summaryrefslogtreecommitdiffstats
diff options
context:
space:
mode:
-rw-r--r--adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceInfo.java7
-rw-r--r--adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceMacroHolder.java8
-rw-r--r--adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceProxyCustomization.java124
-rw-r--r--adapters/mso-nssmf-adapter/src/main/resources/META-INF/services/org.onap.so.client.RestProperties1
-rw-r--r--adapters/mso-nssmf-adapter/src/main/resources/application.yaml61
-rw-r--r--adapters/mso-nssmf-adapter/src/main/resources/nssmf.jksbin0 -> 1386 bytes
-rw-r--r--adapters/mso-nssmf-adapter/src/main/resources/nssmf.p12bin0 -> 1616 bytes
-rw-r--r--adapters/mso-nssmf-adapter/src/main/resources/org.onap.so.jksbin0 -> 1386 bytes
-rw-r--r--adapters/mso-nssmf-adapter/src/main/resources/org.onap.so.p12bin0 -> 1616 bytes
-rw-r--r--adapters/mso-nssmf-adapter/src/test/java/org/onap/so/adapters/nssmf/NssmfAdapterRestTest.java392
-rw-r--r--asdc-controller/src/main/java/org/onap/so/asdc/client/ASDCController.java59
-rw-r--r--asdc-controller/src/main/java/org/onap/so/asdc/installer/heat/ToscaResourceInstaller.java187
-rw-r--r--asdc-controller/src/main/java/org/onap/so/asdc/util/ZipParser.java67
-rw-r--r--asdc-controller/src/test/java/org/onap/so/asdc/installer/heat/ToscaResourceInstallerTest.java22
-rw-r--r--asdc-controller/src/test/java/org/onap/so/asdc/utils/ASDCLoggingVisitorImpl.java4
-rw-r--r--asdc-controller/src/test/resources/schema.sql28
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/restproperties/SDNCLcmPropertiesImpl.java117
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/common/SDNCConstants.java49
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmClientBuilder.java77
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmClientBuilderException.java30
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmDmaapClient.java90
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmMessageBuilder.java87
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmProperties.java47
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmRestClient.java67
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmActionIdentifiers.java97
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmCommonHeader.java97
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapRequest.java97
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapResponse.java97
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmFlags.java64
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmInput.java75
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmOutput.java64
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmRestRequest.java42
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmRestResponse.java42
-rw-r--r--bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmStatus.java53
-rw-r--r--bpmn/MSOCommonBPMN/src/main/resources/META-INF/services/org.onap.so.client.RestProperties3
-rw-r--r--bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmDmaapClientTest.java139
-rw-r--r--bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmMessageBuilderTest.java53
-rw-r--r--bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmRestClientTest.java93
-rw-r--r--bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmBeanTest.java78
-rw-r--r--bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapRequestTest.java67
-rw-r--r--bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapResponseTest.java67
-rw-r--r--bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmInputTest.java67
-rw-r--r--bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmOutputTest.java84
-rw-r--r--bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmRestRequestTest.java54
-rw-r--r--bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmRestResponseTest.java54
-rw-r--r--bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DeleteCommunicationService.groovy429
-rw-r--r--bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DeleteSliceService.groovy263
-rw-r--r--bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/CreateSliceService.bpmn808
-rw-r--r--bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/DeleteCommunicationService.bpmn523
-rw-r--r--common/pom.xml2
-rw-r--r--common/src/main/java/org/onap/so/beans/nsmf/SliceTaskParams.java413
-rw-r--r--common/src/main/java/org/onap/so/client/aai/AAIObjectType.java76
-rw-r--r--mso-api-handlers/mso-api-handler-common/src/main/java/org/onap/so/apihandler/common/RequestClientParameter.java14
-rw-r--r--mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/E2EServiceInstances.java156
-rw-r--r--mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/e2eserviceinstancebeans/E2ESliceServiceActivateRequest.java23
-rw-r--r--mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/Service.java14
-rw-r--r--mso-catalog-db/src/main/java/org/onap/so/db/catalog/data/repository/ServiceInfoRepository.java33
-rw-r--r--mso-catalog-db/src/main/java/org/onap/so/db/catalog/rest/beans/ServiceMacroHolder.java49
58 files changed, 5663 insertions, 151 deletions
diff --git a/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceInfo.java b/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceInfo.java
index b1911654c4..6c1c81c6ef 100644
--- a/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceInfo.java
+++ b/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceInfo.java
@@ -65,6 +65,9 @@ public class QueryServiceInfo extends CatalogQuery {
@Override
public String JSON2(boolean isArray, boolean isEmbed) {
+ if (serviceInfo == null) {
+ return "\"serviceInfo\": null";
+ }
StringBuilder sb = new StringBuilder();
sb.append("\"serviceInfo\": ");
sb.append("\n");
@@ -73,8 +76,8 @@ public class QueryServiceInfo extends CatalogQuery {
put(valueMap, "ID", null == serviceInfo ? null : serviceInfo.getId());
put(valueMap, "SERVICE_INPUT", null == serviceInfo ? null : serviceInfo.getServiceInput());
put(valueMap, "SERVICE_PROPERTIES", null == serviceInfo ? null : serviceInfo.getServiceProperties());
- // String subitem = new QueryServiceArtifact(service.getServiceArtifactList()).JSON2(true, true);
- // valueMap.put("_SERVICEARTIFACT_", subitem.replaceAll("(?m)^", "\t\t"));m
+ String subitem = new QueryServiceArtifact(service.getServiceArtifactList()).JSON2(true, true);
+ valueMap.put("_SERVICEARTIFACT_", subitem.replaceAll("(?m)^", "\t\t"));
sb.append(this.setTemplate(TEMPLATE, valueMap));
sb.append("}");
return sb.toString();
diff --git a/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceMacroHolder.java b/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceMacroHolder.java
index 0eb7d0418e..d5aa472c8d 100644
--- a/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceMacroHolder.java
+++ b/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceMacroHolder.java
@@ -40,7 +40,7 @@ public class QueryServiceMacroHolder extends CatalogQuery {
+ "\t\"serviceType\" : <SERVICE_TYPE>,\n" + "\t\"serviceRole\" : <SERVICE_ROLE>,\n"
+ "\t\"environmentContext\" : <ENVIRONMENT_CONTEXT>,\n" + "\t\"resourceOrder\" : <RESOURCE_ORDER>,\n"
+ "\t\"workloadContext\" : <WORKLOAD_CONTEXT>,\n" + "<_SERVICEVNFS_>,\n" + "<_SERVICENETWORKS_>,\n"
- + "<_SERVICEALLOTTEDRESOURCES_>\n" + "\t}}";
+ + "<_SERVICEINFO_>,\n" + "<_SERVICEPROXY_>,\n" + "<_SERVICEALLOTTEDRESOURCES_>\n" + "\t}}";
public QueryServiceMacroHolder() {
super();
@@ -94,6 +94,12 @@ public class QueryServiceMacroHolder extends CatalogQuery {
subitem = new QueryAllottedResourceCustomization(service.getAllottedCustomizations()).JSON2(true, true);
valueMap.put("_SERVICEALLOTTEDRESOURCES_", subitem.replaceAll(LINE_BEGINNING, "\t"));
+ subitem = new QueryServiceInfo(serviceMacroHolder.getServiceInfo()).JSON2(true, true);
+ valueMap.put("_SERVICEINFO_", subitem.replaceAll(LINE_BEGINNING, "\t"));
+
+ subitem = new QueryServiceProxyCustomization(service.getServiceProxyCustomizations()).JSON2(true, true);
+ valueMap.put("_SERVICEPROXY_", subitem.replaceAll(LINE_BEGINNING, "\t"));
+
buf.append(this.setTemplate(TEMPLATE, valueMap));
return buf.toString();
}
diff --git a/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceProxyCustomization.java b/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceProxyCustomization.java
new file mode 100644
index 0000000000..94cf304120
--- /dev/null
+++ b/adapters/mso-catalog-db-adapter/src/main/java/org/onap/so/adapters/catalogdb/catalogrest/QueryServiceProxyCustomization.java
@@ -0,0 +1,124 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (c) 2019, CMCC Technologies Co., Ltd.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.catalogdb.catalogrest;
+
+import org.onap.so.db.catalog.beans.ServiceProxyResourceCustomization;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+import javax.xml.bind.annotation.XmlRootElement;
+import java.util.ArrayList;
+import java.util.HashMap;
+import java.util.List;
+import java.util.Map;
+
+@XmlRootElement(name = "serviceProxyCustomizations")
+public class QueryServiceProxyCustomization extends CatalogQuery {
+
+ protected static Logger logger = LoggerFactory.getLogger(QueryServiceProxyCustomization.class);
+
+ private List<ServiceProxyResourceCustomization> serviceProxyResourceCustomizationList;
+
+ private static final String TEMPLATE =
+ "\t{\n" + "\t\t\"modelInfo\" : {\n" + "\t\t\t\"modelName\" : <MODEL_NAME>,\n"
+ + "\t\t\t\"modelUuid\" : <MODEL_UUID>,\n"
+ + "\t\t\t\"modelInvariantUuid\" : <MODEL_INVARIANT_UUID>,\n"
+ + "\t\t\t\"modelVersion\" : <MODEL_VERSION>,\n"
+ + "\t\t\t\"modelCustomizationUuid\" : <MODEL_CUSTOMIZATION_UUID>,\n"
+ + "\t\t\t\"modelInstanceName\" : <MODEL_INSTANCE_NAME>\n" + "\t},\n"
+ + "\t\t\"toscaNodeType\" : <TOSCA_NODE_TYPE>,\n"
+ + "\t\t\"description\" : <DESCRIPTION>,\n"
+ + "\t\t\"sourceModelUuid\" : <SOURCE_SERVICE_MODEL_UUID>\n" + "\t}";
+
+ public QueryServiceProxyCustomization() {
+ super();
+ this.serviceProxyResourceCustomizationList = new ArrayList<>();
+ }
+
+ public QueryServiceProxyCustomization(
+ List<ServiceProxyResourceCustomization> serviceProxyResourceCustomizationList) {
+ this.serviceProxyResourceCustomizationList = serviceProxyResourceCustomizationList;
+ }
+
+ @Override
+ public String toString() {
+ StringBuilder sb = new StringBuilder();
+
+ boolean first = true;
+ int i = 1;
+ for (ServiceProxyResourceCustomization o : serviceProxyResourceCustomizationList) {
+ sb.append(i).append("\t");
+ if (!first)
+ sb.append("\n");
+
+ first = false;
+ sb.append(o);
+ }
+ return sb.toString();
+ }
+
+ @Override
+ public String JSON2(boolean isArray, boolean isEmbed) {
+ StringBuilder sb = new StringBuilder();
+ if (!isEmbed && isArray)
+ sb.append("{ ");
+ if (isArray)
+ sb.append("\"serviceProxy\": [");
+ Map<String, String> valueMap = new HashMap<>();
+ String sep = "";
+ boolean first = true;
+
+ if (this.serviceProxyResourceCustomizationList != null) {
+ for (ServiceProxyResourceCustomization o : serviceProxyResourceCustomizationList) {
+ if (first)
+ sb.append("\n");
+
+ first = false;
+
+ boolean arNull = o == null;
+
+ put(valueMap, "MODEL_CUSTOMIZATION_UUID", arNull ? null : o.getModelCustomizationUUID());
+ put(valueMap, "MODEL_INSTANCE_NAME", arNull ? null : o.getModelInstanceName());
+ put(valueMap, "MODEL_UUID", arNull ? null : o.getModelUUID());
+ put(valueMap, "MODEL_INVARIANT_UUID", arNull ? null : o.getModelInvariantUUID());
+ put(valueMap, "MODEL_VERSION", arNull ? null : o.getModelVersion());
+ put(valueMap, "MODEL_NAME", arNull ? null : o.getModelName());
+ put(valueMap, "TOSCA_NODE_TYPE", arNull ? null : o.getToscaNodeType());
+ put(valueMap, "DESCRIPTION", arNull ? null : o.getDescription());
+ put(valueMap, "SOURCE_SERVICE_MODEL_UUID", (String) (arNull ? null
+ : o.getSourceService() == null ? null : o.getSourceService().getModelUUID()));
+
+ sb.append(sep).append(this.setTemplate(TEMPLATE, valueMap));
+ sep = ",\n";
+ }
+ }
+ if (!first)
+ sb.append("\n");
+
+ if (isArray)
+ sb.append("]");
+
+ if (!isEmbed && isArray)
+ sb.append("}");
+
+ return sb.toString();
+ }
+
+}
diff --git a/adapters/mso-nssmf-adapter/src/main/resources/META-INF/services/org.onap.so.client.RestProperties b/adapters/mso-nssmf-adapter/src/main/resources/META-INF/services/org.onap.so.client.RestProperties
new file mode 100644
index 0000000000..f93ec63f37
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/resources/META-INF/services/org.onap.so.client.RestProperties
@@ -0,0 +1 @@
+org.onap.so.adapters.nssmf.extclients.aai.AaiClientPropertiesImpl \ No newline at end of file
diff --git a/adapters/mso-nssmf-adapter/src/main/resources/application.yaml b/adapters/mso-nssmf-adapter/src/main/resources/application.yaml
new file mode 100644
index 0000000000..cb2f04d7ec
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/resources/application.yaml
@@ -0,0 +1,61 @@
+#
+# ============LICENSE_START=======================================================
+# ONAP - SO
+# ================================================================================
+# Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+# ================================================================================
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+# ============LICENSE_END=========================================================
+#/
+aai:
+ auth: 2A11B07DB6214A839394AA1EC5844695F5114FC407FF5422625FB00175A3DCB8A1FF745F22867EFA72D5369D599BBD88DA8BED4233CF5586
+ endpoint: https://aai.onap:30233
+logging:
+ path: logs
+
+spring:
+ datasource:
+ driver-class-name: org.mariadb.jdbc.Driver
+ jdbcUrl: jdbc:mariadb://192.168.235.44:30444/requestdb
+ username: root
+ password: secretpassword
+
+ jpa:
+ show-sql: false
+ hibernate:
+ dialect: org.hibernate.dialect.MySQL5Dialect
+ ddl-auto: validate
+ naming-strategy: org.hibernate.cfg.ImprovedNamingStrategy
+ enable-lazy-load-no-trans: true
+server:
+ port: 8080
+ tomcat:
+ max-threads: 50
+
+mso:
+ key: 07a7159d3bf51a0e53be7a8f89699be7
+ site-name: localSite
+ logPath: ./logs/nssmf
+ msb-ip: msb-iag.{{ include "common.namespace" . }}
+ msb-port: 80
+ adapters:
+ requestDb:
+ endpoint: https://so-request-db-adapter.{{ include "common.namespace" . }}:8083
+ auth: Basic YnBlbDpwYXNzd29yZDEk
+
+#Actuator
+management:
+ security:
+ enabled: false
+ basic:
+ enabled: false \ No newline at end of file
diff --git a/adapters/mso-nssmf-adapter/src/main/resources/nssmf.jks b/adapters/mso-nssmf-adapter/src/main/resources/nssmf.jks
new file mode 100644
index 0000000000..2ecce5bd3d
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/resources/nssmf.jks
Binary files differ
diff --git a/adapters/mso-nssmf-adapter/src/main/resources/nssmf.p12 b/adapters/mso-nssmf-adapter/src/main/resources/nssmf.p12
new file mode 100644
index 0000000000..25e7fbfca9
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/resources/nssmf.p12
Binary files differ
diff --git a/adapters/mso-nssmf-adapter/src/main/resources/org.onap.so.jks b/adapters/mso-nssmf-adapter/src/main/resources/org.onap.so.jks
new file mode 100644
index 0000000000..f7cd9e8f86
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/resources/org.onap.so.jks
Binary files differ
diff --git a/adapters/mso-nssmf-adapter/src/main/resources/org.onap.so.p12 b/adapters/mso-nssmf-adapter/src/main/resources/org.onap.so.p12
new file mode 100644
index 0000000000..1927b1f13f
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/main/resources/org.onap.so.p12
Binary files differ
diff --git a/adapters/mso-nssmf-adapter/src/test/java/org/onap/so/adapters/nssmf/NssmfAdapterRestTest.java b/adapters/mso-nssmf-adapter/src/test/java/org/onap/so/adapters/nssmf/NssmfAdapterRestTest.java
new file mode 100644
index 0000000000..5bfd39096c
--- /dev/null
+++ b/adapters/mso-nssmf-adapter/src/test/java/org/onap/so/adapters/nssmf/NssmfAdapterRestTest.java
@@ -0,0 +1,392 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.adapters.nssmf;
+
+import java.io.ByteArrayInputStream;
+import java.io.InputStream;
+import java.util.LinkedList;
+import java.util.List;
+import org.apache.http.HttpEntity;
+import org.apache.http.HttpResponse;
+import org.apache.http.StatusLine;
+import org.apache.http.client.HttpClient;
+import org.apache.http.client.methods.HttpRequestBase;
+import org.junit.Before;
+import org.junit.Test;
+import org.junit.runner.RunWith;
+import org.mockito.Mock;
+import org.mockito.invocation.InvocationOnMock;
+import org.mockito.stubbing.Answer;
+import org.onap.so.adapters.nssmf.model.TokenResponse;
+import org.onap.so.adapters.nssmf.rest.HttpMethod;
+import org.onap.so.adapters.nssmf.rest.NssmfAdapterRest;
+import org.onap.so.adapters.nssmf.rest.NssmfInfo;
+import org.onap.so.adapters.nssmf.rest.NssmfManager;
+import org.onap.so.adapters.nssmf.rest.RestUtil;
+import org.onap.so.beans.nsmf.ActDeActNssi;
+import org.onap.so.beans.nsmf.AllocateCnNssi;
+import org.onap.so.beans.nsmf.CnSliceProfile;
+import org.onap.so.beans.nsmf.DeAllocateNssi;
+import org.onap.so.beans.nsmf.EsrInfo;
+import org.onap.so.beans.nsmf.JobStatusRequest;
+import org.onap.so.beans.nsmf.NsiInfo;
+import org.onap.so.beans.nsmf.NssiActDeActRequest;
+import org.onap.so.beans.nsmf.NssiAllocateRequest;
+import org.onap.so.beans.nsmf.NssiDeAllocateRequest;
+import org.onap.so.beans.nsmf.NssiResponse;
+import org.onap.so.beans.nsmf.PerfReq;
+import org.onap.so.beans.nsmf.PerfReqEmbbList;
+import org.onap.so.db.request.data.repository.ResourceOperationStatusRepository;
+import org.springframework.http.ResponseEntity;
+import org.springframework.test.context.junit4.SpringRunner;
+import static java.nio.charset.StandardCharsets.UTF_8;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertNotNull;
+import static org.mockito.ArgumentMatchers.any;
+import static org.mockito.Mockito.doAnswer;
+import static org.mockito.Mockito.when;
+import static org.mockito.MockitoAnnotations.initMocks;
+import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.marshal;
+import static org.onap.so.adapters.nssmf.util.NssmfAdapterUtil.unMarshal;
+import static org.onap.so.beans.nsmf.NetworkType.CORE;
+import static org.onap.so.beans.nsmf.ResourceSharingLevel.NON_SHARED;
+
+@RunWith(SpringRunner.class)
+public class NssmfAdapterRestTest {
+
+ private final static String ALLOCATE = "{\n" + " \"esrInfo\" : {\n" + " \"vendor\" : \"huawei\",\n"
+ + " \"networkType\" : \"cn\"\n" + " },\n" + " \"allocateCnNssi\" : {\n"
+ + " \"nssiId\" : \"NSST-C-001-HDBNJ-NSSMF-01-A-ZX\",\n" + " \"nssiName\" : \"eMBB-001\",\n"
+ + " \"sliceProfile\" : {\n" + " \"snssaiList\" : [ \"001-100001\" ],\n"
+ + " \"sliceProfileId\" : \"ab9af40f13f721b5f13539d87484098\",\n"
+ + " \"plmnIdList\" : [ \"460-00\", \"460-01\" ],\n" + " \"perfReq\" : {\n"
+ + " \"perfReqEmbbList\" : [ {\n" + " \"activityFactor\" : 50\n" + " } ]\n"
+ + " },\n" + " \"maxNumberofUEs\" : 200,\n"
+ + " \"coverageAreaTAList\" : [ \"1\", \"2\", \"3\" ],\n" + " \"latency\" : 6,\n"
+ + " \"resourceSharingLevel\" : \"non-shared\"\n" + " },\n" + " \"scriptName\" : \"CN1\",\n"
+ + " \"nsiInfo\" : {\n" + " \"nsiName\" : \"eMBB-001\",\n"
+ + " \"nsiId\" : \"NSI-M-001-HDBNJ-NSMF-01-A-ZX\"\n" + " }\n" + " }\n" + "}";
+
+ private NssmfManager nssmfMgr;
+
+ @Mock
+ private ResourceOperationStatusRepository rscOperStatusRepo;
+
+ @Mock
+ private RestUtil restUtil;
+
+ @Mock
+ private NssmfAdapterRest nssmfRest;
+
+ @Mock
+ private HttpResponse tokenResponse;
+
+ @Mock
+ private HttpEntity tokenEntity;
+
+ @Mock
+ private HttpResponse commonResponse;
+
+ @Mock
+ private HttpEntity commonEntity;
+
+ @Mock
+ private StatusLine statusLine;
+
+ @Mock
+ private HttpClient httpClient;
+
+ private InputStream postStream;
+
+ private InputStream tokenStream;
+
+ @Before
+ public void setUp() {
+ initMocks(this);
+ nssmfMgr = new NssmfManager();
+ nssmfMgr.setRestUtil(restUtil);
+ nssmfMgr.setRscOperStatusRepo(rscOperStatusRepo);
+ }
+
+ private void createCommonMock(int statusCode, NssmfInfo nssmf) throws Exception {
+ when(nssmfRest.getNssmfMgr()).thenReturn(nssmfMgr);
+ when(nssmfRest.allocateNssi(any(NssiAllocateRequest.class))).thenCallRealMethod();
+ when(nssmfRest.deAllocateNssi(any(NssiDeAllocateRequest.class), any(String.class))).thenCallRealMethod();
+ when(nssmfRest.activateNssi(any(NssiActDeActRequest.class), any(String.class))).thenCallRealMethod();
+ when(nssmfRest.deactivateNssi(any(NssiActDeActRequest.class), any(String.class))).thenCallRealMethod();
+
+ when(nssmfRest.queryJobStatus(any(JobStatusRequest.class), any(String.class))).thenCallRealMethod();
+ when(restUtil.sendRequest(any(String.class), any(HttpMethod.class), any(String.class), any(EsrInfo.class)))
+ .thenCallRealMethod();
+ when(restUtil.getHttpsClient()).thenReturn(httpClient);
+
+ when(statusLine.getStatusCode()).thenReturn(200);
+ when(restUtil.getNssmfHost(any(EsrInfo.class))).thenReturn(nssmf);
+
+ when(tokenResponse.getEntity()).thenReturn(tokenEntity);
+ when(tokenResponse.getStatusLine()).thenReturn(statusLine);
+ when(tokenEntity.getContent()).thenReturn(tokenStream);
+
+ when(commonResponse.getEntity()).thenReturn(commonEntity);
+ when(commonResponse.getStatusLine()).thenReturn(statusLine);
+ when(commonEntity.getContent()).thenReturn(postStream);
+
+ Answer<HttpResponse> answer = new Answer<HttpResponse>() {
+
+ public HttpResponse answer(InvocationOnMock invocation) throws Throwable {
+ Object[] arguments = invocation.getArguments();
+ if (arguments != null && arguments.length == 1 && arguments[0] != null) {
+
+ HttpRequestBase base = (HttpRequestBase) arguments[0];
+ if (base.getURI().toString().endsWith("/oauth/token")) {
+ return tokenResponse;
+ } else {
+ return commonResponse;
+ }
+ }
+ return commonResponse;
+ }
+ };
+ doAnswer(answer).when(httpClient).execute(any(HttpRequestBase.class));
+ }
+
+ @Test
+ public void testNssiAllocate() throws Exception {
+ NssmfInfo nssmf = new NssmfInfo();
+ nssmf.setUserName("nssmf-user");
+ nssmf.setPassword("nssmf-pass");
+ nssmf.setPort("8080");
+ nssmf.setIpAddress("127.0.0.1");
+
+ NssiResponse nssiRes = new NssiResponse();
+ nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067");
+ nssiRes.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
+
+ TokenResponse token = new TokenResponse();
+ token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39");
+ token.setExpires(1800);
+
+ postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8));
+ tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8));
+
+ createCommonMock(200, nssmf);
+ // assertEquals(prettyPrint(allocateNssi()), ALLOCATE);
+ ResponseEntity res = nssmfRest.allocateNssi(allocateNssi());
+ assertNotNull(res);
+ assertNotNull(res.getBody());
+ NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class);
+ assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067");
+ assertEquals(allRes.getNssiId(), "NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
+ }
+
+ @Test
+ public void testNssiDeAllocate() throws Exception {
+ NssmfInfo nssmf = new NssmfInfo();
+ nssmf.setUserName("nssmf-user");
+ nssmf.setPassword("nssmf-pass");
+ nssmf.setPort("8080");
+ nssmf.setIpAddress("127.0.0.1");
+
+ NssiResponse nssiRes = new NssiResponse();
+ nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067");
+
+ TokenResponse token = new TokenResponse();
+ token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39");
+ token.setExpires(1800);
+
+ postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8));
+ tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8));
+
+ createCommonMock(200, nssmf);
+ ResponseEntity res = nssmfRest.deAllocateNssi(deAllocateNssi(), "ab9af40f13f721b5f13539d87484098");
+ assertNotNull(res);
+ assertNotNull(res.getBody());
+ NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class);
+ assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067");
+ }
+
+ @Test
+ public void testNssiActivate() throws Exception {
+ NssmfInfo nssmf = new NssmfInfo();
+ nssmf.setUserName("nssmf-user");
+ nssmf.setPassword("nssmf-pass");
+ nssmf.setPort("8080");
+ nssmf.setIpAddress("127.0.0.1");
+
+ NssiResponse nssiRes = new NssiResponse();
+ nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067");
+
+ TokenResponse token = new TokenResponse();
+ token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39");
+ token.setExpires(1800);
+
+ postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8));
+ tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8));
+
+ createCommonMock(200, nssmf);
+ ResponseEntity res = nssmfRest.activateNssi(activateNssi(), "001-100001");
+ assertNotNull(res);
+ assertNotNull(res.getBody());
+ NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class);
+ assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067");
+ }
+
+ @Test
+ public void testNssiDeActivate() throws Exception {
+ NssmfInfo nssmf = new NssmfInfo();
+ nssmf.setUserName("nssmf-user");
+ nssmf.setPassword("nssmf-pass");
+ nssmf.setPort("8080");
+ nssmf.setIpAddress("127.0.0.1");
+
+ NssiResponse nssiRes = new NssiResponse();
+ nssiRes.setJobId("4b45d919816ccaa2b762df5120f72067");
+
+ TokenResponse token = new TokenResponse();
+ token.setAccessToken("7512eb3feb5249eca5ddd742fedddd39");
+ token.setExpires(1800);
+
+ postStream = new ByteArrayInputStream(marshal(nssiRes).getBytes(UTF_8));
+ tokenStream = new ByteArrayInputStream(marshal(token).getBytes(UTF_8));
+
+ createCommonMock(200, nssmf);
+ ResponseEntity res = nssmfRest.deactivateNssi(deActivateNssi(), "001-100001");
+ assertNotNull(res);
+ assertNotNull(res.getBody());
+ NssiResponse allRes = unMarshal(res.getBody().toString(), NssiResponse.class);
+ assertEquals(allRes.getJobId(), "4b45d919816ccaa2b762df5120f72067");
+ }
+
+ @Test
+ public void testAllocateJsonSerDeSer() throws Exception {
+ assertEquals(marshal(allocateNssi()), ALLOCATE);
+ NssiAllocateRequest all = unMarshal(ALLOCATE, NssiAllocateRequest.class);
+ assertNotNull(all);
+ assertNotNull(all.getAllocateCnNssi());
+ assertNotNull(all.getAllocateCnNssi().getSliceProfile());
