm.extension.mockito.delegate.DelegateExecutionFake; +import org.junit.Before; +import org.junit.Test; +import org.onap.so.bpmn.infrastructure.workflow.tasks.WorkflowType; +import org.onap.so.bpmn.servicedecomposition.entities.WorkflowResourceIds; +import java.util.function.Supplier; +import static org.junit.Assert.assertEquals; + + +public class WorkflowResourceIdsUtilsTest { + + private static final String SERVICE_ID = "serviceId"; + private static final String NETWORK_ID = "networkId"; + private static final String VF_MODULE_ID = "vfModuleId"; + private static final String VNF_ID = "vnfId"; + private static final String VOLUME_GROUP_ID = "volumeGroupId"; + private static final String INSTANCE_GROUP_ID = "instanceGroupId"; + private static final String PNF_ID = "pnfId"; + private static final String NETWORK_COLLECTION_ID = "networkCollectionId"; + private static final String CONFIGURATION_ID = "configurationId"; + + private WorkflowResourceIds workflowResourceIds; + + @Before + public void setUp() { + workflowResourceIds = new WorkflowResourceIds(); + } + + @Test + public void shouldProperlySetFieldsFromExecution() { + DelegateExecutionFake execution = new DelegateExecutionFake(); + execution.setVariable("serviceInstanceId", SERVICE_ID); + execution.setVariable("networkId", NETWORK_ID); + execution.setVariable("vfModuleId", VF_MODULE_ID); + execution.setVariable("vnfId", VNF_ID); + execution.setVariable("volumeGroupId", VOLUME_GROUP_ID); + execution.setVariable("instanceGroupId", INSTANCE_GROUP_ID); + + workflowResourceIds = WorkflowResourceIdsUtils.getWorkflowResourceIdsFromExecution(execution); + + assertEquals(SERVICE_ID, workflowResourceIds.getServiceInstanceId()); + assertEquals(NETWORK_ID, workflowResourceIds.getNetworkId()); + assertEquals(VF_MODULE_ID, workflowResourceIds.getVfModuleId()); + assertEquals(VNF_ID, workflowResourceIds.getVnfId()); + assertEquals(VOLUME_GROUP_ID, workflowResourceIds.getVolumeGroupId()); + assertEquals(INSTANCE_GROUP_ID, workflowResourceIds.getInstanceGroupId()); + } + + @Test + public void shouldProperlySetServiceInstanceId() { + assertFieldSetProperly(WorkflowType.SERVICE, SERVICE_ID, workflowResourceIds::getServiceInstanceId); + } + + @Test + public void shouldProperlySetVnfId() { + assertFieldSetProperly(WorkflowType.VNF, VNF_ID, workflowResourceIds::getVnfId); + + } + + @Test + public void shouldProperlySetPnfId() { + assertFieldSetProperly(WorkflowType.PNF, PNF_ID, workflowResourceIds::getPnfId); + } + + @Test + public void shouldProperlySetVfModuleId() { + assertFieldSetProperly(WorkflowType.VFMODULE, VF_MODULE_ID, workflowResourceIds::getVfModuleId); + } + + @Test + public void shouldProperlySetVolumeGroupId() { + assertFieldSetProperly(WorkflowType.VOLUMEGROUP, VOLUME_GROUP_ID, workflowResourceIds::getVolumeGroupId); + } + + @Test + public void shouldProperlySetNetworkId() { + assertFieldSetProperly(WorkflowType.NETWORK, NETWORK_ID, workflowResourceIds::getNetworkId); + } + + @Test + public void shouldProperlySetNetworkCollectionId() { + assertFieldSetProperly(WorkflowType.NETWORKCOLLECTION, NETWORK_COLLECTION_ID, + workflowResourceIds::getNetworkCollectionId); + + } + + @Test + public void shouldProperlySetConfigurationId() { + assertFieldSetProperly(WorkflowType.CONFIGURATION, CONFIGURATION_ID, workflowResourceIds::getConfigurationId); + } + + @Test + public void shouldProperlySetInstanceGroupId() { + assertFieldSetProperly(WorkflowType.INSTANCE_GROUP, INSTANCE_GROUP_ID, workflowResourceIds::getInstanceGroupId); + } + + private void assertFieldSetProperly(WorkflowType workflowType, String expectedId, + Supplier<String> testedObjectField) { + WorkflowResourceIdsUtils.setResourceIdByWorkflowType(workflowResourceIds, workflowType, expectedId); + assertEquals(expectedId, testedObjectField.get()); + } +} diff --git a/cloudify-client/pom.xml b/cloudify-client/pom.xml index 6f4ea03ca5..6bb9357c38 100644 --- a/cloudify-client/pom.xml +++ b/cloudify-client/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>so</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <groupId>org.onap.so</groupId> diff --git a/common/pom.xml b/common/pom.xml index 04deacf129..02d2f35545 100644 --- a/common/pom.xml +++ b/common/pom.xml @@ -5,7 +5,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>so</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>common</artifactId> <name>MSO Common classes</name> @@ -59,7 +59,7 @@ <dependency> <groupId>org.onap.aai.schema-service</groupId> <artifactId>aai-schema</artifactId> - <version>1.6.3</version> + <version>1.6.4-SNAPSHOT</version> </dependency> <dependency> <groupId>org.modelmapper</groupId> diff --git a/common/src/main/java/org/onap/so/beans/nsmf/ActDeActNssi.java b/common/src/main/java/org/onap/so/beans/nsmf/ActDeActNssi.java new file mode 100644 index 0000000000..8d45048ee4 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/ActDeActNssi.java @@ -0,0 +1,51 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class ActDeActNssi { + + public final static String ACT_URL = "/api/rest/provMns/v1/NSS/%s" + "/activation"; + + public final static String DE_ACT_URL = "/api/rest/provMns/v1/NSS/%s" + "/deactivation"; + + private String nsiId; + + private String nssiId; + + public String getNsiId() { + return nsiId; + } + + public void setNsiId(String nsiId) { + this.nsiId = nsiId; + } + + public String getNssiId() { + return nssiId; + } + + public void setNssiId(String nssiId) { + this.nssiId = nssiId; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/AllocateAnNssi.java b/common/src/main/java/org/onap/so/beans/nsmf/AllocateAnNssi.java new file mode 100644 index 0000000000..484f5b42b1 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/AllocateAnNssi.java @@ -0,0 +1,109 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class AllocateAnNssi { + + public final static String URL = "/api/rest/provMns/v1/an/NSS" + "/SliceProfiles"; + + private String nsstId; + + private String flavorId; + + private String nssiId; + + private String nssiName; + + private AnSliceProfile sliceProfile; + + private String scriptName; + + private Object extension; + + private NsiInfo nsiInfo; + + public String getNsstId() { + return nsstId; + } + + public void setNsstId(String nsstId) { + this.nsstId = nsstId; + } + + public String getFlavorId() { + return flavorId; + } + + public void setFlavorId(String flavorId) { + this.flavorId = flavorId; + } + + public String getNssiId() { + return nssiId; + } + + public void setNssiId(String nssiId) { + this.nssiId = nssiId; + } + + public String getNssiName() { + return nssiName; + } + + public void setNssiName(String nssiName) { + this.nssiName = nssiName; + } + + public AnSliceProfile getSliceProfile() { + return sliceProfile; + } + + public void setSliceProfile(AnSliceProfile sliceProfile) { + this.sliceProfile = sliceProfile; + } + + public String getScriptName() { + return scriptName; + } + + public void setScriptName(String scriptName) { + this.scriptName = scriptName; + } + + public Object getExtension() { + return extension; + } + + public void setExtension(Object extension) { + this.extension = extension; + } + + public NsiInfo getNsiInfo() { + return nsiInfo; + } + + public void setNsiInfo(NsiInfo nsiInfo) { + this.nsiInfo = nsiInfo; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/AllocateCnNssi.java b/common/src/main/java/org/onap/so/beans/nsmf/AllocateCnNssi.java new file mode 100644 index 0000000000..d03673368c --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/AllocateCnNssi.java @@ -0,0 +1,110 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; +import java.io.Serializable; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class AllocateCnNssi implements Serializable { + + public final static String URL = "/api/rest/provMns/v1/NSS/SliceProfiles"; + + private String nsstId; + + private String flavorId; + + private String nssiId; + + private String nssiName; + + private CnSliceProfile sliceProfile; + + private String scriptName; + + private Object extension; + + private NsiInfo nsiInfo; + + public NsiInfo getNsiInfo() { + return nsiInfo; + } + + public void setNsiInfo(NsiInfo nsiInfo) { + this.nsiInfo = nsiInfo; + } + + public String getNsstId() { + return nsstId; + } + + public void setNsstId(String nsstId) { + this.nsstId = nsstId; + } + + public String getScriptName() { + return scriptName; + } + + public void setScriptName(String scriptName) { + this.scriptName = scriptName; + } + + public CnSliceProfile getSliceProfile() { + return sliceProfile; + } + + public void setSliceProfile(CnSliceProfile sliceProfile) { + this.sliceProfile = sliceProfile; + } + + public String getFlavorId() { + return flavorId; + } + + public void setFlavorId(String flavorId) { + this.flavorId = flavorId; + } + + public String getNssiId() { + return nssiId; + } + + public void setNssiId(String nssiId) { + this.nssiId = nssiId; + } + + public String getNssiName() { + return nssiName; + } + + public void setNssiName(String nssiName) { + this.nssiName = nssiName; + } + + public void setExtension(Object extension) { + this.extension = extension; + } + + public Object getExtension() { + return extension; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/AllocateTnNssi.java b/common/src/main/java/org/onap/so/beans/nsmf/AllocateTnNssi.java new file mode 100644 index 0000000000..b66fb133d2 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/AllocateTnNssi.java @@ -0,0 +1,109 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class AllocateTnNssi { + + public final static String URL = "/api/rest/provMns/v1/tn/NSS" + "/SliceProfiles"; + + private String nsstId; + + private String flavorId; + + private String nssiId; + + private String nssiName; + + private TnSliceProfile sliceProfile; + + private String scriptName; + + private Object extension; + + private NsiInfo nsiInfo; + + public String getNsstId() { + return nsstId; + } + + public void setNsstId(String nsstId) { + this.nsstId = nsstId; + } + + public String getFlavorId() { + return flavorId; + } + + public void setFlavorId(String flavorId) { + this.flavorId = flavorId; + } + + public String getNssiId() { + return nssiId; + } + + public void setNssiId(String nssiId) { + this.nssiId = nssiId; + } + + public String getNssiName() { + return nssiName; + } + + public void setNssiName(String nssiName) { + this.nssiName = nssiName; + } + + public TnSliceProfile getSliceProfile() { + return sliceProfile; + } + + public void setSliceProfile(TnSliceProfile sliceProfile) { + this.sliceProfile = sliceProfile; + } + + public String getScriptName() { + return scriptName; + } + + public void setScriptName(String scriptName) { + this.scriptName = scriptName; + } + + public Object getExtension() { + return extension; + } + + public void setExtension(Object extension) { + this.extension = extension; + } + + public NsiInfo getNsiInfo() { + return nsiInfo; + } + + public void setNsiInfo(NsiInfo nsiInfo) { + this.nsiInfo = nsiInfo; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/AnSliceProfile.java b/common/src/main/java/org/onap/so/beans/nsmf/AnSliceProfile.java new file mode 100644 index 0000000000..3d60949385 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/AnSliceProfile.java @@ -0,0 +1,61 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; +import com.fasterxml.jackson.annotation.JsonProperty; +import java.util.List; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class AnSliceProfile { + + @JsonProperty("5QI") + private String qi; + + private List<String> coverageAreaTAList; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int latency; + + public String getQi() { + return qi; + } + + public void setQi(String qi) { + this.qi = qi; + } + + public List<String> getCoverageAreaTAList() { + return coverageAreaTAList; + } + + public void setCoverageAreaTAList(List<String> coverageAreaTAList) { + this.coverageAreaTAList = coverageAreaTAList; + } + + public int getLatency() { + return latency; + } + + public void setLatency(int latency) { + this.latency = latency; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/CnSliceProfile.java b/common/src/main/java/org/onap/so/beans/nsmf/CnSliceProfile.java new file mode 100644 index 0000000000..3bd155d512 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/CnSliceProfile.java @@ -0,0 +1,120 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; +import java.util.List; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class CnSliceProfile { + + private List<String> snssaiList; + + private String sliceProfileId; + + private List<String> plmnIdList; + + private PerfReq perfReq; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int maxNumberofUEs; + + private List<String> coverageAreaTAList; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int latency; + + private UeMobilityLevel ueMobilityLevel; + + private ResourceSharingLevel resourceSharingLevel; + + public String getSliceProfileId() { + return sliceProfileId; + } + + public void setSliceProfileId(String sliceProfileId) { + this.sliceProfileId = sliceProfileId; + } + + public List<String> getPlmnIdList() { + return plmnIdList; + } + + public void setPlmnIdList(List<String> plmnIdList) { + this.plmnIdList = plmnIdList; + } + + public PerfReq getPerfReq() { + return perfReq; + } + + public void setPerfReq(PerfReq perfReq) { + this.perfReq = perfReq; + } + + public int getMaxNumberofUEs() { + return maxNumberofUEs; + } + + public void setMaxNumberofUEs(int maxNumberofUEs) { + this.maxNumberofUEs = maxNumberofUEs; + } + + public List<String> getCoverageAreaTAList() { + return coverageAreaTAList; + } + + public void setCoverageAreaTAList(List<String> coverageAreaTAList) { + this.coverageAreaTAList = coverageAreaTAList; + } + + public int getLatency() { + return latency; + } + + public void setLatency(int latency) { + this.latency = latency; + } + + public UeMobilityLevel getUeMobilityLevel() { + return ueMobilityLevel; + } + + public void setUeMobilityLevel(UeMobilityLevel ueMobilityLevel) { + this.ueMobilityLevel = ueMobilityLevel; + } + + public ResourceSharingLevel getResourceSharingLevel() { + return resourceSharingLevel; + } + + public void setResourceSharingLevel(ResourceSharingLevel resourceSharingLevel) { + this.resourceSharingLevel = resourceSharingLevel; + } + + public List<String> getSnssaiList() { + return snssaiList; + } + + public void setSnssaiList(List<String> snssaiList) { + this.snssaiList = snssaiList; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/CreateCnNssi.java b/common/src/main/java/org/onap/so/beans/nsmf/CreateCnNssi.java new file mode 100644 index 0000000000..424966948e --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/CreateCnNssi.java @@ -0,0 +1,89 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class CreateCnNssi { + + public final static String URL = "/api/rest/provMns/v1/NSS/nssi"; + + private String nsstId; + + private String flavorId; + + private String nssiName; + + private String scriptName; + + private String extension; + + private NsiInfo nsiInfo; + + public String getNsstId() { + return nsstId; + } + + public void setNsstId(String nsstId) { + this.nsstId = nsstId; + } + + public String getFlavorId() { + return flavorId; + } + + public void setFlavorId(String flavorId) { + this.flavorId = flavorId; + } + + public String getNssiName() { + return nssiName; + } + + public void setNssiName(String nssiName) { + this.nssiName = nssiName; + } + + public String getScriptName() { + return scriptName; + } + + public void setScriptName(String scriptName) { + this.scriptName = scriptName; + } + + public String getExtension() { + return extension; + } + + public void setExtension(String extension) { + this.extension = extension; + } + + public NsiInfo getNsiInfo() { + return nsiInfo; + } + + public void setNsiInfo(NsiInfo nsiInfo) { + this.nsiInfo = nsiInfo; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/DeAllocateNssi.java b/common/src/main/java/org/onap/so/beans/nsmf/DeAllocateNssi.java new file mode 100644 index 0000000000..648fd4985f --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/DeAllocateNssi.java @@ -0,0 +1,91 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; +import java.util.List; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class DeAllocateNssi { + + public final static String URL = "/api/rest/provMns/v1/NSS" + "/SliceProfiles/%s"; + + private String nsiId; + + private String nssiId; + + private List<String> snssaiList; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int terminateNssiOption; + + private String scriptName; + + private String extension; + + public String getNsiId() { + return nsiId; + } + + public void setNsiId(String nsiId) { + this.nsiId = nsiId; + } + + public String getNssiId() { + return nssiId; + } + + public void setNssiId(String nssiId) { + this.nssiId = nssiId; + } + + public List<String> getSnssaiList() { + return snssaiList; + } + + public void setSnssaiList(List<String> snssaiList) { + this.snssaiList = snssaiList; + } + + public int getTerminateNssiOption() { + return terminateNssiOption; + } + + public void setTerminateNssiOption(int terminateNssiOption) { + this.terminateNssiOption = terminateNssiOption; + } + + public String getScriptName() { + return scriptName; + } + + public void setScriptName(String scriptName) { + this.scriptName = scriptName; + } + + public String getExtension() { + return extension; + } + + public void setExtension(String extension) { + this.extension = extension; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/EsrInfo.java b/common/src/main/java/org/onap/so/beans/nsmf/EsrInfo.java new file mode 100644 index 0000000000..c124bfa944 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/EsrInfo.java @@ -0,0 +1,47 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class EsrInfo { + + private String vendor; + + private NetworkType networkType; + + public String getVendor() { + return vendor; + } + + public void setVendor(String vendor) { + this.vendor = vendor; + } + + public NetworkType getNetworkType() { + return networkType; + } + + public void setNetworkType(NetworkType networkType) { + this.networkType = networkType; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/JobStatusRequest.java b/common/src/main/java/org/onap/so/beans/nsmf/JobStatusRequest.java new file mode 100644 index 0000000000..cc8503c250 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/JobStatusRequest.java @@ -0,0 +1,70 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class JobStatusRequest { + + public final static String URL = "/api/rest/provMns/v1/NSS/jobs/%s"; + + private String nsiId; + + private String nssiId; + + private String responseId; + + private EsrInfo esrInfo; + + public String getNsiId() { + return nsiId; + } + + public void setNsiId(String nsiId) { + this.nsiId = nsiId; + } + + public String getNssiId() { + return nssiId; + } + + public void setNssiId(String nssiId) { + this.nssiId = nssiId; + } + + + public String getResponseId() { + return responseId; + } + + public void setResponseId(String responseId) { + this.responseId = responseId; + } + + public EsrInfo getEsrInfo() { + return esrInfo; + } + + public void setEsrInfo(EsrInfo esrInfo) { + this.esrInfo = esrInfo; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/JobStatusResponse.java b/common/src/main/java/org/onap/so/beans/nsmf/JobStatusResponse.java new file mode 100644 index 0000000000..9259d51591 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/JobStatusResponse.java @@ -0,0 +1,37 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class JobStatusResponse { + + private ResponseDescriptor responseDescriptor; + + public ResponseDescriptor getResponseDescriptor() { + return responseDescriptor; + } + + public void setResponseDescriptor(ResponseDescriptor responseDescriptor) { + this.responseDescriptor = responseDescriptor; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/NetworkType.java b/common/src/main/java/org/onap/so/beans/nsmf/NetworkType.java new file mode 100644 index 0000000000..2e10fe5746 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/NetworkType.java @@ -0,0 +1,58 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonCreator; +import com.fasterxml.jackson.annotation.JsonValue; + +public enum NetworkType { + + ACCESS("an"), + + CORE("cn"), + + TRANSPORT("tn"); + + private String networkType; + + NetworkType(String networkType) { + this.networkType = networkType; + } + + @JsonValue + public String getNetworkType() { + return networkType; + } + + @JsonCreator + public NetworkType forValue(String value) { + return valueOf(value); + } + + public static NetworkType fromString(String value) { + for (NetworkType nType : NetworkType.values()) { + if (nType.networkType.equalsIgnoreCase(value)) { + return nType; + } + } + return null; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/NewNsst.java b/common/src/main/java/org/onap/so/beans/nsmf/NewNsst.java new file mode 100644 index 0000000000..e13aa5000a --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/NewNsst.java @@ -0,0 +1,47 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class NewNsst { + + private String nsstId; + + private String flavorId; + + public String getNsstId() { + return nsstId; + } + + public void setNsstId(String nsstId) { + this.nsstId = nsstId; + } + + public String getFlavorId() { + return flavorId; + } + + public void setFlavorId(String flavorId) { + this.flavorId = flavorId; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/NsiInfo.java b/common/src/main/java/org/onap/so/beans/nsmf/NsiInfo.java new file mode 100644 index 0000000000..0ff554d10d --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/NsiInfo.java @@ -0,0 +1,47 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class NsiInfo { + + private String nsiName; + + private String nsiId; + + public String getNsiName() { + return nsiName; + } + + public void setNsiName(String nsiName) { + this.nsiName = nsiName; + } + + public void setNsiId(String nsiId) { + this.nsiId = nsiId; + } + + public String getNsiId() { + return nsiId; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/NssiActDeActRequest.java b/common/src/main/java/org/onap/so/beans/nsmf/NssiActDeActRequest.java new file mode 100644 index 0000000000..fbba8c77b1 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/NssiActDeActRequest.java @@ -0,0 +1,47 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class NssiActDeActRequest { + + private EsrInfo esrInfo; + + private ActDeActNssi actDeActNssi; + + public ActDeActNssi getActDeActNssi() { + return actDeActNssi; + } + + public void setActDeActNssi(ActDeActNssi actDeActNssi) { + this.actDeActNssi = actDeActNssi; + } + + public EsrInfo getEsrInfo() { + return esrInfo; + } + + public void setEsrInfo(EsrInfo esrInfo) { + this.esrInfo = esrInfo; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/NssiAllocateRequest.java b/common/src/main/java/org/onap/so/beans/nsmf/NssiAllocateRequest.java new file mode 100644 index 0000000000..f72a74a063 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/NssiAllocateRequest.java @@ -0,0 +1,67 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class NssiAllocateRequest { + + private EsrInfo esrInfo; + + private AllocateCnNssi allocateCnNssi; + + private AllocateTnNssi allocateTnNssi; + + private AllocateAnNssi allocateAnNssi; + + public EsrInfo getEsrInfo() { + return esrInfo; + } + + public void setEsrInfo(EsrInfo esrInfo) { + this.esrInfo = esrInfo; + } + + public AllocateCnNssi getAllocateCnNssi() { + return allocateCnNssi; + } + + public void setAllocateCnNssi(AllocateCnNssi allocateCnNssi) { + this.allocateCnNssi = allocateCnNssi; + } + + public AllocateTnNssi getAllocateTnNssi() { + return allocateTnNssi; + } + + public void setAllocateTnNssi(AllocateTnNssi allocateTnNssi) { + this.allocateTnNssi = allocateTnNssi; + } + + public AllocateAnNssi getAllocateAnNssi() { + return allocateAnNssi; + } + + public void setAllocateAnNssi(AllocateAnNssi allocateAnNssi) { + this.allocateAnNssi = allocateAnNssi; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/NssiCreateRequest.java b/common/src/main/java/org/onap/so/beans/nsmf/NssiCreateRequest.java new file mode 100644 index 0000000000..ca26e9f0cb --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/NssiCreateRequest.java @@ -0,0 +1,47 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class NssiCreateRequest { + + private EsrInfo esrInfo; + + private CreateCnNssi createCnNssi; + + public EsrInfo getEsrInfo() { + return esrInfo; + } + + public void setEsrInfo(EsrInfo esrInfo) { + this.esrInfo = esrInfo; + } + + public CreateCnNssi getCreateCnNssi() { + return createCnNssi; + } + + public void setCreateCnNssi(CreateCnNssi createCnNssi) { + this.createCnNssi = createCnNssi; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/NssiDeAllocateRequest.java b/common/src/main/java/org/onap/so/beans/nsmf/NssiDeAllocateRequest.java new file mode 100644 index 0000000000..bbfc30c37a --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/NssiDeAllocateRequest.java @@ -0,0 +1,47 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class NssiDeAllocateRequest { + + private DeAllocateNssi deAllocateNssi; + + private EsrInfo esrInfo; + + public DeAllocateNssi getDeAllocateNssi() { + return deAllocateNssi; + } + + public void setDeAllocateNssi(DeAllocateNssi deAllocateNssi) { + this.deAllocateNssi = deAllocateNssi; + } + + public EsrInfo getEsrInfo() { + return esrInfo; + } + + public void setEsrInfo(EsrInfo esrInfo) { + this.esrInfo = esrInfo; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/NssiResponse.java b/common/src/main/java/org/onap/so/beans/nsmf/NssiResponse.java new file mode 100644 index 0000000000..66368be6b8 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/NssiResponse.java @@ -0,0 +1,47 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class NssiResponse { + + private String nssiId; + + private String jobId; + + public String getNssiId() { + return nssiId; + } + + public void setNssiId(String nssiId) { + this.nssiId = nssiId; + } + + public String getJobId() { + return jobId; + } + + public void setJobId(String jobId) { + this.jobId = jobId; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/NssiTerminateRequest.java b/common/src/main/java/org/onap/so/beans/nsmf/NssiTerminateRequest.java new file mode 100644 index 0000000000..df0a463584 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/NssiTerminateRequest.java @@ -0,0 +1,47 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class NssiTerminateRequest { + + private TerminateNssi terminateNssi; + + private EsrInfo esrInfo; + + public TerminateNssi getTerminateNssi() { + return terminateNssi; + } + + public void setTerminateNssi(TerminateNssi terminateNssi) { + this.terminateNssi = terminateNssi; + } + + public EsrInfo getEsrInfo() { + return esrInfo; + } + + public void setEsrInfo(EsrInfo esrInfo) { + this.esrInfo = esrInfo; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/NssiUpdateRequest.java b/common/src/main/java/org/onap/so/beans/nsmf/NssiUpdateRequest.java new file mode 100644 index 0000000000..6642734b7f --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/NssiUpdateRequest.java @@ -0,0 +1,47 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class NssiUpdateRequest { + + private UpdateCnNssi updateCnNssi; + + private EsrInfo esrInfo; + + public EsrInfo getEsrInfo() { + return esrInfo; + } + + public void setEsrInfo(EsrInfo esrInfo) { + this.esrInfo = esrInfo; + } + + public UpdateCnNssi getUpdateCnNssi() { + return updateCnNssi; + } + + public void setUpdateCnNssi(UpdateCnNssi updateCnNssi) { + this.updateCnNssi = updateCnNssi; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/NssiUpdateRequestById.java b/common/src/main/java/org/onap/so/beans/nsmf/NssiUpdateRequestById.java new file mode 100644 index 0000000000..0554d2fcfd --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/NssiUpdateRequestById.java @@ -0,0 +1,47 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class NssiUpdateRequestById { + + private UpdateCnNssiById updateCnNssiById; + + private EsrInfo esrInfo; + + public EsrInfo getEsrInfo() { + return esrInfo; + } + + public void setEsrInfo(EsrInfo esrInfo) { + this.esrInfo = esrInfo; + } + + public UpdateCnNssiById getUpdateCnNssiById() { + return updateCnNssiById; + } + + public void setUpdateCnNssiById(UpdateCnNssiById updateCnNssiById) { + this.updateCnNssiById = updateCnNssiById; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/NssmiReqInfo.java b/common/src/main/java/org/onap/so/beans/nsmf/NssmiReqInfo.java new file mode 100644 index 0000000000..093825f0ff --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/NssmiReqInfo.java @@ -0,0 +1,57 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class NssmiReqInfo { + + private String nsiId; + + private String nssiId; + + private EsrInfo esrInfo; + + public String getNsiId() { + return nsiId; + } + + public void setNsiId(String nsiId) { + this.nsiId = nsiId; + } + + public String getNssiId() { + return nssiId; + } + + public void setNssiId(String nssiId) { + this.nssiId = nssiId; + } + + public EsrInfo