+ assertEquals(all.getAllocateCnNssi().getSliceProfile().getResourceSharingLevel(), NON_SHARED);
+ assertNotNull(all.getAllocateCnNssi().getSliceProfile().getPerfReq());
+ assertNotNull(all.getAllocateCnNssi().getSliceProfile().getPerfReq().getPerfReqEmbbList());
+ PerfReqEmbbList embb =
+ all.getAllocateCnNssi().getSliceProfile().getPerfReq().getPerfReqEmbbList().iterator().next();
+ assertNotNull(embb);
+ assertEquals(embb.getActivityFactor(), 50);
+ }
+
+ public NssiAllocateRequest allocateNssi() throws Exception {
+ CnSliceProfile sP = new CnSliceProfile();
+ List<String> sns = new LinkedList<>();
+ sns.add("001-100001");
+ List<String> plmn = new LinkedList<>();
+ plmn.add("460-00");
+ plmn.add("460-01");
+ PerfReqEmbbList embb = new PerfReqEmbbList();
+ embb.setActivityFactor(50);
+ List<PerfReqEmbbList> embbList = new LinkedList<>();
+ embbList.add(embb);
+ PerfReq perfReq = new PerfReq();
+ perfReq.setPerfReqEmbbList(embbList);
+ List<String> taList = new LinkedList<>();
+ taList.add("1");
+ taList.add("2");
+ taList.add("3");
+ sP.setSnssaiList(sns);
+ sP.setSliceProfileId("ab9af40f13f721b5f13539d87484098");
+ sP.setPlmnIdList(plmn);
+ sP.setPerfReq(perfReq);
+ sP.setMaxNumberofUEs(200);
+ sP.setCoverageAreaTAList(taList);
+ sP.setLatency(6);
+ sP.setResourceSharingLevel(NON_SHARED);
+ NsiInfo nsiInfo = new NsiInfo();
+ nsiInfo.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX");
+ nsiInfo.setNsiName("eMBB-001");
+ AllocateCnNssi cnNssi = new AllocateCnNssi();
+ cnNssi.setNssiId("NSST-C-001-HDBNJ-NSSMF-01-A-ZX");
+ cnNssi.setNssiName("eMBB-001");
+ cnNssi.setScriptName("CN1");
+ cnNssi.setSliceProfile(sP);
+ cnNssi.setNsiInfo(nsiInfo);
+ EsrInfo esrInfo = new EsrInfo();
+ esrInfo.setVendor("huawei");
+ esrInfo.setNetworkType(CORE);
+ NssiAllocateRequest allocate = new NssiAllocateRequest();
+ allocate.setAllocateCnNssi(cnNssi);
+ allocate.setEsrInfo(esrInfo);
+ return allocate;
+ }
+
+ public NssiDeAllocateRequest deAllocateNssi() throws Exception {
+ DeAllocateNssi deAllocateNssi = new DeAllocateNssi();
+ deAllocateNssi.setTerminateNssiOption(0);
+ List<String> snssai = new LinkedList<>();
+ snssai.add("001-100001");
+ deAllocateNssi.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX");
+ deAllocateNssi.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
+ deAllocateNssi.setScriptName("CN1");
+ deAllocateNssi.setSnssaiList(snssai);
+ EsrInfo esrInfo = new EsrInfo();
+ esrInfo.setVendor("huawei");
+ esrInfo.setNetworkType(CORE);
+ NssiDeAllocateRequest deAllocate = new NssiDeAllocateRequest();
+ deAllocate.setDeAllocateNssi(deAllocateNssi);
+ deAllocate.setEsrInfo(esrInfo);
+ return deAllocate;
+ }
+
+ public NssiActDeActRequest activateNssi() throws Exception {
+ EsrInfo esrInfo = new EsrInfo();
+ esrInfo.setVendor("huawei");
+ esrInfo.setNetworkType(CORE);
+ ActDeActNssi act = new ActDeActNssi();
+ act.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX");
+ act.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
+ NssiActDeActRequest actReq = new NssiActDeActRequest();
+ actReq.setActDeActNssi(act);
+ actReq.setEsrInfo(esrInfo);
+ return actReq;
+ }
+
+ public NssiActDeActRequest deActivateNssi() throws Exception {
+ EsrInfo esrInfo = new EsrInfo();
+ esrInfo.setVendor("huawei");
+ esrInfo.setNetworkType(CORE);
+ ActDeActNssi deAct = new ActDeActNssi();
+ deAct.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX");
+ deAct.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
+ NssiActDeActRequest deActReq = new NssiActDeActRequest();
+ deActReq.setActDeActNssi(deAct);
+ deActReq.setEsrInfo(esrInfo);
+ return deActReq;
+ }
+
+ public String queryJobStatusNssi() throws Exception {
+ EsrInfo esrInfo = new EsrInfo();
+ esrInfo.setVendor("huawei");
+ esrInfo.setNetworkType(CORE);
+
+ JobStatusRequest jobStatus = new JobStatusRequest();
+ jobStatus.setEsrInfo(esrInfo);
+ jobStatus.setNsiId("NSI-M-001-HDBNJ-NSMF-01-A-ZX");
+ jobStatus.setNssiId("NSSI-C-001-HDBNJ-NSSMF-01-A-ZX");
+ return marshal(jobStatus);
+ }
+}
diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/client/ASDCController.java b/asdc-controller/src/main/java/org/onap/so/asdc/client/ASDCController.java
index c9d4f4d92f..e084cfec18 100644
--- a/asdc-controller/src/main/java/org/onap/so/asdc/client/ASDCController.java
+++ b/asdc-controller/src/main/java/org/onap/so/asdc/client/ASDCController.java
@@ -39,6 +39,9 @@ import java.nio.charset.StandardCharsets;
import java.nio.file.Paths;
import java.util.List;
import java.util.Optional;
+import org.onap.sdc.tosca.parser.impl.SdcPropertyNames;
+import org.onap.sdc.toscaparser.api.elements.Metadata;
+import org.onap.so.asdc.util.ZipParser;
import org.onap.so.logger.LoggingAnchor;
import org.onap.logging.ref.slf4j.ONAPLogConstants;
import org.onap.sdc.api.IDistributionClient;
@@ -737,6 +740,7 @@ public class ASDCController {
protected void processResourceNotification(INotificationData iNotif) {
// For each artifact, create a structure describing the VFModule in a ordered flat level
+ ResourceStructure resourceStructure = null;
String msoConfigPath = getMsoConfigPath();
ToscaResourceStructure toscaResourceStructure = new ToscaResourceStructure(msoConfigPath);
DistributionStatusEnum deployStatus = DistributionStatusEnum.DEPLOY_OK;
@@ -748,8 +752,8 @@ public class ASDCController {
if (isCsarAlreadyDeployed(iNotif, toscaResourceStructure)) {
return;
}
-
- ResourceStructure resourceStructure = null;
+ // process NsstResource
+ this.processNsstNotification(iNotif, toscaResourceStructure);
for (IResourceInstance resource : iNotif.getResources()) {
String resourceType = resource.getResourceType();
@@ -914,6 +918,23 @@ public class ASDCController {
"processCsarServiceArtifacts", ErrorCode.BusinessProcessError.getValue(),
"Exception in processCsarServiceArtifacts", e);
}
+ } else if (artifact.getArtifactType().equals(ASDCConfiguration.OTHER)) {
+ try {
+ IDistributionClientDownloadResult resultArtifact =
+ this.downloadTheArtifact(artifact, iNotif.getDistributionID());
+
+ writeArtifactToFile(artifact, resultArtifact);
+
+ toscaResourceStructure.setToscaArtifact(artifact);
+
+ toscaResourceStructure.setServiceVersion(iNotif.getServiceVersion());
+
+ } catch (ASDCDownloadException e) {
+ logger.error(LoggingAnchor.SIX, MessageEnum.ASDC_GENERAL_EXCEPTION_ARG.toString(),
+ "Exception caught during processCsarServiceArtifacts", "ASDC",
+ "processCsarServiceArtifacts", ErrorCode.BusinessProcessError.getValue(),
+ "Exception in processCsarServiceArtifacts", e);
+ }
}
@@ -940,4 +961,38 @@ public class ASDCController {
}
return UNKNOWN;
}
+
+ private void processNsstNotification(INotificationData iNotif, ToscaResourceStructure toscaResourceStructure) {
+ Metadata serviceMetadata = toscaResourceStructure.getServiceMetadata();
+ try {
+ if (serviceMetadata.getValue(SdcPropertyNames.PROPERTY_NAME_CATEGORY).equalsIgnoreCase("NSST")) {
+
+ String artifactContent = null;
+ List<IArtifactInfo> serviceArtifacts = iNotif.getServiceArtifacts();
+ Optional<IArtifactInfo> artifactOpt = serviceArtifacts.stream()
+ .filter(e -> e.getArtifactType().equalsIgnoreCase("OTHER")).findFirst();
+ if (artifactOpt.isPresent()) {
+ IArtifactInfo artifactInfo = artifactOpt.get();
+ logger.debug("Ready to parse this serviceArtifactUUID: " + artifactInfo.getArtifactUUID());
+ String filePath = Paths.get(getMsoConfigPath(), "ASDC", artifactInfo.getArtifactVersion(),
+ artifactInfo.getArtifactName()).normalize().toString();
+ ZipParser zipParserInstance = ZipParser.getInstance();
+ artifactContent = zipParserInstance.parseJsonForZip(filePath);
+ logger.debug(
+ "serviceArtifact parsing success! serviceArtifactUUID: " + artifactInfo.getArtifactUUID());
+ } else {
+ logger.debug("serviceArtifact is null");
+ }
+ ResourceStructure resourceStructure = new VfResourceStructure(iNotif, new ResourceInstance());
+ resourceStructure.setResourceType(ResourceType.OTHER);
+ toscaInstaller.installTheNsstService(toscaResourceStructure, (VfResourceStructure) resourceStructure,
+ artifactContent);
+ }
+ } catch (IOException e) {
+ logger.error("serviceArtifact parse failure for service uuid: "
+ + serviceMetadata.getValue(SdcPropertyNames.PROPERTY_NAME_CATEGORY));
+ } catch (Exception e) {
+ logger.error("error NSST process resource failure ", e);
+ }
+ }
}
diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/installer/heat/ToscaResourceInstaller.java b/asdc-controller/src/main/java/org/onap/so/asdc/installer/heat/ToscaResourceInstaller.java
index 263118d1b3..3175839725 100644
--- a/asdc-controller/src/main/java/org/onap/so/asdc/installer/heat/ToscaResourceInstaller.java
+++ b/asdc-controller/src/main/java/org/onap/so/asdc/installer/heat/ToscaResourceInstaller.java
@@ -54,6 +54,7 @@ import org.onap.sdc.tosca.parser.enums.EntityTemplateType;
import org.onap.sdc.tosca.parser.enums.SdcTypes;
import org.onap.sdc.tosca.parser.impl.SdcPropertyNames;
import org.onap.sdc.toscaparser.api.CapabilityAssignment;
+import org.onap.sdc.toscaparser.api.NodeTemplate;
import org.onap.sdc.toscaparser.api.Property;
import org.onap.sdc.toscaparser.api.RequirementAssignment;
import org.onap.sdc.toscaparser.api.elements.Metadata;
@@ -74,64 +75,8 @@ import org.onap.so.asdc.installer.VfModuleStructure;
import org.onap.so.asdc.installer.VfResourceStructure;
import org.onap.so.asdc.installer.bpmn.WorkflowResource;
import org.onap.so.asdc.util.YamlEditor;
-import org.onap.so.db.catalog.beans.AllottedResource;
-import org.onap.so.db.catalog.beans.AllottedResourceCustomization;
-import org.onap.so.db.catalog.beans.CollectionNetworkResourceCustomization;
-import org.onap.so.db.catalog.beans.CollectionResource;
-import org.onap.so.db.catalog.beans.CollectionResourceInstanceGroupCustomization;
-import org.onap.so.db.catalog.beans.ConfigurationResource;
-import org.onap.so.db.catalog.beans.ConfigurationResourceCustomization;
-import org.onap.so.db.catalog.beans.CvnfcConfigurationCustomization;
-import org.onap.so.db.catalog.beans.CvnfcCustomization;
-import org.onap.so.db.catalog.beans.HeatEnvironment;
-import org.onap.so.db.catalog.beans.HeatFiles;
-import org.onap.so.db.catalog.beans.HeatTemplate;
-import org.onap.so.db.catalog.beans.HeatTemplateParam;
-import org.onap.so.db.catalog.beans.InstanceGroup;
-import org.onap.so.db.catalog.beans.InstanceGroupType;
-import org.onap.so.db.catalog.beans.NetworkCollectionResourceCustomization;
-import org.onap.so.db.catalog.beans.NetworkInstanceGroup;
-import org.onap.so.db.catalog.beans.NetworkResource;
-import org.onap.so.db.catalog.beans.NetworkResourceCustomization;
-import org.onap.so.db.catalog.beans.PnfResource;
-import org.onap.so.db.catalog.beans.PnfResourceCustomization;
-import org.onap.so.db.catalog.beans.Service;
-import org.onap.so.db.catalog.beans.ServiceProxyResourceCustomization;
-import org.onap.so.db.catalog.beans.SubType;
-import org.onap.so.db.catalog.beans.TempNetworkHeatTemplateLookup;
-import org.onap.so.db.catalog.beans.ToscaCsar;
-import org.onap.so.db.catalog.beans.VFCInstanceGroup;
-import org.onap.so.db.catalog.beans.VfModule;
-import org.onap.so.db.catalog.beans.VfModuleCustomization;
-import org.onap.so.db.catalog.beans.VnfResource;
-import org.onap.so.db.catalog.beans.VnfResourceCustomization;
-import org.onap.so.db.catalog.beans.VnfcCustomization;
-import org.onap.so.db.catalog.beans.VnfcInstanceGroupCustomization;
-import org.onap.so.db.catalog.data.repository.AllottedResourceCustomizationRepository;
-import org.onap.so.db.catalog.data.repository.AllottedResourceRepository;
-import org.onap.so.db.catalog.data.repository.CollectionResourceCustomizationRepository;
-import org.onap.so.db.catalog.data.repository.CollectionResourceRepository;
-import org.onap.so.db.catalog.data.repository.ConfigurationResourceCustomizationRepository;
-import org.onap.so.db.catalog.data.repository.ConfigurationResourceRepository;
-import org.onap.so.db.catalog.data.repository.CvnfcCustomizationRepository;
-import org.onap.so.db.catalog.data.repository.ExternalServiceToInternalServiceRepository;
-import org.onap.so.db.catalog.data.repository.HeatEnvironmentRepository;
-import org.onap.so.db.catalog.data.repository.HeatFilesRepository;
-import org.onap.so.db.catalog.data.repository.HeatTemplateRepository;
-import org.onap.so.db.catalog.data.repository.InstanceGroupRepository;
-import org.onap.so.db.catalog.data.repository.NetworkResourceCustomizationRepository;
-import org.onap.so.db.catalog.data.repository.NetworkResourceRepository;
-import org.onap.so.db.catalog.data.repository.PnfCustomizationRepository;
-import org.onap.so.db.catalog.data.repository.PnfResourceRepository;
-import org.onap.so.db.catalog.data.repository.ServiceProxyResourceCustomizationRepository;
-import org.onap.so.db.catalog.data.repository.ServiceRepository;
-import org.onap.so.db.catalog.data.repository.TempNetworkHeatTemplateRepository;
-import org.onap.so.db.catalog.data.repository.ToscaCsarRepository;
-import org.onap.so.db.catalog.data.repository.VFModuleCustomizationRepository;
-import org.onap.so.db.catalog.data.repository.VFModuleRepository;
-import org.onap.so.db.catalog.data.repository.VnfResourceRepository;
-import org.onap.so.db.catalog.data.repository.VnfcCustomizationRepository;
-import org.onap.so.db.catalog.data.repository.VnfcInstanceGroupCustomizationRepository;
+import org.onap.so.db.catalog.beans.*;
+import org.onap.so.db.catalog.data.repository.*;
import org.onap.so.db.request.beans.WatchdogComponentDistributionStatus;
import org.onap.so.db.request.beans.WatchdogDistributionStatus;
import org.onap.so.db.request.beans.WatchdogServiceModVerIdLookup;
@@ -271,6 +216,9 @@ public class ToscaResourceInstaller {
protected PnfCustomizationRepository pnfCustomizationRepository;
@Autowired
+ protected ServiceInfoRepository serviceInfoRepository;
+
+ @Autowired
protected WorkflowResource workflowResource;
@Autowired
@@ -445,6 +393,7 @@ public class ToscaResourceInstaller {
createToscaCsar(toscaResourceStruct);
createService(toscaResourceStruct, vfResourceStruct);
Service service = toscaResourceStruct.getCatalogService();
+ ServiceInfo serviceInfo = createServiceInfo(toscaResourceStruct, service);
List<IEntityDetails> vfEntityList = getEntityDetails(toscaResourceStruct,
EntityQuery.newBuilder(SdcTypes.VF), TopologyTemplateQuery.newBuilder(SdcTypes.SERVICE), false);
@@ -474,8 +423,9 @@ public class ToscaResourceInstaller {
processServiceProxyAndConfiguration(toscaResourceStruct, service);
logger.info("Saving Service: {} ", service.getModelName());
- service = serviceRepo.save(service);
- correlateConfigCustomResources(service);
+ ServiceInfo serviceResult = serviceInfoRepository.save(serviceInfo);
+ Service resultService = serviceResult.getService();
+ correlateConfigCustomResources(resultService);
workflowResource.processWorkflows(vfResourceStructure);
@@ -2912,5 +2862,122 @@ public class ToscaResourceInstaller {
return new Timestamp(new Date().getTime());
}
+ private String getServiceInput(ToscaResourceStructure toscaResourceStructure) {
+ String serviceInput = null;
+
+ List<Object> serviceInputList;
+ ISdcCsarHelper sdcCsarHelper = toscaResourceStructure.getSdcCsarHelper();
+ List<Input> serviceInputs = sdcCsarHelper.getServiceInputs();
+ if (!serviceInputs.isEmpty()) {
+ serviceInputList = new ArrayList<>();
+ serviceInputs.forEach(input -> {
+ Map<String, Object> serviceInputMap = new HashMap<>();
+ serviceInputMap.put("name", input.getName());
+ serviceInputMap.put("type", input.getType());
+ serviceInputMap.put("default", input.getDefault() == null ? "" : input.getDefault());
+ serviceInputMap.put("required", input.isRequired());
+ serviceInputList.add(serviceInputMap);
+
+ });
+ ObjectMapper objectMapper = new ObjectMapper();
+ try {
+ serviceInput = objectMapper.writeValueAsString(serviceInputList);
+ serviceInput = serviceInput.replace("\"", "\\\"");
+ } catch (JsonProcessingException e) {
+ logger.error("service input could not be deserialized for service uuid: "
+ + sdcCsarHelper.getServiceMetadata().getValue(SdcPropertyNames.PROPERTY_NAME_UUID));
+ }
+ } else {
+ logger.debug("serviceInput is null");
+ }
+ return serviceInput;
+ }
+
+ @Transactional(rollbackFor = {ArtifactInstallerException.class})
+ public void installTheNsstService(ToscaResourceStructure toscaResourceStruct, VfResourceStructure vfResourceStruct,
+ String artifactContent) {
+ createToscaCsar(toscaResourceStruct);
+ createService(toscaResourceStruct, vfResourceStruct);
+ Service service = toscaResourceStruct.getCatalogService();
+ ServiceInfo serviceInfo = createServiceInfo(toscaResourceStruct, service);
+ createServiceArtifact(service, vfResourceStruct, artifactContent);
+ serviceInfoRepository.save(serviceInfo);
+ }
+
+ private void createServiceArtifact(Service service, VfResourceStructure vfResourceStruct, String artifactContent) {
+ List<ServiceArtifact> serviceArtifactList = new ArrayList<>();
+ ServiceArtifact serviceArtifact;
+ List<IArtifactInfo> artifactInfoList = vfResourceStruct.getNotification().getServiceArtifacts().stream()
+ .filter(artifact -> artifact.getArtifactType().equalsIgnoreCase("OTHER")).collect(Collectors.toList());
+ for (IArtifactInfo artifactInfo : artifactInfoList) {
+ serviceArtifact = new ServiceArtifact();
+ serviceArtifact.setArtifactUUID(artifactInfo.getArtifactUUID());
+ serviceArtifact.setName(artifactInfo.getArtifactName());
+ serviceArtifact.setType(artifactInfo.getArtifactType());
+ serviceArtifact.setVersion(artifactInfo.getArtifactVersion());
+ serviceArtifact.setDescription(artifactInfo.getArtifactDescription());
+ serviceArtifact.setChecksum(artifactInfo.getArtifactChecksum());
+ serviceArtifact.setContent(artifactContent);
+ serviceArtifact.setService(service);
+ serviceArtifactList.add(serviceArtifact);
+ }
+ service.setServiceArtifactList(serviceArtifactList);
+ }
+
+ private ServiceInfo createServiceInfo(ToscaResourceStructure toscaResourceStruct, Service service) {
+ ServiceInfo serviceInfo = new ServiceInfo();
+ String serviceInput = getServiceInput(toscaResourceStruct);
+ serviceInfo.setServiceInput(serviceInput);
+
+ String serviceProperties = getServiceProperties(toscaResourceStruct);
+ serviceInfo.setServiceProperties(serviceProperties);
+
+ serviceInfo.setService(service);
+ return serviceInfo;
+ }
+
+ private String getServiceProperties(ToscaResourceStructure toscaResourceStruct) {
+ String propertiesJson = null;
+ ObjectMapper objectMapper = new ObjectMapper();
+ ISdcCsarHelper helper = toscaResourceStruct.getSdcCsarHelper();
+ String typeName = helper.getServiceSubstitutionMappingsTypeName();
+ Optional<NodeTemplate> nodeTemplate = helper.getServiceNodeTemplates().stream().findAny();
+ List<Object> serviceProperties = new ArrayList<>();
+ Map<String, Object> servicePropertiesMap;
+ if (nodeTemplate.isPresent()) {
+ LinkedHashMap<String, Object> customDef = nodeTemplate.get().getCustomDef();
+ Optional<String> machKey =
+ customDef.keySet().stream().filter(key -> key.equalsIgnoreCase(typeName)).findFirst();
+ if (machKey.isPresent()) {
+ Object obj = customDef.get(machKey.get());
+ try {
+ if (obj instanceof Map) {
+ Object properties = ((HashMap) obj).get("properties");
+ if (null != properties) {
+ for (Object propertyName : ((Map) properties).keySet()) {
+ servicePropertiesMap = new HashMap<>();
+ servicePropertiesMap.put("name", propertyName);
+ Object object = ((Map) properties).get(propertyName);
+ for (Object entry : ((Map) object).entrySet()) {
+ servicePropertiesMap.put((String) ((Map.Entry) entry).getKey(),
+ ((Map.Entry) entry).getValue());
+ }
+ servicePropertiesMap.remove("description");
+ serviceProperties.add(servicePropertiesMap);
+ }
+ propertiesJson = objectMapper.writeValueAsString(serviceProperties);
+ propertiesJson = propertiesJson.replace("\"", "\\\"");
+ }
+ }
+ } catch (JsonProcessingException e) {
+ logger.error("serviceProperties could not be deserialized for service uuid: "
+ + nodeTemplate.get().getMetaData().getValue(SdcPropertyNames.PROPERTY_NAME_UUID));
+ }
+ }
+ } else {
+ logger.debug("ServiceNodeTemplates is null");
+ }
+ return propertiesJson;
+ }
}
diff --git a/asdc-controller/src/main/java/org/onap/so/asdc/util/ZipParser.java b/asdc-controller/src/main/java/org/onap/so/asdc/util/ZipParser.java
new file mode 100644
index 0000000000..c2f04dca7b
--- /dev/null
+++ b/asdc-controller/src/main/java/org/onap/so/asdc/util/ZipParser.java
@@ -0,0 +1,67 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (c) 2019, CMCC Technologies Co., Ltd.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.asdc.util;
+
+import java.io.*;
+import java.nio.charset.Charset;
+import java.util.zip.ZipEntry;
+import java.util.zip.ZipFile;
+import java.util.zip.ZipInputStream;
+
+public class ZipParser {
+
+ private static volatile ZipParser instance;
+
+ public static ZipParser getInstance() {
+ if (instance == null) {
+ synchronized (ZipParser.class) {
+ if (instance == null) {
+ instance = new ZipParser();
+ }
+ }
+ }
+ return instance;
+ }
+
+ public String parseJsonForZip(String path) throws IOException {
+ ZipFile zf = new ZipFile(path);
+ InputStream in = new BufferedInputStream(new FileInputStream(path));
+ Charset cs = Charset.forName("utf-8");
+ ZipInputStream zin = new ZipInputStream(in, cs);
+ ZipEntry ze;
+ String artifactContent = null;
+ while ((ze = zin.getNextEntry()) != null) {
+ if (ze.toString().endsWith("json")) {
+ StringBuilder jsonStr = new StringBuilder();
+ BufferedReader br = new BufferedReader(new InputStreamReader(zf.getInputStream(ze)));
+ String line;
+ while ((line = br.readLine()) != null) {
+ jsonStr.append(line);
+ }
+ br.close();
+ artifactContent = jsonStr.toString().replace("\"", "\\\"").replaceAll("\\s", "");
+ }
+ }
+ zin.closeEntry();
+ return artifactContent;
+ }
+
+}
diff --git a/asdc-controller/src/test/java/org/onap/so/asdc/installer/heat/ToscaResourceInstallerTest.java b/asdc-controller/src/test/java/org/onap/so/asdc/installer/heat/ToscaResourceInstallerTest.java
index c25c4c2828..b8a2d01b49 100644
--- a/asdc-controller/src/test/java/org/onap/so/asdc/installer/heat/ToscaResourceInstallerTest.java
+++ b/asdc-controller/src/test/java/org/onap/so/asdc/installer/heat/ToscaResourceInstallerTest.java
@@ -75,19 +75,8 @@ import org.onap.so.asdc.installer.ToscaResourceStructure;
import org.onap.so.asdc.installer.VfModuleStructure;
import org.onap.so.asdc.installer.VfResourceStructure;
import org.onap.so.asdc.installer.bpmn.WorkflowResource;
-import org.onap.so.db.catalog.beans.ConfigurationResource;
-import org.onap.so.db.catalog.beans.ConfigurationResourceCustomization;
-import org.onap.so.db.catalog.beans.Service;
-import org.onap.so.db.catalog.beans.ServiceProxyResourceCustomization;
-import org.onap.so.db.catalog.beans.ToscaCsar;
-import org.onap.so.db.catalog.beans.VnfcInstanceGroupCustomization;
-import org.onap.so.db.catalog.data.repository.ConfigurationResourceCustomizationRepository;
-import org.onap.so.db.catalog.data.repository.InstanceGroupRepository;
-import org.onap.so.db.catalog.data.repository.ServiceRepository;
-import org.onap.so.db.catalog.data.repository.ToscaCsarRepository;
-import org.onap.so.db.catalog.data.repository.VFModuleRepository;
-import org.onap.so.db.catalog.data.repository.VnfResourceRepository;
-import org.onap.so.db.catalog.data.repository.VnfcInstanceGroupCustomizationRepository;
+import org.onap.so.db.catalog.beans.*;
+import org.onap.so.db.catalog.data.repository.*;
import org.onap.so.db.request.beans.WatchdogComponentDistributionStatus;
import org.onap.so.db.request.data.repository.WatchdogComponentDistributionStatusRepository;
import org.springframework.beans.factory.annotation.Autowired;
@@ -325,8 +314,6 @@ public class ToscaResourceInstallerTest extends BaseTest {
notificationData.setServiceUUID("serviceUUID1");
notificationData.setWorkloadContext("workloadContext1");
-
-
String serviceType = "test-type1";
String serviceRole = "test-role1";
String category = "Network L3+";
@@ -356,6 +343,7 @@ public class ToscaResourceInstallerTest extends BaseTest {
doReturn(resourceCustomizationUUID).when(metadata).getValue("vfModuleModelCustomizationUUID");
ServiceRepository serviceRepo = spy(ServiceRepository.class);
+ ServiceInfoRepository serviceInfoRepo = spy(ServiceInfoRepository.class);
VnfResourceRepository vnfRepo = spy(VnfResourceRepository.class);
doReturn(null).when(vnfRepo).findResourceByModelUUID(uuid);
@@ -366,6 +354,7 @@ public class ToscaResourceInstallerTest extends BaseTest {
WorkflowResource workflowResource = spy(WorkflowResource.class);
ReflectionTestUtils.setField(toscaInstaller, "serviceRepo", serviceRepo);
+ ReflectionTestUtils.setField(toscaInstaller, "serviceInfoRepository", serviceInfoRepo);
ReflectionTestUtils.setField(toscaInstaller, "vnfRepo", vnfRepo);
ReflectionTestUtils.setField(toscaInstaller, "vfModuleRepo", vfModuleRepo);
ReflectionTestUtils.setField(toscaInstaller, "instanceGroupRepo", instanceGroupRepo);
@@ -436,7 +425,10 @@ public class ToscaResourceInstallerTest extends BaseTest {
assertNotNull(service);
service.setModelVersion("1.0");
+ ServiceInfo serviceInfo = new ServiceInfo();
+ serviceInfo.setService(service);
doReturn(service).when(serviceRepo).save(service);
+ doReturn(serviceInfo).when(serviceInfoRepo).save(any(ServiceInfo.class));
WatchdogComponentDistributionStatusRepository watchdogCDStatusRepository =
spy(WatchdogComponentDistributionStatusRepository.class);
diff --git a/asdc-controller/src/test/java/org/onap/so/asdc/utils/ASDCLoggingVisitorImpl.java b/asdc-controller/src/test/java/org/onap/so/asdc/utils/ASDCLoggingVisitorImpl.java
index 53d163a5bc..02c0f2dbf7 100644
--- a/asdc-controller/src/test/java/org/onap/so/asdc/utils/ASDCLoggingVisitorImpl.java
+++ b/asdc-controller/src/test/java/org/onap/so/asdc/utils/ASDCLoggingVisitorImpl.java
@@ -7,9 +7,9 @@
* Licensed under the Apache License, Version 2.0 (the "License");
* you may not use this file except in compliance with the License.