getEsrInfo() { + return esrInfo; + } + + public void setEsrInfo(EsrInfo esrInfo) { + this.esrInfo = esrInfo; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/NssmiResInfo.java b/common/src/main/java/org/onap/so/beans/nsmf/NssmiResInfo.java new file mode 100644 index 0000000000..e75934a7a9 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/NssmiResInfo.java @@ -0,0 +1,47 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class NssmiResInfo { + + private String jobId; + + private String status; + + public String getJobId() { + return jobId; + } + + public void setJobId(String jobId) { + this.jobId = jobId; + } + + public String getStatus() { + return status; + } + + public void setStatus(String status) { + this.status = status; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/PerfReq.java b/common/src/main/java/org/onap/so/beans/nsmf/PerfReq.java new file mode 100644 index 0000000000..4aabc3f26f --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/PerfReq.java @@ -0,0 +1,48 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; +import java.util.List; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class PerfReq { + + private List<PerfReqEmbbList> perfReqEmbbList; + + private List<PerfReqUrllcList> perfReqUrllcList; + + public List<PerfReqEmbbList> getPerfReqEmbbList() { + return perfReqEmbbList; + } + + public void setPerfReqEmbbList(List<PerfReqEmbbList> perfReqEmbbList) { + this.perfReqEmbbList = perfReqEmbbList; + } + + public List<PerfReqUrllcList> getPerfReqUrllcList() { + return perfReqUrllcList; + } + + public void setPerfReqUrllcList(List<PerfReqUrllcList> perfReqUrllcList) { + this.perfReqUrllcList = perfReqUrllcList; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/PerfReqEmbbList.java b/common/src/main/java/org/onap/so/beans/nsmf/PerfReqEmbbList.java new file mode 100644 index 0000000000..9e9fcaa19e --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/PerfReqEmbbList.java @@ -0,0 +1,82 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class PerfReqEmbbList { + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int expDataRateDL; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int expDataRateUL; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int areaTrafficCapDL; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int areaTrafficCapUL; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int activityFactor; + + public int getExpDataRateDL() { + return expDataRateDL; + } + + public void setExpDataRateDL(int expDataRateDL) { + this.expDataRateDL = expDataRateDL; + } + + public int getExpDataRateUL() { + return expDataRateUL; + } + + public void setExpDataRateUL(int expDataRateUL) { + this.expDataRateUL = expDataRateUL; + } + + public int getAreaTrafficCapDL() { + return areaTrafficCapDL; + } + + public void setAreaTrafficCapDL(int areaTrafficCapDL) { + this.areaTrafficCapDL = areaTrafficCapDL; + } + + public int getAreaTrafficCapUL() { + return areaTrafficCapUL; + } + + public void setAreaTrafficCapUL(int areaTrafficCapUL) { + this.areaTrafficCapUL = areaTrafficCapUL; + } + + public int getActivityFactor() { + return activityFactor; + } + + public void setActivityFactor(int activityFactor) { + this.activityFactor = activityFactor; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/PerfReqUrllcList.java b/common/src/main/java/org/onap/so/beans/nsmf/PerfReqUrllcList.java new file mode 100644 index 0000000000..00f0a917aa --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/PerfReqUrllcList.java @@ -0,0 +1,135 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class PerfReqUrllcList { + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int e2eLatency; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int jitter; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int survivalTime; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private float csAvailability; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private float reliability; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int expDataRate; + + private String payloadSize; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int trafficDensity; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int connDensity; + + private String serviceAreaDimension; + + public int getE2eLatency() { + return e2eLatency; + } + + public void setE2eLatency(int e2eLatency) { + this.e2eLatency = e2eLatency; + } + + public int getJitter() { + return jitter; + } + + public void setJitter(int jitter) { + this.jitter = jitter; + } + + public int getSurvivalTime() { + return survivalTime; + } + + public void setSurvivalTime(int survivalTime) { + this.survivalTime = survivalTime; + } + + public float getReliability() { + return reliability; + } + + public void setReliability(float reliability) { + this.reliability = reliability; + } + + public int getExpDataRate() { + return expDataRate; + } + + public void setExpDataRate(int expDataRate) { + this.expDataRate = expDataRate; + } + + public String getPayloadSize() { + return payloadSize; + } + + public void setPayloadSize(String payloadSize) { + this.payloadSize = payloadSize; + } + + public int getTrafficDensity() { + return trafficDensity; + } + + public void setTrafficDensity(int trafficDensity) { + this.trafficDensity = trafficDensity; + } + + public int getConnDensity() { + return connDensity; + } + + public void setConnDensity(int connDensity) { + this.connDensity = connDensity; + } + + public String getServiceAreaDimension() { + return serviceAreaDimension; + } + + public void setServiceAreaDimension(String serviceAreaDimension) { + this.serviceAreaDimension = serviceAreaDimension; + } + + public float getCsAvailability() { + return csAvailability; + } + + public void setCsAvailability(float csAvailability) { + this.csAvailability = csAvailability; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/PnfErrorList.java b/common/src/main/java/org/onap/so/beans/nsmf/PnfErrorList.java new file mode 100644 index 0000000000..66bfbdcea9 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/PnfErrorList.java @@ -0,0 +1,47 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class PnfErrorList { + + private String pnfId; + + private String pnfErrorDesc; + + public String getPnfId() { + return pnfId; + } + + public void setPnfId(String pnfId) { + this.pnfId = pnfId; + } + + public String getPnfErrorDesc() { + return pnfErrorDesc; + } + + public void setPnfErrorDesc(String pnfErrorDesc) { + this.pnfErrorDesc = pnfErrorDesc; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/ResourceSharingLevel.java b/common/src/main/java/org/onap/so/beans/nsmf/ResourceSharingLevel.java new file mode 100644 index 0000000000..405429c34d --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/ResourceSharingLevel.java @@ -0,0 +1,56 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonCreator; +import com.fasterxml.jackson.annotation.JsonValue; + +public enum ResourceSharingLevel { + + SHARED("shared"), + + NON_SHARED("non-shared"); + + private String resourceSharingLevel; + + ResourceSharingLevel(String resourceSharingLevel) { + this.resourceSharingLevel = resourceSharingLevel; + } + + @JsonValue + public String getResourceSharingLevel() { + return resourceSharingLevel; + } + + @JsonCreator + public ResourceSharingLevel forValue(String value) { + return valueOf(value); + } + + public static ResourceSharingLevel fromString(String value) { + for (ResourceSharingLevel rscLvl : ResourceSharingLevel.values()) { + if (rscLvl.resourceSharingLevel.equalsIgnoreCase(value)) { + return rscLvl; + } + } + return null; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/ResponseDescriptor.java b/common/src/main/java/org/onap/so/beans/nsmf/ResponseDescriptor.java new file mode 100644 index 0000000000..469d212ef9 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/ResponseDescriptor.java @@ -0,0 +1,85 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; +import java.util.List; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class ResponseDescriptor { + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int progress; + + private String status; + + private String statusDescription; + + private String errorCode; + + private List<VnfErrorList> vnfErrorList; + + private List<PnfErrorList> pnfErrorList; + + private String responseId; + + private List<ResponseHistory> responseHistoryList; + + public int getProgress() { + return progress; + } + + public void setProgress(int progress) { + this.progress = progress; + } + + public String getStatus() { + return status; + } + + public void setStatus(String status) { + this.status = status; + } + + public String getStatusDescription() { + return statusDescription; + } + + public void setStatusDescription(String statusDescription) { + this.statusDescription = statusDescription; + } + + public String getResponseId() { + return responseId; + } + + public void setResponseId(String responseId) { + this.responseId = responseId; + } + + public List<ResponseHistory> getResponseHistoryList() { + return responseHistoryList; + } + + public void setResponseHistoryList(List<ResponseHistory> responseHistoryList) { + this.responseHistoryList = responseHistoryList; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/ResponseHistory.java b/common/src/main/java/org/onap/so/beans/nsmf/ResponseHistory.java new file mode 100644 index 0000000000..c71441a80a --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/ResponseHistory.java @@ -0,0 +1,94 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; +import java.util.List; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class ResponseHistory { + + private int progress; + + private String status; + + private String errorCode; + + private String statusDescription; + + private String responseId; + + private List<VnfErrorList> vnfErrorList; + + private List<PnfErrorList> pnfErrorList; + + public int getProgress() { + return progress; + } + + public void setProgress(int progress) { + this.progress = progress; + } + + public String getStatus() { + return status; + } + + public void setStatus(String status) { + this.status = status; + } + + public String getStatusDescription() { + return statusDescription; + } + + public void setStatusDescription(String statusDescription) { + this.statusDescription = statusDescription; + } + + public String getResponseId() { + return responseId; + } + + public void setResponseId(String responseId) { + this.responseId = responseId; + } + + public String getErrorCode() { + return errorCode; + } + + public void setErrorCode(String errorCode) { + this.errorCode = errorCode; + } + + public List<VnfErrorList> getVnfErrorList() { + return vnfErrorList; + } + + public List<PnfErrorList> getPnfErrorList() { + return pnfErrorList; + } + + public void setPnfErrorList(List<PnfErrorList> pnfErrorList) { + this.pnfErrorList = pnfErrorList; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/ServiceProfile.java b/common/src/main/java/org/onap/so/beans/nsmf/ServiceProfile.java new file mode 100644 index 0000000000..cc6c9bbb82 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/ServiceProfile.java @@ -0,0 +1,50 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import java.io.Serializable; +import java.util.HashMap; +import java.util.Map; +import com.fasterxml.jackson.annotation.JsonAnyGetter; +import com.fasterxml.jackson.annotation.JsonAnySetter; +import com.fasterxml.jackson.annotation.JsonIgnore; +import com.fasterxml.jackson.annotation.JsonInclude; +import com.fasterxml.jackson.annotation.JsonProperty; +import com.fasterxml.jackson.annotation.JsonPropertyOrder; + +@JsonInclude(JsonInclude.Include.NON_NULL) +@JsonPropertyOrder({"service-profile"}) +public class ServiceProfile implements Serializable { + + @JsonProperty("service-profile") + private Map<String, Object> serviceProfile; + + @JsonProperty("service-profile") + public Map<String, Object> getServiceProfile() { + return serviceProfile; + } + + @JsonProperty("service-profile") + public void setServiceProfile(Map<String, Object> serviceProfile) { + this.serviceProfile = serviceProfile; + } +} + diff --git a/common/src/main/java/org/onap/so/beans/nsmf/SliceTaskParams.java b/common/src/main/java/org/onap/so/beans/nsmf/SliceTaskParams.java new file mode 100644 index 0000000000..bf881c0f19 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/SliceTaskParams.java @@ -0,0 +1,413 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License") + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.databind.ObjectMapper; +import com.google.gson.JsonObject; +import java.io.IOException; +import java.io.Serializable; +import java.util.HashMap; +import java.util.Map; + +public class SliceTaskParams implements Serializable { + + private static final long serialVersionUID = -4389946152970978423L; + + private String serviceId; + + private String serviceName; + + private String nstId; + + private String nstName; + + private String tnScriptName; + + private String anScriptName; + + private String cnScriptName; + + private Map<String, Object> serviceProfile; + + private String suggestNsiId; + + private String suggestNsiName; + + private Map<String, Object> sliceProfileTn; + + private Map<String, Object> sliceProfileCn; + + private Map<String, Object> sliceProfileAn; + + private String tnSuggestNssiId; + + private String tnSuggestNssiName; + + private String tnProgress; + + private String tnStatus; + + private String tnStatusDescription; + + private String cnSuggestNssiId; + + private String cnSuggestNssiName; + + private String cnProgress; + + private String cnStatus; + + private String cnStatusDescription; + + private String anSuggestNssiId; + + private String anSuggestNssiName; + + private String anProgress; + + private String anStatus; + + private String anStatusDescription; + + public String getNstId() { + return nstId; + } + + public void setNstId(String nstId) { + this.nstId = nstId; + } + + public String getNstName() { + return nstName; + } + + public void setNstName(String nstName) { + this.nstName = nstName; + } + + public String getTnScriptName() { + return tnScriptName; + } + + public void setTnScriptName(String tnScriptName) { + this.tnScriptName = tnScriptName; + } + + public String getAnScriptName() { + return anScriptName; + } + + public void setAnScriptName(String anScriptName) { + this.anScriptName = anScriptName; + } + + public String getCnScriptName() { + return cnScriptName; + } + + public void setCnScriptName(String cnScriptName) { + this.cnScriptName = cnScriptName; + } + + public String getServiceId() { + return serviceId; + } + + public void setServiceId(String serviceId) { + this.serviceId = serviceId; + } + + public String getServiceName() { + return serviceName; + } + + public void setServiceName(String serviceName) { + this.serviceName = serviceName; + } + + public Map<String, Object> getServiceProfile() { + return serviceProfile; + } + + public void setServiceProfile(Map<String, Object> serviceProfile) { + this.serviceProfile = serviceProfile; + } + + public String getSuggestNsiId() { + return suggestNsiId; + } + + public void setSuggestNsiId(String suggestNsiId) { + this.suggestNsiId = suggestNsiId; + } + + public String getSuggestNsiName() { + return suggestNsiName; + } + + public void setSuggestNsiName(String suggestNsiName) { + this.suggestNsiName = suggestNsiName; + } + + public Map<String, Object> getSliceProfileTn() { + return sliceProfileTn; + } + + public void setSliceProfileTn(Map<String, Object> sliceProfileTn) { + this.sliceProfileTn = sliceProfileTn; + } + + public Map<String, Object> getSliceProfileCn() { + return sliceProfileCn; + } + + public void setSliceProfileCn(Map<String, Object> sliceProfileCn) { + this.sliceProfileCn = sliceProfileCn; + } + + public Map<String, Object> getSliceProfileAn() { + return sliceProfileAn; + } + + public void setSliceProfileAn(Map<String, Object> sliceProfileAn) { + this.sliceProfileAn = sliceProfileAn; + } + + public String getTnSuggestNssiId() { + return tnSuggestNssiId; + } + + public void setTnSuggestNssiId(String tnSuggestNssiId) { + this.tnSuggestNssiId = tnSuggestNssiId; + } + + public String getTnSuggestNssiName() { + return tnSuggestNssiName; + } + + public void setTnSuggestNssiName(String tnSuggestNssiName) { + this.tnSuggestNssiName = tnSuggestNssiName; + } + + public String getTnProgress() { + return tnProgress; + } + + public void setTnProgress(String tnProgress) { + this.tnProgress = tnProgress; + } + + public String getTnStatus() { + return tnStatus; + } + + public void setTnStatus(String tnStatus) { + this.tnStatus = tnStatus; + } + + public String getTnStatusDescription() { + return tnStatusDescription; + } + + public void setTnStatusDescription(String tnStatusDescription) { + this.tnStatusDescription = tnStatusDescription; + } + + public String getCnSuggestNssiId() { + return cnSuggestNssiId; + } + + public void setCnSuggestNssiId(String cnSuggestNssiId) { + this.cnSuggestNssiId = cnSuggestNssiId; + } + + public String getCnSuggestNssiName() { + return cnSuggestNssiName; + } + + public void setCnSuggestNssiName(String cnSuggestNssiName) { + this.cnSuggestNssiName = cnSuggestNssiName; + } + + public String getCnProgress() { + return cnProgress; + } + + public void setCnProgress(String cnProgress) { + this.cnProgress = cnProgress; + } + + public String getCnStatus() { + return cnStatus; + } + + public void setCnStatus(String cnStatus) { + this.cnStatus = cnStatus; + } + + public String getCnStatusDescription() { + return cnStatusDescription; + } + + public void setCnStatusDescription(String cnStatusDescription) { + this.cnStatusDescription = cnStatusDescription; + } + + public String getAnSuggestNssiId() { + return anSuggestNssiId; + } + + public void setAnSuggestNssiId(String anSuggestNssiId) { + this.anSuggestNssiId = anSuggestNssiId; + } + + public String getAnSuggestNssiName() { + return anSuggestNssiName; + } + + public void setAnSuggestNssiName(String anSuggestNssiName) { + this.anSuggestNssiName = anSuggestNssiName; + } + + public String getAnProgress() { + return anProgress; + } + + public void setAnProgress(String anProgress) { + this.anProgress = anProgress; + } + + public String getAnStatus() { + return anStatus; + } + + public void setAnStatus(String anStatus) { + this.anStatus = anStatus; + } + + public String getAnStatusDescription() { + return anStatusDescription; + } + + public void setAnStatusDescription(String anStatusDescription) { + this.anStatusDescription = anStatusDescription; + } + + public String convertToJson() { + JsonObject jsonObject = new JsonObject(); + jsonObject.addProperty("ServiceId", serviceId); + jsonObject.addProperty("ServiceName", serviceName); + jsonObject.addProperty("NSTId", nstId); + jsonObject.addProperty("NSTName", nstName); + jsonObject.addProperty("TN.ScriptName", tnScriptName); + jsonObject.addProperty("AN.ScriptName", anScriptName); + jsonObject.addProperty("CN.ScriptName", cnScriptName); + for (Map.Entry<String, Object> entry : serviceProfile.entrySet()) { + jsonObject.addProperty("ServiceProfile." + entry.getKey(), entry.getValue().toString()); + } + jsonObject.addProperty("suggestNSIId", suggestNsiId); + jsonObject.addProperty("suggestNSIName", suggestNsiName); + for (Map.Entry<String, Object> entry : sliceProfileTn.entrySet()) { + jsonObject.addProperty("SliceProfile.TN." + entry.getKey(), entry.getValue().toString()); + } + for (Map.Entry<String, Object> entry : sliceProfileCn.entrySet()) { + jsonObject.addProperty("SliceProfile.CN." + entry.getKey(), entry.getValue().toString()); + } + for (Map.Entry<String, Object> entry : sliceProfileAn.entrySet()) { + jsonObject.addProperty("SliceProfile.AN." + entry.getKey(), entry.getValue().toString()); + } + jsonObject.addProperty("TN.SuggestNSSIId", tnSuggestNssiId); + jsonObject.addProperty("TN.SuggestNSSIName", tnSuggestNssiName); + jsonObject.addProperty("TN.progress", tnProgress); + jsonObject.addProperty("TN.status", tnStatus); + jsonObject.addProperty("TN.statusDescription", tnStatusDescription); + jsonObject.addProperty("CN.SuggestNSSIId", cnSuggestNssiId); + jsonObject.addProperty("CN.SuggestNSSIName", cnSuggestNssiName); + jsonObject.addProperty("CN.progress", cnProgress); + jsonObject.addProperty("CN.status", cnStatus); + jsonObject.addProperty("CN.statusDescription", cnStatusDescription); + jsonObject.addProperty("AN.SuggestNSSIId", anSuggestNssiId); + jsonObject.addProperty("AN.SuggestNSSIName", anSuggestNssiName); + jsonObject.addProperty("AN.progress", anProgress); + jsonObject.addProperty("AN.status", anStatus); + jsonObject.addProperty("AN.statusDescription", anStatusDescription); + + return jsonObject.toString(); + } + + public void convertFromJson(String jsonString) throws IOException { + ObjectMapper mapper = new ObjectMapper(); + Map<String, String> paramMap = (Map<String, String>) mapper.readValue(jsonString, Map.class); + this.setServiceId(paramMap.get("ServiceId")); + this.setServiceName(paramMap.get("ServiceName")); + this.setNstId(paramMap.get("NSTId")); + this.setNstName(paramMap.get("NSTName")); + this.setTnScriptName(paramMap.get("TN.ScriptName")); + this.setAnScriptName(paramMap.get("AN.ScriptName")); + this.setCnScriptName(paramMap.get("CN.ScriptName")); + Map<String, Object> serviceProfileMap = new HashMap<>(); + for (Map.Entry<String, String> entry : paramMap.entrySet()) { + if (entry.getKey().startsWith("ServiceProfile.")) { + serviceProfileMap.put(entry.getKey().replaceFirst("^ServiceProfile.", ""), entry.getValue()); + } + } + this.setServiceProfile(serviceProfileMap); + this.setSuggestNsiId(paramMap.get("suggestNSIId")); + this.setSuggestNsiName(paramMap.get("suggestNSIName")); + Map<String, Object> sliceProfileTnMap = new HashMap<>(); + for (Map.Entry<String, String> entry : paramMap.entrySet()) { + if (entry.getKey().startsWith("SliceProfile.TN.")) { + sliceProfileTnMap.put(entry.getKey().replaceFirst("^SliceProfile.TN.", ""), entry.getValue()); + } + } + this.setSliceProfileTn(sliceProfileTnMap); + Map<String, Object> sliceProfileCnMap = new HashMap<>(); + for (Map.Entry<String, String> entry : paramMap.entrySet()) { + if (entry.getKey().startsWith("SliceProfile.CN.")) { + sliceProfileCnMap.put(entry.getKey().replaceFirst("^SliceProfile.CN.", ""), entry.getValue()); + } + } + this.setSliceProfileCn(sliceProfileCnMap); + Map<String, Object> sliceProfileAnMap = new HashMap<>(); + for (Map.Entry<String, String> entry : paramMap.entrySet()) { + if (entry.getKey().startsWith("SliceProfile.AN.")) { + sliceProfileAnMap.put(entry.getKey().replaceFirst("^SliceProfile.AN.", ""), entry.getValue()); + } + } + this.setSliceProfileAn(sliceProfileAnMap); + this.setTnSuggestNssiId(paramMap.get("TN.SuggestNSSIId")); + this.setTnSuggestNssiName(paramMap.get("TN.SuggestNSSIName")); + this.setTnProgress(paramMap.get("TN.progress")); + this.setTnStatus(paramMap.get("TN.status")); + this.setTnStatusDescription(paramMap.get("TN.statusDescription")); + this.setCnSuggestNssiId(paramMap.get("CN.SuggestNSSIId")); + this.setCnSuggestNssiName(paramMap.get("CN.SuggestNSSIName")); + this.setCnProgress(paramMap.get("CN.progress")); + this.setCnStatus(paramMap.get("CN.status")); + this.setCnStatusDescription(paramMap.get("CN.statusDescription")); + this.setAnSuggestNssiId(paramMap.get("AN.SuggestNSSIId")); + this.setAnSuggestNssiName(paramMap.get("AN.SuggestNSSIName")); + this.setAnProgress(paramMap.get("AN.progress")); + this.setAnStatus(paramMap.get("AN.status")); + this.setAnStatusDescription(paramMap.get("AN.statusDescription")); + } +} + diff --git a/common/src/main/java/org/onap/so/beans/nsmf/TerminateNssi.java b/common/src/main/java/org/onap/so/beans/nsmf/TerminateNssi.java new file mode 100644 index 0000000000..28cc565272 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/TerminateNssi.java @@ -0,0 +1,59 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class TerminateNssi { + + public final static String URL = "/api/rest/provMns/v1/NSS/nssi/%s"; + + private String nsiId; + + private String scriptName; + + private String extension; + + public String getNsiId() { + return nsiId; + } + + public void setNsiId(String nsiId) { + this.nsiId = nsiId; + } + + public String getScriptName() { + return scriptName; + } + + public void setScriptName(String scriptName) { + this.scriptName = scriptName; + } + + public String getExtension() { + return extension; + } + + public void setExtension(String extension) { + this.extension = extension; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/TnSliceProfile.java b/common/src/main/java/org/onap/so/beans/nsmf/TnSliceProfile.java new file mode 100644 index 0000000000..c3548f15af --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/TnSliceProfile.java @@ -0,0 +1,48 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class TnSliceProfile { + + private String bandwidth; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int latency; + + public String getBandwidth() { + return bandwidth; + } + + public void setBandwidth(String bandwidth) { + this.bandwidth = bandwidth; + } + + public int getLatency() { + return latency; + } + + public void setLatency(int latency) { + this.latency = latency; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/UeMobilityLevel.java b/common/src/main/java/org/onap/so/beans/nsmf/UeMobilityLevel.java new file mode 100644 index 0000000000..ffb7229838 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/UeMobilityLevel.java @@ -0,0 +1,60 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonCreator; +import com.fasterxml.jackson.annotation.JsonValue; + +public enum UeMobilityLevel { + + STATIONARY("stationary"), + + NOMADIC("nomadic"), + + RESTRICTED_MOBILITY("restricted mobility"), + + FULLY_MOBILITY("fully mobility"); + + private String ueMobilityLevel; + + UeMobilityLevel(String ueMobilityLevel) { + this.ueMobilityLevel = ueMobilityLevel; + } + + @JsonValue + public String getUeMobilityLevel() { + return ueMobilityLevel; + } + + @JsonCreator + public UeMobilityLevel forValue(String value) { + return valueOf(value); + } + + public static UeMobilityLevel fromString(String value) { + for (UeMobilityLevel ueLvl : UeMobilityLevel.values()) { + if (ueLvl.ueMobilityLevel.equalsIgnoreCase(value)) { + return ueLvl; + } + } + return null; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/UpdateCnNssi.java b/common/src/main/java/org/onap/so/beans/nsmf/UpdateCnNssi.java new file mode 100644 index 0000000000..9fb8f26440 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/UpdateCnNssi.java @@ -0,0 +1,119 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class UpdateCnNssi { + + public final static String URL = "/api/rest/provMns/v1/NSS/SliceProfiles/%s"; + + private String snssai; + + private String nssiId; + + private String nsstId; + + private String flavorId; + + private UpdateSliceProfile sliceProfile; + + private String scriptName; + + private String extension; + + private NsiInfo nsiInfo; + + private NewNsst newNsst; + + public String getSnssai() { + return snssai; + } + + public void setSnssai(String snssai) { + this.snssai = snssai; + } + + public String getNssiId() { + return nssiId; + } + + public void setNssiId(String nssiId) { + this.nssiId = nssiId; + } + + public String getNsstId() { + return nsstId; + } + + public void setNsstId(String nsstId) { + this.nsstId = nsstId; + } + + public String getFlavorId() { + return flavorId; + } + + public void setFlavorId(String flavorId) { + this.flavorId = flavorId; + } + + public UpdateSliceProfile getSliceProfile() { + return sliceProfile; + } + + public void setSliceProfile(UpdateSliceProfile sliceProfile) { + this.sliceProfile = sliceProfile; + } + + public String getScriptName() { + return scriptName; + } + + public void setScriptName(String scriptName) { + this.scriptName = scriptName; + } + + public String getExtension() { + return extension; + } + + public void setExtension(String extension) { + this.extension = extension; + } + + public NsiInfo getNsiInfo() { + return nsiInfo; + } + + public void setNsiInfo(NsiInfo nsiInfo) { + this.nsiInfo = nsiInfo; + } + + public NewNsst getNewNsst() { + return newNsst; + } + + public void setNewNsst(NewNsst newNsst) { + this.newNsst = newNsst; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/UpdateCnNssiById.java b/common/src/main/java/org/onap/so/beans/nsmf/UpdateCnNssiById.java new file mode 100644 index 0000000000..26e6ca02bb --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/UpdateCnNssiById.java @@ -0,0 +1,89 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class UpdateCnNssiById { + + public final static String URL = "/api/rest/provMns/v1/NSS/nssi/%s"; + + private String nsstId; + + private String flavorId; + + private String scriptName; + + private String extension; + + private NsiInfo nsiInfo; + + private NewNsst newNsst; + + public String getNsstId() { + return nsstId; + } + + public void setNsstId(String nsstId) { + this.nsstId = nsstId; + } + + public String getFlavorId() { + return flavorId; + } + + public void setFlavorId(String flavorId) { + this.flavorId = flavorId; + } + + public String getScriptName() { + return scriptName; + } + + public void setScriptName(String scriptName) { + this.scriptName = scriptName; + } + + public String getExtension() { + return extension; + } + + public void setExtension(String extension) { + this.extension = extension; + } + + public NsiInfo getNsiInfo() { + return nsiInfo; + } + + public void setNsiInfo(NsiInfo nsiInfo) { + this.nsiInfo = nsiInfo; + } + + public NewNsst getNewNsst() { + return newNsst; + } + + public void setNewNsst(NewNsst newNsst) { + this.newNsst = newNsst; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/UpdateSliceProfile.java b/common/src/main/java/org/onap/so/beans/nsmf/UpdateSliceProfile.java new file mode 100644 index 0000000000..74ea7ae424 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/UpdateSliceProfile.java @@ -0,0 +1,101 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; +import java.util.List; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class UpdateSliceProfile { + + private List<String> plmnIdList; + + private PerfReq perfReq; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int maxNumberofUEs; + + private List<String> coverageAreaTAList; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int latency; + + @JsonInclude(JsonInclude.Include.NON_DEFAULT) + private int ueMobilityLevel; + + private String resourceSharingLevel; + + public List<String> getPlmnIdList() { + return plmnIdList; + } + + public void setPlmnIdList(List<String> plmnIdList) { + this.plmnIdList = plmnIdList; + } + + public PerfReq getPerfReq() { + return perfReq; + } + + public void setPerfReq(PerfReq perfReq) { + this.perfReq = perfReq; + } + + public int getMaxNumberofUEs() { + return maxNumberofUEs; + } + + public void setMaxNumberofUEs(int maxNumberofUEs) { + this.maxNumberofUEs = maxNumberofUEs; + } + + public List<String> getCoverageAreaTAList() { + return coverageAreaTAList; + } + + public void setCoverageAreaTAList(List<String> coverageAreaTAList) { + this.coverageAreaTAList = coverageAreaTAList; + } + + public int getLatency() { + return latency; + } + + public void setLatency(int latency) { + this.latency = latency; + } + + public int getUeMobilityLevel() { + return ueMobilityLevel; + } + + public void setUeMobilityLevel(int ueMobilityLevel) { + this.ueMobilityLevel = ueMobilityLevel; + } + + public String getResourceSharingLevel() { + return resourceSharingLevel; + } + + public void setResourceSharingLevel(String resourceSharingLevel) { + this.resourceSharingLevel = resourceSharingLevel; + } +} diff --git a/common/src/main/java/org/onap/so/beans/nsmf/VnfErrorList.java b/common/src/main/java/org/onap/so/beans/nsmf/VnfErrorList.java new file mode 100644 index 0000000000..6388ca6106 --- /dev/null +++ b/common/src/main/java/org/onap/so/beans/nsmf/VnfErrorList.java @@ -0,0 +1,47 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.beans.nsmf; + +import com.fasterxml.jackson.annotation.JsonInclude; + +@JsonInclude(JsonInclude.Include.NON_NULL) +public class VnfErrorList { + + private String vnfInstanceId; + + private String vnfErrorDesc; + + public String getVnfInstanceId() { + return vnfInstanceId; + } + + public void setVnfInstanceId(String vnfInstanceId) { + this.vnfInstanceId = vnfInstanceId; + } + + public String getVnfErrorDesc() { + return vnfErrorDesc; + } + + public void setVnfErrorDesc(String vnfErrorDesc) { + this.vnfErrorDesc = vnfErrorDesc; + } +} diff --git a/common/src/main/java/org/onap/so/client/aai/AAIObjectType.java b/common/src/main/java/org/onap/so/client/aai/AAIObjectType.java index c2c8e933b1..b96df4ff9e 100644 --- a/common/src/main/java/org/onap/so/client/aai/AAIObjectType.java +++ b/common/src/main/java/org/onap/so/client/aai/AAIObjectType.java @@ -20,66 +20,21 @@ package org.onap.so.client.aai; -import java.io.Serializable; -import java.net.URL; -import java.util.HashMap; -import java.util.Map; -import java.util.Set; -import java.util.regex.Pattern; +import com.google.common.base.CaseFormat; import org.onap.aai.annotations.Metadata; -import org.onap.aai.domain.yang.AggregateRoute; -import org.onap.aai.domain.yang.AllottedResource; -import org.onap.aai.domain.yang.CloudRegion; -import org.onap.aai.domain.yang.Collection; -import org.onap.aai.domain.yang.Complex; -import org.onap.aai.domain.yang.Configuration; -import org.onap.aai.domain.yang.Connector; -import org.onap.aai.domain.yang.Customer; -import org.onap.aai.domain.yang.Device; -import org.onap.aai.domain.yang.EsrVnfm; -import org.onap.aai.domain.yang.ExtAaiNetwork; -import org.onap.aai.domain.yang.Flavor; -import org.onap.aai.domain.yang.GenericVnf; -import org.onap.aai.domain.yang.Image; -import org.onap.aai.domain.yang.InstanceGroup; -import org.onap.aai.domain.yang.L3Network; -import org.onap.aai.domain.yang.LInterface; -import org.onap.aai.domain.yang.LineOfBusiness; -import org.onap.aai.domain.yang.ModelVer; -import org.onap.aai.domain.yang.NetworkPolicy; -import org.onap.aai.domain.yang.NetworkTechnology; -import org.onap.aai.domain.yang.OperationalEnvironment; -import org.onap.aai.domain.yang.OwningEntity; -import org.onap.aai.domain.yang.PInterface; -import org.onap.aai.domain.yang.PhysicalLink; -import org.onap.aai.domain.yang.Platform; -import org.onap.aai.domain.yang.Pnf; -import org.onap.aai.domain.yang.PortGroup; -import org.onap.aai.domain.yang.Project; -import org.onap.aai.domain.yang.Pserver; -import org.onap.aai.domain.yang.RouteTableReference; -import org.onap.aai.domain.yang.ServiceInstance; -import org.onap.aai.domain.yang.ServiceSubscription; -import org.onap.aai.domain.yang.SpPartner; -import org.onap.aai.domain.yang.SriovPf; -import org.onap.aai.domain.yang.Subnet; -import org.onap.aai.domain.yang.Tenant; -import org.onap.aai.domain.yang.TunnelXconnect; -import org.onap.aai.domain.yang.Vce; -import org.onap.aai.domain.yang.VfModule; -import org.onap.aai.domain.yang.VlanTag; -import org.onap.aai.domain.yang.Vnfc; -import org.onap.aai.domain.yang.VolumeGroup; -import org.onap.aai.domain.yang.VpnBinding; -import org.onap.aai.domain.yang.Vserver; -import org.onap.aai.domain.yang.Zone; +import org.onap.aai.domain.yang.*; import org.onap.so.client.graphinventory.GraphInventoryObjectType; import org.onap.so.constants.Defaults; import org.reflections.Reflections; import org.reflections.scanners.SubTypesScanner; import org.reflections.util.ClasspathHelper; import org.reflections.util.ConfigurationBuilder; -import com.google.common.base.CaseFormat; +import java.io.Serializable; +import java.net.URL; +import java.util.HashMap; +import java.util.Map; +import java.util.Set; +import java.util.regex.Pattern; public class AAIObjectType implements GraphInventoryObjectType, Serializable { @@ -122,6 +77,8 @@ public class AAIObjectType implements GraphInventoryObjectType, Serializable { public static final AAIObjectType SERVICE_INSTANCE_METADATA = new AAIObjectType( AAIObjectType.SERVICE_INSTANCE + "/metadata", org.onap.aai.domain.yang.v13.Metadata.class); + public static final AAIObjectType SERVICE = new AAIObjectType( + AAINamespaceConstants.SERVICE_DESIGN_AND_CREATION + "/services/service/{service-id}", Service.class); public static final AAIObjectType SERVICE_INSTANCE = new AAIObjectType(AAIObjectType.SERVICE_SUBSCRIPTION.uriTemplate(), ServiceInstance.class); public static final AAIObjectType PROJECT = new AAIObjectType(AAINamespaceConstants.BUSINESS, Project.class); @@ -132,6 +89,8 @@ public class AAIObjectType implements GraphInventoryObjectType, Serializable { new AAIObjectType(AAINamespaceConstants.BUSINESS, OwningEntity.class); public static final AAIObjectType ALLOTTED_RESOURCE = new AAIObjectType(AAIObjectType.SERVICE_INSTANCE.uriTemplate(), AllottedResource.class); + public static final AAIObjectType ALLOTTED_RESOURCE_ALL = + new AAIObjectType(AAIObjectType.SERVICE_INSTANCE.uriTemplate(), "/allotted-resources", "allottedResources"); public static final AAIObjectType PNF = new AAIObjectType(AAINamespaceConstants.NETWORK, Pnf.class); public static final AAIObjectType OPERATIONAL_ENVIRONMENT = new AAIObjectType(AAINamespaceConstants.CLOUD_INFRASTRUCTURE, OperationalEnvironment.class); @@ -188,6 +147,23 @@ public class AAIObjectType implements GraphInventoryObjectType, Serializable { public static final AAIObjectType CLOUD_ESR_SYSTEM_INFO_LIST = new AAIObjectType( AAIObjectType.CLOUD_REGION.uriTemplate(), "/esr-system-info-list", "cloud-esr-system-info-list"); public static final AAIObjectType ZONE = new AAIObjectType(AAINamespaceConstants.NETWORK, Zone.class); + public static final AAIObjectType THIRDPARTY_SDNC_LIST = new AAIObjectType(AAINamespaceConstants.EXTERNAL_SYSTEM, + "/esr-thirdparty-sdnc-list", "thirdparty-sdnc-list"); + public static final AAIObjectType THIRDPARTY_SDNC_SYSTEM_INFO_LIST = + new AAIObjectType(AAINamespaceConstants.EXTERNAL_SYSTEM + "/esr-thirdparty-sdnc-list", + "/esr-thirdparty-sdnc/{sdnc-id}/esr-system-info-list", "thirdparty-sdnc-system-info-list"); + public static final AAIObjectType COMMUNICATION_SERVICE_PROFILE = + new AAIObjectType(AAIObjectType.SERVICE_SUBSCRIPTION.uriTemplate(), CommunicationServiceProfile.class); + public static final AAIObjectType SERVICE_PROFILE = + new AAIObjectType(AAIObjectType.SERVICE_SUBSCRIPTION.uriTemplate(), ServiceProfile.class); + public static final AAIObjectType SERVICE_PROFILE_ALL = + new AAIObjectType(AAIObjectType.SERVICE_INSTANCE.uriTemplate(), "/service-profiles", "serviceProfiles"); + public static final AAIObjectType SLICE_PROFILE = + new AAIObjectType(AAIObjectType.SERVICE_SUBSCRIPTION.uriTemplate(), SliceProfile.class); + public static final AAIObjectType SLICE_PROFILE_ALL = + new AAIObjectType(AAIObjectType.SERVICE_INSTANCE.uriTemplate(), "/slice-profiles", "sliceProfiles"); + public static final AAIObjectType COMMUNICATION_PROFILE_ALL = new AAIObjectType( + AAIObjectType.SERVICE_INSTANCE.uriTemplate(), "/communication-service-profiles", "communicationProfiles"); private final String uriTemplate; private final String parentUri; diff --git a/common/src/main/java/org/onap/so/client/aai/AAIRestClientI.java b/common/src/main/java/org/onap/so/client/aai/AAIRestClientI.java index 8bc709b276..2698bc347f 100644 --- a/common/src/main/java/org/onap/so/client/aai/AAIRestClientI.java +++ b/common/src/main/java/org/onap/so/client/aai/AAIRestClientI.java @@ -38,4 +38,6 @@ public interface AAIRestClientI { Optional<Pnf> getPnfByName(String pnfId); void createPnf(String pnfId, Pnf pnf); + + void updatePnf(String pnfId, Pnf pnf); } diff --git a/common/src/main/java/org/onap/so/client/aai/AAIRestClientImpl.java b/common/src/main/java/org/onap/so/client/aai/AAIRestClientImpl.java index 03e2eaea1f..f2f96ca905 100644 --- a/common/src/main/java/org/onap/so/client/aai/AAIRestClientImpl.java +++ b/common/src/main/java/org/onap/so/client/aai/AAIRestClientImpl.java @@ -92,4 +92,9 @@ public class AAIRestClientImpl implements AAIRestClientI { new AAIResourcesClient().createIfNotExists(AAIUriFactory.createResourceUri(AAIObjectType.PNF, pnfId), Optional.of(pnf)); } + + @Override + public void updatePnf(String pnfId, Pnf pnf) { + new AAIResourcesClient().update(AAIUriFactory.createResourceUri(AAIObjectType.PNF, pnfId), pnf); + } } diff --git a/common/src/main/java/org/onap/so/logging/jaxrs/filter/SOAuditLogContainerFilter.java b/common/src/main/java/org/onap/so/logging/jaxrs/filter/SOAuditLogContainerFilter.java index 5ae1082464..3e85cc5ec6 100644 --- a/common/src/main/java/org/onap/so/logging/jaxrs/filter/SOAuditLogContainerFilter.java +++ b/common/src/main/java/org/onap/so/logging/jaxrs/filter/SOAuditLogContainerFilter.java @@ -3,6 +3,7 @@ package org.onap.so.logging.jaxrs.filter; import javax.annotation.Priority; import javax.ws.rs.container.ContainerRequestContext; import javax.ws.rs.container.ContainerResponseContext; +import javax.ws.rs.container.PreMatching; import org.onap.logging.ref.slf4j.ONAPLogConstants; import org.onap.so.logger.HttpHeadersConstants; import org.onap.so.logger.LogConstants; @@ -11,6 +12,7 @@ import org.springframework.stereotype.Component; import org.onap.logging.filter.base.AuditLogContainerFilter; @Priority(1) +@PreMatching @Component public class SOAuditLogContainerFilter extends AuditLogContainerFilter { @@ -26,9 +28,4 @@ public class SOAuditLogContainerFilter extends AuditLogContainerFilter { } MDC.put(LogConstants.URI_BASE, request.getUriInfo().getBaseUri().toString()); } - - @Override - protected void additionalPostHandling(ContainerResponseContext response) { - // override to add additional post handling - } } diff --git a/common/src/main/java/org/onap/so/rest/service/HttpRestServiceProvider.java b/common/src/main/java/org/onap/so/rest/service/HttpRestServiceProvider.java index 69046a2eba..4434dce4e3 100644 --- a/common/src/main/java/org/onap/so/rest/service/HttpRestServiceProvider.java +++ b/common/src/main/java/org/onap/so/rest/service/HttpRestServiceProvider.java @@ -21,6 +21,7 @@ package org.onap.so.rest.service; import com.google.common.base.Optional; +import org.springframework.http.HttpHeaders; import org.springframework.http.ResponseEntity; /** @@ -39,6 +40,16 @@ public interface HttpRestServiceProvider { /** * Execute the HTTP GET to the given URI template + * + * @param url the URL + * @param headers request headers + * @param clazz the type of the return value + * @return Returns the body of this entity. + */ + <T> Optional<T> get(final String url, final HttpHeaders headers, final Class<T> clazz); + + /** + * Execute the HTTP GET to the given URI template * * @param url the URL * @param clazz the type of the return value @@ -46,6 +57,15 @@ public interface HttpRestServiceProvider { */ <T> ResponseEntity<T> getHttpResponse(final String url, final Class<T> clazz); + /** + * Execute the HTTP GET to the given URI template + * + * @param url the URL + * @param headers request headers + * @param clazz the type of the return value + * @return Returns the {@link ResponseEntity}. + */ + <T> ResponseEntity<T> getHttpResponse(final String url, final HttpHeaders headers, final Class<T> clazz); /** * Execute the HTTP POST to the given URI template @@ -68,6 +88,18 @@ public interface HttpRestServiceProvider { <T> ResponseEntity<T> postHttpRequest(final Object object, final String url, final Class<T> clazz); /** + * Execute the HTTP POST to the given URI template + * + * @param object the entity (i.e. body) to write to the request + * @param url the URL + * @param clazz the type of the return value + * @param headers request headers + * @return Returns the {@link ResponseEntity}. + */ + <T> ResponseEntity<T> postHttpRequest(final Object object, final String url, final HttpHeaders headers, + final Class<T> clazz); + + /** * Execute the HTTP PUT to the given URI template * * @param object the entity (i.e. body) to write to the request diff --git a/common/src/main/java/org/onap/so/rest/service/HttpRestServiceProviderImpl.java b/common/src/main/java/org/onap/so/rest/service/HttpRestServiceProviderImpl.java index b82d73bbbf..04dd0bbb7a 100644 --- a/common/src/main/java/org/onap/so/rest/service/HttpRestServiceProviderImpl.java +++ b/common/src/main/java/org/onap/so/rest/service/HttpRestServiceProviderImpl.java @@ -20,8 +20,6 @@ package org.onap.so.rest.service; -import com.google.common.base.Optional; -import org.onap.so.configuration.rest.BasicHttpHeadersProvider; import org.onap.so.configuration.rest.HttpHeadersProvider; import org.onap.so.rest.exceptions.HttpResouceNotFoundException; import org.onap.so.rest.exceptions.InvalidRestRequestException; @@ -36,6 +34,7 @@ import org.springframework.http.ResponseEntity; import org.springframework.web.client.HttpStatusCodeException; import org.springframework.web.client.RestClientException; import org.springframework.web.client.RestTemplate; +import com.google.common.base.Optional; /** * A Service to perform HTTP requests @@ -46,16 +45,27 @@ public class HttpRestServiceProviderImpl implements HttpRestServiceProvider { private static final Logger LOGGER = LoggerFactory.getLogger(HttpRestServiceProviderImpl.class); private final RestTemplate restTemplate; - private final HttpHeadersProvider httpHeadersProvider; + private final HttpHeaders defaultHttpHeaders; public HttpRestServiceProviderImpl(final RestTemplate restTemplate) { this.restTemplate = restTemplate; - this.httpHeadersProvider = new BasicHttpHeadersProvider(); + this.defaultHttpHeaders = new HttpHeaders(); } + public HttpRestServiceProviderImpl(final RestTemplate restTemplate, final HttpHeaders defaultHttpHeaders) { + this.restTemplate = restTemplate; + this.defaultHttpHeaders = defaultHttpHeaders; + } + + /** + * + * @deprecated this constructor is deprecated in favor of using {@link HttpRestServiceProviderImpl(RestTemplate + * restTemplate, HttpHeaders defaultHttpHeaders)} + */ + @Deprecated public HttpRestServiceProviderImpl(final RestTemplate restTemplate, final HttpHeadersProvider httpHeadersProvider) { this.restTemplate = restTemplate; - this.httpHeadersProvider = httpHeadersProvider; + this.defaultHttpHeaders = httpHeadersProvider.getHttpHeaders(); } @Override @@ -64,10 +74,21 @@ public class HttpRestServiceProviderImpl implements HttpRestServiceProvider { return createOptional(response, url, HttpMethod.GET); } + @Override + public <T> Optional<T> get(final String url, final HttpHeaders headers, final Class<T> clazz) { + final ResponseEntity<T> response = invokeHttpRequest(new HttpEntity<>(headers), HttpMethod.GET, url, clazz); + return createOptional(response, url, HttpMethod.GET); + } @Override public <T> ResponseEntity<T> getHttpResponse(final String url, final Class<T> clazz) { - final HttpEntity<?> request = new HttpEntity<>(getHttpHeaders()); + final HttpEntity<?> request = new HttpEntity<>(getDefaultHttpHeaders()); + return invokeHttpRequest(request, HttpMethod.GET, url, clazz); + } + + @Override + public <T> ResponseEntity<T> getHttpResponse(final String url, final HttpHeaders headers, final Class<T> clazz) { + final HttpEntity<?> request = new HttpEntity<>(headers); return invokeHttpRequest(request, HttpMethod.GET, url, clazz); } @@ -79,7 +100,14 @@ public class HttpRestServiceProviderImpl implements HttpRestServiceProvider { @Override public <T> ResponseEntity<T> postHttpRequest(final Object object, final String url, final Class<T> clazz) { - final HttpEntity<?> request = new HttpEntity<>(object, getHttpHeaders()); + final HttpEntity<?> request = new HttpEntity<>(object, getDefaultHttpHeaders()); + return invokeHttpRequest(request, HttpMethod.POST, url, clazz); + } + + @Override + public <T> ResponseEntity<T> postHttpRequest(final Object object, final String url, final HttpHeaders headers, + final Class<T> clazz) { + final HttpEntity<?> request = new HttpEntity<>(object, headers); return invokeHttpRequest(request, HttpMethod.POST, url, clazz); } @@ -91,7 +119,7 @@ public class HttpRestServiceProviderImpl implements HttpRestServiceProvider { @Override public <T> ResponseEntity<T> putHttpRequest(final Object object, final String url, final Class<T> clazz) { - final HttpEntity<?> request = new HttpEntity<>(object, getHttpHeaders()); + final HttpEntity<?> request = new HttpEntity<>(object, getDefaultHttpHeaders()); return invokeHttpRequest(request, HttpMethod.PUT, url, clazz); } @@ -140,9 +168,21 @@ public class HttpRestServiceProviderImpl implements HttpRestServiceProvider { @Override public <T> ResponseEntity<T> deleteHttpRequest(final String url, final Class<T> clazz) { try { - final HttpEntity<?> request = new HttpEntity<>(getHttpHeaders()); + final HttpEntity<?> request = new HttpEntity<>(getDefaultHttpHeaders()); return restTemplate.exchange(url, HttpMethod.DELETE, request, clazz); + } catch (final HttpStatusCodeException httpStatusCodeException) { + final String message = "Unable to invoke HTTP " + HttpMethod.DELETE + " using url: " + url + ", Response: " + + httpStatusCodeException.getRawStatusCode(); + LOGGER.error(message, httpStatusCodeException); + final int rawStatusCode = httpStatusCodeException.getRawStatusCode(); + if (rawStatusCode == HttpStatus.BAD_REQUEST.value()) { + throw new InvalidRestRequestException("No result found for given url: " + url); + } else if (rawStatusCode == HttpStatus.NOT_FOUND.value()) { + throw new HttpResouceNotFoundException("No result found for given url: " + url); + } + throw new RestProcessingException("Unable to invoke HTTP " + HttpMethod.DELETE + " using URL: " + url, + httpStatusCodeException, rawStatusCode); } catch (final RestClientException restClientException) { LOGGER.error("Unable to invoke HTTP DELETE using url: " + url, restClientException); throw new InvalidRestRequestException("Unable to invoke HTTP DELETE using URL: " + url, @@ -150,7 +190,7 @@ public class HttpRestServiceProviderImpl implements HttpRestServiceProvider { } } - private HttpHeaders getHttpHeaders() { - return httpHeadersProvider.getHttpHeaders(); + private HttpHeaders getDefaultHttpHeaders() { + return defaultHttpHeaders; } } diff --git a/common/src/main/java/org/onap/so/serviceinstancebeans/CloudConfiguration.java b/common/src/main/java/org/onap/so/serviceinstancebeans/CloudConfiguration.java index 4a284b55ec..777dcc6171 100644 --- a/common/src/main/java/org/onap/so/serviceinstancebeans/CloudConfiguration.java +++ b/common/src/main/java/org/onap/so/serviceinstancebeans/CloudConfiguration.java @@ -37,6 +37,8 @@ public class CloudConfiguration implements Serializable { protected String aicNodeClli; @JsonProperty("tenantId") protected String tenantId; + @JsonProperty("tenantName") + protected String tenantName; @JsonProperty("cloudOwner") protected String cloudOwner = Defaults.CLOUD_OWNER.toString(); @JsonProperty("lcpCloudRegionId") @@ -82,6 +84,13 @@ public class CloudConfiguration implements Serializable { this.tenantId = value; } + public String getTenantName() { + return tenantName; + } + + public void setTenantName(String tenantName) { + this.tenantName = tenantName; + } public String getLcpCloudRegionId() { return lcpCloudRegionId; @@ -102,7 +111,8 @@ public class CloudConfiguration implements Serializable { @Override public String toString() { return new ToStringBuilder(this).append("aicNodeClli", getAicNodeClli()).append("tenantId", getTenantId()) - .append("cloudOwner", getCloudOwner()).append("lcpCloudRegionId", getLcpCloudRegionId()).toString(); + .append("tenantName", getTenantName()).append("cloudOwner", getCloudOwner()) + .append("lcpCloudRegionId", getLcpCloudRegionId()).toString(); } diff --git a/common/src/main/java/org/onap/so/serviceinstancebeans/RequestInfo.java b/common/src/main/java/org/onap/so/serviceinstancebeans/RequestInfo.java index 250c5df5ce..026db1e644 100644 --- a/common/src/main/java/org/onap/so/serviceinstancebeans/RequestInfo.java +++ b/common/src/main/java/org/onap/so/serviceinstancebeans/RequestInfo.java @@ -43,6 +43,8 @@ public class RequestInfo implements Serializable { protected String orderNumber; @JsonProperty("productFamilyId") protected String productFamilyId; + @JsonProperty("productFamilyName") + protected String productFamilyName; @JsonProperty("orderVersion") protected Integer orderVersion; @JsonSerialize(include = Inclusion.ALWAYS) @@ -180,6 +182,14 @@ public class RequestInfo implements Serializable { public void setProductFamilyId(String productFamilyId) { this.productFamilyId = productFamilyId; + }; + + public String getProductFamilyName() { + return productFamilyName; + } + + public void setProductFamilyName(String productFamilyName) { + this.productFamilyName = productFamilyName; } /** @@ -215,9 +225,9 @@ public class RequestInfo implements Serializable { public String toString() { return "RequestInfo [billingAccountNumber=" + billingAccountNumber + ", callbackUrl=" + callbackUrl + ", correlator=" + correlator + ", orderNumber=" + orderNumber + ", productFamilyId=" + productFamilyId - + ", orderVersion=" + orderVersion + ", source=" + source + ", instanceName=" + instanceName - + ", suppressRollback=" + suppressRollback + ", requestorId=" + requestorId + ", applicationId=" - + applicationId + "]"; + + ", productFamilyName=" + productFamilyName + ", orderVersion=" + orderVersion + ", source=" + source + + ", instanceName=" + instanceName + ", suppressRollback=" + suppressRollback + ", requestorId=" + + requestorId + ", applicationId=" + applicationId + "]"; } diff --git a/common/src/main/java/org/onap/so/serviceinstancebeans/ServiceInstancesRequest.java b/common/src/main/java/org/onap/so/serviceinstancebeans/ServiceInstancesRequest.java index 5bcdcb181b..05e69b7b19 100644 --- a/common/src/main/java/org/onap/so/serviceinstancebeans/ServiceInstancesRequest.java +++ b/common/src/main/java/org/onap/so/serviceinstancebeans/ServiceInstancesRequest.java @@ -32,8 +32,8 @@ public class ServiceInstancesRequest implements Serializable { private String serviceInstanceId; @JsonProperty("vnfInstanceId") private String vnfInstanceId; - @JsonProperty("pnfId") - private String pnfId; + @JsonProperty("pnfName") + private String pnfName; @JsonProperty("networkInstanceId") private String networkInstanceId; @JsonProperty("volumeGroupInstanceId") @@ -69,12 +69,12 @@ public class ServiceInstancesRequest implements Serializable { this.vnfInstanceId = vnfInstanceId; } - public String getPnfId() { - return pnfId; + public String getPnfName() { + return pnfName; } - public void setPnfId(String pnfId) { - this.pnfId = pnfId; + public void setPnfName(String pnfName) { + this.pnfName = pnfName; } public String getNetworkInstanceId() { @@ -123,7 +123,7 @@ public class ServiceInstancesRequest implements Serializable { sb.append("requestDetails=").append(requestDetails); sb.append(", serviceInstanceId='").append(serviceInstanceId).append('\''); sb.append(", vnfInstanceId='").append(vnfInstanceId).append('\''); - sb.append(", pnfId='").append(pnfId).append('\''); + sb.append(", pnfName='").append(pnfName).append('\''); sb.append(", networkInstanceId='").append(networkInstanceId).append('\''); sb.append(", volumeGroupInstanceId='").append(volumeGroupInstanceId).append('\''); sb.append(", vfModuleInstanceId='").append(vfModuleInstanceId).append('\''); diff --git a/cxf-logging/pom.xml b/cxf-logging/pom.xml index f0c969aeb1..c056daf6f8 100644 --- a/cxf-logging/pom.xml +++ b/cxf-logging/pom.xml @@ -5,7 +5,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>so</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <name>CXFLogging</name> <description>Common CXF Logging Classes</description> diff --git a/deployment-configs/pom.xml b/deployment-configs/pom.xml index 6935a15955..002cd19f81 100644 --- a/deployment-configs/pom.xml +++ b/deployment-configs/pom.xml @@ -5,7 +5,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>so</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>deployment-configs</artifactId> <name>deployment-configs</name> diff --git a/deployment-configs/src/main/resources/logger/logback-spring.xml b/deployment-configs/src/main/resources/logger/logback-spring.xml index 831a33a490..3f022f55fb 100644 --- a/deployment-configs/src/main/resources/logger/logback-spring.xml +++ b/deployment-configs/src/main/resources/logger/logback-spring.xml @@ -27,7 +27,7 @@ <property name="currentTimeStamp" value="%d{"yyyy-MM-dd'T'HH:mm:ss.SSSXXX",UTC}"/> <property name="errorPattern" - value="%d{yyyy-MM-dd'T'HH:mm:ss.SSSXXX}|%X{RequestID}|%thread|%X{ServiceName:-Unknown}|%X{PartnerName}|%X{TargetEntity}|%X{TargetServiceName}|%.-5level|%X{ErrorCode:-900}|%X{ErrorDesc:-UnknownError}|%msg%n" /> + value="%d{yyyy-MM-dd'T'HH:mm:ss.SSSXXX}|%X{RequestID}|%thread|%X{ServiceName:-Unknown}|%X{PartnerName}|%X{TargetEntity}|%X{TargetServiceName}|%.