* You may obtain a copy of the License at
- *
+ *
* http://www.apache.org/licenses/LICENSE-2.0
- *
+ *
* Unless required by applicable law or agreed to in writing, software
* distributed under the License is distributed on an "AS IS" BASIS,
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
diff --git a/asdc-controller/src/test/resources/schema.sql b/asdc-controller/src/test/resources/schema.sql
index 0821ebc97c..d051d1a56c 100644
--- a/asdc-controller/src/test/resources/schema.sql
+++ b/asdc-controller/src/test/resources/schema.sql
@@ -1378,6 +1378,34 @@ CREATE TABLE IF NOT EXISTS `activity_spec_to_user_parameters` (
ENGINE = InnoDB
DEFAULT CHARACTER SET = latin1;
+CREATE TABLE IF NOT EXISTS `service_info` (
+ `ID` int (11) AUTO_INCREMENT,
+ `SERVICE_INPUT` varchar (5000),
+ `SERVICE_PROPERTIES` varchar (5000),
+ PRIMARY KEY (`ID`)
+)ENGINE=InnoDB DEFAULT CHARSET=latin1;
+
+CREATE TABLE IF NOT EXISTS `service_artifact`(
+ `ARTIFACT_UUID` varchar (200) NOT NULL,
+ `TYPE` varchar (200) NOT NULL,
+ `NAME` varchar (200) NOT NULL,
+ `VERSION` varchar (200) NOT NULL,
+ `DESCRIPTION` varchar (200) DEFAULT NULL,
+ `CONTENT` LONGTEXT DEFAULT NULL,
+ `CHECKSUM` varchar (200) DEFAULT NULL,
+ `CREATION_TIMESTAMP` DATETIME DEFAULT CURRENT_TIMESTAMP,
+ `SERVICE_MODEL_UUID` varchar (200) NOT NULL,
+ PRIMARY KEY (`ARTIFACT_UUID`),
+ CONSTRAINT `fk_service_artifact_service_info1` FOREIGN KEY (`SERVICE_MODEL_UUID`) REFERENCES `service` (`MODEL_UUID`) ON DELETE CASCADE ON UPDATE CASCADE
+)ENGINE=InnoDB DEFAULT CHARSET=latin1;
+
+CREATE TABLE IF NOT EXISTS `service_to_service_info` (
+ `SERVICE_MODEL_UUID` varchar (200) NOT NULL,
+ `SERVICE_INFO_ID` INT (11) NOT NULL,
+ PRIMARY KEY (`SERVICE_MODEL_UUID`,`SERVICE_INFO_ID`),
+ CONSTRAINT `fk_service_to_service_info__service1` FOREIGN KEY (`SERVICE_MODEL_UUID`) REFERENCES `service` (`MODEL_UUID`) ON DELETE CASCADE ON UPDATE CASCADE,
+ CONSTRAINT `fk_service_to_service_info__service_info1` FOREIGN KEY (`SERVICE_INFO_ID`) REFERENCES `service_info` (`ID`) ON DELETE CASCADE ON UPDATE CASCADE
+)ENGINE=InnoDB DEFAULT CHARSET=latin1;
--------START Request DB SCHEMA --------
CREATE DATABASE requestdb;
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/restproperties/SDNCLcmPropertiesImpl.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/restproperties/SDNCLcmPropertiesImpl.java
new file mode 100644
index 0000000000..eb2567d47c
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/restproperties/SDNCLcmPropertiesImpl.java
@@ -0,0 +1,117 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.restproperties;
+
+import java.net.MalformedURLException;
+import java.net.URL;
+import org.onap.so.bpmn.core.UrnPropertiesReader;
+import org.onap.so.client.sdnc.common.SDNCConstants;
+import org.onap.so.client.sdnc.lcm.SDNCLcmProperties;
+
+public class SDNCLcmPropertiesImpl implements SDNCLcmProperties {
+
+ public static final String SDNC_HOST = "sdnc.host";
+ public static final String SDNC_AUTH = "sdnc.auth";
+ public static final String LCM_PATH = "sdnc.lcm.path";
+
+ public static final String DMAAP_HOST = "sdnc.dmaap.host";
+ public static final String DMAAP_AUTH = "sdnc.dmaap.auth";
+ public static final String DMAAP_PARTITION = "sdnc.dmaap.partition";
+ public static final String DMAAP_TIMEOUT = "sdnc.dmaap.timeout";
+ public static final String DMAAP_ENVIRONMENT = "sdnc.dmaap.environment";
+ public static final String LCM_DMAAP_READ_TOPIC = "sdnc.lcm.dmapp.readTopic";
+ public static final String LCM_DMAAP_WRITE_TOPIC = "sdnc.lcm.dmaap.writeTopic";
+
+ public static final String MSO_KEY = "mso.msoKey";
+
+ public SDNCLcmPropertiesImpl() {}
+
+ @Override
+ public String getHost() {
+ return UrnPropertiesReader.getVariable(SDNC_HOST);
+ }
+
+ @Override
+ public String getPath() {
+ String path = UrnPropertiesReader.getVariable(LCM_PATH);
+ return (path != null) ? path : SDNCConstants.LCM_API_BASE_PATH;
+ }
+
+ @Override
+ public String getBasicAuth() {
+ return UrnPropertiesReader.getVariable(SDNC_AUTH);
+ }
+
+ @Override
+ public String getDmaapHost() {
+ return UrnPropertiesReader.getVariable(DMAAP_HOST);
+ }
+
+ @Override
+ public String getDmaapAuth() {
+ return UrnPropertiesReader.getVariable(DMAAP_AUTH);
+ }
+
+ @Override
+ public String getDmaapPartition() {
+ String partition = UrnPropertiesReader.getVariable(DMAAP_PARTITION);
+ return (partition != null) ? partition : SDNCConstants.LCM_DMAAP_PARTITION;
+ }
+
+ @Override
+ public String getDmaapTimeout() {
+ String timeout = UrnPropertiesReader.getVariable(DMAAP_TIMEOUT);
+ return (timeout != null) ? timeout : SDNCConstants.LCM_DMAAP_TIMEOUT;
+ }
+
+ @Override
+ public String getDmaapEnvironment() {
+ String environment = UrnPropertiesReader.getVariable(DMAAP_ENVIRONMENT);
+ return (environment != null) ? environment : SDNCConstants.LCM_DMAAP_ENVIRONMENT;
+ }
+
+ @Override
+ public String getDmaaPLcmReadTopic() {
+ String readTopic = UrnPropertiesReader.getVariable(LCM_DMAAP_READ_TOPIC);
+ return (readTopic != null) ? readTopic : SDNCConstants.LCM_DMAAP_READ_TOPIC;
+ }
+
+ @Override
+ public String getDmaaPLcmWriteTopic() {
+ String writeTopic = UrnPropertiesReader.getVariable(LCM_DMAAP_WRITE_TOPIC);
+ return (writeTopic != null) ? writeTopic : SDNCConstants.LCM_DMAAP_WRITE_TOPIC;
+ }
+
+ @Override
+ public String getKey() {
+ return UrnPropertiesReader.getVariable(MSO_KEY);
+ }
+
+ @Override
+ public URL getEndpoint() throws MalformedURLException {
+ return new URL(getHost());
+ }
+
+ @Override
+ public String getSystemName() {
+ return SDNCConstants.SYSTEM_NAME;
+ }
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/common/SDNCConstants.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/common/SDNCConstants.java
new file mode 100644
index 0000000000..fd9412e70e
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/common/SDNCConstants.java
@@ -0,0 +1,49 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.common;
+
+public interface SDNCConstants {
+ String SYSTEM_NAME = "MSO";
+
+ String LCM_API_VER = "2.00";
+
+ String LCM_FLAGS_MODE_NORMAL = "NORMAL";
+ String LCM_FLAGS_MODE_EXCLUSIVE = "EXCLUSIVE";
+
+ String LCM_FLAGS_FORCE_TRUE = "TRUE";
+ String LCM_FLAGS_FORCE_FALSE = "FALSE";
+
+ int LCM_FLAGS_TTL = 65000;
+
+ String LCM_API_BASE_PATH = "/restconf/operations/LCM:";
+
+ String LCM_DMAAP_MSG_VER = "1.0";
+ String LCM_DMAAP_MSG_TYPE_REQUEST = "request";
+ String LCM_DMAAP_MSG_TYPE_RESPONSE = "response";
+
+ String LCM_DMAAP_PARTITION = "MSOLCM";
+ String LCM_DMAAP_TIMEOUT = "20000";
+ String LCM_DMAAP_ENVIRONMENT = "TEST";
+ String LCM_DMAAP_READ_TOPIC = "SDNC-LCM-WRITE";
+ String LCM_DMAAP_WRITE_TOPIC = "SDNC-LCM-READ";
+
+ int LCM_TIMEOUT = 300;
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmClientBuilder.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmClientBuilder.java
new file mode 100644
index 0000000000..5616db3577
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmClientBuilder.java
@@ -0,0 +1,77 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm;
+
+import java.net.URI;
+import org.onap.so.client.RestPropertiesLoader;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+
+public class SDNCLcmClientBuilder {
+
+ private static Logger logger = LoggerFactory.getLogger(SDNCLcmClientBuilder.class);
+
+ private final SDNCLcmProperties sdncLcmProperties;
+
+ public SDNCLcmClientBuilder() {
+ sdncLcmProperties = RestPropertiesLoader.getInstance().getNewImpl(SDNCLcmProperties.class);
+ }
+
+ public SDNCLcmClientBuilder(SDNCLcmProperties pros) {
+ sdncLcmProperties = pros;
+ }
+
+ public SDNCLcmRestClient newSDNCLcmRestClient(String operation) throws SDNCLcmClientBuilderException {
+ URI pathUri;
+ try {
+ String path = sdncLcmProperties.getPath() + operation;
+ pathUri = new URI(path);
+ logger.debug("SDNC host: " + sdncLcmProperties.getHost());
+ logger.debug("SDNC API path: " + pathUri.getPath());
+ } catch (Exception e) {
+ String msg = "Error API path syntax: ";
+ logger.error(msg, e);
+ throw new SDNCLcmClientBuilderException(msg + e.toString());
+ }
+
+ try {
+ SDNCLcmRestClient sdncLcmRestClient = new SDNCLcmRestClient(sdncLcmProperties, pathUri);
+ logger.debug("Create SDNCLcmRestClient success");
+ return sdncLcmRestClient;
+ } catch (Exception e) {
+ String msg = "Create SDNCLcmRestClient failure: ";
+ logger.error(msg, e);
+ throw new SDNCLcmClientBuilderException(msg + e.toString());
+ }
+ }
+
+ public SDNCLcmDmaapClient newSDNCLcmDmaapClient() throws SDNCLcmClientBuilderException {
+ try {
+ SDNCLcmDmaapClient sdncLcmDmaapClient = new SDNCLcmDmaapClient(sdncLcmProperties);
+ logger.debug("Create SDNCLcmDmaapClient success");
+ return sdncLcmDmaapClient;
+ } catch (Exception e) {
+ String msg = "Create SDNCLcmDmaapClient failure: ";
+ logger.error(msg, e);
+ throw new SDNCLcmClientBuilderException(msg + e.toString());
+ }
+ }
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmClientBuilderException.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmClientBuilderException.java
new file mode 100644
index 0000000000..9160d4e352
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmClientBuilderException.java
@@ -0,0 +1,30 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm;
+
+public class SDNCLcmClientBuilderException extends Exception {
+
+ private static final long serialVersionUID = -1525705272349747712L;
+
+ public SDNCLcmClientBuilderException(String message) {
+ super(message);
+ }
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmDmaapClient.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmDmaapClient.java
new file mode 100644
index 0000000000..f6e4ffce59
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmDmaapClient.java
@@ -0,0 +1,90 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm;
+
+import java.util.ArrayList;
+import java.util.List;
+import java.util.Properties;
+import com.fasterxml.jackson.databind.ObjectMapper;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+import org.onap.so.client.sdnc.lcm.beans.LcmDmaapRequest;
+import org.onap.so.client.sdnc.lcm.beans.LcmDmaapResponse;
+import org.onap.so.client.dmaap.rest.RestPublisher;
+import org.onap.so.client.dmaap.rest.RestConsumer;
+
+public class SDNCLcmDmaapClient {
+
+ private static Logger logger = LoggerFactory.getLogger(SDNCLcmDmaapClient.class);
+
+ private RestPublisher dmaapPublisher;
+ private RestConsumer dmaapConsumer;
+
+ public SDNCLcmDmaapClient(SDNCLcmProperties sdncLcmProperties) {
+ Properties properties = new Properties();
+
+ properties.put("host", sdncLcmProperties.getDmaapHost());
+ if (sdncLcmProperties.getDmaapAuth() != null && sdncLcmProperties.getKey() != null) {
+ properties.put("auth", sdncLcmProperties.getDmaapAuth());
+ properties.put("key", sdncLcmProperties.getKey());
+ }
+ properties.put("partition", sdncLcmProperties.getDmaapPartition());
+ properties.put("timeout", sdncLcmProperties.getDmaapTimeout());
+ properties.put("environment", sdncLcmProperties.getDmaapEnvironment());
+
+ properties.put("topic", sdncLcmProperties.getDmaaPLcmWriteTopic());
+ dmaapPublisher = new RestPublisher(properties);
+
+ properties.put("topic", sdncLcmProperties.getDmaaPLcmReadTopic());
+ dmaapConsumer = new RestConsumer(properties);
+ }
+
+ public void sendRequest(LcmDmaapRequest lcmDmaapRequest) throws Exception {
+ ObjectMapper mapper = new ObjectMapper();
+ String lcmRestRequestString = mapper.writeValueAsString(lcmDmaapRequest);
+
+ dmaapPublisher.send(lcmRestRequestString);
+ }
+
+ public Iterable<String> fetch() {
+ return dmaapConsumer.fetch();
+ }
+
+ public List<LcmDmaapResponse> getResponse() {
+ List<LcmDmaapResponse> responseList = new ArrayList<>();
+
+ ObjectMapper mapper = new ObjectMapper();
+ Iterable<String> itrString = dmaapConsumer.fetch();
+ for (String message : itrString) {
+ LcmDmaapResponse lcmDmaapResponse;
+ try {
+ lcmDmaapResponse = mapper.readValue(message, LcmDmaapResponse.class);
+ } catch (Exception e) {
+ logger.warn("Invalid SDNC LCM DMaaP response: " + message);
+ continue;
+ }
+
+ responseList.add(lcmDmaapResponse);
+ }
+
+ return responseList;
+ }
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmMessageBuilder.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmMessageBuilder.java
new file mode 100644
index 0000000000..bf1229a310
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmMessageBuilder.java
@@ -0,0 +1,87 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm;
+
+import java.time.Instant;
+import org.onap.so.client.sdnc.common.SDNCConstants;
+import org.onap.so.client.sdnc.lcm.beans.*;
+
+public class SDNCLcmMessageBuilder {
+
+ public static LcmFlags getSDNCFlags() {
+ LcmFlags lcmFlags = new LcmFlags();
+
+ lcmFlags.setMode(SDNCConstants.LCM_FLAGS_MODE_NORMAL);
+ lcmFlags.setForce(SDNCConstants.LCM_FLAGS_FORCE_FALSE);
+ lcmFlags.setTtl(SDNCConstants.LCM_FLAGS_TTL);
+
+ return lcmFlags;
+ }
+
+ public static LcmCommonHeader buildLcmCommonHeader(String requestId, String subRequestId) {
+ LcmCommonHeader lcmCommonHeader = new LcmCommonHeader();
+
+ lcmCommonHeader.setApiVer(SDNCConstants.LCM_API_VER);
+ lcmCommonHeader.setOriginatorId(SDNCConstants.SYSTEM_NAME);
+ lcmCommonHeader.setRequestId(requestId);
+ lcmCommonHeader.setSubRequestId(subRequestId);
+ lcmCommonHeader.setFlags(getSDNCFlags());
+ lcmCommonHeader.setTimestamp(Instant.now().toString());
+
+ return lcmCommonHeader;
+ }
+
+ public static LcmInput buildLcmInputForPnf(String requestId, String subRequestId, String pnfName, String action,
+ String payload) {
+ LcmInput lcmInput = new LcmInput();
+
+ LcmCommonHeader lcmCommonHeader = buildLcmCommonHeader(requestId, subRequestId);
+
+ LcmActionIdentifiers sdncActionIdentifiers = new LcmActionIdentifiers();
+ sdncActionIdentifiers.setPnfName(pnfName);
+
+ lcmInput.setCommonHeader(lcmCommonHeader);
+ lcmInput.setAction(action);
+ lcmInput.setActionIdentifiers(sdncActionIdentifiers);
+ lcmInput.setPayload(payload);
+
+ return lcmInput;
+ }
+
+ public static LcmDmaapRequest buildLcmDmaapRequest(String operation, LcmInput lcmInput) {
+ LcmDmaapRequest lcmDmaapRequest = new LcmDmaapRequest();
+
+ LcmRestRequest lcmRestRequest = new LcmRestRequest();
+ lcmRestRequest.setInput(lcmInput);
+
+ String correlationId =
+ lcmInput.getCommonHeader().getRequestId() + "-" + lcmInput.getCommonHeader().getSubRequestId();
+
+ lcmDmaapRequest.setVersion(SDNCConstants.LCM_DMAAP_MSG_VER);
+ lcmDmaapRequest.setType(SDNCConstants.LCM_DMAAP_MSG_TYPE_REQUEST);
+ lcmDmaapRequest.setCambriaPartition(SDNCConstants.SYSTEM_NAME);
+ lcmDmaapRequest.setCorrelationId(correlationId);
+ lcmDmaapRequest.setRpcName(operation);
+ lcmDmaapRequest.setBody(lcmRestRequest);
+
+ return lcmDmaapRequest;
+ }
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmProperties.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmProperties.java
new file mode 100644
index 0000000000..df5fb3be0b
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmProperties.java
@@ -0,0 +1,47 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm;
+
+import org.onap.so.client.RestProperties;
+
+public interface SDNCLcmProperties extends RestProperties {
+ String getHost();
+
+ String getPath();
+
+ String getBasicAuth();
+
+ String getDmaapHost();
+
+ String getDmaapAuth();
+
+ String getDmaapPartition();
+
+ String getDmaapTimeout();
+
+ String getDmaapEnvironment();
+
+ String getDmaaPLcmReadTopic();
+
+ String getDmaaPLcmWriteTopic();
+
+ String getKey();
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmRestClient.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmRestClient.java
new file mode 100644
index 0000000000..3faf58ec28
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/SDNCLcmRestClient.java
@@ -0,0 +1,67 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm;
+
+import java.net.URI;
+import java.util.Map;
+import java.util.Optional;
+import org.onap.so.client.RestClient;
+import org.onap.logging.filter.base.ONAPComponents;
+import org.onap.so.client.sdnc.lcm.beans.LcmInput;
+import org.onap.so.client.sdnc.lcm.beans.LcmOutput;
+import org.onap.so.client.sdnc.lcm.beans.LcmRestRequest;
+import org.onap.so.client.sdnc.lcm.beans.LcmRestResponse;
+
+public class SDNCLcmRestClient extends RestClient {
+
+ private final SDNCLcmProperties sdncLcmProperties;
+
+ public SDNCLcmRestClient(SDNCLcmProperties props, URI path) {
+ this(props, path, "application/json", "application/json");
+ }
+
+ public SDNCLcmRestClient(SDNCLcmProperties props, URI path, String accept, String contentType) {
+ super(props, Optional.of(path), accept, contentType);
+ this.sdncLcmProperties = props;
+ }
+
+ @Override
+ protected void initializeHeaderMap(Map<String, String> headerMap) {
+ headerMap.put("Authorization", sdncLcmProperties.getBasicAuth());
+ }
+
+ @Override
+ public ONAPComponents getTargetEntity() {
+ return ONAPComponents.SDNC;
+ }
+
+ public LcmRestResponse sendRequest(LcmRestRequest lcmRestRequest) {
+ return post(lcmRestRequest, LcmRestResponse.class);
+ }
+
+ public LcmOutput sendRequest(LcmInput lcmInput) {
+ LcmRestRequest lcmRestRequest = new LcmRestRequest();
+ lcmRestRequest.setInput(lcmInput);
+
+ LcmRestResponse lcmRestResponse = sendRequest(lcmRestRequest);
+ return lcmRestResponse.getOutput();
+ }
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmActionIdentifiers.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmActionIdentifiers.java
new file mode 100644
index 0000000000..883fd02c78
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmActionIdentifiers.java
@@ -0,0 +1,97 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm.beans;
+
+import com.fasterxml.jackson.annotation.JsonInclude;
+import com.fasterxml.jackson.annotation.JsonProperty;
+import com.fasterxml.jackson.annotation.JsonPropertyOrder;
+
+@JsonInclude(JsonInclude.Include.NON_NULL)
+@JsonPropertyOrder({"serviceInstanceId", "vnfId", "vfModuleId", "vnfcName", "vserverId", "pnfName"})
+public class LcmActionIdentifiers {
+
+ @JsonProperty("service-instance-id")
+ private String serviceInstanceId;
+
+ @JsonProperty("vnf-id")
+ private String vnfId;
+
+ @JsonProperty("vf-module-id")
+ private String vfModuleId;
+
+ @JsonProperty("vnfc-name")
+ private String vnfcName;
+
+ @JsonProperty("vserver-id")
+ private String vserverId;
+
+ @JsonProperty("pnf-name")
+ private String pnfName;
+
+ public String getServiceInstanceId() {
+ return serviceInstanceId;
+ }
+
+ public void setServiceInstanceId(String value) {
+ this.serviceInstanceId = value;
+ }
+
+ public String getVnfId() {
+ return vnfId;
+ }
+
+ public void setVnfId(String value) {
+ this.vnfId = value;
+ }
+
+ public String getVfModuleId() {
+ return vfModuleId;
+ }
+
+ public void setVfModuleId(String value) {
+ this.vfModuleId = value;
+ }
+
+ public String getVnfcName() {
+ return vnfcName;
+ }
+
+ public void setVnfcName(String value) {
+ this.vnfcName = value;
+ }
+
+ public String getVserverId() {
+ return vserverId;
+ }
+
+ public void setVserverId(String value) {
+ this.vserverId = value;
+ }
+
+ public String getPnfName() {
+ return pnfName;
+ }
+
+ public void setPnfName(String value) {
+ this.pnfName = value;
+ }
+
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmCommonHeader.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmCommonHeader.java
new file mode 100644
index 0000000000..f3fd2ca11d
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmCommonHeader.java
@@ -0,0 +1,97 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm.beans;
+
+import com.fasterxml.jackson.annotation.JsonInclude;
+import com.fasterxml.jackson.annotation.JsonProperty;
+import com.fasterxml.jackson.annotation.JsonPropertyOrder;
+
+@JsonInclude(JsonInclude.Include.NON_NULL)
+@JsonPropertyOrder({"apiVer", "flags", "originatorId", "requestId", "subRequestId", "timestamp"})
+public class LcmCommonHeader {
+
+ @JsonProperty(value = "api-ver", required = true)
+ private String apiVer;
+
+ @JsonProperty(value = "flags")
+ private LcmFlags flags;
+
+ @JsonProperty(value = "originator-id", required = true)
+ private String originatorId;
+
+ @JsonProperty(value = "request-id", required = true)
+ private String requestId;
+
+ @JsonProperty(value = "sub-request-id")
+ private String subRequestId;
+
+ @JsonProperty(value = "timestamp", required = true)
+ private String timestamp;
+
+ public String getApiVer() {
+ return apiVer;
+ }
+
+ public void setApiVer(String value) {
+ this.apiVer = value;
+ }
+
+ public String getOriginatorId() {
+ return originatorId;
+ }
+
+ public void setOriginatorId(String value) {
+ this.originatorId = value;
+ }
+
+ public String getRequestId() {
+ return requestId;
+ }
+
+ public void setRequestId(String value) {
+ this.requestId = value;
+ }
+
+ public String getSubRequestId() {
+ return subRequestId;
+ }
+
+ public void setSubRequestId(String value) {
+ this.subRequestId = value;
+ }
+
+ public LcmFlags getFlags() {
+ return flags;
+ }
+
+ public void setFlags(LcmFlags value) {
+ this.flags = value;
+ }
+
+ public String getTimestamp() {
+ return timestamp;
+ }
+
+ public void setTimestamp(String value) {
+ this.timestamp = value;
+ }
+
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapRequest.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapRequest.java
new file mode 100644
index 0000000000..db62e8b20b
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapRequest.java
@@ -0,0 +1,97 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm.beans;
+
+import com.fasterxml.jackson.annotation.JsonInclude;
+import com.fasterxml.jackson.annotation.JsonProperty;
+import com.fasterxml.jackson.annotation.JsonPropertyOrder;
+
+@JsonInclude(JsonInclude.Include.NON_NULL)
+@JsonPropertyOrder({"version", "type", "cambriaPartition", "correlationId", "rpcName", "body"})
+public class LcmDmaapRequest {
+
+ @JsonProperty(value = "version", required = true)
+ private String version;
+
+ @JsonProperty(value = "type", required = true)
+ private String type;
+
+ @JsonProperty(value = "cambria.partition", required = true)
+ private String cambriaPartition;
+
+ @JsonProperty(value = "correlation-id", required = true)
+ private String correlationId;
+
+ @JsonProperty(value = "rpc-name", required = true)
+ private String rpcName;
+
+ @JsonProperty(value = "body")
+ private LcmRestRequest body;
+
+ public String getVersion() {
+ return version;
+ }
+
+ public void setVersion(String value) {
+ this.version = value;
+ }
+
+ public String getType() {
+ return type;
+ }
+
+ public void setType(String value) {
+ this.type = value;
+ }
+
+ public String getCambriaPartition() {
+ return cambriaPartition;
+ }
+
+ public void setCambriaPartition(String value) {
+ this.cambriaPartition = value;
+ }
+
+ public String getCorrelationId() {
+ return correlationId;
+ }
+
+ public void setCorrelationId(String value) {
+ this.correlationId = value;
+ }
+
+ public String getRpcName() {
+ return rpcName;
+ }
+
+ public void setRpcName(String value) {
+ this.rpcName = value;
+ }
+
+ public LcmRestRequest getBody() {
+ return body;
+ }
+
+ public void setBody(LcmRestRequest value) {
+ this.body = value;
+ }
+
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapResponse.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapResponse.java
new file mode 100644
index 0000000000..35f4a26b17
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapResponse.java
@@ -0,0 +1,97 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm.beans;
+
+import com.fasterxml.jackson.annotation.JsonInclude;
+import com.fasterxml.jackson.annotation.JsonProperty;
+import com.fasterxml.jackson.annotation.JsonPropertyOrder;
+
+@JsonInclude(JsonInclude.Include.NON_NULL)
+@JsonPropertyOrder({"version", "type", "cambriaPartition", "correlationId", "rpcName", "body"})
+public class LcmDmaapResponse {
+
+ @JsonProperty(value = "version", required = true)
+ private String version;
+
+ @JsonProperty(value = "type", required = true)
+ private String type;
+
+ @JsonProperty(value = "cambria.partition", required = true)
+ private String cambriaPartition;
+
+ @JsonProperty(value = "correlation-id", required = true)
+ private String correlationId;
+
+ @JsonProperty(value = "rpc-name", required = true)
+ private String rpcName;
+
+ @JsonProperty(value = "body")
+ private LcmRestResponse body;
+
+ public String getVersion() {
+ return version;
+ }
+
+ public void setVersion(String value) {
+ this.version = value;
+ }
+
+ public String getType() {
+ return type;
+ }
+
+ public void setType(String value) {
+ this.type = value;
+ }
+
+ public String getCambriaPartition() {
+ return cambriaPartition;
+ }
+
+ public void setCambriaPartition(String value) {
+ this.cambriaPartition = value;
+ }
+
+ public String getCorrelationId() {
+ return correlationId;
+ }
+
+ public void setCorrelationId(String value) {
+ this.correlationId = value;
+ }
+
+ public String getRpcName() {
+ return rpcName;
+ }
+
+ public void setRpcName(String value) {
+ this.rpcName = value;
+ }
+
+ public LcmRestResponse getBody() {
+ return body;
+ }
+
+ public void setBody(LcmRestResponse value) {
+ this.body = value;
+ }
+
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmFlags.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmFlags.java
new file mode 100644
index 0000000000..36527ec887
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmFlags.java
@@ -0,0 +1,64 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm.beans;
+
+import com.fasterxml.jackson.annotation.JsonInclude;
+import com.fasterxml.jackson.annotation.JsonProperty;
+import com.fasterxml.jackson.annotation.JsonPropertyOrder;
+
+@JsonInclude(JsonInclude.Include.NON_NULL)
+@JsonPropertyOrder({"mode", "force", "ttl"})
+public class LcmFlags {
+
+ @JsonProperty("mode")
+ private String mode;
+
+ @JsonProperty("force")
+ private String force;
+
+ @JsonProperty("ttl")
+ private int ttl;
+
+ public String getMode() {
+ return mode;
+ }
+
+ public void setMode(String value) {
+ this.mode = value;
+ }
+
+ public String getForce() {
+ return force;
+ }
+
+ public void setForce(String value) {
+ this.force = value;
+ }
+
+ public Integer getTtl() {
+ return ttl;
+ }
+
+ public void setTtl(Integer value) {
+ this.ttl = value;
+ }
+
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmInput.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmInput.java
new file mode 100644
index 0000000000..6634430bed
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmInput.java
@@ -0,0 +1,75 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm.beans;
+
+import com.fasterxml.jackson.annotation.JsonInclude;
+import com.fasterxml.jackson.annotation.JsonProperty;
+import com.fasterxml.jackson.annotation.JsonPropertyOrder;
+
+@JsonInclude(JsonInclude.Include.NON_NULL)
+@JsonPropertyOrder({"commonHeader", "action", "actionIdentifiers", "payload"})
+public class LcmInput {
+
+ @JsonProperty(value = "common-header", required = true)
+ private LcmCommonHeader commonHeader;
+
+ @JsonProperty(value = "action", required = true)
+ private String action;
+
+ @JsonProperty(value = "action-identifiers", required = true)
+ private LcmActionIdentifiers actionIdentifiers;
+
+ @JsonProperty(value = "payload")
+ private String payload;
+
+ public LcmCommonHeader getCommonHeader() {
+ return commonHeader;
+ }
+
+ public void setCommonHeader(LcmCommonHeader value) {
+ this.commonHeader = value;
+ }
+
+ public String getAction() {
+ return action;
+ }
+
+ public void setAction(String value) {
+ this.action = value;
+ }
+
+ public LcmActionIdentifiers getActionIdentifiers() {
+ return actionIdentifiers;
+ }
+
+ public void setActionIdentifiers(LcmActionIdentifiers value) {
+ this.actionIdentifiers = value;
+ }
+
+ public String getPayload() {
+ return payload;
+ }
+
+ public void setPayload(String value) {
+ this.payload = value;
+ }
+
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmOutput.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmOutput.java
new file mode 100644
index 0000000000..3741786671
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmOutput.java
@@ -0,0 +1,64 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm.beans;
+
+import com.fasterxml.jackson.annotation.JsonInclude;
+import com.fasterxml.jackson.annotation.JsonProperty;
+import com.fasterxml.jackson.annotation.JsonPropertyOrder;
+
+@JsonInclude(JsonInclude.Include.NON_NULL)
+@JsonPropertyOrder({"commonHeader", "status", "payload"})
+public class LcmOutput {
+
+ @JsonProperty(value = "common-header", required = true)
+ private LcmCommonHeader commonHeader;
+
+ @JsonProperty(value = "status", required = true)
+ private LcmStatus status;
+
+ @JsonProperty(value = "payload")
+ private String payload;
+
+ public LcmCommonHeader getCommonHeader() {
+ return commonHeader;
+ }
+
+ public void setCommonHeader(LcmCommonHeader value) {
+ this.commonHeader = value;
+ }
+
+ public LcmStatus getStatus() {
+ return status;
+ }
+
+ public void setStatus(LcmStatus value) {
+ this.status = value;
+ }
+
+ public String getPayload() {
+ return payload;
+ }
+
+ public void setPayload(String value) {
+ this.payload = value;
+ }
+
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmRestRequest.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmRestRequest.java
new file mode 100644
index 0000000000..146eb8a4f6
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmRestRequest.java
@@ -0,0 +1,42 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm.beans;
+
+import com.fasterxml.jackson.annotation.JsonInclude;
+import com.fasterxml.jackson.annotation.JsonProperty;
+import com.fasterxml.jackson.annotation.JsonPropertyOrder;
+
+@JsonInclude(JsonInclude.Include.NON_NULL)
+@JsonPropertyOrder({"input"})
+public class LcmRestRequest {
+
+ @JsonProperty(value = "input", required = true)
+ private LcmInput input;
+
+ public LcmInput getInput() {
+ return input;
+ }
+
+ public void setInput(LcmInput value) {
+ this.input = value;
+ }
+
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmRestResponse.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmRestResponse.java
new file mode 100644
index 0000000000..6920f95ce2
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmRestResponse.java
@@ -0,0 +1,42 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm.beans;
+
+import com.fasterxml.jackson.annotation.JsonInclude;
+import com.fasterxml.jackson.annotation.JsonProperty;
+import com.fasterxml.jackson.annotation.JsonPropertyOrder;
+
+@JsonInclude(JsonInclude.Include.NON_NULL)
+@JsonPropertyOrder({"output"})
+public class LcmRestResponse {
+
+ @JsonProperty(value = "output", required = true)
+ private LcmOutput output;
+
+ public LcmOutput getOutput() {
+ return output;
+ }
+
+ public void setOutput(LcmOutput value) {
+ this.output = value;
+ }
+
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmStatus.java b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmStatus.java
new file mode 100644
index 0000000000..8a2a142792
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/main/java/org/onap/so/client/sdnc/lcm/beans/LcmStatus.java
@@ -0,0 +1,53 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm.beans;
+
+import com.fasterxml.jackson.annotation.JsonInclude;
+import com.fasterxml.jackson.annotation.JsonProperty;
+import com.fasterxml.jackson.annotation.JsonPropertyOrder;
+
+@JsonInclude(JsonInclude.Include.NON_NULL)
+@JsonPropertyOrder({"code", "message"})
+public class LcmStatus {
+
+ @JsonProperty(value = "code", required = true)
+ private int code;
+
+ @JsonProperty(value = "message", required = true)
+ private String message;
+
+ public int getCode() {
+ return code;
+ }
+
+ public void setCode(int value) {
+ this.code = value;
+ }
+
+ public String getMessage() {
+ return message;
+ }
+
+ public void setMessage(String value) {
+ this.message = value;
+ }
+
+}
diff --git a/bpmn/MSOCommonBPMN/src/main/resources/META-INF/services/org.onap.so.client.RestProperties b/bpmn/MSOCommonBPMN/src/main/resources/META-INF/services/org.onap.so.client.RestProperties
index 27da189456..147bc2ee95 100644
--- a/bpmn/MSOCommonBPMN/src/main/resources/META-INF/services/org.onap.so.client.RestProperties
+++ b/bpmn/MSOCommonBPMN/src/main/resources/META-INF/services/org.onap.so.client.RestProperties
@@ -1,3 +1,4 @@
org.onap.so.client.restproperties.AAIPropertiesImpl
org.onap.so.client.restproperties.CDSPropertiesImpl
-org.onap.so.client.restproperties.PolicyRestPropertiesImpl \ No newline at end of file
+org.onap.so.client.restproperties.PolicyRestPropertiesImpl
+org.onap.so.client.restproperties.SDNCLcmPropertiesImpl
diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmDmaapClientTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmDmaapClientTest.java
new file mode 100644
index 0000000000..5483792a84
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmDmaapClientTest.java
@@ -0,0 +1,139 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm;
+
+import java.util.List;
+import org.apache.http.HttpStatus;
+import com.fasterxml.jackson.core.JsonProcessingException;
+import org.junit.Test;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertNotEquals;
+import static org.junit.Assert.fail;
+import static com.github.tomakehurst.wiremock.client.WireMock.aResponse;
+import static com.github.tomakehurst.wiremock.client.WireMock.post;
+import static com.github.tomakehurst.wiremock.client.WireMock.get;
+import static com.github.tomakehurst.wiremock.client.WireMock.urlPathEqualTo;
+import org.onap.so.BaseTest;
+import org.onap.so.client.restproperties.SDNCLcmPropertiesImpl;
+import org.onap.so.client.sdnc.lcm.beans.*;
+
+public class SDNCLcmDmaapClientTest extends BaseTest {
+
+ protected SDNCLcmMessageBuilderTest sdncLcmMessageBuilderTest = new SDNCLcmMessageBuilderTest();
+
+ protected static final String DMAAP_HOST_PROP = SDNCLcmPropertiesImpl.DMAAP_HOST;
+ protected static final String DMAAP_WRITE_TOPIC_PROP = SDNCLcmPropertiesImpl.LCM_DMAAP_WRITE_TOPIC;
+ protected static final String DMAAP_READ_TOPIC_PROP = SDNCLcmPropertiesImpl.LCM_DMAAP_READ_TOPIC;