-5level|%X{ErrorCode:-900}|%X{ErrorDesc:-UnknownError}|%msg%nopex%n" /> <property name="debugPattern" value="%d{yyyy-MM-dd'T'HH:mm:ss.SSSXXX}|%X{RequestID}|%logger{50} - %msg%n" /> diff --git a/mso-api-handlers/mso-api-handler-common/pom.xml b/mso-api-handlers/mso-api-handler-common/pom.xml index a3fd37ce2b..865de7998f 100644 --- a/mso-api-handlers/mso-api-handler-common/pom.xml +++ b/mso-api-handlers/mso-api-handler-common/pom.xml @@ -5,7 +5,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>mso-api-handlers</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> diff --git a/mso-api-handlers/mso-api-handler-common/src/main/java/org/onap/so/apihandler/common/RequestClientParameter.java b/mso-api-handlers/mso-api-handler-common/src/main/java/org/onap/so/apihandler/common/RequestClientParameter.java index 3cf3907424..2101252ad0 100644 --- a/mso-api-handlers/mso-api-handler-common/src/main/java/org/onap/so/apihandler/common/RequestClientParameter.java +++ b/mso-api-handlers/mso-api-handler-common/src/main/java/org/onap/so/apihandler/common/RequestClientParameter.java @@ -45,6 +45,7 @@ public class RequestClientParameter { private String requestUri; private String instanceGroupId; private boolean generateIdsOnly; + private String operationType; private RequestClientParameter(Builder builder) { requestId = builder.requestId; @@ -69,6 +70,11 @@ public class RequestClientParameter { requestUri = builder.requestUri; instanceGroupId = builder.instanceGroupId; generateIdsOnly = builder.generateIdsOnly; + operationType = builder.operationType; + } + + public String getOperationType() { + return operationType; } public String getRequestId() { @@ -186,6 +192,12 @@ public class RequestClientParameter { private String requestUri; private String instanceGroupId; private boolean generateIdsOnly; + private String operationType; + + public Builder setOperationType(String operationType) { + this.operationType = operationType; + return this; + } public Builder setRequestId(String requestId) { this.requestId = requestId; @@ -302,4 +314,6 @@ public class RequestClientParameter { } } + + } diff --git a/mso-api-handlers/mso-api-handler-infra/pom.xml b/mso-api-handlers/mso-api-handler-infra/pom.xml index 84a80e6617..3a7c7ad477 100644 --- a/mso-api-handlers/mso-api-handler-infra/pom.xml +++ b/mso-api-handlers/mso-api-handler-infra/pom.xml @@ -5,7 +5,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>mso-api-handlers</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> @@ -98,6 +98,10 @@ <artifactId>spring-retry</artifactId> </dependency> <dependency> + <groupId>org.springframework.boot</groupId> + <artifactId>spring-boot-starter-webflux</artifactId> + </dependency> + <dependency> <groupId>commons-lang</groupId> <artifactId>commons-lang</artifactId> <version>2.6</version> diff --git a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/CamundaRequestHandler.java b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/CamundaRequestHandler.java index 17377d881a..f30b66c6b5 100644 --- a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/CamundaRequestHandler.java +++ b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/CamundaRequestHandler.java @@ -9,9 +9,11 @@ import javax.ws.rs.core.UriBuilder; import javax.xml.bind.DatatypeConverter; import org.camunda.bpm.engine.impl.persistence.entity.HistoricActivityInstanceEntity; import org.camunda.bpm.engine.impl.persistence.entity.HistoricProcessInstanceEntity; +import org.json.JSONObject; import org.onap.logging.filter.spring.SpringClientPayloadFilter; import org.onap.so.logging.jaxrs.filter.SOSpringClientFilter; import org.onap.so.utils.CryptoUtils; +import org.onap.so.apihandlerinfra.exceptions.ContactCamundaException; import org.slf4j.Logger; import org.slf4j.LoggerFactory; import org.springframework.beans.factory.annotation.Autowired; @@ -29,6 +31,9 @@ import org.springframework.stereotype.Component; import org.springframework.web.client.ResourceAccessException; import org.springframework.web.client.RestClientException; import org.springframework.web.client.RestTemplate; +import org.springframework.web.reactive.function.BodyInserters; +import org.springframework.web.reactive.function.client.WebClient; +import reactor.core.publisher.Flux; @Component public class CamundaRequestHandler { @@ -202,6 +207,20 @@ public class CamundaRequestHandler { return retryTemplate; } + protected void sendCamundaMessages(JSONObject msgJson) { + String url = env.getProperty("mso.camundaURL") + "/sobpmnengine/message"; + HttpHeaders headers = + setCamundaHeaders(env.getRequiredProperty("mso.camundaAuth"), env.getRequiredProperty("mso.msoKey")); + headers.setContentType(org.springframework.http.MediaType.APPLICATION_JSON); + // Workflow may take a long time so use non-blocking request + Flux<String> flux = WebClient.create().post().uri(url).headers(httpHeaders -> { + httpHeaders.set(httpHeaders.AUTHORIZATION, headers.get(httpHeaders.AUTHORIZATION).get(0)); + httpHeaders.set(httpHeaders.ACCEPT, headers.get(httpHeaders.ACCEPT).get(0)); + httpHeaders.set(httpHeaders.CONTENT_TYPE, headers.get(httpHeaders.CONTENT_TYPE).get(0)); + }).body(BodyInserters.fromObject(msgJson.toString())).retrieve().bodyToFlux(String.class); + flux.subscribe(res -> logger.debug("Send Camunda Message: " + res)); + } + protected RestTemplate getRestTemplate(boolean retry) { int timeout; if (retry) { diff --git a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/E2EServiceInstances.java b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/E2EServiceInstances.java index 0bcb0f1c86..94e03f1452 100644 --- a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/E2EServiceInstances.java +++ b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/E2EServiceInstances.java @@ -23,11 +23,7 @@ package org.onap.so.apihandlerinfra; import java.io.IOException; -import java.util.ArrayList; -import java.util.HashMap; -import java.util.List; -import java.util.Map; -import java.util.UUID; +import java.util.*; import javax.ws.rs.Consumes; import javax.ws.rs.DELETE; import javax.ws.rs.GET; @@ -38,6 +34,12 @@ import javax.ws.rs.PathParam; import javax.ws.rs.Produces; import javax.ws.rs.core.MediaType; import javax.ws.rs.core.Response; +import org.onap.so.apihandlerinfra.e2eserviceinstancebeans.*; +import org.onap.aai.domain.yang.v16.ServiceInstance; +import org.onap.so.client.aai.AAIObjectType; +import org.onap.so.client.aai.AAIResourcesClient; +import org.onap.so.client.aai.entities.uri.AAIResourceUri; +import org.onap.so.client.aai.entities.uri.AAIUriFactory; import org.onap.so.logger.LoggingAnchor; import org.apache.http.HttpResponse; import org.apache.http.HttpStatus; @@ -174,6 +176,30 @@ public class E2EServiceInstances { return deleteE2EserviceInstances(request, Action.deleteInstance, instanceIdMap, version); } + /** + * Activate Requests for 5G slice Service on a specified version and serviceId + * + * @throws ApiException + */ + + @POST + @Path("/{version:[vV][3-5]}/{serviceId}/{operationType}") + @Consumes(MediaType.APPLICATION_JSON) + @Produces(MediaType.APPLICATION_JSON) + @Operation(description = "Activate 5G slice Service on a specified version and serviceId", responses = @ApiResponse( + content = @Content(array = @ArraySchema(schema = @Schema(implementation = Response.class))))) + public Response Activate5GSliceServiceInstance(String request, @PathParam("version") String version, + @PathParam("operationType") String operationType, @PathParam(SERVICE_ID) String serviceId) + throws ApiException { + if (operationType.equals("activate")) { + instanceIdMap.put("operationType", "activation"); + } else { + instanceIdMap.put("operationType", "deactivation"); + } + instanceIdMap.put(SERVICE_ID, serviceId); + return Activate5GSliceServiceInstances(request, Action.activateInstance, instanceIdMap, version); + } + @GET @Path("/{version:[vV][3-5]}/{serviceId}/operations/{operationId}") @Operation(description = "Find e2eServiceInstances Requests for a given serviceId and operationId", @@ -345,6 +371,116 @@ public class E2EServiceInstances { return builder.buildResponse(HttpStatus.SC_OK, null, e2eServiceResponse, apiVersion); } + private Response Activate5GSliceServiceInstances(String requestJSON, Action action, + HashMap<String, String> instanceIdMap, String version) throws ApiException { + // TODO should be a new one or the same service instance Id + E2ESliceServiceActivateRequest e2eActReq; + + ObjectMapper mapper = new ObjectMapper(); + try { + e2eActReq = mapper.readValue(requestJSON, E2ESliceServiceActivateRequest.class); + + } catch (Exception e) { + + logger.debug("Mapping of request to JSON object failed : ", e); + Response response = msoRequest.buildServiceErrorResponse(HttpStatus.SC_BAD_REQUEST, + MsoException.ServiceException, "Mapping of request to JSON object failed. " + e.getMessage(), + ErrorNumbers.SVC_BAD_PARAMETER, null, version); + logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_REQUEST_VALIDATION_ERROR.toString(), + MSO_PROP_APIHANDLER_INFRA, ErrorCode.SchemaError.getValue(), requestJSON, e); + logger.debug(END_OF_THE_TRANSACTION + response.getEntity()); + return response; + } + + String requestId = UUID.randomUUID().toString(); + RecipeLookupResult recipeLookupResult; + try { + // TODO Get the service template model version uuid from AAI. + String modelVersionId = null; + AAIResourcesClient client = new AAIResourcesClient(); + AAIResourceUri url = AAIUriFactory.createResourceUri(AAIObjectType.SERVICE_INSTANCE, + e2eActReq.getGlobalSubscriberId(), e2eActReq.getServiceType(), instanceIdMap.get(SERVICE_ID)); + Optional<ServiceInstance> serviceInstanceOpt = client.get(ServiceInstance.class, url); + if (serviceInstanceOpt.isPresent()) { + modelVersionId = serviceInstanceOpt.get().getModelVersionId(); + } + recipeLookupResult = getServiceInstanceOrchestrationURI(modelVersionId, action); + } catch (Exception e) { + logger.error(MessageEnum.APIH_DB_ACCESS_EXC.toString(), MSO_PROP_APIHANDLER_INFRA, + ErrorCode.AvailabilityError.getValue(), "Exception while communciate with Catalog DB", e); + + Response response = msoRequest.buildServiceErrorResponse(HttpStatus.SC_NOT_FOUND, + MsoException.ServiceException, "No communication to catalog DB " + e.getMessage(), + ErrorNumbers.SVC_NO_SERVER_RESOURCES, null, version); + + msoRequest.createErrorRequestRecord(Status.FAILED, requestId, + "Exception while communciate with " + "Catalog DB", action, ModelType.service.name(), requestJSON); + logger.debug(END_OF_THE_TRANSACTION + response.getEntity()); + return response; + } + if (recipeLookupResult == null) { + logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_DB_ATTRIBUTE_NOT_FOUND.toString(), + MSO_PROP_APIHANDLER_INFRA, ErrorCode.DataError.getValue(), "No recipe found in DB"); + Response response = msoRequest.buildServiceErrorResponse(HttpStatus.SC_NOT_FOUND, + MsoException.ServiceException, "Recipe does not exist in catalog DB", + ErrorNumbers.SVC_GENERAL_SERVICE_ERROR, null, version); + + msoRequest.createErrorRequestRecord(Status.FAILED, requestId, "Recipe does not exist in catalog DB", action, + ModelType.service.name(), requestJSON); + logger.debug(END_OF_THE_TRANSACTION + response.getEntity()); + return response; + } + + RequestClient requestClient; + HttpResponse response; + + try { + requestClient = requestClientFactory.getRequestClient(recipeLookupResult.getOrchestrationURI()); + + JSONObject jjo = new JSONObject(requestJSON); + jjo.put("operationId", requestId); + + String bpmnRequest = jjo.toString(); + + // Capture audit event + logger.debug("MSO API Handler Posting call to BPEL engine for url: " + requestClient.getUrl()); + String serviceId = instanceIdMap.get(SERVICE_ID); + String operationType = instanceIdMap.get("operationType"); + String serviceInstanceType = e2eActReq.getServiceType(); + RequestClientParameter clientParam = new RequestClientParameter.Builder().setRequestId(requestId) + .setBaseVfModule(false).setRecipeTimeout(recipeLookupResult.getRecipeTimeout()) + .setRequestAction(action.name()).setServiceInstanceId(serviceId).setOperationType(operationType) + .setServiceType(serviceInstanceType).setRequestDetails(bpmnRequest).setApiVersion(version) + .setALaCarte(false).setRecipeParamXsd(recipeLookupResult.getRecipeParamXsd()).build(); + response = requestClient.post(clientParam); + + } catch (Exception e) { + Response resp = msoRequest.buildServiceErrorResponse(HttpStatus.SC_BAD_GATEWAY, + MsoException.ServiceException, "Failed calling bpmn " + e.getMessage(), + ErrorNumbers.SVC_NO_SERVER_RESOURCES, null, version); + logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_BPEL_COMMUNICATE_ERROR.toString(), + MSO_PROP_APIHANDLER_INFRA, ErrorCode.AvailabilityError.getValue(), + "Exception while communicate with BPMN engine"); + logger.debug("End of the transaction, the final response is: " + resp.getEntity()); + return resp; + } + + if (response == null) { + Response resp = + msoRequest.buildServiceErrorResponse(HttpStatus.SC_BAD_GATEWAY, MsoException.ServiceException, + "bpelResponse is null", ErrorNumbers.SVC_NO_SERVER_RESOURCES, null, version); + logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_BPEL_COMMUNICATE_ERROR.toString(), + MSO_PROP_APIHANDLER_INFRA, ErrorCode.BusinessProcessError.getValue(), "Null response from BPEL"); + logger.debug(END_OF_THE_TRANSACTION + resp.getEntity()); + return resp; + } + + ResponseHandler respHandler = new ResponseHandler(response, requestClient.getType()); + int bpelStatus = respHandler.getStatus(); + + return beplStatusUpdate(requestClient, respHandler, bpelStatus, version); + } + private Response deleteE2EserviceInstances(String requestJSON, Action action, HashMap<String, String> instanceIdMap, String version) throws ApiException { // TODO should be a new one or the same service instance Id @@ -370,7 +506,15 @@ public class E2EServiceInstances { RecipeLookupResult recipeLookupResult; try { // TODO Get the service template model version uuid from AAI. - recipeLookupResult = getServiceInstanceOrchestrationURI(null, action); + String modelVersionId = null; + AAIResourcesClient client = new AAIResourcesClient(); + AAIResourceUri url = AAIUriFactory.createResourceUri(AAIObjectType.SERVICE_INSTANCE, + e2eDelReq.getGlobalSubscriberId(), e2eDelReq.getServiceType(), instanceIdMap.get(SERVICE_ID)); + Optional<ServiceInstance> serviceInstanceOpt = client.get(ServiceInstance.class, url); + if (serviceInstanceOpt.isPresent()) { + modelVersionId = serviceInstanceOpt.get().getModelVersionId(); + } + recipeLookupResult = getServiceInstanceOrchestrationURI(modelVersionId, action); } catch (Exception e) { logger.error(MessageEnum.APIH_DB_ACCESS_EXC.toString(), MSO_PROP_APIHANDLER_INFRA, ErrorCode.AvailabilityError.getValue(), "Exception while communciate with Catalog DB", e); diff --git a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/InstanceManagement.java b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/InstanceManagement.java index 028abd6d25..88028d32a1 100644 --- a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/InstanceManagement.java +++ b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/InstanceManagement.java @@ -95,7 +95,7 @@ public class InstanceManagement { @Path("/{version:[vV][1]}/serviceInstances/{serviceInstanceId}/vnfs/{vnfInstanceId}/workflows/{workflowUuid}") @Consumes(MediaType.APPLICATION_JSON) @Produces(MediaType.APPLICATION_JSON) - @Operation(description = "Execute custom workflow", responses = @ApiResponse( + @Operation(description = "Execute custom VNF workflow", responses = @ApiResponse( content = @Content(array = @ArraySchema(schema = @Schema(implementation = Response.class))))) @Transactional public Response executeVNFCustomWorkflow(String request, @PathParam("version") String version, @@ -112,20 +112,20 @@ public class InstanceManagement { } @POST - @Path("/{version:[vV][1]}/serviceInstances/{serviceInstanceId}/pnfs/{pnfId}/workflows/{workflowUuid}") + @Path("/{version:[vV][1]}/serviceInstances/{serviceInstanceId}/pnfs/{pnfName}/workflows/{workflowUuid}") @Consumes(MediaType.APPLICATION_JSON) @Produces(MediaType.APPLICATION_JSON) - @Operation(description = "Execute custom workflow", responses = @ApiResponse( + @Operation(description = "Execute custom PNF workflow", responses = @ApiResponse( content = @Content(array = @ArraySchema(schema = @Schema(implementation = Response.class))))) @Transactional public Response executePNFCustomWorkflow(String request, @PathParam("version") String version, - @PathParam("serviceInstanceId") String serviceInstanceId, @PathParam("pnfId") String pnfId, + @PathParam("serviceInstanceId") String serviceInstanceId, @PathParam("pnfName") String pnfName, @PathParam("workflowUuid") String workflowUuid, @Context ContainerRequestContext requestContext) throws ApiException { String requestId = requestHandlerUtils.getRequestId(requestContext); HashMap<String, String> instanceIdMap = new HashMap<>(); instanceIdMap.put("serviceInstanceId", serviceInstanceId); - instanceIdMap.put("pnfId", pnfId); + instanceIdMap.put("pnfName", pnfName); instanceIdMap.put("workflowUuid", workflowUuid); return processPNFCustomWorkflowRequest(request, Action.forCustomWorkflow, instanceIdMap, version, requestId, requestContext); @@ -255,18 +255,18 @@ public class InstanceManagement { String apiVersion = version.substring(1); String serviceInstanceId = ""; - String pnfId = ""; + String pnfName = ""; String workflowUuid = ""; if (instanceIdMap != null) { serviceInstanceId = instanceIdMap.get("serviceInstanceId"); - pnfId = instanceIdMap.get("pnfId"); + pnfName = instanceIdMap.get("pnfName"); workflowUuid = instanceIdMap.get("workflowUuid"); } String requestUri = requestHandlerUtils.getRequestUri(requestContext, uriPrefix); sir = requestHandlerUtils.convertJsonToServiceInstanceRequest(requestJSON, action, requestId, requestUri); sir.setServiceInstanceId(serviceInstanceId); - sir.setPnfId(pnfId); + sir.setPnfName(pnfName); String requestScope = ModelType.pnf.name(); InfraActiveRequests currentActiveReq = msoRequest.createRequestObject(sir, action, requestId, Status.IN_PROGRESS, requestJSON, requestScope); @@ -299,7 +299,7 @@ public class InstanceManagement { try { requestClientParameter = new RequestClientParameter.Builder().setRequestId(requestId) .setRecipeTimeout(recipeLookupResult.getRecipeTimeout()).setRequestAction(action.toString()) - .setServiceInstanceId(serviceInstanceId).setPnfCorrelationId(pnfId) + .setServiceInstanceId(serviceInstanceId).setPnfCorrelationId(pnfName) .setRequestDetails(requestHandlerUtils.mapJSONtoMSOStyle(requestJSON, null, aLaCarte, action)) .setApiVersion(apiVersion).setRequestUri(requestUri).build(); } catch (IOException e) { diff --git a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/JerseyConfiguration.java b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/JerseyConfiguration.java index b7288e4c91..0afc272b0a 100644 --- a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/JerseyConfiguration.java +++ b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/JerseyConfiguration.java @@ -92,6 +92,7 @@ public class JerseyConfiguration extends ResourceConfig { register(NoRecipeExceptionMapper.class); register(RequestConflictMapper.class); register(WorkflowEngineConnectionMapper.class); + register(OrchestrationTasks.class); // this registration seems to be needed to get predictable // execution behavior for the above JSON Exception Mappers register(com.fasterxml.jackson.jaxrs.json.JacksonJaxbJsonProvider.class); diff --git a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/MsoRequest.java b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/MsoRequest.java index 5c81f4e6a5..ce371203ab 100644 --- a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/MsoRequest.java +++ b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/MsoRequest.java @@ -42,7 +42,11 @@ import javax.xml.transform.Transformer; import javax.xml.transform.TransformerFactory; import javax.xml.transform.dom.DOMSource; import javax.xml.transform.stream.StreamResult; +import org.onap.aai.domain.yang.GenericVnf; +import org.onap.aai.domain.yang.ServiceInstance; +import org.onap.aai.domain.yang.Tenant; import org.onap.so.apihandler.common.ResponseBuilder; +import org.onap.so.apihandlerinfra.infra.rest.AAIDataRetrieval; import org.onap.so.apihandlerinfra.tasksbeans.TasksRequest; import org.onap.so.apihandlerinfra.validation.ApplyUpdatedConfigValidation; import org.onap.so.apihandlerinfra.validation.CloudConfigurationValidation; @@ -97,7 +101,6 @@ import com.fasterxml.jackson.core.JsonGenerationException; import com.fasterxml.jackson.databind.JsonMappingException; import com.fasterxml.jackson.databind.ObjectMapper; - @Component public class MsoRequest { @@ -107,6 +110,9 @@ public class MsoRequest { @Autowired private ResponseBuilder builder; + @Autowired + private AAIDataRetrieval aaiDataRet; + @Value("${mso.enforceDLP:false}") private boolean enforceDLP; @@ -311,11 +317,30 @@ public class MsoRequest { aq.setVnfId(servInsReq.getVnfInstanceId()); } - if (servInsReq.getPnfId() != null) { + if (servInsReq.getPnfName() != null) { aq.setRequestScope(requestScope); - aq.setPnfId(servInsReq.getPnfId()); + aq.setPnfName(servInsReq.getPnfName()); } + if (servInsReq.getRequestDetails() != null && servInsReq.getRequestDetails().getRequestInfo() != null + && servInsReq.getRequestDetails().getRequestInfo().getProductFamilyId() != null) { + logger.debug("Retrieving productFamilyName to put into requests db"); + + org.onap.aai.domain.yang.Service service = + aaiDataRet.getService(servInsReq.getRequestDetails().getRequestInfo().getProductFamilyId()); + if (service != null) { + logger.debug("Found service by service-id"); + String productFamilyName = service.getServiceDescription(); + if (productFamilyName != null) { + aq.setProductFamilyName(productFamilyName); + } + } + } + + aq.setProductFamilyName(getProductFamilyNameFromAAI(servInsReq)); + + aq.setTenantName(getTenantNameFromAAI(servInsReq)); + if (ModelType.service.name().equalsIgnoreCase(requestScope)) { if (servInsReq.getRequestDetails().getRequestInfo() != null) { if (servInsReq.getRequestDetails().getRequestInfo().getInstanceName() != null) { @@ -683,4 +708,31 @@ public class MsoRequest { return vnfType; } + protected String getTenantNameFromAAI(ServiceInstancesRequest servInsReq) { + String tenantName = null; + if (servInsReq.getRequestDetails() != null && servInsReq.getRequestDetails().getCloudConfiguration() != null + && servInsReq.getRequestDetails().getCloudConfiguration().getTenantId() != null) { + Tenant tenant = aaiDataRet.getTenant(servInsReq.getRequestDetails().getCloudConfiguration().getCloudOwner(), + servInsReq.getRequestDetails().getCloudConfiguration().getLcpCloudRegionId(), + servInsReq.getRequestDetails().getCloudConfiguration().getTenantId()); + if (tenant != null) { + tenantName = tenant.getTenantName(); + } + } + return tenantName; + } + + protected String getProductFamilyNameFromAAI(ServiceInstancesRequest servInsReq) { + String productFamilyName = null; + if (servInsReq.getRequestDetails() != null && servInsReq.getRequestDetails().getRequestInfo() != null + && servInsReq.getRequestDetails().getRequestInfo().getProductFamilyId() != null) { + org.onap.aai.domain.yang.Service service = + aaiDataRet.getService(servInsReq.getRequestDetails().getRequestInfo().getProductFamilyId()); + if (service != null) { + productFamilyName = service.getServiceDescription(); + } + } + return productFamilyName; + } + } diff --git a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/OrchestrationRequests.java b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/OrchestrationRequests.java index ae68cc6032..fec93f72e4 100644 --- a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/OrchestrationRequests.java +++ b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/OrchestrationRequests.java @@ -347,6 +347,13 @@ public class OrchestrationRequests { } else { requestDetails = mapper.readValue(requestBody, RequestDetails.class); } + if (requestDetails.getRequestInfo() != null && iar.getProductFamilyName() != null) { + requestDetails.getRequestInfo().setProductFamilyName(iar.getProductFamilyName()); + } + if (requestDetails.getCloudConfiguration() != null && iar.getTenantName() != null) { + requestDetails.getCloudConfiguration().setTenantName(iar.getTenantName()); + } + } catch (IOException e) { logger.error("Exception occurred", e); ErrorLoggerInfo errorLoggerInfo = diff --git a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/OrchestrationTasks.java b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/OrchestrationTasks.java new file mode 100644 index 0000000000..90cf50262b --- /dev/null +++ b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/OrchestrationTasks.java @@ -0,0 +1,300 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License") + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.apihandlerinfra; + +import com.fasterxml.jackson.databind.ObjectMapper; +import io.swagger.v3.oas.annotations.OpenAPIDefinition; +import io.swagger.v3.oas.annotations.Operation; +import io.swagger.v3.oas.annotations.info.Info; +import io.swagger.v3.oas.annotations.media.ArraySchema; +import io.swagger.v3.oas.annotations.media.Content; +import io.swagger.v3.oas.annotations.media.Schema; +import io.swagger.v3.oas.annotations.responses.ApiResponse; +import org.apache.http.HttpStatus; +import org.json.JSONObject; +import org.onap.so.apihandler.common.ErrorNumbers; +import org.onap.so.apihandler.common.ResponseBuilder; +import org.onap.so.apihandlerinfra.exceptions.ApiException; +import org.onap.so.db.request.beans.OrchestrationTask; +import org.onap.so.db.request.client.RequestsDbClient; +import org.onap.so.logger.ErrorCode; +import org.onap.so.logger.LoggingAnchor; +import org.onap.so.logger.MessageEnum; +import org.slf4j.Logger; +import org.slf4j.LoggerFactory; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.stereotype.Component; +import javax.transaction.Transactional; +import javax.ws.rs.*; +import javax.ws.rs.core.MediaType; +import javax.ws.rs.core.Response; +import java.util.HashMap; +import java.util.Iterator; +import java.util.List; +import java.util.Map; +import static org.onap.so.apihandlerinfra.Constants.MSO_PROP_APIHANDLER_INFRA; + +@Path("/onap/so/infra/orchestrationTasks") +@OpenAPIDefinition( + info = @Info(title = "onap/so/infra/orchestrationTasks", description = "API Requests for Orchestration Task")) +@Component +public class OrchestrationTasks { + + private static Logger logger = LoggerFactory.getLogger(OrchestrationTasks.class); + + @Autowired + private MsoRequest msoRequest; + + @Autowired + private CamundaRequestHandler camundaRequestHandler; + + @Autowired + private RequestsDbClient requestsDbClient; + + @Autowired + private ResponseBuilder builder; + + private ObjectMapper mapper = new ObjectMapper(); + + @GET + @Path("/{version:[vV][4-7]}/") + @Operation(description = "Find All Orchestrated Task", responses = @ApiResponse( + content = @Content(array = @ArraySchema(schema = @Schema(implementation = Response.class))))) + @Produces(MediaType.APPLICATION_JSON) + @Transactional + public Response getAllOrchestrationTasks(@QueryParam("status") String status, + @PathParam("version") String version) { + List<OrchestrationTask> orchestrationTaskList = requestsDbClient.getAllOrchestrationTasks(); + if (status != null && !status.isEmpty()) { + for (Iterator<OrchestrationTask> it = orchestrationTaskList.iterator(); it.hasNext();) { + OrchestrationTask task = it.next(); + if (!status.equals(task.getStatus())) { + it.remove(); + } + } + } + return builder.buildResponse(HttpStatus.SC_OK, null, orchestrationTaskList, version); + } + + @GET + @Path("/{version:[vV][4-7]}/{taskId}") + @Operation(description = "Find Orchestrated Task for a given TaskId", responses = @ApiResponse( + content = @Content(array = @ArraySchema(schema = @Schema(implementation = Response.class))))) + @Produces(MediaType.APPLICATION_JSON) + @Transactional + public Response getOrchestrationTask(@PathParam("taskId") String taskId, @PathParam("version") String version) + throws ApiException { + try { + OrchestrationTask orchestrationTask = requestsDbClient.getOrchestrationTask(taskId); + return builder.buildResponse(HttpStatus.SC_OK, null, orchestrationTask, version); + } catch (Exception e) { + logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_DB_ACCESS_EXC.toString(), MSO_PROP_APIHANDLER_INFRA, + ErrorCode.AvailabilityError.getValue(), + "Exception while communciate with Request DB - Orchestration Task Lookup", e); + Response response = + msoRequest.buildServiceErrorResponse(HttpStatus.SC_NOT_FOUND, MsoException.ServiceException, + e.getMessage(), ErrorNumbers.NO_COMMUNICATION_TO_REQUESTS_DB, null, version); + return response; + } + } + + @POST + @Path("/{version:[vV][4-7]}/") + @Operation(description = "Create an Orchestrated Task", responses = @ApiResponse( + content = @Content(array = @ArraySchema(schema = @Schema(implementation = Response.class))))) + @Produces(MediaType.APPLICATION_JSON) + @Transactional + public Response CreateOrchestrationTask(String requestJson, @PathParam("version") String version) { + try { + OrchestrationTask orchestrationTask = mapper.readValue(requestJson, OrchestrationTask.class); + requestsDbClient.createOrchestrationTask(orchestrationTask); + return builder.buildResponse(HttpStatus.SC_OK, null, orchestrationTask, version); + } catch (Exception e) { + logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_DB_ACCESS_EXC.toString(), MSO_PROP_APIHANDLER_INFRA, + ErrorCode.AvailabilityError.getValue(), + "Exception while communciate with Request DB - Orchestration Task Create", e); + Response response = msoRequest.buildServiceErrorResponse(HttpStatus.SC_INTERNAL_SERVER_ERROR, + MsoException.ServiceException, e.getMessage(), ErrorNumbers.COULD_NOT_WRITE_TO_REQUESTS_DB, null, + version); + return response; + } + } + + @PUT + @Path("/{version:[vV][4-7]}/{taskId}") + @Operation(description = "Update an Orchestrated Task", responses = @ApiResponse( + content = @Content(array = @ArraySchema(schema = @Schema(implementation = Response.class))))) + @Produces(MediaType.APPLICATION_JSON) + @Transactional + public Response UpdateOrchestrationTask(@PathParam("taskId") String taskId, String requestJson, + @PathParam("version") String version) { + try { + OrchestrationTask orchestrationTask = requestsDbClient.getOrchestrationTask(taskId); + } catch (Exception e) { + logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_DB_ACCESS_EXC.toString(), MSO_PROP_APIHANDLER_INFRA, + ErrorCode.AvailabilityError.getValue(), + "Exception while communciate with Request DB - Orchestration Task Update", e); + Response response = + msoRequest.buildServiceErrorResponse(HttpStatus.SC_NOT_FOUND, MsoException.ServiceException, + e.getMessage(), ErrorNumbers.NO_COMMUNICATION_TO_REQUESTS_DB, null, version); + return response; + } + + try { + OrchestrationTask orchestrationTask = mapper.readValue(requestJson, OrchestrationTask.class); + requestsDbClient.updateOrchestrationTask(taskId, orchestrationTask); + return builder.buildResponse(HttpStatus.SC_OK, null, orchestrationTask, version); + } catch (Exception e) { + logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_DB_ACCESS_EXC.toString(), MSO_PROP_APIHANDLER_INFRA, + ErrorCode.AvailabilityError.getValue(), + "Exception while communciate with Request DB - Orchestration Task Update", e); + Response response = msoRequest.buildServiceErrorResponse(HttpStatus.SC_INTERNAL_SERVER_ERROR, + MsoException.ServiceException, e.getMessage(), ErrorNumbers.NO_COMMUNICATION_TO_REQUESTS_DB, null, + version); + return response; + } + } + + @DELETE + @Path("/{version:[vV][4-7]}/{taskId}") + @Operation(description = "Delete an Orchestrated Task", responses = @ApiResponse( + content = @Content(array = @ArraySchema(schema = @Schema(implementation = Response.class))))) + @Produces(MediaType.APPLICATION_JSON) + @Transactional + public Response DeleteOrchestrationTask(@PathParam("taskId") String taskId, @PathParam("version") String version) { + try { + OrchestrationTask orchestrationTask = requestsDbClient.getOrchestrationTask(taskId); + } catch (Exception e) { + logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_DB_ACCESS_EXC.toString(), MSO_PROP_APIHANDLER_INFRA, + ErrorCode.AvailabilityError.getValue(), + "Exception while communciate with Request DB - Orchestration Task Delete", e); + Response response = + msoRequest.buildServiceErrorResponse(HttpStatus.SC_NOT_FOUND, MsoException.ServiceException, + e.getMessage(), ErrorNumbers.NO_COMMUNICATION_TO_REQUESTS_DB, null, version); + return response; + } + + try { + requestsDbClient.deleteOrchestrationTask(taskId); + return builder.buildResponse(HttpStatus.SC_OK, null, null, version); + } catch (Exception e) { + logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_DB_ACCESS_EXC.toString(), MSO_PROP_APIHANDLER_INFRA, + ErrorCode.AvailabilityError.getValue(), + "Exception while communciate with Request DB - Orchestration Task Delete", e); + Response response = msoRequest.buildServiceErrorResponse(HttpStatus.SC_INTERNAL_SERVER_ERROR, + MsoException.ServiceException, e.getMessage(), ErrorNumbers.COULD_NOT_WRITE_TO_REQUESTS_DB, null, + version); + return response; + } + } + + @POST + @Path("/{version:[vV][4-7]}/{taskId}/commit") + @Operation(description = "Commit an Orchestrated Task", responses = @ApiResponse( + content = @Content(array = @ArraySchema(schema = @Schema(implementation = Response.class))))) + @Produces(MediaType.APPLICATION_JSON) + @Transactional + public Response CommitOrchestrationTask(@PathParam("taskId") String taskId, @PathParam("version") String version) { + OrchestrationTask orchestrationTask; + try { + orchestrationTask = requestsDbClient.getOrchestrationTask(taskId); + } catch (Exception e) { + logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_DB_ACCESS_EXC.toString(), MSO_PROP_APIHANDLER_INFRA, + ErrorCode.AvailabilityError.getValue(), + "Exception while communciate with Request DB - Orchestration Task Commit", e); + Response response = + msoRequest.buildServiceErrorResponse(HttpStatus.SC_NOT_FOUND, MsoException.ServiceException, + e.getMessage(), ErrorNumbers.NO_COMMUNICATION_TO_REQUESTS_DB, null, version); + return response; + } + try { + String taskName = orchestrationTask.getName(); + Map<String, String> commitVar = new HashMap<>(); + commitVar.put("taskAction", "commit"); + JSONObject msgJson = createMessageBody(taskId, taskName, commitVar); + camundaRequestHandler.sendCamundaMessages(msgJson); + return builder.buildResponse(HttpStatus.SC_OK, null, orchestrationTask, version); + } catch (Exception e) { + logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_DB_ACCESS_EXC.toString(), MSO_PROP_APIHANDLER_INFRA, + ErrorCode.AvailabilityError.getValue(), + "Exception while communciate with Request DB - Orchestration Task Delete", e); + Response response = msoRequest.buildServiceErrorResponse(HttpStatus.SC_INTERNAL_SERVER_ERROR, + MsoException.ServiceException, e.getMessage(), ErrorNumbers.ERROR_FROM_BPEL, null, version); + return response; + } + + } + + @POST + @Path("/{version:[vV][4-7]}/{taskId}/abort") + @Operation(description = "Commit an Orchestrated Task", responses = @ApiResponse( + content = @Content(array = @ArraySchema(schema = @Schema(implementation = Response.class))))) + @Produces(MediaType.APPLICATION_JSON) + @Transactional + public Response AbortOrchestrationTask(@PathParam("taskId") String taskId, @PathParam("version") String version) { + OrchestrationTask orchestrationTask; + try { + orchestrationTask = requestsDbClient.getOrchestrationTask(taskId); + } catch (Exception e) { + logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_DB_ACCESS_EXC.toString(), MSO_PROP_APIHANDLER_INFRA, + ErrorCode.AvailabilityError.getValue(), + "Exception while communciate with Request DB - Orchestration Task Commit", e); + Response response = + msoRequest.buildServiceErrorResponse(HttpStatus.SC_NOT_FOUND, MsoException.ServiceException, + e.getMessage(), ErrorNumbers.NO_COMMUNICATION_TO_REQUESTS_DB, null, version); + return response; + } + try { + String taskName = orchestrationTask.getName(); + Map<String, String> commitVar = new HashMap<>(); + commitVar.put("taskAction", "abort"); + JSONObject msgJson = createMessageBody(taskId, taskName, commitVar); + camundaRequestHandler.sendCamundaMessages(msgJson); + return builder.buildResponse(HttpStatus.SC_OK, null, orchestrationTask, version); + } catch (Exception e) { + logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_DB_ACCESS_EXC.toString(), MSO_PROP_APIHANDLER_INFRA, + ErrorCode.AvailabilityError.getValue(), + "Exception while communciate with Request DB - Orchestration Task Delete", e); + Response response = msoRequest.buildServiceErrorResponse(HttpStatus.SC_INTERNAL_SERVER_ERROR, + MsoException.ServiceException, e.getMessage(), ErrorNumbers.ERROR_FROM_BPEL, null, version); + return response; + } + + } + + private JSONObject createMessageBody(String taskId, String taskName, Map<String, ?> variables) { + JSONObject msgJson = new JSONObject(); + msgJson.put("messageName", taskName); + msgJson.put("businessKey", taskId); + JSONObject processVariables = new JSONObject(); + for (Map.Entry<String, ?> entry : variables.entrySet()) { + JSONObject valueInfo = new JSONObject(); + String key = entry.getKey(); + Object value = entry.getValue(); + valueInfo.put("value", value.toString()); + valueInfo.put("type", value.getClass().getSimpleName()); + processVariables.put(key, valueInfo); + } + msgJson.put("processVariables", processVariables); + return msgJson; + } + +} diff --git a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/RequestHandlerUtils.java b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/RequestHandlerUtils.java index 75b7e74d49..38fb1596d0 100644 --- a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/RequestHandlerUtils.java +++ b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/RequestHandlerUtils.java @@ -506,8 +506,8 @@ public class RequestHandlerUtils extends AbstractRestHandler { if (instanceIdMap.get(CommonConstants.INSTANCE_GROUP_INSTANCE_ID) != null) { currentActiveReq.setInstanceGroupId(instanceIdMap.get(CommonConstants.INSTANCE_GROUP_INSTANCE_ID)); } - if (instanceIdMap.get("PnfId") != null) { - currentActiveReq.setPnfId(instanceIdMap.get("PnfId")); + if (instanceIdMap.get("pnfName") != null) { + currentActiveReq.setPnfName(instanceIdMap.get("pnfName")); } } } diff --git a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/WorkflowSpecificationsHandler.java b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/WorkflowSpecificationsHandler.java index 925d10179f..d9955352c6 100644 --- a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/WorkflowSpecificationsHandler.java +++ b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/WorkflowSpecificationsHandler.java @@ -6,6 +6,8 @@ * ================================================================================ * Modifications Copyright (c) 2019 Samsung * ================================================================================ + * Modifications Copyright (c) 2020 Nordix + * ================================================================================ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at @@ -21,34 +23,23 @@ */ package org.onap.so.apihandlerinfra; -import java.util.ArrayList; -import java.util.HashMap; -import java.util.List; -import java.util.Map; -import java.util.stream.Collectors; -import javax.transaction.Transactional; -import javax.ws.rs.GET; -import javax.ws.rs.Path; -import javax.ws.rs.PathParam; -import javax.ws.rs.QueryParam; -import javax.ws.rs.core.Response; +import com.fasterxml.jackson.core.JsonProcessingException; +import com.fasterxml.jackson.databind.DeserializationFeature; +import com.fasterxml.jackson.databind.ObjectMapper; +import io.swagger.v3.oas.annotations.OpenAPIDefinition; +import io.swagger.v3.oas.annotations.Operation; +import io.swagger.v3.oas.annotations.info.Info; +import io.swagger.v3.oas.annotations.media.ArraySchema; +import io.swagger.v3.oas.annotations.media.Content; +import io.swagger.v3.oas.annotations.media.Schema; +import io.swagger.v3.oas.annotations.responses.ApiResponse; import org.apache.http.HttpStatus; import org.onap.so.apihandler.common.ErrorNumbers; import org.onap.so.apihandler.common.ResponseBuilder; import org.onap.so.apihandlerinfra.exceptions.ValidateException; import org.onap.so.apihandlerinfra.logging.ErrorLoggerInfo; -import org.onap.so.apihandlerinfra.workflowspecificationbeans.ActivitySequence; -import org.onap.so.apihandlerinfra.workflowspecificationbeans.ArtifactInfo; -import org.onap.so.apihandlerinfra.workflowspecificationbeans.Validation; -import org.onap.so.apihandlerinfra.workflowspecificationbeans.WorkflowInputParameter; -import org.onap.so.apihandlerinfra.workflowspecificationbeans.WorkflowSpecification; -import org.onap.so.apihandlerinfra.workflowspecificationbeans.WorkflowSpecificationList; -import org.onap.so.apihandlerinfra.workflowspecificationbeans.WorkflowSpecifications; -import org.onap.so.db.catalog.beans.ActivitySpec; -import org.onap.so.db.catalog.beans.ActivitySpecUserParameters; -import org.onap.so.db.catalog.beans.UserParameters; -import org.onap.so.db.catalog.beans.Workflow; -import org.onap.so.db.catalog.beans.WorkflowActivitySpecSequence; +import org.onap.so.apihandlerinfra.workflowspecificationbeans.*; +import org.onap.so.db.catalog.beans.*; import org.onap.so.db.catalog.client.CatalogDbClient; import org.onap.so.logger.ErrorCode; import org.onap.so.logger.MessageEnum; @@ -56,16 +47,15 @@ import org.slf4j.Logger; import org.slf4j.LoggerFactory; import org.springframework.beans.factory.annotation.Autowired; import org.springframework.stereotype.Component; -import com.fasterxml.jackson.core.JsonProcessingException; -import com.fasterxml.jackson.databind.DeserializationFeature; -import com.fasterxml.jackson.databind.ObjectMapper; -import io.swagger.v3.oas.annotations.OpenAPIDefinition; -import io.swagger.v3.oas.annotations.Operation; -import io.swagger.v3.oas.annotations.info.Info; -import io.swagger.v3.oas.annotations.media.ArraySchema; -import io.swagger.v3.oas.annotations.media.Content; -import io.swagger.v3.oas.annotations.media.Schema; -import io.swagger.v3.oas.annotations.responses.ApiResponse; +import javax.transaction.Transactional; +import javax.ws.rs.GET; +import javax.ws.rs.Path; +import javax.ws.rs.PathParam; +import javax.ws.rs.QueryParam; +import javax.ws.rs.core.Response; +import java.util.*; +import java.util.stream.Collectors; + @Path("onap/so/infra/workflowSpecifications") @OpenAPIDefinition(info = @Info(title = "onap/so/infra/workflowSpecifications", @@ -82,6 +72,7 @@ public class WorkflowSpecificationsHandler { private static Logger logger = LoggerFactory.getLogger(WorkflowSpecificationsHandler.class); private static final String ARTIFACT_TYPE_WORKFLOW = "workflow"; private static final String NATIVE_WORKFLOW = "native"; + private static final String EMPTY_BODY = ""; @Path("/{version:[vV]1}/workflows") @GET @@ -90,38 +81,62 @@ public class WorkflowSpecificationsHandler { @Transactional public Response queryWorkflowSpecifications(@QueryParam("vnfModelVersionId") String vnfModelVersionId, - @PathParam("version") String version) throws Exception { - + @QueryParam("pnfModelVersionId") String pnfModelVersionId, @PathParam("version") String version) + throws Exception { String apiVersion = version.substring(1); - ObjectMapper mapper1 = new ObjectMapper(); - mapper1.configure(DeserializationFeature.FAIL_ON_UNKNOWN_PROPERTIES, false); - - List<Workflow> workflows = catalogDbClient.findWorkflowByModelUUID(vnfModelVersionId); + List<Workflow> workflows = new ArrayList<>(); + if (vnfModelVersionId == null && pnfModelVersionId == null) { + workflows.addAll(queryWorkflowSpecificationsForAll()); + } else { + // 1. query workflow specifications for given vnfModelVersionId if need. + if (vnfModelVersionId != null) { + List<Workflow> vnfWorkflows = queryWorkflowSpecificationsForVnf(vnfModelVersionId); + logger.debug("Retrieved " + vnfWorkflows.size() + " workflows for given vnfModelVersionId."); + if (vnfWorkflows.size() > 0) { + workflows.addAll(vnfWorkflows); + } + } - List<Workflow> nativeWorkflows = catalogDbClient.findWorkflowBySource(NATIVE_WORKFLOW); - if (nativeWorkflows != null && !nativeWorkflows.isEmpty()) { - workflows.addAll(nativeWorkflows); + // 2. query workflow specifications for given pnfModelVersionId if need. + if (pnfModelVersionId != null) { + List<Workflow> pnfWorkflows = queryWorkflowSpecificationsForPnf(pnfModelVersionId); + logger.debug("Retrieved " + pnfWorkflows.size() + " workflows for given pnfModelVerionId."); + if (pnfWorkflows.size() > 0) { + workflows.addAll(pnfWorkflows); + } + } } - WorkflowSpecifications workflowSpecifications = mapWorkflowsToWorkflowSpecifications(workflows); + // Deduplication + List<Workflow> retWorkflows = workflows.stream() + .collect(Collectors.collectingAndThen( + Collectors.toCollection(() -> new TreeSet<>(Comparator.comparing(Workflow::getArtifactUUID))), + ArrayList::new)); - String jsonResponse; - try { - ObjectMapper mapper = new ObjectMapper(); - jsonResponse = mapper.writeValueAsString(workflowSpecifications); - } catch (JsonProcessingException e) { - ErrorLoggerInfo errorLoggerInfo = - new ErrorLoggerInfo.Builder(MessageEnum.APIH_REQUEST_VALIDATION_ERROR, ErrorCode.SchemaError) - .build(); - ValidateException validateException = - new ValidateException.Builder("Mapping of request to JSON object failed : " + e.getMessage(), - HttpStatus.SC_BAD_REQUEST, ErrorNumbers.SVC_BAD_PARAMETER).cause(e) - .errorInfo(errorLoggerInfo).build(); - throw validateException; - } + Optional<String> optional = getResponseByWorkflowSpec(retWorkflows); + return builder.buildResponse(HttpStatus.SC_OK, "", optional.isPresent() ? optional.get() : EMPTY_BODY, + apiVersion); + } + + @Path("/{version:[vV]1}/pnfWorkflows") + @GET + @Operation(description = "Finds pnf workflow specifications", responses = @ApiResponse( + content = @Content(array = @ArraySchema(schema = @Schema(implementation = Response.class))))) + @Transactional + public Response getWorkflowsSpecForPnf(@PathParam("version") String version) throws Exception { - return builder.buildResponse(HttpStatus.SC_OK, "", jsonResponse, apiVersion); + final String pnf_resource = "pnf"; + String apiVersion = version.substring(1); + + ObjectMapper mapper = new ObjectMapper(); + mapper.configure(DeserializationFeature.FAIL_ON_UNKNOWN_PROPERTIES, false); + + List<Workflow> workflows = catalogDbClient.findWorkflowByResourceTarget(pnf_resource); + + Optional<String> optional = getResponseByWorkflowSpec(workflows); + return builder.buildResponse(HttpStatus.SC_OK, "", optional.isPresent() ? optional.get() : EMPTY_BODY, + apiVersion); } protected WorkflowSpecifications mapWorkflowsToWorkflowSpecifications(List<Workflow> workflows) { @@ -144,6 +159,28 @@ public class WorkflowSpecificationsHandler { return workflowSpecifications; } + private Optional<String> getResponseByWorkflowSpec(List<Workflow> workflows) throws ValidateException { + WorkflowSpecifications workflowSpecifications = mapWorkflowsToWorkflowSpecifications(workflows); + + try { + ObjectMapper mapper = new ObjectMapper(); + return Optional.of(mapper.writeValueAsString(workflowSpecifications)); + } catch (JsonProcessingException e) { + catchAndThrowValidationEx(e); + } + return Optional.empty(); + } + + private Response catchAndThrowValidationEx(JsonProcessingException e) throws ValidateException { + ErrorLoggerInfo errorLoggerInfo = + new ErrorLoggerInfo.Builder(MessageEnum.APIH_REQUEST_VALIDATION_ERROR, ErrorCode.SchemaError).build(); + ValidateException validateException = + new ValidateException.Builder("Mapping of request to JSON object failed : " + e.getMessage(), + HttpStatus.SC_BAD_REQUEST, ErrorNumbers.SVC_BAD_PARAMETER).cause(e).errorInfo(errorLoggerInfo) + .build(); + throw validateException; + } + private ArtifactInfo buildArtifactInfo(Workflow workflow) { ArtifactInfo artifactInfo = new ArtifactInfo(); artifactInfo.setArtifactType(ARTIFACT_TYPE_WORKFLOW); @@ -239,4 +276,24 @@ public class WorkflowSpecificationsHandler { } return validationList; } + + private List<Workflow> queryWorkflowSpecificationsForAll() { + List<Workflow> workflows = catalogDbClient.findWorkflowBySource(NATIVE_WORKFLOW); + return workflows; + } + + private List<Workflow> queryWorkflowSpecificationsForVnf(String vnfModelVersionId) { + List<Workflow> workflows = catalogDbClient.findWorkflowByVnfModelUUID(vnfModelVersionId); + + List<Workflow> nativeWorkflows = catalogDbClient.findWorkflowBySource(NATIVE_WORKFLOW); + if (!nativeWorkflows.isEmpty()) { + workflows.addAll(nativeWorkflows); + } + return workflows; + } + + private List<Workflow> queryWorkflowSpecificationsForPnf(String pnfModelVersionId) { + List<Workflow> workflows = catalogDbClient.findWorkflowByPnfModelUUID(pnfModelVersionId); + return workflows; + } } diff --git a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/e2eserviceinstancebeans/E2ESliceServiceActivateRequest.java b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/e2eserviceinstancebeans/E2ESliceServiceActivateRequest.java new file mode 100644 index 0000000000..2fb219c182 --- /dev/null +++ b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/e2eserviceinstancebeans/E2ESliceServiceActivateRequest.java @@ -0,0 +1,23 @@ +package org.onap.so.apihandlerinfra.e2eserviceinstancebeans; + +public class E2ESliceServiceActivateRequest { + private String globalSubscriberId; + + private String serviceType; + + public String getGlobalSubscriberId() { + return globalSubscriberId; + } + + public void setGlobalSubscriberId(String globalSubscriberId) { + this.globalSubscriberId = globalSubscriberId; + } + + public String getServiceType() { + return serviceType; + } + + public void setServiceType(String serviceType) { + this.serviceType = serviceType; + } +} diff --git a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/infra/rest/AAIDataRetrieval.java b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/infra/rest/AAIDataRetrieval.java index 344e5438c9..fee7a3a8f4 100644 --- a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/infra/rest/AAIDataRetrieval.java +++ b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/infra/rest/AAIDataRetrieval.java @@ -3,7 +3,9 @@ package org.onap.so.apihandlerinfra.infra.rest; import java.util.Optional; import org.onap.aai.domain.yang.GenericVnf; import org.onap.aai.domain.yang.L3Network; +import org.onap.aai.domain.yang.Service; import org.onap.aai.domain.yang.ServiceInstance; +import org.onap.aai.domain.yang.Tenant; import org.onap.aai.domain.yang.VfModule; import org.onap.aai.domain.yang.VolumeGroup; import org.onap.so.apihandlerinfra.infra.rest.exception.AAIEntityNotFound; @@ -34,7 +36,6 @@ public class AAIDataRetrieval { }); } - public VfModule getAAIVfModule(String vnfId, String vfModuleId) { return this.getAaiResourcesClient() .get(VfModule.class, AAIUriFactory.createResourceUri(AAIObjectType.VF_MODULE, vnfId, vfModuleId)) @@ -75,6 +76,24 @@ public class AAIDataRetrieval { }); } + public Service getService(String serviceId) { + return this.getAaiResourcesClient() + .get(Service.class, AAIUriFactory.createResourceUri(AAIObjectType.SERVICE, serviceId)).orElseGet(() -> { + logger.debug("No Service found in A&AI ServiceId: {}", serviceId); + return null; + }); + } + + public Tenant getTenant(String cloudOwner, String cloudRegion, String tenantId) { + return this.getAaiResourcesClient() + .get(Tenant.class, + AAIUriFactory.createResourceUri(AAIObjectType.TENANT, cloudOwner, cloudRegion, tenantId)) + .orElseGet(() -> { + logger.debug("No Tenant found in A&AI TenantId: {}", tenantId); + return null; + }); + } + protected AAIResourcesClient getAaiResourcesClient() { if (aaiResourcesClient == null) { aaiResourcesClient = new AAIResourcesClient(); diff --git a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/validation/CustomWorkflowValidation.java b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/validation/CustomWorkflowValidation.java index c05ef98fbb..01c7fd33f9 100644 --- a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/validation/CustomWorkflowValidation.java +++ b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/validation/CustomWorkflowValidation.java @@ -29,20 +29,13 @@ import com.google.common.base.Strings; public class CustomWorkflowValidation implements ValidationRule { + /** + * This function should be generic both for custom VNF workflow and PNF workflow + */ @Override public ValidationInformation validate(ValidationInformation info) throws ValidationException { RequestParameters requestParameters = info.getSir().getRequestDetails().getRequestParameters(); - CloudConfiguration cloudConfiguration = info.getSir().getRequestDetails().getCloudConfiguration(); - if (cloudConfiguration == null) { - // throw new ValidationException("cloudConfiguration"); - } else if (Strings.isNullOrEmpty((cloudConfiguration.getCloudOwner()))) { - // throw new ValidationException("cloudOwner"); - } else if (Strings.isNullOrEmpty((cloudConfiguration.getLcpCloudRegionId()))) { - // throw new ValidationException("lcpCloudRegionId"); - } else if (Strings.isNullOrEmpty((cloudConfiguration.getTenantId()))) { - // throw new ValidationException("tenantId"); - } if (requestParameters == null) { throw new ValidationException("requestParameters"); } diff --git a/mso-api-handlers/mso-api-handler-infra/src/test/java/org/onap/so/apihandlerinfra/InstanceManagementTest.java b/mso-api-handlers/mso-api-handler-infra/src/test/java/org/onap/so/apihandlerinfra/InstanceManagementTest.java index 5c78af3601..ba7fe2b9cb 100644 --- a/mso-api-handlers/mso-api-handler-infra/src/test/java/org/onap/so/apihandlerinfra/InstanceManagementTest.java +++ b/mso-api-handlers/mso-api-handler-infra/src/test/java/org/onap/so/apihandlerinfra/InstanceManagementTest.java @@ -192,11 +192,12 @@ public class InstanceManagementTest extends BaseTest { requestReferences.setRequestSelfLink(createExpectedSelfLink("v1", "32807a28-1a14-4b88-b7b3-2950918aa76d")); expectedResponse.setRequestReferences(requestReferences); uri = instanceManagementUri + "v1" - + "/serviceInstances/5df8b6de-2083-11e7-93ae-92361f002676/pnfs/testpnfcId/workflows/81526781-e55c-4cb7-adb3-97e09d9c76bf"; + + "/serviceInstances/5df8b6de-2083-11e7-93ae-92361f002676/pnfs/testPnfName/workflows/81526781-e55c-4cb7-adb3-97e09d9c76bf"; ResponseEntity<String> response = sendRequest(inputStream("/ExecutePNFCustomWorkflow.json"), uri, HttpMethod.POST, headers); assertEquals(Response.Status.ACCEPTED.getStatusCode(), response.getStatusCode().value()); + ServiceInstancesResponse realResponse = mapper.readValue(response.getBody(), ServiceInstancesResponse.class); assertThat(realResponse, sameBeanAs(expectedResponse).ignoring("requestReferences.requestId")); } diff --git a/mso-api-handlers/mso-api-handler-infra/src/test/java/org/onap/so/apihandlerinfra/MsoRequestTest.java b/mso-api-handlers/mso-api-handler-infra/src/test/java/org/onap/so/apihandlerinfra/MsoRequestTest.java index f1d5a5487f..d1e5dc717e 100644 --- a/mso-api-handlers/mso-api-handler-infra/src/test/java/org/onap/so/apihandlerinfra/MsoRequestTest.java +++ b/mso-api-handlers/mso-api-handler-infra/src/test/java/org/onap/so/apihandlerinfra/MsoRequestTest.java @@ -22,6 +22,7 @@ package org.onap.so.apihandlerinfra; import static org.junit.Assert.assertEquals; import static org.junit.Assert.assertNotNull; +import static org.mockito.Mockito.doReturn; import java.io.IOException; import java.io.StringReader; import java.nio.file.Files; @@ -34,12 +35,19 @@ import javax.ws.rs.core.Response; import javax.xml.parsers.DocumentBuilder; import javax.xml.parsers.DocumentBuilderFactory; import org.apache.http.HttpStatus; +import org.junit.Before; import org.junit.ClassRule; import org.junit.Rule; import org.junit.Test; import org.junit.rules.ExpectedException; import org.junit.runner.RunWith; +import org.mockito.InjectMocks; +import org.mockito.Mock; +import org.mockito.MockitoAnnotations; +import org.onap.aai.domain.yang.Service; +import org.onap.aai.domain.yang.Tenant; import org.onap.so.apihandler.common.ErrorNumbers; +import org.onap.so.apihandlerinfra.infra.rest.AAIDataRetrieval; import org.onap.so.exceptions.ValidationException; import org.onap.so.serviceinstancebeans.ServiceInstancesRequest; import org.springframework.test.context.junit4.rules.SpringClassRule; @@ -75,6 +83,17 @@ public class MsoRequestTest extends BaseTest { @Rule public ExpectedException thrown = ExpectedException.none(); + @Mock + private AAIDataRetrieval aaiDataRet; + + @InjectMocks + private MsoRequest msoRequestMock; + + @Before + public void setUp() { + MockitoAnnotations.initMocks(this); + } + public String inputStream(String JsonInput) throws IOException { JsonInput = "src/test/resources/MsoRequestTest" + JsonInput; String input = new String(Files.readAllBytes(Paths.get(JsonInput))); @@ -1056,5 +1075,37 @@ public class MsoRequestTest extends BaseTest { assertNotNull(result); } + @Test + public void getTenantNameFromAAITest() throws Exception { + this.sir = mapper.readValue(inputStream("/SuccessfulValidation/ServiceAssign.json"), + ServiceInstancesRequest.class); + String tenantId = "88a6ca3ee0394ade9403f075db23167e"; + String tenantNameFromAAI = "testTenantName"; + String cloudRegion = "mdt1"; + String cloudOwner = "cloudOwner"; + this.sir.getRequestDetails().getCloudConfiguration().setCloudOwner(cloudOwner); + Tenant tenant = new Tenant(); + tenant.setTenantId(tenantId); + tenant.setTenantName(tenantNameFromAAI); + doReturn(tenant).when(aaiDataRet).getTenant(cloudOwner, cloudRegion, tenantId); + String tenantName = msoRequestMock.getTenantNameFromAAI(this.sir); + assertEquals(tenantNameFromAAI, tenantName); + } + + + @Test + public void getProductFamilyNameFromAAITest() throws Exception { + this.sir = mapper.readValue(inputStream("/SuccessfulValidation/ServiceAssign.json"), + ServiceInstancesRequest.class); + String serviceId = "a9a77d5a-123e-4ca2-9eb9-0b015d2ee0fb"; + String serviceDescription = "testServiceDescription"; + Service service = new Service(); + service.setServiceId(serviceId); + service.setServiceDescription(serviceDescription); + doReturn(service).when(aaiDataRet).getService(serviceId); + String productFamilyName = msoRequestMock.getProductFamilyNameFromAAI(this.sir); + assertEquals(serviceDescription, productFamilyName); + } + } diff --git a/mso-api-handlers/mso-api-handler-infra/src/test/java/org/onap/so/apihandlerinfra/ServiceInstancesTest.java b/mso-api-handlers/mso-api-handler-infra/src/test/java/org/onap/so/apihandlerinfra/ServiceInstancesTest.java index f566628ee3..1332ffd913 100644 --- a/mso-api-handlers/mso-api-handler-infra/src/test/java/org/onap/so/apihandlerinfra/ServiceInstancesTest.java +++ b/mso-api-handlers/mso-api-handler-infra/src/test/java/org/onap/so/apihandlerinfra/ServiceInstancesTest.java @@ -441,6 +441,10 @@ public class ServiceInstancesTest extends BaseTest { .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) .withBody(mapper.writeValueAsString(defaultService)).withStatus(HttpStatus.SC_OK))); + wireMockServer.stubFor(get(urlMatching(".*/service-design-and-creation/services/service/.*")) + .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) + .withBodyFile("/aai/ServiceFromAAI.json").withStatus(HttpStatus.SC_OK))); + wireMockServer.stubFor(get(urlMatching(".*/service/search/.*")) .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) .withBody(mapper.writeValueAsString(defaultService)).withStatus(HttpStatus.SC_OK))); @@ -483,6 +487,10 @@ public class ServiceInstancesTest extends BaseTest { .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) .withBody(mapper.writeValueAsString(defaultService)).withStatus(HttpStatus.SC_OK))); + wireMockServer.stubFor(get(urlMatching(".