+ protected static final String DMAAP_PARTITION_PROP = SDNCLcmPropertiesImpl.DMAAP_PARTITION;
+
+ protected String testWriteTopic = "TEST-WRITE-TOPIC";
+ protected String testReadTopic = "TEST-READ-TOPIC";
+ protected String testPartition = "TESTMSO";
+ protected final String defaultConsumerName = "consumer1";
+
+ private void clearSystemProperty() {
+ System.clearProperty(DMAAP_HOST_PROP);
+ System.clearProperty(DMAAP_WRITE_TOPIC_PROP);
+ System.clearProperty(DMAAP_READ_TOPIC_PROP);
+ System.clearProperty(DMAAP_PARTITION_PROP);
+ }
+
+ public SDNCLcmDmaapClient buildSDNCLcmDmaapClient() {
+ String testHost = "http://localhost:" + wireMockPort;
+
+ System.setProperty(DMAAP_HOST_PROP, testHost);
+ System.setProperty(DMAAP_WRITE_TOPIC_PROP, testWriteTopic);
+ System.setProperty(DMAAP_READ_TOPIC_PROP, testReadTopic);
+ System.setProperty(DMAAP_PARTITION_PROP, testPartition);
+
+ SDNCLcmProperties sdncLcmProperties = new SDNCLcmPropertiesImpl();
+ SDNCLcmClientBuilder sdncLcmClientBuilder = new SDNCLcmClientBuilder(sdncLcmProperties);
+
+ try {
+ return sdncLcmClientBuilder.newSDNCLcmDmaapClient();
+ } catch (Exception e) {
+ clearSystemProperty();
+ fail("Create SDNCLcmDmaapClient error: " + e.toString());
+ return null;
+ }
+ }
+
+ @Test
+ public final void testSDNCLcmDmaapClientSendRequest() {
+ SDNCLcmDmaapClient sdncLcmDmaapClient = buildSDNCLcmDmaapClient();
+
+ assertNotEquals(null, sdncLcmDmaapClient);
+
+ String testDmaapWritePath = "/events/" + testWriteTopic;
+ String expectedWriteResponse = "{\"serverTimeMs\":2,\"count\":1}";
+ wireMockServer.stubFor(post(urlPathEqualTo(testDmaapWritePath))
+ .willReturn(aResponse().withHeader("Content-Type", "application/json").withBody(expectedWriteResponse)
+ .withStatus(HttpStatus.SC_OK)));
+
+ LcmInput lcmInput = sdncLcmMessageBuilderTest.buildLcmInputForPnf();
+ LcmDmaapRequest lcmDmaapRequest =
+ SDNCLcmMessageBuilder.buildLcmDmaapRequest(sdncLcmMessageBuilderTest.getOperation(), lcmInput);
+
+ try {
+ sdncLcmDmaapClient.sendRequest(lcmDmaapRequest);
+ } catch (Exception e) {
+ clearSystemProperty();
+ fail("SDNCLcmDmaapClient sends request error: " + e.toString());
+ return;
+ }
+
+ String testDmaapReadPath = "/events/" + testReadTopic + "/" + testPartition + "/" + defaultConsumerName;
+
+ String expectedLcmDmaapResponse = LcmDmaapResponseTest.getExpectedLcmDmaapResponse();
+ String expectedResponseListItem;
+ try {
+ expectedResponseListItem = sdncLcmMessageBuilderTest.convertToSting(expectedLcmDmaapResponse);
+ } catch (JsonProcessingException e) {
+ clearSystemProperty();
+ fail("Convert LcmDmaapResponse String to List item error: " + e.toString());
+ return;
+ }
+ String expectedReadResponse = "[" + expectedResponseListItem + "]";
+ wireMockServer.stubFor(get(urlPathEqualTo(testDmaapReadPath))
+ .willReturn(aResponse().withHeader("Content-Type", "application/json").withBody(expectedReadResponse)
+ .withStatus(HttpStatus.SC_OK)));
+
+ List<LcmDmaapResponse> LcmDmaapResponseList = sdncLcmDmaapClient.getResponse();
+
+ clearSystemProperty();
+
+ if (LcmDmaapResponseList.size() < 1) {
+ clearSystemProperty();
+ fail("Can not get LcmDmaapResponse list");
+ return;
+ }
+
+ LcmOutput lcmOutput = LcmDmaapResponseList.get(0).getBody().getOutput();
+
+ String expectedLcmOutput = LcmOutputTest.getExpectedLcmOutput();
+ try {
+ String lcmOutputString = sdncLcmMessageBuilderTest.convertToSting(lcmOutput);
+ assertEquals(expectedLcmOutput, lcmOutputString);
+ } catch (Exception e) {
+ fail("Convert LcmOutput to String error: " + e.toString());
+ }
+ }
+}
diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmMessageBuilderTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmMessageBuilderTest.java
new file mode 100644
index 0000000000..d930c6728c
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmMessageBuilderTest.java
@@ -0,0 +1,53 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm;
+
+import org.junit.Test;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.fail;
+import org.onap.so.client.sdnc.lcm.beans.LcmBeanTest;
+import org.onap.so.client.sdnc.lcm.beans.LcmInput;
+import org.onap.so.client.sdnc.lcm.beans.LcmInputTest;
+
+public class SDNCLcmMessageBuilderTest extends LcmBeanTest {
+
+ public LcmInput buildLcmInputForPnf() {
+ LcmInput lcmInput =
+ SDNCLcmMessageBuilder.buildLcmInputForPnf(requestId, subRequestId, pnfName, action, inputPayload);
+
+ lcmInput.getCommonHeader().setTimestamp(timestamp);
+
+ return lcmInput;
+ }
+
+ @Test
+ public final void testBuildLcmRestRequestForPnf() {
+ LcmInput lcmInput = buildLcmInputForPnf();
+
+ String expectedLcmInput = LcmInputTest.getExpectedLcmInput();
+ try {
+ String lcmInputString = convertToSting(lcmInput);
+ assertEquals(expectedLcmInput, lcmInputString);
+ } catch (Exception e) {
+ fail("Convert LcmInput to String error: " + e.toString());
+ }
+ }
+}
diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmRestClientTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmRestClientTest.java
new file mode 100644
index 0000000000..04cfc6e3c8
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/SDNCLcmRestClientTest.java
@@ -0,0 +1,93 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm;
+
+import org.apache.http.HttpStatus;
+import org.junit.Test;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertNotEquals;
+import static org.junit.Assert.fail;
+import static com.github.tomakehurst.wiremock.client.WireMock.aResponse;
+import static com.github.tomakehurst.wiremock.client.WireMock.post;
+import static com.github.tomakehurst.wiremock.client.WireMock.urlPathEqualTo;
+import org.onap.logging.filter.base.ONAPComponents;
+import org.onap.so.BaseTest;
+import org.onap.so.client.restproperties.SDNCLcmPropertiesImpl;
+import org.onap.so.client.sdnc.common.SDNCConstants;
+import org.onap.so.client.sdnc.lcm.beans.*;
+
+public class SDNCLcmRestClientTest extends BaseTest {
+
+ protected SDNCLcmMessageBuilderTest sdncLcmMessageBuilderTest = new SDNCLcmMessageBuilderTest();
+
+ protected static final String SDNC_HOST_PROP = SDNCLcmPropertiesImpl.SDNC_HOST;
+ protected static final String SDNC_PATH_PROP = SDNCLcmPropertiesImpl.LCM_PATH;
+
+ private void clearSystemProperty() {
+ System.clearProperty(SDNC_HOST_PROP);
+ System.clearProperty(SDNC_PATH_PROP);
+ }
+
+ public SDNCLcmRestClient buildSDNCLcmRestClient() {
+ String testHost = "http://localhost:" + wireMockPort;
+
+ System.setProperty(SDNC_HOST_PROP, testHost);
+ System.setProperty(SDNC_PATH_PROP, SDNCConstants.LCM_API_BASE_PATH);
+
+ SDNCLcmProperties sdncLcmProperties = new SDNCLcmPropertiesImpl();
+ SDNCLcmClientBuilder sdncLcmClientBuilder = new SDNCLcmClientBuilder(sdncLcmProperties);
+
+ try {
+ return sdncLcmClientBuilder.newSDNCLcmRestClient(sdncLcmMessageBuilderTest.getOperation());
+ } catch (Exception e) {
+ clearSystemProperty();
+ fail("Create SDNCLcmRestClient error: " + e.toString());
+ return null;
+ }
+ }
+
+ @Test
+ public final void testSDNCLcmRestClientSendRequest() {
+ SDNCLcmRestClient sdncLcmRestClient = buildSDNCLcmRestClient();
+
+ assertNotEquals(null, sdncLcmRestClient);
+ assertEquals(ONAPComponents.SDNC, sdncLcmRestClient.getTargetEntity());
+
+ String testLcmApiPath = SDNCConstants.LCM_API_BASE_PATH + sdncLcmMessageBuilderTest.getOperation();
+ String expectedLcmRestResponse = LcmRestResponseTest.getExpectedLcmRestResponse();
+ wireMockServer.stubFor(post(urlPathEqualTo(testLcmApiPath))
+ .willReturn(aResponse().withHeader("Content-Type", "application/json").withBody(expectedLcmRestResponse)
+ .withStatus(HttpStatus.SC_OK)));
+
+ LcmInput lcmInput = sdncLcmMessageBuilderTest.buildLcmInputForPnf();
+ LcmOutput lcmOutput = sdncLcmRestClient.sendRequest(lcmInput);
+
+ clearSystemProperty();
+
+ String expectedLcmOutput = LcmOutputTest.getExpectedLcmOutput();
+ try {
+ String lcmOutputString = sdncLcmMessageBuilderTest.convertToSting(lcmOutput);
+ assertEquals(expectedLcmOutput, lcmOutputString);
+ } catch (Exception e) {
+ fail("Convert LcmOutput to String error: " + e.toString());
+ }
+ }
+}
diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmBeanTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmBeanTest.java
new file mode 100644
index 0000000000..5562444a46
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmBeanTest.java
@@ -0,0 +1,78 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm.beans;
+
+import com.fasterxml.jackson.core.JsonProcessingException;
+import com.fasterxml.jackson.databind.ObjectMapper;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+import org.onap.so.client.sdnc.common.SDNCConstants;
+
+public class LcmBeanTest {
+ private static Logger logger = LoggerFactory.getLogger(LcmBeanTest.class);
+
+ protected String requestId = "9f77f437-1515-44bd-a420-0aaf8a3c31a0";
+ protected String subRequestId = "c197a4b5-18d9-48a2-ad2d-a3b56858501c";
+ protected String timestamp = "2020-02-25T10:20:28.116Z";
+
+ protected String pnfName = "testpnf";
+ protected String action = "TestAction";
+ protected String operation = "test-operation";
+
+ protected String inputPayload = "{\"testPayload\": \"input test\"}";
+ protected String outputPayload = "{\"testPayload\": \"output test\"}";
+
+ public String getOperation() {
+ return operation;
+ }
+
+ public LcmFlags buildSDNCFlags() {
+ LcmFlags lcmFlags = new LcmFlags();
+
+ lcmFlags.setMode(SDNCConstants.LCM_FLAGS_MODE_NORMAL);
+ lcmFlags.setForce(SDNCConstants.LCM_FLAGS_FORCE_FALSE);
+ lcmFlags.setTtl(SDNCConstants.LCM_FLAGS_TTL);
+
+ return lcmFlags;
+ }
+
+ public LcmCommonHeader buildLcmCommonHeader() {
+ LcmCommonHeader lcmCommonHeader = new LcmCommonHeader();
+
+ lcmCommonHeader.setApiVer(SDNCConstants.LCM_API_VER);
+ lcmCommonHeader.setFlags(buildSDNCFlags());
+ lcmCommonHeader.setOriginatorId(SDNCConstants.SYSTEM_NAME);
+ lcmCommonHeader.setRequestId(requestId);
+ lcmCommonHeader.setSubRequestId(subRequestId);
+ lcmCommonHeader.setTimestamp(timestamp);
+
+ return lcmCommonHeader;
+ }
+
+ public String convertToSting(Object msgObject) throws JsonProcessingException {
+ ObjectMapper mapper = new ObjectMapper();
+
+ String msgString = mapper.writeValueAsString(msgObject);
+ logger.debug(msgObject.getClass().getSimpleName() + "\n" + msgString);
+
+ return msgString;
+ }
+}
diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapRequestTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapRequestTest.java
new file mode 100644
index 0000000000..709a557937
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapRequestTest.java
@@ -0,0 +1,67 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm.beans;
+
+import org.junit.Test;
+import org.onap.so.client.sdnc.common.SDNCConstants;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.fail;
+
+public class LcmDmaapRequestTest extends LcmBeanTest {
+ private static String expectedLcmDmaapRequest = "{" + "\"version\":\"1.0\"," + "\"type\":\"request\","
+ + "\"cambria.partition\":\"MSO\","
+ + "\"correlation-id\":\"9f77f437-1515-44bd-a420-0aaf8a3c31a0-c197a4b5-18d9-48a2-ad2d-a3b56858501c\","
+ + "\"rpc-name\":\"test-operation\"," + "\"body\":" + LcmRestRequestTest.getExpectedLcmRestRequest() + "}";
+
+ public LcmDmaapRequest buildLcmDmaapRequest() {
+ LcmDmaapRequest lcmDmaapRequest = new LcmDmaapRequest();
+
+ LcmRestRequestTest lcmRestRequestTest = new LcmRestRequestTest();
+ LcmRestRequest lcmRestRequest = lcmRestRequestTest.buildLcmRestRequest();
+ LcmCommonHeader lcmCommonHeader = lcmRestRequest.getInput().getCommonHeader();
+ String correlationId = lcmCommonHeader.getRequestId() + "-" + lcmCommonHeader.getSubRequestId();
+
+ lcmDmaapRequest.setVersion(SDNCConstants.LCM_DMAAP_MSG_VER);
+ lcmDmaapRequest.setType(SDNCConstants.LCM_DMAAP_MSG_TYPE_REQUEST);
+ lcmDmaapRequest.setCambriaPartition(SDNCConstants.SYSTEM_NAME);
+ lcmDmaapRequest.setCorrelationId(correlationId);
+ lcmDmaapRequest.setRpcName(operation);
+ lcmDmaapRequest.setBody(lcmRestRequest);
+
+ return lcmDmaapRequest;
+ }
+
+ public static String getExpectedLcmDmaapRequest() {
+ return expectedLcmDmaapRequest;
+ }
+
+ @Test
+ public final void testLcmDmaapRequest() {
+ LcmDmaapRequest lcmDmaapRequest = buildLcmDmaapRequest();
+
+ try {
+ String lcmDmaapRequestString = convertToSting(lcmDmaapRequest);
+ assertEquals(expectedLcmDmaapRequest, lcmDmaapRequestString);
+ } catch (Exception e) {
+ fail("Convert LcmDmaapRequest to String error: " + e.toString());
+ }
+ }
+}
diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapResponseTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapResponseTest.java
new file mode 100644
index 0000000000..0cdbeebb27
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmDmaapResponseTest.java
@@ -0,0 +1,67 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm.beans;
+
+import org.junit.Test;
+import org.onap.so.client.sdnc.common.SDNCConstants;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.fail;
+
+public class LcmDmaapResponseTest extends LcmBeanTest {
+ private static String expectedLcmDmaapResponse = "{" + "\"version\":\"1.0\"," + "\"type\":\"response\","
+ + "\"cambria.partition\":\"MSO\","
+ + "\"correlation-id\":\"9f77f437-1515-44bd-a420-0aaf8a3c31a0-c197a4b5-18d9-48a2-ad2d-a3b56858501c\","
+ + "\"rpc-name\":\"test-operation\"," + "\"body\":" + LcmRestResponseTest.getExpectedLcmRestResponse() + "}";
+
+ public LcmDmaapResponse buildLcmDmaapResponse() {
+ LcmDmaapResponse lcmDmaapResponse = new LcmDmaapResponse();
+
+ LcmRestResponseTest lcmRestResponseTest = new LcmRestResponseTest();
+ LcmRestResponse lcmRestResponse = lcmRestResponseTest.buildLcmRestResponse();
+ LcmCommonHeader lcmCommonHeader = lcmRestResponse.getOutput().getCommonHeader();
+ String correlationId = lcmCommonHeader.getRequestId() + "-" + lcmCommonHeader.getSubRequestId();
+
+ lcmDmaapResponse.setVersion(SDNCConstants.LCM_DMAAP_MSG_VER);
+ lcmDmaapResponse.setType(SDNCConstants.LCM_DMAAP_MSG_TYPE_RESPONSE);
+ lcmDmaapResponse.setCambriaPartition(SDNCConstants.SYSTEM_NAME);
+ lcmDmaapResponse.setCorrelationId(correlationId);
+ lcmDmaapResponse.setRpcName(operation);
+ lcmDmaapResponse.setBody(lcmRestResponse);
+
+ return lcmDmaapResponse;
+ }
+
+ public static String getExpectedLcmDmaapResponse() {
+ return expectedLcmDmaapResponse;
+ }
+
+ @Test
+ public final void testLcmDmaapResponse() {
+ LcmDmaapResponse lcmDmaapResponse = buildLcmDmaapResponse();
+
+ try {
+ String lcmDmaapResponseString = convertToSting(lcmDmaapResponse);
+ assertEquals(expectedLcmDmaapResponse, lcmDmaapResponseString);
+ } catch (Exception e) {
+ fail("Convert LcmDmaapResponse to String error: " + e.toString());
+ }
+ }
+}
diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmInputTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmInputTest.java
new file mode 100644
index 0000000000..b8c34fcbc7
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmInputTest.java
@@ -0,0 +1,67 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm.beans;
+
+import org.junit.Test;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.fail;
+
+public class LcmInputTest extends LcmBeanTest {
+ private static String expectedLcmInput = "{" + "\"common-header\":{" + "\"api-ver\":\"2.00\","
+ + "\"flags\":{\"mode\":\"NORMAL\",\"force\":\"FALSE\",\"ttl\":65000}," + "\"originator-id\":\"MSO\","
+ + "\"request-id\":\"9f77f437-1515-44bd-a420-0aaf8a3c31a0\","
+ + "\"sub-request-id\":\"c197a4b5-18d9-48a2-ad2d-a3b56858501c\","
+ + "\"timestamp\":\"2020-02-25T10:20:28.116Z\"" + "}," + "\"action\":\"TestAction\","
+ + "\"action-identifiers\":{\"pnf-name\":\"testpnf\"},"
+ + "\"payload\":\"{\\\"testPayload\\\": \\\"input test\\\"}\"}";
+
+ public LcmInput buildLcmInput() {
+ LcmInput lcmInput = new LcmInput();
+
+ LcmCommonHeader lcmCommonHeader = buildLcmCommonHeader();
+
+ LcmActionIdentifiers lcmActionIdentifiers = new LcmActionIdentifiers();
+ lcmActionIdentifiers.setPnfName(pnfName);
+
+ lcmInput.setCommonHeader(lcmCommonHeader);
+ lcmInput.setAction(action);
+ lcmInput.setActionIdentifiers(lcmActionIdentifiers);
+ lcmInput.setPayload(inputPayload);
+
+ return lcmInput;
+ }
+
+ public static String getExpectedLcmInput() {
+ return expectedLcmInput;
+ }
+
+ @Test
+ public final void testLcmInput() {
+ LcmInput lcmInput = buildLcmInput();
+
+ try {
+ String lcmInputString = convertToSting(lcmInput);
+ assertEquals(expectedLcmInput, lcmInputString);
+ } catch (Exception e) {
+ fail("Convert LcmInput to String error: " + e.toString());
+ }
+ }
+}
diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmOutputTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmOutputTest.java
new file mode 100644
index 0000000000..1530be38a7
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmOutputTest.java
@@ -0,0 +1,84 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm.beans;
+
+import org.junit.Test;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.fail;
+import org.onap.so.client.sdnc.common.SDNCConstants;
+
+public class LcmOutputTest extends LcmBeanTest {
+ private static String expectedLcmOutput = "{" + "\"common-header\":{" + "\"api-ver\":\"2.00\","
+ + "\"originator-id\":\"MSO\"," + "\"request-id\":\"9f77f437-1515-44bd-a420-0aaf8a3c31a0\","
+ + "\"sub-request-id\":\"c197a4b5-18d9-48a2-ad2d-a3b56858501c\"" + "},"
+ + "\"status\":{\"code\":400,\"message\":\"Test output message\"},"
+ + "\"payload\":\"{\\\"testPayload\\\": \\\"output test\\\"}\"}";
+
+ @Override
+ public LcmCommonHeader buildLcmCommonHeader() {
+ LcmCommonHeader lcmCommonHeader = new LcmCommonHeader();
+
+ lcmCommonHeader.setApiVer(SDNCConstants.LCM_API_VER);
+ lcmCommonHeader.setOriginatorId(SDNCConstants.SYSTEM_NAME);
+ lcmCommonHeader.setRequestId(requestId);
+ lcmCommonHeader.setSubRequestId(subRequestId);
+
+ return lcmCommonHeader;
+ }
+
+ public LcmStatus buildLcmStatus() {
+ LcmStatus lcmStatus = new LcmStatus();
+
+ lcmStatus.setCode(400);
+ lcmStatus.setMessage("Test output message");
+
+ return lcmStatus;
+ }
+
+ public LcmOutput buildLcmOutput() {
+ LcmOutput lcmOutput = new LcmOutput();
+
+ LcmCommonHeader lcmCommonHeader = buildLcmCommonHeader();
+ LcmStatus lcmStatus = buildLcmStatus();
+
+ lcmOutput.setCommonHeader(lcmCommonHeader);
+ lcmOutput.setStatus(lcmStatus);
+ lcmOutput.setPayload(outputPayload);
+
+ return lcmOutput;
+ }
+
+ public static String getExpectedLcmOutput() {
+ return expectedLcmOutput;
+ }
+
+ @Test
+ public final void testLcmOutput() {
+ LcmOutput lcmOutput = buildLcmOutput();
+
+ try {
+ String lcmOutputString = convertToSting(lcmOutput);
+ assertEquals(expectedLcmOutput, lcmOutputString);
+ } catch (Exception e) {
+ fail("Convert LcmOutput to String error: " + e.toString());
+ }
+ }
+}
diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmRestRequestTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmRestRequestTest.java
new file mode 100644
index 0000000000..c078326c82
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmRestRequestTest.java
@@ -0,0 +1,54 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm.beans;
+
+import org.junit.Test;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.fail;
+
+public class LcmRestRequestTest extends LcmBeanTest {
+ private static String expectedLcmRestRequest = "{" + "\"input\":" + LcmInputTest.getExpectedLcmInput() + "}";
+
+ public LcmRestRequest buildLcmRestRequest() {
+ LcmRestRequest lcmRestRequest = new LcmRestRequest();
+
+ LcmInputTest lcmInputTest = new LcmInputTest();
+ lcmRestRequest.setInput(lcmInputTest.buildLcmInput());
+
+ return lcmRestRequest;
+ }
+
+ public static String getExpectedLcmRestRequest() {
+ return expectedLcmRestRequest;
+ }
+
+ @Test
+ public final void testLcmRestRequest() {
+ LcmRestRequest lcmRestRequest = buildLcmRestRequest();
+
+ try {
+ String lcmRestRequestString = convertToSting(lcmRestRequest);
+ assertEquals(expectedLcmRestRequest, lcmRestRequestString);
+ } catch (Exception e) {
+ fail("Convert LcmRestRequest to String error: " + e.toString());
+ }
+ }
+}
diff --git a/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmRestResponseTest.java b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmRestResponseTest.java
new file mode 100644
index 0000000000..5867acb421
--- /dev/null
+++ b/bpmn/MSOCommonBPMN/src/test/java/org/onap/so/client/sdnc/lcm/beans/LcmRestResponseTest.java
@@ -0,0 +1,54 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2020 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.client.sdnc.lcm.beans;
+
+import org.junit.Test;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.fail;
+
+public class LcmRestResponseTest extends LcmBeanTest {
+ private static String expectedLcmRestResponse = "{" + "\"output\":" + LcmOutputTest.getExpectedLcmOutput() + "}";
+
+ public LcmRestResponse buildLcmRestResponse() {
+ LcmRestResponse lcmRestResponse = new LcmRestResponse();
+
+ LcmOutputTest lcmOutputTest = new LcmOutputTest();
+ lcmRestResponse.setOutput(lcmOutputTest.buildLcmOutput());
+
+ return lcmRestResponse;
+ }
+
+ public static String getExpectedLcmRestResponse() {
+ return expectedLcmRestResponse;
+ }
+
+ @Test
+ public final void testLcmRestResponse() {
+ LcmRestResponse lcmRestResponse = buildLcmRestResponse();
+
+ try {
+ String lcmRestResponseString = convertToSting(lcmRestResponse);
+ assertEquals(expectedLcmRestResponse, lcmRestResponseString);
+ } catch (Exception e) {
+ fail("Convert LcmRestResponse to String error: " + e.toString());
+ }
+ }
+}
diff --git a/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DeleteCommunicationService.groovy b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DeleteCommunicationService.groovy
new file mode 100644
index 0000000000..00b0b37b18
--- /dev/null
+++ b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DeleteCommunicationService.groovy
@@ -0,0 +1,429 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ # Copyright (c) 2019, CMCC Technologies Co., Ltd.
+ #
+ # Licensed under the Apache License, Version 2.0 (the "License")
+ # you may not use this file except in compliance with the License.
+ # You may obtain a copy of the License at
+ #
+ # http://www.apache.org/licenses/LICENSE-2.0
+ #
+ # Unless required by applicable law or agreed to in writing, software
+ # distributed under the License is distributed on an "AS IS" BASIS,
+ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ # See the License for the specific language governing permissions and
+ # limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+package org.onap.so.bpmn.infrastructure.scripts
+
+
+import org.camunda.bpm.engine.delegate.BpmnError
+import org.camunda.bpm.engine.delegate.DelegateExecution
+import org.onap.aai.domain.yang.Relationship
+import org.onap.aai.domain.yang.ServiceInstance
+import org.onap.aai.domain.yang.CommunicationServiceProfile
+import org.onap.aai.domain.yang.CommunicationServiceProfiles
+import org.onap.logging.filter.base.ONAPComponents
+import org.onap.so.bpmn.common.scripts.AbstractServiceTaskProcessor
+import org.onap.so.bpmn.common.scripts.ExceptionUtil
+import org.onap.so.bpmn.common.scripts.MsoUtils
+import org.onap.so.bpmn.common.scripts.RequestDBUtil
+import org.onap.so.bpmn.core.UrnPropertiesReader
+import org.onap.so.bpmn.core.WorkflowException
+import org.onap.so.bpmn.core.json.JsonUtils
+import org.onap.so.client.HttpClient
+import org.onap.so.client.HttpClientFactory
+import org.onap.so.client.aai.AAIObjectType
+import org.onap.so.client.aai.AAIResourcesClient
+import org.onap.so.client.aai.entities.AAIResultWrapper
+import org.onap.so.client.aai.entities.uri.AAIResourceUri
+import org.onap.so.client.aai.entities.uri.AAIUriFactory
+import org.onap.so.db.request.beans.OperationStatus
+import org.slf4j.Logger
+import org.slf4j.LoggerFactory
+
+import javax.ws.rs.NotFoundException
+import javax.ws.rs.core.Response
+
+import static org.apache.commons.lang3.StringUtils.isBlank
+
+class DeleteCommunicationService extends AbstractServiceTaskProcessor {
+ private final String PREFIX ="DeleteCommunicationService"
+ private final Long TIMEOUT = 60 * 60 * 1000
+
+ ExceptionUtil exceptionUtil = new ExceptionUtil()
+ JsonUtils jsonUtil = new JsonUtils()
+ private RequestDBUtil requestDBUtil = new RequestDBUtil()
+ private static final Logger LOGGER = LoggerFactory.getLogger(DeleteCommunicationService.class)
+
+ @Override
+ void preProcessRequest(DelegateExecution execution) {
+ execution.setVariable("prefix",PREFIX)
+ String msg = ""
+
+ LOGGER.trace("Starting preProcessRequest")
+
+ try {
+ // check for incoming json message/input
+ String siRequest = execution.getVariable("bpmnRequest")
+ String requestId = execution.getVariable("mso-request-id")
+ execution.setVariable("msoRequestId", requestId)
+ execution.setVariable("operationType", "DELETE")
+
+ //communication service id
+ String serviceInstanceId = execution.getVariable("serviceInstanceId")
+ if (isBlank(serviceInstanceId)) {
+ msg = "communication-service id is null"
+ exceptionUtil.buildAndThrowWorkflowException(execution, 500, msg)
+ }
+
+ LOGGER.info("Input Request: ${siRequest}, reqId: ${requestId}, serviceInstanceId: ${serviceInstanceId}")
+
+ //requestParameters
+ checkAndSetRequestParam(siRequest,"globalSubscriberId",false,execution)
+ checkAndSetRequestParam(siRequest,"serviceType",false,execution)
+ checkAndSetRequestParam(siRequest,"operationId",false,execution)
+
+ } catch (BpmnError e) {
+ throw e
+ } catch (any) {
+ msg = "Exception in preProcessRequest " + any.getCause()
+ LOGGER.debug(msg)
+ exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg)
+ }
+ LOGGER.trace("Exit preProcessRequest")
+ }
+
+
+ /**
+ * prepare update operation status
+ * @param execution
+ */
+ void preInitUpdateOperationStatus(DelegateExecution execution){
+ LOGGER.trace(" ======== STARTED initUpdateOperationStatus Process ======== ")
+ try{
+ execution.setVariable("result","processing")
+ execution.setVariable("progress","0")
+ execution.setVariable("operationContent","delete communication service operation start")
+ setOperationStatus(execution)
+
+ }catch(Exception e){
+ LOGGER.error("Exception Occured Processing initUpdateOperationStatus. Exception is:\n" + e)
+ execution.setVariable("CVFMI_ErrorResponse", "Error Occurred during initUpdateOperationStatus Method:\n" + e.getMessage())
+ }
+ LOGGER.trace("======== COMPLETED initUpdateOperationStatus Process ======== ")
+ }
+
+ /**
+ * send sync response
+ * @param execution
+ */
+ void sendSyncResponse(DelegateExecution execution) {
+ LOGGER.debug("Begin sendSyncResponse")
+
+ try {
+ String operationId = execution.getVariable("operationId")
+ String syncResponse = """{"operationId":"${operationId}"}""".trim()
+ sendWorkflowResponse(execution, 202, syncResponse)
+
+ } catch (Exception ex) {
+ String msg = "Exception in sendSyncResponse: " + ex.getMessage()
+ exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg)
+ }
+ LOGGER.debug("Exit sendSyncResponse")
+ }
+
+ /**
+ * query CommunicationSerive from AAI
+ * save e2eslice-service instance id and service name
+ * @param execution
+ */
+ private void queryCommunicationSeriveFromAAI(DelegateExecution execution)
+ {
+ LOGGER.trace(" ***** begin queryCommunicationSeriveFromAAI *****")
+ String serviceInstanceId = execution.getVariable("serviceInstanceId")
+
+ String errorMsg = "query communication service from aai failed"
+ AAIResultWrapper wrapper = queryAAI(execution, AAIObjectType.SERVICE_INSTANCE, serviceInstanceId, errorMsg)
+ Optional<ServiceInstance> si = wrapper.asBean(ServiceInstance.class)
+ if(si.isPresent())
+ {
+ String serviceInstName = si.get()?.getServiceInstanceName()
+ String e2eSliceServiceInstId
+ if(si.isPresent())
+ {
+ List<Relationship> relationshipList = si.get().getRelationshipList()?.getRelationship()
+ for (Relationship relationship : relationshipList)
+ {
+ String relatedTo = relationship.getRelatedTo()
+ if (relatedTo == "service-instance")
+ {
+ String relatedLink = relationship.getRelatedLink()?:""
+ e2eSliceServiceInstId = relatedLink ? relatedLink.substring(relatedLink.lastIndexOf("/") + 1,relatedLink.length()) : ""
+ break
+ }
+ }
+ }
+ execution.setVariable("e2eSliceServiceInstanceId", e2eSliceServiceInstId)
+ execution.setVariable("serviceInstanceName", serviceInstName ?: "")
+ LOGGER.info("communication-service Id: ${serviceInstanceId}, e2eslice-service Id: ${e2eSliceServiceInstId}, serviceName: ${serviceInstName}")
+ }
+ LOGGER.debug(" ***** Exit queryCommunicationSeriveFromAAI *****")
+ }
+
+ /**
+ * query AAI
+ * @param execution
+ * @param aaiObjectType
+ * @param instanceId
+ * @return AAIResultWrapper
+ */
+ private AAIResultWrapper queryAAI(DelegateExecution execution, AAIObjectType aaiObjectType, String instanceId, String errorMsg)
+ {
+ String globalSubscriberId = execution.getVariable("globalSubscriberId")
+ String serviceType = execution.getVariable("serviceType")
+
+ AAIResourcesClient resourceClient = new AAIResourcesClient()
+ AAIResourceUri resourceUri = AAIUriFactory.createResourceUri(aaiObjectType, globalSubscriberId, serviceType, instanceId)
+ if (!resourceClient.exists(resourceUri)) {
+ exceptionUtil.buildAndThrowWorkflowException(execution, 2500, errorMsg)
+ }
+ AAIResultWrapper wrapper = resourceClient.get(resourceUri, NotFoundException.class)
+ return wrapper
+ }
+
+
+ /**
+ * 再次调用deleteE2EServiceInstance接口,然后获取到operationid,
+ */
+ void sendRequest2NSMFWF(DelegateExecution execution) {
+ LOGGER.trace("begin preRequestSend2NSMF")
+ try {
+ //url:/onap/so/infra/e2eServiceInstances/v3/{serviceInstanceId}"
+ def NSMF_endpoint = UrnPropertiesReader.getVariable("mso.infra.endpoint.url", execution)
+ String url = "${NSMF_endpoint}/e2eServiceInstances/v3/${execution.getVariable("e2eSliceServiceInstanceId")}"
+
+ String requestBody = """
+ {
+ "globalSubscriberId": "${execution.getVariable("globalSubscriberId")}",
+ "serviceType": "${execution.getVariable("serviceType")}"
+ }
+ """
+ requestBody.replaceAll("\\s+", "")
+
+ String basicAuthValue = UrnPropertiesReader.getVariable("mso.infra.endpoint.auth", execution)
+ HttpClient httpClient = new HttpClientFactory().newJsonClient(new URL(url), ONAPComponents.SO)
+ httpClient.addAdditionalHeader("Authorization", basicAuthValue)
+ httpClient.addAdditionalHeader("Accept", "application/json")
+ Response httpResponse = httpClient.delete(requestBody)
+ handleNSSMFWFResponse(httpResponse, execution)
+
+ } catch (BpmnError e) {
+ throw e
+ } catch (any) {
+ String msg = "Exception in DeleteCommunicationService.preRequestSend2NSMF. " + any.getCause()
+ LOGGER.error(msg)
+ exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg)
+ }
+
+ LOGGER.trace("exit preRequestSend2NSMF")
+ }
+
+ /**
+ * prepare to call sub process
+ * @param execution
+ */
+ void prepareCallCheckProcessStatus(DelegateExecution execution)
+ {
+ LOGGER.debug(PREFIX + "prepareCallCheckProcessStatus Start")
+
+ def successConditions = new ArrayList<>()
+ successConditions.add("finished")
+ execution.setVariable("successConditions", successConditions)
+
+ def errorConditions = new ArrayList<>()
+ errorConditions.add("error")
+ execution.setVariable("errorConditions", errorConditions)
+
+ execution.setVariable("processServiceType", "communication service")
+ execution.setVariable("subOperationType", "DELETE")
+ execution.setVariable("initProgress", 20)
+ execution.setVariable("endProgress",90)
+
+ execution.setVariable("timeOut", TIMEOUT)
+
+ LOGGER.debug(PREFIX + "prepareCallCheckProcessStatus Exit")
+ }
+
+ /**
+ * delete communication profile from AAI
+ * @param execution
+ */
+ void delCSProfileFromAAI(DelegateExecution execution)
+ {
+ LOGGER.debug("start delete communication service profile from AAI")
+ String globalSubscriberId = execution.getVariable("globalSubscriberId")
+ String serviceType = execution.getVariable("serviceType")
+ String serviceInstanceId = execution.getVariable("serviceInstanceId")
+
+ String profileId
+ try
+ {
+ AAIResourcesClient resourceClient = new AAIResourcesClient()
+ AAIResourceUri resourceUri = AAIUriFactory.createResourceUri(AAIObjectType.COMMUNICATION_PROFILE_ALL, globalSubscriberId, serviceType, serviceInstanceId)
+ AAIResultWrapper wrapper = resourceClient.get(resourceUri, NotFoundException.class)
+ Optional<CommunicationServiceProfiles> csProfilesOpt = wrapper.asBean(CommunicationServiceProfiles.class)
+ if(csProfilesOpt.isPresent()){
+ CommunicationServiceProfiles csProf
+ iles = csProfilesOpt.get()
+ CommunicationServiceProfile csProfile = csProfiles.getCommunicationServiceProfile().get(0)
+ profileId = csProfile ? csProfile.getProfileId() : ""
+ }
+ resourceUri = AAIUriFactory.createResourceUri(AAIObjectType.COMMUNICATION_SERVICE_PROFILE, globalSubscriberId, serviceType, serviceInstanceId, profileId)
+ if (!resourceClient.exists(resourceUri)) {
+ exceptionUtil.buildAndThrowWorkflowException(execution, 2500, "communication service profile was not found in aai")
+ }
+
+ resourceClient.delete(resourceUri)
+ LOGGER.debug("end delete communication service profile from AAI")
+ }
+ catch (any)
+ {
+ String msg = "delete communication service profile from aai failed! cause-"+any.getCause()
+ LOGGER.error(any.printStackTrace())
+ exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg);
+ }
+
+ }
+
+ /**
+ * delete communication service from AAI
+ * @param execution
+ */
+ void delCSFromAAI(DelegateExecution execution)
+ {
+ try
+ {
+ LOGGER.debug("start delete communication service from AAI")
+ AAIResourcesClient resourceClient = new AAIResourcesClient()
+ AAIResourceUri serviceInstanceUri = AAIUriFactory.createResourceUri(AAIObjectType.SERVICE_INSTANCE, execution.getVariable("globalSubscriberId"), execution.getVariable("serviceType"), execution.getVariable("serviceInstanceId"))
+ resourceClient.delete(serviceInstanceUri)
+
+ execution.setVariable("progress", "100")
+ execution.setVariable("result", "finished")
+ execution.setVariable("operationContent", "CSMF completes service terminated.")