*/service-design-and-creation/services/service/.*")) + .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) + .withBodyFile("/aai/ServiceFromAAI.json").withStatus(HttpStatus.SC_OK))); + wireMockServer.stubFor(get(urlMatching(".*/service/search/.*")) .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) .withBody(mapper.writeValueAsString(defaultService)).withStatus(HttpStatus.SC_OK))); @@ -524,6 +532,10 @@ public class ServiceInstancesTest extends BaseTest { .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) .withBody(mapper.writeValueAsString(defaultService)).withStatus(HttpStatus.SC_OK))); + wireMockServer.stubFor(get(urlMatching(".*/service-design-and-creation/services/service/.*")) + .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) + .withBodyFile("/aai/ServiceFromAAI.json").withStatus(HttpStatus.SC_OK))); + wireMockServer.stubFor(get(urlMatching(".*/service/search/.*")) .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) .withBody(mapper.writeValueAsString(defaultService)).withStatus(HttpStatus.SC_OK))); @@ -1939,6 +1951,10 @@ public class ServiceInstancesTest extends BaseTest { .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) .withBody(mapper.writeValueAsString(defaultService)).withStatus(HttpStatus.SC_OK))); + wireMockServer.stubFor(get(urlMatching(".*/service-design-and-creation/services/service/.*")) + .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) + .withBodyFile("/aai/ServiceFromAAI.json").withStatus(HttpStatus.SC_OK))); + wireMockServer.stubFor(get(urlMatching(".*/serviceRecipe/search.*")) .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) .withBody(mapper.writeValueAsString(serviceRecipe)).withStatus(HttpStatus.SC_OK))); @@ -2114,6 +2130,10 @@ public class ServiceInstancesTest extends BaseTest { .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) .withBody(mapper.writeValueAsString(defaultService)).withStatus(HttpStatus.SC_OK))); + wireMockServer.stubFor(get(urlMatching(".*/service-design-and-creation/services/service/.*")) + .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) + .withBodyFile("/aai/ServiceFromAAI.json").withStatus(HttpStatus.SC_OK))); + wireMockServer.stubFor(get(urlMatching(".*/serviceRecipe/search.*")) .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) .withBody(mapper.writeValueAsString(serviceRecipe)).withStatus(HttpStatus.SC_OK))); diff --git a/mso-api-handlers/mso-api-handler-infra/src/test/java/org/onap/so/apihandlerinfra/WorkflowSpecificationsHandlerTest.java b/mso-api-handlers/mso-api-handler-infra/src/test/java/org/onap/so/apihandlerinfra/WorkflowSpecificationsHandlerTest.java index 0beab1bd13..21e6d53c14 100644 --- a/mso-api-handlers/mso-api-handler-infra/src/test/java/org/onap/so/apihandlerinfra/WorkflowSpecificationsHandlerTest.java +++ b/mso-api-handlers/mso-api-handler-infra/src/test/java/org/onap/so/apihandlerinfra/WorkflowSpecificationsHandlerTest.java @@ -4,6 +4,8 @@ * ================================================================================ * Copyright (C) 2019 AT&T Intellectual Property. All rights reserved. * ================================================================================ + * Modifications Copyright (c) 2020 Nordix + * ================================================================================ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at @@ -20,30 +22,15 @@ package org.onap.so.apihandlerinfra; -import static com.github.tomakehurst.wiremock.client.WireMock.aResponse; -import static com.github.tomakehurst.wiremock.client.WireMock.get; -import static com.github.tomakehurst.wiremock.client.WireMock.urlMatching; -import static com.shazam.shazamcrest.matcher.Matchers.sameBeanAs; -import static org.junit.Assert.assertEquals; -import static org.junit.Assert.assertThat; -import java.io.File; -import java.io.IOException; -import java.nio.file.Files; -import java.nio.file.Paths; -import java.text.ParseException; -import java.util.ArrayList; -import java.util.List; -import javax.ws.rs.core.MediaType; -import javax.ws.rs.core.Response; +import com.fasterxml.jackson.core.JsonParseException; +import com.fasterxml.jackson.databind.DeserializationFeature; +import com.fasterxml.jackson.databind.JsonMappingException; +import com.fasterxml.jackson.databind.ObjectMapper; import org.json.JSONException; import org.junit.Test; import org.onap.so.apihandlerinfra.workflowspecificationbeans.WorkflowInputParameter; import org.onap.so.apihandlerinfra.workflowspecificationbeans.WorkflowSpecifications; -import org.onap.so.db.catalog.beans.ActivitySpec; -import org.onap.so.db.catalog.beans.ActivitySpecUserParameters; -import org.onap.so.db.catalog.beans.UserParameters; -import org.onap.so.db.catalog.beans.Workflow; -import org.onap.so.db.catalog.beans.WorkflowActivitySpecSequence; +import org.onap.so.db.catalog.beans.*; import org.skyscreamer.jsonassert.JSONAssert; import org.springframework.beans.factory.annotation.Autowired; import org.springframework.beans.factory.annotation.Value; @@ -53,10 +40,19 @@ import org.springframework.http.HttpMethod; import org.springframework.http.ResponseEntity; import org.springframework.util.ResourceUtils; import org.springframework.web.util.UriComponentsBuilder; -import com.fasterxml.jackson.core.JsonParseException; -import com.fasterxml.jackson.databind.DeserializationFeature; -import com.fasterxml.jackson.databind.JsonMappingException; -import com.fasterxml.jackson.databind.ObjectMapper; +import javax.ws.rs.core.MediaType; +import javax.ws.rs.core.Response; +import java.io.File; +import java.io.IOException; +import java.nio.file.Files; +import java.nio.file.Paths; +import java.text.ParseException; +import java.util.ArrayList; +import java.util.List; +import static com.github.tomakehurst.wiremock.client.WireMock.*; +import static com.shazam.shazamcrest.matcher.Matchers.sameBeanAs; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.assertThat; public class WorkflowSpecificationsHandlerTest extends BaseTest { @Autowired @@ -65,19 +61,20 @@ public class WorkflowSpecificationsHandlerTest extends BaseTest { @Value("${wiremock.server.port}") private String wiremockPort; - private final String basePath = "onap/so/infra/workflowSpecifications/v1/workflows"; + private final String basePath = "onap/so/infra/workflowSpecifications"; @Test - public void queryWorkflowSpecifications_Test_Success() + public void queryWorkflowSpecificationsByVnfModelUUID_Test_Success() throws ParseException, JSONException, JsonParseException, JsonMappingException, IOException { + final String urlPath = basePath + "/v1/workflows"; HttpHeaders headers = new HttpHeaders(); headers.set("Accept", MediaType.APPLICATION_JSON); headers.set("Content-Type", MediaType.APPLICATION_JSON); HttpEntity<String> entity = new HttpEntity<String>(null, headers); wireMockServer.stubFor(get(urlMatching( - "/workflow/search/findWorkflowByModelUUID[?]vnfResourceModelUUID=b5fa707a-f55a-11e7-a796-005056856d52")) + "/workflow/search/findWorkflowByVnfModelUUID[?]vnfResourceModelUUID=b5fa707a-f55a-11e7-a796-005056856d52")) .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) .withBody(getWiremockResponseForCatalogdb("WorkflowSpecificationsQuery_Response.json")) .withStatus(org.apache.http.HttpStatus.SC_OK))); @@ -147,7 +144,7 @@ public class WorkflowSpecificationsHandlerTest extends BaseTest { .withBody(getWiremockResponseForCatalogdb("UserParameters6_Response.json")) .withStatus(org.apache.http.HttpStatus.SC_OK))); - UriComponentsBuilder builder = UriComponentsBuilder.fromHttpUrl(createURLWithPort(basePath)) + UriComponentsBuilder builder = UriComponentsBuilder.fromHttpUrl(createURLWithPort(urlPath)) .queryParam("vnfModelVersionId", "b5fa707a-f55a-11e7-a796-005056856d52"); ResponseEntity<String> response = @@ -174,7 +171,7 @@ public class WorkflowSpecificationsHandlerTest extends BaseTest { @Test public void mapWorkflowsToWorkflowSpecifications_Test_Success() throws Exception { - List<Workflow> workflows = new ArrayList<Workflow>(); + List<Workflow> workflows = new ArrayList<>(); Workflow workflow = new Workflow(); workflow.setArtifactUUID("ab6478e4-ea33-3346-ac12-ab121484a333"); workflow.setArtifactName("inPlaceSoftwareUpdate-1_0.bpmn"); @@ -267,8 +264,7 @@ public class WorkflowSpecificationsHandlerTest extends BaseTest { activitySpecUserParameter6.setUserParameters(userParameter6); activitySpecUserParameters.add(activitySpecUserParameter6); - List<WorkflowActivitySpecSequence> workflowActivitySpecSequences = - new ArrayList<WorkflowActivitySpecSequence>(); + List<WorkflowActivitySpecSequence> workflowActivitySpecSequences = new ArrayList<>(); ActivitySpec activitySpec1 = new ActivitySpec(); activitySpec1.setName("VNFQuiesceTrafficActivity"); @@ -324,6 +320,100 @@ public class WorkflowSpecificationsHandlerTest extends BaseTest { assertThat(expectedResult, sameBeanAs(workflowSpecifications).ignoring(WorkflowInputParameter.class)); } + @Test + public void queryWorkflowSpecificationsByPnfModelUUID_Test_Success() throws JSONException, IOException { + + final String urlPath = basePath + "/v1/workflows"; + HttpHeaders headers = new HttpHeaders(); + headers.set("Accept", MediaType.APPLICATION_JSON); + headers.set("Content-Type", MediaType.APPLICATION_JSON); + HttpEntity<String> entity = new HttpEntity<String>(null, headers); + + wireMockServer.stubFor(get(urlMatching( + "/workflow/search/findWorkflowByPnfModelUUID[?]pnfResourceModelUUID=f2d1f2b2-88bb-49da-b716-36ae420ccbff")) + .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) + .withBody(getWiremockResponseForCatalogdb( + "WorkflowSpecificationsForPnfQuery_Response.json")) + .withStatus(org.apache.http.HttpStatus.SC_OK))); + + wireMockServer.stubFor(get(urlMatching("/workflow/4/workflowActivitySpecSequence")) + .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) + .withBody(getWiremockResponseForCatalogdb("Empty_workflowActivitySpecSequence_Response.json")) + .withStatus(org.apache.http.HttpStatus.SC_OK))); + + UriComponentsBuilder builder = UriComponentsBuilder.fromHttpUrl(createURLWithPort(urlPath)) + .queryParam("pnfModelVersionId", "f2d1f2b2-88bb-49da-b716-36ae420ccbff"); + + ResponseEntity<String> response = + restTemplate.exchange(builder.toUriString(), HttpMethod.GET, entity, String.class); + + assertEquals(Response.Status.OK.getStatusCode(), response.getStatusCode().value()); + + ObjectMapper mapper = new ObjectMapper(); + mapper.configure(DeserializationFeature.FAIL_ON_UNKNOWN_PROPERTIES, false); + + WorkflowSpecifications expectedResponse = mapper.readValue( + new String(Files.readAllBytes( + Paths.get("src/test/resources/__files/catalogdb/WorkflowSpecificationsForPnf.json"))), + WorkflowSpecifications.class); + WorkflowSpecifications realResponse = mapper.readValue(response.getBody(), WorkflowSpecifications.class); + + assertEquals(Response.Status.OK.getStatusCode(), response.getStatusCode().value()); + assertThat(expectedResponse, sameBeanAs(realResponse)); + assertEquals("application/json", response.getHeaders().get(HttpHeaders.CONTENT_TYPE).get(0)); + assertEquals("0", response.getHeaders().get("X-MinorVersion").get(0)); + assertEquals("0", response.getHeaders().get("X-PatchVersion").get(0)); + assertEquals("1.0.0", response.getHeaders().get("X-LatestVersion").get(0)); + } + + @Test + public void testWorkflowSpecificationsForPnf_Success() throws JSONException, IOException { + + final String urlPath = basePath + "/v1/pnfWorkflows"; + HttpHeaders headers = new HttpHeaders(); + headers.set("Accept", MediaType.APPLICATION_JSON); + headers.set("Content-Type", MediaType.APPLICATION_JSON); + HttpEntity<String> entity = new HttpEntity(null, headers); + + wireMockServer.stubFor(get(urlMatching("/workflow/search/findByResourceTarget[?]resource_target=pnf")) + .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) + .withBody( + getWiremockResponseForCatalogdb("WorkflowSpecificationsForPnfWorkflows_Response.json")) + .withStatus(org.apache.http.HttpStatus.SC_OK))); + + wireMockServer.stubFor(get(urlMatching("/infraActiveRequests.*")) + .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) + .withStatus(org.apache.http.HttpStatus.SC_OK))); + + wireMockServer.stubFor(get(urlMatching("/workflow/1/workflowActivitySpecSequence")) + .willReturn(aResponse().withHeader(HttpHeaders.CONTENT_TYPE, MediaType.APPLICATION_JSON) + .withBody(getWiremockResponseForCatalogdb("Empty_workflowActivitySpecSequence_Response.json")) + .withStatus(org.apache.http.HttpStatus.SC_OK))); + + UriComponentsBuilder builder = UriComponentsBuilder.fromHttpUrl(createURLWithPort(urlPath)); + + ResponseEntity<String> response = + restTemplate.exchange(builder.toUriString(), HttpMethod.GET, entity, String.class); + + assertEquals(Response.Status.OK.getStatusCode(), response.getStatusCode().value()); + + ObjectMapper mapper = new ObjectMapper(); + mapper.configure(DeserializationFeature.FAIL_ON_UNKNOWN_PROPERTIES, false); + + WorkflowSpecifications expectedResponse = mapper.readValue( + new String(Files.readAllBytes( + Paths.get("src/test/resources/__files/catalogdb/WorkflowSpecificationsForPnf.json"))), + WorkflowSpecifications.class); + WorkflowSpecifications realResponse = mapper.readValue(response.getBody(), WorkflowSpecifications.class); + + assertEquals(Response.Status.OK.getStatusCode(), response.getStatusCode().value()); + assertThat(expectedResponse, sameBeanAs(realResponse)); + assertEquals("application/json", response.getHeaders().get(HttpHeaders.CONTENT_TYPE).get(0)); + assertEquals("0", response.getHeaders().get("X-MinorVersion").get(0)); + assertEquals("0", response.getHeaders().get("X-PatchVersion").get(0)); + assertEquals("1.0.0", response.getHeaders().get("X-LatestVersion").get(0)); + } + private String getWiremockResponseForCatalogdb(String file) { try { File resource = ResourceUtils.getFile("classpath:__files/catalogdb/" + file); diff --git a/mso-api-handlers/mso-api-handler-infra/src/test/resources/ServiceInstanceTest/ExecutePNFCustomWorkflow.json b/mso-api-handlers/mso-api-handler-infra/src/test/resources/ServiceInstanceTest/ExecutePNFCustomWorkflow.json index 63021b611f..09f94b61a4 100644 --- a/mso-api-handlers/mso-api-handler-infra/src/test/resources/ServiceInstanceTest/ExecutePNFCustomWorkflow.json +++ b/mso-api-handlers/mso-api-handler-infra/src/test/resources/ServiceInstanceTest/ExecutePNFCustomWorkflow.json @@ -1,20 +1,47 @@ { - "requestDetails": { - "requestParameters": { - "userParams": [{ - "nrmObj": { - "EUtranGenericCell" : [ - {"cellLocalId":1, "pci":5}, - {"cellLocalId":2, "pci":6} - ], - "ExternalEUtranCell" : [ - {"cellLocalId":3, "eNBId": "x"}, - {"cellLocalId":4, "eNBId": "y"} - ], - "EUtranRelation": [{"scellLocalId":5, "tcellLocalId":6}] - } - }], - "payload": "[{\"GNBDUFunction\":{\"gNBId\":1,\"gNBDUId\":5}}]" - } - } + "requestDetails":{ + "subscriberInfo":{ + "globalSubscriberId":"Test" + }, + "requestInfo":{ + "suppressRollback": false, + "productFamilyId": "a9a77d5a-123e-4ca2-9eb9-0b015d2ee0fb", + "requestorId": "tester", + "instanceName":"testInstanceName", + "source":"test" + }, + "cloudConfiguration":{ + "lcpCloudRegionId": "RegionOne", + "tenantId": "7320ec4a5b9d4589ba7c4412ccfd290f", + "cloudOwner": "CloudOwner" + }, + "requestParameters":{ + "subscriptionServiceType": "test", + "userParams":[ + { + "name": "key1", + "value": "val1" + }, + { + "name": "key2", + "value": "val2" + }], + "aLaCarte": false, + "payload": "{\"k1\": \"v1\"}" + }, + "project":{ + "projectName": "Test" + }, + "owningEntity":{ + "owningEntityId":"67f2e84c-734d-4e90-a1e4-d2ffa2e75849", + "owningEntityName":"OE-Test" + }, + "modelInfo":{ + "modelVersion": "2.0", + "modelVersionId": "test-version-id", + "modelInvariantId": "test-invariantUUID", + "modelName": "test-name", + "modelType": "pnf" + } + } } diff --git a/mso-api-handlers/mso-api-handler-infra/src/test/resources/__files/aai/ServiceFromAAI.json b/mso-api-handlers/mso-api-handler-infra/src/test/resources/__files/aai/ServiceFromAAI.json new file mode 100644 index 0000000000..f0d511789f --- /dev/null +++ b/mso-api-handlers/mso-api-handler-infra/src/test/resources/__files/aai/ServiceFromAAI.json @@ -0,0 +1,4 @@ +{ + "service-id": "a9a77d5a-123e-4ca2-9eb9-0b015d2ee0fb", + "service-description": "testServiceDescription" +}
\ No newline at end of file diff --git a/mso-api-handlers/mso-api-handler-infra/src/test/resources/__files/catalogdb/Empty_workflowActivitySpecSequence_Response.json b/mso-api-handlers/mso-api-handler-infra/src/test/resources/__files/catalogdb/Empty_workflowActivitySpecSequence_Response.json new file mode 100644 index 0000000000..6779c1f3e4 --- /dev/null +++ b/mso-api-handlers/mso-api-handler-infra/src/test/resources/__files/catalogdb/Empty_workflowActivitySpecSequence_Response.json @@ -0,0 +1,5 @@ +{ + "_embedded": { + "workflowActivitySpecSequence": [] + } +}
\ No newline at end of file diff --git a/mso-api-handlers/mso-api-handler-infra/src/test/resources/__files/catalogdb/WorkflowSpecificationsForPnf.json b/mso-api-handlers/mso-api-handler-infra/src/test/resources/__files/catalogdb/WorkflowSpecificationsForPnf.json new file mode 100644 index 0000000000..b5b93873c8 --- /dev/null +++ b/mso-api-handlers/mso-api-handler-infra/src/test/resources/__files/catalogdb/WorkflowSpecificationsForPnf.json @@ -0,0 +1,20 @@ +{ + "workflowSpecificationList": [ + { + "workflowSpecification": { + "artifactInfo": { + "artifactType": "workflow", + "artifactUuid": "b2fd5627-55e4-4f4f-8064-9e6f443e9152", + "artifactName": "DummyPnfWorkflow", + "artifactVersion": "1.0", + "artifactDescription": "Dummy Pnf Workflow to test custom Pnf workflow", + "workflowName": "Dummy Pnf Workflow", + "operationName": "DummyPnfWorkflow", + "workflowSource": "native", + "workflowResourceTarget": "pnf" + }, + "workflowInputParameters": [] + } + } + ] +}
\ No newline at end of file diff --git a/mso-api-handlers/mso-api-handler-infra/src/test/resources/__files/catalogdb/WorkflowSpecificationsForPnfQuery_Response.json b/mso-api-handlers/mso-api-handler-infra/src/test/resources/__files/catalogdb/WorkflowSpecificationsForPnfQuery_Response.json new file mode 100644 index 0000000000..a4e1bbcdc5 --- /dev/null +++ b/mso-api-handlers/mso-api-handler-infra/src/test/resources/__files/catalogdb/WorkflowSpecificationsForPnfQuery_Response.json @@ -0,0 +1,41 @@ +{ + "_embedded": { + "workflow": [ + { + "artifactChecksum": "MANUAL RECORD", + "artifactName": "DummyPnfWorkflow", + "artifactUUID": "b2fd5627-55e4-4f4f-8064-9e6f443e9152", + "body": null, + "created": "2020-02-18T08:28:15.000+0000", + "description": "Dummy Pnf Workflow to test custom Pnf workflow", + "id": 4, + "name": "Dummy Pnf Workflow", + "operationName": "DummyPnfWorkflow", + "pnfResourceWorkflow": null, + "resourceTarget": "pnf", + "source": "native", + "timeoutMinutes": null, + "version": 1.0, + "_links": { + "self": { + "href": "http://localhost:8090/workflow/search/findWorkflowByPnfModelUUID?pnfResourceModelUUID=f2d1f2b2-88bb-49da-b716-36ae420ccbff" + }, + "workflow": { + "href": "http://localhost:8090/workflow/4" + }, + "workflowActivitySpecSequence": { + "href": "http://localhost:8090/workflow/4/workflowActivitySpecSequence" + } + } + } + ] + }, + "_links": { + "self": { + "href": "http://localhost:8090/workflow/search/findWorkflowByPnfModelUUID?pnfResourceModelUUID=f2d1f2b2-88bb-49da-b716-36ae420ccbff" + }, + "workflowActivitySpecSequence": { + "href": "http://localhost:8090/workflow/4/workflowActivitySpecSequence" + } + } +} diff --git a/mso-api-handlers/mso-api-handler-infra/src/test/resources/__files/catalogdb/WorkflowSpecificationsForPnfWorkflows_Response.json b/mso-api-handlers/mso-api-handler-infra/src/test/resources/__files/catalogdb/WorkflowSpecificationsForPnfWorkflows_Response.json new file mode 100644 index 0000000000..2447617897 --- /dev/null +++ b/mso-api-handlers/mso-api-handler-infra/src/test/resources/__files/catalogdb/WorkflowSpecificationsForPnfWorkflows_Response.json @@ -0,0 +1,41 @@ +{ + "_embedded": { + "workflow": [ + { + "artifactChecksum": "MANUAL RECORD", + "artifactName": "DummyPnfWorkflow", + "artifactUUID": "b2fd5627-55e4-4f4f-8064-9e6f443e9152", + "body": null, + "created": "2020-02-18T08:28:15.000+0000", + "description": "Dummy Pnf Workflow to test custom Pnf workflow", + "id": 4, + "name": "Dummy Pnf Workflow", + "operationName": "DummyPnfWorkflow", + "pnfResourceWorkflow": null, + "resourceTarget": "pnf", + "source": "native", + "timeoutMinutes": null, + "version": 1.0, + "_links": { + "self": { + "href": "http://localhost:8090/workflow/search/findByResourceTarget?resource_target=pnf" + }, + "workflow": { + "href": "http://localhost:8090/workflow/4" + }, + "workflowActivitySpecSequence": { + "href": "http://localhost:8090/workflow/4/workflowActivitySpecSequence" + } + } + } + ] + }, + "_links": { + "self": { + "href": "http://localhost:8090/workflow/search/findByResourceTarget?resource_target=pnf" + }, + "workflowActivitySpecSequence": { + "href": "http://localhost:8090/workflow/4/workflowActivitySpecSequence" + } + } +}
\ No newline at end of file diff --git a/mso-api-handlers/mso-api-handler-infra/src/test/resources/schema.sql b/mso-api-handlers/mso-api-handler-infra/src/test/resources/schema.sql index 050780c9a2..85a17dd369 100644 --- a/mso-api-handlers/mso-api-handler-infra/src/test/resources/schema.sql +++ b/mso-api-handlers/mso-api-handler-infra/src/test/resources/schema.sql @@ -1262,7 +1262,7 @@ CREATE TABLE `infra_active_requests` ( `END_TIME` datetime DEFAULT NULL, `SOURCE` varchar(45) DEFAULT NULL, `VNF_ID` varchar(45) DEFAULT NULL, - `PNF_ID` varchar(45) DEFAULT NULL, + `PNF_NAME` varchar(45) DEFAULT NULL, `VNF_NAME` varchar(80) DEFAULT NULL, `VNF_TYPE` varchar(200) DEFAULT NULL, `SERVICE_TYPE` varchar(45) DEFAULT NULL, @@ -1297,6 +1297,8 @@ CREATE TABLE `infra_active_requests` ( `ORIGINAL_REQUEST_ID` varchar(45) DEFAULT NULL, `EXT_SYSTEM_ERROR_SOURCE` varchar(80) DEFAULT NULL, `ROLLBACK_EXT_SYSTEM_ERROR_SOURCE` varchar(80) DEFAULT NULL, + `TENANT_NAME` varchar(200) DEFAULT NULL, + `PRODUCT_FAMILY_NAME` varchar(200) DEFAULT NULL, PRIMARY KEY (`REQUEST_ID`) ) ENGINE=InnoDB DEFAULT CHARSET=latin1; diff --git a/mso-api-handlers/mso-requests-db-repositories/pom.xml b/mso-api-handlers/mso-requests-db-repositories/pom.xml index 4dbf22cd87..efc81384d4 100644 --- a/mso-api-handlers/mso-requests-db-repositories/pom.xml +++ b/mso-api-handlers/mso-requests-db-repositories/pom.xml @@ -5,7 +5,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>mso-api-handlers</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>mso-requests-db-repositories</artifactId> diff --git a/mso-api-handlers/mso-requests-db-repositories/src/main/java/org/onap/so/db/request/data/repository/InfraActiveRequestsRepositoryImpl.java b/mso-api-handlers/mso-requests-db-repositories/src/main/java/org/onap/so/db/request/data/repository/InfraActiveRequestsRepositoryImpl.java index bba0ad4696..da8f30ab1e 100644 --- a/mso-api-handlers/mso-requests-db-repositories/src/main/java/org/onap/so/db/request/data/repository/InfraActiveRequestsRepositoryImpl.java +++ b/mso-api-handlers/mso-requests-db-repositories/src/main/java/org/onap/so/db/request/data/repository/InfraActiveRequestsRepositoryImpl.java @@ -245,8 +245,8 @@ public class InfraActiveRequestsRepositoryImpl implements InfraActiveRequestsRep mapKey = "serviceInstanceName"; } else if ("vnfInstanceId".equalsIgnoreCase(mapKey)) { mapKey = "vnfId"; - } else if ("pnfId".equalsIgnoreCase(mapKey)) { - mapKey = "pnfId"; + } else if ("pnfName".equalsIgnoreCase(mapKey)) { + mapKey = "pnfName"; } else if ("vnfInstanceName".equalsIgnoreCase(mapKey)) { mapKey = "vnfName"; } else if ("vfModuleInstanceId".equalsIgnoreCase(mapKey)) { diff --git a/mso-api-handlers/mso-requests-db-repositories/src/main/java/org/onap/so/db/request/data/repository/InstanceNfvoMappingRepository.java b/mso-api-handlers/mso-requests-db-repositories/src/main/java/org/onap/so/db/request/data/repository/InstanceNfvoMappingRepository.java new file mode 100644 index 0000000000..2e2c0872b6 --- /dev/null +++ b/mso-api-handlers/mso-requests-db-repositories/src/main/java/org/onap/so/db/request/data/repository/InstanceNfvoMappingRepository.java @@ -0,0 +1,28 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.db.request.data.repository; + +import org.onap.so.db.request.beans.InstanceNfvoMapping; +import org.onap.so.db.request.beans.OperationStatus; +import org.onap.so.db.request.beans.OperationStatusId; +import org.springframework.data.jpa.repository.JpaRepository; +import org.springframework.data.repository.query.Param; +import org.springframework.data.rest.core.annotation.RepositoryRestResource; + +@RepositoryRestResource(collectionResourceRel = "instanceNfvoMapping", path = "instanceNfvoMapping") +public interface InstanceNfvoMappingRepository extends JpaRepository<InstanceNfvoMapping, String> { + + public InstanceNfvoMapping findOneByInstanceId(String instanceId); + + public InstanceNfvoMapping findOneByJobId(String jobId); + +} diff --git a/mso-api-handlers/mso-requests-db-repositories/src/main/java/org/onap/so/db/request/data/repository/OrchestrationTaskRepository.java b/mso-api-handlers/mso-requests-db-repositories/src/main/java/org/onap/so/db/request/data/repository/OrchestrationTaskRepository.java new file mode 100644 index 0000000000..1093c79638 --- /dev/null +++ b/mso-api-handlers/mso-requests-db-repositories/src/main/java/org/onap/so/db/request/data/repository/OrchestrationTaskRepository.java @@ -0,0 +1,33 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License") + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.db.request.data.repository; + +import org.onap.so.db.request.beans.OrchestrationTask; +import org.springframework.data.jpa.repository.JpaRepository; +import org.springframework.data.repository.query.Param; +import org.springframework.data.rest.core.annotation.RepositoryRestResource; +import java.util.List; + +@RepositoryRestResource(collectionResourceRel = "orchestrationTask", path = "orchestrationTask") +public interface OrchestrationTaskRepository extends JpaRepository<OrchestrationTask, String> { + + public List<OrchestrationTask> findByStatus(@Param("status") String status); +} diff --git a/mso-api-handlers/mso-requests-db-repositories/src/test/java/org/onap/so/db/request/OrchestrationTaskTest.java b/mso-api-handlers/mso-requests-db-repositories/src/test/java/org/onap/so/db/request/OrchestrationTaskTest.java new file mode 100644 index 0000000000..0b2aae6730 --- /dev/null +++ b/mso-api-handlers/mso-requests-db-repositories/src/test/java/org/onap/so/db/request/OrchestrationTaskTest.java @@ -0,0 +1,75 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Huawei Technologies Co., Ltd. All rights reserved. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License") + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.db.request; + +import org.junit.Test; +import org.junit.runner.RunWith; +import org.onap.so.TestApplication; +import org.onap.so.db.request.beans.OrchestrationTask; +import org.onap.so.db.request.data.repository.OrchestrationTaskRepository; +import org.onap.so.db.request.exceptions.NoEntityFoundException; +import org.springframework.beans.factory.annotation.Autowired; +import org.springframework.boot.test.context.SpringBootTest; +import org.springframework.test.context.ActiveProfiles; +import org.springframework.test.context.junit4.SpringRunner; +import javax.transaction.Transactional; +import java.util.Date; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.assertNotNull; + +@RunWith(SpringRunner.class) +@SpringBootTest(classes = TestApplication.class, webEnvironment = SpringBootTest.WebEnvironment.RANDOM_PORT) +@ActiveProfiles("test") +public class OrchestrationTaskTest { + + @Autowired + private OrchestrationTaskRepository repository; + + @Test + @Transactional + public void timeStampCreated() throws NoEntityFoundException { + + final String testTaskId = "test-task-id"; + final String testRequestId = "test-request-id"; + final String testTaskName = "test-task-name"; + final String testTaskStatus = "test-task-status"; + final String testIsManual = "test-is-manual"; + OrchestrationTask task = new OrchestrationTask(); + + task.setTaskId(testTaskId); + task.setRequestId(testRequestId); + task.setName(testTaskName); + task.setStatus(testTaskStatus); + task.setIsManual(testIsManual); + repository.saveAndFlush(task); + + OrchestrationTask found = + repository.findById(testTaskId).orElseThrow(() -> new NoEntityFoundException("Cannot Find Task")); + + Date createdTime = found.getCreatedTime(); + assertNotNull(createdTime); + assertEquals(testTaskId, found.getTaskId()); + assertEquals(testRequestId, found.getRequestId()); + assertEquals(testTaskName, found.getName()); + assertEquals(testTaskStatus, found.getStatus()); + assertEquals(testIsManual, found.getIsManual()); + } +} diff --git a/mso-api-handlers/mso-requests-db-repositories/src/test/resources/schema.sql b/mso-api-handlers/mso-requests-db-repositories/src/test/resources/schema.sql index d2b3a71cad..c6d22f5402 100644 --- a/mso-api-handlers/mso-requests-db-repositories/src/test/resources/schema.sql +++ b/mso-api-handlers/mso-requests-db-repositories/src/test/resources/schema.sql @@ -64,7 +64,7 @@ CREATE TABLE IF NOT EXISTS PUBLIC.INFRA_ACTIVE_REQUESTS( END_TIME VARCHAR, SOURCE VARCHAR SELECTIVITY 2, VNF_ID VARCHAR SELECTIVITY 15, - PNF_ID VARCHAR SELECTIVITY 15, + PNF_NAME VARCHAR SELECTIVITY 15, VNF_NAME VARCHAR SELECTIVITY 11, VNF_TYPE VARCHAR SELECTIVITY 5, SERVICE_TYPE VARCHAR SELECTIVITY 1, @@ -100,7 +100,10 @@ CREATE TABLE IF NOT EXISTS PUBLIC.INFRA_ACTIVE_REQUESTS( REQUEST_URL VARCHAR SELECTIVITY 1, ORIGINAL_REQUEST_ID VARCHAR SELECTIVITY 1, EXT_SYSTEM_ERROR_SOURCE VARCHAR SELECTIVITY 1, - ROLLBACK_EXT_SYSTEM_ERROR_SOURCE VARCHAR SELECTIVITY 1 + ROLLBACK_EXT_SYSTEM_ERROR_SOURCE VARCHAR SELECTIVITY 1, + TENANT_NAME VARCHAR SELECTIVITY 1, + PRODUCT_FAMILY_NAME VARCHAR SELECTIVITY 1 + ); INSERT INTO PUBLIC.INFRA_ACTIVE_REQUESTS(REQUEST_ID, REQUEST_STATUS, STATUS_MESSAGE, PROGRESS, START_TIME, END_TIME, SOURCE, VNF_ID, VNF_NAME, VNF_TYPE, SERVICE_TYPE, TENANT_ID, VNF_PARAMS, VNF_OUTPUTS, REQUEST_BODY, RESPONSE_BODY, LAST_MODIFIED_BY, MODIFY_TIME, VOLUME_GROUP_ID, VOLUME_GROUP_NAME, VF_MODULE_ID, VF_MODULE_NAME, VF_MODULE_MODEL_NAME, CLOUD_REGION, CALLBACK_URL, CORRELATOR, NETWORK_ID, NETWORK_NAME, NETWORK_TYPE, REQUEST_SCOPE, REQUEST_ACTION, SERVICE_INSTANCE_ID, SERVICE_INSTANCE_NAME, REQUESTOR_ID, CONFIGURATION_ID, CONFIGURATION_NAME, OPERATIONAL_ENV_ID, OPERATIONAL_ENV_NAME, REQUEST_URL) VALUES @@ -169,7 +172,9 @@ CREATE CACHED TABLE PUBLIC.ARCHIVED_INFRA_REQUESTS( OPERATIONAL_ENV_NAME VARCHAR SELECTIVITY 1, INSTANCE_GROUP_ID VARCHAR SELECTIVITY 1, INSTANCE_GROUP_NAME VARCHAR SELECTIVITY 1, - REQUEST_URL VARCHAR SELECTIVITY 1 + REQUEST_URL VARCHAR SELECTIVITY 1, + TENANT_NAME VARCHAR SELECTIVITY 1, + PRODUCT_FAMILY_NAME VARCHAR SELECTIVITY 1 ); CREATE TABLE IF NOT EXISTS cloud_api_requests( @@ -246,11 +251,22 @@ CREATE CACHED TABLE PUBLIC.WATCHDOG_SERVICE_MOD_VER_ID_LOOKUP( INSERT INTO PUBLIC.WATCHDOG_SERVICE_MOD_VER_ID_LOOKUP(DISTRIBUTION_ID, SERVICE_MODEL_VERSION_ID, CREATE_TIME, MODIFY_TIME) VALUES ('1533c4bd-a3e3-493f-a16d-28c20614415e', '7e813ab5-88d3-4fcb-86c0-498c5d7eef9a', '2017-11-30 15:48:08', '2017-11-30 15:48:08'), ('55429711-809b-4a3b-9ee5-5120d46d9de0', 'cc031e75-4442-4d1a-b774-8a2b434e0a50', '2017-11-30 16:35:36', '2017-11-30 16:35:36'), -('67f0b2d1-9013-4b2b-9914-bbe2288284fb', 'eade1e9d-c1ec-4ef3-bc31-60570fba1573', '2017-11-30 15:54:39', '2017-11-30 15:54:39'); +('67f0b2d1-9013-4b2b-9914-bbe2288284fb', 'eade1e9d-c1ec-4ef3-bc31-60570fba1573', '2017-11-30 15:54:39', '2017-11-30 15:54:39'); -ALTER TABLE PUBLIC.INFRA_ACTIVE_REQUESTS ADD CONSTRAINT PUBLIC.CONSTRAINT_E PRIMARY KEY(REQUEST_ID); -ALTER TABLE PUBLIC.SITE_STATUS ADD CONSTRAINT PUBLIC.CONSTRAINT_C PRIMARY KEY(SITE_NAME); +ALTER TABLE PUBLIC.INFRA_ACTIVE_REQUESTS ADD CONSTRAINT PUBLIC.CONSTRAINT_E PRIMARY KEY(REQUEST_ID); +ALTER TABLE PUBLIC.SITE_STATUS ADD CONSTRAINT PUBLIC.CONSTRAINT_C PRIMARY KEY(SITE_NAME); ALTER TABLE PUBLIC.WATCHDOG_DISTRIBUTIONID_STATUS ADD CONSTRAINT PUBLIC.CONSTRAINT_7 PRIMARY KEY(DISTRIBUTION_ID); ALTER TABLE PUBLIC.WATCHDOG_PER_COMPONENT_DISTRIBUTION_STATUS ADD CONSTRAINT PUBLIC.CONSTRAINT_D PRIMARY KEY(DISTRIBUTION_ID, COMPONENT_NAME); -ALTER TABLE PUBLIC.WATCHDOG_SERVICE_MOD_VER_ID_LOOKUP ADD CONSTRAINT PUBLIC.CONSTRAINT_6 PRIMARY KEY(DISTRIBUTION_ID, SERVICE_MODEL_VERSION_ID); -ALTER TABLE PUBLIC.WATCHDOG_PER_COMPONENT_DISTRIBUTION_STATUS ADD CONSTRAINT PUBLIC.CONSTRAINT_DE FOREIGN KEY(DISTRIBUTION_ID) REFERENCES PUBLIC.WATCHDOG_DISTRIBUTIONID_STATUS(DISTRIBUTION_ID) NOCHECK;