+ setOperationStatus(execution)
+ LOGGER.debug("end delete communication service from AAI")
+ }
+ catch (any)
+ {
+ LOGGER.error("Error occured within delCSFromAAI method, cause: ${any.getCause()} ")
+ exceptionUtil.buildAndThrowWorkflowException(execution, 2500, "Error occured during delete communication service from aai")
+ }
+ }
+
+ void sendSyncError(DelegateExecution execution)
+ {
+ LOGGER.debug("Starting sendSyncError")
+
+ try {
+ String errorMessage
+ if (execution.getVariable("WorkflowException") instanceof WorkflowException) {
+ WorkflowException wfe = execution.getVariable("WorkflowException")
+ errorMessage = wfe.getErrorMessage()
+ } else {
+ errorMessage = "Sending Sync Error."
+ }
+
+ String buildworkflowException =
+ """<aetgt:WorkflowException xmlns:aetgt="http://org.onap/so/workflow/schema/v1">
+ <aetgt:ErrorMessage>${MsoUtils.xmlEscape(errorMessage)}</aetgt:ErrorMessage>
+ <aetgt:ErrorCode>7000</aetgt:ErrorCode>
+ </aetgt:WorkflowException>"""
+
+ LOGGER.debug(buildworkflowException)
+ sendWorkflowResponse(execution, 500, buildworkflowException)
+
+ } catch (Exception ex) {
+ LOGGER.error("Sending Sync Error Activity Failed. " + "\n" + ex.getMessage())
+ }
+ }
+
+ /**
+ * prepare update operation status
+ * @param execution
+ */
+ void preFailedOperationStatus(DelegateExecution execution)
+ {
+ LOGGER.debug(" ======== STARTED preFailedOperationStatus Process ======== ")
+
+ execution.setVariable("progress", "100")
+ execution.setVariable("result", "error")
+ execution.setVariable("operationContent", "terminate service failure")
+
+ WorkflowException wfex = execution.getVariable("WorkflowException") as WorkflowException
+ String errorMessage = wfex.getErrorMessage()
+ errorMessage = errorMessage.length() > 200 ? errorMessage.substring(0,200) + "......" : errorMessage
+ execution.setVariable("reason", errorMessage)
+ setOperationStatus(execution)
+
+ LOGGER.debug("======== COMPLETED prepareEndOperationStatus Process ======== ")
+ }
+
+ /**
+ * prepare Operation status
+ * @param execution
+ * @param operationType
+ */
+ private void setOperationStatus(DelegateExecution execution)
+ {
+ OperationStatus operationStatus = new OperationStatus()
+ operationStatus.setServiceId(execution.getVariable("serviceInstanceId"))
+ operationStatus.setOperationId(execution.getVariable("operationId"))
+ operationStatus.setUserId(execution.getVariable("globalSubscriberId"))
+ //interface not support update
+ operationStatus.setServiceName(execution.getVariable("serviceInstanceName"))
+ operationStatus.setResult(execution.getVariable("result"))
+ operationStatus.setProgress(execution.getVariable("progress"))
+ operationStatus.setOperationContent(execution.getVariable("operationContent"))
+ operationStatus.setReason(execution.getVariable("reason")?:"")
+ operationStatus.setOperation("DELETE")
+
+ requestDBUtil.prepareUpdateOperationStatus(execution, operationStatus)
+ }
+
+ void prepareFailureStatus(DelegateExecution execution)
+ {
+ execution.setVariable("progress", "100")
+ execution.setVariable("operationContent", "terminate service failure.")
+ setOperationStatus(execution)
+ LOGGER.debug("${PREFIX}-prepareFailureStatus,result:${execution.getVariable("result")}, reason: ${execution.getVariable("reason")}")
+ }
+
+ /**
+ * check request json and save parameter to execution
+ * @param siRequest
+ * @param paraName
+ * @param isErrorException
+ * @param execution
+ */
+ private void checkAndSetRequestParam(String siRequest, String paraName, boolean isErrorException, DelegateExecution execution)
+ {
+ String msg = ""
+ String paramValue = jsonUtil.getJsonValue(siRequest, paraName)
+ if (isBlank(paramValue)) {
+ msg = "Input ${paraName} is null"
+ LOGGER.error(msg)
+ if(isErrorException)
+ {
+ exceptionUtil.buildAndThrowWorkflowException(execution, 500, msg)
+ }
+
+ } else {
+ execution.setVariable(paraName, paramValue)
+ }
+ }
+}
diff --git a/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DeleteSliceService.groovy b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DeleteSliceService.groovy
new file mode 100644
index 0000000000..f0d43cf8d7
--- /dev/null
+++ b/bpmn/so-bpmn-infrastructure-common/src/main/groovy/org/onap/so/bpmn/infrastructure/scripts/DeleteSliceService.groovy
@@ -0,0 +1,263 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (c) 2019, CMCC Technologies Co., Ltd.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.bpmn.infrastructure.scripts
+
+import org.camunda.bpm.engine.delegate.BpmnError
+import org.camunda.bpm.engine.delegate.DelegateExecution
+import org.onap.aai.domain.yang.ServiceProfile
+import org.onap.aai.domain.yang.ServiceProfiles
+import org.onap.so.bpmn.common.scripts.AbstractServiceTaskProcessor
+import org.onap.so.bpmn.common.scripts.ExceptionUtil
+import org.onap.so.bpmn.common.scripts.MsoUtils
+import org.onap.so.bpmn.common.scripts.RequestDBUtil
+import org.onap.so.bpmn.core.WorkflowException
+import org.onap.so.bpmn.core.json.JsonUtils
+import org.onap.so.client.aai.AAIObjectType
+import org.onap.so.client.aai.AAIResourcesClient
+import org.onap.so.client.aai.entities.AAIResultWrapper
+import org.onap.so.client.aai.entities.uri.AAIResourceUri
+import org.onap.so.client.aai.entities.uri.AAIUriFactory
+import org.onap.so.db.request.beans.OperationStatus
+import org.slf4j.Logger
+import org.slf4j.LoggerFactory
+
+import javax.ws.rs.NotFoundException
+
+import static org.apache.commons.lang3.StringUtils.isBlank
+
+class DeleteSliceService extends AbstractServiceTaskProcessor {
+
+ String Prefix="DELSS_"
+ ExceptionUtil exceptionUtil = new ExceptionUtil()
+ JsonUtils jsonUtil = new JsonUtils()
+ private RequestDBUtil requestDBUtil = new RequestDBUtil()
+
+ private static final Logger logger = LoggerFactory.getLogger( DeleteSliceService.class)
+
+ @Override
+ void preProcessRequest(DelegateExecution execution) {
+ execution.setVariable("prefix", Prefix)
+ String msg = ""
+
+ logger.trace("Starting preProcessRequest")
+
+ try {
+ // check for incoming json message/input
+ String siRequest = execution.getVariable("bpmnRequest")
+ String requestId = execution.getVariable("mso-request-id")
+ execution.setVariable("msoRequestId", requestId)
+
+ //e2eslice-service instance id
+ String serviceInstanceId = execution.getVariable("serviceInstanceId")
+ if (isBlank(serviceInstanceId)) {
+ msg = "e2eslice-service id is null"
+ exceptionUtil.buildAndThrowWorkflowException(execution, 500, msg)
+ }
+ logger.info("Input Request: ${siRequest}, reqId: ${requestId}, e2eslice-service: ${serviceInstanceId}")
+
+ //subscriberInfo
+ checkAndSetRequestParam(siRequest,"globalSubscriberId",false, execution)
+ checkAndSetRequestParam(siRequest,"serviceType",false, execution)
+ checkAndSetRequestParam(siRequest,"operationId",false, execution)
+
+ //prepare init operation status
+ execution.setVariable("progress", "0")
+ execution.setVariable("result", "processing")
+ execution.setVariable("operationType", "DELETE")
+ execution.setVariable("operationContent", "Prepare init service")
+ updateServiceOperationStatus(execution)
+
+ } catch (BpmnError e) {
+ throw e
+ } catch (Exception ex) {
+ msg = "Exception in preProcessRequest " + ex.getMessage()
+ logger.debug(msg)
+ exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg)
+ }
+ logger.trace("Exit preProcessRequest")
+ }
+
+ /**
+ * send asynchronous response
+ * @param execution
+ */
+ void sendAsyncResponse(DelegateExecution execution) {
+ logger.trace("Staring sendSyncResponse")
+
+ try {
+ String operationId = execution.getVariable("operationId")
+ String syncResponse = """{"operationId":"${operationId}"}""".trim()
+ logger.info("sendSynchResponse: xmlSyncResponse - " + "\n" + syncResponse)
+ sendWorkflowResponse(execution, 202, syncResponse)
+
+ } catch (Exception ex) {
+ String msg = "Exception in sendSyncResponse: " + ex.getMessage()
+ exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg)
+ }
+ logger.trace("Exit sendSyncResponse")
+ }
+
+ /**
+ * Deletes the slice service instance in aai
+ */
+ void deleteSliceServiceInstance(DelegateExecution execution) {
+ logger.trace("Entered deleteSliceServiceInstance")
+ try {
+
+ AAIResourcesClient resourceClient = new AAIResourcesClient()
+ AAIResourceUri serviceInstanceUri = AAIUriFactory.createResourceUri(AAIObjectType.SERVICE_INSTANCE, execution.getVariable("globalSubscriberId"), execution.getVariable("serviceType"), execution.getVariable("serviceInstanceId"))
+ resourceClient.delete(serviceInstanceUri)
+
+ execution.setVariable("progress", "100")
+ execution.setVariable("result", "finished")
+ execution.setVariable("operationContent", "NSMF completes slicing service termination.")
+ updateServiceOperationStatus(execution)
+
+ logger.trace("Exited deleteSliceServiceInstance")
+ }catch(Exception e){
+ logger.debug("Error occured within deleteSliceServiceInstance method: " + e)
+ exceptionUtil.buildAndThrowWorkflowException(execution, 2500, "Error occured during deleteSliceServiceInstance from aai")
+ }
+ }
+
+ /**
+ * update operation status
+ * @param execution
+ */
+ private void updateServiceOperationStatus(DelegateExecution execution){
+
+ OperationStatus operationStatus = new OperationStatus()
+ operationStatus.setServiceId(execution.getVariable("serviceInstanceId"))
+ operationStatus.setOperationId(execution.getVariable("operationId"))
+ operationStatus.setUserId(execution.getVariable("globalSubscriberId"))
+ operationStatus.setResult(execution.getVariable("result"))
+ operationStatus.setProgress(execution.getVariable("progress"))
+ operationStatus.setOperationContent(execution.getVariable("operationContent"))
+ operationStatus.setReason(execution.getVariable("reason"))
+ operationStatus.setOperation(execution.getVariable("operationType"))
+
+ requestDBUtil.prepareUpdateOperationStatus(execution, operationStatus)
+ }
+
+ /**
+ * delete service profile from aai
+ * @param execution
+ */
+ private void delServiceProfileFromAAI(DelegateExecution execution)
+ {
+ String globalSubscriberId = execution.getVariable("globalSubscriberId")
+ String serviceType = execution.getVariable("serviceType")
+ String serviceInstanceId = execution.getVariable("serviceInstanceId")
+ String profileId = ""
+
+ try
+ {
+ AAIResourcesClient resourceClient = new AAIResourcesClient()
+ AAIResourceUri resourceUri = AAIUriFactory.createResourceUri(AAIObjectType.SERVICE_PROFILE_ALL, globalSubscriberId, serviceType, serviceInstanceId)
+ AAIResultWrapper wrapper = resourceClient.get(resourceUri, NotFoundException.class)
+ Optional<ServiceProfiles> serviceProfilesOpt =wrapper.asBean(ServiceProfiles.class)
+ if(serviceProfilesOpt.isPresent()){
+ ServiceProfiles serviceProfiles = serviceProfilesOpt.get()
+ ServiceProfile serviceProfile = serviceProfiles.getServiceProfile().get(0)
+ profileId = serviceProfile ? serviceProfile.getProfileId() : ""
+ }
+ resourceUri = AAIUriFactory.createResourceUri(AAIObjectType.SERVICE_PROFILE, globalSubscriberId, serviceType, serviceInstanceId, profileId)
+ if (!resourceClient.exists(resourceUri)) {
+ exceptionUtil.buildAndThrowWorkflowException(execution, 2500, "Service Instance was not found in aai")
+ }
+ resourceClient.delete(resourceUri)
+ }
+ catch (any)
+ {
+ String msg = "delete service profile from aai failed! cause-"+any.getCause()
+ logger.error(any.printStackTrace())
+ exceptionUtil.buildAndThrowWorkflowException(execution, 7000, msg);
+ }
+ }
+
+ void sendSyncError(DelegateExecution execution) {
+ logger.info("Starting sendSyncError")
+
+ try {
+ String errorMessage
+ if (execution.getVariable("WorkflowException") instanceof WorkflowException) {
+ WorkflowException wfe = execution.getVariable("WorkflowException")
+ errorMessage = wfe.getErrorMessage()
+ } else {
+ errorMessage = "Sending Sync Error."
+ }
+
+ String buildworkflowException =
+ """<aetgt:WorkflowException xmlns:aetgt="http://org.onap/so/workflow/schema/v1">
+ <aetgt:ErrorMessage>${MsoUtils.xmlEscape(errorMessage)}</aetgt:ErrorMessage>
+ <aetgt:ErrorCode>7000</aetgt:ErrorCode>
+ </aetgt:WorkflowException>"""
+
+ logger.debug(buildworkflowException)
+ sendWorkflowResponse(execution, 500, buildworkflowException)
+
+ } catch (Exception ex) {
+ logger.error("Sending Sync Error Activity Failed. " + "\n" + ex.getMessage())
+ }
+
+ }
+
+ void prepareEndOperationStatus(DelegateExecution execution){
+ logger.debug(" ======== STARTED prepareEndOperationStatus Process ======== ")
+
+ execution.setVariable("progress", "100")
+ execution.setVariable("result", "error")
+ execution.setVariable("operationContent", "NSSMF Terminate service failure")
+
+ WorkflowException wfex = execution.getVariable("WorkflowException") as WorkflowException
+ String errorMessage = wfex.getErrorMessage()
+ errorMessage = errorMessage.length() > 200 ? errorMessage.substring(0,200) + "......" : errorMessage
+ execution.setVariable("reason",errorMessage)
+ updateServiceOperationStatus(execution)
+
+ logger.debug("======== COMPLETED prepareEndOperationStatus Process ======== ")
+ }
+
+ /**
+ * check parameters from request body
+ * set to execution
+ * @param siRequest
+ * @param paraName
+ * @param isErrorException
+ * @param execution
+ */
+ private void checkAndSetRequestParam(String siRequest, String paraName, boolean isErrorException, DelegateExecution execution)
+ {
+ String msg = ""
+ String paramValue = jsonUtil.getJsonValue(siRequest, paraName)
+ if (isBlank(paramValue)) {
+ msg = "Input ${paraName} is null"
+ logger.error(msg)
+ if(isErrorException)
+ {
+ exceptionUtil.buildAndThrowWorkflowException(execution, 500, msg)
+ }
+
+ } else {
+ execution.setVariable(paraName, paramValue)
+ }
+ }
+}
diff --git a/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/CreateSliceService.bpmn b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/CreateSliceService.bpmn
new file mode 100644
index 0000000000..3e1c1179bf
--- /dev/null
+++ b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/CreateSliceService.bpmn
@@ -0,0 +1,808 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<bpmn:definitions xmlns:bpmn="http://www.omg.org/spec/BPMN/20100524/MODEL" xmlns:bpmndi="http://www.omg.org/spec/BPMN/20100524/DI" xmlns:dc="http://www.omg.org/spec/DD/20100524/DC" xmlns:camunda="http://camunda.org/schema/1.0/bpmn" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xmlns:di="http://www.omg.org/spec/DD/20100524/DI" id="Definitions_1wio50w" targetNamespace="http://bpmn.io/schema/bpmn" exporter="Camunda Modeler" exporterVersion="3.1.2">
+ <bpmn:process id="Process_0r5eb97" isExecutable="true">
+ <bpmn:startEvent id="StartEvent_1nbljfd" name="Create Slice Service Creation Flow">
+ <bpmn:outgoing>SequenceFlow_03s744c</bpmn:outgoing>
+ </bpmn:startEvent>
+ <bpmn:intermediateCatchEvent id="IntermediateCatchEvent_0vilb24" name="Waiting for confirmation">
+ <bpmn:outgoing>SequenceFlow_1fk37v7</bpmn:outgoing>
+ <bpmn:linkEventDefinition id="LinkEventDefinition_197u5pe" name="WaitingForConfirmation" />
+ </bpmn:intermediateCatchEvent>
+ <bpmn:scriptTask id="ScriptTask_1tc44ge" name="PreProcess Incoming Request" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_03s744c</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_07e12rt</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def css= new CreateSliceService()
+css.preProcessRequest(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:scriptTask id="ScriptTask_1jgtb0y" name="Process User Options" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_1cv0wop</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_197cm2e</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def css = new CreateSliceService()
+css.processUserOptions(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:exclusiveGateway id="ExclusiveGateway_0elbczl" name="Continue Slice?" default="SequenceFlow_038lb9m">
+ <bpmn:incoming>SequenceFlow_197cm2e</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_12t5exy</bpmn:outgoing>
+ <bpmn:outgoing>SequenceFlow_038lb9m</bpmn:outgoing>
+ </bpmn:exclusiveGateway>
+ <bpmn:scriptTask id="ScriptTask_0l3d1ai" name="Process Decomposition" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_1t19ips</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0jrclmc</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def css = new CreateSliceService()
+css.processDecomposition(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:scriptTask id="ScriptTask_1eo3m4q" name="Get NST Selection" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_046irye</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_1o23s0i</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def css = new CreateSliceService()
+css.getNSTSelection(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:callActivity id="CallActivity_139l55g" name="Call DoCreateSliceServiceInstance&#10;" calledElement="DoCreateSliceServiceInstance">
+ <bpmn:extensionElements>
+ <camunda:in source="msoRequestId" target="msoRequestId" />
+ <camunda:in source="serviceInstanceId" target="serviceInstanceId" />
+ <camunda:in source="serviceInstanceName" target="serviceInstanceName" />
+ <camunda:in source="serviceModelInfo" target="serviceModelInfo" />
+ <camunda:in source="productFamilyId" target="productFamilyId" />
+ <camunda:in source="serviceInputParams" target="serviceInputParams" />
+ <camunda:in source="globalSubscriberId" target="globalSubscriberId" />
+ <camunda:in source="subscriptionServiceType" target="subscriptionServiceType" />
+ <camunda:in source="serviceType" target="serviceType" />
+ <camunda:in source="uuiRequest" target="uuiRequest" />
+ <camunda:in source="requestAction" target="operationType" />
+ <camunda:in source="operationId" target="operationId" />
+ <camunda:in source="serviceProfile" target="serviceProfile" />
+ <camunda:in source="sliceProfileTn" target="sliceProfileTn" />
+ <camunda:in source="sliceProfileCn" target="sliceProfileCn" />
+ <camunda:in source="sliceProfileAn" target="sliceProfileAn" />
+ <camunda:in source="sliceServiceDecomposition" target="sliceServiceDecomposition" />
+ <camunda:out source="WorkflowException" target="WorkflowException" />
+ <camunda:out source="rollbackData" target="rollbackData" />
+ <camunda:out source="rolledBack" target="rolledBack" />
+ <camunda:out source="allottedResourceId" target="allottedResourceId" />
+ <camunda:out source="serviceInstanceData" target="serviceInstanceData" />
+ </bpmn:extensionElements>
+ <bpmn:incoming>SequenceFlow_1p8vxo5</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_1g8m7tq</bpmn:outgoing>
+ </bpmn:callActivity>
+ <bpmn:intermediateThrowEvent id="IntermediateThrowEvent_1v96asi" name="Goto Waiting for Confirmation">
+ <bpmn:incoming>SequenceFlow_0it2g9j</bpmn:incoming>
+ <bpmn:linkEventDefinition id="LinkEventDefinition_0uj34dx" name="WaitingForConfirmation" />
+ </bpmn:intermediateThrowEvent>
+ <bpmn:scriptTask id="ScriptTask_0gb975b" name="Prepare Update Orchestration Task" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_1aaozcg</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_18kur12</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+execution.setVariable("taskStatus", "WaitingToConfirm")
+def css = new CreateSliceService()
+css.prepareUpdateOrchestrationTask(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:exclusiveGateway id="ExclusiveGateway_18eld2o" name="Is Slice Successful?" default="SequenceFlow_1c6ka9h">
+ <bpmn:incoming>SequenceFlow_0mlrlbv</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_1c6ka9h</bpmn:outgoing>
+ <bpmn:outgoing>SequenceFlow_0n4xku8</bpmn:outgoing>
+ </bpmn:exclusiveGateway>
+ <bpmn:endEvent id="EndEvent_0x406rw">
+ <bpmn:incoming>SequenceFlow_1c6ka9h</bpmn:incoming>
+ <bpmn:errorEventDefinition id="ErrorEventDefinition_0mlneuw" errorRef="Error_03akl5v" />
+ </bpmn:endEvent>
+ <bpmn:subProcess id="SubProcess_1yv9i68" name="Sub-process for FalloutHandler and Rollback" triggeredByEvent="true">
+ <bpmn:startEvent id="StartEvent_1omdx56">
+ <bpmn:outgoing>SequenceFlow_1w67v6s</bpmn:outgoing>
+ <bpmn:errorEventDefinition id="ErrorEventDefinition_06xcioh" />
+ </bpmn:startEvent>
+ <bpmn:endEvent id="EndEvent_1jx3026">
+ <bpmn:incoming>SequenceFlow_08mlzwz</bpmn:incoming>
+ </bpmn:endEvent>
+ <bpmn:scriptTask id="ScriptTask_1swzdpw" name="Handle Unexpected Error" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_1w67v6s</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_08mlzwz</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.common.scripts.*
+ExceptionUtil ex = new ExceptionUtil()
+ex.processJavaException(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:sequenceFlow id="SequenceFlow_1w67v6s" sourceRef="StartEvent_1omdx56" targetRef="ScriptTask_1swzdpw" />
+ <bpmn:sequenceFlow id="SequenceFlow_08mlzwz" sourceRef="ScriptTask_1swzdpw" targetRef="EndEvent_1jx3026" />
+ </bpmn:subProcess>
+ <bpmn:scriptTask id="ScriptTask_1ef3voz" name="Prepare Update Orchestration Task" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_0kixzdj</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0klb3ey</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+execution.setVariable("taskStatus", "Completed")
+def css = new CreateSliceService()
+css.prepareUpdateOrchestrationTask(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:endEvent id="EndEvent_05h01gx" name="End">
+ <bpmn:incoming>SequenceFlow_11rbv41</bpmn:incoming>
+ </bpmn:endEvent>
+ <bpmn:scriptTask id="ScriptTask_1xxag1o" name="Init Service Operation Status" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_07e12rt</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0t094g7</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def css = new CreateSliceService()
+css.prepareInitServiceOperationStatus(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:intermediateThrowEvent id="IntermediateThrowEvent_1ex8ke9" name="Goto Create Slice Service">
+ <bpmn:incoming>SequenceFlow_0jrclmc</bpmn:incoming>
+ <bpmn:linkEventDefinition id="LinkEventDefinition_0de65en" name="CreateSliceService" />
+ </bpmn:intermediateThrowEvent>
+ <bpmn:intermediateCatchEvent id="IntermediateCatchEvent_1wii8im" name="Create Slice Service">
+ <bpmn:outgoing>SequenceFlow_1o1tu0f</bpmn:outgoing>
+ <bpmn:linkEventDefinition id="LinkEventDefinition_1krpcdk" name="CreateSliceService" />
+ </bpmn:intermediateCatchEvent>
+ <bpmn:scriptTask id="ScriptTask_1ssh2l9" name="Prepare Update Service Oper Status((finish)" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_0lbdfmt</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_1qv8qw1</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+execution.setVariable("operationProgress", "100")
+execution.setVariable("operationResult", "finished")
+execution.setVariable("operationReason", "Slice completed")
+def css = new CreateSliceService()
+css.prepareUpdateServiceOperationStatus(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:serviceTask id="ServiceTask_0kd6p6p" name="Update Service Operation Status">
+ <bpmn:extensionElements>
+ <camunda:connector>
+ <camunda:inputOutput>
+ <camunda:inputParameter name="url">${CSSOS_dbAdapterEndpoint}</camunda:inputParameter>
+ <camunda:inputParameter name="headers">
+ <camunda:script scriptFormat="groovy">execution.getVariable("CSSOS_headerMap")</camunda:script>
+ </camunda:inputParameter>
+ <camunda:inputParameter name="payload">${CSSOS_updateServiceOperStatusRequest}</camunda:inputParameter>
+ <camunda:inputParameter name="method">POST</camunda:inputParameter>
+ <camunda:outputParameter name="CSSOS_dbResponseCode">${statusCode}</camunda:outputParameter>
+ <camunda:outputParameter name="CSSOS_dbResponse">${response}</camunda:outputParameter>
+ </camunda:inputOutput>
+ <camunda:connectorId>http-connector</camunda:connectorId>
+ </camunda:connector>
+ </bpmn:extensionElements>
+ <bpmn:incoming>SequenceFlow_0t094g7</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_046irye</bpmn:outgoing>
+ </bpmn:serviceTask>
+ <bpmn:callActivity id="CallActivity_1bnkmaz" name="Call Decompose Service" calledElement="DecomposeService">
+ <bpmn:extensionElements>
+ <camunda:in source="msoRequestId" target="msoRequestId" />
+ <camunda:in source="serviceInstanceId" target="serviceInstanceId" />
+ <camunda:in source="serviceModelInfo" target="serviceModelInfo" />
+ <camunda:in source="isDebugLogEnabled" target="isDebugLogEnabled" />
+ <camunda:out source="serviceDecomposition" target="sliceServiceDecomposition" />
+ <camunda:out source="WorkflowException" target="WorkflowException" />
+ </bpmn:extensionElements>
+ <bpmn:incoming>SequenceFlow_0q7yc2c</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_1t19ips</bpmn:outgoing>
+ </bpmn:callActivity>
+ <bpmn:scriptTask id="ScriptTask_0o2r07o" name="Prepare&#10;Decompose&#10;Service&#10;" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_1o23s0i</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0q7yc2c</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def dcsi= new CreateSliceService()
+dcsi.prepareDecomposeService(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:scriptTask id="ScriptTask_0b7senu" name="Prepare Create OrchestrationTask" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_1o1tu0f</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_1sq6kp6</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def css= new CreateSliceService()
+css.prepareCreateOrchestrationTask(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:callActivity id="CallActivity_0h88mep" name="Call HandleOrchestrationTask" calledElement="HandleOrchestrationTask">
+ <bpmn:extensionElements>
+ <camunda:out source="statusCode" target="CSSOT_dbResponseCode" />
+ <camunda:out source="response" target="CSSOT_dbResponse" />
+ <camunda:in source="CSSOT_taskId" target="taskId" />
+ <camunda:in source="msoRequestId" target="requestId" />
+ <camunda:in source="CSSOT_name" target="taskName" />
+ <camunda:in source="CSSOT_status" target="taskStatus" />
+ <camunda:in source="CSSOT_isManual" target="isManual" />
+ <camunda:in source="CSSOT_paramJson" target="paramJson" />
+ <camunda:in source="CSSOT_requestMethod" target="method" />
+ </bpmn:extensionElements>
+ <bpmn:incoming>SequenceFlow_1sq6kp6</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_1p8vxo5</bpmn:outgoing>
+ </bpmn:callActivity>
+ <bpmn:callActivity id="CallActivity_0n47zoh" name="Call HandleOrchestrationTask" calledElement="HandleOrchestrationTask">
+ <bpmn:extensionElements>
+ <camunda:out source="statusCode" target="CSSOT_dbResponseCode" />
+ <camunda:out source="response" target="CSSOT_dbResponse" />
+ <camunda:in source="CSSOT_taskId" target="taskId" />
+ <camunda:in source="msoRequestId" target="requestId" />
+ <camunda:in source="CSSOT_name" target="taskName" />
+ <camunda:in source="CSSOT_status" target="taskStatus" />
+ <camunda:in source="CSSOT_isManual" target="isManual" />
+ <camunda:in source="CSSOT_paramJson" target="paramJson" />
+ <camunda:in source="CSSOT_requestMethod" target="method" />
+ </bpmn:extensionElements>
+ <bpmn:incoming>SequenceFlow_18kur12</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0it2g9j</bpmn:outgoing>
+ </bpmn:callActivity>
+ <bpmn:scriptTask id="ScriptTask_12h8542" name="Prepare Update Orchestration Task" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_12t5exy</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0thd6ny</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+execution.setVariable("taskStatus", "Creating")
+def css = new CreateSliceService()
+css.prepareUpdateOrchestrationTask(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:callActivity id="CallActivity_0o89wmf" name="Call HandleOrchestrationTask" calledElement="HandleOrchestrationTask">
+ <bpmn:extensionElements>
+ <camunda:out source="statusCode" target="CSSOT_dbResponseCode" />
+ <camunda:out source="response" target="CSSOT_dbResponse" />
+ <camunda:in source="CSSOT_taskId" target="taskId" />
+ <camunda:in source="msoRequestId" target="requestId" />
+ <camunda:in source="CSSOT_name" target="taskName" />
+ <camunda:in source="CSSOT_status" target="taskStatus" />
+ <camunda:in source="CSSOT_isManual" target="isManual" />
+ <camunda:in source="CSSOT_paramJson" target="paramJson" />
+ <camunda:in source="CSSOT_requestMethod" target="method" />
+ </bpmn:extensionElements>
+ <bpmn:incoming>SequenceFlow_0thd6ny</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0477975</bpmn:outgoing>
+ </bpmn:callActivity>
+ <bpmn:callActivity id="CallActivity_0g98b71" name="Call HandleOrchestrationTask" calledElement="HandleOrchestrationTask">
+ <bpmn:extensionElements>
+ <camunda:out source="statusCode" target="CSSOT_dbResponseCode" />
+ <camunda:out source="response" target="CSSOT_dbResponse" />
+ <camunda:in source="CSSOT_taskId" target="taskId" />
+ <camunda:in source="msoRequestId" target="requestId" />
+ <camunda:in source="CSSOT_name" target="taskName" />
+ <camunda:in source="CSSOT_status" target="taskStatus" />
+ <camunda:in source="CSSOT_isManual" target="isManual" />
+ <camunda:in source="CSSOT_paramJson" target="paramJson" />
+ <camunda:in source="CSSOT_requestMethod" target="method" />
+ </bpmn:extensionElements>
+ <bpmn:incoming>SequenceFlow_0h2oree</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_1cv0wop</bpmn:outgoing>
+ </bpmn:callActivity>
+ <bpmn:scriptTask id="ScriptTask_08wim95" name="Prepare Get User Options" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_16uz2t9</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0h2oree</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def css = new CreateSliceService()
+css.prepareGetUserOptions(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:callActivity id="CallActivity_0jdzpem" name="Call HandleOrchestrationTask" calledElement="HandleOrchestrationTask">
+ <bpmn:extensionElements>
+ <camunda:out source="statusCode" target="CSSOT_dbResponseCode" />
+ <camunda:out source="response" target="CSSOT_dbResponse" />
+ <camunda:in source="CSSOT_taskId" target="taskId" />
+ <camunda:in source="msoRequestId" target="requestId" />
+ <camunda:in source="CSSOT_name" target="taskName" />
+ <camunda:in source="CSSOT_status" target="taskStatus" />
+ <camunda:in source="CSSOT_isManual" target="isManual" />
+ <camunda:in source="CSSOT_paramJson" target="paramJson" />
+ <camunda:in source="CSSOT_requestMethod" target="method" />
+ </bpmn:extensionElements>
+ <bpmn:incoming>SequenceFlow_19lsayh</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_10ng1vx</bpmn:outgoing>
+ </bpmn:callActivity>
+ <bpmn:scriptTask id="ScriptTask_1mscu5w" name="Prepare Update Orchestration Task" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_038lb9m</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_19lsayh</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+execution.setVariable("taskStatus", "Aborted")
+def css = new CreateSliceService()
+css.prepareUpdateOrchestrationTask(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:intermediateCatchEvent id="IntermediateCatchEvent_0pkvfun" name="Allocate Slice">
+ <bpmn:outgoing>SequenceFlow_1bevt3a</bpmn:outgoing>
+ <bpmn:linkEventDefinition id="LinkEventDefinition_1vlfclx" name="AllocateSlice" />
+ </bpmn:intermediateCatchEvent>
+ <bpmn:intermediateThrowEvent id="IntermediateThrowEvent_0ktwpki" name="Goto Allocate Slice">
+ <bpmn:incoming>SequenceFlow_0477975</bpmn:incoming>
+ <bpmn:linkEventDefinition id="LinkEventDefinition_16f2ri9" name="AllocateSlice" />
+ </bpmn:intermediateThrowEvent>
+ <bpmn:callActivity id="CallActivity_15pl4ld" name="Call HandleOrchestrationTask" calledElement="HandleOrchestrationTask">
+ <bpmn:extensionElements>
+ <camunda:out source="statusCode" target="CSSOT_dbResponseCode" />
+ <camunda:out source="response" target="CSSOT_dbResponse" />
+ <camunda:in source="CSSOT_taskId" target="taskId" />
+ <camunda:in source="msoRequestId" target="requestId" />
+ <camunda:in source="CSSOT_name" target="taskName" />
+ <camunda:in source="CSSOT_status" target="taskStatus" />
+ <camunda:in source="CSSOT_isManual" target="isManual" />
+ <camunda:in source="CSSOT_paramJson" target="paramJson" />
+ <camunda:in source="CSSOT_requestMethod" target="method" />
+ </bpmn:extensionElements>
+ <bpmn:incoming>SequenceFlow_0klb3ey</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0lbdfmt</bpmn:outgoing>
+ </bpmn:callActivity>
+ <bpmn:endEvent id="EndEvent_1oouvuh" name="End">
+ <bpmn:incoming>SequenceFlow_10ng1vx</bpmn:incoming>
+ </bpmn:endEvent>
+ <bpmn:serviceTask id="ServiceTask_0esr949" name="Update Service Operation Status">
+ <bpmn:extensionElements>
+ <camunda:connector>
+ <camunda:inputOutput>
+ <camunda:inputParameter name="url">${CSSOS_dbAdapterEndpoint}</camunda:inputParameter>
+ <camunda:inputParameter name="headers">
+ <camunda:script scriptFormat="groovy">execution.getVariable("CSSOS_headerMap")</camunda:script>
+ </camunda:inputParameter>
+ <camunda:inputParameter name="payload">${CSSOS_updateServiceOperStatusRequest}</camunda:inputParameter>
+ <camunda:inputParameter name="method">POST</camunda:inputParameter>
+ <camunda:outputParameter name="CSSOS_dbResponseCode">${statusCode}</camunda:outputParameter>
+ <camunda:outputParameter name="CSSOS_dbResponse">${response}</camunda:outputParameter>
+ </camunda:inputOutput>
+ <camunda:connectorId>http-connector</camunda:connectorId>
+ </camunda:connector>
+ </bpmn:extensionElements>
+ <bpmn:incoming>SequenceFlow_1qv8qw1</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_11rbv41</bpmn:outgoing>
+ </bpmn:serviceTask>
+ <bpmn:scriptTask id="ScriptTask_1jj846g" name="Send Sync Ack Response" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_1g8m7tq</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_1ey6m1e</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def css = new CreateSliceService()
+css.sendSyncResponse(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:callActivity id="CallActivity_0cxst1i" name="Call DoAllocateNSIandNSSI&#10;" calledElement="DoAllocateNSIandNSSI">
+ <bpmn:extensionElements>
+ <camunda:in source="msoRequestId" target="msoRequestId" />
+ <camunda:in source="serviceInstanceId" target="sliceServiceInstanceId" />
+ <camunda:in source="serviceInstanceName" target="sliceServiceInstanceName" />
+ <camunda:in source="serviceModelInfo" target="serviceModelInfo" />
+ <camunda:in source="productFamilyId" target="productFamilyId" />
+ <camunda:in source="disableRollback" target="disableRollback" />
+ <camunda:in source="serviceInputParams" target="serviceInputParams" />
+ <camunda:in source="globalSubscriberId" target="globalSubscriberId" />
+ <camunda:in source="subscriptionServiceType" target="subscriptionServiceType" />
+ <camunda:in source="serviceType" target="serviceType" />
+ <camunda:in source="uuiRequest" target="uuiRequest" />
+ <camunda:in source="requestAction" target="operationType" />
+ <camunda:in source="operationId" target="operationId" />
+ <camunda:in source="serviceProfile" target="serviceProfile" />
+ <camunda:in source="sliceProfileTn" target="sliceProfileTn" />
+ <camunda:in source="sliceProfileCn" target="sliceProfileCn" />
+ <camunda:in source="sliceProfileAn" target="sliceProfileAn" />
+ <camunda:in source="sliceTaskParams" target="sliceTaskParams" />
+ <camunda:in source="CSSOT_taskId" target="taskId" />
+ <camunda:in source="CSSOT_name" target="taskName" />
+ <camunda:in source="CSSOT_status" target="taskStatus" />
+ <camunda:in source="CSSOT_isManual" target="isManual" />
+ <camunda:in source="resourceSharingLevel" target="resourceSharingLevel" />
+ <camunda:in source="globalSubscriberId" target="globalSubscriberId" />
+ <camunda:out source="WorkflowException" target="WorkflowException" />
+ <camunda:out source="rollbackData" target="rollbackData" />
+ <camunda:out source="rolledBack" target="rolledBack" />
+ <camunda:in source="allottedResourceId" target="allottedResourceId" />
+ </bpmn:extensionElements>
+ <bpmn:incoming>SequenceFlow_1bevt3a</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0mlrlbv</bpmn:outgoing>
+ </bpmn:callActivity>
+ <bpmn:endEvent id="EndEvent_0bh0kwx">
+ <bpmn:incoming>SequenceFlow_12qt5ci</bpmn:incoming>
+ <bpmn:errorEventDefinition id="ErrorEventDefinition_1xa66sx" errorRef="Error_0p2naox" />
+ </bpmn:endEvent>
+ <bpmn:sequenceFlow id="SequenceFlow_03s744c" sourceRef="StartEvent_1nbljfd" targetRef="ScriptTask_1tc44ge" />
+ <bpmn:sequenceFlow id="SequenceFlow_07e12rt" sourceRef="ScriptTask_1tc44ge" targetRef="ScriptTask_1xxag1o" />
+ <bpmn:sequenceFlow id="SequenceFlow_1cv0wop" sourceRef="CallActivity_0g98b71" targetRef="ScriptTask_1jgtb0y" />
+ <bpmn:sequenceFlow id="SequenceFlow_197cm2e" sourceRef="ScriptTask_1jgtb0y" targetRef="ExclusiveGateway_0elbczl" />
+ <bpmn:sequenceFlow id="SequenceFlow_12t5exy" name="continue" sourceRef="ExclusiveGateway_0elbczl" targetRef="ScriptTask_12h8542">
+ <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("taskAction") == "commit"}</bpmn:conditionExpression>
+ </bpmn:sequenceFlow>
+ <bpmn:sequenceFlow id="SequenceFlow_038lb9m" name="abort" sourceRef="ExclusiveGateway_0elbczl" targetRef="ScriptTask_1mscu5w" />
+ <bpmn:sequenceFlow id="SequenceFlow_1t19ips" sourceRef="CallActivity_1bnkmaz" targetRef="ScriptTask_0l3d1ai" />
+ <bpmn:sequenceFlow id="SequenceFlow_1p8vxo5" sourceRef="CallActivity_0h88mep" targetRef="CallActivity_139l55g" />
+ <bpmn:sequenceFlow id="SequenceFlow_1g8m7tq" sourceRef="CallActivity_139l55g" targetRef="ScriptTask_1jj846g" />
+ <bpmn:sequenceFlow id="SequenceFlow_0it2g9j" sourceRef="CallActivity_0n47zoh" targetRef="IntermediateThrowEvent_1v96asi" />
+ <bpmn:sequenceFlow id="SequenceFlow_18kur12" sourceRef="ScriptTask_0gb975b" targetRef="CallActivity_0n47zoh" />
+ <bpmn:sequenceFlow id="SequenceFlow_0mlrlbv" sourceRef="CallActivity_0cxst1i" targetRef="ExclusiveGateway_18eld2o" />
+ <bpmn:sequenceFlow id="SequenceFlow_1c6ka9h" name="No" sourceRef="ExclusiveGateway_18eld2o" targetRef="EndEvent_0x406rw" />
+ <bpmn:sequenceFlow id="SequenceFlow_0n4xku8" name="Yes" sourceRef="ExclusiveGateway_18eld2o" targetRef="ScriptTask_19uxoi8">
+ <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{execution.getVariable("WorkflowException") == null}</bpmn:conditionExpression>
+ </bpmn:sequenceFlow>
+ <bpmn:sequenceFlow id="SequenceFlow_0klb3ey" sourceRef="ScriptTask_1ef3voz" targetRef="CallActivity_15pl4ld" />
+ <bpmn:sequenceFlow id="SequenceFlow_11rbv41" sourceRef="ServiceTask_0esr949" targetRef="EndEvent_05h01gx" />
+ <bpmn:sequenceFlow id="SequenceFlow_0t094g7" sourceRef="ScriptTask_1xxag1o" targetRef="ServiceTask_0kd6p6p" />
+ <bpmn:sequenceFlow id="SequenceFlow_1o1tu0f" sourceRef="IntermediateCatchEvent_1wii8im" targetRef="ScriptTask_0b7senu" />
+ <bpmn:sequenceFlow id="SequenceFlow_0lbdfmt" sourceRef="CallActivity_15pl4ld" targetRef="ScriptTask_1ssh2l9" />
+ <bpmn:sequenceFlow id="SequenceFlow_1qv8qw1" sourceRef="ScriptTask_1ssh2l9" targetRef="ServiceTask_0esr949" />
+ <bpmn:sequenceFlow id="SequenceFlow_0q7yc2c" sourceRef="ScriptTask_0o2r07o" targetRef="CallActivity_1bnkmaz" />
+ <bpmn:sequenceFlow id="SequenceFlow_1sq6kp6" sourceRef="ScriptTask_0b7senu" targetRef="CallActivity_0h88mep" />
+ <bpmn:sequenceFlow id="SequenceFlow_0thd6ny" sourceRef="ScriptTask_12h8542" targetRef="CallActivity_0o89wmf" />
+ <bpmn:sequenceFlow id="SequenceFlow_0477975" sourceRef="CallActivity_0o89wmf" targetRef="IntermediateThrowEvent_0ktwpki" />
+ <bpmn:sequenceFlow id="SequenceFlow_0h2oree" sourceRef="ScriptTask_08wim95" targetRef="CallActivity_0g98b71" />
+ <bpmn:sequenceFlow id="SequenceFlow_19lsayh" sourceRef="ScriptTask_1mscu5w" targetRef="CallActivity_0jdzpem" />
+ <bpmn:sequenceFlow id="SequenceFlow_10ng1vx" sourceRef="CallActivity_0jdzpem" targetRef="EndEvent_1oouvuh" />
+ <bpmn:sequenceFlow id="SequenceFlow_1bevt3a" sourceRef="IntermediateCatchEvent_0pkvfun" targetRef="CallActivity_0cxst1i" />
+ <bpmn:sequenceFlow id="SequenceFlow_1ey6m1e" sourceRef="ScriptTask_1jj846g" targetRef="CallActivity_0v4mw2x" />
+ <bpmn:receiveTask id="Task_1b5t88h" name="Waiting for confirmation" messageRef="Message_0c4b2r5">
+ <bpmn:incoming>SequenceFlow_1fk37v7</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_16uz2t9</bpmn:outgoing>
+ </bpmn:receiveTask>
+ <bpmn:sequenceFlow id="SequenceFlow_1fk37v7" sourceRef="IntermediateCatchEvent_0vilb24" targetRef="Task_1b5t88h" />
+ <bpmn:sequenceFlow id="SequenceFlow_16uz2t9" sourceRef="Task_1b5t88h" targetRef="ScriptTask_08wim95" />
+ <bpmn:boundaryEvent id="BoundaryEvent_0clo9pv" attachedToRef="Task_1b5t88h">
+ <bpmn:outgoing>SequenceFlow_12qt5ci</bpmn:outgoing>
+ <bpmn:timerEventDefinition>
+ <bpmn:timeDuration xsi:type="bpmn:tFormalExpression">PT2H</bpmn:timeDuration>
+ </bpmn:timerEventDefinition>
+ </bpmn:boundaryEvent>
+ <bpmn:sequenceFlow id="SequenceFlow_12qt5ci" sourceRef="BoundaryEvent_0clo9pv" targetRef="EndEvent_0bh0kwx" />
+ <bpmn:callActivity id="CallActivity_0v4mw2x" name="Call DoCreateSliceServiceOption&#10;" calledElement="DoCreateSliceServiceOption">
+ <bpmn:extensionElements>
+ <camunda:in source="nstModelUuid" target="nstModelUuid" />
+ <camunda:in source="nstModelInvariantUuid" target="nstModelInvariantUuid" />
+ <camunda:in source="serviceProfile" target="serviceProfile" />
+ <camunda:in source="sliceProfileTn" target="sliceProfileTn" />
+ <camunda:in source="msoRequestId" target="msoRequestId" />
+ <camunda:in source="sliceProfileCn" target="sliceProfileCn" />
+ <camunda:in source="sliceProfileAn" target="sliceProfileAn" />
+ <camunda:in source="sliceTaskParams" target="sliceTaskParams" />
+ <camunda:in source="resourceSharingLevel" target="resourceSharingLevel" />
+ <camunda:out source="sliceTaskParams" target="sliceTaskParams" />
+ <camunda:in source="globalSubscriberId" target="globalSubscriberId" />
+ <camunda:in source="subscriptionServiceType" target="subscriptionServiceType" />
+ <camunda:in source="serviceType" target="serviceType" />
+ </bpmn:extensionElements>
+ <bpmn:incoming>SequenceFlow_1ey6m1e</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_1aaozcg</bpmn:outgoing>
+ </bpmn:callActivity>
+ <bpmn:sequenceFlow id="SequenceFlow_1aaozcg" sourceRef="CallActivity_0v4mw2x" targetRef="ScriptTask_0gb975b" />
+ <bpmn:sequenceFlow id="SequenceFlow_046irye" sourceRef="ServiceTask_0kd6p6p" targetRef="ScriptTask_1eo3m4q" />
+ <bpmn:sequenceFlow id="SequenceFlow_1o23s0i" sourceRef="ScriptTask_1eo3m4q" targetRef="ScriptTask_0o2r07o" />
+ <bpmn:sequenceFlow id="SequenceFlow_0jrclmc" sourceRef="ScriptTask_0l3d1ai" targetRef="IntermediateThrowEvent_1ex8ke9" />
+ <bpmn:scriptTask id="ScriptTask_19uxoi8" name="Update AAI Status" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_0n4xku8</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0kixzdj</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+execution.setVariable("orchestrationStatus", "deactivated")
+def css = new CreateSliceService()
+css.updateAAIOrchStatus(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:sequenceFlow id="SequenceFlow_0kixzdj" sourceRef="ScriptTask_19uxoi8" targetRef="ScriptTask_1ef3voz" />
+ </bpmn:process>
+ <bpmn:message id="Message_0c4b2r5" name="SliceServiceTask" />
+ <bpmn:error id="Error_03akl5v" name="MSOWorkflowException" errorCode="MSOWorkflowException" />
+ <bpmn:error id="Error_0p2naox" name="MSOWorkflowException" errorCode="MSOWorkflowException" />
+ <bpmndi:BPMNDiagram id="BPMNDiagram_1">
+ <bpmndi:BPMNPlane id="BPMNPlane_1" bpmnElement="Process_0r5eb97">
+ <bpmndi:BPMNShape id="StartEvent_1nbljfd_di" bpmnElement="StartEvent_1nbljfd">
+ <dc:Bounds x="178" y="103" width="36" height="36" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="156" y="146" width="82" height="40" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="IntermediateCatchEvent_0vilb24_di" bpmnElement="IntermediateCatchEvent_0vilb24">
+ <dc:Bounds x="178" y="438" width="36" height="36" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="168" y="481" width="60" height="27" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_1tc44ge_di" bpmnElement="ScriptTask_1tc44ge">
+ <dc:Bounds x="285" y="81" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_1jgtb0y_di" bpmnElement="ScriptTask_1jgtb0y">
+ <dc:Bounds x="830" y="416" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ExclusiveGateway_0elbczl_di" bpmnElement="ExclusiveGateway_0elbczl" isMarkerVisible="true">
+ <dc:Bounds x="1040" y="431" width="50" height="50" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="1027" y="413" width="78" height="14" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_0l3d1ai_di" bpmnElement="ScriptTask_0l3d1ai">
+ <dc:Bounds x="1370" y="81" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_1eo3m4q_di" bpmnElement="ScriptTask_1eo3m4q">
+ <dc:Bounds x="830" y="81" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="CallActivity_139l55g_di" bpmnElement="CallActivity_139l55g">
+ <dc:Bounds x="645" y="249" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="IntermediateThrowEvent_1v96asi_di" bpmnElement="IntermediateThrowEvent_1v96asi">
+ <dc:Bounds x="1584" y="271" width="36" height="36" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="1567" y="312" width="81" height="27" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_0gb975b_di" bpmnElement="ScriptTask_0gb975b">
+ <dc:Bounds x="1193" y="249" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ExclusiveGateway_18eld2o_di" bpmnElement="ExclusiveGateway_18eld2o" isMarkerVisible="true">
+ <dc:Bounds x="488" y="776" width="50" height="50" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="483" y="746" width="60" height="27" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="EndEvent_0x406rw_di" bpmnElement="EndEvent_0x406rw">
+ <dc:Bounds x="495" y="926" width="36" height="36" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="SubProcess_1yv9i68_di" bpmnElement="SubProcess_1yv9i68" isExpanded="true">
+ <dc:Bounds x="685" y="1080" width="781" height="196" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_1ef3voz_di" bpmnElement="ScriptTask_1ef3voz">
+ <dc:Bounds x="823" y="761" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="EndEvent_05h01gx_di" bpmnElement="EndEvent_05h01gx">
+ <dc:Bounds x="1585" y="783" width="36" height="36" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="1593" y="826" width="20" height="14" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_1xxag1o_di" bpmnElement="ScriptTask_1xxag1o">
+ <dc:Bounds x="468" y="81" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="IntermediateThrowEvent_1ex8ke9_di" bpmnElement="IntermediateThrowEvent_1ex8ke9">
+ <dc:Bounds x="1584" y="103" width="36" height="36" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="1564" y="144" width="87" height="27" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="IntermediateCatchEvent_1wii8im_di" bpmnElement="IntermediateCatchEvent_1wii8im">
+ <dc:Bounds x="178" y="271" width="36" height="36" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="171" y="314" width="60" height="27" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_1ssh2l9_di" bpmnElement="ScriptTask_1ssh2l9">
+ <dc:Bounds x="1197" y="761" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ServiceTask_0kd6p6p_di" bpmnElement="ServiceTask_0kd6p6p">
+ <dc:Bounds x="645" y="81" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="CallActivity_1bnkmaz_di" bpmnElement="CallActivity_1bnkmaz">
+ <dc:Bounds x="1193" y="81" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_0o2r07o_di" bpmnElement="ScriptTask_0o2r07o">
+ <dc:Bounds x="1015" y="81" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_0b7senu_di" bpmnElement="ScriptTask_0b7senu">
+ <dc:Bounds x="285" y="249" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="CallActivity_0h88mep_di" bpmnElement="CallActivity_0h88mep">
+ <dc:Bounds x="467" y="249" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="CallActivity_0n47zoh_di" bpmnElement="CallActivity_0n47zoh">
+ <dc:Bounds x="1371" y="249" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_12h8542_di" bpmnElement="ScriptTask_12h8542">
+ <dc:Bounds x="1193" y="416" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="CallActivity_0o89wmf_di" bpmnElement="CallActivity_0o89wmf">
+ <dc:Bounds x="1371" y="416" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="CallActivity_0g98b71_di" bpmnElement="CallActivity_0g98b71">
+ <dc:Bounds x="645" y="416" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_08wim95_di" bpmnElement="ScriptTask_08wim95">
+ <dc:Bounds x="467" y="416" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="CallActivity_0jdzpem_di" bpmnElement="CallActivity_0jdzpem">
+ <dc:Bounds x="1371" y="605" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_1mscu5w_di" bpmnElement="ScriptTask_1mscu5w">
+ <dc:Bounds x="1193" y="605" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="IntermediateCatchEvent_0pkvfun_di" bpmnElement="IntermediateCatchEvent_0pkvfun">
+ <dc:Bounds x="178" y="783" width="36" height="36" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="168" y="826" width="66" height="14" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="IntermediateThrowEvent_0ktwpki_di" bpmnElement="IntermediateThrowEvent_0ktwpki">
+ <dc:Bounds x="1584" y="438" width="36" height="36" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="1577" y="479" width="67" height="27" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="CallActivity_15pl4ld_di" bpmnElement="CallActivity_15pl4ld">
+ <dc:Bounds x="1005" y="761" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="EndEvent_1oouvuh_di" bpmnElement="EndEvent_1oouvuh">
+ <dc:Bounds x="1584" y="627" width="36" height="36" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="1592" y="670" width="20" height="14" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ServiceTask_0esr949_di" bpmnElement="ServiceTask_0esr949">
+ <dc:Bounds x="1375" y="761" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_1jj846g_di" bpmnElement="ScriptTask_1jj846g">
+ <dc:Bounds x="830" y="249" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="CallActivity_0cxst1i_di" bpmnElement="CallActivity_0cxst1i">
+ <dc:Bounds x="285" y="761" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="EndEvent_0bh0kwx_di" bpmnElement="EndEvent_0bh0kwx">
+ <dc:Bounds x="317" y="593" width="36" height="36" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_03s744c_di" bpmnElement="SequenceFlow_03s744c">
+ <di:waypoint x="214" y="121" />
+ <di:waypoint x="285" y="121" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_07e12rt_di" bpmnElement="SequenceFlow_07e12rt">
+ <di:waypoint x="385" y="121" />
+ <di:waypoint x="468" y="121" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_1cv0wop_di" bpmnElement="SequenceFlow_1cv0wop">
+ <di:waypoint x="745" y="456" />
+ <di:waypoint x="830" y="456" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_197cm2e_di" bpmnElement="SequenceFlow_197cm2e">
+ <di:waypoint x="930" y="456" />
+ <di:waypoint x="1040" y="456" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_12t5exy_di" bpmnElement="SequenceFlow_12t5exy">
+ <di:waypoint x="1090" y="456" />
+ <di:waypoint x="1193" y="456" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="1121.5" y="438" width="42" height="14" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_038lb9m_di" bpmnElement="SequenceFlow_038lb9m">
+ <di:waypoint x="1065" y="481" />
+ <di:waypoint x="1065" y="645" />
+ <di:waypoint x="1193" y="645" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="1067" y="560" width="27" height="14" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_1t19ips_di" bpmnElement="SequenceFlow_1t19ips">
+ <di:waypoint x="1293" y="121" />
+ <di:waypoint x="1370" y="121" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_1p8vxo5_di" bpmnElement="SequenceFlow_1p8vxo5">
+ <di:waypoint x="567" y="289" />
+ <di:waypoint x="645" y="289" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_1g8m7tq_di" bpmnElement="SequenceFlow_1g8m7tq">
+ <di:waypoint x="745" y="289" />
+ <di:waypoint x="830" y="289" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_0it2g9j_di" bpmnElement="SequenceFlow_0it2g9j">
+ <di:waypoint x="1471" y="289" />
+ <di:waypoint x="1584" y="289" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_18kur12_di" bpmnElement="SequenceFlow_18kur12">
+ <di:waypoint x="1293" y="289" />
+ <di:waypoint x="1371" y="289" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_0mlrlbv_di" bpmnElement="SequenceFlow_0mlrlbv">
+ <di:waypoint x="385" y="801" />
+ <di:waypoint x="488" y="801" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_1c6ka9h_di" bpmnElement="SequenceFlow_1c6ka9h">
+ <di:waypoint x="513" y="826" />
+ <di:waypoint x="513" y="926" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="521" y="832" width="15" height="14" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_0n4xku8_di" bpmnElement="SequenceFlow_0n4xku8">
+ <di:waypoint x="538" y="801" />
+ <di:waypoint x="645" y="801" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="584" y="783" width="18" height="14" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_0klb3ey_di" bpmnElement="SequenceFlow_0klb3ey">
+ <di:waypoint x="923" y="801" />
+ <di:waypoint x="1005" y="801" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_11rbv41_di" bpmnElement="SequenceFlow_11rbv41">
+ <di:waypoint x="1475" y="801" />
+ <di:waypoint x="1585" y="801" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_0t094g7_di" bpmnElement="SequenceFlow_0t094g7">
+ <di:waypoint x="568" y="121" />
+ <di:waypoint x="645" y="121" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_1o1tu0f_di" bpmnElement="SequenceFlow_1o1tu0f">
+ <di:waypoint x="214" y="289" />
+ <di:waypoint x="285" y="289" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_0lbdfmt_di" bpmnElement="SequenceFlow_0lbdfmt">
+ <di:waypoint x="1105" y="801" />
+ <di:waypoint x="1197" y="801" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_1qv8qw1_di" bpmnElement="SequenceFlow_1qv8qw1">
+ <di:waypoint x="1297" y="801" />
+ <di:waypoint x="1375" y="801" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_0q7yc2c_di" bpmnElement="SequenceFlow_0q7yc2c">
+ <di:waypoint x="1115" y="121" />
+ <di:waypoint x="1193" y="121" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_1sq6kp6_di" bpmnElement="SequenceFlow_1sq6kp6">
+ <di:waypoint x="385" y="289" />
+ <di:waypoint x="467" y="289" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_0thd6ny_di" bpmnElement="SequenceFlow_0thd6ny">
+ <di:waypoint x="1293" y="456" />
+ <di:waypoint x="1371" y="456" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_0477975_di" bpmnElement="SequenceFlow_0477975">
+ <di:waypoint x="1471" y="456" />
+ <di:waypoint x="1584" y="456" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_0h2oree_di" bpmnElement="SequenceFlow_0h2oree">
+ <di:waypoint x="567" y="456" />
+ <di:waypoint x="645" y="456" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_19lsayh_di" bpmnElement="SequenceFlow_19lsayh">
+ <di:waypoint x="1293" y="645" />
+ <di:waypoint x="1371" y="645" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_10ng1vx_di" bpmnElement="SequenceFlow_10ng1vx">
+ <di:waypoint x="1471" y="645" />
+ <di:waypoint x="1584" y="645" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_1bevt3a_di" bpmnElement="SequenceFlow_1bevt3a">
+ <di:waypoint x="214" y="801" />
+ <di:waypoint x="285" y="801" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_1ey6m1e_di" bpmnElement="SequenceFlow_1ey6m1e">
+ <di:waypoint x="930" y="289" />
+ <di:waypoint x="1015" y="289" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="StartEvent_1omdx56_di" bpmnElement="StartEvent_1omdx56">
+ <dc:Bounds x="715" y="1166" width="36" height="36" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="EndEvent_1jx3026_di" bpmnElement="EndEvent_1jx3026">
+ <dc:Bounds x="1353" y="1166" width="36" height="36" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_1swzdpw_di" bpmnElement="ScriptTask_1swzdpw">
+ <dc:Bounds x="979" y="1144" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_1w67v6s_di" bpmnElement="SequenceFlow_1w67v6s">
+ <di:waypoint x="751" y="1184" />
+ <di:waypoint x="979" y="1184" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_08mlzwz_di" bpmnElement="SequenceFlow_08mlzwz">
+ <di:waypoint x="1079" y="1184" />
+ <di:waypoint x="1353" y="1184" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="ReceiveTask_0zkpdpa_di" bpmnElement="Task_1b5t88h">
+ <dc:Bounds x="285" y="416" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_1fk37v7_di" bpmnElement="SequenceFlow_1fk37v7">
+ <di:waypoint x="214" y="456" />
+ <di:waypoint x="285" y="456" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_16uz2t9_di" bpmnElement="SequenceFlow_16uz2t9">
+ <di:waypoint x="385" y="456" />
+ <di:waypoint x="467" y="456" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="BoundaryEvent_15igwk2_di" bpmnElement="BoundaryEvent_0clo9pv">
+ <dc:Bounds x="317" y="478" width="36" height="36" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_12qt5ci_di" bpmnElement="SequenceFlow_12qt5ci">
+ <di:waypoint x="335" y="514" />
+ <di:waypoint x="335" y="611" />
+ <di:waypoint x="335" y="593" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="CallActivity_0v4mw2x_di" bpmnElement="CallActivity_0v4mw2x">
+ <dc:Bounds x="1015" y="249" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_1aaozcg_di" bpmnElement="SequenceFlow_1aaozcg">
+ <di:waypoint x="1115" y="289" />
+ <di:waypoint x="1193" y="289" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_046irye_di" bpmnElement="SequenceFlow_046irye">
+ <di:waypoint x="745" y="121" />
+ <di:waypoint x="830" y="121" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_1o23s0i_di" bpmnElement="SequenceFlow_1o23s0i">
+ <di:waypoint x="930" y="121" />
+ <di:waypoint x="1015" y="121" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_0jrclmc_di" bpmnElement="SequenceFlow_0jrclmc">
+ <di:waypoint x="1470" y="121" />
+ <di:waypoint x="1584" y="121" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="ScriptTask_19uxoi8_di" bpmnElement="ScriptTask_19uxoi8">
+ <dc:Bounds x="645" y="761" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_0kixzdj_di" bpmnElement="SequenceFlow_0kixzdj">
+ <di:waypoint x="745" y="801" />
+ <di:waypoint x="823" y="801" />
+ </bpmndi:BPMNEdge>
+ </bpmndi:BPMNPlane>
+ </bpmndi:BPMNDiagram>
+</bpmn:definitions>
+
diff --git a/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/DeleteCommunicationService.bpmn b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/DeleteCommunicationService.bpmn
new file mode 100644
index 0000000000..58a69621d3
--- /dev/null
+++ b/bpmn/so-bpmn-infrastructure-flows/src/main/resources/process/DeleteCommunicationService.bpmn
@@ -0,0 +1,523 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<bpmn:definitions xmlns:bpmn="http://www.omg.org/spec/BPMN/20100524/MODEL" xmlns:bpmndi="http://www.omg.org/spec/BPMN/20100524/DI" xmlns:dc="http://www.omg.org/spec/DD/20100524/DC" xmlns:di="http://www.omg.org/spec/DD/20100524/DI" xmlns:camunda="http://camunda.org/schema/1.0/bpmn" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" id="Definitions_1nvjixd" targetNamespace="http://bpmn.io/schema/bpmn" exporter="Camunda Modeler" exporterVersion="3.4.1">
+ <bpmn:process id="DeleteCommunicationService" name="DeleteCommunicationService" isExecutable="true">
+ <bpmn:startEvent id="StartEvent_1" name="start">
+ <bpmn:outgoing>SequenceFlow_1kjqnil</bpmn:outgoing>
+ </bpmn:startEvent>
+ <bpmn:sequenceFlow id="SequenceFlow_1kjqnil" sourceRef="StartEvent_1" targetRef="Task_1mqm4nb" />
+ <bpmn:sequenceFlow id="SequenceFlow_0ogievs" sourceRef="Task_1mqm4nb" targetRef="Task_0q2v7qe" />
+ <bpmn:sequenceFlow id="SequenceFlow_192yyii" sourceRef="Task_0q2v7qe" targetRef="Task_0zaekmn" />
+ <bpmn:serviceTask id="Task_0zaekmn" name="Init Service Operation Status">
+ <bpmn:extensionElements>
+ <camunda:connector>
+ <camunda:inputOutput>
+ <camunda:inputParameter name="url">${dbAdapterEndpoint}</camunda:inputParameter>
+ <camunda:inputParameter name="headers">
+ <camunda:map>
+ <camunda:entry key="content-type">application/soap+xml</camunda:entry>
+ <camunda:entry key="Authorization">Basic YnBlbDpwYXNzd29yZDEk</camunda:entry>
+ </camunda:map>
+ </camunda:inputParameter>
+ <camunda:inputParameter name="payload">${updateOperationStatus}</camunda:inputParameter>
+ <camunda:inputParameter name="method">POST</camunda:inputParameter>
+ <camunda:outputParameter name="CSMF_dbResponseCode">${statusCode}</camunda:outputParameter>
+ <camunda:outputParameter name="CSMF_dbResponse">${response}</camunda:outputParameter>
+ </camunda:inputOutput>
+ <camunda:connectorId>http-connector</camunda:connectorId>
+ </camunda:connector>
+ </bpmn:extensionElements>
+ <bpmn:incoming>SequenceFlow_192yyii</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0xvoume</bpmn:outgoing>
+ </bpmn:serviceTask>
+ <bpmn:scriptTask id="Task_0q2v7qe" name="Init Service Operation Status" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_0ogievs</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_192yyii</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def dcs= new DeleteCommunicationService()