\ No newline at end of file +ALTER TABLE PUBLIC.WATCHDOG_SERVICE_MOD_VER_ID_LOOKUP ADD CONSTRAINT PUBLIC.CONSTRAINT_6 PRIMARY KEY(DISTRIBUTION_ID, SERVICE_MODEL_VERSION_ID); +ALTER TABLE PUBLIC.WATCHDOG_PER_COMPONENT_DISTRIBUTION_STATUS ADD CONSTRAINT PUBLIC.CONSTRAINT_DE FOREIGN KEY(DISTRIBUTION_ID) REFERENCES PUBLIC.WATCHDOG_DISTRIBUTIONID_STATUS(DISTRIBUTION_ID) NOCHECK; + +CREATE TABLE `orchestration_task` ( + `TASK_ID` varchar(200) NOT NULL, + `REQUEST_ID` varchar(200) NOT NULL, + `NAME` varchar(200) NOT NULL, + `CREATED_TIME` datetime NOT NULL DEFAULT CURRENT_TIMESTAMP, + `STATUS` varchar(200) NOT NULL, + `IS_MANUAL` varchar(20) NOT NULL, + `PARAMS` varchar(20000) DEFAULT NULL, + PRIMARY KEY (`TASK_ID`) +); diff --git a/mso-api-handlers/mso-requests-db/pom.xml b/mso-api-handlers/mso-requests-db/pom.xml index 031f86282a..37bb4175a5 100644 --- a/mso-api-handlers/mso-requests-db/pom.xml +++ b/mso-api-handlers/mso-requests-db/pom.xml @@ -5,7 +5,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>mso-api-handlers</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>mso-requests-db</artifactId> diff --git a/mso-api-handlers/mso-requests-db/src/main/java/org/onap/so/db/request/beans/InfraActiveRequests.java b/mso-api-handlers/mso-requests-db/src/main/java/org/onap/so/db/request/beans/InfraActiveRequests.java index 5848f3b3d9..750fa13c77 100644 --- a/mso-api-handlers/mso-requests-db/src/main/java/org/onap/so/db/request/beans/InfraActiveRequests.java +++ b/mso-api-handlers/mso-requests-db/src/main/java/org/onap/so/db/request/beans/InfraActiveRequests.java @@ -72,15 +72,15 @@ public class InfraActiveRequests extends InfraRequests { .append("statusMessage", getStatusMessage()).append("progress", getProgress()) .append("startTime", getStartTime()).append("endTime", getEndTime()).append("source", getSource()) .append("vnfId", getVnfId()).append("vnfName", getVnfName()).append("vnfType", getVnfType()) - .append("pnfId", getPnfId()).append("serviceType", getServiceType()).append("tenantId", getTenantId()) - .append("vnfParams", getVnfParams()).append("vnfOutputs", getVnfOutputs()) - .append("requestBody", getRequestBody()).append("responseBody", getResponseBody()) - .append("lastModifiedBy", getLastModifiedBy()).append("modifyTime", getModifyTime()) - .append("volumeGroupId", getVolumeGroupId()).append("volumeGroupName", getVolumeGroupName()) - .append("vfModuleId", getVfModuleId()).append("vfModuleName", getVfModuleName()) - .append("vfModuleModelName", getVfModuleModelName()).append("CloudRegion", getCloudRegion()) - .append("callBackUrl", getCallBackUrl()).append("correlator", getCorrelator()) - .append("serviceInstanceId", getServiceInstanceId()) + .append("pnfName", getPnfName()).append("serviceType", getServiceType()) + .append("tenantId", getTenantId()).append("vnfParams", getVnfParams()) + .append("vnfOutputs", getVnfOutputs()).append("requestBody", getRequestBody()) + .append("responseBody", getResponseBody()).append("lastModifiedBy", getLastModifiedBy()) + .append("modifyTime", getModifyTime()).append("volumeGroupId", getVolumeGroupId()) + .append("volumeGroupName", getVolumeGroupName()).append("vfModuleId", getVfModuleId()) + .append("vfModuleName", getVfModuleName()).append("vfModuleModelName", getVfModuleModelName()) + .append("CloudRegion", getCloudRegion()).append("callBackUrl", getCallBackUrl()) + .append("correlator", getCorrelator()).append("serviceInstanceId", getServiceInstanceId()) .append("serviceInstanceName", getServiceInstanceName()).append("requestScope", getRequestScope()) .append("requestAction", getRequestAction()).append("networkId", getNetworkId()) .append("networkName", getNetworkName()).append("networkType", getNetworkType()) @@ -89,6 +89,7 @@ public class InfraActiveRequests extends InfraRequests { .append("operationalEnvName", getOperationalEnvName()).append("requestUrl", getRequestUrl()) .append("originalRequestId", getOriginalRequestId()) .append("extSystemErrorSource", getExtSystemErrorSource()) - .append("rollbackExtSystemErrorSource", getRollbackExtSystemErrorSource()).toString(); + .append("rollbackExtSystemErrorSource", getRollbackExtSystemErrorSource()) + .append("tenantName", getTenantName()).append("productFamilyName", getProductFamilyName()).toString(); } } diff --git a/mso-api-handlers/mso-requests-db/src/main/java/org/onap/so/db/request/beans/InfraRequests.java b/mso-api-handlers/mso-requests-db/src/main/java/org/onap/so/db/request/beans/InfraRequests.java index 8f798a207c..66768ea349 100644 --- a/mso-api-handlers/mso-requests-db/src/main/java/org/onap/so/db/request/beans/InfraRequests.java +++ b/mso-api-handlers/mso-requests-db/src/main/java/org/onap/so/db/request/beans/InfraRequests.java @@ -74,8 +74,8 @@ public abstract class InfraRequests implements java.io.Serializable { private String source; @Column(name = "VNF_ID", length = 45) private String vnfId; - @Column(name = "PNF_ID", length = 45) - private String pnfId; + @Column(name = "PNF_NAME", length = 45) + private String pnfName; @Column(name = "VNF_NAME", length = 80) private String vnfName; @Column(name = "VNF_TYPE", length = 200) @@ -149,6 +149,10 @@ public abstract class InfraRequests implements java.io.Serializable { private String extSystemErrorSource; @Column(name = "ROLLBACK_EXT_SYSTEM_ERROR_SOURCE", length = 80) private String rollbackExtSystemErrorSource; + @Column(name = "TENANT_NAME", length = 80) + private String tenantName; + @Column(name = "PRODUCT_FAMILY_NAME", length = 80) + private String productFamilyName; @OneToMany(cascade = CascadeType.ALL, fetch = FetchType.EAGER) @JoinColumn(name = "SO_REQUEST_ID", referencedColumnName = "REQUEST_ID", updatable = false) @@ -249,12 +253,12 @@ public abstract class InfraRequests implements java.io.Serializable { this.vnfId = vnfId; } - public String getPnfId() { - return this.pnfId; + public String getPnfName() { + return this.pnfName; } - public void setPnfId(String pnfId) { - this.pnfId = pnfId; + public void setPnfName(String pnfName) { + this.pnfName = pnfName; } public String getVnfName() { @@ -550,6 +554,22 @@ public abstract class InfraRequests implements java.io.Serializable { this.rollbackExtSystemErrorSource = rollbackExtSystemErrorSource; } + public String getTenantName() { + return tenantName; + } + + public void setTenantName(String tenantName) { + this.tenantName = tenantName; + } + + public String getProductFamilyName() { + return productFamilyName; + } + + public void setProductFamilyName(String productFamilyName) { + this.productFamilyName = productFamilyName; + } + @PrePersist protected void onCreate() { if (requestScope == null) @@ -592,7 +612,7 @@ public abstract class InfraRequests implements java.io.Serializable { .append("flowStatus", getFlowStatus()).append("retryStatusMessage", getRetryStatusMessage()) .append("progress", getProgress()).append("startTime", getStartTime()).append("endTime", getEndTime()) .append("source", getSource()).append("vnfId", getVnfId()).append("vnfName", getVnfName()) - .append("pnfId", getPnfId()).append("vnfType", getVnfType()).append("serviceType", getServiceType()) + .append("pnfName", getPnfName()).append("vnfType", getVnfType()).append("serviceType", getServiceType()) .append("tenantId", getTenantId()).append("vnfParams", getVnfParams()) .append("vnfOutputs", getVnfOutputs()).append("requestBody", getRequestBody()) .append("responseBody", getResponseBody()).append("lastModifiedBy", getLastModifiedBy()) @@ -609,6 +629,7 @@ public abstract class InfraRequests implements java.io.Serializable { .append("operationalEnvName", getOperationalEnvName()).append("instanceGroupId", getInstanceGroupId()) .append("instanceGroupName", getInstanceGroupName()).append("requestUrl", getRequestUrl()) .append("originalRequestId", originalRequestId).append("extSystemErrorSource", extSystemErrorSource) - .append("rollbackExtSystemErrorSource", rollbackExtSystemErrorSource).toString(); + .append("rollbackExtSystemErrorSource", rollbackExtSystemErrorSource).append("tenantName", tenantName) + .append("productFamilyName", productFamilyName).toString(); } } diff --git a/mso-api-handlers/mso-requests-db/src/main/java/org/onap/so/db/request/beans/InstanceNfvoMapping.java b/mso-api-handlers/mso-requests-db/src/main/java/org/onap/so/db/request/beans/InstanceNfvoMapping.java new file mode 100644 index 0000000000..53b3fcde55 --- /dev/null +++ b/mso-api-handlers/mso-requests-db/src/main/java/org/onap/so/db/request/beans/InstanceNfvoMapping.java @@ -0,0 +1,123 @@ +/*** + * Copyright (C) 2019 Verizon. All Rights Reserved Licensed under the Apache License, Version 2.0 (the "License"); you + * may not use this file except in compliance with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on + * an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ + +package org.onap.so.db.request.beans; + +import javax.persistence.Column; +import javax.persistence.Entity; +import javax.persistence.Id; +import javax.persistence.Table; +import java.util.Objects; + +@Entity +@Table(name = "instance_nfvo_mapping") +public class InstanceNfvoMapping implements java.io.Serializable { + + private static final long serialVersionUID = 1L; + @Id + @Column(name = "INSTANCE_ID") + private String instanceId; + @Column(name = "NFVO_NAME", length = 256) + private String nfvoName; + @Column(name = "ENDPOINT", length = 256) + private String endpoint; + @Column(name = "USERNAME", length = 256) + private String username; + @Column(name = "PASSWORD", length = 256) + private String password; + @Column(name = "API_ROOT", length = 256) + private String apiRoot; + @Column(name = "JOB_ID", length = 256) + private String jobId; + + public InstanceNfvoMapping() {} + + @Override + public boolean equals(final Object other) { + if (this == other) { + return true; + } + if (!(other instanceof InstanceNfvoMapping)) { + return false; + } + final InstanceNfvoMapping castOther = (InstanceNfvoMapping) other; + return Objects.equals(getInstanceId(), castOther.getInstanceId()); + } + + @Override + public int hashCode() { + return Objects.hash(getInstanceId()); + } + + + public String getJobId() { + return jobId; + } + + public void setJobId(String jobId) { + this.jobId = jobId; + } + + public String getInstanceId() { + return instanceId; + } + + public void setInstanceId(String instanceId) { + this.instanceId = instanceId; + } + + public String getNfvoName() { + return nfvoName; + } + + public void setNfvoName(String nfvoName) { + this.nfvoName = nfvoName; + } + + public String getEndpoint() { + return endpoint; + } + + public void setEndpoint(String endpoint) { + this.endpoint = endpoint; + } + + public String getUsername() { + return username; + } + + public void setUsername(String username) { + this.username = username; + } + + public String getPassword() { + return password; + } + + public void setPassword(String password) { + this.password = password; + } + + public String getApiRoot() { + return apiRoot; + } + + public void setApiRoot(String apiRoot) { + this.apiRoot = apiRoot; + } + + @Override + public String toString() { + return "InstanceNfvoMapping{" + "instanceId='" + instanceId + '\'' + ", nfvoName='" + nfvoName + '\'' + + ", endpoint='" + endpoint + '\'' + ", username='" + username + '\'' + ", password='" + password + '\'' + + ", apiRoot='" + apiRoot + '\'' + '}'; + } +} diff --git a/mso-api-handlers/mso-requests-db/src/main/java/org/onap/so/db/request/client/RequestsDbClient.java b/mso-api-handlers/mso-requests-db/src/main/java/org/onap/so/db/request/client/RequestsDbClient.java index 334eb73da4..7b642ab831 100644 --- a/mso-api-handlers/mso-requests-db/src/main/java/org/onap/so/db/request/client/RequestsDbClient.java +++ b/mso-api-handlers/mso-requests-db/src/main/java/org/onap/so/db/request/client/RequestsDbClient.java @@ -45,6 +45,7 @@ import org.onap.so.db.request.beans.SiteStatus; import org.onap.so.db.request.beans.WatchdogComponentDistributionStatus; import org.onap.so.db.request.beans.WatchdogDistributionStatus; import org.onap.so.db.request.beans.WatchdogServiceModVerIdLookup; +import org.onap.so.db.request.beans.OrchestrationTask; import org.onap.so.db.request.data.controller.InstanceNameDuplicateCheckRequest; import org.onap.so.logging.jaxrs.filter.SOSpringClientFilter; import org.springframework.beans.factory.annotation.Autowired; @@ -119,6 +120,8 @@ public class RequestsDbClient { private String getInProgressVolumeGroupsAndVfModules = "/infraActiveRequests/getInProgressVolumeGroupsAndVfModules"; + private String orchestrationTasksURI = "/orchestrationTask"; + private static final String findBySoRequestIdAndGroupIdAndName = "/requestProcessingData/search/findOneBySoRequestIdAndGroupingIdAndName"; @@ -156,6 +159,7 @@ public class RequestsDbClient { findAllByOperationalEnvIdAndRequestIdURI = endpoint + OPERATIONAL_ENV_SERVICE_MODEL_STATUS_SEARCH + findAllByOperationalEnvIdAndRequestIdURI; findOneByRequestId = endpoint + findOneByRequestId; + orchestrationTasksURI = endpoint + orchestrationTasksURI; } protected String getEndpoint() { @@ -520,6 +524,40 @@ public class RequestsDbClient { .getBody(); } + public List<OrchestrationTask> getAllOrchestrationTasks() { + String url = UriBuilder.fromUri(getUri(orchestrationTasksURI)).build().toString(); + HttpEntity<?> entity = getHttpEntity(); + return restTemplate + .exchange(url, HttpMethod.GET, entity, new ParameterizedTypeReference<List<OrchestrationTask>>() {}) + .getBody(); + } + + public OrchestrationTask getOrchestrationTask(String taskId) { + String url = UriBuilder.fromUri(getUri(orchestrationTasksURI + "/" + taskId)).build().toString(); + HttpEntity<?> entity = getHttpEntity(); + return restTemplate.exchange(url, HttpMethod.GET, entity, OrchestrationTask.class).getBody(); + } + + public OrchestrationTask createOrchestrationTask(OrchestrationTask orchestrationTask) { + String url = UriBuilder.fromUri(getUri(orchestrationTasksURI + "/")).build().toString(); + HttpHeaders headers = getHttpHeaders(); + HttpEntity<OrchestrationTask> entity = new HttpEntity<>(orchestrationTask, headers); + return restTemplate.exchange(url, HttpMethod.POST, entity, OrchestrationTask.class).getBody(); + } + + public OrchestrationTask updateOrchestrationTask(String taskId, OrchestrationTask orchestrationTask) { + String url = getUri(orchestrationTasksURI + "/" + taskId).toString(); + HttpHeaders headers = getHttpHeaders(); + HttpEntity<OrchestrationTask> entity = new HttpEntity<>(orchestrationTask, headers); + return restTemplate.exchange(url, HttpMethod.PUT, entity, OrchestrationTask.class).getBody(); + } + + public void deleteOrchestrationTask(String taskId) { + String url = getUri(orchestrationTasksURI + "/" + taskId).toString(); + HttpEntity<?> entity = getHttpEntity(); + restTemplate.exchange(url, HttpMethod.DELETE, entity, Void.class).getBody(); + } + @Component static class ClassURLMapper { private static final Map<Class, String> classURLMap = new HashMap<>(); diff --git a/mso-api-handlers/pom.xml b/mso-api-handlers/pom.xml index b4d5c7070a..5c84ab1d77 100644 --- a/mso-api-handlers/pom.xml +++ b/mso-api-handlers/pom.xml @@ -5,7 +5,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>so</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>mso-api-handlers</artifactId> diff --git a/mso-catalog-db/pom.xml b/mso-catalog-db/pom.xml index 6a4a6774e6..7444866315 100644 --- a/mso-catalog-db/pom.xml +++ b/mso-catalog-db/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>so</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>mso-catalog-db</artifactId> diff --git a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/BBNameSelectionReference.java b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/BBNameSelectionReference.java new file mode 100644 index 0000000000..9b71c970a7 --- /dev/null +++ b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/BBNameSelectionReference.java @@ -0,0 +1,115 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Tech Mahindra + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.db.catalog.beans; + +import java.io.Serializable; +import javax.persistence.Column; +import javax.persistence.Entity; +import javax.persistence.GeneratedValue; +import javax.persistence.GenerationType; +import javax.persistence.Id; +import javax.persistence.Table; +import org.apache.commons.lang3.builder.EqualsBuilder; +import org.apache.commons.lang3.builder.HashCodeBuilder; +import org.apache.commons.lang3.builder.ToStringBuilder; +import com.openpojo.business.annotation.BusinessKey; + +@Entity +@Table(name = "bbname_selection_reference") +public class BBNameSelectionReference implements Serializable { + + private static final long serialVersionUID = 1L; + + @Id + @Column(name = "ID", nullable = false, updatable = false) + @GeneratedValue(strategy = GenerationType.IDENTITY) + private Integer ID; + + @BusinessKey + @Column(name = "CONTROLLER_ACTOR") + private String controllerActor; + + @Column(name = "SCOPE") + private String scope; + + @Column(name = "ACTION") + private String action; + + @BusinessKey + @Column(name = "BB_NAME") + private String bbName; + + public String getControllerActor() { + return controllerActor; + } + + public void setControllerActor(String controllerActor) { + this.controllerActor = controllerActor; + } + + public String getScope() { + return scope; + } + + public void setScope(String scope) { + this.scope = scope; + } + + public String getAction() { + return action; + } + + public void setAction(String action) { + this.action = action; + } + + public Integer getID() { + return ID; + } + + public String getBbName() { + return bbName; + } + + public void setBbName(String bbName) { + this.bbName = bbName; + } + + @Override + public String toString() { + return new ToStringBuilder(this).append("ID", ID).append("controllerActor", controllerActor) + .append("scope", scope).append("action", action).append("bbName", bbName).toString(); + } + + @Override + public boolean equals(final Object other) { + if (!(other instanceof BBNameSelectionReference)) { + return false; + } + BBNameSelectionReference castOther = (BBNameSelectionReference) other; + return new EqualsBuilder().append(controllerActor, castOther.controllerActor).isEquals(); + } + + @Override + public int hashCode() { + return new HashCodeBuilder().append(controllerActor).append(bbName).toHashCode(); + } +} diff --git a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/Service.java b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/Service.java index ab40cefb4e..0d7a6dbd1f 100644 --- a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/Service.java +++ b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/Service.java @@ -136,6 +136,9 @@ public class Service implements Serializable { @JoinColumn(name = "TOSCA_CSAR_ARTIFACT_UUID") private ToscaCsar csar; + @OneToMany(cascade = CascadeType.ALL, mappedBy = "service") + private List<ServiceArtifact> serviceArtifactList; + @Column(name = "NAMING_POLICY") private String namingPolicy; @@ -371,6 +374,17 @@ public class Service implements Serializable { this.csar = csar; } + public List<ServiceArtifact> getServiceArtifactList() { + if (serviceArtifactList == null) { + serviceArtifactList = new ArrayList<>(); + } + return serviceArtifactList; + } + + public void setServiceArtifactList(List<ServiceArtifact> serviceArtifactList) { + this.serviceArtifactList = serviceArtifactList; + } + public String getWorkloadContext() { return this.workloadContext; } diff --git a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/ServiceArtifact.java b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/ServiceArtifact.java new file mode 100644 index 0000000000..a8884a81bb --- /dev/null +++ b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/ServiceArtifact.java @@ -0,0 +1,168 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (c) 2019, CMCC Technologies Co., Ltd. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.db.catalog.beans; + +import com.fasterxml.jackson.annotation.JsonFormat; +import com.openpojo.business.annotation.BusinessKey; +import org.apache.commons.lang3.builder.ToStringBuilder; +import javax.persistence.*; +import java.io.Serializable; +import java.util.Date; +import java.util.Objects; + +@Entity +@Table(name = "service_artifact") +public class ServiceArtifact implements Serializable { + + private static final long serialVersionUID = 768026109321305392L; + + @BusinessKey + @Id + @Column(name = "ARTIFACT_UUID") + private String artifactUUID; + + @Column(name = "TYPE") + private String type; + + @Column(name = "NAME") + private String name; + + @Column(name = "VERSION") + private String version; + + @Column(name = "DESCRIPTION") + private String description; + + @Column(name = "CONTENT", columnDefinition = "LONGTEXT") + private String content; + + @Column(name = "CHECKSUM") + private String checksum; + + @Column(name = "CREATION_TIMESTAMP", updatable = false) + @JsonFormat(pattern = "yyyy-MM-dd HH:mm:ss.SSS") + @Temporal(TemporalType.TIMESTAMP) + private Date creationTimestamp; + + @ManyToOne(cascade = CascadeType.ALL) + @JoinColumn(name = "SERVICE_MODEL_UUID") + private Service service; + + @PrePersist + protected void onCreate() { + this.creationTimestamp = new Date(); + } + + public String getArtifactUUID() { + return artifactUUID; + } + + public void setArtifactUUID(String artifactUUID) { + this.artifactUUID = artifactUUID; + } + + + public String getType() { + return type; + } + + public void setType(String type) { + this.type = type; + } + + public String getName() { + return name; + } + + public void setName(String name) { + this.name = name; + } + + public String getVersion() { + return version; + } + + public void setVersion(String version) { + this.version = version; + } + + public String getDescription() { + return description; + } + + public void setDescription(String description) { + this.description = description; + } + + public String getContent() { + return content; + } + + public void setContent(String content) { + this.content = content; + } + + public String getChecksum() { + return checksum; + } + + public void setChecksum(String checksum) { + this.checksum = checksum; + } + + public Date getCreationTimestamp() { + return creationTimestamp; + } + + public void setCreationTimestamp(Date creationTimestamp) { + this.creationTimestamp = creationTimestamp; + } + + public Service getService() { + return service; + } + + public void setService(Service service) { + this.service = service; + } + + @Override + public String toString() { + return new ToStringBuilder(this).append("artifactUUID", artifactUUID).append("type", type).append("name", name) + .append("version", version).append("description", description).append("content", content) + .append("checksum", checksum).append("creationTimestamp", creationTimestamp).toString(); + } + + @Override + public boolean equals(Object o) { + if (this == o) + return true; + if (o == null || getClass() != o.getClass()) + return false; + ServiceArtifact that = (ServiceArtifact) o; + return artifactUUID.equals(that.artifactUUID); + } + + @Override + public int hashCode() { + return Objects.hash(artifactUUID); + } +} diff --git a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/ServiceInfo.java b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/ServiceInfo.java new file mode 100644 index 0000000000..f9c95767f6 --- /dev/null +++ b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/ServiceInfo.java @@ -0,0 +1,106 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (c) 2019, CMCC Technologies Co., Ltd. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.db.catalog.beans; + +import com.openpojo.business.annotation.BusinessKey; +import org.apache.commons.lang3.builder.ToStringBuilder; +import uk.co.blackpepper.bowman.annotation.LinkedResource; +import javax.persistence.*; +import java.io.Serializable; +import java.util.Objects; + +@Entity +@Table(name = "service_info") +public class ServiceInfo implements Serializable { + + private static final long serialVersionUID = 768026109321305392L; + + @Id + @BusinessKey + @GeneratedValue(strategy = GenerationType.IDENTITY) + @Column(name = "ID") + private Integer id; + + @Column(name = "SERVICE_INPUT") + private String serviceInput; + + @Column(name = "SERVICE_PROPERTIES") + private String serviceProperties; + + @OneToOne(cascade = CascadeType.ALL) + @JoinTable(name = "service_to_service_info", joinColumns = @JoinColumn(name = "SERVICE_INFO_ID"), + inverseJoinColumns = @JoinColumn(name = "SERVICE_MODEL_UUID")) + private Service service; + + public Integer getId() { + return id; + } + + public void setId(Integer serviceInfoId) { + this.id = serviceInfoId; + } + + public String getServiceInput() { + return serviceInput; + } + + public void setServiceInput(String serviceInput) { + this.serviceInput = serviceInput; + } + + public String getServiceProperties() { + return serviceProperties; + } + + public void setServiceProperties(String serviceProperties) { + this.serviceProperties = serviceProperties; + } + + @LinkedResource + public Service getService() { + return service; + } + + public void setService(Service service) { + this.service = service; + } + + @Override + public String toString() { + return new ToStringBuilder(this).append("id", id).append("serviceProperties", serviceProperties) + .append("serviceInput", serviceInput).toString(); + } + + @Override + public boolean equals(Object o) { + if (this == o) + return true; + if (o == null || getClass() != o.getClass()) + return false; + ServiceInfo that = (ServiceInfo) o; + return id.equals(that.id); + } + + @Override + public int hashCode() { + return Objects.hash(id); + } +} diff --git a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/client/CatalogDbClient.java b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/client/CatalogDbClient.java index 161ca2a2fb..26c33941ed 100644 --- a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/client/CatalogDbClient.java +++ b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/client/CatalogDbClient.java @@ -7,9 +7,9 @@ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at - * + * * http://www.apache.org/licenses/LICENSE-2.0 - * + * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. @@ -32,6 +32,7 @@ import javax.ws.rs.core.UriBuilder; import org.apache.http.HttpStatus; import org.onap.logging.filter.base.Constants; import org.onap.logging.filter.spring.SpringClientPayloadFilter; +import org.onap.so.db.catalog.beans.BBNameSelectionReference; import org.onap.so.db.catalog.beans.BuildingBlockDetail; import org.onap.so.db.catalog.beans.CloudSite; import org.onap.so.db.catalog.beans.CloudifyManager; @@ -119,6 +120,7 @@ public class CatalogDbClient { private static final String PNF_RESOURCE = "/pnfResource"; private static final String PNF_RESOURCE_CUSTOMIZATION = "/pnfResourceCustomization"; private static final String WORKFLOW = "/workflow"; + private static final String BB_NAME_SELECTION_REFERENCE = "/bbNameSelectionReference"; private static final String SEARCH = "/search"; @@ -156,6 +158,7 @@ public class CatalogDbClient { protected static final String HOMING_INSTANCE = "/homingInstance"; protected static final String ARTIFACT_UUID = "artifactUUID"; protected static final String SOURCE = "source"; + protected static final String RESOURCE_TARGET = "resource_target"; private static final String TARGET_ENTITY = "SO:CatalogDB"; private static final String ASTERISK = "*"; @@ -201,10 +204,13 @@ public class CatalogDbClient { private String findServiceByServiceInstanceId = "/findServiceByServiceInstanceId"; private String findPnfResourceCustomizationByModelUuid = "/findPnfResourceCustomizationByModelUuid"; private String findWorkflowByArtifactUUID = "/findByArtifactUUID"; - private String findWorkflowByModelUUID = "/findWorkflowByModelUUID"; + private String findWorkflowByVnfModelUUID = "/findWorkflowByVnfModelUUID"; private String findWorkflowByPnfModelUUID = "/findWorkflowByPnfModelUUID"; private String findWorkflowBySource = "/findBySource"; private String findVnfResourceCustomizationByModelUuid = "/findVnfResourceCustomizationByModelUuid"; + private String findBBNameSelectionReferenceByControllerActorAndScopeAndAction = + "/findBBNameSelectionReferenceByControllerActorAndScopeAndAction"; + private String findWorkflowByResourceTarget = "/findByResourceTarget"; private String serviceURI; private String vfModuleURI; @@ -277,6 +283,8 @@ public class CatalogDbClient { private final Client<Workflow> workflowClient; + private final Client<BBNameSelectionReference> bbNameSelectionReferenceClient; + @Value("${mso.catalog.db.spring.endpoint:#{null}}") private String endpoint; @@ -339,13 +347,17 @@ public class CatalogDbClient { endpoint + PNF_RESOURCE_CUSTOMIZATION + SEARCH + findPnfResourceCustomizationByModelUuid; findWorkflowByArtifactUUID = endpoint + WORKFLOW + SEARCH + findWorkflowByArtifactUUID; - findWorkflowByModelUUID = endpoint + WORKFLOW + SEARCH + findWorkflowByModelUUID; + findWorkflowByVnfModelUUID = endpoint + WORKFLOW + SEARCH + findWorkflowByVnfModelUUID; findWorkflowByPnfModelUUID = endpoint + WORKFLOW + SEARCH + findWorkflowByPnfModelUUID; findWorkflowBySource = endpoint + WORKFLOW + SEARCH + findWorkflowBySource; + findWorkflowByResourceTarget = endpoint + WORKFLOW + SEARCH + findWorkflowByResourceTarget; findVnfResourceCustomizationByModelUuid = endpoint + VNF_RESOURCE_CUSTOMIZATION + SEARCH + findVnfResourceCustomizationByModelUuid; + findBBNameSelectionReferenceByControllerActorAndScopeAndAction = endpoint + BB_NAME_SELECTION_REFERENCE + SEARCH + + findBBNameSelectionReferenceByControllerActorAndScopeAndAction; + serviceURI = endpoint + SERVICE + URI_SEPARATOR; vfModuleURI = endpoint + VFMODULE + URI_SEPARATOR; vnfResourceURI = endpoint + VNF_RESOURCE + URI_SEPARATOR; @@ -412,6 +424,8 @@ public class CatalogDbClient { pnfResourceClient = clientFactory.create(PnfResource.class); pnfResourceCustomizationClient = clientFactory.create(PnfResourceCustomization.class); workflowClient = clientFactory.create(Workflow.class); + bbNameSelectionReferenceClient = clientFactory.create(BBNameSelectionReference.class); + } public CatalogDbClient(String baseUri, String auth) { @@ -462,6 +476,7 @@ public class CatalogDbClient { pnfResourceClient = clientFactory.create(PnfResource.class); pnfResourceCustomizationClient = clientFactory.create(PnfResourceCustomization.class); workflowClient = clientFactory.create(Workflow.class); + bbNameSelectionReferenceClient = clientFactory.create(BBNameSelectionReference.class); } public NetworkCollectionResourceCustomization getNetworkCollectionResourceCustomizationByID( @@ -689,6 +704,14 @@ public class CatalogDbClient { UriBuilder.fromUri(findFirstByModelNameURI).queryParam(MODEL_NAME, modelName).build()); } + public BBNameSelectionReference getBBNameSelectionReference(String controllerActor, String scope, String action) { + + return this.getSingleResource(bbNameSelectionReferenceClient, + getUri(UriBuilder.fromUri(findBBNameSelectionReferenceByControllerActorAndScopeAndAction) + .queryParam("CONTROLLER_ACTOR", controllerActor).queryParam("SCOPE", scope) + .queryParam("ACTION", action).build().toString())); + } + public ExternalServiceToInternalService findExternalToInternalServiceByServiceName(String serviceName) { return this.getSingleResource(externalServiceToInternalServiceClient, getUri(UriBuilder.fromUri(findExternalToInternalServiceByServiceName) @@ -1049,8 +1072,8 @@ public class CatalogDbClient { .queryParam(ARTIFACT_UUID, artifactUUID).build().toString())); } - public List<Workflow> findWorkflowByModelUUID(String vnfResourceModelUUID) { - return this.getMultipleResources(workflowClient, getUri(UriBuilder.fromUri(findWorkflowByModelUUID) + public List<Workflow> findWorkflowByVnfModelUUID(String vnfResourceModelUUID) { + return this.getMultipleResources(workflowClient, getUri(UriBuilder.fromUri(findWorkflowByVnfModelUUID) .queryParam(VNF_RESOURCE_MODEL_UUID, vnfResourceModelUUID).build().toString())); } @@ -1064,6 +1087,11 @@ public class CatalogDbClient { getUri(UriBuilder.fromUri(findWorkflowBySource).queryParam(SOURCE, source).build().toString())); } + public List<Workflow> findWorkflowByResourceTarget(String resourceTarget) { + return this.getMultipleResources(workflowClient, getUri(UriBuilder.fromUri(findWorkflowByResourceTarget) + .queryParam(RESOURCE_TARGET, resourceTarget).build().toString())); + } + public String getEndpoint() { return endpoint; } diff --git a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/data/repository/BBNameSelectionReferenceRepository.java b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/data/repository/BBNameSelectionReferenceRepository.java new file mode 100644 index 0000000000..38f1291f37 --- /dev/null +++ b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/data/repository/BBNameSelectionReferenceRepository.java @@ -0,0 +1,36 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (C) 2019 Tech Mahindra + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.db.catalog.data.repository; + + +import org.onap.so.db.catalog.beans.BBNameSelectionReference; +import org.springframework.data.jpa.repository.JpaRepository; +import org.springframework.data.repository.query.Param; +import org.springframework.data.rest.core.annotation.RepositoryRestResource; + + +@RepositoryRestResource(collectionResourceRel = "bbNameSelectionReference", path = "bbNameSelectionReference") +public interface BBNameSelectionReferenceRepository extends JpaRepository<BBNameSelectionReference, Integer> { + + public BBNameSelectionReference findBBNameSelectionReferenceByControllerActorAndScopeAndAction( + @Param("CONTROLLER_ACTOR") String controllerActor, @Param("SCOPE") String scope, + @Param("ACTION") String action); +} diff --git a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/data/repository/ServiceInfoRepository.java b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/data/repository/ServiceInfoRepository.java new file mode 100644 index 0000000000..e3a4ca264e --- /dev/null +++ b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/data/repository/ServiceInfoRepository.java @@ -0,0 +1,33 @@ +/*- + * ============LICENSE_START======================================================= + * ONAP - SO + * ================================================================================ + * Copyright (c) 2019, CMCC Technologies Co., Ltd. + * ================================================================================ + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============LICENSE_END========================================================= + */ + +package org.onap.so.db.catalog.data.repository; + +import org.onap.so.db.catalog.beans.Service; +import org.onap.so.db.catalog.beans.ServiceInfo; +import org.springframework.data.jpa.repository.JpaRepository; +import org.springframework.data.rest.core.annotation.RepositoryRestResource; + +@RepositoryRestResource(collectionResourceRel = "serviceInfo", path = "serviceInfo") +public interface ServiceInfoRepository extends JpaRepository<ServiceInfo, Integer> { + + ServiceInfo findByService(Service service); + +} diff --git a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/data/repository/WorkflowRepository.java b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/data/repository/WorkflowRepository.java index f1b399325e..93ec54a2eb 100644 --- a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/data/repository/WorkflowRepository.java +++ b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/data/repository/WorkflowRepository.java @@ -7,9 +7,9 @@ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at - * + * * http://www.apache.org/licenses/LICENSE-2.0 - * + * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. @@ -33,18 +33,20 @@ public interface WorkflowRepository extends JpaRepository<Workflow, Integer> { List<Workflow> findBySource(String source); + List<Workflow> findByResourceTarget(String resourceTarget); + /** * Used to fetch the @{link Workflow} by the Model UUID. * * This operation is required by {@link org.onap.so.db.catalog.client.CatalogDbClient} to provide Workflow based on - * model UUID without projection. + * vnf model UUID without projection. * * @param vnfResourceModelUUID UUID * @return List of Workflow */ @Query(value = "select b.* from vnf_resource_to_workflow a join workflow b where a.WORKFLOW_ID = b.ID and a.VNF_RESOURCE_MODEL_UUID = ?1", nativeQuery = true) - List<Workflow> findWorkflowByModelUUID(String vnfResourceModelUUID); + List<Workflow> findWorkflowByVnfModelUUID(String vnfResourceModelUUID); /** * Used to fetch the @{link Workflow} by the Pnf Model UUID. diff --git a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/rest/beans/ServiceMacroHolder.java b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/rest/beans/ServiceMacroHolder.java index f9cbb0d462..ec4e922c8f 100644 --- a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/rest/beans/ServiceMacroHolder.java +++ b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/rest/beans/ServiceMacroHolder.java @@ -20,14 +20,10 @@ package org.onap.so.db.catalog.rest.beans; +import com.openpojo.business.annotation.BusinessKey; +import org.onap.so.db.catalog.beans.*; import java.io.Serializable; import java.util.ArrayList; -import org.onap.so.db.catalog.beans.AllottedResourceCustomization; -import org.onap.so.db.catalog.beans.NetworkResourceCustomization; -import org.onap.so.db.catalog.beans.Service; -import org.onap.so.db.catalog.beans.VnfResource; -import org.onap.so.db.catalog.beans.VnfResourceCustomization; -import com.openpojo.business.annotation.BusinessKey; /* * A simple holder for Service and its associated elements: VnfResource, 1-n VfModule, Network TBD @@ -42,6 +38,8 @@ public class ServiceMacroHolder implements Serializable { private ArrayList<NetworkResourceCustomization> networkResourceCustomizations; private ArrayList<AllottedResourceCustomization> allottedResourceCustomizations; private ArrayList<VnfResourceCustomization> vnfResourceCustomizations; + private ArrayList<ServiceProxyResourceCustomization> serviceProxyResourceCustomizations; + private ServiceInfo serviceInfo; public ServiceMacroHolder() { @@ -51,6 +49,8 @@ public class ServiceMacroHolder implements Serializable { this.networkResourceCustomizations = new ArrayList<>(); this.allottedResourceCustomizations = new ArrayList<>(); this.vnfResourceCustomizations = new ArrayList<>(); + this.serviceProxyResourceCustomizations = new ArrayList<>(); + this.serviceInfo = null; } public ServiceMacroHolder(Service service) { @@ -66,6 +66,14 @@ public class ServiceMacroHolder implements Serializable { this.service = service; } + public ServiceInfo getServiceInfo() { + return serviceInfo; + } + + public void setServiceInfo(ServiceInfo serviceInfo) { + this.serviceInfo = serviceInfo; + } + public void setVnfResources(ArrayList<VnfResource> vnfResources) { this.vnfResources = vnfResources; } @@ -139,6 +147,15 @@ public class ServiceMacroHolder implements Serializable { } } + public void addServiceProxyResourceCustomization(ServiceProxyResourceCustomization sprc) { + if (this.serviceProxyResourceCustomizations != null) { + this.serviceProxyResourceCustomizations.add(sprc); + } else { + this.serviceProxyResourceCustomizations = new ArrayList<>(); + this.serviceProxyResourceCustomizations.add(sprc); + } + } + @Override public String toString() { StringBuilder sb = new StringBuilder(); @@ -148,6 +165,11 @@ public class ServiceMacroHolder implements Serializable { } else { sb.append("service: null"); } + if (this.serviceInfo != null) { + sb.append("serviceInfo: " + this.serviceInfo.toString()); + } else { + sb.append("serviceInfo: null"); + } if (this.vnfResourceCustomizations != null && this.vnfResourceCustomizations.size() > 0) { int i = 0; sb.append("VnfResources: "); @@ -180,6 +202,13 @@ public class ServiceMacroHolder implements Serializable { sb.append("ARC[" + i++ + "]: " + arc.toString()); } } + if (this.serviceProxyResourceCustomizations != null && this.serviceProxyResourceCustomizations.size() > 0) { + int i = 0; + sb.append("ServiceProxyResourceCustomizations:"); + for (ServiceProxyResourceCustomization sprc : this.serviceProxyResourceCustomizations) { + sb.append("SPRC[" + i++ + "]: " + sprc.toString()); + } + } return sb.toString(); } @@ -202,6 +231,12 @@ public class ServiceMacroHolder implements Serializable { this.allottedResourceCustomizations = allottedResourceCustomizations; } + public ArrayList<ServiceProxyResourceCustomization> getServiceProxyResourceCustomizations() { + return serviceProxyResourceCustomizations; + } - + public void setServiceProxyResourceCustomizations( + ArrayList<ServiceProxyResourceCustomization> serviceProxyResourceCustomizations) { + this.serviceProxyResourceCustomizations = serviceProxyResourceCustomizations; + } } diff --git a/mso-catalog-db/src/test/java/org/onap/so/db/catalog/client/CatalogDbClientTest.java b/mso-catalog-db/src/test/java/org/onap/so/db/catalog/client/CatalogDbClientTest.java index 66fc0f5dc5..79e3cbcc08 100644 --- a/mso-catalog-db/src/test/java/org/onap/so/db/catalog/client/CatalogDbClientTest.java +++ b/mso-catalog-db/src/test/java/org/onap/so/db/catalog/client/CatalogDbClientTest.java @@ -4,6 +4,8 @@ * ================================================================================ * Copyright (C) 2017 AT&T Intellectual Property. All rights reserved. * ================================================================================ + * Modifications Copyright (c) 2020 Nordix + * ================================================================================ * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at @@ -179,7 +181,7 @@ public class CatalogDbClientTest { } @Test - public final void testFindWorkflowByPnfModelUUID() throws Exception { + public final void testFindWorkflowByPnfModelUUID() { String pnfResourceModelUUID = "f2d1f2b2-88bb-49da-b716-36ae420ccbff"; doReturn(new ArrayList()).when(catalogDbClient).getMultipleResources(any(), any()); @@ -190,4 +192,16 @@ public class CatalogDbClientTest { } + @Test + public final void testFindWorkflowByResourceTarget() { + // when + final String pnf_resource = "pnf"; + doReturn(new ArrayList()).when(catalogDbClient).getMultipleResources(any(), any()); + catalogDbClient.findWorkflowByResourceTarget(pnf_resource); + + // verify + verify(catalogDbClient).getMultipleResources(any(Client.class), eq(UriBuilder.fromUri("/findByResourceTarget") + .queryParam(CatalogDbClient.RESOURCE_TARGET, pnf_resource).build())); + } + } diff --git a/mso-catalog-db/src/test/java/org/onap/so/db/catalog/data/repository/WorkflowRepositoryTest.java b/mso-catalog-db/src/test/java/org/onap/so/db/catalog/data/repository/WorkflowRepositoryTest.java index 7d1b8d0d96..e47c61d8b4 100644 --- a/mso-catalog-db/src/test/java/org/onap/so/db/catalog/data/repository/WorkflowRepositoryTest.java +++ b/mso-catalog-db/src/test/java/org/onap/so/db/catalog/data/repository/WorkflowRepositoryTest.java @@ -36,7 +36,8 @@ public class WorkflowRepositoryTest extends BaseTest { @Test public void findByVnfResourceModelUUIDTest() throws Exception { - List<Workflow> workflows = workflowRepository.findWorkflowByModelUUID("ff2ae348-214a-11e7-93ae-92361f002671"); + List<Workflow> workflows = + workflowRepository.findWorkflowByVnfModelUUID("ff2ae348-214a-11e7-93ae-92361f002671"); Assert.assertTrue(workflows != null); Assert.assertTrue(workflows.size() != 0); @@ -54,4 +55,14 @@ public class WorkflowRepositoryTest extends BaseTest { Assert.assertTrue("testingWorkflow.bpmn".equals(workflows.get(0).getArtifactName())); } + @Test + public void findByResourceTargetTest() { + List<Workflow> workflows = workflowRepository.findByResourceTarget("pnf"); + + Assert.assertTrue(workflows != null); + Assert.assertTrue(workflows.size() == 1); + + Assert.assertTrue("DummyPnfWorkflow".equals(workflows.get(0).getArtifactName())); + } + } diff --git a/mso-catalog-db/src/test/resources/data.sql b/mso-catalog-db/src/test/resources/data.sql index e5963c183f..0852aa026d 100644 --- a/mso-catalog-db/src/test/resources/data.sql +++ b/mso-catalog-db/src/test/resources/data.sql @@ -957,3 +957,9 @@ VALUES (select ID from user_parameters where NAME='existing_software_version')), ((select ID from activity_spec where NAME='VNFUpgradeSoftwareActivity' and VERSION=1.0), (select ID from user_parameters where NAME='new_software_version')); + +INSERT INTO bbname_selection_reference (CONTROLLER_ACTOR,SCOPE,ACTION,BB_NAME) +VALUES +('APPC', 'vfModule', 'healthCheck','GenericVnfHealthCheckBB'), +('APPC', 'vfModule', 'configScaleOut','ConfigurationScaleOutBB'), +('APPC', 'vnf', 'healthCheck','GenericVnfHealthCheckBB');
\ No newline at end of file diff --git a/mso-catalog-db/src/test/resources/schema.sql b/mso-catalog-db/src/test/resources/schema.sql index 9037e431d4..6573def570 100644 --- a/mso-catalog-db/src/test/resources/schema.sql +++ b/mso-catalog-db/src/test/resources/schema.sql @@ -1387,6 +1387,18 @@ CREATE TABLE IF NOT EXISTS `activity_spec_to_user_parameters` ( ENGINE = InnoDB DEFAULT CHARACTER SET = latin1; +-- +-- Table structure for table `bbname_selection_reference` +-- +DROP TABLE IF EXISTS `bbname_selection_reference`; +CREATE TABLE IF NOT EXISTS `bbname_selection_reference` ( + `ID` INT(11) NOT NULL AUTO_INCREMENT, + `CONTROLLER_ACTOR` varchar(200) NOT NULL , + `SCOPE` varchar(200) NOT NULL, + `ACTION` varchar(200) NOT NULL, + `BB_NAME` varchar(200) NOT NULL, + PRIMARY KEY (`ID`) +) ENGINE=InnoDB DEFAULT CHARSET=latin1; diff --git a/packages/docker/pom.xml b/packages/docker/pom.xml index 44d94dfdbf..8d95d063da 100644 --- a/packages/docker/pom.xml +++ b/packages/docker/pom.xml @@ -6,7 +6,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>packages</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <packaging>pom</packaging> @@ -257,6 +257,31 @@ </build> </image> <image> + <name>${docker.image.prefix}/nssmf-adapter</name> + <build> + <cleanup>try</cleanup> + <dockerFileDir>docker-files</dockerFileDir> + <dockerFile>Dockerfile.so-app</dockerFile> + <tags> + <tag>${project.version}</tag> + <tag>${project.version}-${maven.build.timestamp}</tag> + <tag>${project.docker.latesttag.version}</tag> + </tags> + <assembly> + <inline> + <dependencySets> + <dependencySet> + <includes> + <include>org.onap.so.adapters:mso-nssmf-adapter</include> + </includes> + <outputFileNameMapping>app.jar</outputFileNameMapping> + </dependencySet> + </dependencySets> + </inline> + </assembly> + </build> + </image> + <image> <name>${docker.image.prefix}/so-appc-orchestrator</name> <build> <cleanup>try</cleanup> @@ -397,7 +422,7 @@ <dependencySets> <dependencySet> <includes> - <include>org.onap.so:so-simulator</include> + <include>org.onap.so.simulator:so-simulator</include> </includes> <outputFileNameMapping>app.jar</outputFileNameMapping> </dependencySet> @@ -437,7 +462,7 @@ <goal>push</goal> </goals> <configuration> - <image>${docker.image.prefix}/catalog-db-adapter,${docker.image.prefix}/request-db-adapter,${docker.image.prefix}/sdnc-adapter,${docker.image.prefix}/openstack-adapter,${docker.image.prefix}/vfc-adapter,${docker.image.prefix}/sdc-controller,${docker.image.prefix}/bpmn-infra,${docker.image.prefix}/api-handler-infra,${docker.image.prefix}/so-monitoring,${docker.image.prefix}/so-simulator</image> + <image>${docker.image.prefix}/catalog-db-adapter,${docker.image.prefix}/request-db-adapter,${docker.image.prefix}/sdnc-adapter,${docker.image.prefix}/openstack-adapter,${docker.image.prefix}/vfc-adapter,${docker.image.prefix}/sdc-controller,${docker.image.prefix}/bpmn-infra,${docker.image.prefix}/api-handler-infra,${docker.image.prefix}/so-monitoring,${docker.image.prefix}/so-simulator,${docker.image.prefix}/mso-nssmf-adapter</image> </configuration> </execution> </executions> @@ -492,6 +517,11 @@ </dependency> <dependency> <groupId>org.onap.so.adapters</groupId> + <artifactId>mso-nssmf-adapter</artifactId> + <version>${project.version}</version> + </dependency> + <dependency> + <groupId>org.onap.so.adapters</groupId> <artifactId>so-appc-orchestrator</artifactId> <version>${project.version}</version> </dependency> @@ -516,7 +546,7 @@ <version>${project.version}</version> </dependency> <dependency> - <groupId>org.onap.so</groupId> + <groupId>org.onap.so.simulator</groupId> <artifactId>so-simulator</artifactId> <version>${project.version}</version> </dependency> diff --git a/packages/pom.xml b/packages/pom.xml index 029fa3d446..af302405cc 100644 --- a/packages/pom.xml +++ b/packages/pom.xml @@ -4,7 +4,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>so</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>packages</artifactId> @@ -11,7 +11,7 @@ <groupId>org.onap.so</groupId> <artifactId>so</artifactId> <packaging>pom</packaging> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> <name>so</name> <description>This Maven project is responsible to build and package all child projects - contributions in the MSO project. This build can be configured to run Functional tests and to start/stop a jboss server + Mysql DB. @@ -32,8 +32,8 @@ <module>cloudify-client</module> <module>cxf-logging</module> <module>so-monitoring</module> - <module>packages</module> <module>so-simulator</module> + <module>packages</module> </modules> <properties> <project.mso.base.folder>.</project.mso.base.folder> @@ -42,14 +42,14 @@ <sonar.language>java</sonar.language> <sonar.java.coveragePlugin>jacoco</sonar.java.coveragePlugin> <sonar.surefire.reportsPath>${project.build.directory}/surefire-reports</sonar.surefire.reportsPath> - <sonar.jacoco.reportPath>${project.build.directory}/code-coverage/jacoco-ut.exec</sonar.jacoco.reportPath> + <sonar.coverage.jacoco.xmlReportPaths>${project.reporting.outputDirectory}/jacoco-ut/jacoco.xml</sonar.coverage.jacoco.xmlReportPaths> <!--sonar.jacoco.itReportPath>${project.mso.base.folder}/packages/arquillian-unit-tests/target/mso-automated-tests/jacoco-it.exec</sonar.jacoco.itReportPath --> <sonar.jacoco.reportMissing.force.zero>true</sonar.jacoco.reportMissing.force.zero> <sonar.projectVersion>${project.version}</sonar.projectVersion> <sonar.cpd.exclusions>**/*</sonar.cpd.exclusions> - <jacoco.version>0.7.5.201505241946</jacoco.version> + <jacoco.version>0.8.5</jacoco.version> <org.apache.maven.user-settings /> - <openstack.version>1.5.1</openstack.version> + <openstack.version>1.5.2-SNAPSHOT</openstack.version> <maven.build.timestamp.format>yyyyMMdd'T'HHmm</maven.build.timestamp.format> <originalClassifier>original</originalClassifier> <docker.skip>true</docker.skip> @@ -342,16 +342,20 @@ <version>${jacoco.version}</version> <executions> <execution> - <id>default-prepare-agent</id> + <id>prepare-agent</id> <goals> <goal>prepare-agent</goal> </goals> </execution> <execution> - <id>default-report</id> + <id>report</id> <goals> <goal>report</goal> </goals> + <configuration> + <dataFile>${project.build.directory}/code-coverage/jacoco.exec</dataFile> + <outputDirectory>${project.reporting.outputDirectory}/jacoco-ut</outputDirectory> + </configuration> </execution> </executions> </plugin> @@ -666,17 +670,17 @@ <dependency> <groupId>org.onap.logging-analytics</groupId> <artifactId>logging-slf4j</artifactId> - <version>1.6.3-SNAPSHOT</version> + <version>1.6.4</version> </dependency> <dependency> <groupId>org.onap.logging-analytics</groupId> <artifactId>logging-filter-base</artifactId> - <version>1.6.2-SNAPSHOT</version> + <version>1.6.4</version> </dependency> <dependency> <groupId>org.onap.logging-analytics</groupId> <artifactId>logging-filter-spring</artifactId> - <version>1.6.3-SNAPSHOT</version> + <version>1.6.4</version> </dependency> <dependency> <groupId>com.fasterxml.jackson.core</groupId> diff --git a/so-monitoring/pom.xml b/so-monitoring/pom.xml index 243073554e..206a0f2851 100644 --- a/so-monitoring/pom.xml +++ b/so-monitoring/pom.xml @@ -24,7 +24,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>so</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <groupId>org.onap.so.monitoring</groupId> diff --git a/so-monitoring/so-monitoring-handler/pom.xml b/so-monitoring/so-monitoring-handler/pom.xml index 59546861c5..176328a434 100644 --- a/so-monitoring/so-monitoring-handler/pom.xml +++ b/so-monitoring/so-monitoring-handler/pom.xml @@ -24,7 +24,7 @@ <parent> <groupId>org.onap.so.monitoring</groupId> <artifactId>so-monitoring</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>so-monitoring-handler</artifactId> <name>${project.artifactId}</name> diff --git a/so-monitoring/so-monitoring-service/pom.xml b/so-monitoring/so-monitoring-service/pom.xml index 762e3a5ee6..110c3fe863 100644 --- a/so-monitoring/so-monitoring-service/pom.xml +++ b/so-monitoring/so-monitoring-service/pom.xml @@ -24,7 +24,7 @@ <parent> <groupId>org.onap.so.monitoring</groupId> <artifactId>so-monitoring</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>so-monitoring-service</artifactId> <name>${project.artifactId}</name> diff --git a/so-monitoring/so-monitoring-ui/pom.xml b/so-monitoring/so-monitoring-ui/pom.xml index c362a83a9b..6488c7d7df 100644 --- a/so-monitoring/so-monitoring-ui/pom.xml +++ b/so-monitoring/so-monitoring-ui/pom.xml @@ -24,7 +24,7 @@ <parent> <groupId>org.onap.so.monitoring</groupId> <artifactId>so-monitoring</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <artifactId>so-monitoring-ui</artifactId> diff --git a/so-simulator/pom.xml b/so-simulator/pom.xml index 6e0d125ddb..35964d6de6 100644 --- a/so-simulator/pom.xml +++ b/so-simulator/pom.xml @@ -5,7 +5,7 @@ <parent> <groupId>org.onap.so</groupId> <artifactId>so</artifactId> - <version>1.4.0-SNAPSHOT</version> + <version>1.6.0-SNAPSHOT</version> </parent> <modelVersion>4.0.0</modelVersion> <artifactId>so-simulator</artifactId> @@ -17,8 +17,19 @@ <project.build.sourceEncoding>UTF-8</project.build.sourceEncoding> <project.reporting.outputEncoding>UTF-8</project.reporting.outputEncoding> <citrus.simulator.version>1.1.0</citrus.simulator.version> + <spring.boot.version>2.0.9.RELEASE</spring.boot.version> </properties> - + <dependencyManagement> + <dependencies> + <dependency> + <groupId>org.springframework.boot</groupId> + <artifactId>spring-boot-dependencies</artifactId> + <version>${spring.boot.version}</version> + <type>pom</type> + <scope>import</scope> + </dependency> + </dependencies> + </dependencyManagement> <dependencies> <dependency> <groupId>org.springframework.boot</groupId> diff --git a/version.properties b/version.properties index 9eb3b93ac9..a0756adf2b 100644 --- a/version.properties +++ b/version.properties @@ -3,8 +3,8 @@ # because they are used in Jenkins, whose plug-in doesn't support major=1 -minor=5 -patch=3 +minor=6 +patch=0 base_version=${major}.${minor}.${patch} |