+dcs.preInitUpdateOperationStatus(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:scriptTask id="Task_1mqm4nb" name="PreProcessRequest" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_1kjqnil</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0ogievs</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def dcs= new DeleteCommunicationService()
+dcs.preProcessRequest(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:scriptTask id="ScriptTask_1k5stey" name="Send Sync Ack Response" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_0xvoume</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_017qgen</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def dcs = new DeleteCommunicationService()
+dcs.sendSyncResponse(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:sequenceFlow id="SequenceFlow_0xvoume" sourceRef="Task_0zaekmn" targetRef="ScriptTask_1k5stey" />
+ <bpmn:sequenceFlow id="SequenceFlow_017qgen" sourceRef="ScriptTask_1k5stey" targetRef="Task_0ux5uk1" />
+ <bpmn:serviceTask id="Task_1kizznk" name="Update Service Operation Status">
+ <bpmn:extensionElements>
+ <camunda:connector>
+ <camunda:inputOutput>
+ <camunda:inputParameter name="url">${dbAdapterEndpoint}</camunda:inputParameter>
+ <camunda:inputParameter name="headers">
+ <camunda:map>
+ <camunda:entry key="content-type">application/soap+xml</camunda:entry>
+ <camunda:entry key="Authorization">Basic YnBlbDpwYXNzd29yZDEk</camunda:entry>
+ </camunda:map>
+ </camunda:inputParameter>
+ <camunda:inputParameter name="payload">${updateOperationStatus}</camunda:inputParameter>
+ <camunda:inputParameter name="method">POST</camunda:inputParameter>
+ <camunda:outputParameter name="CSMF_dbResponseCode">${statusCode}</camunda:outputParameter>
+ <camunda:outputParameter name="CSMF_dbResponse">${response}</camunda:outputParameter>
+ </camunda:inputOutput>
+ <camunda:connectorId>http-connector</camunda:connectorId>
+ </camunda:connector>
+ </bpmn:extensionElements>
+ <bpmn:incoming>SequenceFlow_0jrbkau</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_1ssiyug</bpmn:outgoing>
+ </bpmn:serviceTask>
+ <bpmn:serviceTask id="Task_0xwjycr" name="update operation status completed">
+ <bpmn:extensionElements>
+ <camunda:connector>
+ <camunda:inputOutput>
+ <camunda:inputParameter name="url">${dbAdapterEndpoint}</camunda:inputParameter>
+ <camunda:inputParameter name="headers">
+ <camunda:map>
+ <camunda:entry key="content-type">application/json</camunda:entry>
+ <camunda:entry key="Authorization">Basic YnBlbDpwYXNzd29yZDEk</camunda:entry>
+ </camunda:map>
+ </camunda:inputParameter>
+ <camunda:inputParameter name="payload">${updateOperationStatus}</camunda:inputParameter>
+ <camunda:inputParameter name="method">POST</camunda:inputParameter>
+ <camunda:outputParameter name="CSMF_dbResponseCode">${statusCode}</camunda:outputParameter>
+ <camunda:outputParameter name="CSMF_dbResponse">${response}</camunda:outputParameter>
+ </camunda:inputOutput>
+ <camunda:connectorId>http-connector</camunda:connectorId>
+ </camunda:connector>
+ </bpmn:extensionElements>
+ <bpmn:incoming>SequenceFlow_00g94pg</bpmn:incoming>
+ <bpmn:incoming>SequenceFlow_16ewagx</bpmn:incoming>
+ <bpmn:incoming>SequenceFlow_1amyd7h</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_10g2pnj</bpmn:outgoing>
+ </bpmn:serviceTask>
+ <bpmn:endEvent id="EndEvent_0ixagvk" name="end">
+ <bpmn:incoming>SequenceFlow_10g2pnj</bpmn:incoming>
+ </bpmn:endEvent>
+ <bpmn:sequenceFlow id="SequenceFlow_10g2pnj" sourceRef="Task_0xwjycr" targetRef="EndEvent_0ixagvk" />
+ <bpmn:scriptTask id="Task_0ux5uk1" name="Query CommunicationSerive From AAI" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_017qgen</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_1j0e2po</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def dcs = new DeleteCommunicationService()
+dcs.queryCommunicationSeriveFromAAI(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:intermediateThrowEvent id="IntermediateThrowEvent_0ce724z" name="Go to Query delete progress">
+ <bpmn:incoming>SequenceFlow_0bmtfxq</bpmn:incoming>
+ <bpmn:linkEventDefinition name="QueryDeleteProgress" />
+ </bpmn:intermediateThrowEvent>
+ <bpmn:intermediateCatchEvent id="IntermediateThrowEvent_11i33ob" name="QueryDeleteProgress">
+ <bpmn:outgoing>SequenceFlow_1tcgzv0</bpmn:outgoing>
+ <bpmn:linkEventDefinition name="QueryDeleteProgress" />
+ </bpmn:intermediateCatchEvent>
+ <bpmn:scriptTask id="Task_0qg5gn6" name="send request to NSMF WF" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_12xn3kz</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0bmtfxq</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def dcs = new DeleteCommunicationService()
+dcs.sendRequest2NSMFWF(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:sequenceFlow id="SequenceFlow_0bmtfxq" sourceRef="Task_0qg5gn6" targetRef="IntermediateThrowEvent_0ce724z" />
+ <bpmn:scriptTask id="Task_0qvxmnh" name="Delete CS Profile From AAI" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_0s7s7zk</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0arvpzv</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def dcs = new DeleteCommunicationService()
+dcs.delCSProfileFromAAI(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:sequenceFlow id="SequenceFlow_0arvpzv" sourceRef="Task_0qvxmnh" targetRef="Task_0b5j6rg" />
+ <bpmn:scriptTask id="Task_0b5j6rg" name="Delete CS From AAI" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_0arvpzv</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_00g94pg</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def dcs = new DeleteCommunicationService()
+dcs.delCSFromAAI(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:subProcess id="SubProcess_0p6namq" name="Exception Handling Sub-Process" triggeredByEvent="true">
+ <bpmn:startEvent id="StartEvent_1843894">
+ <bpmn:outgoing>SequenceFlow_1u5ko4h</bpmn:outgoing>
+ <bpmn:errorEventDefinition />
+ </bpmn:startEvent>
+ <bpmn:sequenceFlow id="SequenceFlow_1u5ko4h" sourceRef="StartEvent_1843894" targetRef="Task_1spbb2x" />
+ <bpmn:scriptTask id="Task_1spbb2x" name="Send Error Response" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_1u5ko4h</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_05yfw7t</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def dcs = new DeleteCommunicationService()
+dcs.sendSyncError(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:sequenceFlow id="SequenceFlow_05yfw7t" sourceRef="Task_1spbb2x" targetRef="Task_0yqtfvh" />
+ <bpmn:scriptTask id="Task_0yqtfvh" name="Pre update Failed Operation Status" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_05yfw7t</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0c0btia</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def dcs = new DeleteCommunicationService()
+dcs.preFailedOperationStatus(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:sequenceFlow id="SequenceFlow_0c0btia" sourceRef="Task_0yqtfvh" targetRef="Task_1s3l3fc" />
+ <bpmn:serviceTask id="Task_1s3l3fc" name="Update Service Operation Status">
+ <bpmn:extensionElements>
+ <camunda:connector>
+ <camunda:inputOutput>
+ <camunda:inputParameter name="url">${dbAdapterEndpoint}</camunda:inputParameter>
+ <camunda:inputParameter name="headers">
+ <camunda:map>
+ <camunda:entry key="content-type">application/soap+xml</camunda:entry>
+ <camunda:entry key="Authorization">Basic YnBlbDpwYXNzd29yZDEk</camunda:entry>
+ </camunda:map>
+ </camunda:inputParameter>
+ <camunda:inputParameter name="payload">${updateOperationStatus}</camunda:inputParameter>
+ <camunda:inputParameter name="method">POST</camunda:inputParameter>
+ <camunda:outputParameter name="CSMF_dbResponseCode">${statusCode}</camunda:outputParameter>
+ <camunda:outputParameter name="CSMF_dbResponse">${response}</camunda:outputParameter>
+ </camunda:inputOutput>
+ <camunda:connectorId>http-connector</camunda:connectorId>
+ </camunda:connector>
+ </bpmn:extensionElements>
+ <bpmn:incoming>SequenceFlow_0c0btia</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_1w55zo7</bpmn:outgoing>
+ </bpmn:serviceTask>
+ <bpmn:endEvent id="EndEvent_1fsful5">
+ <bpmn:incoming>SequenceFlow_1w55zo7</bpmn:incoming>
+ </bpmn:endEvent>
+ <bpmn:sequenceFlow id="SequenceFlow_1w55zo7" sourceRef="Task_1s3l3fc" targetRef="EndEvent_1fsful5" />
+ </bpmn:subProcess>
+ <bpmn:sequenceFlow id="SequenceFlow_1tcgzv0" sourceRef="IntermediateThrowEvent_11i33ob" targetRef="ExclusiveGateway_16tdrty" />
+ <bpmn:subProcess id="SubProcess_1l7gd5k" name="Sub-process for UnexpectedErrors" triggeredByEvent="true">
+ <bpmn:startEvent id="StartEvent_0zc2hnn">
+ <bpmn:outgoing>SequenceFlow_0mifi3x</bpmn:outgoing>
+ <bpmn:errorEventDefinition />
+ </bpmn:startEvent>
+ <bpmn:sequenceFlow id="SequenceFlow_0mifi3x" sourceRef="StartEvent_0zc2hnn" targetRef="Task_01va9ms" />
+ <bpmn:endEvent id="EndEvent_052gdjz">
+ <bpmn:incoming>SequenceFlow_073yxs4</bpmn:incoming>
+ </bpmn:endEvent>
+ <bpmn:sequenceFlow id="SequenceFlow_073yxs4" sourceRef="Task_01va9ms" targetRef="EndEvent_052gdjz" />
+ <bpmn:scriptTask id="Task_01va9ms" name="Handle Unexpected Error" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_0mifi3x</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_073yxs4</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.common.scripts.*
+ExceptionUtil ex = new ExceptionUtil()
+ex.processJavaException(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ </bpmn:subProcess>
+ <bpmn:exclusiveGateway id="ExclusiveGateway_1lyw619" name="Is NSMF timeout?" default="SequenceFlow_0s7s7zk">
+ <bpmn:incoming>SequenceFlow_0xipbpr</bpmn:incoming>
+ <bpmn:incoming>SequenceFlow_1sah9so</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0s7s7zk</bpmn:outgoing>
+ <bpmn:outgoing>SequenceFlow_0bqfbxf</bpmn:outgoing>
+ </bpmn:exclusiveGateway>
+ <bpmn:sequenceFlow id="SequenceFlow_0s7s7zk" sourceRef="ExclusiveGateway_1lyw619" targetRef="Task_0qvxmnh" />
+ <bpmn:sequenceFlow id="SequenceFlow_00g94pg" sourceRef="Task_0b5j6rg" targetRef="Task_0xwjycr" />
+ <bpmn:sequenceFlow id="SequenceFlow_0bqfbxf" name="yes" sourceRef="ExclusiveGateway_1lyw619" targetRef="Task_1ovewjr">
+ <bpmn:documentation>#{(execution.getVariable("isTimeOut") == "YES")}</bpmn:documentation>
+ <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{(execution.getVariable("isTimeOut") == "YES")}</bpmn:conditionExpression>
+ </bpmn:sequenceFlow>
+ <bpmn:exclusiveGateway id="ExclusiveGateway_16tdrty" name="is NSMF Async Succeed?" default="SequenceFlow_0jrbkau">
+ <bpmn:incoming>SequenceFlow_1tcgzv0</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0jrbkau</bpmn:outgoing>
+ <bpmn:outgoing>SequenceFlow_16ewagx</bpmn:outgoing>
+ </bpmn:exclusiveGateway>
+ <bpmn:sequenceFlow id="SequenceFlow_0jrbkau" sourceRef="ExclusiveGateway_16tdrty" targetRef="Task_1kizznk" />
+ <bpmn:sequenceFlow id="SequenceFlow_16ewagx" name="no" sourceRef="ExclusiveGateway_16tdrty" targetRef="Task_0xwjycr">
+ <bpmn:documentation>#{(execution.getVariable("isNSMFWFRspSucceed" ) == "no")}</bpmn:documentation>
+ <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{(execution.getVariable("isNSMFWFRspSucceed" ) == "no")}</bpmn:conditionExpression>
+ </bpmn:sequenceFlow>
+ <bpmn:exclusiveGateway id="ExclusiveGateway_0icj4go" name="Is E2E Slice Service Instance Id Exist?" default="SequenceFlow_12xn3kz">
+ <bpmn:incoming>SequenceFlow_1j0e2po</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_12xn3kz</bpmn:outgoing>
+ <bpmn:outgoing>SequenceFlow_0xipbpr</bpmn:outgoing>
+ </bpmn:exclusiveGateway>
+ <bpmn:sequenceFlow id="SequenceFlow_1j0e2po" sourceRef="Task_0ux5uk1" targetRef="ExclusiveGateway_0icj4go" />
+ <bpmn:sequenceFlow id="SequenceFlow_12xn3kz" sourceRef="ExclusiveGateway_0icj4go" targetRef="Task_0qg5gn6" />
+ <bpmn:sequenceFlow id="SequenceFlow_0xipbpr" name="no" sourceRef="ExclusiveGateway_0icj4go" targetRef="ExclusiveGateway_1lyw619">
+ <bpmn:documentation>#{(execution.getVariable("e2eSliceServiceInstanceId") == null)}</bpmn:documentation>
+ <bpmn:conditionExpression xsi:type="bpmn:tFormalExpression">#{(execution.getVariable("e2eSliceServiceInstanceId") == null)}</bpmn:conditionExpression>
+ </bpmn:sequenceFlow>
+ <bpmn:callActivity id="Task_1ff6flk" name="CallCheckServiceProcessStatus" calledElement="CheckServiceProcessStatus">
+ <bpmn:extensionElements>
+ <camunda:in source="e2eSliceServiceInstanceId" target="serviceInstanceId" />
+ <camunda:in source="e2eOperationId" target="operationId" />
+ <camunda:in source="successConditions" target="successConditions" />
+ <camunda:in source="errorConditions" target="errorConditions" />
+ <camunda:in source="processServiceType" target="processServiceType" />
+ <camunda:in source="timeOut" target="timeOut" />
+ <camunda:out source="operationStatus" target="result" />
+ <camunda:out source="operationContent" target="reason" />
+ <camunda:out source="WorkflowException" target="WorkflowException" />
+ <camunda:out source="isTimeOut" target="isTimeOut" />
+ <camunda:in source="subOperationType" target="operationType" />
+ <camunda:in source="initProgress" target="initProgress" />
+ <camunda:in source="endProgress" target="endProgress" />
+ <camunda:in source="serviceInstanceId" target="parentServiceInstanceId" />
+ <camunda:in source="globalSubscriberId" target="globalSubscriberId" />
+ <camunda:in source="operationId" target="parentOperationId" />
+ </bpmn:extensionElements>
+ <bpmn:incoming>SequenceFlow_0thr8dc</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_1sah9so</bpmn:outgoing>
+ </bpmn:callActivity>
+ <bpmn:scriptTask id="Task_1ovewjr" name="Prepare update operation status error" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_0bqfbxf</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_1amyd7h</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def dcs = new DeleteCommunicationService()
+dcs.prepareFailureStatus(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ <bpmn:sequenceFlow id="SequenceFlow_1amyd7h" sourceRef="Task_1ovewjr" targetRef="Task_0xwjycr" />
+ <bpmn:sequenceFlow id="SequenceFlow_1sah9so" sourceRef="Task_1ff6flk" targetRef="ExclusiveGateway_1lyw619" />
+ <bpmn:sequenceFlow id="SequenceFlow_1ssiyug" sourceRef="Task_1kizznk" targetRef="Task_0y1n9ls" />
+ <bpmn:sequenceFlow id="SequenceFlow_0thr8dc" sourceRef="Task_0y1n9ls" targetRef="Task_1ff6flk" />
+ <bpmn:scriptTask id="Task_0y1n9ls" name="Prepare Call CheckServiceProcessStatus" scriptFormat="groovy">
+ <bpmn:incoming>SequenceFlow_1ssiyug</bpmn:incoming>
+ <bpmn:outgoing>SequenceFlow_0thr8dc</bpmn:outgoing>
+ <bpmn:script>import org.onap.so.bpmn.infrastructure.scripts.*
+def dcs = new DeleteCommunicationService()
+dcs.prepareCallCheckProcessStatus(execution)</bpmn:script>
+ </bpmn:scriptTask>
+ </bpmn:process>
+ <bpmndi:BPMNDiagram id="BPMNDiagram_1">
+ <bpmndi:BPMNPlane id="BPMNPlane_1" bpmnElement="DeleteCommunicationService">
+ <bpmndi:BPMNShape id="_BPMNShape_StartEvent_2" bpmnElement="StartEvent_1">
+ <dc:Bounds x="152" y="102" width="36" height="36" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="159" y="145" width="23" height="14" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_1kjqnil_di" bpmnElement="SequenceFlow_1kjqnil">
+ <di:waypoint x="188" y="120" />
+ <di:waypoint x="240" y="120" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_0ogievs_di" bpmnElement="SequenceFlow_0ogievs">
+ <di:waypoint x="340" y="120" />
+ <di:waypoint x="390" y="120" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_192yyii_di" bpmnElement="SequenceFlow_192yyii">
+ <di:waypoint x="490" y="120" />
+ <di:waypoint x="560" y="120" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="ServiceTask_104igd7_di" bpmnElement="Task_0zaekmn">
+ <dc:Bounds x="560" y="80" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_0tqibrd_di" bpmnElement="Task_0q2v7qe">
+ <dc:Bounds x="390" y="80" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_18pflck_di" bpmnElement="Task_1mqm4nb">
+ <dc:Bounds x="240" y="80" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_1k5stey_di" bpmnElement="ScriptTask_1k5stey">
+ <dc:Bounds x="740" y="80" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_0xvoume_di" bpmnElement="SequenceFlow_0xvoume">
+ <di:waypoint x="660" y="120" />
+ <di:waypoint x="740" y="120" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_017qgen_di" bpmnElement="SequenceFlow_017qgen">
+ <di:waypoint x="840" y="120" />
+ <di:waypoint x="910" y="120" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="ServiceTask_17pxrcl_di" bpmnElement="Task_1kizznk">
+ <dc:Bounds x="330" y="310" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ServiceTask_0ucwm85_di" bpmnElement="Task_0xwjycr">
+ <dc:Bounds x="1250" y="310" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="EndEvent_0ixagvk_di" bpmnElement="EndEvent_0ixagvk">
+ <dc:Bounds x="1432" y="332" width="36" height="36" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="1441" y="375" width="19" height="14" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_10g2pnj_di" bpmnElement="SequenceFlow_10g2pnj">
+ <di:waypoint x="1350" y="350" />
+ <di:waypoint x="1432" y="350" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="ScriptTask_05zxl7j_di" bpmnElement="Task_0ux5uk1">
+ <dc:Bounds x="910" y="80" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="IntermediateThrowEvent_1go0jt1_di" bpmnElement="IntermediateThrowEvent_0ce724z">
+ <dc:Bounds x="1432" y="102" width="36" height="36" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="1417" y="145" width="76" height="27" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="IntermediateCatchEvent_09w3u1d_di" bpmnElement="IntermediateThrowEvent_11i33ob">
+ <dc:Bounds x="152" y="332" width="36" height="36" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="127" y="375" width="86" height="27" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_0me3crz_di" bpmnElement="Task_0qg5gn6">
+ <dc:Bounds x="1220" y="80" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_0bmtfxq_di" bpmnElement="SequenceFlow_0bmtfxq">
+ <di:waypoint x="1320" y="120" />
+ <di:waypoint x="1432" y="120" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="ScriptTask_14svlaf_di" bpmnElement="Task_0qvxmnh">
+ <dc:Bounds x="900" y="310" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_0arvpzv_di" bpmnElement="SequenceFlow_0arvpzv">
+ <di:waypoint x="1000" y="350" />
+ <di:waypoint x="1060" y="350" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="ScriptTask_0q6s59r_di" bpmnElement="Task_0b5j6rg">
+ <dc:Bounds x="1060" y="310" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="SubProcess_04znyto_di" bpmnElement="SubProcess_0p6namq" isExpanded="true">
+ <dc:Bounds x="480" y="650" width="730" height="210" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="StartEvent_1qti4dg_di" bpmnElement="StartEvent_1843894">
+ <dc:Bounds x="520" y="742" width="36" height="36" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_1u5ko4h_di" bpmnElement="SequenceFlow_1u5ko4h">
+ <di:waypoint x="556" y="760" />
+ <di:waypoint x="610" y="760" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="ScriptTask_0xdbw5d_di" bpmnElement="Task_1spbb2x">
+ <dc:Bounds x="610" y="720" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_05yfw7t_di" bpmnElement="SequenceFlow_05yfw7t">
+ <di:waypoint x="710" y="760" />
+ <di:waypoint x="770" y="760" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="ScriptTask_0hmczex_di" bpmnElement="Task_0yqtfvh">
+ <dc:Bounds x="770" y="720" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_0c0btia_di" bpmnElement="SequenceFlow_0c0btia">
+ <di:waypoint x="870" y="760" />
+ <di:waypoint x="930" y="760" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="ServiceTask_0ra7dbt_di" bpmnElement="Task_1s3l3fc">
+ <dc:Bounds x="930" y="720" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="EndEvent_1fsful5_di" bpmnElement="EndEvent_1fsful5">
+ <dc:Bounds x="1092" y="742" width="36" height="36" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_1w55zo7_di" bpmnElement="SequenceFlow_1w55zo7">
+ <di:waypoint x="1030" y="760" />
+ <di:waypoint x="1092" y="760" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_1tcgzv0_di" bpmnElement="SequenceFlow_1tcgzv0">
+ <di:waypoint x="188" y="350" />
+ <di:waypoint x="235" y="350" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="SubProcess_0dwywjh_di" bpmnElement="SubProcess_1l7gd5k" isExpanded="true">
+ <dc:Bounds x="660" y="950" width="350" height="200" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="StartEvent_18u3hph_di" bpmnElement="StartEvent_0zc2hnn">
+ <dc:Bounds x="700" y="1032" width="36" height="36" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_0mifi3x_di" bpmnElement="SequenceFlow_0mifi3x">
+ <di:waypoint x="736" y="1050" />
+ <di:waypoint x="790" y="1050" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="EndEvent_052gdjz_di" bpmnElement="EndEvent_052gdjz">
+ <dc:Bounds x="952" y="1032" width="36" height="36" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_073yxs4_di" bpmnElement="SequenceFlow_073yxs4">
+ <di:waypoint x="890" y="1050" />
+ <di:waypoint x="952" y="1050" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="ScriptTask_0lzly9f_di" bpmnElement="Task_01va9ms">
+ <dc:Bounds x="790" y="1010" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ExclusiveGateway_1lyw619_di" bpmnElement="ExclusiveGateway_1lyw619" isMarkerVisible="true">
+ <dc:Bounds x="785" y="325" width="50" height="50" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="786.5" y="384.5" width="47" height="27" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_0s7s7zk_di" bpmnElement="SequenceFlow_0s7s7zk">
+ <di:waypoint x="835" y="350" />
+ <di:waypoint x="900" y="350" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_00g94pg_di" bpmnElement="SequenceFlow_00g94pg">
+ <di:waypoint x="1160" y="350" />
+ <di:waypoint x="1250" y="350" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_0bqfbxf_di" bpmnElement="SequenceFlow_0bqfbxf">
+ <di:waypoint x="810" y="325" />
+ <di:waypoint x="810" y="250" />
+ <di:waypoint x="900" y="250" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="846" y="232" width="17" height="14" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="ExclusiveGateway_16tdrty_di" bpmnElement="ExclusiveGateway_16tdrty" isMarkerVisible="true">
+ <dc:Bounds x="235" y="325" width="50" height="50" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="226" y="295" width="77" height="27" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_0jrbkau_di" bpmnElement="SequenceFlow_0jrbkau">
+ <di:waypoint x="285" y="350" />
+ <di:waypoint x="330" y="350" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_16ewagx_di" bpmnElement="SequenceFlow_16ewagx">
+ <di:waypoint x="260" y="375" />
+ <di:waypoint x="260" y="500" />
+ <di:waypoint x="1300" y="500" />
+ <di:waypoint x="1300" y="390" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="774" y="482" width="13" height="14" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="ExclusiveGateway_0icj4go_di" bpmnElement="ExclusiveGateway_0icj4go" isMarkerVisible="true">
+ <dc:Bounds x="1085" y="95" width="50" height="50" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="1069" y="50" width="82" height="40" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_1j0e2po_di" bpmnElement="SequenceFlow_1j0e2po">
+ <di:waypoint x="1010" y="120" />
+ <di:waypoint x="1085" y="120" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_12xn3kz_di" bpmnElement="SequenceFlow_12xn3kz">
+ <di:waypoint x="1135" y="120" />
+ <di:waypoint x="1220" y="120" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_0xipbpr_di" bpmnElement="SequenceFlow_0xipbpr">
+ <di:waypoint x="1110" y="145" />
+ <di:waypoint x="1110" y="190" />
+ <di:waypoint x="810" y="190" />
+ <di:waypoint x="810" y="325" />
+ <bpmndi:BPMNLabel>
+ <dc:Bounds x="946" y="172" width="13" height="14" />
+ </bpmndi:BPMNLabel>
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="CallActivity_1knnc2k_di" bpmnElement="Task_1ff6flk">
+ <dc:Bounds x="630" y="310" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNShape id="ScriptTask_1r84j75_di" bpmnElement="Task_1ovewjr">
+ <dc:Bounds x="900" y="210" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ <bpmndi:BPMNEdge id="SequenceFlow_1amyd7h_di" bpmnElement="SequenceFlow_1amyd7h">
+ <di:waypoint x="1000" y="250" />
+ <di:waypoint x="1300" y="250" />
+ <di:waypoint x="1300" y="310" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_1sah9so_di" bpmnElement="SequenceFlow_1sah9so">
+ <di:waypoint x="730" y="350" />
+ <di:waypoint x="785" y="350" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_1ssiyug_di" bpmnElement="SequenceFlow_1ssiyug">
+ <di:waypoint x="430" y="350" />
+ <di:waypoint x="480" y="350" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNEdge id="SequenceFlow_0thr8dc_di" bpmnElement="SequenceFlow_0thr8dc">
+ <di:waypoint x="580" y="350" />
+ <di:waypoint x="630" y="350" />
+ </bpmndi:BPMNEdge>
+ <bpmndi:BPMNShape id="ScriptTask_0r8ad9j_di" bpmnElement="Task_0y1n9ls">
+ <dc:Bounds x="480" y="310" width="100" height="80" />
+ </bpmndi:BPMNShape>
+ </bpmndi:BPMNPlane>
+ </bpmndi:BPMNDiagram>
+</bpmn:definitions>
diff --git a/common/pom.xml b/common/pom.xml
index 3b33d6ed37..02d2f35545 100644
--- a/common/pom.xml
+++ b/common/pom.xml
@@ -59,7 +59,7 @@
<dependency>
<groupId>org.onap.aai.schema-service</groupId>
<artifactId>aai-schema</artifactId>
- <version>1.6.3</version>
+ <version>1.6.4-SNAPSHOT</version>
</dependency>
<dependency>
<groupId>org.modelmapper</groupId>
diff --git a/common/src/main/java/org/onap/so/beans/nsmf/SliceTaskParams.java b/common/src/main/java/org/onap/so/beans/nsmf/SliceTaskParams.java
new file mode 100644
index 0000000000..bf881c0f19
--- /dev/null
+++ b/common/src/main/java/org/onap/so/beans/nsmf/SliceTaskParams.java
@@ -0,0 +1,413 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (C) 2019 Huawei Technologies Co., Ltd. All rights reserved.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License")
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.beans.nsmf;
+
+import com.fasterxml.jackson.databind.ObjectMapper;
+import com.google.gson.JsonObject;
+import java.io.IOException;
+import java.io.Serializable;
+import java.util.HashMap;
+import java.util.Map;
+
+public class SliceTaskParams implements Serializable {
+
+ private static final long serialVersionUID = -4389946152970978423L;
+
+ private String serviceId;
+
+ private String serviceName;
+
+ private String nstId;
+
+ private String nstName;
+
+ private String tnScriptName;
+
+ private String anScriptName;
+
+ private String cnScriptName;
+
+ private Map<String, Object> serviceProfile;
+
+ private String suggestNsiId;
+
+ private String suggestNsiName;
+
+ private Map<String, Object> sliceProfileTn;
+
+ private Map<String, Object> sliceProfileCn;
+
+ private Map<String, Object> sliceProfileAn;
+
+ private String tnSuggestNssiId;
+
+ private String tnSuggestNssiName;
+
+ private String tnProgress;
+
+ private String tnStatus;
+
+ private String tnStatusDescription;
+
+ private String cnSuggestNssiId;
+
+ private String cnSuggestNssiName;
+
+ private String cnProgress;
+
+ private String cnStatus;
+
+ private String cnStatusDescription;
+
+ private String anSuggestNssiId;
+
+ private String anSuggestNssiName;
+
+ private String anProgress;
+
+ private String anStatus;
+
+ private String anStatusDescription;
+
+ public String getNstId() {
+ return nstId;
+ }
+
+ public void setNstId(String nstId) {
+ this.nstId = nstId;
+ }
+
+ public String getNstName() {
+ return nstName;
+ }
+
+ public void setNstName(String nstName) {
+ this.nstName = nstName;
+ }
+
+ public String getTnScriptName() {
+ return tnScriptName;
+ }
+
+ public void setTnScriptName(String tnScriptName) {
+ this.tnScriptName = tnScriptName;
+ }
+
+ public String getAnScriptName() {
+ return anScriptName;
+ }
+
+ public void setAnScriptName(String anScriptName) {
+ this.anScriptName = anScriptName;
+ }
+
+ public String getCnScriptName() {
+ return cnScriptName;
+ }
+
+ public void setCnScriptName(String cnScriptName) {
+ this.cnScriptName = cnScriptName;
+ }
+
+ public String getServiceId() {
+ return serviceId;
+ }
+
+ public void setServiceId(String serviceId) {
+ this.serviceId = serviceId;
+ }
+
+ public String getServiceName() {
+ return serviceName;
+ }
+
+ public void setServiceName(String serviceName) {
+ this.serviceName = serviceName;
+ }
+
+ public Map<String, Object> getServiceProfile() {
+ return serviceProfile;
+ }
+
+ public void setServiceProfile(Map<String, Object> serviceProfile) {
+ this.serviceProfile = serviceProfile;
+ }
+
+ public String getSuggestNsiId() {
+ return suggestNsiId;
+ }
+
+ public void setSuggestNsiId(String suggestNsiId) {
+ this.suggestNsiId = suggestNsiId;
+ }
+
+ public String getSuggestNsiName() {
+ return suggestNsiName;
+ }
+
+ public void setSuggestNsiName(String suggestNsiName) {
+ this.suggestNsiName = suggestNsiName;
+ }
+
+ public Map<String, Object> getSliceProfileTn() {
+ return sliceProfileTn;
+ }
+
+ public void setSliceProfileTn(Map<String, Object> sliceProfileTn) {
+ this.sliceProfileTn = sliceProfileTn;
+ }
+
+ public Map<String, Object> getSliceProfileCn() {
+ return sliceProfileCn;
+ }
+
+ public void setSliceProfileCn(Map<String, Object> sliceProfileCn) {
+ this.sliceProfileCn = sliceProfileCn;
+ }
+
+ public Map<String, Object> getSliceProfileAn() {
+ return sliceProfileAn;
+ }
+
+ public void setSliceProfileAn(Map<String, Object> sliceProfileAn) {
+ this.sliceProfileAn = sliceProfileAn;
+ }
+
+ public String getTnSuggestNssiId() {
+ return tnSuggestNssiId;
+ }
+
+ public void setTnSuggestNssiId(String tnSuggestNssiId) {
+ this.tnSuggestNssiId = tnSuggestNssiId;
+ }
+
+ public String getTnSuggestNssiName() {
+ return tnSuggestNssiName;
+ }
+
+ public void setTnSuggestNssiName(String tnSuggestNssiName) {
+ this.tnSuggestNssiName = tnSuggestNssiName;
+ }
+
+ public String getTnProgress() {
+ return tnProgress;
+ }
+
+ public void setTnProgress(String tnProgress) {
+ this.tnProgress = tnProgress;
+ }
+
+ public String getTnStatus() {
+ return tnStatus;
+ }
+
+ public void setTnStatus(String tnStatus) {
+ this.tnStatus = tnStatus;
+ }
+
+ public String getTnStatusDescription() {
+ return tnStatusDescription;
+ }
+
+ public void setTnStatusDescription(String tnStatusDescription) {
+ this.tnStatusDescription = tnStatusDescription;
+ }
+
+ public String getCnSuggestNssiId() {
+ return cnSuggestNssiId;
+ }
+
+ public void setCnSuggestNssiId(String cnSuggestNssiId) {
+ this.cnSuggestNssiId = cnSuggestNssiId;
+ }
+
+ public String getCnSuggestNssiName() {
+ return cnSuggestNssiName;
+ }
+
+ public void setCnSuggestNssiName(String cnSuggestNssiName) {
+ this.cnSuggestNssiName = cnSuggestNssiName;
+ }
+
+ public String getCnProgress() {
+ return cnProgress;
+ }
+
+ public void setCnProgress(String cnProgress) {
+ this.cnProgress = cnProgress;
+ }
+
+ public String getCnStatus() {
+ return cnStatus;
+ }
+
+ public void setCnStatus(String cnStatus) {
+ this.cnStatus = cnStatus;
+ }
+
+ public String getCnStatusDescription() {
+ return cnStatusDescription;
+ }
+
+ public void setCnStatusDescription(String cnStatusDescription) {
+ this.cnStatusDescription = cnStatusDescription;
+ }
+
+ public String getAnSuggestNssiId() {
+ return anSuggestNssiId;
+ }
+
+ public void setAnSuggestNssiId(String anSuggestNssiId) {
+ this.anSuggestNssiId = anSuggestNssiId;
+ }
+
+ public String getAnSuggestNssiName() {
+ return anSuggestNssiName;
+ }
+
+ public void setAnSuggestNssiName(String anSuggestNssiName) {
+ this.anSuggestNssiName = anSuggestNssiName;
+ }
+
+ public String getAnProgress() {
+ return anProgress;
+ }
+
+ public void setAnProgress(String anProgress) {
+ this.anProgress = anProgress;
+ }
+
+ public String getAnStatus() {
+ return anStatus;
+ }
+
+ public void setAnStatus(String anStatus) {
+ this.anStatus = anStatus;
+ }
+
+ public String getAnStatusDescription() {
+ return anStatusDescription;
+ }
+
+ public void setAnStatusDescription(String anStatusDescription) {
+ this.anStatusDescription = anStatusDescription;
+ }
+
+ public String convertToJson() {
+ JsonObject jsonObject = new JsonObject();
+ jsonObject.addProperty("ServiceId", serviceId);
+ jsonObject.addProperty("ServiceName", serviceName);
+ jsonObject.addProperty("NSTId", nstId);
+ jsonObject.addProperty("NSTName", nstName);
+ jsonObject.addProperty("TN.ScriptName", tnScriptName);
+ jsonObject.addProperty("AN.ScriptName", anScriptName);
+ jsonObject.addProperty("CN.ScriptName", cnScriptName);
+ for (Map.Entry<String, Object> entry : serviceProfile.entrySet()) {
+ jsonObject.addProperty("ServiceProfile." + entry.getKey(), entry.getValue().toString());
+ }
+ jsonObject.addProperty("suggestNSIId", suggestNsiId);
+ jsonObject.addProperty("suggestNSIName", suggestNsiName);
+ for (Map.Entry<String, Object> entry : sliceProfileTn.entrySet()) {
+ jsonObject.addProperty("SliceProfile.TN." + entry.getKey(), entry.getValue().toString());
+ }
+ for (Map.Entry<String, Object> entry : sliceProfileCn.entrySet()) {
+ jsonObject.addProperty("SliceProfile.CN." + entry.getKey(), entry.getValue().toString());
+ }
+ for (Map.Entry<String, Object> entry : sliceProfileAn.entrySet()) {
+ jsonObject.addProperty("SliceProfile.AN." + entry.getKey(), entry.getValue().toString());
+ }
+ jsonObject.addProperty("TN.SuggestNSSIId", tnSuggestNssiId);
+ jsonObject.addProperty("TN.SuggestNSSIName", tnSuggestNssiName);
+ jsonObject.addProperty("TN.progress", tnProgress);
+ jsonObject.addProperty("TN.status", tnStatus);
+ jsonObject.addProperty("TN.statusDescription", tnStatusDescription);
+ jsonObject.addProperty("CN.SuggestNSSIId", cnSuggestNssiId);
+ jsonObject.addProperty("CN.SuggestNSSIName", cnSuggestNssiName);
+ jsonObject.addProperty("CN.progress", cnProgress);
+ jsonObject.addProperty("CN.status", cnStatus);
+ jsonObject.addProperty("CN.statusDescription", cnStatusDescription);
+ jsonObject.addProperty("AN.SuggestNSSIId", anSuggestNssiId);
+ jsonObject.addProperty("AN.SuggestNSSIName", anSuggestNssiName);
+ jsonObject.addProperty("AN.progress", anProgress);
+ jsonObject.addProperty("AN.status", anStatus);
+ jsonObject.addProperty("AN.statusDescription", anStatusDescription);
+
+ return jsonObject.toString();
+ }
+
+ public void convertFromJson(String jsonString) throws IOException {
+ ObjectMapper mapper = new ObjectMapper();
+ Map<String, String> paramMap = (Map<String, String>) mapper.readValue(jsonString, Map.class);
+ this.setServiceId(paramMap.get("ServiceId"));
+ this.setServiceName(paramMap.get("ServiceName"));
+ this.setNstId(paramMap.get("NSTId"));
+ this.setNstName(paramMap.get("NSTName"));
+ this.setTnScriptName(paramMap.get("TN.ScriptName"));
+ this.setAnScriptName(paramMap.get("AN.ScriptName"));
+ this.setCnScriptName(paramMap.get("CN.ScriptName"));
+ Map<String, Object> serviceProfileMap = new HashMap<>();
+ for (Map.Entry<String, String> entry : paramMap.entrySet()) {
+ if (entry.getKey().startsWith("ServiceProfile.")) {
+ serviceProfileMap.put(entry.getKey().replaceFirst("^ServiceProfile.", ""), entry.getValue());
+ }
+ }
+ this.setServiceProfile(serviceProfileMap);
+ this.setSuggestNsiId(paramMap.get("suggestNSIId"));
+ this.setSuggestNsiName(paramMap.get("suggestNSIName"));
+ Map<String, Object> sliceProfileTnMap = new HashMap<>();
+ for (Map.Entry<String, String> entry : paramMap.entrySet()) {
+ if (entry.getKey().startsWith("SliceProfile.TN.")) {
+ sliceProfileTnMap.put(entry.getKey().replaceFirst("^SliceProfile.TN.", ""), entry.getValue());
+ }
+ }
+ this.setSliceProfileTn(sliceProfileTnMap);
+ Map<String, Object> sliceProfileCnMap = new HashMap<>();
+ for (Map.Entry<String, String> entry : paramMap.entrySet()) {
+ if (entry.getKey().startsWith("SliceProfile.CN.")) {
+ sliceProfileCnMap.put(entry.getKey().replaceFirst("^SliceProfile.CN.", ""), entry.getValue());
+ }
+ }
+ this.setSliceProfileCn(sliceProfileCnMap);
+ Map<String, Object> sliceProfileAnMap = new HashMap<>();
+ for (Map.Entry<String, String> entry : paramMap.entrySet()) {
+ if (entry.getKey().startsWith("SliceProfile.AN.")) {
+ sliceProfileAnMap.put(entry.getKey().replaceFirst("^SliceProfile.AN.", ""), entry.getValue());
+ }
+ }
+ this.setSliceProfileAn(sliceProfileAnMap);
+ this.setTnSuggestNssiId(paramMap.get("TN.SuggestNSSIId"));
+ this.setTnSuggestNssiName(paramMap.get("TN.SuggestNSSIName"));
+ this.setTnProgress(paramMap.get("TN.progress"));
+ this.setTnStatus(paramMap.get("TN.status"));
+ this.setTnStatusDescription(paramMap.get("TN.statusDescription"));
+ this.setCnSuggestNssiId(paramMap.get("CN.SuggestNSSIId"));
+ this.setCnSuggestNssiName(paramMap.get("CN.SuggestNSSIName"));
+ this.setCnProgress(paramMap.get("CN.progress"));
+ this.setCnStatus(paramMap.get("CN.status"));
+ this.setCnStatusDescription(paramMap.get("CN.statusDescription"));
+ this.setAnSuggestNssiId(paramMap.get("AN.SuggestNSSIId"));
+ this.setAnSuggestNssiName(paramMap.get("AN.SuggestNSSIName"));
+ this.setAnProgress(paramMap.get("AN.progress"));
+ this.setAnStatus(paramMap.get("AN.status"));
+ this.setAnStatusDescription(paramMap.get("AN.statusDescription"));
+ }
+}
+
diff --git a/common/src/main/java/org/onap/so/client/aai/AAIObjectType.java b/common/src/main/java/org/onap/so/client/aai/AAIObjectType.java
index f78ac737ed..b96df4ff9e 100644
--- a/common/src/main/java/org/onap/so/client/aai/AAIObjectType.java
+++ b/common/src/main/java/org/onap/so/client/aai/AAIObjectType.java
@@ -20,67 +20,21 @@
package org.onap.so.client.aai;
-import java.io.Serializable;
-import java.net.URL;
-import java.util.HashMap;
-import java.util.Map;
-import java.util.Set;
-import java.util.regex.Pattern;
+import com.google.common.base.CaseFormat;
import org.onap.aai.annotations.Metadata;
-import org.onap.aai.domain.yang.AggregateRoute;
-import org.onap.aai.domain.yang.AllottedResource;
-import org.onap.aai.domain.yang.CloudRegion;
-import org.onap.aai.domain.yang.Collection;
-import org.onap.aai.domain.yang.Complex;
-import org.onap.aai.domain.yang.Configuration;
-import org.onap.aai.domain.yang.Connector;
-import org.onap.aai.domain.yang.Customer;
-import org.onap.aai.domain.yang.Device;
-import org.onap.aai.domain.yang.EsrVnfm;
-import org.onap.aai.domain.yang.ExtAaiNetwork;
-import org.onap.aai.domain.yang.Flavor;
-import org.onap.aai.domain.yang.GenericVnf;
-import org.onap.aai.domain.yang.Image;
-import org.onap.aai.domain.yang.InstanceGroup;
-import org.onap.aai.domain.yang.L3Network;
-import org.onap.aai.domain.yang.LInterface;
-import org.onap.aai.domain.yang.LineOfBusiness;
-import org.onap.aai.domain.yang.ModelVer;
-import org.onap.aai.domain.yang.NetworkPolicy;
-import org.onap.aai.domain.yang.NetworkTechnology;
-import org.onap.aai.domain.yang.OperationalEnvironment;
-import org.onap.aai.domain.yang.OwningEntity;
-import org.onap.aai.domain.yang.PInterface;
-import org.onap.aai.domain.yang.PhysicalLink;
-import org.onap.aai.domain.yang.Platform;
-import org.onap.aai.domain.yang.Pnf;
-import org.onap.aai.domain.yang.PortGroup;
-import org.onap.aai.domain.yang.Project;
-import org.onap.aai.domain.yang.Pserver;
-import org.onap.aai.domain.yang.RouteTableReference;
-import org.onap.aai.domain.yang.Service;
-import org.onap.aai.domain.yang.ServiceInstance;
-import org.onap.aai.domain.yang.ServiceSubscription;
-import org.onap.aai.domain.yang.SpPartner;
-import org.onap.aai.domain.yang.SriovPf;
-import org.onap.aai.domain.yang.Subnet;
-import org.onap.aai.domain.yang.Tenant;
-import org.onap.aai.domain.yang.TunnelXconnect;
-import org.onap.aai.domain.yang.Vce;
-import org.onap.aai.domain.yang.VfModule;
-import org.onap.aai.domain.yang.VlanTag;
-import org.onap.aai.domain.yang.Vnfc;
-import org.onap.aai.domain.yang.VolumeGroup;
-import org.onap.aai.domain.yang.VpnBinding;
-import org.onap.aai.domain.yang.Vserver;
-import org.onap.aai.domain.yang.Zone;
+import org.onap.aai.domain.yang.*;
import org.onap.so.client.graphinventory.GraphInventoryObjectType;
import org.onap.so.constants.Defaults;
import org.reflections.Reflections;
import org.reflections.scanners.SubTypesScanner;
import org.reflections.util.ClasspathHelper;
import org.reflections.util.ConfigurationBuilder;
-import com.google.common.base.CaseFormat;
+import java.io.Serializable;
+import java.net.URL;
+import java.util.HashMap;
+import java.util.Map;
+import java.util.Set;
+import java.util.regex.Pattern;
public class AAIObjectType implements GraphInventoryObjectType, Serializable {
@@ -135,6 +89,8 @@ public class AAIObjectType implements GraphInventoryObjectType, Serializable {
new AAIObjectType(AAINamespaceConstants.BUSINESS, OwningEntity.class);
public static final AAIObjectType ALLOTTED_RESOURCE =
new AAIObjectType(AAIObjectType.SERVICE_INSTANCE.uriTemplate(), AllottedResource.class);
+ public static final AAIObjectType ALLOTTED_RESOURCE_ALL =
+ new AAIObjectType(AAIObjectType.SERVICE_INSTANCE.uriTemplate(), "/allotted-resources", "allottedResources");
public static final AAIObjectType PNF = new AAIObjectType(AAINamespaceConstants.NETWORK, Pnf.class);
public static final AAIObjectType OPERATIONAL_ENVIRONMENT =
new AAIObjectType(AAINamespaceConstants.CLOUD_INFRASTRUCTURE, OperationalEnvironment.class);
@@ -196,6 +152,18 @@ public class AAIObjectType implements GraphInventoryObjectType, Serializable {
public static final AAIObjectType THIRDPARTY_SDNC_SYSTEM_INFO_LIST =
new AAIObjectType(AAINamespaceConstants.EXTERNAL_SYSTEM + "/esr-thirdparty-sdnc-list",
"/esr-thirdparty-sdnc/{sdnc-id}/esr-system-info-list", "thirdparty-sdnc-system-info-list");
+ public static final AAIObjectType COMMUNICATION_SERVICE_PROFILE =
+ new AAIObjectType(AAIObjectType.SERVICE_SUBSCRIPTION.uriTemplate(), CommunicationServiceProfile.class);
+ public static final AAIObjectType SERVICE_PROFILE =
+ new AAIObjectType(AAIObjectType.SERVICE_SUBSCRIPTION.uriTemplate(), ServiceProfile.class);
+ public static final AAIObjectType SERVICE_PROFILE_ALL =
+ new AAIObjectType(AAIObjectType.SERVICE_INSTANCE.uriTemplate(), "/service-profiles", "serviceProfiles");
+ public static final AAIObjectType SLICE_PROFILE =
+ new AAIObjectType(AAIObjectType.SERVICE_SUBSCRIPTION.uriTemplate(), SliceProfile.class);
+ public static final AAIObjectType SLICE_PROFILE_ALL =
+ new AAIObjectType(AAIObjectType.SERVICE_INSTANCE.uriTemplate(), "/slice-profiles", "sliceProfiles");
+ public static final AAIObjectType COMMUNICATION_PROFILE_ALL = new AAIObjectType(
+ AAIObjectType.SERVICE_INSTANCE.uriTemplate(), "/communication-service-profiles", "communicationProfiles");
private final String uriTemplate;
private final String parentUri;
diff --git a/mso-api-handlers/mso-api-handler-common/src/main/java/org/onap/so/apihandler/common/RequestClientParameter.java b/mso-api-handlers/mso-api-handler-common/src/main/java/org/onap/so/apihandler/common/RequestClientParameter.java
index 3cf3907424..2101252ad0 100644
--- a/mso-api-handlers/mso-api-handler-common/src/main/java/org/onap/so/apihandler/common/RequestClientParameter.java
+++ b/mso-api-handlers/mso-api-handler-common/src/main/java/org/onap/so/apihandler/common/RequestClientParameter.java
@@ -45,6 +45,7 @@ public class RequestClientParameter {
private String requestUri;
private String instanceGroupId;
private boolean generateIdsOnly;
+ private String operationType;
private RequestClientParameter(Builder builder) {
requestId = builder.requestId;
@@ -69,6 +70,11 @@ public class RequestClientParameter {
requestUri = builder.requestUri;
instanceGroupId = builder.instanceGroupId;
generateIdsOnly = builder.generateIdsOnly;
+ operationType = builder.operationType;
+ }
+
+ public String getOperationType() {
+ return operationType;
}
public String getRequestId() {
@@ -186,6 +192,12 @@ public class RequestClientParameter {
private String requestUri;
private String instanceGroupId;
private boolean generateIdsOnly;
+ private String operationType;
+
+ public Builder setOperationType(String operationType) {
+ this.operationType = operationType;
+ return this;
+ }
public Builder setRequestId(String requestId) {
this.requestId = requestId;
@@ -302,4 +314,6 @@ public class RequestClientParameter {
}
}
+
+
}
diff --git a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/E2EServiceInstances.java b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/E2EServiceInstances.java
index 0bcb0f1c86..94e03f1452 100644
--- a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/E2EServiceInstances.java
+++ b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/E2EServiceInstances.java
@@ -23,11 +23,7 @@
package org.onap.so.apihandlerinfra;
import java.io.IOException;
-import java.util.ArrayList;
-import java.util.HashMap;
-import java.util.List;
-import java.util.Map;
-import java.util.UUID;
+import java.util.*;
import javax.ws.rs.Consumes;
import javax.ws.rs.DELETE;
import javax.ws.rs.GET;
@@ -38,6 +34,12 @@ import javax.ws.rs.PathParam;
import javax.ws.rs.Produces;
import javax.ws.rs.core.MediaType;
import javax.ws.rs.core.Response;
+import org.onap.so.apihandlerinfra.e2eserviceinstancebeans.*;
+import org.onap.aai.domain.yang.v16.ServiceInstance;
+import org.onap.so.client.aai.AAIObjectType;
+import org.onap.so.client.aai.AAIResourcesClient;
+import org.onap.so.client.aai.entities.uri.AAIResourceUri;
+import org.onap.so.client.aai.entities.uri.AAIUriFactory;
import org.onap.so.logger.LoggingAnchor;
import org.apache.http.HttpResponse;
import org.apache.http.HttpStatus;
@@ -174,6 +176,30 @@ public class E2EServiceInstances {
return deleteE2EserviceInstances(request, Action.deleteInstance, instanceIdMap, version);
}
+ /**
+ * Activate Requests for 5G slice Service on a specified version and serviceId
+ *
+ * @throws ApiException
+ */
+
+ @POST
+ @Path("/{version:[vV][3-5]}/{serviceId}/{operationType}")
+ @Consumes(MediaType.APPLICATION_JSON)
+ @Produces(MediaType.APPLICATION_JSON)
+ @Operation(description = "Activate 5G slice Service on a specified version and serviceId", responses = @ApiResponse(
+ content = @Content(array = @ArraySchema(schema = @Schema(implementation = Response.class)))))
+ public Response Activate5GSliceServiceInstance(String request, @PathParam("version") String version,
+ @PathParam("operationType") String operationType, @PathParam(SERVICE_ID) String serviceId)
+ throws ApiException {
+ if (operationType.equals("activate")) {
+ instanceIdMap.put("operationType", "activation");
+ } else {
+ instanceIdMap.put("operationType", "deactivation");
+ }
+ instanceIdMap.put(SERVICE_ID, serviceId);
+ return Activate5GSliceServiceInstances(request, Action.activateInstance, instanceIdMap, version);
+ }
+
@GET
@Path("/{version:[vV][3-5]}/{serviceId}/operations/{operationId}")
@Operation(description = "Find e2eServiceInstances Requests for a given serviceId and operationId",
@@ -345,6 +371,116 @@ public class E2EServiceInstances {
return builder.buildResponse(HttpStatus.SC_OK, null, e2eServiceResponse, apiVersion);
}
+ private Response Activate5GSliceServiceInstances(String requestJSON, Action action,
+ HashMap<String, String> instanceIdMap, String version) throws ApiException {
+ // TODO should be a new one or the same service instance Id
+ E2ESliceServiceActivateRequest e2eActReq;
+
+ ObjectMapper mapper = new ObjectMapper();
+ try {
+ e2eActReq = mapper.readValue(requestJSON, E2ESliceServiceActivateRequest.class);
+
+ } catch (Exception e) {
+
+ logger.debug("Mapping of request to JSON object failed : ", e);
+ Response response = msoRequest.buildServiceErrorResponse(HttpStatus.SC_BAD_REQUEST,
+ MsoException.ServiceException, "Mapping of request to JSON object failed. " + e.getMessage(),
+ ErrorNumbers.SVC_BAD_PARAMETER, null, version);
+ logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_REQUEST_VALIDATION_ERROR.toString(),
+ MSO_PROP_APIHANDLER_INFRA, ErrorCode.SchemaError.getValue(), requestJSON, e);
+ logger.debug(END_OF_THE_TRANSACTION + response.getEntity());
+ return response;
+ }
+
+ String requestId = UUID.randomUUID().toString();
+ RecipeLookupResult recipeLookupResult;
+ try {
+ // TODO Get the service template model version uuid from AAI.
+ String modelVersionId = null;
+ AAIResourcesClient client = new AAIResourcesClient();
+ AAIResourceUri url = AAIUriFactory.createResourceUri(AAIObjectType.SERVICE_INSTANCE,
+ e2eActReq.getGlobalSubscriberId(), e2eActReq.getServiceType(), instanceIdMap.get(SERVICE_ID));
+ Optional<ServiceInstance> serviceInstanceOpt = client.get(ServiceInstance.class, url);
+ if (serviceInstanceOpt.isPresent()) {
+ modelVersionId = serviceInstanceOpt.get().getModelVersionId();
+ }
+ recipeLookupResult = getServiceInstanceOrchestrationURI(modelVersionId, action);
+ } catch (Exception e) {
+ logger.error(MessageEnum.APIH_DB_ACCESS_EXC.toString(), MSO_PROP_APIHANDLER_INFRA,
+ ErrorCode.AvailabilityError.getValue(), "Exception while communciate with Catalog DB", e);
+
+ Response response = msoRequest.buildServiceErrorResponse(HttpStatus.SC_NOT_FOUND,
+ MsoException.ServiceException, "No communication to catalog DB " + e.getMessage(),
+ ErrorNumbers.SVC_NO_SERVER_RESOURCES, null, version);
+
+ msoRequest.createErrorRequestRecord(Status.FAILED, requestId,
+ "Exception while communciate with " + "Catalog DB", action, ModelType.service.name(), requestJSON);
+ logger.debug(END_OF_THE_TRANSACTION + response.getEntity());
+ return response;
+ }
+ if (recipeLookupResult == null) {
+ logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_DB_ATTRIBUTE_NOT_FOUND.toString(),
+ MSO_PROP_APIHANDLER_INFRA, ErrorCode.DataError.getValue(), "No recipe found in DB");
+ Response response = msoRequest.buildServiceErrorResponse(HttpStatus.SC_NOT_FOUND,
+ MsoException.ServiceException, "Recipe does not exist in catalog DB",
+ ErrorNumbers.SVC_GENERAL_SERVICE_ERROR, null, version);
+
+ msoRequest.createErrorRequestRecord(Status.FAILED, requestId, "Recipe does not exist in catalog DB", action,
+ ModelType.service.name(), requestJSON);
+ logger.debug(END_OF_THE_TRANSACTION + response.getEntity());
+ return response;
+ }
+
+ RequestClient requestClient;
+ HttpResponse response;
+
+ try {
+ requestClient = requestClientFactory.getRequestClient(recipeLookupResult.getOrchestrationURI());
+
+ JSONObject jjo = new JSONObject(requestJSON);
+ jjo.put("operationId", requestId);
+
+ String bpmnRequest = jjo.toString();
+
+ // Capture audit event
+ logger.debug("MSO API Handler Posting call to BPEL engine for url: " + requestClient.getUrl());
+ String serviceId = instanceIdMap.get(SERVICE_ID);
+ String operationType = instanceIdMap.get("operationType");
+ String serviceInstanceType = e2eActReq.getServiceType();
+ RequestClientParameter clientParam = new RequestClientParameter.Builder().setRequestId(requestId)
+ .setBaseVfModule(false).setRecipeTimeout(recipeLookupResult.getRecipeTimeout())
+ .setRequestAction(action.name()).setServiceInstanceId(serviceId).setOperationType(operationType)
+ .setServiceType(serviceInstanceType).setRequestDetails(bpmnRequest).setApiVersion(version)
+ .setALaCarte(false).setRecipeParamXsd(recipeLookupResult.getRecipeParamXsd()).build();
+ response = requestClient.post(clientParam);
+
+ } catch (Exception e) {
+ Response resp = msoRequest.buildServiceErrorResponse(HttpStatus.SC_BAD_GATEWAY,
+ MsoException.ServiceException, "Failed calling bpmn " + e.getMessage(),
+ ErrorNumbers.SVC_NO_SERVER_RESOURCES, null, version);
+ logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_BPEL_COMMUNICATE_ERROR.toString(),
+ MSO_PROP_APIHANDLER_INFRA, ErrorCode.AvailabilityError.getValue(),
+ "Exception while communicate with BPMN engine");
+ logger.debug("End of the transaction, the final response is: " + resp.getEntity());
+ return resp;
+ }
+
+ if (response == null) {
+ Response resp =
+ msoRequest.buildServiceErrorResponse(HttpStatus.SC_BAD_GATEWAY, MsoException.ServiceException,
+ "bpelResponse is null", ErrorNumbers.SVC_NO_SERVER_RESOURCES, null, version);
+ logger.error(LoggingAnchor.FOUR, MessageEnum.APIH_BPEL_COMMUNICATE_ERROR.toString(),
+ MSO_PROP_APIHANDLER_INFRA, ErrorCode.BusinessProcessError.getValue(), "Null response from BPEL");
+ logger.debug(END_OF_THE_TRANSACTION + resp.getEntity());
+ return resp;
+ }
+
+ ResponseHandler respHandler = new ResponseHandler(response, requestClient.getType());
+ int bpelStatus = respHandler.getStatus();
+
+ return beplStatusUpdate(requestClient, respHandler, bpelStatus, version);
+ }
+
private Response deleteE2EserviceInstances(String requestJSON, Action action, HashMap<String, String> instanceIdMap,
String version) throws ApiException {
// TODO should be a new one or the same service instance Id
@@ -370,7 +506,15 @@ public class E2EServiceInstances {
RecipeLookupResult recipeLookupResult;
try {
// TODO Get the service template model version uuid from AAI.
- recipeLookupResult = getServiceInstanceOrchestrationURI(null, action);
+ String modelVersionId = null;
+ AAIResourcesClient client = new AAIResourcesClient();
+ AAIResourceUri url = AAIUriFactory.createResourceUri(AAIObjectType.SERVICE_INSTANCE,
+ e2eDelReq.getGlobalSubscriberId(), e2eDelReq.getServiceType(), instanceIdMap.get(SERVICE_ID));
+ Optional<ServiceInstance> serviceInstanceOpt = client.get(ServiceInstance.class, url);
+ if (serviceInstanceOpt.isPresent()) {
+ modelVersionId = serviceInstanceOpt.get().getModelVersionId();
+ }
+ recipeLookupResult = getServiceInstanceOrchestrationURI(modelVersionId, action);
} catch (Exception e) {
logger.error(MessageEnum.APIH_DB_ACCESS_EXC.toString(), MSO_PROP_APIHANDLER_INFRA,
ErrorCode.AvailabilityError.getValue(), "Exception while communciate with Catalog DB", e);
diff --git a/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/e2eserviceinstancebeans/E2ESliceServiceActivateRequest.java b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/e2eserviceinstancebeans/E2ESliceServiceActivateRequest.java
new file mode 100644
index 0000000000..2fb219c182
--- /dev/null
+++ b/mso-api-handlers/mso-api-handler-infra/src/main/java/org/onap/so/apihandlerinfra/e2eserviceinstancebeans/E2ESliceServiceActivateRequest.java
@@ -0,0 +1,23 @@
+package org.onap.so.apihandlerinfra.e2eserviceinstancebeans;
+
+public class E2ESliceServiceActivateRequest {
+ private String globalSubscriberId;
+
+ private String serviceType;
+
+ public String getGlobalSubscriberId() {
+ return globalSubscriberId;
+ }
+
+ public void setGlobalSubscriberId(String globalSubscriberId) {
+ this.globalSubscriberId = globalSubscriberId;
+ }
+
+ public String getServiceType() {
+ return serviceType;
+ }
+
+ public void setServiceType(String serviceType) {
+ this.serviceType = serviceType;
+ }
+}
diff --git a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/Service.java b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/Service.java
index ab40cefb4e..0d7a6dbd1f 100644
--- a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/Service.java
+++ b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/beans/Service.java
@@ -136,6 +136,9 @@ public class Service implements Serializable {
@JoinColumn(name = "TOSCA_CSAR_ARTIFACT_UUID")
private ToscaCsar csar;
+ @OneToMany(cascade = CascadeType.ALL, mappedBy = "service")
+ private List<ServiceArtifact> serviceArtifactList;
+
@Column(name = "NAMING_POLICY")
private String namingPolicy;
@@ -371,6 +374,17 @@ public class Service implements Serializable {
this.csar = csar;
}
+ public List<ServiceArtifact> getServiceArtifactList() {
+ if (serviceArtifactList == null) {
+ serviceArtifactList = new ArrayList<>();
+ }
+ return serviceArtifactList;
+ }
+
+ public void setServiceArtifactList(List<ServiceArtifact> serviceArtifactList) {
+ this.serviceArtifactList = serviceArtifactList;
+ }
+
public String getWorkloadContext() {
return this.workloadContext;
}
diff --git a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/data/repository/ServiceInfoRepository.java b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/data/repository/ServiceInfoRepository.java
new file mode 100644
index 0000000000..e3a4ca264e
--- /dev/null
+++ b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/data/repository/ServiceInfoRepository.java
@@ -0,0 +1,33 @@
+/*-
+ * ============LICENSE_START=======================================================
+ * ONAP - SO
+ * ================================================================================
+ * Copyright (c) 2019, CMCC Technologies Co., Ltd.
+ * ================================================================================
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============LICENSE_END=========================================================
+ */
+
+package org.onap.so.db.catalog.data.repository;
+
+import org.onap.so.db.catalog.beans.Service;
+import org.onap.so.db.catalog.beans.ServiceInfo;
+import org.springframework.data.jpa.repository.JpaRepository;
+import org.springframework.data.rest.core.annotation.RepositoryRestResource;
+
+@RepositoryRestResource(collectionResourceRel = "serviceInfo", path = "serviceInfo")
+public interface ServiceInfoRepository extends JpaRepository<ServiceInfo, Integer> {
+
+ ServiceInfo findByService(Service service);
+
+}
diff --git a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/rest/beans/ServiceMacroHolder.java b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/rest/beans/ServiceMacroHolder.java
index f9cbb0d462..ec4e922c8f 100644
--- a/mso-catalog-db/src/main/java/org/onap/so/db/catalog/rest/beans/ServiceMacroHolder.java
+++ b/mso-catalog-db/src/main/java/org/onap/so/db/catalog/rest/beans/ServiceMacroHolder.java
@@ -20,14 +20,10 @@
package org.onap.so.db.catalog.rest.beans;
+import com.openpojo.business.annotation.BusinessKey;
+import org.onap.so.db.catalog.beans.*;
import java.io.Serializable;
import java.util.ArrayList;
-import org.onap.so.db.catalog.beans.AllottedResourceCustomization;
-import org.onap.so.db.catalog.beans.NetworkResourceCustomization;
-import org.onap.so.db.catalog.beans.Service;
-import org.onap.so.db.catalog.beans.VnfResource;
-import org.onap.so.db.catalog.beans.VnfResourceCustomization;
-import com.openpojo.business.annotation.BusinessKey;
/*
* A simple holder for Service and its associated elements: VnfResource, 1-n VfModule, Network TBD
@@ -42,6 +38,8 @@ public class ServiceMacroHolder implements Serializable {
private ArrayList<NetworkResourceCustomization> networkResourceCustomizations;
private ArrayList<AllottedResourceCustomization> allottedResourceCustomizations;
private ArrayList<VnfResourceCustomization> vnfResourceCustomizations;
+ private ArrayList<ServiceProxyResourceCustomization> serviceProxyResourceCustomizations;
+ private ServiceInfo serviceInfo;
public ServiceMacroHolder() {
@@ -51,6 +49,8 @@ public class ServiceMacroHolder implements Serializable {
this.networkResourceCustomizations = new ArrayList<>();
this.allottedResourceCustomizations = new ArrayList<>();
this.vnfResourceCustomizations = new ArrayList<>();
+ this.serviceProxyResourceCustomizations = new ArrayList<>();
+ this.serviceInfo = null;
}
public ServiceMacroHolder(Service service) {
@@ -66,6 +66,14 @@ public class ServiceMacroHolder implements Serializable {
this.service = service;
}
+ public ServiceInfo getServiceInfo() {
+ return serviceInfo;
+ }
+
+ public void setServiceInfo(ServiceInfo serviceInfo) {
+ this.serviceInfo = serviceInfo;
+ }
+
public void setVnfResources(ArrayList<VnfResource> vnfResources) {
this.vnfResources = vnfResources;
}
@@ -139,6 +147,15 @@ public class ServiceMacroHolder implements Serializable {
}
}
+ public void addServiceProxyResourceCustomization(ServiceProxyResourceCustomization sprc) {
+ if (this.serviceProxyResourceCustomizations != null) {
+ this.serviceProxyResourceCustomizations.add(sprc);
+ } else {
+ this.serviceProxyResourceCustomizations = new ArrayList<>();
+ this.serviceProxyResourceCustomizations.add(sprc);
+ }
+ }
+
@Override
public String toString() {
StringBuilder sb = new StringBuilder();
@@ -148,6 +165,11 @@ public class ServiceMacroHolder implements Serializable {
} else {
sb.append("service: null");
}
+ if (this.serviceInfo != null) {
+ sb.append("serviceInfo: " + this.serviceInfo.toString());
+ } else {
+ sb.append("serviceInfo: null");
+ }
if (this.vnfResourceCustomizations != null && this.vnfResourceCustomizations.size() > 0) {
int i = 0;
sb.append("VnfResources: ");
@@ -180,6 +202,13 @@ public class ServiceMacroHolder implements Serializable {
sb.append("ARC[" + i++ + "]: " + arc.toString());
}
}
+ if (this.serviceProxyResourceCustomizations != null && this.serviceProxyResourceCustomizations.size() > 0) {
+ int i = 0;
+ sb.append("ServiceProxyResourceCustomizations:");
+ for (ServiceProxyResourceCustomization sprc : this.serviceProxyResourceCustomizations) {
+ sb.append("SPRC[" + i++ + "]: " + sprc.toString());
+ }
+ }
return sb.toString();
}
@@ -202,6 +231,12 @@ public class ServiceMacroHolder implements Serializable {
this.allottedResourceCustomizations = allottedResourceCustomizations;
}
+ public ArrayList<ServiceProxyResourceCustomization> getServiceProxyResourceCustomizations() {
+ return serviceProxyResourceCustomizations;
+ }
-
+ public void setServiceProxyResourceCustomizations(
+ ArrayList<ServiceProxyResourceCustomization> serviceProxyResourceCustomizations) {
+ this.serviceProxyResourceCustomizations = serviceProxyResourceCustomizations;
+ }
}